DE1245363B - Verfahren zur Herstellung von Acrylsaeure oder Methacrylsaeure durch Oxydation von Acrolein oder Methacrolein - Google Patents
Verfahren zur Herstellung von Acrylsaeure oder Methacrylsaeure durch Oxydation von Acrolein oder MethacroleinInfo
- Publication number
- DE1245363B DE1245363B DEST13555A DEST013555A DE1245363B DE 1245363 B DE1245363 B DE 1245363B DE ST13555 A DEST13555 A DE ST13555A DE ST013555 A DEST013555 A DE ST013555A DE 1245363 B DE1245363 B DE 1245363B
- Authority
- DE
- Germany
- Prior art keywords
- acrolein
- methacrolein
- acid
- catalyst
- seconds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 title claims description 80
- 238000000034 method Methods 0.000 title claims description 44
- STNJBCKSHOAVAJ-UHFFFAOYSA-N Methacrolein Chemical compound CC(=C)C=O STNJBCKSHOAVAJ-UHFFFAOYSA-N 0.000 title claims description 31
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 title claims description 25
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 title claims description 20
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 title claims description 18
- 230000003647 oxidation Effects 0.000 title claims description 15
- 238000007254 oxidation reaction Methods 0.000 title claims description 15
- 238000004519 manufacturing process Methods 0.000 title claims description 10
- 239000003054 catalyst Substances 0.000 claims description 59
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 36
- 238000006243 chemical reaction Methods 0.000 claims description 26
- 239000000203 mixture Substances 0.000 claims description 19
- 239000007789 gas Substances 0.000 claims description 15
- 229910052760 oxygen Inorganic materials 0.000 claims description 14
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 13
- 239000001301 oxygen Substances 0.000 claims description 13
- 229910052797 bismuth Inorganic materials 0.000 claims description 10
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 10
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 8
- 229910052718 tin Inorganic materials 0.000 claims description 8
- 150000001462 antimony Chemical class 0.000 claims description 7
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 claims description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 6
- DHRLEVQXOMLTIM-UHFFFAOYSA-N phosphoric acid;trioxomolybdenum Chemical compound O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.OP(O)(O)=O DHRLEVQXOMLTIM-UHFFFAOYSA-N 0.000 claims description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 19
- 239000000243 solution Substances 0.000 description 17
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 13
- 150000001299 aldehydes Chemical class 0.000 description 9
- 239000007795 chemical reaction product Substances 0.000 description 9
- JKQOBWVOAYFWKG-UHFFFAOYSA-N molybdenum trioxide Chemical compound O=[Mo](=O)=O JKQOBWVOAYFWKG-UHFFFAOYSA-N 0.000 description 8
- 239000000377 silicon dioxide Substances 0.000 description 8
- 238000005406 washing Methods 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 7
- 239000002245 particle Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 239000007788 liquid Substances 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- 238000006116 polymerization reaction Methods 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 4
- VLAPMBHFAWRUQP-UHFFFAOYSA-L molybdic acid Chemical compound O[Mo](O)(=O)=O VLAPMBHFAWRUQP-UHFFFAOYSA-L 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 239000011574 phosphorus Substances 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- PPNKDDZCLDMRHS-UHFFFAOYSA-N dinitrooxybismuthanyl nitrate Chemical compound [Bi+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O PPNKDDZCLDMRHS-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000008246 gaseous mixture Substances 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- -1 peroxide compounds Chemical class 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- AMWVZPDSWLOFKA-UHFFFAOYSA-N phosphanylidynemolybdenum Chemical compound [Mo]#P AMWVZPDSWLOFKA-UHFFFAOYSA-N 0.000 description 2
- 150000003016 phosphoric acids Chemical class 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000012495 reaction gas Substances 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- TVEXGJYMHHTVKP-UHFFFAOYSA-N 6-oxabicyclo[3.2.1]oct-3-en-7-one Chemical compound C1C2C(=O)OC1C=CC2 TVEXGJYMHHTVKP-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- WVVOBOZHTQJXPB-UHFFFAOYSA-N N-anilino-N-nitronitramide Chemical compound [N+](=O)([O-])N(NC1=CC=CC=C1)[N+](=O)[O-] WVVOBOZHTQJXPB-UHFFFAOYSA-N 0.000 description 1
- HSNVNALJRSJDHT-UHFFFAOYSA-N P(=O)(=O)[Mo] Chemical class P(=O)(=O)[Mo] HSNVNALJRSJDHT-UHFFFAOYSA-N 0.000 description 1
- 229920002845 Poly(methacrylic acid) Polymers 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- QDAYJHVWIRGGJM-UHFFFAOYSA-B [Mo+4].[Mo+4].[Mo+4].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O Chemical compound [Mo+4].[Mo+4].[Mo+4].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QDAYJHVWIRGGJM-UHFFFAOYSA-B 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 238000005056 compaction Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 235000014510 cooky Nutrition 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- 230000035622 drinking Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- ZDGGJQMSELMHLK-UHFFFAOYSA-N m-Trifluoromethylhippuric acid Chemical compound OC(=O)CNC(=O)C1=CC=CC(C(F)(F)F)=C1 ZDGGJQMSELMHLK-UHFFFAOYSA-N 0.000 description 1
- 125000005397 methacrylic acid ester group Chemical group 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- MEFBJEMVZONFCJ-UHFFFAOYSA-N molybdate Chemical compound [O-][Mo]([O-])(=O)=O MEFBJEMVZONFCJ-UHFFFAOYSA-N 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- ORSLXQZSKCIHDH-UHFFFAOYSA-N prop-2-enal;prop-2-enoic acid Chemical compound C=CC=O.OC(=O)C=C ORSLXQZSKCIHDH-UHFFFAOYSA-N 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- GZNAASVAJNXPPW-UHFFFAOYSA-M tin(4+) chloride dihydrate Chemical compound O.O.[Cl-].[Sn+4] GZNAASVAJNXPPW-UHFFFAOYSA-M 0.000 description 1
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Substances O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 229910001928 zirconium oxide Inorganic materials 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J27/00—Catalysts comprising the elements or compounds of halogens, sulfur, selenium, tellurium, phosphorus or nitrogen; Catalysts comprising carbon compounds
- B01J27/14—Phosphorus; Compounds thereof
- B01J27/186—Phosphorus; Compounds thereof with arsenic, antimony, bismuth, vanadium, niobium, tantalum, polonium, chromium, molybdenum, tungsten, manganese, technetium or rhenium
- B01J27/188—Phosphorus; Compounds thereof with arsenic, antimony, bismuth, vanadium, niobium, tantalum, polonium, chromium, molybdenum, tungsten, manganese, technetium or rhenium with chromium, molybdenum, tungsten or polonium
- B01J27/19—Molybdenum
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/16—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation
- C07C51/21—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen
- C07C51/25—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of unsaturated compounds containing no six-membered aromatic ring
- C07C51/252—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of unsaturated compounds containing no six-membered aromatic ring of propene, butenes, acrolein or methacrolein
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US646581A US2881212A (en) | 1957-03-18 | 1957-03-18 | Process and catalyst for the production of unsaturated carboxylic acids |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1245363B true DE1245363B (de) | 1967-07-27 |
| DE1245363C2 DE1245363C2 (enExample) | 1968-02-08 |
Family
ID=24593603
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEST13555A Granted DE1245363B (de) | 1957-03-18 | 1958-03-17 | Verfahren zur Herstellung von Acrylsaeure oder Methacrylsaeure durch Oxydation von Acrolein oder Methacrolein |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US2881212A (enExample) |
| DE (1) | DE1245363B (enExample) |
| NL (2) | NL225963A (enExample) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3172909A (en) * | 1965-03-09 | Oxidation of acrolein and methacrolein | ||
| US3021366A (en) * | 1958-10-10 | 1962-02-13 | Standard Oil Co | Process for the conversion of unsaturated aldehydes to the corresponding unsaturated acids |
| NL248487A (enExample) * | 1959-02-17 | |||
| US3044965A (en) * | 1959-04-16 | 1962-07-17 | Standard Oil Co | Process for the manufacture of bismuth catalysts |
| US3044966A (en) * | 1959-08-05 | 1962-07-17 | Standard Oil Co | Attrition resistant oxidation catalysts |
| US3380931A (en) * | 1960-01-12 | 1968-04-30 | Shell Oil Co | Oxidation catalysts |
| USRE28593E (en) * | 1960-03-31 | 1975-10-28 | Oxidation of acrolein and methacrolein with a molybdenum polyvalent metal oxygen catalyst | |
| DE1204659B (de) * | 1960-04-16 | 1965-11-11 | Bayer Ag | Verfahren zur Herstellung von Acrylsaeure oder Methacrylsaeure durch Oxydation von Propylen oder Isobutylen |
| US3238253A (en) * | 1961-02-20 | 1966-03-01 | Petro Tex Chem Corp | Oxidation of alpha, beta unsaturated aldehydes in the presence of a catalyst containing v, p, mn and o |
| US3259652A (en) * | 1961-03-31 | 1966-07-05 | Shell Oil Co | Oxidation of acrolein or methacrolein to the corresponding acid in the presence of an sn-sb-mo catalyst |
| US3271446A (en) * | 1962-07-02 | 1966-09-06 | Petro Tex Chem Corp | Preparing acetic acid by the catalytic oxidation of methacrolein |
| GB1040002A (en) * | 1963-01-25 | 1966-08-24 | Sumitomo Chemical Co | Improvements in or relating to a catalyst composition and to a process for producingunsaturated carbonyl compounds |
| NL128875C (enExample) * | 1963-05-21 | |||
| US3321411A (en) * | 1964-05-04 | 1967-05-23 | Eastman Kodak Co | Novel catalyst system for the synthesis of unsaturated nitriles |
| GB1036957A (en) * | 1964-09-05 | 1966-07-20 | Distillers Co Yeast Ltd | Improvements in or relating to the production of unsaturated aliphatic carboxylic acids |
| US3395178A (en) * | 1965-03-08 | 1968-07-30 | Standard Oil Co | Process for producing unsaturated carboxylic acids with phosphomolybdic acid on silicon carbide as catalyst |
| US3457303A (en) * | 1965-08-30 | 1969-07-22 | Goodrich Co B F | Method of preparing unsaturated aldehydes and acids |
| US3524824A (en) * | 1965-08-30 | 1970-08-18 | Goodrich Co B F | Catalyst and process of preparing unsaturated aldehydes and acids |
| US3666804A (en) * | 1966-10-26 | 1972-05-30 | Grace W R & Co | Oxidation process |
| US3379652A (en) * | 1967-04-28 | 1968-04-23 | Eastman Kodak Co | Arsenophosphomolybdic acid catalyst compositions and process for their preparation |
| US3480564A (en) * | 1968-01-22 | 1969-11-25 | Catalysts & Chem Inc | Oxidation catalyst |
| JPS5613702B2 (enExample) * | 1972-12-19 | 1981-03-30 | ||
| CH569926A5 (enExample) * | 1973-06-15 | 1975-11-28 | Bartolomeis Spa Forni Ed Impia | |
| US4000088A (en) * | 1974-06-03 | 1976-12-28 | Nippon Kayaku Co., Ltd. | Oxidation catalyst for the manufacture of methacrylic acid |
| JPS57179007A (en) * | 1981-04-24 | 1982-11-04 | Sumitomo Chem Co Ltd | Novel heteropolyacid, its manufacture and its using method |
| JP3132781B2 (ja) * | 1992-03-27 | 2001-02-05 | 株式会社クラレ | ビタミンa酸の製造方法 |
Citations (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1911219A (en) * | 1930-03-21 | 1933-05-30 | Rohm & Haas Ag | Process for the preparation of acrylic acid |
| US2030901A (en) * | 1935-01-10 | 1936-02-18 | Du Pont Viscoloid Co | Process for depolymerizing alpha substituted acrylic acid esters |
| DE642289C (de) * | 1935-07-21 | 1937-02-27 | Roehm & Haas Akt Ges | Verfahren zur Herstellung von Methacrylsaeureestern |
| US2153406A (en) * | 1935-07-02 | 1939-04-04 | Rohm & Haas | Process for the preparation of methacrylic acid |
| US2212900A (en) * | 1935-09-11 | 1940-08-27 | Shell Dev | Process and product relating to the oxidation of unsaturated aldehydes |
| US2288566A (en) * | 1940-04-11 | 1942-06-30 | Acrolein Corp | Process of producing acrylic acid and its salts |
| DE729730C (de) * | 1940-03-16 | 1942-12-22 | Roehm & Haas G M B H | Verfahren zur Gewinnung von monomeren Methacrylsaeureverbindungen |
| US2369182A (en) * | 1943-03-27 | 1945-02-13 | Shell Dev | Controlled oxidation of unsaturated organic compounds |
| US2377584A (en) * | 1940-09-26 | 1945-06-05 | Distillers Co Yeast Ltd | Oxidation of unsaturated aldehydes |
| GB573723A (en) * | 1941-02-28 | 1945-12-04 | Distillers Co Yeast Ltd | Improvements in or relating to the manufacture of polymerisable unsaturated acids |
| GB596034A (en) * | 1945-07-16 | 1947-12-24 | Charles Weizmann | Improvements relating to the production of unsaturated carboxylic acids |
| US2582911A (en) * | 1950-07-12 | 1952-01-15 | Rohm & Haas | Preparation of acrylic esters |
| DE854797C (de) * | 1948-10-02 | 1952-11-06 | Chemische Werke Huels G M B H | Verfahren zur Herstellung von ungesaettigten Carbonsaeuren durch Oxydation der entsprechenden Aldehyde |
| US2625519A (en) * | 1950-03-07 | 1953-01-13 | Du Pont | Oxidation catalysts |
| DE869950C (de) * | 1951-02-22 | 1953-03-09 | Chemische Werke Huels Ges Mit | Verfahren zur Herstellung von ungesaettigten Carbonsaeuren durch Oxydation von ungesaettigten Aldehyden |
| DE871147C (de) * | 1949-03-25 | 1953-03-19 | Distillers Co Yeast Ltd | Verfahren zur Herstellung von ª‡-Neopentylacrylsaeure |
| DE871895C (de) * | 1950-03-03 | 1953-03-26 | Distillers Co Yeast Ltd | Verfahren zur Herstellung eines Oxydationskatalysators |
| DE875509C (de) * | 1949-12-09 | 1953-05-04 | Distillers Co Yeast Ltd | Verfahren zur Herstellung von Maleinsaeure und bzw. oder Maleinsaeureanhydrid |
| FR1079107A (fr) * | 1953-03-23 | 1954-11-25 | Procédé et dispositif de régénération des monomères à partir de polyméthacrylate, et, en particulier, de polyméthacrylate de méthyle | |
| US2719171A (en) * | 1951-03-28 | 1955-09-27 | Du Pont | Oxidative dehydrogenation process |
| GB740005A (en) * | 1952-12-06 | 1955-11-09 | Distillers Co Yeast Ltd | Manufacture of acrylates |
| FR1114639A (fr) * | 1954-11-19 | 1956-04-16 | Cie Francaise Des Plastiques I | Procédé de transformation des déchets de polyméthacrylate de méthyle en produits industriellement utilisables |
| US2744929A (en) * | 1952-09-26 | 1956-05-08 | Shell Dev | Production of unsaturated carboxylic acids |
| US2744928A (en) * | 1952-11-28 | 1956-05-08 | Shell Dev | Oxidation of unsaturated aldehydes to acids |
| DE944789C (de) * | 1953-11-15 | 1956-06-21 | Basf Ag | Verfahren zur Herstellung von Acrylsaeureestern |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1882712A (en) * | 1930-03-13 | 1932-10-18 | Ig Farbenindustrie Ag | Production of catalysts comprising phosphates |
| GB560166A (en) * | 1940-09-21 | 1944-03-23 | Distillers Co Yeast Ltd | Improvements in or relating to the oxidation of unsaturated aldehydes |
| US2487188A (en) * | 1945-05-19 | 1949-11-08 | Celanese Corp | Oxidation of aldehydes |
| US2577829A (en) * | 1947-08-09 | 1951-12-11 | Publicker Ind Inc | Production of unsaturated acids |
| GB677624A (en) * | 1950-01-24 | 1952-08-20 | Distillers Co Yeast Ltd | Process for the manufacture of maleic acid |
| US2773838A (en) * | 1951-05-01 | 1956-12-11 | Atlantic Refining Co | Production of maleic and alkyl substituted maleic anhydrides by catalytic oxidation |
| US2772244A (en) * | 1952-12-01 | 1956-11-27 | Standard Oil Co | Titanium-phosphorus catalyst |
-
0
- NL NL104763D patent/NL104763C/xx active
- NL NL225963D patent/NL225963A/xx unknown
-
1957
- 1957-03-18 US US646581A patent/US2881212A/en not_active Expired - Lifetime
-
1958
- 1958-03-17 DE DEST13555A patent/DE1245363B/de active Granted
Patent Citations (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1911219A (en) * | 1930-03-21 | 1933-05-30 | Rohm & Haas Ag | Process for the preparation of acrylic acid |
| US2030901A (en) * | 1935-01-10 | 1936-02-18 | Du Pont Viscoloid Co | Process for depolymerizing alpha substituted acrylic acid esters |
| US2153406A (en) * | 1935-07-02 | 1939-04-04 | Rohm & Haas | Process for the preparation of methacrylic acid |
| DE642289C (de) * | 1935-07-21 | 1937-02-27 | Roehm & Haas Akt Ges | Verfahren zur Herstellung von Methacrylsaeureestern |
| US2212900A (en) * | 1935-09-11 | 1940-08-27 | Shell Dev | Process and product relating to the oxidation of unsaturated aldehydes |
| DE729730C (de) * | 1940-03-16 | 1942-12-22 | Roehm & Haas G M B H | Verfahren zur Gewinnung von monomeren Methacrylsaeureverbindungen |
| US2288566A (en) * | 1940-04-11 | 1942-06-30 | Acrolein Corp | Process of producing acrylic acid and its salts |
| US2377584A (en) * | 1940-09-26 | 1945-06-05 | Distillers Co Yeast Ltd | Oxidation of unsaturated aldehydes |
| GB573723A (en) * | 1941-02-28 | 1945-12-04 | Distillers Co Yeast Ltd | Improvements in or relating to the manufacture of polymerisable unsaturated acids |
| US2369182A (en) * | 1943-03-27 | 1945-02-13 | Shell Dev | Controlled oxidation of unsaturated organic compounds |
| GB596034A (en) * | 1945-07-16 | 1947-12-24 | Charles Weizmann | Improvements relating to the production of unsaturated carboxylic acids |
| DE854797C (de) * | 1948-10-02 | 1952-11-06 | Chemische Werke Huels G M B H | Verfahren zur Herstellung von ungesaettigten Carbonsaeuren durch Oxydation der entsprechenden Aldehyde |
| DE871147C (de) * | 1949-03-25 | 1953-03-19 | Distillers Co Yeast Ltd | Verfahren zur Herstellung von ª‡-Neopentylacrylsaeure |
| DE875509C (de) * | 1949-12-09 | 1953-05-04 | Distillers Co Yeast Ltd | Verfahren zur Herstellung von Maleinsaeure und bzw. oder Maleinsaeureanhydrid |
| DE871895C (de) * | 1950-03-03 | 1953-03-26 | Distillers Co Yeast Ltd | Verfahren zur Herstellung eines Oxydationskatalysators |
| US2625519A (en) * | 1950-03-07 | 1953-01-13 | Du Pont | Oxidation catalysts |
| US2582911A (en) * | 1950-07-12 | 1952-01-15 | Rohm & Haas | Preparation of acrylic esters |
| DE869950C (de) * | 1951-02-22 | 1953-03-09 | Chemische Werke Huels Ges Mit | Verfahren zur Herstellung von ungesaettigten Carbonsaeuren durch Oxydation von ungesaettigten Aldehyden |
| US2719171A (en) * | 1951-03-28 | 1955-09-27 | Du Pont | Oxidative dehydrogenation process |
| US2744929A (en) * | 1952-09-26 | 1956-05-08 | Shell Dev | Production of unsaturated carboxylic acids |
| US2744928A (en) * | 1952-11-28 | 1956-05-08 | Shell Dev | Oxidation of unsaturated aldehydes to acids |
| GB740005A (en) * | 1952-12-06 | 1955-11-09 | Distillers Co Yeast Ltd | Manufacture of acrylates |
| FR1079107A (fr) * | 1953-03-23 | 1954-11-25 | Procédé et dispositif de régénération des monomères à partir de polyméthacrylate, et, en particulier, de polyméthacrylate de méthyle | |
| DE944789C (de) * | 1953-11-15 | 1956-06-21 | Basf Ag | Verfahren zur Herstellung von Acrylsaeureestern |
| FR1114639A (fr) * | 1954-11-19 | 1956-04-16 | Cie Francaise Des Plastiques I | Procédé de transformation des déchets de polyméthacrylate de méthyle en produits industriellement utilisables |
Also Published As
| Publication number | Publication date |
|---|---|
| NL104763C (enExample) | |
| US2881212A (en) | 1959-04-07 |
| NL225963A (enExample) | |
| DE1245363C2 (enExample) | 1968-02-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1245363B (de) | Verfahren zur Herstellung von Acrylsaeure oder Methacrylsaeure durch Oxydation von Acrolein oder Methacrolein | |
| DE3141173C2 (de) | Verfahren zur Herstellung von α,β-ungesättigten Carbonsäuren oder deren Estern oder einem Gemisch hiervon | |
| DE1127351B (de) | Verfahren zur Herstellung von ª, ª-ungesaettigten aliphatischen Nitrilen durch Umsetzen von Olefinen mit Ammoniak und Sauerstoff | |
| DE2627475C3 (de) | Verfahren zur Herstellung von Terephthalsäure | |
| DE2704991C3 (de) | Verfahren zur Herstellung von Methacrylsäure | |
| DE2151417C3 (de) | Verfahren zur Herstellung von Katalysatoren | |
| DE2505844A1 (de) | Verfahren zur herstellung eines mischoxid-oxydationskatalysators auf basis von vanadin und fuenfwertigem phosphor | |
| EP0036623B1 (de) | Verfahren zur Herstellung von Katalysatoren für die Gasphaseoxidation von gesättigten und/oder ungesättigten C4-Kohlenwasserstoffen zu Maleinsäureanhydrid | |
| DE2523757C3 (de) | Verfahren zur Herstellung von Methacrylsäure durch katalytische Oxidation von Methacrolein mit Sauerstoff | |
| DE69002008T2 (de) | Verfahren zur Herstellung von Hydroxyalkylestern. | |
| DE2847288A1 (de) | Katalysator und verfahren zur herstellung von methacrylsaeure | |
| DE2203710C3 (de) | Verfahren zur Herstellung von ungesättigten Aldehyden und Säuren | |
| EP0059414B1 (de) | Katalysatoren für die Herstellung von 3-Cyanpyridin | |
| DE1162348B (de) | Verfahren zur Herstellung von Phthalsaeureanhydrid | |
| DE3107756C2 (enExample) | ||
| DE2739779C2 (de) | Molybdän, Vanadin, Phosphor sowie gegebenenfalls Kupfer, Zinn, Eisen, Blei und/oder Cer enthaltender Katalysator und dessen Verwendung zur Herstellung von Methacrylsäure | |
| DE2456113A1 (de) | Verfahren zur herstellung von methylacrylat oder gemischen hiervon mit akrylsaeure | |
| DE68905709T2 (de) | Herstellung von Alkylglyoxaten mit Ferriphosphat-Katalysator. | |
| DE2111216C3 (de) | Verfahren zur Herstellung von e-Caprolactam | |
| DE3150555A1 (de) | Verbessertes herstellungsverfahren fuer phosphor-vanadium-sauerstoff-katalysatoren | |
| DE3151833C2 (de) | Eisen, Phosphor, Sauerstoff und eine zusätzliche Metallkomponente enthaltender Katalysator und seine Verwendung zur oxidativen Dehydrierung von niederen gesättigten aliphatischen Carbonsäuren oder -estern | |
| DE2112938B2 (de) | Verfahren zur Herstellung ungesättigter Fettsäuren aus den entsprechenden ungesättigten aliphatischen Aldehyden | |
| DE2255225C3 (de) | Verfahren zur Herstellung von Katalysatoren | |
| DE1618271B1 (de) | Verfahren zur Herstellung von Acrolein durch Oxydation vo Propylen | |
| DE2836309A1 (de) | Verfahren zur umwandlung gesaettigter aliphatischer saeuren und deren derivate mit mindestens 4 c-atomen in die entsprechenden ungesaettigten verbindungen |