DE1544563C3 - - Google Patents
Info
- Publication number
- DE1544563C3 DE1544563C3 DE1544563A DE1544563A DE1544563C3 DE 1544563 C3 DE1544563 C3 DE 1544563C3 DE 1544563 A DE1544563 A DE 1544563A DE 1544563 A DE1544563 A DE 1544563A DE 1544563 C3 DE1544563 C3 DE 1544563C3
- Authority
- DE
- Germany
- Prior art keywords
- aniline
- dibromo
- bromo
- amino
- methylpyrrolidone
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000987 azo dye Substances 0.000 claims description 20
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 11
- 238000002360 preparation method Methods 0.000 claims description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 149
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 48
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 47
- 239000000975 dye Substances 0.000 description 33
- 238000006243 chemical reaction Methods 0.000 description 22
- 239000007795 chemical reaction product Substances 0.000 description 19
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 18
- 239000000460 chlorine Substances 0.000 description 17
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 16
- 239000000047 product Substances 0.000 description 16
- -1 Cyano- Chemical class 0.000 description 14
- 244000172533 Viola sororia Species 0.000 description 13
- 239000010979 ruby Substances 0.000 description 11
- 229910001750 ruby Inorganic materials 0.000 description 11
- YMZIFDLWYUSZCC-UHFFFAOYSA-N 2,6-dibromo-4-nitroaniline Chemical compound NC1=C(Br)C=C([N+]([O-])=O)C=C1Br YMZIFDLWYUSZCC-UHFFFAOYSA-N 0.000 description 10
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical compound [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 description 10
- RFPZFFIPFKMAIP-UHFFFAOYSA-N 4-amino-5-bromobenzene-1,3-dicarbonitrile Chemical compound NC1=C(Br)C=C(C#N)C=C1C#N RFPZFFIPFKMAIP-UHFFFAOYSA-N 0.000 description 9
- 230000008878 coupling Effects 0.000 description 9
- 238000010168 coupling process Methods 0.000 description 9
- 238000005859 coupling reaction Methods 0.000 description 9
- 150000002367 halogens Chemical class 0.000 description 9
- 150000002825 nitriles Chemical class 0.000 description 9
- 229910052801 chlorine Inorganic materials 0.000 description 8
- 229910052736 halogen Inorganic materials 0.000 description 8
- 239000003973 paint Substances 0.000 description 8
- 125000001424 substituent group Chemical group 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- ZYECOAILUNWEAL-NUDFZHEQSA-N (4z)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-n-(3-nitrophenyl)-3-oxonaphthalene-2-carboxamide Chemical compound COC1=CC=C(C(=O)NC=2C=CC=CC=2)C=C1N\N=C(C1=CC=CC=C1C=1)/C(=O)C=1C(=O)NC1=CC=CC([N+]([O-])=O)=C1 ZYECOAILUNWEAL-NUDFZHEQSA-N 0.000 description 7
- ATDIROHVRVQMRO-UHFFFAOYSA-N 2,6-dibromo-4-methylaniline Chemical compound CC1=CC(Br)=C(N)C(Br)=C1 ATDIROHVRVQMRO-UHFFFAOYSA-N 0.000 description 7
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 7
- 125000001246 bromo group Chemical group Br* 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 6
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 6
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 6
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- CEKVGQOFHYOXSE-UHFFFAOYSA-N methyl 4-amino-3,5-dibromobenzoate Chemical compound COC(=O)C1=CC(Br)=C(N)C(Br)=C1 CEKVGQOFHYOXSE-UHFFFAOYSA-N 0.000 description 6
- UWIGJWZPRNWPBK-UHFFFAOYSA-N 4-amino-3,5-dibromobenzonitrile Chemical compound NC1=C(Br)C=C(C#N)C=C1Br UWIGJWZPRNWPBK-UHFFFAOYSA-N 0.000 description 5
- 235000005811 Viola adunca Nutrition 0.000 description 5
- 240000009038 Viola odorata Species 0.000 description 5
- 235000013487 Viola odorata Nutrition 0.000 description 5
- 235000002254 Viola papilionacea Nutrition 0.000 description 5
- 125000001309 chloro group Chemical group Cl* 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- FPUKYOSOAAPHTN-UHFFFAOYSA-N n-[3-(diethylamino)phenyl]acetamide Chemical compound CCN(CC)C1=CC=CC(NC(C)=O)=C1 FPUKYOSOAAPHTN-UHFFFAOYSA-N 0.000 description 5
- ROOYXYKMLWEXIU-UHFFFAOYSA-N (4-amino-3,5-dibromophenyl)-phenylmethanone Chemical compound C1=C(Br)C(N)=C(Br)C=C1C(=O)C1=CC=CC=C1 ROOYXYKMLWEXIU-UHFFFAOYSA-N 0.000 description 4
- XEYLQXUJSOJWJV-UHFFFAOYSA-N 2,6-dibromo-4-chloroaniline Chemical compound NC1=C(Br)C=C(Cl)C=C1Br XEYLQXUJSOJWJV-UHFFFAOYSA-N 0.000 description 4
- KWMDHCLJYMVBNS-UHFFFAOYSA-N 2-bromo-4,6-dinitroaniline Chemical compound NC1=C(Br)C=C([N+]([O-])=O)C=C1[N+]([O-])=O KWMDHCLJYMVBNS-UHFFFAOYSA-N 0.000 description 4
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical class [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 4
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 241001387976 Pera Species 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 238000004949 mass spectrometry Methods 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- GVPODVKBTHCGFU-UHFFFAOYSA-N 2,4,6-tribromoaniline Chemical compound NC1=C(Br)C=C(Br)C=C1Br GVPODVKBTHCGFU-UHFFFAOYSA-N 0.000 description 3
- CNSTWVXFFAFKFG-UHFFFAOYSA-N 2,6-dibromo-4-methylsulfonylaniline Chemical compound CS(=O)(=O)C1=CC(Br)=C(N)C(Br)=C1 CNSTWVXFFAFKFG-UHFFFAOYSA-N 0.000 description 3
- MUHLVSZIVTURCZ-UHFFFAOYSA-N 2-amino-3-bromo-5-nitrobenzonitrile Chemical compound NC1=C(Br)C=C([N+]([O-])=O)C=C1C#N MUHLVSZIVTURCZ-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000012954 diazonium Substances 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- PEMGGJDINLGTON-UHFFFAOYSA-N n-(3-aminophenyl)acetamide Chemical compound CC(=O)NC1=CC=CC(N)=C1 PEMGGJDINLGTON-UHFFFAOYSA-N 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- GETTZEONDQJALK-UHFFFAOYSA-N (trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC=C1 GETTZEONDQJALK-UHFFFAOYSA-N 0.000 description 2
- LBUJPTNKIBCYBY-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline Chemical compound C1=CC=C2CCCNC2=C1 LBUJPTNKIBCYBY-UHFFFAOYSA-N 0.000 description 2
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 2
- AVYGCQXNNJPXSS-UHFFFAOYSA-N 2,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC=C1Cl AVYGCQXNNJPXSS-UHFFFAOYSA-N 0.000 description 2
- VOWZNBNDMFLQGM-UHFFFAOYSA-N 2,5-dimethylaniline Chemical compound CC1=CC=C(C)C(N)=C1 VOWZNBNDMFLQGM-UHFFFAOYSA-N 0.000 description 2
- JIZVMILRYBKPFN-UHFFFAOYSA-N 2,6-dibromo-4-methoxyaniline Chemical compound COC1=CC(Br)=C(N)C(Br)=C1 JIZVMILRYBKPFN-UHFFFAOYSA-N 0.000 description 2
- XIRRDAWDNHRRLB-UHFFFAOYSA-N 2,6-dibromoaniline Chemical compound NC1=C(Br)C=CC=C1Br XIRRDAWDNHRRLB-UHFFFAOYSA-N 0.000 description 2
- GZCPEUOCUUNCLZ-UHFFFAOYSA-N 2-(3-methylanilino)ethanol Chemical compound CC1=CC=CC(NCCO)=C1 GZCPEUOCUUNCLZ-UHFFFAOYSA-N 0.000 description 2
- XVYNBLCPQVDRCH-UHFFFAOYSA-N 2-amino-3-chloro-5-nitrobenzonitrile Chemical compound NC1=C(Cl)C=C([N+]([O-])=O)C=C1C#N XVYNBLCPQVDRCH-UHFFFAOYSA-N 0.000 description 2
- MWGATWIBSKHFMR-UHFFFAOYSA-N 2-anilinoethanol Chemical compound OCCNC1=CC=CC=C1 MWGATWIBSKHFMR-UHFFFAOYSA-N 0.000 description 2
- HDXNPIRMUMFLIC-UHFFFAOYSA-N 2-bromo-4,6-dimethoxyaniline Chemical compound COC1=CC(Br)=C(N)C(OC)=C1 HDXNPIRMUMFLIC-UHFFFAOYSA-N 0.000 description 2
- YOSJCQJJIHEUKA-UHFFFAOYSA-N 2-bromo-4,6-dimethylaniline Chemical compound CC1=CC(C)=C(N)C(Br)=C1 YOSJCQJJIHEUKA-UHFFFAOYSA-N 0.000 description 2
- GLUCALKKMFBJEB-UHFFFAOYSA-N 2-bromo-6-chloro-4-nitroaniline Chemical compound NC1=C(Cl)C=C([N+]([O-])=O)C=C1Br GLUCALKKMFBJEB-UHFFFAOYSA-N 0.000 description 2
- QYLWEPIKPMUYAW-UHFFFAOYSA-N 2-bromo-6-methoxy-4-nitroaniline Chemical compound COC1=CC([N+]([O-])=O)=CC(Br)=C1N QYLWEPIKPMUYAW-UHFFFAOYSA-N 0.000 description 2
- LOCWBQIWHWIRGN-UHFFFAOYSA-N 2-chloro-4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1Cl LOCWBQIWHWIRGN-UHFFFAOYSA-N 0.000 description 2
- WFNLHDJJZSJARK-UHFFFAOYSA-N 2-chloro-6-methylaniline Chemical compound CC1=CC=CC(Cl)=C1N WFNLHDJJZSJARK-UHFFFAOYSA-N 0.000 description 2
- BHNHHSOHWZKFOX-UHFFFAOYSA-N 2-methyl-1H-indole Chemical compound C1=CC=C2NC(C)=CC2=C1 BHNHHSOHWZKFOX-UHFFFAOYSA-N 0.000 description 2
- VWYQFZKTKAMCLU-UHFFFAOYSA-N 4-amino-3,5-dibromobenzoic acid Chemical compound NC1=C(Br)C=C(C(O)=O)C=C1Br VWYQFZKTKAMCLU-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical group [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 2
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 241000092161 Pithys Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 125000004442 acylamino group Chemical group 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- 239000001049 brown dye Substances 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- BIXZHMJUSMUDOQ-UHFFFAOYSA-N dichloran Chemical compound NC1=C(Cl)C=C([N+]([O-])=O)C=C1Cl BIXZHMJUSMUDOQ-UHFFFAOYSA-N 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229940113088 dimethylacetamide Drugs 0.000 description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- UETZVSHORCDDTH-UHFFFAOYSA-N iron(2+);hexacyanide Chemical compound [Fe+2].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] UETZVSHORCDDTH-UHFFFAOYSA-N 0.000 description 2
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- SJWQCBCAGCEWCV-UHFFFAOYSA-N n-(3-amino-4-methoxyphenyl)acetamide Chemical compound COC1=CC=C(NC(C)=O)C=C1N SJWQCBCAGCEWCV-UHFFFAOYSA-N 0.000 description 2
- 125000002560 nitrile group Chemical group 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 150000003462 sulfoxides Chemical class 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- ZINRVIQBCHAZMM-UHFFFAOYSA-N 1-Amino-2,4-dibromoanthraquinone Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(Br)=CC(Br)=C2N ZINRVIQBCHAZMM-UHFFFAOYSA-N 0.000 description 1
- MVRDXWVWKOUPDO-UHFFFAOYSA-N 1-amino-2-bromoanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC(Br)=C2N MVRDXWVWKOUPDO-UHFFFAOYSA-N 0.000 description 1
- WENXBAFANCRIGK-UHFFFAOYSA-N 1-bromonaphthalen-2-amine Chemical compound C1=CC=CC2=C(Br)C(N)=CC=C21 WENXBAFANCRIGK-UHFFFAOYSA-N 0.000 description 1
- XRVZENCDEZEWAE-UHFFFAOYSA-N 1-chloro-3-(n-ethylanilino)propan-2-ol Chemical compound ClCC(O)CN(CC)C1=CC=CC=C1 XRVZENCDEZEWAE-UHFFFAOYSA-N 0.000 description 1
- ZTSYGXLLTYTXCS-UHFFFAOYSA-N 1-chloronaphthalen-2-amine Chemical compound C1=CC=CC2=C(Cl)C(N)=CC=C21 ZTSYGXLLTYTXCS-UHFFFAOYSA-N 0.000 description 1
- BRPSAOUFIJSKOT-UHFFFAOYSA-N 2,3-dichloroaniline Chemical compound NC1=CC=CC(Cl)=C1Cl BRPSAOUFIJSKOT-UHFFFAOYSA-N 0.000 description 1
- GUMCAKKKNKYFEB-UHFFFAOYSA-N 2,4,5-trichloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C=C1Cl GUMCAKKKNKYFEB-UHFFFAOYSA-N 0.000 description 1
- NATVSFWWYVJTAZ-UHFFFAOYSA-N 2,4,6-trichloroaniline Chemical compound NC1=C(Cl)C=C(Cl)C=C1Cl NATVSFWWYVJTAZ-UHFFFAOYSA-N 0.000 description 1
- DYSRXWYRUJCNFI-UHFFFAOYSA-N 2,4-dibromoaniline Chemical compound NC1=CC=C(Br)C=C1Br DYSRXWYRUJCNFI-UHFFFAOYSA-N 0.000 description 1
- IGSFOXNHUBLZHU-UHFFFAOYSA-N 2,4-dichloro-5-methylaniline Chemical compound CC1=CC(N)=C(Cl)C=C1Cl IGSFOXNHUBLZHU-UHFFFAOYSA-N 0.000 description 1
- KQCMTOWTPBNWDB-UHFFFAOYSA-N 2,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C=C1Cl KQCMTOWTPBNWDB-UHFFFAOYSA-N 0.000 description 1
- WRTAZRGRFBCKBU-UHFFFAOYSA-N 2,5-dibromoaniline Chemical compound NC1=CC(Br)=CC=C1Br WRTAZRGRFBCKBU-UHFFFAOYSA-N 0.000 description 1
- JBXZCPXEYAEMJS-UHFFFAOYSA-N 2,5-dichloro-4-nitroaniline Chemical compound NC1=CC(Cl)=C([N+]([O-])=O)C=C1Cl JBXZCPXEYAEMJS-UHFFFAOYSA-N 0.000 description 1
- NAZDVUBIEPVUKE-UHFFFAOYSA-N 2,5-dimethoxyaniline Chemical compound COC1=CC=C(OC)C(N)=C1 NAZDVUBIEPVUKE-UHFFFAOYSA-N 0.000 description 1
- NKTOLZVEWDHZMU-UHFFFAOYSA-N 2,5-xylenol Chemical compound CC1=CC=C(C)C(O)=C1 NKTOLZVEWDHZMU-UHFFFAOYSA-N 0.000 description 1
- YWADYUWJRWZMSS-UHFFFAOYSA-N 2,6-dichloro-4-methoxyaniline Chemical compound COC1=CC(Cl)=C(N)C(Cl)=C1 YWADYUWJRWZMSS-UHFFFAOYSA-N 0.000 description 1
- HMUDNHJDRNNRIE-UHFFFAOYSA-N 2,6-dichloro-4-methylaniline Chemical compound CC1=CC(Cl)=C(N)C(Cl)=C1 HMUDNHJDRNNRIE-UHFFFAOYSA-N 0.000 description 1
- JMVVMLXAGZVYMB-UHFFFAOYSA-N 2,6-dichloro-4-methylsulfonylaniline Chemical compound CS(=O)(=O)C1=CC(Cl)=C(N)C(Cl)=C1 JMVVMLXAGZVYMB-UHFFFAOYSA-N 0.000 description 1
- JDMFXJULNGEPOI-UHFFFAOYSA-N 2,6-dichloroaniline Chemical compound NC1=C(Cl)C=CC=C1Cl JDMFXJULNGEPOI-UHFFFAOYSA-N 0.000 description 1
- IVHOSOFUEVLNPA-UHFFFAOYSA-N 2-(3,4-dihydro-2h-quinolin-1-yl)-n,n-dimethylethanamine Chemical compound C1=CC=C2N(CCN(C)C)CCCC2=C1 IVHOSOFUEVLNPA-UHFFFAOYSA-N 0.000 description 1
- PMRRSCWLXKOMSK-UHFFFAOYSA-N 2-(n-butylanilino)ethanol Chemical compound CCCCN(CCO)C1=CC=CC=C1 PMRRSCWLXKOMSK-UHFFFAOYSA-N 0.000 description 1
- HLJIIZLYKMQFSS-UHFFFAOYSA-N 2-(naphthalen-1-ylamino)ethanol Chemical compound C1=CC=C2C(NCCO)=CC=CC2=C1 HLJIIZLYKMQFSS-UHFFFAOYSA-N 0.000 description 1
- RIYSFSQPHCAGLS-UHFFFAOYSA-N 2-amino-3,5-dinitrobenzonitrile Chemical compound NC1=C(C#N)C=C([N+]([O-])=O)C=C1[N+]([O-])=O RIYSFSQPHCAGLS-UHFFFAOYSA-N 0.000 description 1
- OEVXGSUDJYKUQX-UHFFFAOYSA-N 2-aminobenzene-1,3-dicarbonitrile Chemical compound NC1=C(C#N)C=CC=C1C#N OEVXGSUDJYKUQX-UHFFFAOYSA-N 0.000 description 1
- RMGNBGBWXYMMCG-UHFFFAOYSA-N 2-bromo-3,4,6-trichloroaniline Chemical compound NC1=C(Cl)C=C(Cl)C(Cl)=C1Br RMGNBGBWXYMMCG-UHFFFAOYSA-N 0.000 description 1
- DTPADCOGQUOGHT-UHFFFAOYSA-N 2-bromo-4,6-dichloroaniline Chemical compound NC1=C(Cl)C=C(Cl)C=C1Br DTPADCOGQUOGHT-UHFFFAOYSA-N 0.000 description 1
- VFPKZASVVCBVMG-UHFFFAOYSA-N 2-bromo-4-methyl-6-nitroaniline Chemical compound CC1=CC(Br)=C(N)C([N+]([O-])=O)=C1 VFPKZASVVCBVMG-UHFFFAOYSA-N 0.000 description 1
- UVRRJILIXQAAFK-UHFFFAOYSA-N 2-bromo-4-methylaniline Chemical compound CC1=CC=C(N)C(Br)=C1 UVRRJILIXQAAFK-UHFFFAOYSA-N 0.000 description 1
- VTSOQYVBDQONBG-UHFFFAOYSA-N 2-bromo-4-nitro-6-(trifluoromethyl)aniline Chemical compound NC1=C(Br)C=C([N+]([O-])=O)C=C1C(F)(F)F VTSOQYVBDQONBG-UHFFFAOYSA-N 0.000 description 1
- CGPPWNTVTNCHDO-UHFFFAOYSA-N 2-bromo-4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1Br CGPPWNTVTNCHDO-UHFFFAOYSA-N 0.000 description 1
- LDUCMSVRKKDATH-UHFFFAOYSA-N 2-bromo-6-methylaniline Chemical compound CC1=CC=CC(Br)=C1N LDUCMSVRKKDATH-UHFFFAOYSA-N 0.000 description 1
- KKMOSYLWYLMHAL-UHFFFAOYSA-N 2-bromo-6-nitroaniline Chemical compound NC1=C(Br)C=CC=C1[N+]([O-])=O KKMOSYLWYLMHAL-UHFFFAOYSA-N 0.000 description 1
- AOPBDRUWRLBSDB-UHFFFAOYSA-N 2-bromoaniline Chemical compound NC1=CC=CC=C1Br AOPBDRUWRLBSDB-UHFFFAOYSA-N 0.000 description 1
- YEHNFUTUJAFCAW-UHFFFAOYSA-N 2-bromonaphthalen-1-amine Chemical compound C1=CC=C2C(N)=C(Br)C=CC2=C1 YEHNFUTUJAFCAW-UHFFFAOYSA-N 0.000 description 1
- LKAQFOKMMXWRRQ-UHFFFAOYSA-N 2-chloro-4,6-dimethylaniline Chemical compound CC1=CC(C)=C(N)C(Cl)=C1 LKAQFOKMMXWRRQ-UHFFFAOYSA-N 0.000 description 1
- XGYLSRFSXKAYCR-UHFFFAOYSA-N 2-chloro-4-methylaniline Chemical compound CC1=CC=C(N)C(Cl)=C1 XGYLSRFSXKAYCR-UHFFFAOYSA-N 0.000 description 1
- HPSCXFOQUFPEPE-UHFFFAOYSA-N 2-chloro-5-methylaniline Chemical compound CC1=CC=C(Cl)C(N)=C1 HPSCXFOQUFPEPE-UHFFFAOYSA-N 0.000 description 1
- VOTXWUCYIOPNNR-UHFFFAOYSA-N 2-chloro-6-nitroaniline Chemical compound NC1=C(Cl)C=CC=C1[N+]([O-])=O VOTXWUCYIOPNNR-UHFFFAOYSA-N 0.000 description 1
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 1
- UWIWGZCNYRBVJL-UHFFFAOYSA-N 2-chloronaphthalen-1-amine Chemical compound C1=CC=C2C(N)=C(Cl)C=CC2=C1 UWIWGZCNYRBVJL-UHFFFAOYSA-N 0.000 description 1
- GYFZMCLUPHXUDV-UHFFFAOYSA-N 2-ethoxy-5-methylaniline Chemical compound CCOC1=CC=C(C)C=C1N GYFZMCLUPHXUDV-UHFFFAOYSA-N 0.000 description 1
- KLLLJCACIRKBDT-UHFFFAOYSA-N 2-phenyl-1H-indole Chemical compound N1C2=CC=CC=C2C=C1C1=CC=CC=C1 KLLLJCACIRKBDT-UHFFFAOYSA-N 0.000 description 1
- ZTTPWPKJVSSSMW-UHFFFAOYSA-N 3-(n-benzylanilino)propanenitrile Chemical compound C=1C=CC=CC=1N(CCC#N)CC1=CC=CC=C1 ZTTPWPKJVSSSMW-UHFFFAOYSA-N 0.000 description 1
- KMGZOJSHGRNXOC-UHFFFAOYSA-N 3-(n-butylanilino)propanenitrile Chemical compound CCCCN(CCC#N)C1=CC=CC=C1 KMGZOJSHGRNXOC-UHFFFAOYSA-N 0.000 description 1
- ZLWISTXMEPFPSK-UHFFFAOYSA-N 3-[n-(2,3-dihydroxypropyl)anilino]propane-1,2-diol Chemical compound OCC(O)CN(CC(O)CO)C1=CC=CC=C1 ZLWISTXMEPFPSK-UHFFFAOYSA-N 0.000 description 1
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 1
- ODQSBWZDOSNPAH-UHFFFAOYSA-N 3-ethoxy-n,n-diethylaniline Chemical compound CCOC1=CC=CC(N(CC)CC)=C1 ODQSBWZDOSNPAH-UHFFFAOYSA-N 0.000 description 1
- WEZAHYDFZNTGKE-UHFFFAOYSA-N 3-ethoxyaniline Chemical compound CCOC1=CC=CC(N)=C1 WEZAHYDFZNTGKE-UHFFFAOYSA-N 0.000 description 1
- VFZOPOZDIBQSJG-UHFFFAOYSA-N 4-amino-2,5-dichlorobenzonitrile Chemical compound NC1=CC(Cl)=C(C#N)C=C1Cl VFZOPOZDIBQSJG-UHFFFAOYSA-N 0.000 description 1
- NKSCCIGPVOELNC-UHFFFAOYSA-N 4-amino-3,5-dibromo-n,n-dimethylbenzenesulfonamide Chemical compound CN(C)S(=O)(=O)C1=CC(Br)=C(N)C(Br)=C1 NKSCCIGPVOELNC-UHFFFAOYSA-N 0.000 description 1
- DLXJPWSYRLLYSV-UHFFFAOYSA-N 4-amino-3,5-dibromobenzenesulfonamide Chemical compound NC1=C(Br)C=C(S(N)(=O)=O)C=C1Br DLXJPWSYRLLYSV-UHFFFAOYSA-N 0.000 description 1
- DVZMRTJKNJKEGV-UHFFFAOYSA-N 4-amino-3,5-dichlorobenzenesulfonamide Chemical compound NC1=C(Cl)C=C(S(N)(=O)=O)C=C1Cl DVZMRTJKNJKEGV-UHFFFAOYSA-N 0.000 description 1
- COFNCCWGWXFACE-UHFFFAOYSA-N 4-amino-3,5-dichlorobenzonitrile Chemical compound NC1=C(Cl)C=C(C#N)C=C1Cl COFNCCWGWXFACE-UHFFFAOYSA-N 0.000 description 1
- POESQIHWIIWNJL-UHFFFAOYSA-N 4-amino-3-bromobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1Br POESQIHWIIWNJL-UHFFFAOYSA-N 0.000 description 1
- UWPJYQYRSWYIGZ-UHFFFAOYSA-N 5-aminonaphthalene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(N)=CC=CC2=C1 UWPJYQYRSWYIGZ-UHFFFAOYSA-N 0.000 description 1
- GDBANHJMXDZUNE-UHFFFAOYSA-N 5-hydroxynaphthalene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(O)=CC=CC2=C1 GDBANHJMXDZUNE-UHFFFAOYSA-N 0.000 description 1
- 239000005725 8-Hydroxyquinoline Substances 0.000 description 1
- SYMAOPXKWWZQIR-UHFFFAOYSA-N 8-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C(O)=CC=CC2=C1 SYMAOPXKWWZQIR-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 102100035861 Cytosolic 5'-nucleotidase 1A Human genes 0.000 description 1
- 101000802744 Homo sapiens Cytosolic 5'-nucleotidase 1A Proteins 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 241000530268 Lycaena heteronea Species 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 238000007080 aromatic substitution reaction Methods 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- ZPUCINDJVBIVPJ-LJISPDSOSA-N cocaine Chemical compound O([C@H]1C[C@@H]2CC[C@@H](N2C)[C@H]1C(=O)OC)C(=O)C1=CC=CC=C1 ZPUCINDJVBIVPJ-LJISPDSOSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 229910000366 copper(II) sulfate Inorganic materials 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical group [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- UMTFPTCPRUEQHM-UHFFFAOYSA-N dicyanolead Chemical compound N#C[Pb]C#N UMTFPTCPRUEQHM-UHFFFAOYSA-N 0.000 description 1
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 1
- 238000006471 dimerization reaction Methods 0.000 description 1
- QKIUAMUSENSFQQ-UHFFFAOYSA-N dimethylazanide Chemical compound C[N-]C QKIUAMUSENSFQQ-UHFFFAOYSA-N 0.000 description 1
- 229910001254 electrum Inorganic materials 0.000 description 1
- 239000010940 green gold Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 239000002932 luster Substances 0.000 description 1
- NCBZRJODKRCREW-UHFFFAOYSA-N m-anisidine Chemical compound COC1=CC=CC(N)=C1 NCBZRJODKRCREW-UHFFFAOYSA-N 0.000 description 1
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- QLNWXBAGRTUKKI-UHFFFAOYSA-N metacetamol Chemical compound CC(=O)NC1=CC=CC(O)=C1 QLNWXBAGRTUKKI-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- WKGMRNVMTBOZIS-UHFFFAOYSA-N methyl 2-amino-3-bromo-5-nitrobenzoate Chemical compound COC(=O)C1=CC([N+]([O-])=O)=CC(Br)=C1N WKGMRNVMTBOZIS-UHFFFAOYSA-N 0.000 description 1
- AJUXDFHPVZQOGF-UHFFFAOYSA-N n,n-dimethyl-1-naphthylamine Chemical compound C1=CC=C2C(N(C)C)=CC=CC2=C1 AJUXDFHPVZQOGF-UHFFFAOYSA-N 0.000 description 1
- XTXFAVHDQCHWCS-UHFFFAOYSA-N n-(3-amino-4-ethoxyphenyl)acetamide Chemical compound CCOC1=CC=C(NC(C)=O)C=C1N XTXFAVHDQCHWCS-UHFFFAOYSA-N 0.000 description 1
- ROKKABNPZRSHHY-UHFFFAOYSA-N n-(4-amino-2,5-dichlorophenyl)acetamide Chemical compound CC(=O)NC1=CC(Cl)=C(N)C=C1Cl ROKKABNPZRSHHY-UHFFFAOYSA-N 0.000 description 1
- SFMJNHNUOVADRW-UHFFFAOYSA-N n-[5-[9-[4-(methanesulfonamido)phenyl]-2-oxobenzo[h][1,6]naphthyridin-1-yl]-2-methylphenyl]prop-2-enamide Chemical compound C1=C(NC(=O)C=C)C(C)=CC=C1N1C(=O)C=CC2=C1C1=CC(C=3C=CC(NS(C)(=O)=O)=CC=3)=CC=C1N=C2 SFMJNHNUOVADRW-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 239000012434 nucleophilic reagent Substances 0.000 description 1
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 1
- 239000012430 organic reaction media Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229960003540 oxyquinoline Drugs 0.000 description 1
- 238000004816 paper chromatography Methods 0.000 description 1
- WXWCDTXEKCVRRO-UHFFFAOYSA-N para-Cresidine Chemical compound COC1=CC=C(C)C=C1N WXWCDTXEKCVRRO-UHFFFAOYSA-N 0.000 description 1
- 229960003742 phenol Drugs 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000001047 purple dye Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- QGKLPGKXAVVPOJ-UHFFFAOYSA-N pyrrolidin-3-one Chemical compound O=C1CCNC1 QGKLPGKXAVVPOJ-UHFFFAOYSA-N 0.000 description 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- LFAGQMCIGQNPJG-UHFFFAOYSA-N silver cyanide Chemical compound [Ag+].N#[C-] LFAGQMCIGQNPJG-UHFFFAOYSA-N 0.000 description 1
- 229940098221 silver cyanide Drugs 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 125000001174 sulfone group Chemical group 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- AWDBHOZBRXWRKS-UHFFFAOYSA-N tetrapotassium;iron(6+);hexacyanide Chemical compound [K+].[K+].[K+].[K+].[Fe+6].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] AWDBHOZBRXWRKS-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Substances CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
- UJMBCXLDXJUMFB-UHFFFAOYSA-K trisodium;5-oxo-1-(4-sulfonatophenyl)-4-[(4-sulfonatophenyl)diazenyl]-4h-pyrazole-3-carboxylate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)C1=NN(C=2C=CC(=CC=2)S([O-])(=O)=O)C(=O)C1N=NC1=CC=C(S([O-])(=O)=O)C=C1 UJMBCXLDXJUMFB-UHFFFAOYSA-K 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- GTLDTDOJJJZVBW-UHFFFAOYSA-N zinc cyanide Chemical compound [Zn+2].N#[C-].N#[C-] GTLDTDOJJJZVBW-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B67/00—Influencing the physical, e.g. the dyeing or printing properties of dyestuffs without chemical reactions, e.g. by treating with solvents grinding or grinding assistants, coating of pigments or dyes; Process features in the making of dyestuff preparations; Dyestuff preparations of a special physical nature, e.g. tablets, films
- C09B67/0033—Blends of pigments; Mixtured crystals; Solid solutions
- C09B67/0046—Mixtures of two or more azo dyes
- C09B67/0051—Mixtures of two or more azo dyes mixture of two or more monoazo dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19511544563 DE1544563A1 (de) | 1951-01-28 | 1951-01-28 | Verfahren zur Herstellung cyangruppenhaltiger Azofarbstoffe |
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19511544563 DE1544563A1 (de) | 1951-01-28 | 1951-01-28 | Verfahren zur Herstellung cyangruppenhaltiger Azofarbstoffe |
| DEF48455A DE1290915B (de) | 1966-02-17 | 1966-02-17 | Verfahren zum Faerben und Bedrucken von Fasermaterialien aus aromatischen Polyestern und Celluloseacetaten |
| DEF0048454 | 1966-02-17 | ||
| DEF0050456 | 1966-10-15 | ||
| DEF0051232 | 1967-01-12 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1544563A1 DE1544563A1 (de) | 1970-05-27 |
| DE1544563B2 DE1544563B2 (enExample) | 1974-05-16 |
| DE1544563C3 true DE1544563C3 (enExample) | 1975-01-23 |
Family
ID=27509889
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19511544563 Granted DE1544563A1 (de) | 1951-01-28 | 1951-01-28 | Verfahren zur Herstellung cyangruppenhaltiger Azofarbstoffe |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE1544563A1 (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2310745C3 (de) * | 1973-03-03 | 1981-11-05 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Azoverbindungen |
| DE2850706C3 (de) * | 1978-11-22 | 1982-02-25 | Bayer Ag, 5090 Leverkusen | Kationische Monoazofarbstoffe, Verfahren zu deren Herstellung und Verfahren zum Färben und Bedrucken |
| DE2937329A1 (de) * | 1979-09-14 | 1981-04-02 | Bayer Ag, 5090 Leverkusen | Azofarbstoffe sowie deren herstellung und verwendung |
| DE3245977A1 (de) * | 1981-12-21 | 1983-06-30 | Sandoz-Patent-GmbH, 7850 Lörrach | Azo-dispersionsfarbstoffe |
| DE4232557A1 (de) | 1992-09-29 | 1994-03-31 | Basf Ag | Verwendung von Pyridinfarbstoffen im textilen Bereich, Farbstoffmischungen, enthaltend Pyridinfarbstoffe, sowie Triazolopyridinfarbstoffe mit einem Thienylrest |
| DE19858997A1 (de) * | 1998-12-21 | 2000-06-29 | Dystar Textilfarben Gmbh & Co | Thermomigrierechte Azofarbstoffe |
-
1951
- 1951-01-28 DE DE19511544563 patent/DE1544563A1/de active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE1544563A1 (de) | 1970-05-27 |
| DE1544563B2 (enExample) | 1974-05-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2503714C3 (de) | Verfahren zur Herstellung von wasserlöslichen Azofarbstoffen | |
| DE1544563C3 (enExample) | ||
| DE2503791C2 (de) | Verfahren zur herstellung von verlackten azofarbstoffen | |
| DE2062717A1 (en) | Azo dyes - from 2,6-diaminopyridine derivatives | |
| DE1807642C3 (de) | Verfahren zur Herstellung von Dispersions-Monoazofarbstoffen | |
| DE1297259B (de) | Verfahren zur Herstellung von Farbstoffen | |
| DE2759103A1 (de) | Azofarbstoffe | |
| DE2513949A1 (de) | Azofarbstoffe | |
| CH639119A5 (de) | Azopigmente. | |
| DE2210074A1 (de) | Verfahren zur herstellung von oxazinfarbstoffen | |
| DE2302582A1 (de) | Wasserloesliche azofarbstoffe der diamino-pyrimidin-reihe | |
| DE2134896A1 (de) | Verfahren zur herstellung von cyangruppenhaltigen azofarbstoffen | |
| DE2531445A1 (de) | Wasserloesliche azofarbstoffe | |
| DE2516032C2 (de) | Verfahren zum Diazotieren aromatischer Amine | |
| DE2307169A1 (de) | Azofarbstoffe | |
| DE1544421B2 (de) | Verfahren zur herstellung wasserunloeslicher monoazofarbstoffe | |
| DE2509560A1 (de) | Verfahren zur herstellung von azoverbindungen | |
| DE2657218A1 (de) | Unsymmetrische xanthenfarbstoffe, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2015172A1 (de) | Verfahren zur Herstellung wasserunlöslicher Azofarbstoffe | |
| DE2603836B2 (de) | farbstoffen | |
| DE1794402C3 (de) | Wasserunlösliche Monoazofarbstoffe | |
| EP0213485B1 (de) | Verfahren zur Herstellung von Arylamino-nitro-phenyl-oxethylsulfonen | |
| DE2748978A1 (de) | Azofarbstoffe | |
| DE1794402B2 (de) | Wasserunloesliche monoazofarbstoffe | |
| DE1644126A1 (de) | Verfahren zur Herstellung wasserunloeslicher Monoazofarbstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |