DE1300569B - - Google Patents
Info
- Publication number
- DE1300569B DE1300569B DE19651300569D DE1300569DA DE1300569B DE 1300569 B DE1300569 B DE 1300569B DE 19651300569 D DE19651300569 D DE 19651300569D DE 1300569D A DE1300569D A DE 1300569DA DE 1300569 B DE1300569 B DE 1300569B
- Authority
- DE
- Germany
- Prior art keywords
- hai
- general formula
- optionally
- hydroxyl group
- chlorine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 claims description 19
- -1 aromatic carboxylic acid radical Chemical class 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 10
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 claims description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 7
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 7
- 238000006243 chemical reaction Methods 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000003277 amino group Chemical group 0.000 claims description 5
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical group [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 150000003335 secondary amines Chemical class 0.000 claims description 4
- 239000007868 Raney catalyst Substances 0.000 claims description 3
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 3
- 238000009833 condensation Methods 0.000 claims description 3
- 230000005494 condensation Effects 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 125000001153 fluoro group Chemical group F* 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 150000001735 carboxylic acids Chemical group 0.000 claims description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- AAIRFJAUVBLEJY-UHFFFAOYSA-N furan-2-ylmethanimine Chemical class N=CC1=CC=CO1 AAIRFJAUVBLEJY-UHFFFAOYSA-N 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- UTQIGSMBKHNNRC-UHFFFAOYSA-N NS(C(C=CC=C1C(O)=O)=C1NCC1=CC=CO1)(=O)=O Chemical class NS(C(C=CC=C1C(O)=O)=C1NCC1=CC=CO1)(=O)=O UTQIGSMBKHNNRC-UHFFFAOYSA-N 0.000 claims 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 230000007062 hydrolysis Effects 0.000 claims 1
- 238000006460 hydrolysis reaction Methods 0.000 claims 1
- 125000002924 primary amino group Chemical class [H]N([H])* 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 7
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 6
- DDRPCXLAQZKBJP-UHFFFAOYSA-N furfurylamine Chemical compound NCC1=CC=CO1 DDRPCXLAQZKBJP-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical class NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- XPFVYQJUAUNWIW-UHFFFAOYSA-N furfuryl alcohol Chemical compound OCC1=CC=CO1 XPFVYQJUAUNWIW-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 229910000510 noble metal Inorganic materials 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 150000003141 primary amines Chemical class 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- RNHDAKUGFHSZEV-UHFFFAOYSA-N 1,4-dioxane;hydrate Chemical compound O.C1COCCO1 RNHDAKUGFHSZEV-UHFFFAOYSA-N 0.000 description 1
- DNUTZBZXLPWRJG-UHFFFAOYSA-N 1-Piperidine carboxylic acid Chemical compound OC(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-N 0.000 description 1
- JGQKORRBYIBYOF-UHFFFAOYSA-N 2-(benzylamino)benzoic acid Chemical class OC(=O)C1=CC=CC=C1NCC1=CC=CC=C1 JGQKORRBYIBYOF-UHFFFAOYSA-N 0.000 description 1
- OTSQJSTZHBDLRW-UHFFFAOYSA-N 2-(pentylamino)benzoic acid Chemical class CCCCCNC1=CC=CC=C1C(O)=O OTSQJSTZHBDLRW-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- NSTREUWFTAOOKS-UHFFFAOYSA-N 2-fluorobenzoic acid Chemical class OC(=O)C1=CC=CC=C1F NSTREUWFTAOOKS-UHFFFAOYSA-N 0.000 description 1
- 241000272525 Anas platyrhynchos Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical class CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical class CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- 150000004753 Schiff bases Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 229940051881 anilide analgesics and antipyretics Drugs 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical class NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical compound C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000000894 saliuretic effect Effects 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0046263 | 1965-06-05 | ||
| DEF0047271 | 1965-09-24 | ||
| DEF0047648 | 1965-11-11 | ||
| DEF0047647 | 1965-11-11 | ||
| DEF0049102 | 1966-05-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1300569B true DE1300569B (enExample) | 1969-08-07 |
Family
ID=27512067
Family Applications (5)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19651272929D Pending DE1272929B (enExample) | 1965-06-05 | 1965-06-05 | |
| DE19651281449D Pending DE1281449B (enExample) | 1965-06-05 | 1965-09-24 | |
| DE19651300569D Pending DE1300569B (enExample) | 1965-06-05 | 1965-11-11 | |
| DE19651302132D Pending DE1302132B (enExample) | 1965-06-05 | 1965-11-11 | |
| DE19661277860D Pending DE1277860B (de) | 1965-06-05 | 1966-05-04 | Verfahren zur Herstellung von SuIfamylanthranilsäuren |
Family Applications Before (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19651272929D Pending DE1272929B (enExample) | 1965-06-05 | 1965-06-05 | |
| DE19651281449D Pending DE1281449B (enExample) | 1965-06-05 | 1965-09-24 |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19651302132D Pending DE1302132B (enExample) | 1965-06-05 | 1965-11-11 | |
| DE19661277860D Pending DE1277860B (de) | 1965-06-05 | 1966-05-04 | Verfahren zur Herstellung von SuIfamylanthranilsäuren |
Country Status (6)
| Country | Link |
|---|---|
| BE (1) | BE682141A (enExample) |
| CH (2) | CH459254A (enExample) |
| DE (5) | DE1272929B (enExample) |
| DK (1) | DK123406B (enExample) |
| FR (1) | FR1489135A (enExample) |
| SE (2) | SE322787B (enExample) |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1174797B (de) * | 1962-10-16 | 1964-07-30 | Hoechst Ag | Verfahren zur Herstellung von Sulfamylanthranilsaeuren |
| FR1396621A (fr) * | 1963-04-13 | 1965-04-23 | Hoechst Ag | Procédé de préparation d'acides sulfamyl-anthraniliques |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2175585A (en) * | 1936-04-14 | 1939-10-10 | Adkins Homer | Preparation of furfurylamines |
-
1965
- 1965-06-05 DE DE19651272929D patent/DE1272929B/de active Pending
- 1965-09-24 DE DE19651281449D patent/DE1281449B/de active Pending
- 1965-11-11 DE DE19651300569D patent/DE1300569B/de active Pending
- 1965-11-11 DE DE19651302132D patent/DE1302132B/de active Pending
-
1966
- 1966-05-04 DE DE19661277860D patent/DE1277860B/de active Pending
- 1966-05-31 CH CH1360767A patent/CH459254A/de unknown
- 1966-05-31 CH CH783466A patent/CH444880A/de unknown
- 1966-06-02 SE SE754066A patent/SE322787B/xx unknown
- 1966-06-02 SE SE1316368A patent/SE332995B/xx unknown
- 1966-06-03 DK DK288966A patent/DK123406B/da unknown
- 1966-06-06 BE BE682141D patent/BE682141A/xx unknown
- 1966-06-06 FR FR1489135D patent/FR1489135A/fr not_active Expired
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1174797B (de) * | 1962-10-16 | 1964-07-30 | Hoechst Ag | Verfahren zur Herstellung von Sulfamylanthranilsaeuren |
| FR1396621A (fr) * | 1963-04-13 | 1965-04-23 | Hoechst Ag | Procédé de préparation d'acides sulfamyl-anthraniliques |
Also Published As
| Publication number | Publication date |
|---|---|
| DE1277860B (de) | 1968-09-19 |
| SE322787B (enExample) | 1970-04-20 |
| SE332995B (enExample) | 1971-03-01 |
| DE1272929B (enExample) | 1968-07-18 |
| DE1302132B (enExample) | 1970-01-22 |
| CH444880A (de) | 1967-10-15 |
| CH459254A (de) | 1968-07-15 |
| FR1489135A (enExample) | 1967-10-26 |
| DE1281449B (enExample) | 1968-10-31 |
| DK123406B (da) | 1972-06-19 |
| BE682141A (enExample) | 1966-12-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1795613B2 (de) | Indolylessigsaeuren, verfahren zu ihrer herstellung und arzneimittel | |
| EP0380712A1 (de) | Verfahren zur Herstellung von 2,6-Dichlordiphenylaminessigsäurederivaten | |
| DE1212984B (de) | Verfahren zur Herstellung von basisch substituierten Cumaronen | |
| DE1104965B (de) | Verfahren zur Herstellung von Derivaten des Urazols | |
| DE1300569B (enExample) | ||
| DE1078582B (de) | Verfahren zur Herstellung substituierter Thyropropionsaeuren | |
| DE2656750C2 (de) | In 5-Stellung substituierte 2-Indancarbonsäuren, Verfahren zu deren LIPHA-Herstellung und sie enthaltende Arzneimittel | |
| DE2728323A1 (de) | Optisch aktive derivate von benzoxazolylpropionsaeure, verfahren zu ihrer herstellung und arzneimittel | |
| DE946986C (de) | Verfahren zur Herstellung von ª‡-Acetotetronsaeuren | |
| DE1917036C3 (de) | N-Acyl-N-(substituiertes)phenyl-4amino-buttersäuren und deren Salze, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE1249851B (de) | Morel Ariesheim (Schweiz) j Verfahren zur Herstellung neuer Phenoxyessigsäure amide | |
| DE1795671C3 (de) | Verfahren zur Herstellung von i-Acyl-3-indolylcarbonsäureverbindungen | |
| AT221515B (de) | Verfahren zur Herstellung neuer 4-Oxo-1,2,3,4-tetrahydronaphthalin-carbonsäureamide | |
| AT237614B (de) | Verfahren zur Herstellung von neuen Imidazol-Derivaten | |
| AT300785B (de) | Verfahren zur Herstellung von neuen 1-Β-Phenylpropioloyl-3-indolylessigsäurederivaten | |
| DE2051800C3 (de) | Pyrazole eckige Klammer auf 1,2-b eckige Klammer zu phthalazin-1,5-(10H)dione und Verfahren zu deren Herstellung | |
| DE1493854C (de) | Benzanilide und Verfahren zu ihrer Herstellung | |
| AT297695B (de) | Verfahren zur Herstellung von 1-Cinnamoyl-3-indolylessigsäurederivaten | |
| DE1445800C (de) | Verfahren zur Herstellung von Diben zoazepinen | |
| AT208867B (de) | Verfahren zur Herstellung von neuen substituierten heterocyclischen Säurehydraziden | |
| DE1168918B (de) | Verfahren zur Herstellung von Acylanthranilsaeureaniliden | |
| CH479547A (de) | Verfahren zur Herstellung von a-Aminocarbonsäureestern | |
| DE1283842B (de) | Indenverbindungen sowie Verfahren zu ihrer Herstellung | |
| DE1139483B (de) | Verfahren zur Herstellung von narkotisch wirksamen ª†-Hydroxycarbonsaeureamiden | |
| DE1545833A1 (de) | Verfahren zur Herstellung von Pyridobenzimidazolcarbonsaeuren |