DE1188078B - Verfahren zur Herstellung von Benzolsulfonylharnstoffen - Google Patents
Verfahren zur Herstellung von BenzolsulfonylharnstoffenInfo
- Publication number
- DE1188078B DE1188078B DEF38953A DEF0038953A DE1188078B DE 1188078 B DE1188078 B DE 1188078B DE F38953 A DEF38953 A DE F38953A DE F0038953 A DEF0038953 A DE F0038953A DE 1188078 B DE1188078 B DE 1188078B
- Authority
- DE
- Germany
- Prior art keywords
- benzenesulfonyl
- formula
- molecular weight
- low molecular
- substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title claims description 6
- -1 isourea ethers Chemical class 0.000 claims description 42
- 150000003839 salts Chemical class 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 6
- 235000013877 carbamide Nutrition 0.000 claims description 6
- UJYAZVSPFMJCLW-UHFFFAOYSA-N n-(oxomethylidene)benzenesulfonamide Chemical class O=C=NS(=O)(=O)C1=CC=CC=C1 UJYAZVSPFMJCLW-UHFFFAOYSA-N 0.000 claims description 6
- 150000003672 ureas Chemical class 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 239000012948 isocyanate Substances 0.000 claims description 5
- 150000002513 isocyanates Chemical class 0.000 claims description 5
- 125000002252 acyl group Chemical group 0.000 claims description 4
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 claims description 4
- 238000007127 saponification reaction Methods 0.000 claims description 4
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 4
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical class NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims description 4
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical class NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 claims description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 3
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 150000008331 benzenesulfonamides Chemical class 0.000 claims description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical group OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 150000007524 organic acids Chemical group 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 14
- 238000002844 melting Methods 0.000 description 12
- 230000008018 melting Effects 0.000 description 12
- 239000000706 filtrate Substances 0.000 description 9
- 235000011121 sodium hydroxide Nutrition 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 239000008280 blood Substances 0.000 description 7
- 210000004369 blood Anatomy 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000003610 charcoal Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 4
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- SWSXEZOUBBVKCO-UHFFFAOYSA-N 1-isocyanato-4-methylcyclohexane Chemical compound CC1CCC(N=C=O)CC1 SWSXEZOUBBVKCO-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- GHDLZGOOOLEJKI-UHFFFAOYSA-N benzenesulfonylurea Chemical class NC(=O)NS(=O)(=O)C1=CC=CC=C1 GHDLZGOOOLEJKI-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 2
- WUESWDIHTKHGQA-UHFFFAOYSA-N cyclohexylurea Chemical compound NC(=O)NC1CCCCC1 WUESWDIHTKHGQA-UHFFFAOYSA-N 0.000 description 2
- HSOHBWMXECKEKV-UHFFFAOYSA-N cyclooctanamine Chemical compound NC1CCCCCCC1 HSOHBWMXECKEKV-UHFFFAOYSA-N 0.000 description 2
- 206010012601 diabetes mellitus Diseases 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 2
- 230000005923 long-lasting effect Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical class OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 description 2
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- GWEHVDNNLFDJLR-UHFFFAOYSA-N 1,3-diphenylurea Chemical compound C=1C=CC=CC=1NC(=O)NC1=CC=CC=C1 GWEHVDNNLFDJLR-UHFFFAOYSA-N 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 244000265913 Crataegus laevigata Species 0.000 description 1
- DQNHNVJSWPPXFY-UHFFFAOYSA-N N-cyclooctylurea Chemical compound NC(=O)NC1CCCCCCC1 DQNHNVJSWPPXFY-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 229940100389 Sulfonylurea Drugs 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 1
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 description 1
- ZVQOOHYFBIDMTQ-UHFFFAOYSA-N [methyl(oxido){1-[6-(trifluoromethyl)pyridin-3-yl]ethyl}-lambda(6)-sulfanylidene]cyanamide Chemical compound N#CN=S(C)(=O)C(C)C1=CC=C(C(F)(F)F)N=C1 ZVQOOHYFBIDMTQ-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229940125708 antidiabetic agent Drugs 0.000 description 1
- 239000003472 antidiabetic agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001716 carbazoles Chemical class 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- NQOJWOIPQBVKKX-UHFFFAOYSA-N cyclooctane Chemical compound [CH]1CCCCCCC1 NQOJWOIPQBVKKX-UHFFFAOYSA-N 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- JCNLHDHXQVZQAM-UHFFFAOYSA-N isocyanatocycloheptane Chemical compound O=C=NC1CCCCCC1 JCNLHDHXQVZQAM-UHFFFAOYSA-N 0.000 description 1
- QYKPRMWZTPVYJC-UHFFFAOYSA-N isocyanatocyclooctane Chemical compound O=C=NC1CCCCCCC1 QYKPRMWZTPVYJC-UHFFFAOYSA-N 0.000 description 1
- 229940101209 mercuric oxide Drugs 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- VRVYXGWCAQXNEB-UHFFFAOYSA-N n-(2-methyl-3-sulfamoylphenyl)acetamide Chemical compound CC(=O)NC1=CC=CC(S(N)(=O)=O)=C1C VRVYXGWCAQXNEB-UHFFFAOYSA-N 0.000 description 1
- AHQONKCJXWTTOW-UHFFFAOYSA-N n-[(4-sulfamoylphenyl)methyl]acetamide Chemical compound CC(=O)NCC1=CC=C(S(N)(=O)=O)C=C1 AHQONKCJXWTTOW-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- PFUVRDFDKPNGAV-UHFFFAOYSA-N sodium peroxide Chemical compound [Na+].[Na+].[O-][O-] PFUVRDFDKPNGAV-UHFFFAOYSA-N 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- QXKXDIKCIPXUPL-UHFFFAOYSA-N sulfanylidenemercury Chemical compound [Hg]=S QXKXDIKCIPXUPL-UHFFFAOYSA-N 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/50—Compounds containing any of the groups, X being a hetero atom, Y being any atom
- C07C311/52—Y being a hetero atom
- C07C311/54—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea
- C07C311/57—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea having sulfur atoms of the sulfonylurea groups bound to carbon atoms of six-membered aromatic rings
- C07C311/59—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea having sulfur atoms of the sulfonylurea groups bound to carbon atoms of six-membered aromatic rings having nitrogen atoms of the sulfonylurea groups bound to carbon atoms of rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (19)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1052113D GB1052113A (enExample) | 1963-02-07 | ||
| DEF38953A DE1188078B (de) | 1963-02-07 | 1963-02-07 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| CH49867A CH468979A (de) | 1963-02-07 | 1964-02-04 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| CH49967A CH449603A (de) | 1963-02-07 | 1964-02-04 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| CH128064A CH448050A (de) | 1963-02-07 | 1964-02-04 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| CH50067A CH449604A (de) | 1963-02-07 | 1964-02-04 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| AT92964A AT253521B (de) | 1963-02-07 | 1964-02-05 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen |
| AT33066A AT254897B (de) | 1963-02-07 | 1964-02-05 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen und deren Salzen |
| AT33266A AT257629B (de) | 1963-02-07 | 1964-02-05 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen und deren Salzen |
| AT33166A AT257628B (de) | 1963-02-07 | 1964-02-05 | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen und deren Salzen |
| DK58664AA DK111817B (da) | 1963-02-07 | 1964-02-06 | Fremgangsmåde til fremstilling af benzensulfonylurinstoffer eller salte deraf. |
| NL6400975A NL6400975A (enExample) | 1963-02-07 | 1964-02-06 | |
| FR962976A FR1384309A (fr) | 1963-02-07 | 1964-02-07 | Procédé de préparation de benzène-sulfonyl-urées |
| BE643527A BE643527A (enExample) | 1963-02-07 | 1964-02-07 | |
| BR156764/64A BR6456764D0 (pt) | 1963-02-07 | 1964-02-07 | Processo para a preparacao de benzenossulfonil-ureias |
| FR973506A FR3497M (fr) | 1963-02-07 | 1964-05-06 | Médicament hypoglycémiant a base de sulfonyl-urée. |
| DK158865AA DK117293B (da) | 1963-02-07 | 1965-03-26 | Analogifremgangsmåde til fremstilling af benzensulfonylurinstoffer eller salte deraf. |
| DK158765AA DK117292B (da) | 1963-02-07 | 1965-03-26 | Analogifremgangsmåde til fremstilling af benzensulfonylurinstoffer eller salte deraf. |
| DK158665AA DK117224B (da) | 1963-02-07 | 1965-03-26 | Analogifremgangsmåde til fremstilling af benzensulfonylurinstoffer eller salte deraf. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF38953A DE1188078B (de) | 1963-02-07 | 1963-02-07 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1188078B true DE1188078B (de) | 1965-03-04 |
Family
ID=7097559
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF38953A Pending DE1188078B (de) | 1963-02-07 | 1963-02-07 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
Country Status (9)
| Country | Link |
|---|---|
| AT (4) | AT254897B (enExample) |
| BE (1) | BE643527A (enExample) |
| BR (1) | BR6456764D0 (enExample) |
| CH (4) | CH468979A (enExample) |
| DE (1) | DE1188078B (enExample) |
| DK (4) | DK111817B (enExample) |
| FR (2) | FR1384309A (enExample) |
| GB (1) | GB1052113A (enExample) |
| NL (1) | NL6400975A (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH505829A (de) * | 1968-03-14 | 1971-04-15 | Ciba Geigy Ag | Verfahren zur Herstellung von neuen Derivaten des p-Aminoalkylbenzolsulfonamids |
| BE754597A (fr) * | 1969-08-08 | 1971-02-08 | Geigy Ag J R | Alkyl-benzene-sulfonamides et medicaments contenant de tels composes |
-
0
- GB GB1052113D patent/GB1052113A/en active Active
-
1963
- 1963-02-07 DE DEF38953A patent/DE1188078B/de active Pending
-
1964
- 1964-02-04 CH CH49867A patent/CH468979A/de unknown
- 1964-02-04 CH CH49967A patent/CH449603A/de unknown
- 1964-02-04 CH CH128064A patent/CH448050A/de unknown
- 1964-02-04 CH CH50067A patent/CH449604A/de unknown
- 1964-02-05 AT AT33066A patent/AT254897B/de active
- 1964-02-05 AT AT33266A patent/AT257629B/de active
- 1964-02-05 AT AT92964A patent/AT253521B/de active
- 1964-02-05 AT AT33166A patent/AT257628B/de active
- 1964-02-06 NL NL6400975A patent/NL6400975A/xx unknown
- 1964-02-06 DK DK58664AA patent/DK111817B/da unknown
- 1964-02-07 BE BE643527A patent/BE643527A/xx unknown
- 1964-02-07 BR BR156764/64A patent/BR6456764D0/pt unknown
- 1964-02-07 FR FR962976A patent/FR1384309A/fr not_active Expired
- 1964-05-06 FR FR973506A patent/FR3497M/fr active Active
-
1965
- 1965-03-26 DK DK158665AA patent/DK117224B/da unknown
- 1965-03-26 DK DK158865AA patent/DK117293B/da unknown
- 1965-03-26 DK DK158765AA patent/DK117292B/da unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AT257628B (de) | 1967-10-10 |
| FR3497M (fr) | 1965-08-23 |
| GB1052113A (enExample) | |
| NL6400975A (enExample) | 1964-08-10 |
| DK117224B (da) | 1970-03-31 |
| DK117293B (da) | 1970-04-13 |
| DK117292B (da) | 1970-04-13 |
| CH449604A (de) | 1968-01-15 |
| FR1384309A (fr) | 1965-01-04 |
| AT257629B (de) | 1967-10-10 |
| AT253521B (de) | 1967-04-10 |
| CH449603A (de) | 1968-01-15 |
| BE643527A (enExample) | 1964-08-07 |
| AT254897B (de) | 1967-06-12 |
| CH468979A (de) | 1969-02-28 |
| CH448050A (de) | 1967-12-15 |
| BR6456764D0 (pt) | 1973-08-14 |
| DK111817B (da) | 1968-10-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1185180B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1543564A1 (de) | Benzolsulfonylharnstoffe und Verfahren zu ihrer Herstellung | |
| DE1188078B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1198354B (de) | Verfahren zur Herstellung von Benzol-sulfonylharnstoffen | |
| DE1179200B (de) | Verfahren zur Herstellung von N-Benzolsulfonyl-N'-methyl-cyclohexylharnstoffen | |
| DE1568648C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE2256979C3 (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1188589B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| DE1518816B2 (de) | Benzolsulfony!harnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1251753B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| CH375706A (de) | Verfahren zur Herstellung von oral wirksamen Antidiabetika | |
| DE1153357B (de) | Verfahren zur Herstellung von Azidobenzolsulfonylharnstoffen | |
| DE1443878C (de) | Verfahren zur Herstellung von Benzol= sulfonylharnstoffen | |
| DE1518846C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| AT201608B (de) | Verfahren zur Herstellung von neuen Sulfonylharnstoffen | |
| DE1443890C (de) | Benzolsulfonyl Harnstoffe und Verfahren zu ihrer Herstellung | |
| DE1443908C3 (de) | Benzolsulfonylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Mittel | |
| DE1135891B (de) | Verfahren zur Herstellung von Benzolsulfonylharnstoffen | |
| AT228798B (de) | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen | |
| DE1443898C (de) | Benzolsulfonylharnstoffe, Verfahren zu deren Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE974506C (de) | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen | |
| DE1793111C3 (de) | Acylaminoäthylbenzolsulfonyl-delta hoch 2-cyclohexenyl-harnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1493670C (de) | Benzolsulfonylharnstoffe und deren pharmakologisch nicht giftige Salze so wie Verfahren zu deren Herstellung und diese enthaltende blutzucker senkende Mittel | |
| AT216521B (de) | Verfahren zur Herstellung von neuen Benzolsulfonylharnstoffen | |
| DE1443894C (de) | Benzolsulfonylharnstoffe, Verfahren zu deren Herstellung und diese enthaltende pharmazeutische Präparate |