DE1182820B - Verfahren zum Herstellen von Spritzgussteilen aus Polyester-Spritzgussmassen - Google Patents
Verfahren zum Herstellen von Spritzgussteilen aus Polyester-SpritzgussmassenInfo
- Publication number
- DE1182820B DE1182820B DEV22843A DEV0022843A DE1182820B DE 1182820 B DE1182820 B DE 1182820B DE V22843 A DEV22843 A DE V22843A DE V0022843 A DEV0022843 A DE V0022843A DE 1182820 B DE1182820 B DE 1182820B
- Authority
- DE
- Germany
- Prior art keywords
- molded parts
- polyester
- injection molded
- injection molding
- molding compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920000728 polyester Polymers 0.000 title claims description 24
- 238000002347 injection Methods 0.000 title claims description 19
- 239000007924 injection Substances 0.000 title claims description 19
- 238000004519 manufacturing process Methods 0.000 title claims description 10
- 239000004413 injection moulding compound Substances 0.000 title claims description 5
- 238000000034 method Methods 0.000 title description 5
- WSSSPWUEQFSQQG-UHFFFAOYSA-N 4-methyl-1-pentene Chemical compound CC(C)CC=C WSSSPWUEQFSQQG-UHFFFAOYSA-N 0.000 claims description 20
- 150000001336 alkenes Chemical class 0.000 claims description 8
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 8
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 8
- 229920000642 polymer Polymers 0.000 claims description 7
- 229920006395 saturated elastomer Polymers 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 150000001991 dicarboxylic acids Chemical class 0.000 claims description 3
- 150000002009 diols Chemical class 0.000 claims description 2
- -1 aromatic dicarboxylic acids Chemical class 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 238000001746 injection moulding Methods 0.000 description 5
- 239000000155 melt Substances 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 238000000465 moulding Methods 0.000 description 5
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 5
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 4
- 229920000139 polyethylene terephthalate Polymers 0.000 description 4
- 239000005020 polyethylene terephthalate Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 229920000098 polyolefin Polymers 0.000 description 3
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 238000000265 homogenisation Methods 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 1
- 238000000137 annealing Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 229920006305 unsaturated polyester Polymers 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000004246 zinc acetate Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L67/00—Compositions of polyesters obtained by reactions forming a carboxylic ester link in the main chain; Compositions of derivatives of such polymers
- C08L67/02—Polyesters derived from dicarboxylic acids and dihydroxy compounds
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B29—WORKING OF PLASTICS; WORKING OF SUBSTANCES IN A PLASTIC STATE IN GENERAL
- B29C—SHAPING OR JOINING OF PLASTICS; SHAPING OF MATERIAL IN A PLASTIC STATE, NOT OTHERWISE PROVIDED FOR; AFTER-TREATMENT OF THE SHAPED PRODUCTS, e.g. REPAIRING
- B29C45/00—Injection moulding, i.e. forcing the required volume of moulding material through a nozzle into a closed mould; Apparatus therefor
- B29C45/0001—Injection moulding, i.e. forcing the required volume of moulding material through a nozzle into a closed mould; Apparatus therefor characterised by the choice of material
Landscapes
- Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Mechanical Engineering (AREA)
- Health & Medical Sciences (AREA)
- Manufacturing & Machinery (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Injection Moulding Of Plastics Or The Like (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Manufacture Of Macromolecular Shaped Articles (AREA)
- Polyesters Or Polycarbonates (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE634942D BE634942A (enExample) | 1962-07-27 | ||
| NL295738D NL295738A (enExample) | 1962-07-27 | ||
| NL136859D NL136859C (enExample) | 1962-07-27 | ||
| DEV22843A DE1182820B (de) | 1962-07-27 | 1962-07-27 | Verfahren zum Herstellen von Spritzgussteilen aus Polyester-Spritzgussmassen |
| CH800263A CH417943A (de) | 1962-07-27 | 1963-06-28 | Verfahren zur Herstellung von formfesten Spritzgussartikeln aus Polyestern aromatischer Dicarbonsäuren |
| US296380A US3361848A (en) | 1962-07-27 | 1963-07-19 | Injection molded polyester/polyolefin blends |
| GB29550/63A GB993770A (en) | 1962-07-27 | 1963-07-25 | A process for the production of injection-moulded articles from aromatic polyesters |
| AT596463A AT252574B (de) | 1962-07-27 | 1963-07-25 | Verfahren zur Herstellung von formfesten Spritzgußartikeln aus Polyestern aromatischer Dicarbonsäuren und gesättigter Diole |
| FR942796A FR1370232A (fr) | 1962-07-27 | 1963-07-26 | Procédé de fabrication d'articles rigides en polyesters d'acides aromatiques dicarboxyliques |
| US674713A US3504080A (en) | 1962-07-27 | 1967-10-12 | Method of producing dimensionally - stable injection molded polyesters |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEV22843A DE1182820B (de) | 1962-07-27 | 1962-07-27 | Verfahren zum Herstellen von Spritzgussteilen aus Polyester-Spritzgussmassen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1182820B true DE1182820B (de) | 1964-12-03 |
Family
ID=7580134
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEV22843A Pending DE1182820B (de) | 1962-07-27 | 1962-07-27 | Verfahren zum Herstellen von Spritzgussteilen aus Polyester-Spritzgussmassen |
Country Status (7)
| Country | Link |
|---|---|
| US (2) | US3361848A (enExample) |
| AT (1) | AT252574B (enExample) |
| BE (1) | BE634942A (enExample) |
| CH (1) | CH417943A (enExample) |
| DE (1) | DE1182820B (enExample) |
| GB (1) | GB993770A (enExample) |
| NL (2) | NL295738A (enExample) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1270282B (de) * | 1965-02-15 | 1968-06-12 | Archer Daniels Midland Co | Formmassen, die Alkydharze enthalten |
| DE1273193B (de) * | 1965-11-25 | 1968-07-18 | Glanzstoff Ag | Spritzgussmassen, die Polyaethylenterephthalat und polymere Olefine enthalten |
| US3435093A (en) * | 1965-12-17 | 1969-03-25 | Du Pont | Polymer blends of polyethylene terephthalate and alpha-olefin,alpha,beta-unsaturated carboxylic acid copolymers |
| DE2255654A1 (de) * | 1971-11-15 | 1973-05-24 | Gen Electric | Polyesterlegierungen und formmassen, die polyesterlegierungen enthalten |
| US3960807A (en) * | 1974-09-30 | 1976-06-01 | Minnesota Mining And Manufacturing Company | Thermoformed polyester articles having impact resistance and high temperature dimensional stability |
| US5089309A (en) * | 1988-11-17 | 1992-02-18 | Shiseido Co., Ltd. | Semitransparent resin container with pearly luster |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3534120A (en) * | 1966-05-11 | 1970-10-13 | Kanebo Ltd | Copolyester filaments containing minor amount of polyolefins |
| FR1580834A (enExample) * | 1968-01-04 | 1969-09-12 | ||
| US3546320A (en) * | 1968-03-25 | 1970-12-08 | Sun Oil Co | Polyalkylene terephthalate molding composition |
| US3923726A (en) * | 1969-06-09 | 1975-12-02 | Minnesota Mining & Mfg | Process of making colored high temperature polymers |
| JPS5028459B1 (enExample) * | 1970-12-21 | 1975-09-16 | ||
| US3988399A (en) * | 1971-04-02 | 1976-10-26 | Raychem Corporation | Heat recoverable articles and methods therefor |
| GB1382363A (en) * | 1971-10-01 | 1975-01-29 | Gen Electric | Reinforced thermoplastic compositions |
| US4013613A (en) * | 1971-10-01 | 1977-03-22 | General Electric Company | Reinforced intercrystalline thermoplastic polyester compositions |
| US4046837A (en) * | 1972-09-25 | 1977-09-06 | Eastman Kodak Company | Polyester-polyolefin blend film or coating composition |
| GB1416066A (en) * | 1972-09-27 | 1975-12-03 | Conwed Corp | Lubricant for the production of nylon and polytetramethylene terephthalate net-like structures |
| DE2457148C3 (de) * | 1973-12-04 | 1979-01-11 | Mitsubishi Rayon Co. Ltd., Tokio | Flammfeste Harzmassen |
| JPS558022B2 (enExample) * | 1975-02-10 | 1980-03-01 | ||
| US4187113A (en) | 1975-11-05 | 1980-02-05 | Imperial Chemical Industries Limited | Voided films of polyester with polyolefin particles |
| US4222928A (en) * | 1977-11-09 | 1980-09-16 | Teijin Limited | Polyester composition |
| US4155952A (en) * | 1977-11-14 | 1979-05-22 | Eastman Kodak Company | Polyester/low-viscosity polyethylene melt blends for powder adhesives or powder coating materials and process for making same |
| US4217426A (en) * | 1977-11-14 | 1980-08-12 | Eastman Kodak Company | Polyester/low-viscosity polyethylene melt blends for powder adhesives or powder coating materials |
| US4290937A (en) * | 1977-12-30 | 1981-09-22 | General Electric Company | Thermoplastic molding compositions |
| US4185047A (en) * | 1977-12-30 | 1980-01-22 | General Electric Company | Thermoplastic molding compositions |
| US4460729A (en) * | 1982-05-13 | 1984-07-17 | Ethyl Corporation | Polyester composition |
| JPH0418446A (ja) * | 1990-05-14 | 1992-01-22 | Shiseido Co Ltd | 真珠光沢を有する半透明樹脂容器 |
| US5118760A (en) * | 1990-12-26 | 1992-06-02 | Eastman Kodak Company | Impact resistant polymer blends |
| JPH06102365B2 (ja) * | 1991-02-27 | 1994-12-14 | 豊田合成株式会社 | 長尺成形品の製造方法 |
| US5208277A (en) * | 1991-07-15 | 1993-05-04 | Phillips Petroleum Company | Glass reinforced blends of higher α-olefins and polyesters optionally compatibilized with carboxylated polyolefins |
| JPH069860A (ja) * | 1991-10-15 | 1994-01-18 | Du Pont Japan Ltd | ポリエステル樹脂組成物 |
| US5786284A (en) * | 1993-04-08 | 1998-07-28 | Unitika, Ltd. | Filament having plexifilamentary structure, nonwoven fabric comprising said filament and their production |
| JP3249302B2 (ja) * | 1994-08-03 | 2002-01-21 | ワイケイケイ株式会社 | パール調光沢を有するファスナー用線状材料の製造方法 |
| US5620797A (en) * | 1995-09-05 | 1997-04-15 | Mallonee; William C. | Polypropylene and polyester conjugate carpet face yarn |
| US5811040A (en) * | 1994-11-14 | 1998-09-22 | Mallonee; William C. | Process of making fiber for carpet face yarn |
| US20040180200A1 (en) * | 1994-11-14 | 2004-09-16 | Luca Bertamini | Polyolefin-based synthetic fibers and method therefor |
| US5741448A (en) * | 1996-03-14 | 1998-04-21 | Reichhold Chemicals, Inc. | Shrink-controlled resin composition |
| US6353762B1 (en) * | 1999-04-30 | 2002-03-05 | Medtronic, Inc. | Techniques for selective activation of neurons in the brain, spinal cord parenchyma or peripheral nerve |
| US7588581B2 (en) * | 2002-03-26 | 2009-09-15 | Medtronic, Inc. | Placement of chronic micro-catheter device and method |
| US8088851B1 (en) * | 2005-10-26 | 2012-01-03 | Henkel Corporation | Polyacrylate compositions |
| US8119724B1 (en) * | 2006-10-13 | 2012-02-21 | Henkel Corporation | Shrinkage-resistant polymers |
| EP2079322A1 (en) * | 2006-10-18 | 2009-07-22 | Symrise GmbH & Co. KG | Substituted bicycloý4.1.0¨heptane-7-carboxylic acid amides and derivatives thereof as food flavor substances |
| US8088850B1 (en) * | 2007-05-30 | 2012-01-03 | Henkel Corporation | Polyacrylate compositions |
| US9243083B2 (en) | 2008-04-03 | 2016-01-26 | Henkel IP & Holding GmbH | Thiol-ene cured oil-resistant polyacrylate sealants for in-place gasketing applications |
| AU2024201331B1 (en) * | 2024-02-28 | 2025-01-23 | Fullthom Pty Ltd | Composite material and method |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1003379B (de) * | 1955-07-21 | 1957-02-28 | Weber & Wirth | Verfahren zur Herstellung von Spachtel- bzw. Ausfuellmassen |
| FR1148285A (fr) * | 1955-07-06 | 1957-12-05 | Ruetgerswerke Ag | Perfectionnements apportés aux procédés pour fabriquer des pièces moulées |
| FR1283536A (fr) * | 1961-03-08 | 1962-02-02 | Kureha Kasei Kabushiki Kaisha | Produits à base de polyoléfines cristallines |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1183427A (en) * | 1912-02-23 | 1916-05-16 | Nat Carbon Co | Method of forming bodies form plastic material. |
| US2443735A (en) * | 1939-04-01 | 1948-06-22 | American Cyanamid Co | Emulsion copolymerization of unsaturated alkyd resins |
| US3025567A (en) * | 1957-08-19 | 1962-03-20 | Owens Illinois Glass Co | Method and apparatus for low pressure molding |
| NL252881A (enExample) * | 1959-07-01 | |||
| BE609226A (enExample) * | 1960-10-19 | 1900-01-01 | ||
| FR1282373A (fr) * | 1961-02-17 | 1962-01-19 | Hoechst Ag | Fermeture à curseur |
| US3152380A (en) * | 1961-05-05 | 1964-10-13 | Du Pont | Process for treating polypropylene fibers |
| US3257489A (en) * | 1961-11-28 | 1966-06-21 | Du Pont | Process for improving gauge of organic, thermoplastic, crystallizable polymeric film by stretching during heat treating |
| US3256367A (en) * | 1962-08-14 | 1966-06-14 | Union Carbide Corp | Polypropylene compositions having improved impact strength containing polyethylene and ethylene-propylene copolymer |
| US3322854A (en) * | 1963-04-06 | 1967-05-30 | Kurashiki Rayon Co | Method of mixing polystyrene with linear polyesters |
-
0
- BE BE634942D patent/BE634942A/xx unknown
- NL NL136859D patent/NL136859C/xx active
- NL NL295738D patent/NL295738A/xx unknown
-
1962
- 1962-07-27 DE DEV22843A patent/DE1182820B/de active Pending
-
1963
- 1963-06-28 CH CH800263A patent/CH417943A/de unknown
- 1963-07-19 US US296380A patent/US3361848A/en not_active Expired - Lifetime
- 1963-07-25 AT AT596463A patent/AT252574B/de active
- 1963-07-25 GB GB29550/63A patent/GB993770A/en not_active Expired
-
1967
- 1967-10-12 US US674713A patent/US3504080A/en not_active Expired - Lifetime
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1148285A (fr) * | 1955-07-06 | 1957-12-05 | Ruetgerswerke Ag | Perfectionnements apportés aux procédés pour fabriquer des pièces moulées |
| DE1003379B (de) * | 1955-07-21 | 1957-02-28 | Weber & Wirth | Verfahren zur Herstellung von Spachtel- bzw. Ausfuellmassen |
| FR1283536A (fr) * | 1961-03-08 | 1962-02-02 | Kureha Kasei Kabushiki Kaisha | Produits à base de polyoléfines cristallines |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1270282B (de) * | 1965-02-15 | 1968-06-12 | Archer Daniels Midland Co | Formmassen, die Alkydharze enthalten |
| DE1273193B (de) * | 1965-11-25 | 1968-07-18 | Glanzstoff Ag | Spritzgussmassen, die Polyaethylenterephthalat und polymere Olefine enthalten |
| US3435093A (en) * | 1965-12-17 | 1969-03-25 | Du Pont | Polymer blends of polyethylene terephthalate and alpha-olefin,alpha,beta-unsaturated carboxylic acid copolymers |
| DE2255654A1 (de) * | 1971-11-15 | 1973-05-24 | Gen Electric | Polyesterlegierungen und formmassen, die polyesterlegierungen enthalten |
| US3960807A (en) * | 1974-09-30 | 1976-06-01 | Minnesota Mining And Manufacturing Company | Thermoformed polyester articles having impact resistance and high temperature dimensional stability |
| US5089309A (en) * | 1988-11-17 | 1992-02-18 | Shiseido Co., Ltd. | Semitransparent resin container with pearly luster |
Also Published As
| Publication number | Publication date |
|---|---|
| NL136859C (enExample) | 1900-01-01 |
| CH417943A (de) | 1966-07-31 |
| AT252574B (de) | 1967-02-27 |
| BE634942A (enExample) | 1900-01-01 |
| NL295738A (enExample) | 1900-01-01 |
| US3361848A (en) | 1968-01-02 |
| GB993770A (en) | 1965-06-02 |
| US3504080A (en) | 1970-03-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1182820B (de) | Verfahren zum Herstellen von Spritzgussteilen aus Polyester-Spritzgussmassen | |
| DE1273193C2 (de) | Verwendung von formmassen aus polyaethylenterephthalat und polymeren olefinen fuer spritzgussmassen | |
| DE2907729C2 (de) | Verstärkungs- oder Füllstoffmaterial enthaltende Polyäthylenterephthalat-Zusammensetzung | |
| DE2907779C2 (de) | Verstärkungs- oder Füllmaterial enthaltende Polyäthylenterephthalat-Zusammensetzung | |
| DE1694296B2 (de) | Herstellung von formstabilen und schlagfesten Spritzgußteilen aus PoIyäthylenterephthalat-Gemi sehen | |
| DE2022011C3 (de) | Glycerintrimontanate, Verfahren zu ihrer Herstellung und deren Verwendung | |
| DE1694200A1 (de) | Thermoplastische Formmassen | |
| DE2525513A1 (de) | Stabilisierte polyalkylenharz- gemische | |
| DE2400097A1 (de) | Verfahren zur steigerung der schmelzelastizitaet von hochmolekularen linearen polyesterharzen | |
| DE1236793B (de) | Verfahren zur Herstellung von Formkoerpern auf der Basis von Polyaddukten | |
| DE1694204A1 (de) | Thermoplastische Formmassen aus Polyestern | |
| DE1945101A1 (de) | Thermoplastische Formmassen auf Basis gesaettigter Polyester | |
| DE2359012A1 (de) | Herstellung von polyesterharzen mit verbesserten presseigenschaften | |
| DE1694186A1 (de) | Thermoplastische Formmassen | |
| DE1694199A1 (de) | Thermoplastische Formmassen aus Polyestern | |
| DE69132608T2 (de) | Zusammensetzung aus äthylen-kohlenmonoxid-copolymeren | |
| DE2540639B2 (enExample) | ||
| DE60116638T9 (de) | Auf erneuerbaren Rohmaterialien basierende Zusammensetzung | |
| DE1545174A1 (de) | Verfahren zur Herstellung von Formgebilden aus Polyglykolid | |
| AT236652B (de) | Preß-, Spritz- oder Gießmasse | |
| AT203207B (de) | Verfahren zur Vergütung von Polymerisaten des Propylens | |
| DE2037335A1 (de) | Organopolysiloxanharzmassen und Ver fahren zur Herstellung von Formartikeln aus diesen Massen | |
| EP0000223A1 (de) | Herstellung von Formteilen aus einem ungesättigten Polyesterharz, mineralischen Füllstoffen und Glasfasern und die nach diesem Verfahren erhaltenen Formteile | |
| AT250664B (de) | Verfahren zur Verbesserung der Schlagfestigkeit von Formkörpern aus Polypropylen | |
| AT228492B (de) | Weichgemachte, thermoplastische Masse |