DE1645355A1 - Verfahren zur Herstellung von neuen Silanpolykondensaten - Google Patents
Verfahren zur Herstellung von neuen SilanpolykondensatenInfo
- Publication number
- DE1645355A1 DE1645355A1 DE19661645355 DE1645355A DE1645355A1 DE 1645355 A1 DE1645355 A1 DE 1645355A1 DE 19661645355 DE19661645355 DE 19661645355 DE 1645355 A DE1645355 A DE 1645355A DE 1645355 A1 DE1645355 A1 DE 1645355A1
- Authority
- DE
- Germany
- Prior art keywords
- hydrolysis
- silane
- hydrolyzed
- group
- mol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 54
- 229910000077 silane Inorganic materials 0.000 title claims description 36
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 title claims description 35
- 230000008569 process Effects 0.000 title claims description 23
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 238000006460 hydrolysis reaction Methods 0.000 claims description 47
- 230000007062 hydrolysis Effects 0.000 claims description 46
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 41
- 239000000047 product Substances 0.000 claims description 38
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 34
- 239000003795 chemical substances by application Substances 0.000 claims description 34
- 125000001424 substituent group Chemical group 0.000 claims description 30
- 229910052710 silicon Inorganic materials 0.000 claims description 26
- 239000000203 mixture Substances 0.000 claims description 24
- 150000004756 silanes Chemical class 0.000 claims description 24
- 238000007614 solvation Methods 0.000 claims description 21
- 239000012071 phase Substances 0.000 claims description 17
- 239000005055 methyl trichlorosilane Substances 0.000 claims description 16
- JLUFWMXJHAVVNN-UHFFFAOYSA-N methyltrichlorosilane Chemical compound C[Si](Cl)(Cl)Cl JLUFWMXJHAVVNN-UHFFFAOYSA-N 0.000 claims description 16
- 239000007788 liquid Substances 0.000 claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 13
- 239000007858 starting material Substances 0.000 claims description 12
- 230000003301 hydrolyzing effect Effects 0.000 claims description 11
- 239000002798 polar solvent Substances 0.000 claims description 11
- FDNAPBUWERUEDA-UHFFFAOYSA-N silicon tetrachloride Chemical compound Cl[Si](Cl)(Cl)Cl FDNAPBUWERUEDA-UHFFFAOYSA-N 0.000 claims description 11
- 239000005046 Chlorosilane Substances 0.000 claims description 10
- 239000006227 byproduct Substances 0.000 claims description 9
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical class Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 claims description 9
- 239000012074 organic phase Substances 0.000 claims description 9
- GQIUQDDJKHLHTB-UHFFFAOYSA-N trichloro(ethenyl)silane Chemical compound Cl[Si](Cl)(Cl)C=C GQIUQDDJKHLHTB-UHFFFAOYSA-N 0.000 claims description 8
- 239000005050 vinyl trichlorosilane Substances 0.000 claims description 8
- 239000012429 reaction media Substances 0.000 claims description 7
- 238000000926 separation method Methods 0.000 claims description 7
- ZDHXKXAHOVTTAH-UHFFFAOYSA-N trichlorosilane Chemical compound Cl[SiH](Cl)Cl ZDHXKXAHOVTTAH-UHFFFAOYSA-N 0.000 claims description 7
- 239000005052 trichlorosilane Substances 0.000 claims description 6
- 150000001298 alcohols Chemical class 0.000 claims description 5
- LIKFHECYJZWXFJ-UHFFFAOYSA-N dimethyldichlorosilane Chemical compound C[Si](C)(Cl)Cl LIKFHECYJZWXFJ-UHFFFAOYSA-N 0.000 claims description 5
- 238000004821 distillation Methods 0.000 claims description 5
- 150000002170 ethers Chemical class 0.000 claims description 5
- 239000005054 phenyltrichlorosilane Substances 0.000 claims description 5
- ORVMIVQULIKXCP-UHFFFAOYSA-N trichloro(phenyl)silane Chemical compound Cl[Si](Cl)(Cl)C1=CC=CC=C1 ORVMIVQULIKXCP-UHFFFAOYSA-N 0.000 claims description 5
- KTQYJQFGNYHXMB-UHFFFAOYSA-N dichloro(methyl)silicon Chemical compound C[Si](Cl)Cl KTQYJQFGNYHXMB-UHFFFAOYSA-N 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 238000009835 boiling Methods 0.000 claims description 3
- 239000005048 methyldichlorosilane Substances 0.000 claims description 3
- 239000012454 non-polar solvent Substances 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 230000006735 deficit Effects 0.000 claims description 2
- 150000002894 organic compounds Chemical class 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 238000006068 polycondensation reaction Methods 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 235000009581 Balanites aegyptiaca Nutrition 0.000 claims 1
- 240000007594 Oryza sativa Species 0.000 claims 1
- 235000007164 Oryza sativa Nutrition 0.000 claims 1
- 150000002561 ketenes Chemical class 0.000 claims 1
- 235000009566 rice Nutrition 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 69
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 57
- -1 Hexadienyl Chemical group 0.000 description 51
- 239000000243 solution Substances 0.000 description 45
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 22
- 239000002904 solvent Substances 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 17
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 15
- 235000019441 ethanol Nutrition 0.000 description 13
- 238000005406 washing Methods 0.000 description 12
- 239000002253 acid Chemical group 0.000 description 11
- 239000007787 solid Substances 0.000 description 11
- 238000004458 analytical method Methods 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical group CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 238000007792 addition Methods 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- 229930195733 hydrocarbon Natural products 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 150000002148 esters Chemical group 0.000 description 6
- 125000005843 halogen group Chemical group 0.000 description 6
- UQEAIHBTYFGYIE-UHFFFAOYSA-N hexamethyldisiloxane Chemical compound C[Si](C)(C)O[Si](C)(C)C UQEAIHBTYFGYIE-UHFFFAOYSA-N 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 229940073561 hexamethyldisiloxane Drugs 0.000 description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 4
- 239000004215 Carbon black (E152) Substances 0.000 description 4
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 4
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 4
- BYLOHCRAPOSXLY-UHFFFAOYSA-N dichloro(diethyl)silane Chemical compound CC[Si](Cl)(Cl)CC BYLOHCRAPOSXLY-UHFFFAOYSA-N 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 150000002430 hydrocarbons Chemical group 0.000 description 4
- 230000003472 neutralizing effect Effects 0.000 description 4
- 125000000962 organic group Chemical group 0.000 description 4
- 239000004033 plastic Substances 0.000 description 4
- 229920003023 plastic Polymers 0.000 description 4
- 238000006116 polymerization reaction Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 230000004580 weight loss Effects 0.000 description 4
- 239000008096 xylene Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000012456 homogeneous solution Substances 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000006386 neutralization reaction Methods 0.000 description 3
- 239000000575 pesticide Substances 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 229920005862 polyol Polymers 0.000 description 3
- 150000003077 polyols Chemical class 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 230000009257 reactivity Effects 0.000 description 3
- 239000010703 silicon Substances 0.000 description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 125000005248 alkyl aryloxy group Chemical group 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 125000005529 alkyleneoxy group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 125000004104 aryloxy group Chemical group 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 2
- 125000000000 cycloalkoxy group Chemical group 0.000 description 2
- 125000002993 cycloalkylene group Chemical group 0.000 description 2
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000003493 decenyl group Chemical group [H]C([*])=C([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- LJSQFQKUNVCTIA-UHFFFAOYSA-N diethyl sulfide Chemical compound CCSCC LJSQFQKUNVCTIA-UHFFFAOYSA-N 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 125000006501 nitrophenyl group Chemical group 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- 229920001296 polysiloxane Polymers 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid group Chemical group S(O)(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- 239000005051 trimethylchlorosilane Substances 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- KWEKXPWNFQBJAY-UHFFFAOYSA-N (dimethyl-$l^{3}-silanyl)oxy-dimethylsilicon Chemical compound C[Si](C)O[Si](C)C KWEKXPWNFQBJAY-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- LEBSOSFJKCSKEI-UHFFFAOYSA-N 2-(cyclopenten-1-yl)ethyl-diethoxysilane Chemical compound C1(=CCCC1)CC[SiH](OCC)OCC LEBSOSFJKCSKEI-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- SSORSZACHCNXSJ-UHFFFAOYSA-N 2-[2-(3,4-dichlorophenyl)-3-[2-(2-hydroxypropylamino)pyrimidin-4-yl]imidazol-4-yl]acetonitrile Chemical compound ClC=1C=C(C=CC=1Cl)C=1N(C(=CN=1)CC#N)C1=NC(=NC=C1)NCC(C)O SSORSZACHCNXSJ-UHFFFAOYSA-N 0.000 description 1
- WOYWLLHHWAMFCB-UHFFFAOYSA-N 2-ethylhexyl acetate Chemical compound CCCCC(CC)COC(C)=O WOYWLLHHWAMFCB-UHFFFAOYSA-N 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 240000000233 Melia azedarach Species 0.000 description 1
- 235000006679 Mentha X verticillata Nutrition 0.000 description 1
- 235000002899 Mentha suaveolens Nutrition 0.000 description 1
- 235000001636 Mentha x rotundifolia Nutrition 0.000 description 1
- RGMZNZABJYWAEC-UHFFFAOYSA-N Methyltris(trimethylsiloxy)silane Chemical compound C[Si](C)(C)O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C RGMZNZABJYWAEC-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 229910002808 Si–O–Si Inorganic materials 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- LMOYHOGFXPDEMD-UHFFFAOYSA-N [acetyloxy(benzyl)silyl] acetate Chemical compound CC(=O)O[SiH](OC(C)=O)CC1=CC=CC=C1 LMOYHOGFXPDEMD-UHFFFAOYSA-N 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 150000001500 aryl chlorides Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- KQWZYFLTZPFOAZ-UHFFFAOYSA-N benzyl(chloro)silane Chemical compound Cl[SiH2]CC1=CC=CC=C1 KQWZYFLTZPFOAZ-UHFFFAOYSA-N 0.000 description 1
- HZBDPZBVINJJET-UHFFFAOYSA-N bis(dimethylsilyloxy)-dimethylsilane Chemical compound C[SiH](C)O[Si](C)(C)O[SiH](C)C HZBDPZBVINJJET-UHFFFAOYSA-N 0.000 description 1
- DLMRBGAENSRVSV-UHFFFAOYSA-N bis(dimethylsilyloxy)-methylsilane Chemical compound C[SiH](C)O[SiH](C)O[SiH](C)C DLMRBGAENSRVSV-UHFFFAOYSA-N 0.000 description 1
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical class OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- WEAGTHQEGNMQLU-UHFFFAOYSA-N chloro(diethyl)silane Chemical compound CC[SiH](Cl)CC WEAGTHQEGNMQLU-UHFFFAOYSA-N 0.000 description 1
- LEYKSONZGURWNL-UHFFFAOYSA-N chloro-diethoxy-phenylsilane Chemical compound CCO[Si](Cl)(OCC)C1=CC=CC=C1 LEYKSONZGURWNL-UHFFFAOYSA-N 0.000 description 1
- KWYZNESIGBQHJK-UHFFFAOYSA-N chloro-dimethyl-phenylsilane Chemical compound C[Si](C)(Cl)C1=CC=CC=C1 KWYZNESIGBQHJK-UHFFFAOYSA-N 0.000 description 1
- XSDCTSITJJJDPY-UHFFFAOYSA-N chloro-ethenyl-dimethylsilane Chemical compound C[Si](C)(Cl)C=C XSDCTSITJJJDPY-UHFFFAOYSA-N 0.000 description 1
- GSXJAPJSIVGONK-UHFFFAOYSA-N chloro-ethenyl-methyl-phenylsilane Chemical compound C=C[Si](Cl)(C)C1=CC=CC=C1 GSXJAPJSIVGONK-UHFFFAOYSA-N 0.000 description 1
- YGHUUVGIRWMJGE-UHFFFAOYSA-N chlorodimethylsilane Chemical compound C[SiH](C)Cl YGHUUVGIRWMJGE-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000001887 cyclopentyloxy group Chemical group C1(CCCC1)O* 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- XNAFLNBULDHNJS-UHFFFAOYSA-N dichloro(phenyl)silicon Chemical compound Cl[Si](Cl)C1=CC=CC=C1 XNAFLNBULDHNJS-UHFFFAOYSA-N 0.000 description 1
- SJTARAZFCVDEIM-UHFFFAOYSA-N dichloro(propyl)silane Chemical compound CCC[SiH](Cl)Cl SJTARAZFCVDEIM-UHFFFAOYSA-N 0.000 description 1
- YLJJAVFOBDSYAN-UHFFFAOYSA-N dichloro-ethenyl-methylsilane Chemical compound C[Si](Cl)(Cl)C=C YLJJAVFOBDSYAN-UHFFFAOYSA-N 0.000 description 1
- MROCJMGDEKINLD-UHFFFAOYSA-N dichlorosilane Chemical class Cl[SiH2]Cl MROCJMGDEKINLD-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- XUKFPAQLGOOCNJ-UHFFFAOYSA-N dimethyl(trimethylsilyloxy)silicon Chemical compound C[Si](C)O[Si](C)(C)C XUKFPAQLGOOCNJ-UHFFFAOYSA-N 0.000 description 1
- UOUILILVWRHZSH-UHFFFAOYSA-N dimethyl-tris[(dimethyl-$l^{3}-silanyl)oxy]silyloxysilicon Chemical compound C[Si](C)O[Si](O[Si](C)C)(O[Si](C)C)O[Si](C)C UOUILILVWRHZSH-UHFFFAOYSA-N 0.000 description 1
- XMKFIGQVEKVTCT-UHFFFAOYSA-N dimethylsilyl 2-phenylacetate Chemical compound C[SiH](C)OC(=O)CC1=CC=CC=C1 XMKFIGQVEKVTCT-UHFFFAOYSA-N 0.000 description 1
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 1
- PZPGRFITIJYNEJ-UHFFFAOYSA-N disilane Chemical class [SiH3][SiH3] PZPGRFITIJYNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 239000000686 essence Substances 0.000 description 1
- CHEFFAKKAFRMHG-UHFFFAOYSA-N ethenyl-tris(trimethylsilyloxy)silane Chemical compound C[Si](C)(C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)C=C CHEFFAKKAFRMHG-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000000265 homogenisation Methods 0.000 description 1
- 230000033444 hydroxylation Effects 0.000 description 1
- 238000005805 hydroxylation reaction Methods 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- BTBMOHJIZAFLQC-UHFFFAOYSA-N methylsilyl 2,2-dichloroacetate Chemical compound C[SiH2]OC(C(Cl)Cl)=O BTBMOHJIZAFLQC-UHFFFAOYSA-N 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 125000001802 myricyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- YKYONYBAUNKHLG-UHFFFAOYSA-N n-Propyl acetate Natural products CCCOC(C)=O YKYONYBAUNKHLG-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000004767 nitrides Chemical group 0.000 description 1
- 150000002825 nitriles Chemical group 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- CXQXSVUQTKDNFP-UHFFFAOYSA-N octamethyltrisiloxane Chemical compound C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C CXQXSVUQTKDNFP-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002905 orthoesters Chemical class 0.000 description 1
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 1
- 125000000109 phenylethoxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])O* 0.000 description 1
- PARWUHTVGZSQPD-UHFFFAOYSA-N phenylsilane Chemical class [SiH3]C1=CC=CC=C1 PARWUHTVGZSQPD-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 229940090181 propyl acetate Drugs 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 125000005372 silanol group Chemical group 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 235000015096 spirit Nutrition 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- VHWQFHRWNWSMGM-UHFFFAOYSA-N tert-butyl(disilanyl)silane Chemical compound CC(C)(C)[SiH2][SiH2][SiH3] VHWQFHRWNWSMGM-UHFFFAOYSA-N 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- VNRWTCZXQWOWIG-UHFFFAOYSA-N tetrakis(trimethylsilyl) silicate Chemical compound C[Si](C)(C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C VNRWTCZXQWOWIG-UHFFFAOYSA-N 0.000 description 1
- 239000012485 toluene extract Substances 0.000 description 1
- WEUBQNJHVBMUMD-UHFFFAOYSA-N trichloro(3,3,3-trifluoropropyl)silane Chemical compound FC(F)(F)CC[Si](Cl)(Cl)Cl WEUBQNJHVBMUMD-UHFFFAOYSA-N 0.000 description 1
- PYJJCSYBSYXGQQ-UHFFFAOYSA-N trichloro(octadecyl)silane Chemical compound CCCCCCCCCCCCCCCCCC[Si](Cl)(Cl)Cl PYJJCSYBSYXGQQ-UHFFFAOYSA-N 0.000 description 1
- QHUNJMXHQHHWQP-UHFFFAOYSA-N trimethylsilyl acetate Chemical compound CC(=O)O[Si](C)(C)C QHUNJMXHQHHWQP-UHFFFAOYSA-N 0.000 description 1
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 1
- UKRDPEFKFJNXQM-UHFFFAOYSA-N vinylsilane Chemical class [SiH3]C=C UKRDPEFKFJNXQM-UHFFFAOYSA-N 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/04—Polysiloxanes
- C08G77/06—Preparatory processes
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/42—Block-or graft-polymers containing polysiloxane sequences
- C08G77/44—Block-or graft-polymers containing polysiloxane sequences containing only polysiloxane sequences
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Silicon Polymers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR22736A FR1472047A (fr) | 1965-06-29 | 1965-06-29 | Polycondensats de silanes et procédé de préparation desdits polycondensats |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1645355A1 true DE1645355A1 (de) | 1969-10-23 |
Family
ID=8583333
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661645355 Pending DE1645355A1 (de) | 1965-06-29 | 1966-06-16 | Verfahren zur Herstellung von neuen Silanpolykondensaten |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3489782A (OSRAM) |
| AT (1) | AT284439B (OSRAM) |
| BE (1) | BE683301A (OSRAM) |
| DE (1) | DE1645355A1 (OSRAM) |
| FR (1) | FR1472047A (OSRAM) |
| GB (1) | GB1154850A (OSRAM) |
| NL (1) | NL6609046A (OSRAM) |
Families Citing this family (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1231448A (OSRAM) * | 1968-12-11 | 1971-05-12 | ||
| US3624030A (en) * | 1969-02-26 | 1971-11-30 | Soc Ind Des Silicones | Organosilsesquioxanes |
| DE2020224C3 (de) * | 1970-04-25 | 1974-04-25 | Th. Goldschmidt Ag, 4300 Essen | Methyl- bzw. Methylphenylpolysiloxanharze |
| US3925276A (en) * | 1971-02-16 | 1975-12-09 | Gen Electric | Organopolysiloxane release resins useful in cooking and baking processes |
| US3861939A (en) * | 1971-12-22 | 1975-01-21 | Gen Electric | Process for coating substrates using fast curing silanol-containing organopolysiloxane resins |
| NL7411631A (nl) * | 1973-09-10 | 1975-03-12 | Rhone Poulenc Sa | Werkwijze voor de bereiding van vloeibare methyl- vinylfenylpolysiloxanharsen, werkwijze voor de bereiding van copolymeriseerbare samenstellingen met deze harsen, werkwijze voor het bekleden van voorwerpen, alsmede de beklede voorwerpen. |
| US4028339A (en) * | 1974-09-16 | 1977-06-07 | General Electric Company | Organopolysiloxane release resins useful in cooking and baking processes |
| US4130599A (en) * | 1975-05-19 | 1978-12-19 | General Electric Company | Silanol-free resins |
| US3983148A (en) * | 1975-08-29 | 1976-09-28 | Union Carbide Corporation | Process for producing cyclic siloxanes |
| US4026868A (en) * | 1975-11-10 | 1977-05-31 | General Electric Company | Process for producing a low viscosity silicone resin |
| US4056492A (en) * | 1976-06-24 | 1977-11-01 | General Electric Company | Process for the production of a bodied silicone resin without the use of a catalyst |
| US4085084A (en) * | 1976-08-26 | 1978-04-18 | General Electric Company | Silicone resins having good thermal stability |
| GB1551861A (en) * | 1976-10-26 | 1979-09-05 | Goldschmidt Ag Th | Process for the hydrolysis and condensation of alkyl and aryl-trichlorosilanes |
| JPS5383680A (en) * | 1976-12-29 | 1978-07-24 | Toray Silicone Co | Filler for gas separation column |
| GB1604414A (en) * | 1977-07-27 | 1981-12-09 | Raychem Ltd | Silicone resin |
| GB1604415A (en) * | 1977-07-27 | 1981-12-09 | Raychem Ltd | Polymeric blends |
| DE2758414A1 (de) * | 1977-12-28 | 1979-07-12 | Fraunhofer Ges Forschung | Kieselsaeureheteropolykondensate, verfahren zu deren herstellung und deren verwendung bei der zuechtung lebender zellen |
| DE2758415A1 (de) * | 1977-12-28 | 1979-07-12 | Fraunhofer Ges Forschung | Kieselsaeureheteropolykondensate, verfahren zu deren herstellung und deren verwendung als membranen und adsorbentien |
| DE2801779A1 (de) * | 1978-01-17 | 1979-07-19 | Wacker Chemie Gmbh | Verfahren zum erhoehen des molekulargewichts |
| JPS55120658A (en) * | 1979-03-13 | 1980-09-17 | Toray Silicone Co Ltd | Silicone composition forming ceramic at high temperature |
| DE3173441D1 (en) * | 1980-08-26 | 1986-02-20 | Japan Synthetic Rubber Co Ltd | Ladder-like lower alkylpolysilsesquioxanes and process for their preparation |
| US4368313A (en) * | 1981-09-18 | 1983-01-11 | General Electric Company | Stabilization of silanol hydrolysates of organosilanes |
| DE3278567D1 (en) * | 1981-10-03 | 1988-07-07 | Japan Synthetic Rubber Co Ltd | Solvent-soluble organopolysilsesquioxanes, processes for producing the same, and compositions and semiconductor devices using the same |
| US4408030A (en) * | 1982-03-22 | 1983-10-04 | Dow Corning Corporation | Waste chlorosilane treatment |
| JPS5933328A (ja) * | 1982-08-19 | 1984-02-23 | Shin Etsu Chem Co Ltd | シリコ−ンエマルジヨンの製造方法 |
| JPH028223A (ja) * | 1988-06-27 | 1990-01-11 | Toshiba Silicone Co Ltd | オルガノクロロシランの加水分解方法 |
| US5010159A (en) * | 1989-09-01 | 1991-04-23 | Dow Corning Corporation | Process for the synthesis of soluble, condensed hydridosilicon resins containing low levels of silanol |
| JP2778258B2 (ja) * | 1991-01-18 | 1998-07-23 | 信越化学工業株式会社 | 部分アルコキシ化ポリシロキサンの製造方法 |
| US5075479A (en) * | 1991-05-20 | 1991-12-24 | Dow Corning Corporation | Anhydrous hydrogen chloride evolving one-step process for producing siloxanes |
| JP3415640B2 (ja) * | 1992-07-29 | 2003-06-09 | 東レ・ダウコーニング・シリコーン株式会社 | オルガノシロキサンオリゴマーの製造方法 |
| TW257785B (OSRAM) * | 1993-05-17 | 1995-09-21 | Dow Corning | |
| DE69408919T2 (de) * | 1993-08-18 | 1998-10-01 | Shinetsu Chemical Co | Verfahren zur Herstellung von Polydimethylsiloxanen |
| KR100361043B1 (ko) * | 1993-12-27 | 2003-04-10 | 가와사키 마이크로 엘렉트로닉스 가부시키가이샤 | 반도체장치의절연막및절연막형성용도포액및절연막의제조방법 |
| US5844060A (en) * | 1995-07-05 | 1998-12-01 | Shin-Etsu Chemical Co., Ltd. | Organopolysiloxane resin, production method thereof, and curable organopolysiloxane resin composition using the same |
| RU2259377C1 (ru) * | 2003-12-26 | 2005-08-27 | Федеральное Государственное унитарное предприятие Государственный научно-исследовательский институт химии и технологии элементоорганических соединений (ФГУП ГНИИХТЭОС) | Способ получения олигоорганосилоксанов |
| DE102005003898A1 (de) * | 2005-01-27 | 2006-08-03 | Wacker Chemie Ag | Kontinuierliches Verfahren zur Herstellung SiOC-enthaltender Verbindungen |
| DE102005003899A1 (de) * | 2005-01-27 | 2006-08-03 | Wacker Chemie Ag | Verfahren zur kontinuierlichen Herstellung von alkoxyarmen Siliconharzen |
| DE102005030579A1 (de) * | 2005-06-30 | 2007-01-04 | Wacker Chemie Ag | Siliconharze mit definierter Reaktivität |
| RU2320678C1 (ru) * | 2007-01-09 | 2008-03-27 | Открытое акционерное общество "Химпром" | Способ получения полифенилэтоксисилоксана |
| KR20090113835A (ko) * | 2007-01-22 | 2009-11-02 | 다우 코닝 코포레이션 | 신규한 실세스퀴옥산 충전재 물질의 제조 방법 |
| DE102013212980A1 (de) | 2013-07-03 | 2015-01-08 | Wacker Chemie Ag | Verfahren zur Herstellung von SiOH-funktionellen Polysiloxanen |
| DE102015214503A1 (de) | 2015-07-30 | 2017-02-02 | Wacker Chemie Ag | Verfahren zur Herstellung von Organopolysiloxanen |
| DE102015214502A1 (de) | 2015-07-30 | 2017-02-02 | Wacker Chemie Ag | Verfahren zur Herstellung von Organopolysiloxanen |
| CN109923150B (zh) | 2016-11-10 | 2021-09-14 | 瓦克化学股份公司 | 制备SiOH官能的聚硅氧烷的方法 |
| CN115873253B (zh) * | 2022-10-10 | 2024-03-12 | 湖北兴瑞硅材料有限公司 | 一种有机硅光扩散剂微球的制备方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2486162A (en) * | 1942-02-26 | 1949-10-25 | Corning Glass Works | Organo-siloxanes |
| US2483158A (en) * | 1946-10-11 | 1949-09-27 | Gen Electric | Liquid organo-substituted polysiloxanes |
| US2758124A (en) * | 1952-04-11 | 1956-08-07 | Gen Electric | Continuous hydrolysis of organohalogenosilanes |
| US2832794A (en) * | 1952-11-05 | 1958-04-29 | Allied Chem & Dye Corp | Hydrolysis of organosilanes |
| US2901460A (en) * | 1956-02-07 | 1959-08-25 | Gen Electric | Halosilane hydrolysis with tetrahydrofuran and water |
-
1965
- 1965-06-29 FR FR22736A patent/FR1472047A/fr not_active Expired
-
1966
- 1966-06-16 DE DE19661645355 patent/DE1645355A1/de active Pending
- 1966-06-28 BE BE683301D patent/BE683301A/xx unknown
- 1966-06-29 GB GB29228/66A patent/GB1154850A/en not_active Expired
- 1966-06-29 AT AT623566A patent/AT284439B/de not_active IP Right Cessation
- 1966-06-29 NL NL6609046A patent/NL6609046A/xx unknown
-
1969
- 1969-02-26 US US804366*A patent/US3489782A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US3489782A (en) | 1970-01-13 |
| AT284439B (de) | 1970-09-10 |
| FR1472047A (fr) | 1967-03-10 |
| NL6609046A (OSRAM) | 1966-12-30 |
| BE683301A (OSRAM) | 1966-12-28 |
| GB1154850A (en) | 1969-06-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1645355A1 (de) | Verfahren zur Herstellung von neuen Silanpolykondensaten | |
| DE69020278T2 (de) | Verfahren zur Herstellung von lösliche Siltgruppen enthaltenden Siloxanharzen mit einem niedrigen Gehalt an Silanolgruppen. | |
| DE69117094T2 (de) | Verfahren zur Herstellung von Kopolymeren mit Diphenyl- und Dimethylsiloxankettensegmenten | |
| DE954198C (de) | Verfahren zur Herstellung von Organopolysiloxanen durch kontinuierliche Hydrolyse von Organochlorsilanen mit Wasser | |
| DE1570686A1 (de) | Verfahren zur Herstellung von Organosilizium-Verbindungen | |
| DE3237847A1 (de) | Verfahren zum hydrolysieren von alkoxysilanen | |
| DE2849092A1 (de) | Silylphosphate und verfahren zu deren herstellung | |
| DE2444529A1 (de) | Verfahren zur herstellung von silikonharzen | |
| EP0927733A1 (de) | Verfahren zur Herstellung von Polyorganosiloxanharzen, die mono- und tetrafunktionelle Einheiten enthalten | |
| DE1570446B2 (de) | Verfahren zur Herstellung von Organosiloxanblockmischpolymeren | |
| DE3041686A1 (de) | Verfahren zur herstellung von triorganosilylendgruppen aufweisenden, fluessigen diorganopolysiloxanen | |
| DE4332425A1 (de) | Organopolysiloxane mit bifunktionellen endständigen Siloxaneinheiten | |
| DE1495859A1 (de) | Organopolysiloxane und Verfahren zur Herstellung derselben | |
| DE60007583T2 (de) | Verfahren zur Herstellung von Silanolgruppe-enthaltende Organosiliziumverbindungen | |
| DE3889103T2 (de) | Verfahren zur herstellung von organopolysiloxanen mit einer alkenyl-endgruppe. | |
| DE69221667T2 (de) | Einstufiges Verfahren zur Herstellung von Siloxanen, wobei wasserfreie Chlorwasserstoff freigesetzt wird | |
| DE4317978A1 (de) | Organosiliciumreste aufweisende Phosphazene, Verfahren zu deren Herstellung und deren Verwendung | |
| DE4033157A1 (de) | Verfahren zur herstellung von loeslichen methylalkoxypoly(disilyl)-siloxanen | |
| DE2345923C3 (de) | Verfahren zur Herstellung von halogensubstituierten linearen oder verzweigten OrganopolysUoxanen | |
| DE69601997T2 (de) | Hydroxyphenylgruppen enthaltende Polyorganosiloxane | |
| DE1745523A1 (de) | Verfahren zur Veraetherung von ungesaettigten polymeren Hydroxy(oxyalkylen)verbindungen | |
| DE3518880C2 (OSRAM) | ||
| DE69727288T2 (de) | Verfahren zur Herstellung von hochreine, verzweigte, flüssige Phenylsiloxane | |
| DE69829144T2 (de) | Verfahren zur Herstellung kettenverlängerter Organopolysiloxane | |
| DE2542425C3 (de) | Verfahren zur Herstellung von Hexasiloxycyclosiloxanen |