DE1206308B - Lichtempfindliche Schicht mit gerbenden Eigenschaften - Google Patents
Lichtempfindliche Schicht mit gerbenden EigenschaftenInfo
- Publication number
- DE1206308B DE1206308B DEK43194A DEK0043194A DE1206308B DE 1206308 B DE1206308 B DE 1206308B DE K43194 A DEK43194 A DE K43194A DE K0043194 A DEK0043194 A DE K0043194A DE 1206308 B DE1206308 B DE 1206308B
- Authority
- DE
- Germany
- Prior art keywords
- weight
- parts
- diazonium
- chloride
- layers
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000011230 binding agent Substances 0.000 claims description 10
- 150000008049 diazo compounds Chemical class 0.000 claims description 5
- 239000000945 filler Substances 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- 239000000975 dye Substances 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 1
- 239000012954 diazonium Substances 0.000 description 27
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 21
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 16
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 16
- -1 amine diazo compounds Chemical class 0.000 description 14
- 238000007650 screen-printing Methods 0.000 description 14
- 239000006185 dispersion Substances 0.000 description 13
- 239000000243 solution Substances 0.000 description 13
- 239000004372 Polyvinyl alcohol Substances 0.000 description 12
- 229920002451 polyvinyl alcohol Polymers 0.000 description 12
- ATGUVEKSASEFFO-UHFFFAOYSA-N p-aminodiphenylamine Chemical compound C1=CC(N)=CC=C1NC1=CC=CC=C1 ATGUVEKSASEFFO-UHFFFAOYSA-N 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 229910052751 metal Inorganic materials 0.000 description 9
- 239000002184 metal Substances 0.000 description 9
- 238000000034 method Methods 0.000 description 9
- 150000001299 aldehydes Chemical class 0.000 description 8
- 229960002380 dibutyl phthalate Drugs 0.000 description 8
- 229920002689 polyvinyl acetate Polymers 0.000 description 8
- 239000011118 polyvinyl acetate Substances 0.000 description 8
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 7
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 6
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 6
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 6
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N butyric aldehyde Natural products CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 5
- 239000011248 coating agent Substances 0.000 description 5
- 238000000576 coating method Methods 0.000 description 5
- 239000007859 condensation product Substances 0.000 description 5
- 229910052802 copper Inorganic materials 0.000 description 5
- 239000010949 copper Substances 0.000 description 5
- 239000004952 Polyamide Substances 0.000 description 4
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 4
- 239000004744 fabric Substances 0.000 description 4
- 239000008098 formaldehyde solution Substances 0.000 description 4
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 238000010907 mechanical stirring Methods 0.000 description 4
- 229920002647 polyamide Polymers 0.000 description 4
- 229940100467 polyvinyl acetate phthalate Drugs 0.000 description 4
- 238000007639 printing Methods 0.000 description 4
- KJPRLNWUNMBNBZ-QPJJXVBHSA-N (E)-cinnamaldehyde Chemical compound O=C\C=C\C1=CC=CC=C1 KJPRLNWUNMBNBZ-QPJJXVBHSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- 229940117916 cinnamic aldehyde Drugs 0.000 description 3
- KJPRLNWUNMBNBZ-UHFFFAOYSA-N cinnamic aldehyde Natural products O=CC=CC1=CC=CC=C1 KJPRLNWUNMBNBZ-UHFFFAOYSA-N 0.000 description 3
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000002985 plastic film Substances 0.000 description 3
- 229920006255 plastic film Polymers 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 235000005074 zinc chloride Nutrition 0.000 description 3
- 239000011592 zinc chloride Substances 0.000 description 3
- XARVANDLQOZMMJ-CHHVJCJISA-N 2-[(z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxo-2-(2-oxoethylamino)ethylidene]amino]oxy-2-methylpropanoic acid Chemical group OC(=O)C(C)(C)O\N=C(/C(=O)NCC=O)C1=CSC(N)=N1 XARVANDLQOZMMJ-CHHVJCJISA-N 0.000 description 2
- QSKPIOLLBIHNAC-UHFFFAOYSA-N 2-chloro-acetaldehyde Chemical compound ClCC=O QSKPIOLLBIHNAC-UHFFFAOYSA-N 0.000 description 2
- NLGIEISQJFZTIS-UHFFFAOYSA-N 4-n-(4-chlorophenyl)benzene-1,4-diamine Chemical compound C1=CC(N)=CC=C1NC1=CC=C(Cl)C=C1 NLGIEISQJFZTIS-UHFFFAOYSA-N 0.000 description 2
- RBLUJIWKMSZIMK-UHFFFAOYSA-N 4-n-(4-methoxyphenyl)benzene-1,4-diamine Chemical compound C1=CC(OC)=CC=C1NC1=CC=C(N)C=C1 RBLUJIWKMSZIMK-UHFFFAOYSA-N 0.000 description 2
- IRIAEXORFWYRCZ-UHFFFAOYSA-N Butylbenzyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCC1=CC=CC=C1 IRIAEXORFWYRCZ-UHFFFAOYSA-N 0.000 description 2
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 2
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 2
- 229920002301 cellulose acetate Polymers 0.000 description 2
- MLUCVPSAIODCQM-NSCUHMNNSA-N crotonaldehyde Chemical compound C\C=C\C=O MLUCVPSAIODCQM-NSCUHMNNSA-N 0.000 description 2
- MLUCVPSAIODCQM-UHFFFAOYSA-N crotonaldehyde Natural products CC=CC=O MLUCVPSAIODCQM-UHFFFAOYSA-N 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 229940015043 glyoxal Drugs 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 239000011148 porous material Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- KUCOHFSKRZZVRO-UHFFFAOYSA-N terephthalaldehyde Chemical compound O=CC1=CC=C(C=O)C=C1 KUCOHFSKRZZVRO-UHFFFAOYSA-N 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- CJDLWNIPPCGBKF-UHFFFAOYSA-N 2-amino-5-(ethylamino)benzoic acid Chemical compound CCNC1=CC=C(N)C(C(O)=O)=C1 CJDLWNIPPCGBKF-UHFFFAOYSA-N 0.000 description 1
- KNBVCCQALCLFKE-UHFFFAOYSA-N 2-ethyl-3-methylbenzene-1,4-diamine Chemical compound CCC1=C(C)C(N)=CC=C1N KNBVCCQALCLFKE-UHFFFAOYSA-N 0.000 description 1
- OKNKHGRNBDFQHL-UHFFFAOYSA-N 3-(2-phenylethenyl)phthalaldehyde Chemical compound O=CC1=CC=CC(C=CC=2C=CC=CC=2)=C1C=O OKNKHGRNBDFQHL-UHFFFAOYSA-N 0.000 description 1
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 1
- AXDJCCTWPBKUKL-UHFFFAOYSA-N 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline;hydron;chloride Chemical compound Cl.C1=CC(=N)C(C)=CC1=C(C=1C=CC(N)=CC=1)C1=CC=C(N)C=C1 AXDJCCTWPBKUKL-UHFFFAOYSA-N 0.000 description 1
- JSUWBBQTCBPTNM-UHFFFAOYSA-N 4-n-(1,3-benzothiazol-2-yl)benzene-1,4-diamine Chemical compound C1=CC(N)=CC=C1NC1=NC2=CC=CC=C2S1 JSUWBBQTCBPTNM-UHFFFAOYSA-N 0.000 description 1
- XHVFCOOFJKCIAP-UHFFFAOYSA-N 4-n-(4-nitrophenyl)benzene-1,4-diamine Chemical compound C1=CC(N)=CC=C1NC1=CC=C([N+]([O-])=O)C=C1 XHVFCOOFJKCIAP-UHFFFAOYSA-N 0.000 description 1
- 229910001369 Brass Inorganic materials 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 229910000906 Bronze Inorganic materials 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 1
- ZNZYKNKBJPZETN-WELNAUFTSA-N Dialdehyde 11678 Chemical compound N1C2=CC=CC=C2C2=C1[C@H](C[C@H](/C(=C/O)C(=O)OC)[C@@H](C=C)C=O)NCC2 ZNZYKNKBJPZETN-WELNAUFTSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- SXRSQZLOMIGNAQ-UHFFFAOYSA-N Glutaraldehyde Chemical compound O=CCCCC=O SXRSQZLOMIGNAQ-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 108010058846 Ovalbumin Proteins 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- 241000978776 Senegalia senegal Species 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- PJANXHGTPQOBST-VAWYXSNFSA-N Stilbene Natural products C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 description 1
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- AMPCGOAFZFKBGH-UHFFFAOYSA-O [4-[[4-(dimethylamino)phenyl]-[4-(methylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium Chemical compound C1=CC(NC)=CC=C1C(C=1C=CC(=CC=1)N(C)C)=C1C=CC(=[N+](C)C)C=C1 AMPCGOAFZFKBGH-UHFFFAOYSA-O 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000003934 aromatic aldehydes Chemical class 0.000 description 1
- DMVOXQPQNTYEKQ-UHFFFAOYSA-N biphenyl-4-amine Chemical group C1=CC(N)=CC=C1C1=CC=CC=C1 DMVOXQPQNTYEKQ-UHFFFAOYSA-N 0.000 description 1
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- 239000010974 bronze Substances 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- JBTHDAVBDKKSRW-UHFFFAOYSA-N chembl1552233 Chemical compound CC1=CC(C)=CC=C1N=NC1=C(O)C=CC2=CC=CC=C12 JBTHDAVBDKKSRW-UHFFFAOYSA-N 0.000 description 1
- ALLOLPOYFRLCCX-UHFFFAOYSA-N chembl1986529 Chemical compound COC1=CC=CC=C1N=NC1=C(O)C=CC2=CC=CC=C12 ALLOLPOYFRLCCX-UHFFFAOYSA-N 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000011889 copper foil Substances 0.000 description 1
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000000378 dietary effect Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 238000007646 gravure printing Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000005660 hydrophilic surface Effects 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- AYOOGWWGECJQPI-NSHDSACASA-N n-[(1s)-1-(5-fluoropyrimidin-2-yl)ethyl]-3-(3-propan-2-yloxy-1h-pyrazol-5-yl)imidazo[4,5-b]pyridin-5-amine Chemical compound N1C(OC(C)C)=CC(N2C3=NC(N[C@@H](C)C=4N=CC(F)=CN=4)=CC=C3N=C2)=N1 AYOOGWWGECJQPI-NSHDSACASA-N 0.000 description 1
- 239000004745 nonwoven fabric Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229940068984 polyvinyl alcohol Drugs 0.000 description 1
- 239000005033 polyvinylidene chloride Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- BGUWFUQJCDRPTL-UHFFFAOYSA-N pyridine-4-carbaldehyde Chemical compound O=CC1=CC=NC=C1 BGUWFUQJCDRPTL-UHFFFAOYSA-N 0.000 description 1
- 229940052224 rosaniline hydrochloride Drugs 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical compound C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 1
- 235000021286 stilbenes Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 208000011117 substance-related disease Diseases 0.000 description 1
- 229940073450 sudan red Drugs 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 235000010215 titanium dioxide Nutrition 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03F—PHOTOMECHANICAL PRODUCTION OF TEXTURED OR PATTERNED SURFACES, e.g. FOR PRINTING, FOR PROCESSING OF SEMICONDUCTOR DEVICES; MATERIALS THEREFOR; ORIGINALS THEREFOR; APPARATUS SPECIALLY ADAPTED THEREFOR
- G03F7/00—Photomechanical, e.g. photolithographic, production of textured or patterned surfaces, e.g. printing surfaces; Materials therefor, e.g. comprising photoresists; Apparatus specially adapted therefor
- G03F7/004—Photosensitive materials
- G03F7/016—Diazonium salts or compounds
- G03F7/0166—Diazonium salts or compounds characterised by the non-macromolecular additives
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03F—PHOTOMECHANICAL PRODUCTION OF TEXTURED OR PATTERNED SURFACES, e.g. FOR PRINTING, FOR PROCESSING OF SEMICONDUCTOR DEVICES; MATERIALS THEREFOR; ORIGINALS THEREFOR; APPARATUS SPECIALLY ADAPTED THEREFOR
- G03F7/00—Photomechanical, e.g. photolithographic, production of textured or patterned surfaces, e.g. printing surfaces; Materials therefor, e.g. comprising photoresists; Apparatus specially adapted therefor
- G03F7/12—Production of screen printing forms or similar printing forms, e.g. stencils
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Photosensitive Polymer And Photoresist Processing (AREA)
Priority Applications (17)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL275561D NL275561A (en, 2012) | 1961-03-15 | ||
| BE615056D BE615056A (en, 2012) | 1961-03-15 | ||
| DEK43194A DE1206308B (de) | 1961-03-15 | 1961-03-15 | Lichtempfindliche Schicht mit gerbenden Eigenschaften |
| GB8973/62A GB998838A (en) | 1961-03-15 | 1962-03-08 | Light sensitive copying material |
| US179489A US3189451A (en) | 1961-03-15 | 1962-03-13 | Light sensitive reproduction material comprising a colloid containing an aldehyde and a diazotized phenyl amine compound and use thereof |
| SE2859/62A SE317257B (en, 2012) | 1961-03-15 | 1962-03-14 | |
| CH306762A CH419833A (de) | 1961-03-15 | 1962-03-14 | Lichtempfindliche gerbbare Schicht |
| DK118762A DK104664C (da) | 1961-03-15 | 1962-03-15 | Lysfølsomt diazotypikopieringsmateriale til fremstilling af trykkeplader. |
| FR891183A FR1325048A (fr) | 1961-03-15 | 1962-03-15 | Matériel de reproduction photosensible |
| DE19631447729D DE1447729B (de) | 1961-03-15 | 1963-09-26 | Lichtempfindliche Schicht mit gerbenden Eigenschaften |
| NL6410778A NL6410778A (en, 2012) | 1961-03-15 | 1964-09-16 | |
| BE653467A BE653467A (en, 2012) | 1961-03-15 | 1964-09-23 | |
| SE11430/64A SE334813B (en, 2012) | 1961-03-15 | 1964-09-23 | |
| US399106A US3322541A (en) | 1961-03-15 | 1964-09-24 | Light sensitive coatings with tanning properties |
| CH1241164A CH459760A (de) | 1961-03-15 | 1964-09-24 | Lichtempfindliche gerbbare Schicht |
| FR989300A FR86438E (fr) | 1961-03-15 | 1964-09-25 | Matériel de reproduction photosensible |
| GB39246/64A GB1069366A (en) | 1961-03-15 | 1964-09-25 | Light-sensitive copying material |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEK43194A DE1206308B (de) | 1961-03-15 | 1961-03-15 | Lichtempfindliche Schicht mit gerbenden Eigenschaften |
| DEK0050933 | 1963-09-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1206308B true DE1206308B (de) | 1965-12-02 |
Family
ID=25983383
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEK43194A Pending DE1206308B (de) | 1961-03-15 | 1961-03-15 | Lichtempfindliche Schicht mit gerbenden Eigenschaften |
| DE19631447729D Pending DE1447729B (de) | 1961-03-15 | 1963-09-26 | Lichtempfindliche Schicht mit gerbenden Eigenschaften |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19631447729D Pending DE1447729B (de) | 1961-03-15 | 1963-09-26 | Lichtempfindliche Schicht mit gerbenden Eigenschaften |
Country Status (7)
| Country | Link |
|---|---|
| US (2) | US3189451A (en, 2012) |
| BE (2) | BE653467A (en, 2012) |
| CH (2) | CH419833A (en, 2012) |
| DE (2) | DE1206308B (en, 2012) |
| GB (2) | GB998838A (en, 2012) |
| NL (2) | NL6410778A (en, 2012) |
| SE (2) | SE317257B (en, 2012) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2057473A1 (de) * | 1970-11-23 | 1972-05-25 | Kalle Ag | Lichtempfindliche Kopiermasse |
| DE2058178A1 (de) * | 1970-11-26 | 1972-05-31 | Kalle Ag | Verfahren zur Herstellung von Siebdruckformen |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL275561A (en, 2012) * | 1961-03-15 | |||
| DE1224611B (de) * | 1963-09-25 | 1966-09-08 | Kalle Ag | Lichtempfindliches Kopiermaterial fuer die Diazotypie mit 2, 5-Dialkoxy-4-tert.-aminobenzol-diazoniumsalzen |
| US3390992A (en) * | 1964-06-15 | 1968-07-02 | North American Rockwell | Non-etching circuit fabrication |
| US3463638A (en) * | 1965-08-20 | 1969-08-26 | Ibm | Heat-fixable light-sensitive compositions and elements |
| US3853561A (en) * | 1970-11-26 | 1974-12-10 | Hoechst Ag | Process for the preparation of screen printing stencils using intermediate support for light sensitive layer |
| DE2522225C2 (de) * | 1975-05-20 | 1983-12-08 | Nippon Paint Co., Ltd., Osaka | Wässriges lichtempfindliches Gemisch und seine Verwendung für die Herstellung von Siebdruckschablonen |
| US4154614A (en) * | 1975-07-02 | 1979-05-15 | Nippon Paint Co., Ltd. | Photosensitive diazo composition with graft copolymer for use in printing screen |
| FR2411432A1 (fr) * | 1977-12-09 | 1979-07-06 | Issec Labo Physicochimie Appli | Procede d'impressions couleur photochimique et dispositif pour sa mise en oeuvre |
| DE3222684A1 (de) * | 1981-06-19 | 1983-05-05 | Sericol Group Ltd., London | Lichtempfindliche zubereitung und deren verwendung |
| DE3135804A1 (de) * | 1981-09-10 | 1983-03-24 | Hoechst Ag, 6000 Frankfurt | Lichtempfindliches, diazoniumgruppen enthaltendes polykondensationsprodukt und damit hergestelltes lichtempfindliches aufzeichnungsmaterial |
| EP0363504A1 (en) * | 1988-10-10 | 1990-04-18 | Dräger Nederland B.V. | Method of providing a substrate with a layer comprising a polyvinylbased hydrogel and a biochemically active material |
| FR2866887A1 (fr) * | 2004-02-27 | 2005-09-02 | Oreal | Para-phenylenediamine secondaire n-heteroaryle, compositon tinctoriale comprenant une telle para-phenylenediamine, procede mettant en oeuvre cette composition et utilisation |
| US7329288B2 (en) | 2004-02-27 | 2008-02-12 | L'oreal S.A. | N-heteroaryl secondary para-phenylenediamine, a dye composition comprising such a para-phenylenediamine, a process for preparing this composition and use thereof |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT209359B (de) * | 1958-01-22 | 1960-06-10 | Kalle & Co Ag | Lichtempfindliches Reproduktionsmaterial, bestehend aus Schichtträger und lichtempfindlicher Kolloidschicht |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2679498A (en) * | 1954-05-25 | Atent office | ||
| DE596731C (de) * | 1932-05-23 | 1934-05-09 | Kalle & Co Akt Ges | Verfahren zur Darstellung von hoehermolekularen Diazoverbindungen |
| NL70798C (en, 2012) * | 1948-10-15 | |||
| NL150528B (nl) * | 1949-05-14 | Hollandse Signaalapparaten Bv | Werkwijze voor het vervaardigen van twistloos of nagenoeg twistloos garen en het door toepassing van deze werkwijze verkregen garen. | |
| US2690968A (en) * | 1952-10-04 | 1954-10-05 | Powers Chemco Inc | Development of diazo and azide sensitized colloids |
| BE528898A (en, 2012) * | 1953-05-28 | |||
| US2937085A (en) * | 1954-01-11 | 1960-05-17 | Ditto Inc | Composite photosensitive plate, and method of making printing plate therefrom |
| US3012886A (en) * | 1954-05-10 | 1961-12-12 | Harry H Lerner | Emulsion coating and method of preparation |
| US3029146A (en) * | 1955-02-25 | 1962-04-10 | Azoplate Corp | Reproduction material |
| BE549814A (en, 2012) * | 1955-07-29 | |||
| US3130051A (en) * | 1958-12-10 | 1964-04-21 | Gen Aniline & Film Corp | Process for producing negative working offset diazo printing plates |
| US2976152A (en) * | 1958-12-19 | 1961-03-21 | Gen Aniline & Film Corp | Photographic gelatin layers containing triazine hardeners |
| BE595534A (en, 2012) * | 1959-10-02 | |||
| NL275561A (en, 2012) * | 1961-03-15 |
-
0
- NL NL275561D patent/NL275561A/xx unknown
- BE BE615056D patent/BE615056A/xx unknown
-
1961
- 1961-03-15 DE DEK43194A patent/DE1206308B/de active Pending
-
1962
- 1962-03-08 GB GB8973/62A patent/GB998838A/en not_active Expired
- 1962-03-13 US US179489A patent/US3189451A/en not_active Expired - Lifetime
- 1962-03-14 SE SE2859/62A patent/SE317257B/xx unknown
- 1962-03-14 CH CH306762A patent/CH419833A/de unknown
-
1963
- 1963-09-26 DE DE19631447729D patent/DE1447729B/de active Pending
-
1964
- 1964-09-16 NL NL6410778A patent/NL6410778A/xx unknown
- 1964-09-23 BE BE653467A patent/BE653467A/xx unknown
- 1964-09-23 SE SE11430/64A patent/SE334813B/xx unknown
- 1964-09-24 US US399106A patent/US3322541A/en not_active Expired - Lifetime
- 1964-09-24 CH CH1241164A patent/CH459760A/de unknown
- 1964-09-25 GB GB39246/64A patent/GB1069366A/en not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT209359B (de) * | 1958-01-22 | 1960-06-10 | Kalle & Co Ag | Lichtempfindliches Reproduktionsmaterial, bestehend aus Schichtträger und lichtempfindlicher Kolloidschicht |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2057473A1 (de) * | 1970-11-23 | 1972-05-25 | Kalle Ag | Lichtempfindliche Kopiermasse |
| DE2058178A1 (de) * | 1970-11-26 | 1972-05-31 | Kalle Ag | Verfahren zur Herstellung von Siebdruckformen |
Also Published As
| Publication number | Publication date |
|---|---|
| BE653467A (en, 2012) | 1965-03-23 |
| SE317257B (en, 2012) | 1969-11-10 |
| NL6410778A (en, 2012) | 1965-03-29 |
| GB998838A (en) | 1965-07-21 |
| US3189451A (en) | 1965-06-15 |
| US3322541A (en) | 1967-05-30 |
| CH459760A (de) | 1968-07-15 |
| CH419833A (de) | 1966-08-31 |
| DE1447729B (de) | 1969-09-04 |
| GB1069366A (en) | 1967-05-17 |
| NL275561A (en, 2012) | |
| SE334813B (en, 2012) | 1971-05-03 |
| BE615056A (en, 2012) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1206308B (de) | Lichtempfindliche Schicht mit gerbenden Eigenschaften | |
| DE1289741B (de) | Verwendung von Kondensationsprodukten des Diazodiphenylamins zum Vorsensibilisieren von Siebdruckmaterial | |
| DE737289C (de) | Lichtempfindliches photographisches Material | |
| DE2218821A1 (de) | Polyamid-Diazoharzmasse | |
| DE1254466B (de) | Kopiermaterial fuer die photomechanische Herstellung von Druckformen und Verfahren zur Herstellung von Druckformen | |
| DE1214086B (de) | Kopierschichten fuer den Flach- und Offsetdruck | |
| DE1422468B2 (de) | Verfahren zur herstellung von lithographischen druckplatten | |
| DE1447022B2 (de) | Vorsensibilisierte flachdruckplatte | |
| DE1237899B (de) | Verfahren zur Herstellung von vorsensibilisierten Flachdruckfolien | |
| DE1055957B (de) | Lichtempfindliche Kopierschichten zur Herstellung von Flachdruckformen von hoher mechanischer Widerstandsfaehigkeit | |
| DE1572068C3 (de) | Lichtempfindliche Schicht zur Herstellung von Druckformen | |
| DE1286898B (de) | Lichtempfindliche Schicht | |
| DE821759C (de) | Verfahren zur Herstellung von Diazotypie-Zwischenkopien | |
| DE876951C (de) | Lichtempfindliches Material zur Herstellung von Druckformen | |
| DE1123204B (de) | Fuer die Herstellung von Siebdruckschablonen bestimmtes Kopiermaterial mit lichtempfindlichen Gerbschichten | |
| DE3222684A1 (de) | Lichtempfindliche zubereitung und deren verwendung | |
| DE604973C (de) | Lichtempfindliche Schicht, insbesondere fuer die Photographie und Reproduktion | |
| DE1572067A1 (de) | Lichtempfindliche Schicht zur Herstellung von Druckformen | |
| DE838548C (de) | Herstellung von Papierdruckfolien fuer Flach- und Offsetdruck mit Hilfe von lichtempfindlichen Diazoverbindungen und Material zur Durchfuehrung des Verfahrens | |
| DE879056C (de) | Verfahren zur Herstellung von Flachdruckformen | |
| DE972998C (de) | Verfahren zur Herstellung von Gerbbildern aus Kunststoffen zur Verwendung als Druckformen | |
| DE1904764A1 (de) | Positiv arbeitende lichtempfindliche Flachdruckplatten und Verfahren zu ihrer Herstellung | |
| DE1572066C3 (de) | Lichtempfindliche Schicht zur Herstellung von Druckformen | |
| DE1929375A1 (de) | Lichtempfindliche Druckplatte | |
| AT109399B (de) | Verfahren zur Härtung von Kolloiden. |