DE1131007B - Gegen Oxydation stabilisierte Formmasse - Google Patents
Gegen Oxydation stabilisierte FormmasseInfo
- Publication number
- DE1131007B DE1131007B DEW22037A DEW0022037A DE1131007B DE 1131007 B DE1131007 B DE 1131007B DE W22037 A DEW22037 A DE W22037A DE W0022037 A DEW0022037 A DE W0022037A DE 1131007 B DE1131007 B DE 1131007B
- Authority
- DE
- Germany
- Prior art keywords
- disulfide
- carbon black
- percent
- stabilizer
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 title claims description 10
- 230000003647 oxidation Effects 0.000 title claims description 10
- 238000007254 oxidation reaction Methods 0.000 title claims description 10
- 238000000465 moulding Methods 0.000 title claims description 9
- -1 polyethylene Polymers 0.000 claims description 30
- 239000004698 Polyethylene Substances 0.000 claims description 22
- 229920000573 polyethylene Polymers 0.000 claims description 22
- 239000006229 carbon black Substances 0.000 claims description 21
- 239000002245 particle Substances 0.000 claims description 19
- 239000000203 mixture Substances 0.000 claims description 18
- 229920000642 polymer Polymers 0.000 claims description 16
- 239000003381 stabilizer Substances 0.000 claims description 14
- GUUVPOWQJOLRAS-UHFFFAOYSA-N Diphenyl disulfide Chemical compound C=1C=CC=CC=1SSC1=CC=CC=C1 GUUVPOWQJOLRAS-UHFFFAOYSA-N 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 150000005673 monoalkenes Chemical group 0.000 claims description 5
- 229920000098 polyolefin Polymers 0.000 claims description 4
- 241000872198 Serjania polyphylla Species 0.000 claims description 3
- WYLQRHZSKIDFEP-UHFFFAOYSA-N benzene-1,4-dithiol Chemical compound SC1=CC=C(S)C=C1 WYLQRHZSKIDFEP-UHFFFAOYSA-N 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 150000002894 organic compounds Chemical class 0.000 claims description 2
- 238000006116 polymerization reaction Methods 0.000 claims description 2
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 2
- 229920001577 copolymer Polymers 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 16
- 239000004071 soot Substances 0.000 description 16
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 11
- 229910052760 oxygen Inorganic materials 0.000 description 11
- 239000001301 oxygen Substances 0.000 description 11
- 239000003963 antioxidant agent Substances 0.000 description 10
- 230000000694 effects Effects 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 230000003078 antioxidant effect Effects 0.000 description 4
- 239000006231 channel black Substances 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- 239000011593 sulfur Substances 0.000 description 4
- 150000003464 sulfur compounds Chemical class 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 3
- 229960001413 acetanilide Drugs 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 238000006731 degradation reaction Methods 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- BZBKGGMMHPADHK-UHFFFAOYSA-N C(CCC)C=1C(=C(C=CC=1)SSC1=C(C(=CC=C1)CCCC)C1=CC=CC=C1)C1=CC=CC=C1 Chemical compound C(CCC)C=1C(=C(C=CC=1)SSC1=C(C(=CC=C1)CCCC)C1=CC=CC=C1)C1=CC=CC=C1 BZBKGGMMHPADHK-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- 230000032683 aging Effects 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000009413 insulation Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- FHWBMOAIFITEKF-UHFFFAOYSA-N 1-butyl-2-[(2-butylphenyl)disulfanyl]benzene Chemical class CCCCC1=CC=CC=C1SSC1=CC=CC=C1CCCC FHWBMOAIFITEKF-UHFFFAOYSA-N 0.000 description 1
- RMSGQZDGSZOJMU-UHFFFAOYSA-N 1-butyl-2-phenylbenzene Chemical group CCCCC1=CC=CC=C1C1=CC=CC=C1 RMSGQZDGSZOJMU-UHFFFAOYSA-N 0.000 description 1
- RPTQMFYXBSBPNM-UHFFFAOYSA-N 1-ethyl-2-[(2-ethylphenyl)disulfanyl]benzene Chemical compound CCC1=CC=CC=C1SSC1=CC=CC=C1CC RPTQMFYXBSBPNM-UHFFFAOYSA-N 0.000 description 1
- ZSSCTTQONPHGRA-UHFFFAOYSA-N 1-methyl-2-(2-methylphenyl)disulfanylbenzene Chemical compound CC1=CC=CC=C1SSC1=CC=CC=C1C ZSSCTTQONPHGRA-UHFFFAOYSA-N 0.000 description 1
- XMAUGWMZSGLOLM-UHFFFAOYSA-N 1-methyl-3-[(3-methyl-2-phenylphenyl)disulfanyl]-2-phenylbenzene Chemical compound C=1C=CC=CC=1C=1C(C)=CC=CC=1SSC1=CC=CC(C)=C1C1=CC=CC=C1 XMAUGWMZSGLOLM-UHFFFAOYSA-N 0.000 description 1
- NGUBOUFHHQYOSB-UHFFFAOYSA-N 1-propan-2-yl-2-[(2-propan-2-ylphenyl)disulfanyl]benzene Chemical class CC(C)C1=CC=CC=C1SSC1=CC=CC=C1C(C)C NGUBOUFHHQYOSB-UHFFFAOYSA-N 0.000 description 1
- HLBZWYXLQJQBKU-UHFFFAOYSA-N 4-(morpholin-4-yldisulfanyl)morpholine Chemical compound C1COCCN1SSN1CCOCC1 HLBZWYXLQJQBKU-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- BYPSKWUZDHHIMX-UHFFFAOYSA-N C(C(C)C)C=1C(=C(C=CC=1)SSC1=C(C(=CC=C1)CC(C)C)C1=CC=CC=C1)C1=CC=CC=C1 Chemical compound C(C(C)C)C=1C(=C(C=CC=1)SSC1=C(C(=CC=C1)CC(C)C)C1=CC=CC=C1)C1=CC=CC=C1 BYPSKWUZDHHIMX-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 229920002367 Polyisobutene Polymers 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 230000000593 degrading effect Effects 0.000 description 1
- AFZSMODLJJCVPP-UHFFFAOYSA-N dibenzothiazol-2-yl disulfide Chemical compound C1=CC=C2SC(SSC=3SC4=CC=CC=C4N=3)=NC2=C1 AFZSMODLJJCVPP-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 150000004662 dithiols Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000004720 fertilization Effects 0.000 description 1
- 239000005357 flat glass Substances 0.000 description 1
- 239000006232 furnace black Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 238000010525 oxidative degradation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 239000005297 pyrex Substances 0.000 description 1
- 230000002940 repellent Effects 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/02—Elements
- C08K3/04—Carbon
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
- C08K5/37—Thiols
- C08K5/375—Thiols containing six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US625577A US2967850A (en) | 1956-11-29 | 1956-11-29 | Compositions of stabilized straight chain hydrocarbons containing carbon black and a compound having r-s-s-r structure |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1131007B true DE1131007B (de) | 1962-06-07 |
Family
ID=24506725
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEW22037A Pending DE1131007B (de) | 1956-11-29 | 1957-10-14 | Gegen Oxydation stabilisierte Formmasse |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2967850A (OSRAM) |
| BE (1) | BE561944A (OSRAM) |
| DE (1) | DE1131007B (OSRAM) |
| FR (1) | FR1199240A (OSRAM) |
| GB (1) | GB836937A (OSRAM) |
| NL (2) | NL221522A (OSRAM) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3050494A (en) * | 1958-10-30 | 1962-08-21 | Phillips Petroleum Co | Compositions comprising an olefin polymer, carbon black, and a dithiobisbenzothiazole, and process for curing same |
| BE586349A (OSRAM) * | 1959-01-09 | |||
| DE1111382B (de) * | 1959-05-02 | 1961-07-20 | Basf Ag | Stabilisierte Formmasse aus Polyolefinen |
| US3143584A (en) * | 1959-05-12 | 1964-08-04 | Ici Ltd | Spinning polypropylenes which have been subjected to thermal degradation promoted bythe presence of sulfur compounds |
| NL252465A (OSRAM) * | 1959-06-10 | |||
| DE1236186C2 (de) * | 1959-09-02 | 1977-04-14 | S.A. Argus Chemical N.V., Drogenbos (Belgien) | Verfahren zum stabilisieren von polypropylen |
| US3070569A (en) * | 1959-10-08 | 1962-12-25 | Thiokol Chemical Corp | Stabilizing polyethylene with carbon, a polymeric phenol sulfide, and an organic reducing agent |
| US3454522A (en) * | 1959-10-23 | 1969-07-08 | Eastman Kodak Co | Black polyethylene compositions stabilized against ultra-violet light degradation with a synergistic mixture of carbon black and a diester of 3,3-thiodipropionic acid |
| BE604775A (OSRAM) * | 1960-06-10 | |||
| GB1002431A (en) * | 1961-05-30 | 1965-08-25 | Ici Ltd | Solid olefine polymer compositions |
| US3335104A (en) * | 1962-06-22 | 1967-08-08 | Stauffer Chemical Co | Stabilization of crystalline polypropylene |
| US3190852A (en) * | 1962-07-31 | 1965-06-22 | Shell Oil Co | Polyolefins stabilized with a combination of dialkyl thiodipropionates and polyphenols |
| US3304283A (en) * | 1964-04-24 | 1967-02-14 | Bell Telephone Labor Inc | Stabilized alpha-mono-olefinic polymers |
| US3259604A (en) * | 1964-04-24 | 1966-07-05 | Bell Telephone Labor Inc | Stabilized long-chain polymers |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB496966A (en) * | 1936-07-25 | 1938-12-09 | Standard Oil Dev Co | An improved manufacture of stabilised hydrocarbon polymers |
| US2448799A (en) * | 1945-11-03 | 1948-09-07 | Du Pont | Ethylene polymer compositions |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2160172A (en) * | 1936-07-25 | 1939-05-30 | Standard Oil Dev Co | Polymer composition |
| US2431303A (en) * | 1946-10-04 | 1947-11-25 | Armstrong Cork Co | Closure |
| US2512459A (en) * | 1949-02-23 | 1950-06-20 | Du Pont | Dispersion of pigments in ethylene polymers |
| US2643241A (en) * | 1951-01-02 | 1953-06-23 | Phillips Petroleum Co | Stabilization of polysulfone resins with organic sulfides |
| US2843577A (en) * | 1955-10-17 | 1958-07-15 | Standard Oil Co | Process and catalyst for polymerization using polyvalent metal salts and a reducing agent plus a sulfur compound |
-
0
- NL NL99393D patent/NL99393C/xx active
- BE BE561944D patent/BE561944A/xx unknown
- NL NL221522D patent/NL221522A/xx unknown
-
1956
- 1956-11-29 US US625577A patent/US2967850A/en not_active Expired - Lifetime
-
1957
- 1957-10-09 FR FR1199240D patent/FR1199240A/fr not_active Expired
- 1957-10-14 DE DEW22037A patent/DE1131007B/de active Pending
- 1957-11-26 GB GB36819/57A patent/GB836937A/en not_active Expired
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB496966A (en) * | 1936-07-25 | 1938-12-09 | Standard Oil Dev Co | An improved manufacture of stabilised hydrocarbon polymers |
| US2448799A (en) * | 1945-11-03 | 1948-09-07 | Du Pont | Ethylene polymer compositions |
Also Published As
| Publication number | Publication date |
|---|---|
| GB836937A (en) | 1960-06-09 |
| FR1199240A (fr) | 1959-12-11 |
| NL221522A (OSRAM) | |
| US2967850A (en) | 1961-01-10 |
| NL99393C (OSRAM) | |
| BE561944A (OSRAM) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1131007B (de) | Gegen Oxydation stabilisierte Formmasse | |
| DE69401882T2 (de) | Frei-radikalisch gehärteter Kautschuk | |
| DE1290712B (de) | Gegen den Abbau durch Licht und Waerme stabilisierte Formmassen | |
| DE3888581T2 (de) | Wasserbäumchenresistente elektrische Isolationszusammensetzung. | |
| DE1131008B (de) | Gegen Oxydation stabilisierte Formmassen | |
| DE1122701B (de) | Gegen Oxydation stabilisierte Formmasse | |
| DE1133122B (de) | Gegen Oxydation stabilisierte Formmasse | |
| DE1118449B (de) | Gegen Oxydation stabilisierte Formmasse | |
| DE1118451B (de) | Gegen Oxydation stabilisierte Formmasse | |
| DE1118450B (de) | Gegen Oxydation stabilisierte Formmasse | |
| EP3380552A1 (de) | Bchpc mit verringerter abbrandgeschwindigkeit | |
| DE1469809C3 (de) | Thermoplastische Massen | |
| DE2053067B2 (de) | Formmassen mit erhöhter Widerstandsfähigkeit gegen SpannungsriBbildung und guter Tieftemperaturbeständigkeit | |
| EP0346863B1 (de) | Zur Vernetzung von Polymeren geeignete Mischung und Verfahren zum Vernetzen von Polymeren unter Verlängerung der Scorchzeit | |
| CH427253A (de) | Stabilisierte Masse aus Olefin-Polymeren | |
| DE1133884B (de) | Stabilisierte Formmasse aus Polyolefinen | |
| EP0123801A1 (de) | Verfahren zur radikalischen Vernetzung organischer Polymerer | |
| EP0113914A1 (de) | Verwendung von stabilisierten vernetzbaren Ethylenpolymerisaten zur Herstellung von Elektroisoliermassen | |
| AT203212B (de) | Stabilisierte Mischung | |
| DE1469899B2 (de) | Flammfeste Kunststoffe | |
| AT203213B (de) | Stabilisierte Mischung | |
| DD237316A1 (de) | Verfahren zur vernetzung von polyolefinen | |
| AT207116B (de) | Stabilisierte Mischung | |
| DE1224924B (de) | Verfahren zum Stabilisieren von Polyolefinen | |
| DE1793192B2 (de) | Verfahren zur Herstellung von Bisphenol-OIigomeren und ihre Verwendung als Antioxidantien zur Stabilisierung von Polymeren bzw. Polymergemischen |