DE1644074C3 - Sulfonsäuregruppenhaltige Monoazofarbstoffe, Verfahren zu deren Herstellung und Farbstoffzubereitungen - Google Patents
Sulfonsäuregruppenhaltige Monoazofarbstoffe, Verfahren zu deren Herstellung und FarbstoffzubereitungenInfo
- Publication number
- DE1644074C3 DE1644074C3 DE1644074A DE1644074A DE1644074C3 DE 1644074 C3 DE1644074 C3 DE 1644074C3 DE 1644074 A DE1644074 A DE 1644074A DE 1644074 A DE1644074 A DE 1644074A DE 1644074 C3 DE1644074 C3 DE 1644074C3
- Authority
- DE
- Germany
- Prior art keywords
- acid
- ester
- red
- parts
- sulfonic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000975 dye Substances 0.000 title claims description 17
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 title claims description 6
- 238000002360 preparation method Methods 0.000 title description 5
- 238000000034 method Methods 0.000 title description 4
- 238000004519 manufacturing process Methods 0.000 title 1
- 125000000542 sulfonic acid group Chemical group 0.000 title 1
- GPNNOCMCNFXRAO-UHFFFAOYSA-N 2-aminoterephthalic acid Chemical compound NC1=CC(C(O)=O)=CC=C1C(O)=O GPNNOCMCNFXRAO-UHFFFAOYSA-N 0.000 description 10
- 239000004952 Polyamide Substances 0.000 description 10
- 150000002148 esters Chemical class 0.000 description 10
- 229920002647 polyamide Polymers 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- -1 η-butyl Chemical group 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 230000008878 coupling Effects 0.000 description 5
- 238000010168 coupling process Methods 0.000 description 5
- 238000005859 coupling reaction Methods 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 238000004043 dyeing Methods 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- WGLQHUKCXBXUDV-UHFFFAOYSA-N 3-aminophthalic acid Chemical compound NC1=CC=CC(C(O)=O)=C1C(O)=O WGLQHUKCXBXUDV-UHFFFAOYSA-N 0.000 description 3
- OXSANYRLJHSQEP-UHFFFAOYSA-N 4-aminophthalic acid Chemical compound NC1=CC=C(C(O)=O)C(C(O)=O)=C1 OXSANYRLJHSQEP-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- UWNADWZGEHDQAB-UHFFFAOYSA-N i-Pr2C2H4i-Pr2 Natural products CC(C)CCC(C)C UWNADWZGEHDQAB-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000011734 sodium Chemical group 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 210000002268 wool Anatomy 0.000 description 3
- KBZFDRWPMZESDI-UHFFFAOYSA-N 5-aminobenzene-1,3-dicarboxylic acid Chemical compound NC1=CC(C(O)=O)=CC(C(O)=O)=C1 KBZFDRWPMZESDI-UHFFFAOYSA-N 0.000 description 2
- HBZVNWNSRNTWPS-UHFFFAOYSA-N 6-amino-4-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(O)C2=CC(N)=CC=C21 HBZVNWNSRNTWPS-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- GQPLMRYTRLFLPF-UHFFFAOYSA-N Nitrous Oxide Chemical compound [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 150000008049 diazo compounds Chemical class 0.000 description 2
- PJARQNJKDUFHOZ-UHFFFAOYSA-N diethyl 3-aminobenzene-1,2-dicarboxylate Chemical compound CCOC(=O)C1=CC=CC(N)=C1C(=O)OCC PJARQNJKDUFHOZ-UHFFFAOYSA-N 0.000 description 2
- SASYYCSGLSADJC-UHFFFAOYSA-N dipropyl 3-aminobenzene-1,2-dicarboxylate Chemical compound CCCOC(=O)C1=CC=CC(N)=C1C(=O)OCCC SASYYCSGLSADJC-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 2
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000011591 potassium Chemical group 0.000 description 2
- 229910052700 potassium Chemical group 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 229920002994 synthetic fiber Polymers 0.000 description 2
- QGLWBTPVKHMVHM-KTKRTIGZSA-N (z)-octadec-9-en-1-amine Chemical compound CCCCCCCC\C=C/CCCCCCCCN QGLWBTPVKHMVHM-KTKRTIGZSA-N 0.000 description 1
- LDOMKUVUXZRECL-UHFFFAOYSA-N 2-aminobenzene-1,3-dicarboxylic acid Chemical compound NC1=C(C(O)=O)C=CC=C1C(O)=O LDOMKUVUXZRECL-UHFFFAOYSA-N 0.000 description 1
- VGUWZCUCNQXGBU-UHFFFAOYSA-N 3-[(4-methylpiperazin-1-yl)methyl]-5-nitro-1h-indole Chemical compound C1CN(C)CCN1CC1=CNC2=CC=C([N+]([O-])=O)C=C12 VGUWZCUCNQXGBU-UHFFFAOYSA-N 0.000 description 1
- BDBLLWHZWCBDAR-UHFFFAOYSA-N 4-aminobenzene-1,3-dicarboxylic acid Chemical compound NC1=CC=C(C(O)=O)C=C1C(O)=O BDBLLWHZWCBDAR-UHFFFAOYSA-N 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- BWNIOCSRONHTOZ-UHFFFAOYSA-N NC1=C(C(C(=O)OCC(C)C)=CC=C1)C(=O)OCC(C)C Chemical compound NC1=C(C(C(=O)OCC(C)C)=CC=C1)C(=O)OCC(C)C BWNIOCSRONHTOZ-UHFFFAOYSA-N 0.000 description 1
- MPPPGHCMCVIREN-UHFFFAOYSA-N NC=1C=C(C(C(=O)OCC(C)C)=CC1)C(=O)OCC(C)C Chemical compound NC=1C=C(C(C(=O)OCC(C)C)=CC1)C(=O)OCC(C)C MPPPGHCMCVIREN-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 229920002292 Nylon 6 Polymers 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- MMCPHWUZLKOIGQ-UHFFFAOYSA-N bis(2-methylpropyl) 2-aminobenzene-1,4-dicarboxylate Chemical compound CC(C)COC(=O)C1=CC=C(C(=O)OCC(C)C)C(N)=C1 MMCPHWUZLKOIGQ-UHFFFAOYSA-N 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical group CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- GROXPXPLDFRFOK-UHFFFAOYSA-N dicyclohexyl 2-aminobenzene-1,4-dicarboxylate Chemical compound NC1=CC(C(=O)OC2CCCCC2)=CC=C1C(=O)OC1CCCCC1 GROXPXPLDFRFOK-UHFFFAOYSA-N 0.000 description 1
- BDFDXMSSBFNAQG-UHFFFAOYSA-N diethyl 2-aminobenzene-1,4-dicarboxylate Chemical compound CCOC(=O)C1=CC=C(C(=O)OCC)C(N)=C1 BDFDXMSSBFNAQG-UHFFFAOYSA-N 0.000 description 1
- MPCAOTRSCWFYIJ-UHFFFAOYSA-N diethyl 4-aminobenzene-1,2-dicarboxylate Chemical compound CCOC(=O)C1=CC=C(N)C=C1C(=O)OCC MPCAOTRSCWFYIJ-UHFFFAOYSA-N 0.000 description 1
- VQRVPAXIXNQFHI-UHFFFAOYSA-N diethyl 5-aminobenzene-1,3-dicarboxylate Chemical compound CCOC(=O)C1=CC(N)=CC(C(=O)OCC)=C1 VQRVPAXIXNQFHI-UHFFFAOYSA-N 0.000 description 1
- DSSKDXUDARIMTR-UHFFFAOYSA-N dimethyl 2-aminobenzene-1,4-dicarboxylate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C(N)=C1 DSSKDXUDARIMTR-UHFFFAOYSA-N 0.000 description 1
- VEJKSNHPNFHCLF-UHFFFAOYSA-N dimethyl 3-aminobenzene-1,2-dicarboxylate Chemical compound COC(=O)C1=CC=CC(N)=C1C(=O)OC VEJKSNHPNFHCLF-UHFFFAOYSA-N 0.000 description 1
- NTBHQNDXAJXRPU-UHFFFAOYSA-N dimethyl 4-aminobenzene-1,2-dicarboxylate Chemical compound COC(=O)C1=CC=C(N)C=C1C(=O)OC NTBHQNDXAJXRPU-UHFFFAOYSA-N 0.000 description 1
- DEKPYXUDJRABNK-UHFFFAOYSA-N dimethyl 5-aminobenzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC(N)=CC(C(=O)OC)=C1 DEKPYXUDJRABNK-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- NDKPWDCVTVYVOW-UHFFFAOYSA-N dipropan-2-yl 5-aminobenzene-1,3-dicarboxylate Chemical compound CC(C)OC(=O)C1=CC(N)=CC(C(=O)OC(C)C)=C1 NDKPWDCVTVYVOW-UHFFFAOYSA-N 0.000 description 1
- YIJNDANNHSUUKB-UHFFFAOYSA-N dipropyl 2-aminobenzene-1,4-dicarboxylate Chemical compound CCCOC(=O)C1=CC=C(C(=O)OCCC)C(N)=C1 YIJNDANNHSUUKB-UHFFFAOYSA-N 0.000 description 1
- PTODGHKGLDDARQ-UHFFFAOYSA-N dipropyl 4-aminobenzene-1,2-dicarboxylate Chemical compound CCCOC(=O)C1=CC=C(N)C=C1C(=O)OCCC PTODGHKGLDDARQ-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000001272 nitrous oxide Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 239000004758 synthetic textile Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/10—Monoazo dyes prepared by diazotising and coupling from coupling components containing hydroxy as the only directing group
- C09B29/16—Naphthol-sulfonic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1644074A DE1644074C3 (de) | 1967-12-01 | 1967-12-01 | Sulfonsäuregruppenhaltige Monoazofarbstoffe, Verfahren zu deren Herstellung und Farbstoffzubereitungen |
| US779652A US3624068A (en) | 1967-12-01 | 1968-11-27 | Di(carboxylic acid ester)-phenyl-azo-naphthol dyes |
| GB5671068A GB1238924A (enExample) | 1967-12-01 | 1968-11-29 | |
| CH1779968A CH503780A (de) | 1967-12-01 | 1968-11-29 | Verfahren zur Herstellung von neuen sulfonsäuregruppenhaltigen Monoazofarbstoffen |
| FR176022A FR1600498A (enExample) | 1967-12-01 | 1968-11-29 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1644074A DE1644074C3 (de) | 1967-12-01 | 1967-12-01 | Sulfonsäuregruppenhaltige Monoazofarbstoffe, Verfahren zu deren Herstellung und Farbstoffzubereitungen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1644074A1 DE1644074A1 (de) | 1971-07-01 |
| DE1644074B2 DE1644074B2 (de) | 1974-05-02 |
| DE1644074C3 true DE1644074C3 (de) | 1974-12-12 |
Family
ID=5684442
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1644074A Expired DE1644074C3 (de) | 1967-12-01 | 1967-12-01 | Sulfonsäuregruppenhaltige Monoazofarbstoffe, Verfahren zu deren Herstellung und Farbstoffzubereitungen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3624068A (enExample) |
| CH (1) | CH503780A (enExample) |
| DE (1) | DE1644074C3 (enExample) |
| FR (1) | FR1600498A (enExample) |
| GB (1) | GB1238924A (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH533666A (de) * | 1970-06-19 | 1973-02-15 | Sandoz Ag | Verfahren zur Herstellung von Monoazoverbindungen |
| GB1448484A (en) * | 1973-04-25 | 1976-09-08 | Ici Ltd | Dyeing process |
| USRE29724E (en) * | 1973-04-25 | 1978-08-08 | Imperial Chemical Industries Limited | Dyeing process |
| MX143090A (es) * | 1975-06-20 | 1981-03-13 | Burlington Industries Inc | Procedimiento para tenir reactivamente sustrato textil con un colorante aromatico substituido con grupos de acido carboxilicon |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1277473B (de) * | 1960-07-02 | 1968-09-12 | Hoechst Ag | Verfahren zur Herstellung von wasserunloeslichen Monoazofarbstoffen |
| US3413280A (en) * | 1961-12-29 | 1968-11-26 | Ciba Ltd | Monoazo dyestuffs |
-
1967
- 1967-12-01 DE DE1644074A patent/DE1644074C3/de not_active Expired
-
1968
- 1968-11-27 US US779652A patent/US3624068A/en not_active Expired - Lifetime
- 1968-11-29 GB GB5671068A patent/GB1238924A/en not_active Expired
- 1968-11-29 FR FR176022A patent/FR1600498A/fr not_active Expired
- 1968-11-29 CH CH1779968A patent/CH503780A/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CH503780A (de) | 1971-02-28 |
| FR1600498A (enExample) | 1970-07-27 |
| DE1644074B2 (de) | 1974-05-02 |
| US3624068A (en) | 1971-11-30 |
| GB1238924A (enExample) | 1971-07-14 |
| DE1644074A1 (de) | 1971-07-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1644074C3 (de) | Sulfonsäuregruppenhaltige Monoazofarbstoffe, Verfahren zu deren Herstellung und Farbstoffzubereitungen | |
| DE1644340C3 (de) | Monoazofarbstoffe und ein Verfahren zu ihrer Herstellung. Ausscheidung aus: 1225323 | |
| DE2433260C3 (de) | In Wasser schwer lösliche Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken | |
| DE1644162C3 (de) | Ein wasserlöslicher Pyrazolon-monoazofarbstoff und Verfahren zu dessen Herstellung | |
| DE2236107C2 (de) | Wasserlösliche Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1769398B2 (de) | Wasserlösliche Phthalocyanin-Azofarbstoffe sowie Verfahren zu deren Herstellung und deren Verwendung | |
| DE652868C (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE1266425B (de) | Verfahren zur Herstellung von Anthrachinon-Dispersionsfarbstoffen | |
| DE2116315A1 (de) | Azoverbindungen | |
| DE229525C (enExample) | ||
| DE1644056C (de) | Sulfonsäuregruppenhaltige Monoazofarbstoffe | |
| DE1644168C3 (enExample) | ||
| DE888902C (de) | Verfahren zur Herstellung saurer Monoazofarbstoffe | |
| DE883021C (de) | Verfahren zur Herstellung von chromierbaren Monoazofarbstoffen | |
| DE2040476C2 (de) | Verfahren zur Herstellung von sauren Azofarbstoffen und deren Verwendung zum Faerben | |
| DE767109C (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| AT227852B (de) | Verfahren zur Herstellung neuer wasserunlöslicher Monoazofarbstoffe | |
| DE731317C (de) | Verfahren zur Herstellung von wasserloeslichen Monoazofarbstoffen | |
| DE1793301C3 (de) | Neue, wasserlösliche Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2517886A1 (de) | Saure azofarbstoffe | |
| CH210604A (de) | Verfahren zur Herstellung eines Azofarbstoffes. | |
| DE2130109A1 (de) | Verfahren zur Herstellung von Monoazoverbindungen | |
| DE3007547A1 (de) | Saure azofarbstoffe, verfahren zu deren herstellung sowie deren verwendung | |
| DE2237554A1 (de) | Mono-disazoamino-substituierte farbstoffe, zwischenprodukte und verfahren zu ihrer herstellung | |
| DE1644068A1 (de) | Sulfonsaeuregruppenfreie Monoazofarbstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| EHV | Ceased/renunciation |