DE1692006B2 - Bleichendes Reinigungsmittel - Google Patents
Bleichendes ReinigungsmittelInfo
- Publication number
- DE1692006B2 DE1692006B2 DE1692006A DE1692006A DE1692006B2 DE 1692006 B2 DE1692006 B2 DE 1692006B2 DE 1692006 A DE1692006 A DE 1692006A DE 1692006 A DE1692006 A DE 1692006A DE 1692006 B2 DE1692006 B2 DE 1692006B2
- Authority
- DE
- Germany
- Prior art keywords
- copper
- persalt
- sodium
- bleaching
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000004061 bleaching Methods 0.000 title claims description 20
- 239000003599 detergent Substances 0.000 title claims description 17
- 239000012190 activator Substances 0.000 claims description 15
- 239000008139 complexing agent Substances 0.000 claims description 14
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 12
- 150000001879 copper Chemical class 0.000 claims description 11
- 239000010949 copper Substances 0.000 claims description 11
- 229910052802 copper Inorganic materials 0.000 claims description 10
- 239000012459 cleaning agent Substances 0.000 claims description 5
- 229960001922 sodium perborate Drugs 0.000 claims description 5
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 2
- 239000000203 mixture Substances 0.000 description 30
- 230000000694 effects Effects 0.000 description 11
- 238000005406 washing Methods 0.000 description 8
- 239000000047 product Substances 0.000 description 7
- 239000000654 additive Substances 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 239000007844 bleaching agent Substances 0.000 description 4
- 238000002310 reflectometry Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 3
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 239000000344 soap Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000004115 Sodium Silicate Substances 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 229960001138 acetylsalicylic acid Drugs 0.000 description 2
- -1 acetylsalicylic acid ester Chemical class 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 125000004104 aryloxy group Chemical group 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000010411 cooking Methods 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 239000002304 perfume Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 229910052911 sodium silicate Inorganic materials 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 235000019832 sodium triphosphate Nutrition 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- WTOCSVCDHNWXCQ-UHFFFAOYSA-N 1-acetyl-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC(=O)N1C(=O)NC(=O)C1(C)C WTOCSVCDHNWXCQ-UHFFFAOYSA-N 0.000 description 1
- CLFHABXQJQAYEF-UHFFFAOYSA-N 1-benzoylpyrrolidine-2,5-dione Chemical compound C=1C=CC=CC=1C(=O)N1C(=O)CCC1=O CLFHABXQJQAYEF-UHFFFAOYSA-N 0.000 description 1
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 1
- XWSGEVNYFYKXCP-UHFFFAOYSA-N 2-[carboxymethyl(methyl)amino]acetic acid Chemical compound OC(=O)CN(C)CC(O)=O XWSGEVNYFYKXCP-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- JYXGIOKAKDAARW-UHFFFAOYSA-N N-(2-hydroxyethyl)iminodiacetic acid Chemical compound OCCN(CC(O)=O)CC(O)=O JYXGIOKAKDAARW-UHFFFAOYSA-N 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 150000003842 bromide salts Chemical class 0.000 description 1
- 244000309466 calf Species 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000003841 chloride salts Chemical class 0.000 description 1
- 230000000536 complexating effect Effects 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 229910001431 copper ion Inorganic materials 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000001795 light effect Effects 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- KBDYPDHUODKDRK-UHFFFAOYSA-N n-acetyl-n-phenylacetamide Chemical compound CC(=O)N(C(C)=O)C1=CC=CC=C1 KBDYPDHUODKDRK-UHFFFAOYSA-N 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000009991 scouring Methods 0.000 description 1
- 210000002374 sebum Anatomy 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- HLWRUJAIJJEZDL-UHFFFAOYSA-M sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetate Chemical compound [Na+].OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC([O-])=O HLWRUJAIJJEZDL-UHFFFAOYSA-M 0.000 description 1
- BYMHXIQVEAYSJD-UHFFFAOYSA-M sodium;4-sulfophenolate Chemical compound [Na+].OC1=CC=C(S([O-])(=O)=O)C=C1 BYMHXIQVEAYSJD-UHFFFAOYSA-M 0.000 description 1
- DUXXGJTXFHUORE-UHFFFAOYSA-M sodium;4-tridecylbenzenesulfonate Chemical compound [Na+].CCCCCCCCCCCCCC1=CC=C(S([O-])(=O)=O)C=C1 DUXXGJTXFHUORE-UHFFFAOYSA-M 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000271 synthetic detergent Substances 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 1
- 235000019801 trisodium phosphate Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3905—Bleach activators or bleach catalysts
- C11D3/3907—Organic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR91876A FR1515237A (fr) | 1967-01-20 | 1967-01-20 | Composition de nettoyage à effet de blanchiment amélioré |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1692006A1 DE1692006A1 (de) | 1971-07-22 |
| DE1692006B2 true DE1692006B2 (de) | 1975-05-22 |
Family
ID=8624144
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1692006A Pending DE1692006B2 (de) | 1967-01-20 | 1968-01-09 | Bleichendes Reinigungsmittel |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3583924A (en:Method) |
| BE (1) | BE709224A (en:Method) |
| CH (1) | CH488801A (en:Method) |
| DE (1) | DE1692006B2 (en:Method) |
| DK (1) | DK130178B (en:Method) |
| FR (1) | FR1515237A (en:Method) |
| GB (1) | GB1192524A (en:Method) |
| NL (1) | NL6800909A (en:Method) |
| SE (1) | SE319258B (en:Method) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3982891A (en) * | 1967-10-24 | 1976-09-28 | Colgate-Palmolive Company | Bleaching and detergent compositions having imide activator and peroxygen bleach |
| GB1355795A (en) * | 1970-05-01 | 1974-06-05 | Colgate Palmolive Co | Process and composition for cleaning fabrics |
| FR2104942A1 (en) * | 1970-09-09 | 1972-04-28 | Colgate Palmolive Co | Detergent compsns - for presoaking and washing stained materials |
| LU61828A1 (en:Method) * | 1970-10-07 | 1972-06-28 | ||
| DE2301437C3 (de) * | 1973-01-12 | 1975-08-07 | Hoechst Ag, 6000 Frankfurt | Mit optischen Aufhellern verträgliche peraeylierte Polyamine als Aktivatoren für anorganische Perverbindungen |
| US3886078A (en) * | 1973-02-28 | 1975-05-27 | American Cyanamid Co | N-benzoylsaccharin as peroxygen bleach activator |
| US4300897A (en) * | 1973-08-24 | 1981-11-17 | Colgate-Palmolive Company | Method for bleaching with peroxymonosulfate-based compositions |
| US4123376A (en) * | 1973-08-24 | 1978-10-31 | Colgate-Palmolive Company | Peroxymonosulfate-base bleaching and bleaching detergent compositions |
| LU70322A1 (en:Method) * | 1974-06-14 | 1976-04-13 | ||
| US3986973A (en) * | 1975-10-24 | 1976-10-19 | American Cyanamid Company | Cyanoformates and cyanoformamides as bleach activators |
| US4145183A (en) * | 1975-12-19 | 1979-03-20 | E. I. Du Pont De Nemours And Company | Method for the oxidative treatment of textiles with activated peroxygen compounds |
| US4086175A (en) * | 1976-02-09 | 1978-04-25 | Shell Oil Company | Activated bleaching process and compositions therefor |
| DE2733849A1 (de) * | 1977-07-27 | 1979-02-15 | Basf Ag | Feste kaltbleichaktivatoren fuer aktivsauerstoff abgebende verbindungen enthaltende wasch- und reinigungsmittel |
| EP0005098B1 (fr) * | 1978-04-14 | 1982-02-03 | Société Chimique des Charbonnages | Compositions contenant un mono- ou polyalkylarylsulfonate de métal alcalin et l'hydroperoxyde correspondant, procédé pour leur préparation et compositions détergentes les contenant |
| FR2423536A1 (fr) | 1978-04-17 | 1979-11-16 | Interox | Compositions et procede pour le lavage et le blanchiment |
| US4367156A (en) * | 1980-07-02 | 1983-01-04 | The Procter & Gamble Company | Bleaching process and compositions |
| US4283301A (en) * | 1980-07-02 | 1981-08-11 | The Procter & Gamble Company | Bleaching process and compositions |
| GR76237B (en:Method) * | 1981-08-08 | 1984-08-04 | Procter & Gamble | |
| US4430244A (en) | 1982-03-04 | 1984-02-07 | Colgate-Palmolive Company | Silicate-free bleaching and laundering composition |
| GB8310698D0 (en) * | 1983-04-20 | 1983-05-25 | Procter & Gamble | Detergent compositions |
| GB8311865D0 (en) * | 1983-04-29 | 1983-06-02 | Procter & Gamble Ltd | Bleach compositions |
| US4671891A (en) * | 1983-09-16 | 1987-06-09 | The Procter & Gamble Company | Bleaching compositions |
| GB8331278D0 (en) * | 1983-11-23 | 1983-12-29 | Unilever Plc | Detergent composition |
| JPS60122703A (ja) * | 1983-12-06 | 1985-07-01 | Mitsubishi Gas Chem Co Inc | 酸素ガス発生方法 |
| GB8908416D0 (en) * | 1989-04-13 | 1989-06-01 | Unilever Plc | Bleach activation |
| US5478356B1 (en) * | 1994-05-10 | 1997-11-18 | Clorox Co | Cyanoimides and compositions useful for bleaching |
| JP5150237B2 (ja) * | 2007-12-19 | 2013-02-20 | ライオン株式会社 | 殺菌・除菌用酸化触媒、および該触媒を含有する殺菌・除菌用酸化触媒粒子 |
| JP5401034B2 (ja) * | 2007-12-19 | 2014-01-29 | ライオン株式会社 | 漂白助剤、および該漂白助剤を含有する漂白助剤粒子 |
-
1967
- 1967-01-20 FR FR91876A patent/FR1515237A/fr not_active Expired
- 1967-12-29 DK DK661667AA patent/DK130178B/da unknown
-
1968
- 1968-01-09 SE SE261/68A patent/SE319258B/xx unknown
- 1968-01-09 DE DE1692006A patent/DE1692006B2/de active Pending
- 1968-01-10 US US696713A patent/US3583924A/en not_active Expired - Lifetime
- 1968-01-11 BE BE709224D patent/BE709224A/xx unknown
- 1968-01-12 CH CH45768A patent/CH488801A/fr not_active IP Right Cessation
- 1968-01-17 GB GB2583/68A patent/GB1192524A/en not_active Expired
- 1968-01-19 NL NL6800909A patent/NL6800909A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK130178B (da) | 1975-01-06 |
| US3583924A (en) | 1971-06-08 |
| FR1515237A (fr) | 1968-03-01 |
| DE1692006A1 (de) | 1971-07-22 |
| SE319258B (en:Method) | 1970-01-12 |
| DK130178C (en:Method) | 1975-06-16 |
| CH488801A (fr) | 1970-04-15 |
| NL6800909A (en:Method) | 1968-07-22 |
| BE709224A (en:Method) | 1968-05-16 |
| GB1192524A (en) | 1970-05-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1692006B2 (de) | Bleichendes Reinigungsmittel | |
| DE69126778T2 (de) | Verfahren zur Erhöhung der Bleichwirksamkeit eines inorganischen Persalzes | |
| DE68920112T2 (de) | Waschmittelzusammensetzung. | |
| DE2657043A1 (de) | Bleichmittel und verfahren zum reinigen von geweben | |
| DE2508412C3 (de) | Lagerbeständiges festes Bleichmittel | |
| DE1080250B (de) | Waschmittel | |
| DE2336291A1 (de) | Fluessiges wasch- und reinigungsmittel | |
| DE2327234C3 (de) | Phosphatfreies Waschmittel | |
| CH493626A (de) | Scheuermittel | |
| DE69121286T2 (de) | Phosphatfreies Waschmittel | |
| DE2161699C3 (de) | Wasch- und Reinigungsmittel | |
| DE1033356B (de) | Reinigungsmittel | |
| DE1767143B2 (de) | Wasch- und reinigungsmittel | |
| DE1617116A1 (de) | Schwachschaeumende Wasch- und Reinigungsmittel | |
| DE1085998B (de) | Reinigungsmittel mit geringem Schaumbildungsvermoegen | |
| DE2360408C2 (de) | Reinigungsmittelzusammensetzung | |
| DE2424855C2 (de) | Vergilbungshinderndes Textilweichmachungsmittel | |
| DE2438136C3 (de) | Reinigungsmittelmischung | |
| DE1054638B (de) | Fluessiges Reinigungsmittel | |
| DE1170574B (de) | Fluessiges homogenes Grobwaschmittel | |
| DE1074186B (de) | Reinigungsmittel | |
| DE1792163A1 (de) | Detergenzzusammensetzungen | |
| DE2144592B2 (de) | Waschmittel | |
| DE2456212C3 (de) | Pulverförmige Reinigungsmittel-Mischung | |
| DE2656285A1 (de) | Bleichmittel |