DE1567151B2 - Diurethane, verfahren zur herstellung dieser verbindungen sowie diese enthaltende herbizide mittel - Google Patents
Diurethane, verfahren zur herstellung dieser verbindungen sowie diese enthaltende herbizide mittelInfo
- Publication number
- DE1567151B2 DE1567151B2 DE19651567151 DE1567151A DE1567151B2 DE 1567151 B2 DE1567151 B2 DE 1567151B2 DE 19651567151 DE19651567151 DE 19651567151 DE 1567151 A DE1567151 A DE 1567151A DE 1567151 B2 DE1567151 B2 DE 1567151B2
- Authority
- DE
- Germany
- Prior art keywords
- phenyl
- carbamate
- carbamoyloxy
- ethyl
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 150000001875 compounds Chemical class 0.000 title description 17
- 239000004009 herbicide Substances 0.000 title description 5
- 238000000034 method Methods 0.000 title description 5
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 39
- -1 3 - (N '- phenylcarbamoyloxy) phenyl Chemical group 0.000 description 25
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 23
- 241000196324 Embryophyta Species 0.000 description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 11
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 5
- 244000042664 Matricaria chamomilla Species 0.000 description 5
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 5
- 240000003705 Senecio vulgaris Species 0.000 description 5
- 240000003768 Solanum lycopersicum Species 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 230000002363 herbicidal effect Effects 0.000 description 5
- CWLKGDAVCFYWJK-UHFFFAOYSA-N 3-aminophenol Chemical compound NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- DXDDOFMELPWPMI-UHFFFAOYSA-N ethyl n-hydroxy-n-phenylcarbamate Chemical class CCOC(=O)N(O)C1=CC=CC=C1 DXDDOFMELPWPMI-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 150000007530 organic bases Chemical class 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 3
- 244000056139 Brassica cretica Species 0.000 description 3
- 235000003351 Brassica cretica Nutrition 0.000 description 3
- 235000003343 Brassica rupestris Nutrition 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 235000021536 Sugar beet Nutrition 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 3
- CWJSHJJYOPWUGX-UHFFFAOYSA-N chlorpropham Chemical compound CC(C)OC(=O)NC1=CC=CC(Cl)=C1 CWJSHJJYOPWUGX-UHFFFAOYSA-N 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000000395 magnesium oxide Substances 0.000 description 3
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 3
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 3
- 235000010460 mustard Nutrition 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- KZKRRZFCAYOXQE-UHFFFAOYSA-N 1$l^{2}-azinane Chemical compound C1CC[N]CC1 KZKRRZFCAYOXQE-UHFFFAOYSA-N 0.000 description 2
- 229940018563 3-aminophenol Drugs 0.000 description 2
- 244000291564 Allium cepa Species 0.000 description 2
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 2
- 235000008427 Brassica arvensis Nutrition 0.000 description 2
- 244000024671 Brassica kaber Species 0.000 description 2
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 2
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 2
- 235000007866 Chamaemelum nobile Nutrition 0.000 description 2
- 244000000626 Daucus carota Species 0.000 description 2
- 235000002767 Daucus carota Nutrition 0.000 description 2
- 241000748465 Galinsoga Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 240000004713 Pisum sativum Species 0.000 description 2
- 235000010582 Pisum sativum Nutrition 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 241000207763 Solanum Species 0.000 description 2
- 235000002634 Solanum Nutrition 0.000 description 2
- 240000006694 Stellaria media Species 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 210000003608 fece Anatomy 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- 239000010871 livestock manure Substances 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- BSCCSDNZEIHXOK-UHFFFAOYSA-N phenyl carbamate Chemical class NC(=O)OC1=CC=CC=C1 BSCCSDNZEIHXOK-UHFFFAOYSA-N 0.000 description 2
- VXPLXMJHHKHSOA-UHFFFAOYSA-N propham Chemical compound CC(C)OC(=O)NC1=CC=CC=C1 VXPLXMJHHKHSOA-UHFFFAOYSA-N 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 244000214240 Galinsoga parviflora Species 0.000 description 1
- 235000018914 Galinsoga parviflora Nutrition 0.000 description 1
- 235000017945 Matricaria Nutrition 0.000 description 1
- 230000006181 N-acylation Effects 0.000 description 1
- MVEFZZKZBYQFPP-UHFFFAOYSA-N [3-(ethoxycarbonylamino)phenyl] n-(3-methylphenyl)carbamate Chemical compound CCOC(=O)NC1=CC=CC(OC(=O)NC=2C=C(C)C=CC=2)=C1 MVEFZZKZBYQFPP-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- KCLZXXMMEDEBMF-UHFFFAOYSA-N ethyl n-(3-hydroxyphenyl)carbamate Chemical compound CCOC(=O)NC1=CC=CC(O)=C1 KCLZXXMMEDEBMF-UHFFFAOYSA-N 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- FFQQCJGNKKIRMD-UHFFFAOYSA-N methyl n-(3-hydroxyphenyl)carbamate Chemical compound COC(=O)NC1=CC=CC(O)=C1 FFQQCJGNKKIRMD-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- PWXJULSLLONQHY-UHFFFAOYSA-N phenylcarbamic acid Chemical compound OC(=O)NC1=CC=CC=C1 PWXJULSLLONQHY-UHFFFAOYSA-N 0.000 description 1
- BIFDXOOJPDHKJH-UHFFFAOYSA-N piperidine-1-carbonyl chloride Chemical compound ClC(=O)N1CCCCC1 BIFDXOOJPDHKJH-UHFFFAOYSA-N 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/20—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof
- C07D295/205—Radicals derived from carbonic acid
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Connector Housings Or Holding Contact Members (AREA)
Description
NH-C-O-R3
Il
o.
in der R1 eine Alkylgruppe mit 1 bis 4 Kohlenstoffatomen,
eine Cyclohexylgruppe oder einen gegebenenfalls durch ein Chloratom, eine Methylgruppe
oder eine Trifluormethylgruppe substituierten Phenylrest, R2 Wasserstoff und R3 eine Alkylgruppe
mit 1 bis 4 Kohlenstoffatomen, eine /3-Chloräthyl-
oder eine Butin-(l)-yl-(3)-Gruppe oder R1 und R2
gemeinsam mit dem N-Atom einen Piperidinorest und R3 eine Äthylgruppe oder R1, R2 und R3
eine Äthylgruppe bedeuten.
2. Methyl - N - (3 - (N' - (3' - chlorphenyl) - carb amoyloxy)-phenyl)-carbamat.
3.' Äthyl"- N - (3 - (N' - (3' - chlorphenyl) - carb amoyloxy)-phenyl)-carbamat.
4. Methyl - N - (3 - (N' - (4' - chlorphenyl) - carb amoyloxy)-phenyl)-carbamat.
5. Äthyl - N - (3 - (N' - (3' - methylphenyl) - carb amoyloxy)-phenyl)-carbamat.
6. Methyl - N - (3 - (N' - (4' - methylphenyl) - carb amoyloxy)-phenyl)-carbamat.
7. Äthyl-N-(3-(N'-(4'-methylphenyl)-carbamoyloxy)-phenyl)-carbamat.
8. Äthyl - N - (3 - (N' - (3' - trifluormethylphenyl) carbamoyloxy)-phenyl)-carbamat.
9. Methyl - N - (3 - (N' - phenylcarbamoyloxy) phenyl)-carbamat.
10. Äthyl - N - (3 - (N' - phenylcarbamoyloxy) phenyl)-cärbamat.
11. Methyl-N-(3-(N'-(3'-methylphenyl)-carbamoyloxy)-phenyl)-carbamat.
12. Methyl - N - (3 - (N' - η - butylcarbamoyloxy) phenyl)-carbamat.
13. Verfahren zur Herstellung der Verbindungen nach Ansprüchen 1 bis 12, dadurch gekennzeichnet,
daß man in an sich bekannter Weise N-Hydroxyphenylurethane der allgemeinen Formel
OH
Il
NH — C — O — R,
mit
a) Isocyanaten der allgemeinen Formel
R1-N = C = O
in Gegenwart eines Katalysators, zweckmäßig einer organischen Base, oder
b) Carbamidsäurechloriden der allgemeinen Formel
Cl
in Gegenwart eines Säureakzeptors, zweckmäßig einer anorganischen oder organischen
Base, umsetzt, wobei R1, R2 und R3 die obengenannte
Bedeutung haben.
14. Herbizide Mittel, enthaltend mindestens eine Verbindung nach Ansprüchen 1 bis 12.
Die Erfindung betrifft neue Diurethane, herbizide Mittel, enthaltend diese Verbindungen als Wirkstoffe,
sowie Verfahren zur Herstellung dieser Verbindungen.
Die herbizide Wirkung von Phenylcarbamaten, z. B. Isopropyl-N-phenylcarbamat und Isopropyl-N-(3-chlorphenyl)-carbamat,
ist bereits bekannt (deutsche Patentschrift 833 274). Diese Mittel zeigen jedoch
eine ungenügende Breitenwirkung, da wesentliche Ackerunkräuter, wie Kreuzkraut, Kamille und Franzosenkraut,
nicht oder nur unbefriedigend bekämpft werden.
Es wurde nun gefunden, daß Diurethane der allgemeinen Formel
in der R1 eine Alkylgruppe mit 1 bis 4 Kohlenstoffatomen,
eine Cyclohexylgruppe oder einen gegebenenfalls durch ein Chloratom, eine Methylgruppe oder
eine Trifluormethylgruppe substituierten Phenylrest, R2 Wasserstoff und R3 eine Alkylgruppe mit 1 bis 4
Kohlenstoffatomen, eine ß-Chloräthyl- oder eine
Butin-(l)-yl-(3)-Gruppe oder R1 und R2 gemeinsam
mit dem N-Atom einen Piperidinorest und R3 eine Äthylgruppe oder R1, R2 und R3 eine Äthylgruppe
bedeuten, breit wirksam gegen eine Vielzahl von Unkräutern, insbesondere auch dikotyle Pflanzenarten,
sind.
Diese Wirkung erstreckt sich sowohl auf die Anwendung im Vorauflauf- als auch im Nachauflaufverfahren
und erlaubt daher die Verwendung der Mittel, welche diese Verbindungen enthalten, je nach der gewünschten
Anwendungsart. Ein weiterer Vorteil ist die Wirksamkeit bei der Kontaktbehandlung über die
Blätter etablierter Unkräuter.
Es hat sich außerdem gezeigt, daß einige der Verbindungen
eine selektive herbizide Wirkung besitzen und beispielsweise zur Unkrautbekämpfung in Rübenkulturen
eingesetzt werden können.
Verbindungen, die gemäß der Erfindung verwendet werden können, sind z. B. die folgenden:
Verbin
dung
dung
Nr.
10
11
11
12
13
13
14
15
16
17
18
19
15
16
17
18
19
Name der Verbindung
Äthyl-N-(3-(N'-(2'-chlorphenyl)-carbamoyloxy)- phenyl)-carbamat £-Chloräthyl-N-(3-N'-(2'-chlorphenyl)-carb-
amoyl)-phenyl)-carbamat Methyl-N-(3-(N'-(3'-chlorphenyl)-carbamoyloxy)-
phenyl)-carbamat Äthyl-N-(3-(N'-(3'-chlorphenyl)-carbamoyloxy)- phenyl)-carbamat
Methyl-N-(3-(N'-(4'-chlorphenyl)-carbamoyloxy)- phenyl)-carbamat
Äthyl-N-(3-(N'-(4'-chlorphenyl)-carbamoyloxy)- phenyl)-carbamat
n-Propyl-N-(3-(N'-(4'-chlorphenyl)-carbamoyloxy)- phenyl)-carbamat
n-Butyl-N-(3-(N'-(4'-chlorphenyl)-carbamoyloxy)- phenyl)-carbamat
Methyl-N-(3-(N'-(2'-methylphenyl)-carbamoyloxy)- phenyl)-carbamat
Äthyl-N-(3-(N'-(2'-methylphenyl)-carbamoyloxy)- phenyl)-carbamat
jS-Chloräthyl-N-(3-(N'-(2'-methylphenyl)-carb- amoyloxy)-phenyl)-carbamat
(3"-methylphenyl)-carbamoyloxy)-phenyl)-
carbamat
(4"-methylphenyl)-carbamoyloxy)-phenyl)- carbamat
(3"-trifluormethylphenyl)-carbamat
Athyl-N-(3-(N',N'-diathylcarbamoyloxy)-phenyl)-
carbamat
Äthyl-N-(3-(N',N'-pentamethylencarbamoyloxy)-
phenyl)-carbamat Äthyl-N-(3-(N'-methylcarbamoyloxy)-phenyl)-
carbamat
|3-Chloräthyl-N-(3-(N'-methylcarbamoyloxy)-
phenyl)-carbamat n-Propyl-N-(3-(N'-methylcarbamoyloxy)-phenyl)- carbamat
Physikalische
Konstante
Konstante
F. 117-1190C
F. 153-155°C
F. 127-128°C
F. 147° C
F. 138°C
F. 158-1600C
F. 126-127°C
F. 129-1300C
F. 138°C
F. 158-1600C
F. 126-127°C
F. 129-1300C
F. 140-141°C
F. 153-155°C
F. 153-155°C
F. 129-1300C so
F. 75-76°C
F. 103,5-105,5° C
F. 127-128°C
Verbin dung
Nr.
35
40
20
F. 116-1170C 21
10
22
23
F. 178° C 24
• 20
F. 150-1510C 25
26
27
28
29
30
45 31
32
33
55 34
F.131-132°C £ 35 60
36
65
F. 125-127°C 37
F. 125-127°C 37
Name der Verbindung
n-Butyl-N-(3-(N'-methylcarbamoyloxy)-phenyl)- carbamat
Methyl-N-(3-(N'-n-butylcarbamoyloxy)-phenyl- carbamat
Äthyl-N-(3-(N'-n-butylcarbamoyloxy)-phenyl)- carbamat
sek.-Butyl-N-(3-(N'-n-butylcarbamoyloxy)-phenyl)- carbamat
Methyl-N-(3-(N'-cycIohexylcarbamoyloxy)- phenyl)-carbamat
Äthyl-N-(3-(N'-cyclohexylcarbamoyloxy)- phenyl)-carbamat
i?-Chloräthyl-N-(3-(N'-cyclohexyl)-carbamoyloxy)-phenyl)-carbamat
n-Propyl-N^-iN'-cyclohexylcarbamoyloxy)-
phenyl)-carbamat
n-Butyl-N-(3-(N'-cyclohexylcarbamoyloxy)- phenyl)-carbamat
Äthyl-N-(3-(N/-(3'-methylphenyl)-carbamoyloxy)-
phenyl)-carbamat
/9-Chloräthyl-N-(3-(N'-(3
'-methylphenyl)-carbamoyloxy)-phenyl)-carbamat
Methyl-N-(3-(N'-(4'-methylphenyl)-carbaraoyloxy)-phenyl)-carbamat
Methyl-N-(3-(N'-(4'-methylphenyl)-carbaraoyloxy)-phenyl)-carbamat
Äthyl-N-(3-(N'-(4/-methyJ-phenyl)-carbamoyloxy)-
phenyl)-carbamat Äthyl-N-(3-(N'-(3'-trifluormethylphenyl)-carbamoyl-
oxy)-phenyl)-carbamat
/9-Chloräthyl-N-{3-(N'-(3'-trifluormethylphenyl)-carbamoyloxy)-phenyl)-carbamat
Butin-{l)-yl-(3)-N-(3'-(N'-methylcarbamoyloxy)-
phenyl)-carbamat Butin-(l)-yl-(3)-N-(3'-(N'-cyclohexylcarbamoyl-
oxy)-phenyl)-carbamat Butin-(l)-yl-{3)-N-(3',
(N'-phenylcarbamoyloxy)-phenyl)-carbamat
Physikalische Konstante
F. 111-112°C F. 114-115°C F. 99,5°C F. 142-143°C
F. 159-16PC F. 128°C
F. 147-148°C
F. 160°C F. 140-141°C F. 128-129°C
F. 118-119°C
F. 162-163,5°C
F. 147-148°C F. 13O-13l°C F. 132-133°C
F. 157-159° C
F. 146-147°C F. 164-166°C
Fortsetzung
| Ver bin dung Nr. |
Name der Verbindung | F. | Physikalische Konstante |
| 38 | Butin-(l)-yl-(3)-N-(3'-(N'- (2"-chlorphenyl)-carb- amoyloxy)-phenyl)- carbamat |
F. | 134-136°C |
| 39 | Butin-(l)-yl-(3)-N-(3'-(N'- (4"-chlorphenyl)-carb- amoyloxy)-phenyl)- carbamat |
F. | 153-155°C |
| 40 | Butin-(l)-yl-(3)-N-(3'-(N'- (2"-methylphenyl)-carb- amoyloxy)-phenyl)- carbamat |
F. | 155-156°C * |
| 41 | sek.-Butyl-N-QKN'-cyclo- hexylcarbamoyloxy)- phenyl)-carbamat |
F. | 149-150°C |
| 42 | Methyl-N-(3-(N'-phenyl- carbamoyloxy)-phenyl)- carbamat |
F. | 152° C |
| 43 | Äthyl-N-(3-(N'-phenyl- carbamoyloxy)-phenyl)- carbamat |
F. | 118-119°C |
| 44 | /J-Chloräthyl-N-(3- (N'-phenylcarbamoyloxy)- phenyl)-carbamat |
F. | 149-150°C |
| 45 | n- Propyl-N-(3-(N'-phenyl- carbamoyloxy)-phenyl)- carbamat |
F. | 125-126°C |
| 46 | Isopropyl-N-(3-(N'-phenyl- carbamoyloxy)-phenyl)- carbamat |
F. | 133-135°C |
| 47 | n-Butyl-N-(3-(N'-phenyl- carbamoyloxy)-phenyl)- carbamat |
F. | 145° C |
| 48 | sek.-Butyl-N-(3-(N'-phenyl- carbamoyloxy)-phenyl)- carbamat |
F. | 145-147°C |
| 49 | Methyl-N-(3-(N'-(2'-chlor- phenyl)-carbamoyloxy)- phenyl)-carbamat |
F. | 124-126°C |
| 50 | Methyl-N-(3-(N'- (3'-methylphenyl)- carbamoyloxy)-phenyl)- carbamat |
139-142°C | |
Insbesondere zeichnen sich die Verbindungen Nr. 3, 4, 5, 29, 31, 32, 33, 42, 43 und 50 als selektive Nachauflauf-Herbizide
für Zuckerrüben und die Verbindung Nr. 21 als ein selektives Nachauflauf-Herbizid
für Tomaten aus.
Die bisher nicht bekannten Verbindungen können beispielsweise nach folgenden Verfahren hergestellt
werden:
Durch Umsetzung von N-Hydroxyphenylurethanen der allgemeinen Formel
Il
NH — C — O — R3
mit
a) Isocyanaten der allgemeinen Formel
R1-N = C=O
in Gegenwart eines Katalysators, zweckmäßig einer organischen Base, bevorzugt Triäthylamin,
oder
b) Carbamidsäurechloriden der allgemeinen Formel
D O
V. ι
)N — C — Cl
in Gegenwart eines Säureakzeptors, zweckmäßig einer anorganischen oder organischen Base, bevorzugt
Pyridin, wobei R1, R2 und R3 die obengenannte
Bedeutung haben.
Die folgenden Beispiele erläutern die Herstellung der neuen Phenylcarbamate.
Methyl-N-(3-(N'-phenylcarbamoyloxy)-phenyl)-carbamat
16,7 g (0,1 Mol) Methyl-N-(3-hydroxyphenyl)-carbamat werden in 50 ml Tetrahydrofuran gelöst. Die
Lösung wird nach Zugabe von 0,5 ml Triäthylamin mit 12 ml (0,11 Mol) Phenylisocyanat versetzt. Nach
20 Stunden bei Zimmertemperatur erfolgt auf Zugabe von Leichtbenzin Kristallisation des Carbamats.
Ausbeute: 27,5 g = 96% der Theorie.
F. = 152°C.
Analyse für C15H14N2O4:
Berechnet ... C 62,90, H 4,93, N 9,78%;
gefunden .... C 62,62, H 5,00, N 9,69%.
gefunden .... C 62,62, H 5,00, N 9,69%.
Äthyl-N-(3-(N',N'-pentamethylencarbamoyloxy)-phenyl)-carbamat
14,5 g (0,08 Mol) Äthyl-N-(3-hydroxyphenyl)-carbamat werden in 30 ml trockenem Pyridin gelöst und
die Lösung mit 13,1 g (0,088 Mol) Piperidin-N-carbonsäurechlorid
versetzt. Nach 2 Stunden bei Zimmertemperatur wird 90 Minuten auf dem Dampfbad erhitzt. Anschließend wird das Pyridin im Vakuum
abgedampft und der Rückstand unter Eiszugabe in Äther und verdünnter Natronlauge aufgenommen.
Die ätherische Lösung wird der Reihe nach gewaschen mit Wasser, verdünnter Salzsäure, Wasser und verdünnter
KHCO3-Lösung, wobei durch Eiszugabe die Temperatur bei O0C gehalten wird. Nach dem Trocknen
mit Natriumsulfat und weitgehendem Abdampfen
des Äthers erfolgte auf Zugabe von Petroläther Kristallisation des Carbamats.
Ausbeute: 15,8 g = 68% der Theorie.
F. = 103,5 bis 105,5° C.
Ausbeute: 15,8 g = 68% der Theorie.
F. = 103,5 bis 105,5° C.
Analyse, berechnet für C15H20N2O4:
Berechnet ... C 61,65, H 6,90, N 9,59%;
gefunden .... C 61,18, H 7,00, N 9,56%.
gefunden .... C 61,18, H 7,00, N 9,56%.
Die für die Umsetzung als Ausgangsprodukte benötigten N-Hydroxyphenylurethane, von denen einige
in der Literatur noch nicht beschrieben sind, lassen sich in an sich bekannter Weise z. B. durch N-Acylierung
von m-Aminophenol mit entsprechenden Chlorameisensäureestern,
z. B. in einem Essigester/Wasser-Gemisch unter Zusatz von Magnesiumoxyd, erhalten.
Im folgenden wird die Herstellung eines der Ausgangsprodukte beschrieben:
21,8 g (0,2 Mol) m-Aminophenol und 5 g Magnesiumoxyd werden in 70 ml Wasser und 70 ml Essigester
aufgenommen. Unter Kühlung auf 10 bis 15°C läßt man dann unter Rühren 26,5 g (0,2 Mol) Chlorameisensäurebutin-(l)-yl-(3)-ester
eintropfen und rührt 30 Minuten bei Zimmertemperatur nach. Anschließend wird das überschüssige Magnesiumoxyd
in verdünnter Salzsäure gelöst und die organische Phase mit wenig Wasser sowie anschließend mit verdünnter
Kaliumbicarbonat-Lösung neutral gewaschen. Nach dem Trocknen mit Natriumsulfat und Abdampfen
des Essigesters im Vakuum erfolgt die Reinigung des Rohprodukts durch Lösen in wenig
Äther, Filtrieren der ätherischen Lösung und Auskristallisieren des Butin-(l)-yl-(3)-N-(3-hydroxyphenyl)-carbamats
durch Zugabe von Leichtbenzin.
Ausbeute: 34 g = 83% der Theorie.
F. = 94bis95°C.
Analyse, berechnet für Q1H11NO3:
Berechnet ... C 64,38, H 5,40, N 6,83%;
gefunden .... C 64,23, H 5,59, N 6,90%.
Nach dem gleichen Verfahren lassen sich auch die anderen, als Ausgangsprodukte erforderlichen N-Hydroxyphenylurethane
herstellen, von denen einige in der folgenden Tabelle aufgeführt sind:
Methyl-N-(3-hydroxyphenyl)-
carbamat F. 94-95°C
Äthyl-N-(3-hydroxyphenyl)-
carbamat F. 94-95°C
n-Propyl-N-(3-hydroxy-
phenyl)-carbamat F. 71-73°C
Isopropyl-N-(3-hydroxy-
phenyl)-carbamat F. 75-76°C
n-Butyl-N-(3-hydroxy-
phenyl)-carbamat F. 87-88°C
sek.-Butyl-N-(3-hydroxy-
phenyl)-carbamat F. 115,5-116,5° C
/?-Chloräthyl-N-(3-hydroxy-
phenyO-carbamat F. 87,5°C
Die erfindungsgemäßen Verbindungen können allein oder als Mischungen untereinander und/oder mit
anderen Herbiziden und/oder sonstigen Stoffen, z. B. Düngemitteln, angewandt werden.
Die Anwendung der erfindungsgemäßen Verbindüngen erfolgt zweckmäßig in einer für eine Unkrautbekämpfung
üblichen Weise in Form von Zubereitungen, wie z. B. Pulvern, Streumitteln, Granulaten,
Lösungen, Emulsionen oder Suspensionen, unter Zusatz von flüssigen und/oder festen Trägerstoffen
bzw. Verdünnungsmitteln und gegebenenfalls von Netz-, Haft-.. Emulgier- und/oder Dispergierhilfsmitteln.
Die Herstellung der verschiedenen Zubereitungsformen erfolgt in an sich bekannter Art und Weise,
z. B. durch Mahl- bzw. Mischverfahren.
Zur selektiven Unkrautbekämpfung haben sich zum Teil schon Aufwandmengen von etwa 0,3 kg
Wirksubstanz/ha an als ausreichend erwiesen.
Die herbizide Wirkung der erfindungsgemäßen Verbindungen geht aus den folgenden Versuchsbeispielen hervor.
Im Gewächshaus wurden die in der Tabelle aufgeführten Verbindungen in einer Aufwandmenge von
10 kg Wirksubstanz/ha, suspendiert in 8001 Wasser/ha,
auf Senf und Tomaten als Testpflanzen gespritzt. Im Gegensatz zum Vergleichsmittel Isopropyl-N-phenylcarbamat
wurde eine Vernichtung der Testpflanzen erreicht.
| Verbindung Nr. | Sen Γ | Tomaten |
| 1 | 0 | 1 |
| 2 | 0 | 1 |
| 3 | 0 | 0 |
| 4 | 0 | 0 |
| 5 | 0 | 5 |
| 6 | 0 | 1 |
| 7 | 0 | 7 |
| 8 | 0 | 7 |
| 9 | 0 | 0 |
| 10 | 1 | 9 |
| 11 | 0 | 3 |
| 12 | 0 | 2 |
| 13 | 0 | 1 |
| 14 | 0 | 1 |
| 15 | 0 | 0 |
| 16 | 0 | 0 |
| 17 | 0 | 0 |
| 18 | 1 | 7 |
| 19 | 0 | 1 |
| 20 | 0 | 0 |
| 21 | 0 | 1 |
| 22 | 0 | 0 |
| 23 | 0 | 6 |
| 24 | 0 | 0 |
| ' 25 | 0 | 0 |
| 26 | 1 | 1 |
| 27 | 0 | 5 |
| 28 | 0 | 7 |
| 29 | 0 | 0 |
| 30 | 0 | 1 |
| 31 | 0 | 1 |
| 32 | 0 | 0 |
| 33 | 0 | 0 |
| 34 | 0 | 1 |
| 35 | 1 | 4 |
| 36 | 0 | 0 |
| 37 | 0 | 1 · |
0 = Total vernichtet.
10 = Keine Wirkung.
10 = Keine Wirkung.
309529/542
Fortsetzung
| Verbindung Nr. | Senf | Tomaten |
| 38 | 0 | 1 |
| 39 | 0 | 1 |
| 40 | 0 | 0 |
| 41 | 1 | 4 |
| 42 | 0 | 0 |
| 43 | 0 | 0 |
| 44 | 0 | ■ ι |
| 45 | 0 | 1 |
| 46 | 0 | 2 |
0 = Total vernichtet.
10 = Keine Wirkung.
10 = Keine Wirkung.
| Verbindung Nr. | Senf | Tomaten |
| 47 | 0 | 1 |
| 5 48 | 0 | 1 |
| 49 | 0 | 2 |
| 50 | 0 | 0 |
| Isopropyl- | ||
| I0 N-phenyl- | ||
| carbamat | 7 | 8 |
| (gemäß | ||
| deutscher | ||
| Patentschrift | ||
| I5 833 274) |
0 = Total vernichtet.
10 = Keine Wirkung.
10 = Keine Wirkung.
Im Gewächshaus bei gezielter Unkrautvernichtung im Keimblattstadium von Kulturpflanzen und Unkräutern
wurden die in der Tabelle aufgeführten
die nachstehenden Pflanzenarten gespritzt. Wie aus den Ergebnissen ersichtlich ist, besitzt das Vergleichsmittel Isopropyl-N-(3-c!ilorphenyl)-carbamat nur eine
Verbindungen in einer Aufwandmenge von 1 kg 25 geringe Wirkung im Vergleich zu den erfindungs-Wirksubstanz/ha,
suspendiert in 800 1 Wasser/ha, auf gemäßen Mitteln.
| Verbindung Nr. | Erbsen | Zucker rüben |
Möhren | Zwiebeln | Sinapis arvensis |
Solanum ssp. |
Varianella ssp. |
Stellaria media |
Galinsoga parvifiora |
Senecio vulgaris |
Matricaria chamo- milla |
| 3 | 10 | 10 | 10 | 10 | 1 | 2 | 0 | 4 | 4 | 1 | 5 |
| 4 | 10 | 10 | 10 | 10 | 0 | 0 | 0 | 1 | 2 | 0 | 1 |
| 9 | 10 | 10 | 10 | 10 | 4 | 10 | 1 | 4 | 2 | 3 | 1 |
| 20 | 10 | 0 | 10 | 10 | 1 | 1 | 0 | 0 | 0 | 0 | 0 |
| 21 | 10 | 5 | 7 | 10 | 0 | 1 | 0 | 0 | 0 | 0 | 0 |
| 22 | 10 | 4 | 7 | 10 | 0 | 4 | 0 | 0 | 0 | 0 | 0 |
| 24 | 10 | 7 | 7 | 10 | 0 | 3 | 0 | 0 | 0 | 1 | 0 |
| 25 | 10 | 0 | 10 | 10 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| 29 | 10 | 10 | 10 | 10 | 0 | 5 | 0 | 1 | 0 | 2 | 2 |
| 42 | 10 | 10 | 10 | 10 | 0 | 7 | 0 | 0 | 0 | 5 | 10 |
| 43 | 10 | 10 | 10 | 10 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| 50 | 10 | 10 | 10 | 10 | 0 | 4 | 0 | 0 | 0 | 0 | 0 |
| Isopropyl- | |||||||||||
| N-(3-chlor- | |||||||||||
| phenyl)- | |||||||||||
| carbamat | 7 | 10 | 10 | 10 | 5 | 10 | 10 | 7 | 10 | 10 | 10 |
| (gemäß | |||||||||||
| deutscher | |||||||||||
| Patentschrift | |||||||||||
| 833 274) |
0 = Total vernichtet.
10 = Keine Wirkung.
10 = Keine Wirkung.
B e i s ρ i e 1 5
Im Gewächshaus bei Behandlung vor dem Aufladen von Kulturpflanzen und Unkräutern wurden die
der erfindungsgemäßen Mittel gegen hartnäckige Unkrautarten, wie Franzosenkraut (Galinsoga parvi-
aufgeführten Verbindungen in einer Aufwandmenge 65 flora), Kreuzkraut (Senecio vulgaris) und Kamille
von 0,3 kg Wirksubstanz/ha, suspendiert in 8001 Wasser/ha, auf unbewachsenen Sandboden gespritzt.
Die Ergebnisse machen deutlich die bessere Wirkung
(Matricaria chamoilla), die durch das Vergleichsmittel Isopropyl-N-(3-chlorphenyl)-carbamat nicht bekämpfbar
sind.
| Verbindung Nr. | Erbsen | Zucker rüben |
Möhren | Zwiebeln | Sinapis arvensis |
Solanum ssp. |
Varianella ssp. |
Stellaria media |
Galinsoga parviflora |
Senecio vulgaris |
Matricaria
chamo- milla |
| 21 | 10 | 10 | 10 | 10 | 4 | 10 | 10 | 0 | 1 | 1 | 1 |
| 24 | 10 | 0 | 10 | 4 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| 25 | 10 | 10 | 10 | 10 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| Isopropyl- | |||||||||||
| N-(3-chlor- | |||||||||||
| phenyl)- | |||||||||||
| carbaraat | 10 | 10 | 10 | 10 | 10 | 0 | 10 | 0 | 10 | 10 | 10 |
| (gemäß | |||||||||||
| deutscher | |||||||||||
| Patentschrift | |||||||||||
| 833 274) | |||||||||||
| 0 = Total vernichtet. | |||||||||||
| 10 = Keine Wirkung. |
Claims (1)
1. Diurethane der allgemeinen Formel
O Ώ
O Ώ
Il /Rl
O —C —N<
■*
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DESC036854 | 1965-04-09 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1567151A1 DE1567151A1 (de) | 1969-07-03 |
| DE1567151B2 true DE1567151B2 (de) | 1973-07-19 |
| DE1567151C3 DE1567151C3 (de) | 1974-02-21 |
Family
ID=7434030
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1567151A Expired DE1567151C3 (de) | 1965-04-09 | 1965-04-09 | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie diese enthaltende herbizide Mittel |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3692820A (de) |
| BE (1) | BE679283A (de) |
| CH (1) | CH478100A (de) |
| DE (1) | DE1567151C3 (de) |
| DK (1) | DK107793C (de) |
| FI (1) | FI40592B (de) |
| FR (1) | FR1475241A (de) |
| GB (1) | GB1127050A (de) |
| IL (1) | IL25420A (de) |
| LU (1) | LU50853A1 (de) |
| MY (1) | MY6900350A (de) |
| NL (1) | NL146798B (de) |
| NO (1) | NO115194B (de) |
Families Citing this family (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3450745A (en) * | 1966-01-18 | 1969-06-17 | Union Carbide Corp | Alkyl and aryl 4-(methylcarbamoyloxy) carbanilates |
| DE1567164C2 (de) * | 1966-09-10 | 1985-03-07 | Schering AG, 1000 Berlin und 4709 Bergkamen | Herbizide Mittel auf Basis von N-Carbamoyloxyphenyl-Carbamaten |
| US3898075A (en) * | 1970-01-20 | 1975-08-05 | Freund Heinz Eberhard | Stabilized liquid compositions |
| DE2020729C2 (de) * | 1970-04-23 | 1983-04-21 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Herbizide Mittel auf Basis von N-(3-(N'-Aryl-carbamoyloxy)-phenyl)-carbamaten |
| US4076518A (en) * | 1970-08-20 | 1978-02-28 | Schering Aktiengesellschaft | Substituted phenyl thiocarbamates with herbicidal action and method for their production |
| US3904396A (en) * | 1971-03-23 | 1975-09-09 | Schering Ag | Herbicidal mixture of several carbamoyloxyphenylcarbamates |
| DE2121958C3 (de) * | 1971-04-27 | 1981-05-27 | Schering Ag Berlin Und Bergkamen, 1000 Berlin | Herbizide Mittel auf Basis von Carbamoyloxyphenylcarbamat-Gemischen |
| US3935001A (en) * | 1972-04-13 | 1976-01-27 | Basf Aktiengesellschaft | Herbicide mixtures of uracil, a carbamate and a pyridazone |
| US3938984A (en) * | 1972-04-13 | 1976-02-17 | Basf Aktiengesellschaft | Herbicide |
| DE2217698A1 (de) * | 1972-04-13 | 1973-10-18 | Basf Ag | Herbizid |
| US3933465A (en) * | 1972-04-13 | 1976-01-20 | Badische Anilin- & Soda-Fabrik Aktiengesellschaft | Herbicide mixtures of 2-ethoxy-2,3-dihydro-3,3-dimethyl-5-benzofuranylmethane sulfonate |
| DE2413933A1 (de) * | 1974-03-20 | 1975-09-25 | Schering Ag | Diurethane mit selektiver herbizider wirkung |
| DE2608473A1 (de) * | 1976-02-27 | 1977-09-01 | Schering Ag | N-methylcarbanilsaeure- eckige klammer auf 3-(aethoxycarbonylamino)-phenyl eckige klammer zu -ester als baumwollherbizides mittel |
| GR66157B (de) * | 1976-08-28 | 1981-01-20 | Basf Ag | |
| DE2650796A1 (de) | 1976-11-03 | 1978-05-11 | Schering Ag | Diurethane, verfahren zur herstellung dieser verbindungen sowie diese enthaltendes selektives herbizides mittel |
| DE2651526A1 (de) * | 1976-11-09 | 1978-05-18 | Schering Ag | Diurethane, verfahren zur herstellung dieser verbindungen sowie diese enthaltendes selektives herbizides mittel |
| DE2732848A1 (de) * | 1977-07-18 | 1979-02-08 | Schering Ag | Diurethane, herbizide mittel enthaltend diese verbindungen sowie verfahren zu ihrer herstellung |
| DE2819748C2 (de) * | 1978-05-02 | 1986-07-31 | Schering AG, 1000 Berlin und 4709 Bergkamen | N-Äthylcarbanilsäure-(3-methoxycarbonylamino)-phenylester, Verfahren zur Herstellung dieser Verbindung sowie diese enthaltendes selektives herbizides Mittel |
| DE2843691A1 (de) | 1978-10-04 | 1980-04-24 | Schering Ag | Diurethane, verfahren zur herstellung dieser verbindungen sowie diese enthaltende selektive herbizide mittel |
| DE2901658A1 (de) | 1979-01-15 | 1980-07-24 | Schering Ag | Diurethane, verfahren zur herstellung dieser verbindungen sowie diese enthaltende herbizide mittel |
| DE3024583A1 (de) * | 1980-06-28 | 1982-02-04 | Basf Ag, 6700 Ludwigshafen | Carbonylaminourethane und diese enthaltende herbizide und fungizide |
| US4381196A (en) * | 1981-04-20 | 1983-04-26 | Stauffer Chemical Company | O-(Substituted phenyl) N-methylcarbamates as herbicide extenders |
| US4381195A (en) * | 1981-04-20 | 1983-04-26 | Stauffer Chemical Company | N-Methylcarbamoyloxy anilides as herbicide extenders |
| AT374452B (de) * | 1982-08-30 | 1984-04-25 | Rhone Poulenc Agrochimie | Verfahren zur herstellung von phenmedipham |
| ES8604495A1 (es) * | 1983-09-20 | 1986-02-01 | Koege Kemisk Vaerk | Un procedimiento para preparar fenil-carbamatos sustituidos |
| DE3338760A1 (de) | 1983-10-21 | 1985-05-02 | Schering AG, 1000 Berlin und 4709 Bergkamen | 2-phenoxypropionsaeurederivate von pentiten vom typ heterocyclischer aether, verfahren zur herstellung dieser verbindungen sowie diese enthaltende mittel mit herbizider wirkung |
| CZ156191A3 (en) * | 1984-02-29 | 1995-10-18 | Schering Ag | Stabilized liquid herbicidal agent and method of controlling weed |
| US5246912A (en) * | 1984-02-29 | 1993-09-21 | Berol Nobel (Suisse) S.A. | Herbicidal compositions of phenmedipham and desmedipham |
| US5651975A (en) * | 1991-09-27 | 1997-07-29 | Harju-Jeanty; Pontus | Method for the preparation of herbicidal granular products comprising two separate phases |
| FI952546A0 (fi) * | 1995-05-24 | 1995-05-24 | Kemira Agro Oy | Bekaempningsmedelspreparat och foerfaranden foer framstaellning av desamma |
| DE19605786A1 (de) | 1996-02-16 | 1997-08-21 | Hoechst Schering Agrevo Gmbh | Ölsuspensionskonzentrate |
| EP2052606A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| DE102008037620A1 (de) | 2008-08-14 | 2010-02-18 | Bayer Crop Science Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
| HRP20171866T4 (hr) | 2010-10-15 | 2021-11-26 | Bayer Intellectual Property Gmbh | Uporaba herbicida inhibitora als za kontrolu neželjene vegetacije kod biljaka beta vulgaris koje su razvile toleranciju na herbicide s inhibitorom als |
| WO2012150333A1 (en) | 2011-05-04 | 2012-11-08 | Bayer Intellectual Property Gmbh | Use of als inhibitor herbicides for control of unwanted vegetation in als inhibitor herbicide tolerant brassica, such as b. napus, plants |
| RS57806B2 (sr) | 2012-12-13 | 2022-07-29 | Bayer Cropscience Ag | Upotreba als inhibitora herbicida za kontrolu neželjene vegetacije kod beta vulgaris biljaka tolerantnih na als inhibitore herbicida |
| US20240401073A1 (en) | 2021-10-15 | 2024-12-05 | KWS SAAT SE & Co. KGaA | Als inhibitor herbicide tolerant beta vulgaris mutants |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3404975A (en) * | 1964-12-18 | 1968-10-08 | Fmc Corp | m-(carbamoyloxy)-carbanilates as herbicides |
-
1965
- 1965-04-09 DE DE1567151A patent/DE1567151C3/de not_active Expired
-
1966
- 1966-03-10 FI FI0610/66A patent/FI40592B/fi active
- 1966-03-18 IL IL25420A patent/IL25420A/xx unknown
- 1966-03-21 DK DK146466AA patent/DK107793C/da active
- 1966-04-01 GB GB14543/66A patent/GB1127050A/en not_active Expired
- 1966-04-01 CH CH481766A patent/CH478100A/de not_active IP Right Cessation
- 1966-04-01 NL NL666604363A patent/NL146798B/xx not_active IP Right Cessation
- 1966-04-05 NO NO162459A patent/NO115194B/no unknown
- 1966-04-07 FR FR56871A patent/FR1475241A/fr not_active Expired
- 1966-04-07 LU LU50853A patent/LU50853A1/xx unknown
- 1966-04-08 BE BE679283D patent/BE679283A/fr not_active IP Right Cessation
-
1969
- 1969-09-25 US US861198A patent/US3692820A/en not_active Expired - Lifetime
- 1969-12-31 MY MY1969350A patent/MY6900350A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE1567151A1 (de) | 1969-07-03 |
| FR1475241A (fr) | 1967-03-31 |
| CH478100A (de) | 1969-09-15 |
| DE1567151C3 (de) | 1974-02-21 |
| GB1127050A (en) | 1968-09-11 |
| LU50853A1 (de) | 1966-06-07 |
| IL25420A (en) | 1969-11-12 |
| BE679283A (de) | 1966-10-10 |
| NL6604363A (de) | 1966-10-10 |
| NL146798B (nl) | 1975-08-15 |
| DK107793C (da) | 1967-07-03 |
| MY6900350A (en) | 1969-12-31 |
| US3692820A (en) | 1972-09-19 |
| NO115194B (de) | 1968-08-26 |
| FI40592B (de) | 1968-11-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1567151C3 (de) | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie diese enthaltende herbizide Mittel | |
| DE2617804C2 (de) | 2-(4-Phenoxy phenoxy)-propionsäurederivate und ihre Verwendung als Herbizide | |
| DE1568621B2 (de) | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie diese enthaltende herbizide Mittel | |
| DE1567164C2 (de) | Herbizide Mittel auf Basis von N-Carbamoyloxyphenyl-Carbamaten | |
| DE2108975C3 (de) | N-Acyl-Diurethane sowie diese enthaltendes herbizides Mittel | |
| DE2812622C2 (de) | (2,3-Dihydro-2,2-dimethyl-benzofuran-7-yl-oxy-N-methyl-carbamoyl)-(N'-alkyl-carbamoyl)-sulfide, Verfahren zu deren Herstellung und diese Verbindungen enthaltende insektizide Mittel | |
| DE2928410A1 (de) | Acylharnstoffe, insektizide mittel enthaltend diese verbindungen sowie verfahren zu ihrer herstellung | |
| DE1593520C3 (de) | 3-(Carbamoyloxyphenyl)-harnstoffe bzw. -thioharnstoffe, diese enthaltende Mittel mit selektiver herbizider Wirkung sowie Verfahren zu deren Herstellung | |
| DE2341079C2 (de) | m-Diurethane und selektive herbizide Mittel enthaltend diese Verbindungen als Wirkstoffe | |
| DE2121957C3 (de) | Diurethane sowie diese enthaltende herbizide Mittel | |
| EP0010692A1 (de) | Neue m-Anilidurethane, sie enthaltende Herbizide und Verfahren zu deren Herstellung, sowie Verfahren zur Bekämpfung von unerwünschtem Pflanzenwuchs | |
| DE4326860C2 (de) | Fungizides Mittel mit synergistischer Wirkung | |
| CH641767A5 (de) | Carbanilsaeure-(3-(acylamino)-phenyl)-ester, verfahren zur herstellung dieser verbindungen sowie diese enthaltendes herbizides mittel. | |
| DE2310648C3 (de) | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie diese enthaltende selektive herbizide Mittel | |
| DE2310649C3 (de) | Diurethane sowie diese enthaltende selektive herbizide Mittel | |
| DE2843691A1 (de) | Diurethane, verfahren zur herstellung dieser verbindungen sowie diese enthaltende selektive herbizide mittel | |
| DE1242936B (de) | Selektive Herbizide | |
| DE2042110C3 (de) | Substituierte Phenylthionocarbamate, Verfahren zu ihrer Herstellung und solche Carbamate enthaltende herbizide Mittel | |
| DE1567163C3 (de) | Diurethane, Verfahren zur Herstellung dieser Verbindungen sowie herbizide und algizide Mittel enthaltend diese Verbindungen | |
| DE1793751A1 (de) | Substituierte phenylcarbamate, herbizide mittel enthaltend diese verbindungen als wirkstoffe sowie verfahren zur herstellung dieser verbindungen | |
| AT275961B (de) | Herbizide Mittel mit verstärkter Wirksamkeit | |
| DE1913043C3 (de) | Substituierte Phenylcarbamate | |
| DE1793752C3 (de) | Diurethane sowie diese enthaltende herbizide Mittel | |
| CH645344A5 (de) | N-(2-propinyl)-carbanilsaeure-(3-methoxycarbonylaminophenyl)-ester, verfahren zur herstellung dieser verbindungen sowie diese enthaltende selektive herbizide mittel. | |
| DE2725146A1 (de) | Diurethane und herbizide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |