DE1158083B - Verfahren zur Herstellung basisch substituierter Phenylacetonitrile - Google Patents
Verfahren zur Herstellung basisch substituierter PhenylacetonitrileInfo
- Publication number
- DE1158083B DE1158083B DEK48518A DEK0048518A DE1158083B DE 1158083 B DE1158083 B DE 1158083B DE K48518 A DEK48518 A DE K48518A DE K0048518 A DEK0048518 A DE K0048518A DE 1158083 B DE1158083 B DE 1158083B
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- radical
- phenylacetonitriles
- compounds
- molecular weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000007962 benzene acetonitriles Chemical class 0.000 title claims description 11
- 238000000034 method Methods 0.000 title claims description 6
- 238000002360 preparation method Methods 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims description 15
- -1 methylenedioxy group Chemical group 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 150000003335 secondary amines Chemical class 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 230000029936 alkylation Effects 0.000 claims description 2
- 238000005804 alkylation reaction Methods 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 42
- VEXZGXHMUGYJMC-UHFFFAOYSA-N hydrochloric acid Substances Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 18
- HNJWKRMESUMDQE-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-n-methylethanamine Chemical compound CNCCC1=CC=C(OC)C(OC)=C1 HNJWKRMESUMDQE-UHFFFAOYSA-N 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- 150000002825 nitriles Chemical class 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 3
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 3
- NFXAXMOAVPLEBH-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-3-methylbutanenitrile Chemical compound COC1=CC=C(C(C#N)C(C)C)C=C1OC NFXAXMOAVPLEBH-UHFFFAOYSA-N 0.000 description 2
- FWHLQIFRFYYHDC-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-n-methylethanamine;hydrobromide Chemical compound Br.CNCCC1=CC=C(OC)C(OC)=C1 FWHLQIFRFYYHDC-UHFFFAOYSA-N 0.000 description 2
- 125000005999 2-bromoethyl group Chemical group 0.000 description 2
- ANOUKFYBOAKOIR-UHFFFAOYSA-N 3,4-dimethoxyphenylethylamine Chemical compound COC1=CC=C(CCN)C=C1OC ANOUKFYBOAKOIR-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 235000019256 formaldehyde Nutrition 0.000 description 2
- 239000008098 formaldehyde solution Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 238000004508 fractional distillation Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- VEFLKXRACNJHOV-UHFFFAOYSA-N 1,3-dibromopropane Chemical compound BrCCCBr VEFLKXRACNJHOV-UHFFFAOYSA-N 0.000 description 1
- YHRUOJUYPBUZOS-UHFFFAOYSA-N 1,3-dichloropropane Chemical compound ClCCCCl YHRUOJUYPBUZOS-UHFFFAOYSA-N 0.000 description 1
- ASLSUMISAQDOOB-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)acetonitrile Chemical compound COC1=CC=C(CC#N)C=C1OC ASLSUMISAQDOOB-UHFFFAOYSA-N 0.000 description 1
- MFESCIUQSIBMSM-UHFFFAOYSA-N I-BCP Chemical compound ClCCCBr MFESCIUQSIBMSM-UHFFFAOYSA-N 0.000 description 1
- 241001071864 Lethrinus laticaudis Species 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- ANFZRGMDGDYNGA-UHFFFAOYSA-N ethyl acetate;propan-2-ol Chemical compound CC(C)O.CCOC(C)=O ANFZRGMDGDYNGA-UHFFFAOYSA-N 0.000 description 1
- 229960005387 etofylline Drugs 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 229960000278 theophylline Drugs 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Steroid Compounds (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL302258D NL302258A (enExample) | 1962-12-19 | ||
| DEK48518A DE1158083B (de) | 1962-12-19 | 1962-12-19 | Verfahren zur Herstellung basisch substituierter Phenylacetonitrile |
| CH1363463A CH484070A (de) | 1962-12-19 | 1963-11-06 | Verfahren zur Herstellung basisch substituierter Phenylacetonitrile |
| BE641269A BE641269R (fr) | 1962-12-19 | 1963-12-13 | Nouveaux phénylacétonitriles substitués par des groupes basiques et leur préparation |
| GB5023963A GB1069921A (en) | 1962-12-19 | 1963-12-19 | Process for the preparation of basically substituted phenylacetonitriles |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEK48518A DE1158083B (de) | 1962-12-19 | 1962-12-19 | Verfahren zur Herstellung basisch substituierter Phenylacetonitrile |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1158083B true DE1158083B (de) | 1963-11-28 |
Family
ID=7224947
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEK48518A Pending DE1158083B (de) | 1962-12-19 | 1962-12-19 | Verfahren zur Herstellung basisch substituierter Phenylacetonitrile |
Country Status (5)
| Country | Link |
|---|---|
| BE (1) | BE641269R (enExample) |
| CH (1) | CH484070A (enExample) |
| DE (1) | DE1158083B (enExample) |
| GB (1) | GB1069921A (enExample) |
| NL (1) | NL302258A (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4305887A (en) | 1979-11-11 | 1981-12-15 | Basf Aktiengesellschaft | Process for obtaining the enantiomeric forms of 4-cyano-1-[N-methyl-N-(2'-{3",4"-dimethoxyphenyl}-ethyl)-amino]-5-methyl-4-(3',4',5'-trimethoxyphenyl)-hexane and of salts thereof |
| US4350636A (en) | 1980-09-11 | 1982-09-21 | Basf Aktiengesellschaft | Preparation of phenylacetonitriles carrying basic substituents |
| WO1986002840A1 (fr) * | 1984-11-06 | 1986-05-22 | Schering Aktiengesellschaft | Composition pharmaceutique, sa production et son utilisation |
| EP0364123A1 (en) * | 1988-10-04 | 1990-04-18 | Pfizer Limited | Muscarinic receptor antagonists |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5451604A (en) * | 1993-07-26 | 1995-09-19 | G. D. Searle & Co. | Halogenated phenylacetonitrile alkylaminoalkylphenyl compounds as immunosuppressives |
-
0
- NL NL302258D patent/NL302258A/xx unknown
-
1962
- 1962-12-19 DE DEK48518A patent/DE1158083B/de active Pending
-
1963
- 1963-11-06 CH CH1363463A patent/CH484070A/de not_active IP Right Cessation
- 1963-12-13 BE BE641269A patent/BE641269R/fr active
- 1963-12-19 GB GB5023963A patent/GB1069921A/en not_active Expired
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4305887A (en) | 1979-11-11 | 1981-12-15 | Basf Aktiengesellschaft | Process for obtaining the enantiomeric forms of 4-cyano-1-[N-methyl-N-(2'-{3",4"-dimethoxyphenyl}-ethyl)-amino]-5-methyl-4-(3',4',5'-trimethoxyphenyl)-hexane and of salts thereof |
| US4350636A (en) | 1980-09-11 | 1982-09-21 | Basf Aktiengesellschaft | Preparation of phenylacetonitriles carrying basic substituents |
| WO1986002840A1 (fr) * | 1984-11-06 | 1986-05-22 | Schering Aktiengesellschaft | Composition pharmaceutique, sa production et son utilisation |
| EP0364123A1 (en) * | 1988-10-04 | 1990-04-18 | Pfizer Limited | Muscarinic receptor antagonists |
| US5219871A (en) * | 1988-10-04 | 1993-06-15 | Pfizer Inc. | Muscarinic receptor antagonists |
| US5302595A (en) * | 1988-10-04 | 1994-04-12 | Pfizer Inc. | Muscarinic receptor antagonists |
Also Published As
| Publication number | Publication date |
|---|---|
| CH484070A (de) | 1970-01-15 |
| BE641269R (fr) | 1964-06-15 |
| GB1069921A (en) | 1967-05-24 |
| NL302258A (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2100323C3 (de) | Ureido-phenoxy-2-hydroxy-3-alkylaminopropane | |
| DE1240846B (de) | Verfahren zur Herstellung von Sulfamiden | |
| DE1158083B (de) | Verfahren zur Herstellung basisch substituierter Phenylacetonitrile | |
| DE916168C (de) | Verfahren zur Herstellung von Pyrrolidinoalkylphenothiazinen | |
| DE1242241B (de) | Verfahren zur Herstellung von substituierten Phenyl-alpha-aminoketonen und deren Saeureadditionssalzen bzw. deren optischen Antipoden | |
| DE1210874B (de) | Verfahren zur Herstellung von Diarylaminoderivaten von Arylaminoalkanen | |
| DE1137439B (de) | Verfahren zur Herstellung von substituierten Morpholinen | |
| DE593192C (de) | Verfahren zur Darstellung von N-substituierten heterocyclischen Verbindungen | |
| DE1593742A1 (de) | Verfahren zur Herstellung von 7-Aminocumarinen | |
| AT216485B (de) | Verfahren zur Herstellung neuer tertiärer Amine | |
| DE1272286C2 (de) | Verfahren zur Herstellung von N-substituierten aliphatischen Thiocarbonsaeureamiden | |
| DE1568092C (de) | Verfahren zur Herstellung von neuen Derivaten des 5,10 Methano 5H dibenzo ecki ge Klammer auf a,d eckige Klammer zu cycloheptens | |
| DE959097C (de) | Verfahren zur Herstellung von basisch substituierten Diarylacetonitrilen | |
| DE2822473A1 (de) | Alkanolaminderivate, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische zusammensetzungen | |
| AT246720B (de) | Verfahren zur Herstellung von neuen cyclischen Aminen und deren Salzen | |
| DE495451C (de) | Verfahren zur Gewinnung von N-substituierten, aromatischen Aminen aus den bei der Doebnerschen Synthese in 2-Stellung substituierter Chinolin-4-carbonsaeuren anfallendenharzigen Rueckstaenden | |
| AT238186B (de) | Verfahren zur Herstellung neuer Pyrrolidinverbindungen | |
| AT221504B (de) | Verfahren zur Herstellung neuer basischer Phenoläther und ihrer Salze | |
| AT319960B (de) | Verfahren zur Herstellung von neuen Pyridazinverbindungen | |
| AT208879B (de) | Verfahren zur Herstellung neuer Theophyllinbasen | |
| AT219577B (de) | Verfahren zur Herstellung von neuen Triaminen und deren salzartigen Abkömmlingen | |
| DE1595903C (de) | 1-Substituierte 2,6-Dimethyl-4-phenylpiperazine | |
| DE1041044B (de) | Verfahren zur Herstellung von N-substituierten Derivaten der Imidodiphosphorsaeure | |
| CH465642A (de) | Verfahren zur Herstellung neuer Amine | |
| DE1279685B (de) | Verfahren zur Herstellung von L-(-)-ª‡-Methyl-ª‰-(3, 4-dihydroxy-phenyl)-alanin |