DE1620702A1 - Benzimidazolonderivate - Google Patents
BenzimidazolonderivateInfo
- Publication number
- DE1620702A1 DE1620702A1 DE19651620702 DE1620702A DE1620702A1 DE 1620702 A1 DE1620702 A1 DE 1620702A1 DE 19651620702 DE19651620702 DE 19651620702 DE 1620702 A DE1620702 A DE 1620702A DE 1620702 A1 DE1620702 A1 DE 1620702A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- carbon atoms
- hydrogen
- inorganic
- isolated
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000008641 benzimidazolones Chemical class 0.000 title claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 150000001875 compounds Chemical class 0.000 claims description 11
- 150000002148 esters Chemical class 0.000 claims description 10
- -1 hydrogen halogen Chemical class 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 6
- 150000007522 mineralic acids Chemical class 0.000 claims description 6
- 150000007524 organic acids Chemical class 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 150000001298 alcohols Chemical class 0.000 claims description 5
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 3
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 2
- 150000004987 o-phenylenediamines Chemical class 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims 5
- 239000012458 free base Substances 0.000 claims 5
- 125000000217 alkyl group Chemical group 0.000 claims 4
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 235000015250 liver sausages Nutrition 0.000 claims 1
- 150000003141 primary amines Chemical class 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 23
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical group Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 125000001309 chloro group Chemical group Cl* 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 239000003208 petroleum Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 125000005843 halogen group Chemical group 0.000 description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 125000002924 primary amino group Chemical class [H]N([H])* 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000001773 anti-convulsant effect Effects 0.000 description 2
- 230000001430 anti-depressive effect Effects 0.000 description 2
- 239000001961 anticonvulsive agent Substances 0.000 description 2
- 239000000935 antidepressant agent Substances 0.000 description 2
- 229940005513 antidepressants Drugs 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000004651 carbonic acid esters Chemical class 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000004986 phenylenediamines Chemical class 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- HUHXLHLWASNVDB-UHFFFAOYSA-N 2-(oxan-2-yloxy)oxane Chemical compound O1CCCCC1OC1OCCCC1 HUHXLHLWASNVDB-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 1
- OXDAHVPWTBASIY-UHFFFAOYSA-N 3-phenyl-1H-benzimidazol-2-one Chemical compound C1(=CC=CC=C1)N1C(NC2=C1C=CC=C2)=O.C2(=CC=CC=C2)N2C(NC1=C2C=CC=C1)=O OXDAHVPWTBASIY-UHFFFAOYSA-N 0.000 description 1
- UCBSMOSFCAQPAI-UHFFFAOYSA-N 5-chloro-3-phenyl-1h-benzimidazol-2-one Chemical compound C12=CC(Cl)=CC=C2NC(=O)N1C1=CC=CC=C1 UCBSMOSFCAQPAI-UHFFFAOYSA-N 0.000 description 1
- OZMMDUAMJJUGJL-UHFFFAOYSA-N 5-chlorobenzimidazol-2-one Chemical compound C1=C(Cl)C=CC2=NC(=O)N=C21 OZMMDUAMJJUGJL-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 1
- MFESCIUQSIBMSM-UHFFFAOYSA-N I-BCP Chemical compound ClCCCBr MFESCIUQSIBMSM-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- AEKNYBWUEYNWMJ-QWOOXDRHSA-N Pramiconazole Chemical compound O=C1N(C(C)C)CCN1C1=CC=C(N2CCN(CC2)C=2C=CC(OC[C@@H]3O[C@](CN4N=CN=C4)(CO3)C=3C(=CC(F)=CC=3)F)=CC=2)C=C1 AEKNYBWUEYNWMJ-QWOOXDRHSA-N 0.000 description 1
- 238000000297 Sandmeyer reaction Methods 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001339 alkali metal compounds Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 229940125681 anticonvulsant agent Drugs 0.000 description 1
- 229960003965 antiepileptics Drugs 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000003944 halohydrins Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 150000003112 potassium compounds Chemical class 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000005932 reductive alkylation reaction Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- KSMWLICLECSXMI-UHFFFAOYSA-N sodium;benzene Chemical compound [Na+].C1=CC=[C-]C=C1 KSMWLICLECSXMI-UHFFFAOYSA-N 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/24—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D235/26—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH133364A CH437315A (de) | 1964-02-05 | 1964-02-05 | Verfahren zur Herstellung von Benzimidazolonderivaten |
| CH501764 | 1964-04-17 | ||
| CH1000264 | 1964-07-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1620702A1 true DE1620702A1 (de) | 1970-03-12 |
Family
ID=27172901
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19651620702 Pending DE1620702A1 (de) | 1964-02-05 | 1965-01-22 | Benzimidazolonderivate |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3338916A (enExample) |
| BE (1) | BE659364A (enExample) |
| BR (1) | BR6566831D0 (enExample) |
| CH (4) | CH438335A (enExample) |
| DE (1) | DE1620702A1 (enExample) |
| DK (4) | DK109988C (enExample) |
| ES (1) | ES308785A1 (enExample) |
| FI (1) | FI44407B (enExample) |
| FR (1) | FR3952M (enExample) |
| GB (1) | GB1078251A (enExample) |
| IL (1) | IL22841A (enExample) |
| NL (1) | NL6501434A (enExample) |
| NO (1) | NO116324B (enExample) |
| SE (4) | SE343580B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3996238A (en) * | 1972-02-08 | 1976-12-07 | Ciba-Geigy Corporation | 4- or 5-Nitroimidazoles and processes for their manufacture |
| US3989707A (en) * | 1974-06-21 | 1976-11-02 | Janssen Pharmaceutica N.V. | Benzimidazolinone derivatives |
| DE2609645A1 (de) * | 1976-03-09 | 1977-09-15 | Boehringer Sohn Ingelheim | Aminoalkylheterocyclen |
| US4335132A (en) * | 1980-12-29 | 1982-06-15 | Sterling Drug, Inc. | 5-(Py-Y)-1H-benzimidazol-2-ols and 5-(Py-Y-)-1H-benzimidazole-2-thiols |
| US5200422A (en) * | 1990-09-24 | 1993-04-06 | Neurosearch A/S | Benzimidazole derivatives, their preparation and use |
| GB9613423D0 (en) * | 1996-06-26 | 1996-08-28 | Lilly Industries Ltd | Pharmaceutical compounds |
| US7526342B2 (en) | 1999-08-10 | 2009-04-28 | Maquet Cardiovascular Llc | Apparatus for endoscopic cardiac mapping and lead placement |
| US7264587B2 (en) | 1999-08-10 | 2007-09-04 | Origin Medsystems, Inc. | Endoscopic subxiphoid surgical procedures |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT290523B (de) * | 1962-01-05 | 1971-06-11 | Merck & Co Inc | Verfahren zur Herstellung neuer α-(3-Indolyl)-carbonsäuren |
-
0
- BE BE659364D patent/BE659364A/xx unknown
-
1964
- 1964-02-05 CH CH661867A patent/CH438335A/de unknown
- 1964-02-05 CH CH661767A patent/CH437317A/de unknown
- 1964-02-05 CH CH661967A patent/CH437318A/de unknown
- 1964-02-05 CH CH133364A patent/CH437315A/de unknown
-
1965
- 1965-01-22 DE DE19651620702 patent/DE1620702A1/de active Pending
- 1965-01-25 GB GB3179/65D patent/GB1078251A/en not_active Expired
- 1965-01-25 IL IL22841A patent/IL22841A/xx unknown
- 1965-01-29 FR FR3628A patent/FR3952M/fr not_active Expired
- 1965-01-29 US US429160A patent/US3338916A/en not_active Expired - Lifetime
- 1965-01-30 ES ES0308785A patent/ES308785A1/es not_active Expired
- 1965-02-02 BR BR166831/65A patent/BR6566831D0/pt unknown
- 1965-02-04 NO NO156634A patent/NO116324B/no unknown
- 1965-02-04 NL NL6501434A patent/NL6501434A/xx unknown
- 1965-02-04 FI FI0274/65A patent/FI44407B/fi active
- 1965-02-05 SE SE7124/69A patent/SE343580B/xx unknown
- 1965-02-05 DK DK52566AA patent/DK109988C/da active
- 1965-02-05 DK DK52666AA patent/DK109869C/da active
- 1965-02-05 DK DK60465AA patent/DK109804C/da active
- 1965-02-05 DK DK52466AA patent/DK109805C/da active
- 1965-02-05 SE SE1479/65A patent/SE322223B/xx unknown
-
1969
- 1969-05-20 SE SE7125/69A patent/SE343581B/xx unknown
- 1969-05-20 SE SE7123/69A patent/SE343579B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE343581B (enExample) | 1972-03-13 |
| DK109869C (da) | 1968-07-22 |
| SE343579B (enExample) | 1972-03-13 |
| BR6566831D0 (pt) | 1973-08-14 |
| SE343580B (enExample) | 1972-03-13 |
| CH437317A (de) | 1967-06-15 |
| BE659364A (enExample) | |
| NO116324B (enExample) | 1969-03-10 |
| DK109988C (da) | 1968-08-19 |
| US3338916A (en) | 1967-08-29 |
| NL6501434A (enExample) | 1965-08-06 |
| CH437315A (de) | 1967-06-15 |
| SE322223B (enExample) | 1970-04-06 |
| FR3952M (enExample) | 1966-02-21 |
| CH437318A (de) | 1967-06-15 |
| IL22841A (en) | 1968-05-30 |
| GB1078251A (en) | 1967-08-09 |
| CH438335A (de) | 1967-06-30 |
| DK109804C (da) | 1968-07-08 |
| DK109805C (da) | 1968-07-08 |
| FI44407B (enExample) | 1971-08-02 |
| ES308785A1 (es) | 1965-12-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1620702A1 (de) | Benzimidazolonderivate | |
| DE1670523A1 (de) | Verfahren zur Herstellung neuer substituierter Aminopyridine | |
| DE2233481C3 (de) | Verfahren zur Herstellung von 2-lmino-3-<2-hydroxy-2-phenyläthyl)-thiazolidin | |
| DE941288C (de) | Verfahren zur Herstellung substituierter 2-Imino-4-thiazoline oder von Salzen derselben bzw. von substituierten 2-Aminothiazolen | |
| DE1795344B2 (de) | Verfahren zur herstellung von 3-aminoisothiazolen | |
| CH667649A5 (en) | 2-Substd. amino-benzoxazole and -benzimidazole derivs. prodn. - by reacting prim. amino cpd. with amine in presence of acid catalyst, useful as intermediates e.g. for pharmaceuticals | |
| DE2265242C2 (de) | Verfahren zur Herstellung von tautomeren 4-Phenyl-1,3-dihydro-2H-1,5-benzodiazepin-2-thionen | |
| DE2809798B2 (de) | Verfahren zur Herstellung von 5-substituierten Tetrazolen | |
| DE929192C (de) | Verfahren zur Herstellung von am Stickstoffatom acylierten oder sulfonylierten aliphatischen Aminocarbonsaeureamiden | |
| AT249048B (de) | Verfahren zur Herstellung von neuen Benzimidazolonderivaten | |
| AT231455B (de) | Verfahren zur Herstellung von neuen Diazepinderivaten | |
| AT216504B (de) | Verfahren zur Herstellung von neuen Isoindolinderivaten | |
| AT205976B (de) | Verfahren zur Herstellung von neuen Nicotinsäurehydrazid-Derivaten | |
| DE1929138C3 (de) | Verfahren zur Herstellung von N hoch 1 -Benzoylphenyläthylendiaminen und ihren Salzen | |
| DE1445872C (de) | 5 Phenyl 1,2 dihydro 3H 1,4 benzodi azepinon (2) derivate | |
| DE1670677C (de) | Verfahren zur Herstellung von 3,1-Benzothiazinen | |
| AT372940B (de) | Verfahren zur herstellung von (d)-(-)-phydroxyphenylglycylchlorid-hydrochlorid | |
| AT247339B (de) | Verfahren zur Herstellung von neuen Chinazolon-Verbindungen | |
| AT273950B (de) | Verfahren zur Herstellung von neuen, einen Nitrofuran- oder Nitrothiophenrest enthaltenden Triazolo-tetrazolo-pyridazin-derivaten | |
| DE1670542B1 (de) | Substituierte 2-Anilino-4-morpholino-6-piperazino-s-triazine | |
| DE1921340C3 (de) | In 4-Stellung substituierte 2-Phenyl-5-haIogen-pyrimidine | |
| AT234691B (de) | Verfahren zur Herstellung von neuen Piperidinderivaten | |
| DE1445008C (de) | Verfahren zur Herstellung von 3,4-Dihydro-1,2,4-benzothiadiazin-1,1 -dioxyden. Ausscheidung aus: 1112079 | |
| AT373588B (de) | Verfahren zur herstellung von neuen substituierten 1-benzoyl-2-phenylimino-imidazolidinen und von deren salzen | |
| AT334379B (de) | Verfahren zur herstellung von neuen 6-aza-3h-1,4-benzodiazepinen und deren salzen |