DK118132B - Fremgangsmåde til fremstilling af derivater af 5-nitro-2-furyl-isoxazoler. - Google Patents
Fremgangsmåde til fremstilling af derivater af 5-nitro-2-furyl-isoxazoler.Info
- Publication number
- DK118132B DK118132B DK421866AA DK421866A DK118132B DK 118132 B DK118132 B DK 118132B DK 421866A A DK421866A A DK 421866AA DK 421866 A DK421866 A DK 421866A DK 118132 B DK118132 B DK 118132B
- Authority
- DK
- Denmark
- Prior art keywords
- isoxazoles
- furyl
- nitro
- derivatives
- preparation
- Prior art date
Links
- USWYRJPZOCLAGG-UHFFFAOYSA-N 3-(5-nitrofuran-2-yl)-1,2-oxazole Chemical class O1C([N+](=O)[O-])=CC=C1C1=NOC=C1 USWYRJPZOCLAGG-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Coin-Freed Apparatuses For Hiring Articles (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3544765 | 1965-08-18 | ||
| GB35448/65A GB1108397A (en) | 1965-08-18 | 1965-08-18 | 5-nitro-2-furyl-isoxazoles |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK118132B true DK118132B (da) | 1970-07-13 |
Family
ID=26262720
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK421866AA DK118132B (da) | 1965-08-18 | 1966-08-17 | Fremgangsmåde til fremstilling af derivater af 5-nitro-2-furyl-isoxazoler. |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3562267A (enExample) |
| BE (1) | BE685636A (enExample) |
| BR (1) | BR6682173D0 (enExample) |
| CH (1) | CH475270A (enExample) |
| DE (1) | DE1695085A1 (enExample) |
| DK (1) | DK118132B (enExample) |
| FI (1) | FI45045C (enExample) |
| FR (1) | FR5947M (enExample) |
| GB (1) | GB1108397A (enExample) |
| IL (1) | IL26353A (enExample) |
| NL (1) | NL6611584A (enExample) |
| NO (1) | NO121097B (enExample) |
| SE (1) | SE310679B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3686408A (en) * | 1970-05-19 | 1972-08-22 | Ciba Geigy Corp | Compositions with 5-nitro-2-furyl-isoxazoles and their use as antibacterial and antifungal agents |
| CZ2004168A3 (cs) * | 2001-08-06 | 2004-05-12 | Pharmaciaáitaliaás@P@A | Aminoizoxazolové derivátyŹ účinné jako kinázové inhibitoryŹ způsob jejich přípravy a farmaceutické prostředkyŹ které je obsahují |
| CN104817549B (zh) * | 2015-04-16 | 2017-08-11 | 河南师范大学 | 具有抗真菌活性的恶唑类化合物及其制备方法和应用 |
-
1965
- 1965-08-18 GB GB35448/65A patent/GB1108397A/en not_active Expired
-
1966
- 1966-08-10 US US571412A patent/US3562267A/en not_active Expired - Lifetime
- 1966-08-15 FI FI662125A patent/FI45045C/fi active
- 1966-08-17 IL IL26353A patent/IL26353A/xx unknown
- 1966-08-17 BE BE685636D patent/BE685636A/xx unknown
- 1966-08-17 NO NO164335A patent/NO121097B/no unknown
- 1966-08-17 BR BR182173/66A patent/BR6682173D0/pt unknown
- 1966-08-17 DK DK421866AA patent/DK118132B/da unknown
- 1966-08-17 NL NL6611584A patent/NL6611584A/xx unknown
- 1966-08-17 DE DE19661695085 patent/DE1695085A1/de active Pending
- 1966-08-17 CH CH1188766A patent/CH475270A/de not_active IP Right Cessation
- 1966-08-17 SE SE11132/66A patent/SE310679B/xx unknown
- 1966-11-15 FR FR83599A patent/FR5947M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR5947M (enExample) | 1968-04-08 |
| BE685636A (enExample) | 1967-02-17 |
| IL26353A (en) | 1970-07-19 |
| BR6682173D0 (pt) | 1973-12-04 |
| DE1695085A1 (de) | 1972-03-16 |
| NL6611584A (enExample) | 1967-02-20 |
| NO121097B (enExample) | 1971-01-18 |
| CH475270A (de) | 1969-07-15 |
| US3562267A (en) | 1971-02-09 |
| GB1108397A (en) | 1968-04-03 |
| FI45045B (enExample) | 1971-11-30 |
| SE310679B (enExample) | 1969-05-12 |
| FI45045C (fi) | 1972-03-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK112733B (da) | Fremgangsmåde til fremstilling af thiazolderivater. | |
| DK118769B (da) | Fremgangsmåde til fremstilling af O-methyl-S-methyl-phosphoroamidothioat. | |
| DK115474B (da) | Analogifremgangsmåde til fremstilling af N-p-chlorbenzoyl-5-fluorcytosin. | |
| DK136901B (da) | Analogifremgangsmåde til fremstilling af 2-anilinonikotinsyrederivater. | |
| DK118505B (da) | Fremgangsmåde til fremstilling af isoindolin-2-sulfonylurinstoffer. | |
| DK111892B (da) | Fremgangsmåde til fremstilling af pyrazinimidoyl-guanidinforbindelser. | |
| DK122766B (da) | Analogifremgangsmåde til fremstilling af oksazolalkansyrederivater. | |
| DK118239B (da) | Fremgangsmåde til fremstilling af substituerede 4-hydroxykinoliner. | |
| DK118395B (da) | Analogifremgangsmåde til fremstilling af aminophenolderivater. | |
| DK135234B (da) | Analogifremgangsmåde til fremstilling af piperazin-phenylethanolforbindelser. | |
| DK114699B (da) | Fremgangsmåde til fremstilling af furylbenzofuranderivater. | |
| DK120193B (da) | Fremgangsmåde til fremstilling af 3-amino-isoxazolderivater. | |
| DK128004B (da) | Fremgangsmåde til fremstilling af chromanderivater. | |
| DK122078B (da) | Fremgangsmåde til fremstilling af pyridazonderivater. | |
| DK118132B (da) | Fremgangsmåde til fremstilling af derivater af 5-nitro-2-furyl-isoxazoler. | |
| DK118458B (da) | Fremgangsmåde til fremstilling af 5-halogen-2-amino-benzophenoniminer. | |
| DK118670B (da) | Fremgangsmåde til fremstilling af cyanphenoler. | |
| DK117705B (da) | Fremgangsmåde til fremstilling af indolderivater. | |
| DK119980B (da) | Fremgangsmåde til fremstilling af 2-alkoxy-4-sulfanilamido-quinazolinderivater. | |
| DK122527B (da) | Fremgangsmåde til fremstilling af 3-nitro-2-oxo-tetrahydro-imidazoler. | |
| DK117704B (da) | Analogifremgangsmåde til fremstilling af tetrahydroisoquinolinderivater. | |
| DK109140C (da) | Fremgangsmåde til fremstilling af 1-hydroksy-3-aminopyrrolidon-2-derivater. | |
| DK119058B (da) | Analogifremgangsmåde til fremstilling af 7-ethylaminopropyl-theophyllinderivater. | |
| DK129925B (da) | Fremgangsmåde til fremstilling af benzophenonderivater. | |
| DK120239B (da) | Fremgangsmåde til fremstilling af piperazin-fenylætanolderivater. |