DE1268148B - 5-(p-Aminobenzolsulfonamido)-1-phenyl-3-(methoxymethyl)-pyrazol - Google Patents
5-(p-Aminobenzolsulfonamido)-1-phenyl-3-(methoxymethyl)-pyrazolInfo
- Publication number
- DE1268148B DE1268148B DEP1268A DE1268148A DE1268148B DE 1268148 B DE1268148 B DE 1268148B DE P1268 A DEP1268 A DE P1268A DE 1268148 A DE1268148 A DE 1268148A DE 1268148 B DE1268148 B DE 1268148B
- Authority
- DE
- Germany
- Prior art keywords
- methoxymethyl
- phenyl
- pyrazole
- aminobenzenesulfonamido
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- HGQZSDFDTCLZQP-UHFFFAOYSA-N 4-amino-N-[5-(methoxymethyl)-2-phenylpyrazol-3-yl]benzenesulfonamide Chemical compound COCC1=NN(C(NS(=O)(=O)C2=CC=C(N)C=C2)=C1)C1=CC=CC=C1 HGQZSDFDTCLZQP-UHFFFAOYSA-N 0.000 title claims description 7
- 150000001875 compounds Chemical class 0.000 description 17
- -1 reaction temperature Substances 0.000 description 11
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- 150000003839 salts Chemical class 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- 125000003277 amino group Chemical group 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 8
- 230000007062 hydrolysis Effects 0.000 description 7
- 238000006460 hydrolysis reaction Methods 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 208000015181 infectious disease Diseases 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 125000004442 acylamino group Chemical group 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- DSVVTTONZVOBII-UHFFFAOYSA-N 5-(methoxymethyl)-2-phenylpyrazol-3-amine Chemical compound N1=C(COC)C=C(N)N1C1=CC=CC=C1 DSVVTTONZVOBII-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 235000011121 sodium hydroxide Nutrition 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- 241000606860 Pasteurella Species 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 241000191967 Staphylococcus aureus Species 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 238000007098 aminolysis reaction Methods 0.000 description 2
- 239000002246 antineoplastic agent Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000036765 blood level Effects 0.000 description 2
- 230000000973 chemotherapeutic effect Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229940127089 cytotoxic agent Drugs 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- JVVRJMXHNUAPHW-UHFFFAOYSA-N 1h-pyrazol-5-amine Chemical compound NC=1C=CNN=1 JVVRJMXHNUAPHW-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- GRDXCFKBQWDAJH-UHFFFAOYSA-N 4-acetamidobenzenesulfonyl chloride Chemical compound CC(=O)NC1=CC=C(S(Cl)(=O)=O)C=C1 GRDXCFKBQWDAJH-UHFFFAOYSA-N 0.000 description 1
- JXRGUPLJCCDGKG-UHFFFAOYSA-N 4-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC=C(S(Cl)(=O)=O)C=C1 JXRGUPLJCCDGKG-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 208000035143 Bacterial infection Diseases 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- UXPPJFHKUUYSPW-UHFFFAOYSA-N COCC(C=C1NS(C(C=C2)=CC=C2[N+]([O-])=O)(=O)=O)=NN1C1=CC=CC=C1 Chemical compound COCC(C=C1NS(C(C=C2)=CC=C2[N+]([O-])=O)(=O)=O)=NN1C1=CC=CC=C1 UXPPJFHKUUYSPW-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000005236 alkanoylamino group Chemical group 0.000 description 1
- 125000001118 alkylidene group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N anhydrous trimethylamine Natural products CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 1
- 208000022362 bacterial infectious disease Diseases 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical class [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 235000011116 calcium hydroxide Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- JLEKJZUYWFJPMB-UHFFFAOYSA-N ethyl 2-methoxyacetate Chemical compound CCOC(=O)COC JLEKJZUYWFJPMB-UHFFFAOYSA-N 0.000 description 1
- QIJQSTNYYPTNBF-UHFFFAOYSA-N ethyl n-(4-chlorosulfonylphenyl)carbamate Chemical compound CCOC(=O)NC1=CC=C(S(Cl)(=O)=O)C=C1 QIJQSTNYYPTNBF-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000035876 healing Effects 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000000654 isopropylidene group Chemical group C(C)(C)=* 0.000 description 1
- 231100000636 lethal dose Toxicity 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000007530 organic bases Chemical group 0.000 description 1
- 244000052769 pathogen Species 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- WSDQIHATCCOMLH-UHFFFAOYSA-N phenyl n-(3,5-dichlorophenyl)carbamate Chemical compound ClC1=CC(Cl)=CC(NC(=O)OC=2C=CC=CC=2)=C1 WSDQIHATCCOMLH-UHFFFAOYSA-N 0.000 description 1
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 1
- 229940067157 phenylhydrazine Drugs 0.000 description 1
- 235000011118 potassium hydroxide Nutrition 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- QWCJHSGMANYXCW-UHFFFAOYSA-N sulfaphenazole Chemical compound C1=CC(N)=CC=C1S(=O)(=O)NC1=CC=NN1C1=CC=CC=C1 QWCJHSGMANYXCW-UHFFFAOYSA-N 0.000 description 1
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 229960005371 tolbutamide Drugs 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/38—Nitrogen atoms
- C07D231/42—Benzene-sulfonamido pyrazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH34263A CH449028A (de) | 1963-01-10 | 1963-01-10 | Verfahren zur Herstellung neuer Sulfonamide |
| CH1359763 | 1963-11-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1268148B true DE1268148B (de) | 1968-05-16 |
Family
ID=25684271
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP1268A Pending DE1268148B (de) | 1963-01-10 | 1964-01-08 | 5-(p-Aminobenzolsulfonamido)-1-phenyl-3-(methoxymethyl)-pyrazol |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3374227A (enExample) |
| BE (1) | BE642276A (enExample) |
| DE (1) | DE1268148B (enExample) |
| GB (1) | GB1029740A (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3920690A (en) * | 1971-05-11 | 1975-11-18 | Minnesota Mining & Mfg | Herbicidal trifluoromethylsulfonamido-pyrazoles |
| RU2642060C2 (ru) * | 2015-12-22 | 2018-01-24 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Сибирский государственный университет науки и технологий имени академика М.Ф.Решетнева" (СибГУ им.М.Ф.Решетнева) | 4-Амино-3-метоксиметил-5-фенил-1Н-пиразол |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1049384B (de) * | 1959-01-29 | Ciba Aktiengesellschaft, Basel (Schweiz) | Verfahren zur Herstellung eines therapeutisch wirksamen Aminobenzolsulfonamids und seiner Salze |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2494524A (en) * | 1943-01-12 | 1950-01-10 | Sharp & Dohme Inc | 2-(benzene sulfonamido)-tetra-hydrobenzothiazoles |
| DE1119869B (de) * | 1958-02-18 | 1961-12-21 | Ciba Geigy | Verfahren zur Herstellung des N-(p-Aminobenzolsulfonyl)-N-acetyl-5-amino-1-phenyl-pyrazols |
| DE1140940B (de) * | 1958-03-14 | 1962-12-13 | Ciba Geigy | Verfahren zur Herstellung des N-(p-Aminobenzolsulfonyl)-N-acetyl-5-amino-3-methyl-1-phenyl-pyrazols |
| DE1144730B (de) * | 1958-04-23 | 1963-03-07 | Ciba Geigy | Verfahren zur Herstellung eines Sulfonamidderivates |
| US3028382A (en) * | 1959-01-21 | 1962-04-03 | C F Boehringer & Sochne G M B | Sulfanilamido pyrazole compounds |
| US2988547A (en) * | 1959-03-28 | 1961-06-13 | Boehringer & Soehne | 1-phenyl-3-methoxy; hydroxy; or benzyloxy-5-sulfanilamido pyrazole-1, 2 and derivatives thereof |
| DE1166784B (de) * | 1960-04-26 | 1964-04-02 | Hoechst Ag | Verfahren zur Herstellung von Sulfanilamidopyrazolen |
-
1963
- 1963-12-26 US US333675A patent/US3374227A/en not_active Expired - Lifetime
-
1964
- 1964-01-06 GB GB585/64A patent/GB1029740A/en not_active Expired
- 1964-01-08 DE DEP1268A patent/DE1268148B/de active Pending
- 1964-01-09 BE BE642276A patent/BE642276A/xx unknown
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1049384B (de) * | 1959-01-29 | Ciba Aktiengesellschaft, Basel (Schweiz) | Verfahren zur Herstellung eines therapeutisch wirksamen Aminobenzolsulfonamids und seiner Salze |
Also Published As
| Publication number | Publication date |
|---|---|
| BE642276A (enExample) | 1964-07-09 |
| GB1029740A (en) | 1966-05-18 |
| US3374227A (en) | 1968-03-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1268148B (de) | 5-(p-Aminobenzolsulfonamido)-1-phenyl-3-(methoxymethyl)-pyrazol | |
| DE946804C (de) | Verfahren zur Herstellung von schwefelhaltigen Abkoemmlingen der Barbitursaeure | |
| DE658114C (de) | Verfahren zur Darstellung von Abkoemmlingen des im Pyridonring phenylierten 1, 9-N-Methylanthrapyridons oder seiner 4-Brom- bzw. 4-Chlorverbindung | |
| DE957841C (de) | Verfahren zur Herstellung von Sulfonamiden | |
| DE740445C (de) | Verfahren zur Herstellung von p,p-Diaminodiphenylsulfon | |
| DE1224319B (de) | Verfahren zur Herstellung des antibakteriell wirksamen 4-(p-Aminobenzolsulfonamido)-1-phenyl-1, 2, 3-triazols und seiner N-Nieder-alkanoylderivate | |
| DE957123C (de) | Verfahren zur Herstellung von Thioabkoemmlingen der Colchiceine | |
| AT230369B (de) | Verfahren zur Herstellung von neuen Alkoxyalkyl-hydrazonen | |
| DE809077C (de) | Verfahren zur Herstellung substituierter Isothioharnstoffe bzw. ihrer Salze | |
| DE1493619C (de) | Verfahren zur Herstellung von 3-(3,4-Dihydroxyphenyl)-2-methylalanin | |
| DE1670378C (de) | Verfahren zur Herstellung des Salzes aus4-n-Butyl-3,5-dioxo-l,2-diphenylpyrazolidin und dem beta-Diäthylamino-äthylamid der p-Chlorphenoxyessigsäure | |
| DE697801C (de) | Verfahren zur Herstellung von Furanverbindungen der Pyrazolonreihe | |
| AT236368B (de) | Verfahren zur Herstellung des neuen 2-Phenyl-3-(p-amino-benzolsulfonamido)-5-äthyl-pyrazols, seiner N4-Formaldehydkondensationsprodukte, sowie den Salzen und N1-Acylderivaten dieser Verbindungen | |
| DE502042C (de) | Verfahren zur Darstellung von neuen Kondensationsprodukten der Benzanthronreihe | |
| DE1470283C (de) | l-Methyl-5-sulfanilamido-pyridazon-(6)-derivate | |
| DE513211C (de) | Verfahren zur Darstellung von p-Oxydiarylamincarbonsaeuren | |
| DE1670346C3 (de) | Borhaltige heterocyclische Verbindungen und Verfahren zu deren Herstellung | |
| DE1175681B (de) | Verfahren zur Herstellung von Sulfanilamidopyrazolen | |
| DE2033090B2 (de) | deren Herstellung | |
| DE1223388B (de) | Verfahren zur Herstellung von neuen Isonicotinsaeureamiden | |
| DE1277857B (de) | Verfahren zur Herstellung von 1, 2-Dialkyl-indazolon-3-hydrazonen | |
| DE1271717B (de) | 2-Phenyl-3-(p-amino-benzolsulfonamido)-5-aethyl-pyrazol, seine Metallsalze, seine N-Carbalkoxyderivate und seine N-Niederalkanoylderivate | |
| DE1470283B1 (de) | 1-Methyl-5-sulfanilamido-pyridazon-(6)-derivate | |
| DE1044821B (de) | Verfahren zur Herstellung von 1-Alkylnorharmanen (1-Alkyl-3-carbolinen) und deren Abkoemmlingen | |
| DE1269128B (de) | 1-AEthyl-5-sulfanilamido-pyrazol |