DE1242773B - Verfahren zur Herstellung von basischen Azofarbstoffen - Google Patents
Verfahren zur Herstellung von basischen AzofarbstoffenInfo
- Publication number
- DE1242773B DE1242773B DEF41548A DEF0041548A DE1242773B DE 1242773 B DE1242773 B DE 1242773B DE F41548 A DEF41548 A DE F41548A DE F0041548 A DEF0041548 A DE F0041548A DE 1242773 B DE1242773 B DE 1242773B
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- alk
- red
- ethyl
- hydrogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000987 azo dye Substances 0.000 title claims description 13
- 238000000034 method Methods 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 62
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 12
- 230000008878 coupling Effects 0.000 claims description 11
- 238000010168 coupling process Methods 0.000 claims description 11
- 238000005859 coupling reaction Methods 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 150000001768 cations Chemical class 0.000 claims description 7
- 150000001412 amines Chemical group 0.000 claims description 6
- 150000001450 anions Chemical class 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 2
- 125000002843 carboxylic acid group Chemical group 0.000 claims description 2
- 150000001989 diazonium salts Chemical class 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 150000002790 naphthalenes Chemical class 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims 2
- 125000003118 aryl group Chemical group 0.000 claims 1
- 238000004040 coloring Methods 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 description 61
- 229910052739 hydrogen Inorganic materials 0.000 description 61
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 49
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 33
- -1 aralkyl halides Chemical class 0.000 description 25
- 229910052757 nitrogen Inorganic materials 0.000 description 18
- 239000000975 dye Substances 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 13
- 206010039587 Scarlet Fever Diseases 0.000 description 12
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 8
- 239000000835 fiber Substances 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 229920002239 polyacrylonitrile Polymers 0.000 description 6
- 235000005074 zinc chloride Nutrition 0.000 description 6
- 239000011592 zinc chloride Substances 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 4
- 238000004043 dyeing Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 235000011054 acetic acid Nutrition 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 3
- 238000010409 ironing Methods 0.000 description 3
- IXCKOXLJNNFOCM-UHFFFAOYSA-N n,n,2-triethylaniline Chemical compound CCN(CC)C1=CC=CC=C1CC IXCKOXLJNNFOCM-UHFFFAOYSA-N 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- KTPUJQUPJJWWNF-UHFFFAOYSA-N 2-ethyl-n,n,3-trimethylaniline Chemical compound CCC1=C(C)C=CC=C1N(C)C KTPUJQUPJJWWNF-UHFFFAOYSA-N 0.000 description 2
- QQAWSFFBRWWLOE-UHFFFAOYSA-N 3-chloro-n,n,2-trimethylaniline Chemical compound CN(C)C1=CC=CC(Cl)=C1C QQAWSFFBRWWLOE-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 150000007860 aryl ester derivatives Chemical class 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 2
- HYXIJVZYRWWFOO-UHFFFAOYSA-N n,n,2,3-tetramethylaniline Chemical compound CN(C)C1=CC=CC(C)=C1C HYXIJVZYRWWFOO-UHFFFAOYSA-N 0.000 description 2
- JDEJGVSZUIJWBM-UHFFFAOYSA-N n,n,2-trimethylaniline Chemical compound CN(C)C1=CC=CC=C1C JDEJGVSZUIJWBM-UHFFFAOYSA-N 0.000 description 2
- QWVUDAMNCWEFBO-UHFFFAOYSA-N n,n-diethyl-2,3-dimethylaniline Chemical compound CCN(CC)C1=CC=CC(C)=C1C QWVUDAMNCWEFBO-UHFFFAOYSA-N 0.000 description 2
- YQYUUNRAPYPAPC-UHFFFAOYSA-N n,n-diethyl-2-methylaniline Chemical compound CCN(CC)C1=CC=CC=C1C YQYUUNRAPYPAPC-UHFFFAOYSA-N 0.000 description 2
- CIPVVROJHKLHJI-UHFFFAOYSA-N n,n-diethyl-3-methylaniline Chemical compound CCN(CC)C1=CC=CC(C)=C1 CIPVVROJHKLHJI-UHFFFAOYSA-N 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 238000005956 quaternization reaction Methods 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 150000003460 sulfonic acids Chemical class 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- WPWHSFAFEBZWBB-UHFFFAOYSA-N 1-butyl radical Chemical compound [CH2]CCC WPWHSFAFEBZWBB-UHFFFAOYSA-N 0.000 description 1
- DWXNXVYTEOEXNP-UHFFFAOYSA-N 2,5-dimethoxy-n,n-dimethylaniline Chemical compound COC1=CC=C(OC)C(N(C)C)=C1 DWXNXVYTEOEXNP-UHFFFAOYSA-N 0.000 description 1
- SGLADJJYQDGSEJ-UHFFFAOYSA-N 2-ethyl-n,n-dimethylaniline Chemical compound CCC1=CC=CC=C1N(C)C SGLADJJYQDGSEJ-UHFFFAOYSA-N 0.000 description 1
- USPVTJCHQHJFBQ-UHFFFAOYSA-N 3-chloro-n,n-diethylaniline Chemical compound CCN(CC)C1=CC=CC(Cl)=C1 USPVTJCHQHJFBQ-UHFFFAOYSA-N 0.000 description 1
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- FHQRDEDZJIFJAL-UHFFFAOYSA-N 4-phenylmorpholine Chemical compound C1COCCN1C1=CC=CC=C1 FHQRDEDZJIFJAL-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- NUSJWYIGQQZLGC-UHFFFAOYSA-N CN(C=1C(=C(C#N)C=CC1)C)C Chemical compound CN(C=1C(=C(C#N)C=CC1)C)C NUSJWYIGQQZLGC-UHFFFAOYSA-N 0.000 description 1
- 229920003043 Cellulose fiber Polymers 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- KIWBPDUYBMNFTB-UHFFFAOYSA-N Ethyl hydrogen sulfate Chemical compound CCOS(O)(=O)=O KIWBPDUYBMNFTB-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- ICGLOTCMOYCOTB-UHFFFAOYSA-N [Cl].[Zn] Chemical compound [Cl].[Zn] ICGLOTCMOYCOTB-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 238000009963 fulling Methods 0.000 description 1
- 239000004519 grease Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000002473 indoazoles Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 239000002932 luster Substances 0.000 description 1
- CZXGXYBOQYQXQD-UHFFFAOYSA-N methyl benzenesulfonate Chemical compound COS(=O)(=O)C1=CC=CC=C1 CZXGXYBOQYQXQD-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- PIDNHCNOWSXVAF-UHFFFAOYSA-N n,n,2,3,4-pentamethylaniline Chemical compound CN(C)C1=CC=C(C)C(C)=C1C PIDNHCNOWSXVAF-UHFFFAOYSA-N 0.000 description 1
- JPONLSOQEDZIOZ-UHFFFAOYSA-N n,n,2-trimethylnaphthalen-1-amine Chemical compound C1=CC=C2C(N(C)C)=C(C)C=CC2=C1 JPONLSOQEDZIOZ-UHFFFAOYSA-N 0.000 description 1
- FQILZCAXBBSGEC-UHFFFAOYSA-N n-benzyl-n,2-dimethylaniline Chemical compound C=1C=CC=C(C)C=1N(C)CC1=CC=CC=C1 FQILZCAXBBSGEC-UHFFFAOYSA-N 0.000 description 1
- UFWIBTONFRDIAS-UHFFFAOYSA-N naphthalene-acid Natural products C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N p-toluenesulfonic acid Substances CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 239000001648 tannin Substances 0.000 description 1
- 235000018553 tannin Nutrition 0.000 description 1
- 229920001864 tannin Polymers 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B44/00—Azo dyes containing onium groups
- C09B44/10—Azo dyes containing onium groups containing cyclammonium groups attached to an azo group by a carbon atom of the ring system
- C09B44/16—1,3-Diazoles or hydrogenated 1,3-diazoles ; (Benz)imidazolium
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL128007D NL128007C (enExample) | 1963-12-14 | ||
| BE657118D BE657118A (enExample) | 1963-12-14 | ||
| DEF41548A DE1242773B (de) | 1963-12-14 | 1963-12-14 | Verfahren zur Herstellung von basischen Azofarbstoffen |
| DEF44292A DE1297255B (de) | 1963-12-14 | 1964-10-23 | Verfahren zur Herstellung von basischen Azofarbstoffen |
| DEF44293A DE1292273B (de) | 1963-12-14 | 1964-10-23 | Verfahren zur Herstellung von basischen Azofarbstoffen |
| CH1604764A CH450590A (de) | 1963-12-14 | 1964-12-11 | Verfahren zur Herstellung von basischen Azofarbstoffen |
| AT1052264A AT251725B (de) | 1963-12-14 | 1964-12-11 | Verfahren zur Herstellung von neuen, wasserlöslichen, basischen Azofarbstoffen |
| AT805865A AT251727B (de) | 1963-12-14 | 1964-12-11 | Verfahren zur Herstellung von neuen, wasserlöslichen, basischen Azofarbstoffen |
| US418264A US3332930A (en) | 1963-12-14 | 1964-12-14 | Basic dialkyl benzimidazolium azo dyestuffs |
| GB50879/66A GB1087068A (en) | 1963-12-14 | 1964-12-14 | Basic benzimidazole monoazo dyestuffs and processes for their manufacture |
| FR998463A FR1420692A (fr) | 1963-12-14 | 1964-12-14 | Colorants azoïques basiques et leur préparation |
| NL6414538A NL6414538A (enExample) | 1963-12-14 | 1964-12-14 |
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF41548A DE1242773B (de) | 1963-12-14 | 1963-12-14 | Verfahren zur Herstellung von basischen Azofarbstoffen |
| DEF44292A DE1297255B (de) | 1963-12-14 | 1964-10-23 | Verfahren zur Herstellung von basischen Azofarbstoffen |
| DEF44293A DE1292273B (de) | 1963-12-14 | 1964-10-23 | Verfahren zur Herstellung von basischen Azofarbstoffen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1242773B true DE1242773B (de) | 1967-06-22 |
Family
ID=27210338
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF41548A Pending DE1242773B (de) | 1963-12-14 | 1963-12-14 | Verfahren zur Herstellung von basischen Azofarbstoffen |
| DEF44293A Pending DE1292273B (de) | 1963-12-14 | 1964-10-23 | Verfahren zur Herstellung von basischen Azofarbstoffen |
| DEF44292A Pending DE1297255B (de) | 1963-12-14 | 1964-10-23 | Verfahren zur Herstellung von basischen Azofarbstoffen |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF44293A Pending DE1292273B (de) | 1963-12-14 | 1964-10-23 | Verfahren zur Herstellung von basischen Azofarbstoffen |
| DEF44292A Pending DE1297255B (de) | 1963-12-14 | 1964-10-23 | Verfahren zur Herstellung von basischen Azofarbstoffen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3332930A (enExample) |
| AT (2) | AT251725B (enExample) |
| BE (1) | BE657118A (enExample) |
| CH (1) | CH450590A (enExample) |
| DE (3) | DE1242773B (enExample) |
| GB (1) | GB1087068A (enExample) |
| NL (2) | NL6414538A (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3948878A (en) * | 1972-02-24 | 1976-04-06 | Produits Chimiques Ugine Kuhlmann | Pyrazolium-azo-phenyl compounds |
| AR207435A1 (es) * | 1972-07-31 | 1976-10-08 | Mills D | Compouestos azoicos basicos libres de grupos acido sulfonico |
| GB1523442A (en) * | 1975-01-23 | 1978-08-31 | Ici Ltd | Cationic azo quinoline dyestuffs |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE628278A (enExample) * | ||||
| FR1291557A (fr) * | 1960-11-29 | 1962-04-27 | Cfmc | Nouveaux colorants de la série de l'indazole |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE544767A (enExample) * | 1955-01-28 | |||
| US3121710A (en) * | 1958-10-02 | 1964-02-18 | Cfmc | Quaternized monoazo dyes containing a 6-hydroxy-indazole radical |
-
0
- NL NL128007D patent/NL128007C/xx active
- BE BE657118D patent/BE657118A/xx unknown
-
1963
- 1963-12-14 DE DEF41548A patent/DE1242773B/de active Pending
-
1964
- 1964-10-23 DE DEF44293A patent/DE1292273B/de active Pending
- 1964-10-23 DE DEF44292A patent/DE1297255B/de active Pending
- 1964-12-11 AT AT1052264A patent/AT251725B/de active
- 1964-12-11 CH CH1604764A patent/CH450590A/de unknown
- 1964-12-11 AT AT805865A patent/AT251727B/de active
- 1964-12-14 US US418264A patent/US3332930A/en not_active Expired - Lifetime
- 1964-12-14 GB GB50879/66A patent/GB1087068A/en not_active Expired
- 1964-12-14 NL NL6414538A patent/NL6414538A/xx unknown
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE628278A (enExample) * | ||||
| FR1291557A (fr) * | 1960-11-29 | 1962-04-27 | Cfmc | Nouveaux colorants de la série de l'indazole |
Also Published As
| Publication number | Publication date |
|---|---|
| NL128007C (enExample) | |
| BE657118A (enExample) | |
| NL6414538A (enExample) | 1965-06-15 |
| DE1297255B (de) | 1969-06-12 |
| AT251725B (de) | 1967-01-25 |
| GB1087068A (en) | 1967-10-11 |
| US3332930A (en) | 1967-07-25 |
| CH450590A (de) | 1968-01-31 |
| DE1292273B (de) | 1969-04-10 |
| AT251727B (de) | 1967-01-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2209838A1 (de) | Azofarbstoffe | |
| DE2006131C3 (de) | Mono- und Disazofarbstoffe, Verfahren zu ihrer Herstellung und deren Verwendung zum Färben und Bedrucken von Acryl-, Nylon- oder Polypropylenfasern, sowie von estergruppenhaltigen Fasern | |
| DE1242773B (de) | Verfahren zur Herstellung von basischen Azofarbstoffen | |
| DE2600036A1 (de) | Organische verbindungen | |
| DE1919511B2 (de) | Basische Oxazinfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| CH433662A (de) | Tragvorrichtung für Deckenverkleidung | |
| DE2531445B2 (de) | Sulfogruppenfreie wasserloesliche azofarbstoffe und deren verwendung zum faerben und/oder bedrucken von synthetischen textilfasern | |
| DE2142565A1 (de) | Basische azofarbstoffe, verfahren zu ihrer herstellung und ihre verwendung | |
| DE1544458A1 (de) | Verfahren zur Herstellung basischer Farbstoffe | |
| DE2022624B2 (de) | Basischer Disazofarbstoff, Ver fahren zu dessen Herstellung und dessen Verwendung | |
| DE1927416C3 (de) | Basische Azofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1233520B (de) | Verfahren zur Herstellung von basischen Hydrazonfarbstoffen | |
| DE1098642B (de) | Verfahren zur Herstellung von kationischen Farbstoffen | |
| DE1544509C3 (de) | Basische Triazolmonoazofarbstoffe und Verfahren zu deren Herstellung | |
| DE1644239A1 (de) | Basische Azofarbstoffe und Verfahren zu ihrer Herstellung | |
| DE1619369A1 (de) | Verfahren zum Faerben und/oder Bedrucken von Textilmaterial aus Acrylnitrilpolymerisaten | |
| DE1234891B (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE1644104B2 (de) | Basiche monoazofarbstoffe | |
| DE1644093A1 (de) | Verfahren zur Herstellung von wasserloeslichen basischen Azofarbstoffen | |
| DE1644230A1 (de) | Basische Azofarbstoffe und Verfahren zu ihrer Herstellung | |
| DE2901666A1 (de) | Faerbeverfahren | |
| DE1644103C3 (de) | Basische kationische Azofarbstoffe | |
| DE1544514C (de) | Verfahren zur Herstellung von bast sehen Azofarbstoffen | |
| DE1544600C (de) | Monoazofarbstoffe sowie Ver fahren zu ihrer Herstellung und Verwendung | |
| CH496768A (de) | Verfahren zur Herstellung von basischen Azofarbstoffen |