DE1126464B - Galvanisches Element - Google Patents
Galvanisches ElementInfo
- Publication number
- DE1126464B DE1126464B DEM39728A DEM0039728A DE1126464B DE 1126464 B DE1126464 B DE 1126464B DE M39728 A DEM39728 A DE M39728A DE M0039728 A DEM0039728 A DE M0039728A DE 1126464 B DE1126464 B DE 1126464B
- Authority
- DE
- Germany
- Prior art keywords
- lithium
- galvanic element
- saturated aliphatic
- element according
- oxides
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229910052744 lithium Inorganic materials 0.000 claims description 34
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 28
- 239000003792 electrolyte Substances 0.000 claims description 14
- 150000001412 amines Chemical class 0.000 claims description 11
- -1 selenium, metallic Halides Chemical class 0.000 claims description 10
- 239000003513 alkali Substances 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 7
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 6
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical class [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 239000011593 sulfur Substances 0.000 claims description 5
- 229910000497 Amalgam Inorganic materials 0.000 claims description 4
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical class OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 claims description 4
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical group CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 claims description 4
- 239000011777 magnesium Substances 0.000 claims description 4
- 150000003335 secondary amines Chemical class 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 3
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 150000004673 fluoride salts Chemical class 0.000 claims description 3
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 3
- 229910052749 magnesium Inorganic materials 0.000 claims description 3
- 229910044991 metal oxide Inorganic materials 0.000 claims description 3
- 150000002823 nitrates Chemical class 0.000 claims description 3
- 229910052711 selenium Inorganic materials 0.000 claims description 3
- 239000011669 selenium Substances 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- 229910052725 zinc Inorganic materials 0.000 claims description 3
- 239000011701 zinc Substances 0.000 claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- 229910000733 Li alloy Inorganic materials 0.000 claims description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 claims description 2
- 229910052709 silver Inorganic materials 0.000 claims description 2
- 239000004332 silver Substances 0.000 claims description 2
- 150000003568 thioethers Chemical class 0.000 claims description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N mono-n-propyl amine Natural products CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 claims 3
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 claims 2
- 150000004694 iodide salts Chemical class 0.000 claims 1
- DPBLXKKOBLCELK-UHFFFAOYSA-N pentan-1-amine Chemical compound CCCCCN DPBLXKKOBLCELK-UHFFFAOYSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 description 11
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- 239000000203 mixture Substances 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 229910016509 CuF 2 Inorganic materials 0.000 description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 150000003512 tertiary amines Chemical class 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 229910002804 graphite Inorganic materials 0.000 description 2
- 239000010439 graphite Substances 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000003350 kerosene Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052750 molybdenum Inorganic materials 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 229910018091 Li 2 S Inorganic materials 0.000 description 1
- 229910013684 LiClO 4 Inorganic materials 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- QDOXWKRWXJOMAK-UHFFFAOYSA-N dichromium trioxide Chemical compound O=[Cr]O[Cr]=O QDOXWKRWXJOMAK-UHFFFAOYSA-N 0.000 description 1
- 230000005518 electrochemistry Effects 0.000 description 1
- 239000008151 electrolyte solution Substances 0.000 description 1
- 229940021013 electrolyte solution Drugs 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910001416 lithium ion Inorganic materials 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000002730 mercury Chemical class 0.000 description 1
- 229910001512 metal fluoride Inorganic materials 0.000 description 1
- 229910001511 metal iodide Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000011255 nonaqueous electrolyte Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003139 primary aliphatic amines Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000006308 propyl amino group Chemical group 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000005619 secondary aliphatic amines Chemical class 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 150000003513 tertiary aromatic amines Chemical class 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01M—PROCESSES OR MEANS, e.g. BATTERIES, FOR THE DIRECT CONVERSION OF CHEMICAL ENERGY INTO ELECTRICAL ENERGY
- H01M10/00—Secondary cells; Manufacture thereof
- H01M10/05—Accumulators with non-aqueous electrolyte
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01M—PROCESSES OR MEANS, e.g. BATTERIES, FOR THE DIRECT CONVERSION OF CHEMICAL ENERGY INTO ELECTRICAL ENERGY
- H01M4/00—Electrodes
- H01M4/02—Electrodes composed of, or comprising, active material
- H01M4/36—Selection of substances as active materials, active masses, active liquids
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01M—PROCESSES OR MEANS, e.g. BATTERIES, FOR THE DIRECT CONVERSION OF CHEMICAL ENERGY INTO ELECTRICAL ENERGY
- H01M4/00—Electrodes
- H01M4/02—Electrodes composed of, or comprising, active material
- H01M4/36—Selection of substances as active materials, active masses, active liquids
- H01M4/38—Selection of substances as active materials, active masses, active liquids of elements or alloys
- H01M4/40—Alloys based on alkali metals
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01M—PROCESSES OR MEANS, e.g. BATTERIES, FOR THE DIRECT CONVERSION OF CHEMICAL ENERGY INTO ELECTRICAL ENERGY
- H01M6/00—Primary cells; Manufacture thereof
- H01M6/14—Cells with non-aqueous electrolyte
- H01M6/16—Cells with non-aqueous electrolyte with organic electrolyte
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02E—REDUCTION OF GREENHOUSE GAS [GHG] EMISSIONS, RELATED TO ENERGY GENERATION, TRANSMISSION OR DISTRIBUTION
- Y02E60/00—Enabling technologies; Technologies with a potential or indirect contribution to GHG emissions mitigation
- Y02E60/10—Energy storage using batteries
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Primary Cells (AREA)
- Battery Electrode And Active Subsutance (AREA)
- Secondary Cells (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR752438 | 1957-11-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1126464B true DE1126464B (de) | 1962-03-29 |
Family
ID=8705162
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEM39728A Pending DE1126464B (de) | 1957-11-26 | 1958-11-25 | Galvanisches Element |
Country Status (6)
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3367800A (en) * | 1964-09-28 | 1968-02-06 | Navy Usa | High energy-density heat-activated voltaic cells at intermediate temperatures |
| DE1671843B1 (de) * | 1966-03-23 | 1971-09-30 | Mallory Batteries Ltd | Galvanisches element mit einer negativen elektrode einer positiven elektrode mit schwefel als aktivem material und einem elektrolyten aus ein einem organischen mittel geloes ten ganischen salz |
| DE1671804B1 (de) * | 1966-03-29 | 1971-10-14 | Honeywell Inc | Galvanisches element mit einer negativen leichtmetallelektrode und einem elektrolyten aus methylacetat in dem ein anorgani sches salz geloest ist |
| DE2205099A1 (de) * | 1971-02-03 | 1972-10-19 | Du Pont | Batterie mit hoher Energiedichte |
| DE2442411A1 (de) * | 1973-09-10 | 1975-03-13 | Exxon Research Engineering Co | Batterien |
| DE2933793A1 (de) * | 1978-08-21 | 1980-03-06 | Klaus Brandt | Batteriezelle, batteriekathode sowie verfahren zur herstellung einer batteriekathode |
Families Citing this family (51)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL130849C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1959-08-21 | |||
| US3261714A (en) * | 1963-01-07 | 1966-07-19 | Union Carbide Corp | Sealed dry cells having an ionization catalyst in the depolarizer |
| US3423242A (en) * | 1964-10-28 | 1969-01-21 | Livingston Electronic Corp | Electric current-producing cell with anhydrous organic liquid electrolyte |
| FR1449663A (fr) * | 1965-04-28 | 1966-08-19 | Comp Generale Electricite | Pile à l'aluminium |
| US3424621A (en) * | 1965-12-29 | 1969-01-28 | Catalyst Research Corp | High energy primary cell |
| US3462313A (en) * | 1966-01-03 | 1969-08-19 | Standard Oil Co | Electrical energy storage device comprising molten metal halide electrolyte and tungsten-containing electrode |
| US3462312A (en) * | 1966-01-03 | 1969-08-19 | Standard Oil Co | Electrical energy storage device comprising fused salt electrolyte,tantalum containing electrode and method for storing electrical energy |
| US3410730A (en) * | 1966-01-03 | 1968-11-12 | Standard Oil Co | Molybdenum-containing composite electrode |
| US3410731A (en) * | 1966-01-03 | 1968-11-12 | Standard Oil Co | Tungsten oxide-containing composite electrode |
| US3445288A (en) * | 1966-01-03 | 1969-05-20 | Standard Oil Co | Aluminum anode electrical energy storage device |
| US3455742A (en) * | 1966-02-10 | 1969-07-15 | Mallory & Co Inc P R | High energy density solid electrolyte cells |
| US3393092A (en) * | 1966-02-28 | 1968-07-16 | Whittaker Corp | High energy density battery |
| US3393093A (en) * | 1966-02-28 | 1968-07-16 | Whittaker Corp | High energy density battery |
| US3395048A (en) * | 1966-03-18 | 1968-07-30 | Electrochimica Corp | Method for making porous alkali metal electrodes |
| US3433679A (en) * | 1966-07-20 | 1969-03-18 | E & B Inc | Primary alkaline cell |
| US3476602A (en) * | 1966-07-25 | 1969-11-04 | Dow Chemical Co | Battery cell |
| US3404042A (en) * | 1966-09-01 | 1968-10-01 | Exxon Research Engineering Co | Electric battery using organic charge transfer liquid |
| US3421947A (en) * | 1966-09-02 | 1969-01-14 | Exxon Research Engineering Co | Organic charge transfer solution battery |
| US3484296A (en) * | 1967-08-30 | 1969-12-16 | Standard Oil Co | Low temperature battery |
| US3506490A (en) * | 1968-05-08 | 1970-04-14 | Standard Oil Co | Solid electrolyte battery having lithium or lithium alloy anode |
| US3506492A (en) * | 1968-05-08 | 1970-04-14 | Standard Oil Co | Solid electrolyte battery having lithium or lithium alloy anode |
| US3506491A (en) * | 1968-05-08 | 1970-04-14 | Standard Oil Co | Solid electrolyte battery having lithium or lithium alloy anode |
| US3514337A (en) * | 1968-06-06 | 1970-05-26 | Us Navy | High energy density battery |
| US3546022A (en) * | 1968-07-15 | 1970-12-08 | Du Pont | Voltaic cells |
| US3531328A (en) * | 1968-11-13 | 1970-09-29 | Mallory & Co Inc P R | Light metal-copper chloride organic electrolyte cell |
| US3804672A (en) * | 1969-08-27 | 1974-04-16 | Mallory & Co Inc P R | Method of making a molybdenum trioxide electrode by pyrolytic decomposition |
| US3808052A (en) * | 1969-08-27 | 1974-04-30 | A Dey | Organic electrolyte cell employing molybdenum oxide cathodic electrode |
| US3639174A (en) * | 1970-04-22 | 1972-02-01 | Du Pont | Voltaic cells with lithium-aluminum alloy anode and nonaqueous solvent electrolyte system |
| US3836403A (en) * | 1971-04-01 | 1974-09-17 | Tyco Laboratories Inc | Lithium batteries and method of preparing a positive electrode material therefor |
| CA988155A (fr) * | 1972-06-09 | 1976-04-27 | Jean P. Gabano | Matiere active negative pour accumulateur a electrolyte acide |
| US3791867A (en) * | 1972-07-24 | 1974-02-12 | Bell Telephone Labor Inc | Rechargable nonaqueous battery |
| US4476204A (en) * | 1972-11-13 | 1984-10-09 | Gte Laboratories Incorporated | Electrochemical cell utilizing a mixture of phosphorus oxychloride and a low freezing solvent as the electrolyte |
| US3873369A (en) * | 1973-05-14 | 1975-03-25 | Du Pont | Tungsten oxide-containing cathode for non-aqueous galvanic cell |
| US3898096A (en) * | 1973-06-11 | 1975-08-05 | Rockwell International Corp | Lithium-molten salt cell with transition metal chalcogenide positive electrode |
| US4091152A (en) * | 1973-08-16 | 1978-05-23 | P.R. Mallory & Co. Inc. | Lithium SO2 cell |
| US3915740A (en) * | 1974-02-07 | 1975-10-28 | Electrochimica Corp | Galvanic cell |
| US3864168A (en) * | 1974-03-22 | 1975-02-04 | Yardney International Corp | Electrolytic cells incorporating water scavengers |
| US3929504A (en) * | 1974-12-18 | 1975-12-30 | Honeywell Inc | Rechargeable power source |
| US3998658A (en) * | 1975-01-31 | 1976-12-21 | P. R. Mallory & Co., Inc. | High voltage organic electrolyte batteries |
| DE2726380C2 (de) * | 1977-06-10 | 1984-03-08 | Varta Batterie Ag, 3000 Hannover | Elektrochemische Stromquelle hoher Energiedichte |
| FR2414253A1 (fr) * | 1978-01-10 | 1979-08-03 | Accumulateurs Fixes | Generateur electrochimique a electrolyte non aqueux a conservation amelioree |
| US4316777A (en) * | 1979-10-01 | 1982-02-23 | Duracell International Inc. | Rechargeable nonaqueous silver alloy anode cell |
| US4330601A (en) * | 1979-10-01 | 1982-05-18 | Duracell International Inc. | Rechargeable nonaqueous silver alloy anode cell |
| US4780380A (en) * | 1984-06-07 | 1988-10-25 | Standard Oil Company (Indiana) | Porous lithium electrodes and their use in nonaqueous electrochemical cells |
| DE3511703A1 (de) * | 1985-03-29 | 1986-10-02 | Max-Planck-Gesellschaft zur Förderung der Wissenschaften e.V., 3400 Göttingen | Lithiumionenleiter |
| EP0693568A1 (en) * | 1992-11-30 | 1996-01-24 | Hope Technologies, Inc. | Electrodes for electrochemical devices |
| FR2674518A1 (fr) * | 1991-03-26 | 1992-10-02 | Centre Nat Rech Scient | Electrolytes fluides a base d'ammoniacates de sel(s) de lithium. |
| TW200520292A (en) | 2003-08-08 | 2005-06-16 | Rovcal Inc | High capacity alkaline cell |
| AR047875A1 (es) | 2004-06-04 | 2006-03-01 | Rovcal Inc | Celdas alcalinas que presentan alta capacidad |
| CN105449165B (zh) * | 2014-06-05 | 2018-01-02 | 宁德新能源科技有限公司 | 锂离子电池的富锂极片及其制备方法 |
| DE102018123285A1 (de) | 2018-09-21 | 2020-03-26 | Deutsches Zentrum für Luft- und Raumfahrt e.V. | Elastisch verformbare Kohlenstoffaerogele als Matrixmaterial in Schwefelelektroden |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1000044A (fr) * | 1949-10-08 | 1952-02-07 | électrolyte pour électrodes de poids léger | |
| US2597453A (en) * | 1948-11-20 | 1952-05-20 | Burgess Battery Co | Primary cell |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US499848A (en) * | 1893-06-20 | Secondary battery | ||
| US553719A (en) * | 1896-01-28 | Electric battery | ||
| US1829635A (en) * | 1929-05-28 | 1931-10-27 | Gen Electric | Method of making alloys |
| US2634303A (en) * | 1949-02-02 | 1953-04-07 | Edison Inc Thomas A | Storage battery |
| US2863933A (en) * | 1952-10-27 | 1958-12-09 | G And W H Corson Inc | Electric current producing cell and method of producing current using the same |
| US2806786A (en) * | 1954-05-14 | 1957-09-17 | Gen Electric | Method of making sintered electrical contact material |
-
1957
- 1957-11-26 FR FR1189268D patent/FR1189268A/fr not_active Expired
-
1958
- 1958-11-21 GB GB37525/58A patent/GB902929A/en not_active Expired
- 1958-11-24 US US775733A patent/US3043896A/en not_active Expired - Lifetime
- 1958-11-25 DE DEM39728A patent/DE1126464B/de active Pending
- 1958-11-26 BE BE573320A patent/BE573320A/fr unknown
- 1958-11-26 NL NL233647A patent/NL112075C/xx active
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2597453A (en) * | 1948-11-20 | 1952-05-20 | Burgess Battery Co | Primary cell |
| FR1000044A (fr) * | 1949-10-08 | 1952-02-07 | électrolyte pour électrodes de poids léger |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3367800A (en) * | 1964-09-28 | 1968-02-06 | Navy Usa | High energy-density heat-activated voltaic cells at intermediate temperatures |
| DE1671843B1 (de) * | 1966-03-23 | 1971-09-30 | Mallory Batteries Ltd | Galvanisches element mit einer negativen elektrode einer positiven elektrode mit schwefel als aktivem material und einem elektrolyten aus ein einem organischen mittel geloes ten ganischen salz |
| DE1671804B1 (de) * | 1966-03-29 | 1971-10-14 | Honeywell Inc | Galvanisches element mit einer negativen leichtmetallelektrode und einem elektrolyten aus methylacetat in dem ein anorgani sches salz geloest ist |
| DE2205099A1 (de) * | 1971-02-03 | 1972-10-19 | Du Pont | Batterie mit hoher Energiedichte |
| DE2442411A1 (de) * | 1973-09-10 | 1975-03-13 | Exxon Research Engineering Co | Batterien |
| DE2933793A1 (de) * | 1978-08-21 | 1980-03-06 | Klaus Brandt | Batteriezelle, batteriekathode sowie verfahren zur herstellung einer batteriekathode |
Also Published As
| Publication number | Publication date |
|---|---|
| US3043896A (en) | 1962-07-10 |
| BE573320A (fr) | 1959-05-26 |
| NL112075C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1965-11-15 |
| FR1189268A (fr) | 1959-10-01 |
| GB902929A (en) | 1962-08-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1126464B (de) | Galvanisches Element | |
| DE69801319T2 (de) | Speicherbatterie auf basis von eisen | |
| CH628184A5 (de) | Elektrolytloesung, verfahren zu deren herstellung und verwendung derselben. | |
| DE2442411A1 (de) | Batterien | |
| DE2817076C2 (de) | Galvanische Zelle mit einem alkalischen Elektrolyten und einer Silberoxid-Elektrode | |
| DE3005869A1 (de) | Nichtwaessriges galvanisches element | |
| DE2535473A1 (de) | Zelle mit einem nichtwaessrigen elektrolyten aus sulfolan oder einem alkylsubstituierten sulfolanderivat | |
| DE3424097C2 (de) | Anorganische, nicht wässrige Zelle | |
| DE1274699B (de) | Galvanisches Element | |
| DE2262256B2 (de) | Galvanisches Element | |
| DE2926632A1 (de) | Stromerzeugende zellen | |
| DE2262660B2 (de) | Nichtwäßriges galvanisches Element | |
| DE1240056B (de) | Verfahren zur Oxydation von Nickel-II-hydroxid fuer alkalische Akkumulatoren | |
| DE2912240A1 (de) | Zinkoxidzusatz fuer elektroden aus zweiwertigem silberoxid | |
| CH493944A (de) | Elektrochemisches Primärelement | |
| DE925330C (de) | Verfahren zum elektrolytischen AEtzen von Tantal | |
| DE2437183C3 (de) | Alkalisches galvanisches Element und Verfahren zu seiner Herstellung | |
| DE2837511C2 (de) | Elektrochemische Zelle mit einem in Thionylchlorid gelösten leitfähigen Stoff | |
| DE2938470A1 (de) | Elektrochemische zelle | |
| EP0073877B1 (de) | Galvanische Festkörperzelle mit ionen- und elektronenleitender Kathode, deren aktives Material aus Metallchloriden besteht | |
| DE3917822C2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| DE1671755C3 (de) | Galvanisches Metall-Halogen-Element | |
| DE1596009C (de) | Galvanisches Element mit einer negativen Elektrode aus einem Alkali- oder Erdalkalimetall und mit einem Elektrolyten aus einem organischen Lösungsmittel, in dem ein Salz gelöst ist | |
| DE1816708B2 (de) | Durch einleiten von wasserfreiem fluessigem ammoniak akti vierbares primaerelement mit depolarisatorschicht aus quecksilbersalz | |
| DE2440620A1 (de) | Nachladbare zinkchlorid-zelle oder -batterie |