DE1092922B - Verfahren zur Herstellung von 4-(p-Amino-benzolsulfonamido)-pyrazolo[3,4-d]pyrimidinen - Google Patents
Verfahren zur Herstellung von 4-(p-Amino-benzolsulfonamido)-pyrazolo[3,4-d]pyrimidinenInfo
- Publication number
- DE1092922B DE1092922B DEC17804A DEC0017804A DE1092922B DE 1092922 B DE1092922 B DE 1092922B DE C17804 A DEC17804 A DE C17804A DE C0017804 A DEC0017804 A DE C0017804A DE 1092922 B DE1092922 B DE 1092922B
- Authority
- DE
- Germany
- Prior art keywords
- formula
- pyrazolo
- pyrimidine
- amino
- radical
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 4- (p-Amino-benzenesulfonamido) -pyrazolo [3,4-d] pyrimidines Chemical class 0.000 title claims description 28
- 238000000034 method Methods 0.000 title claims description 8
- 238000002360 preparation method Methods 0.000 title claims description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 79
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 63
- VEXZGXHMUGYJMC-UHFFFAOYSA-N hydrochloric acid Substances Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 45
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 28
- 239000013078 crystal Substances 0.000 claims description 20
- 239000002244 precipitate Substances 0.000 claims description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 16
- 238000001816 cooling Methods 0.000 claims description 14
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- 125000003277 amino group Chemical group 0.000 claims description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- 229940124530 sulfonamide Drugs 0.000 claims description 7
- 150000003456 sulfonamides Chemical class 0.000 claims description 7
- QUKPALAWEPMWOS-UHFFFAOYSA-N 1h-pyrazolo[3,4-d]pyrimidine Chemical class C1=NC=C2C=NNC2=N1 QUKPALAWEPMWOS-UHFFFAOYSA-N 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 239000003208 petroleum Substances 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 230000003301 hydrolyzing effect Effects 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims 2
- 239000007795 chemical reaction product Substances 0.000 claims 1
- CGRKCGWEOIQFRD-UHFFFAOYSA-N sodium;(4-aminophenyl)sulfonylazanide Chemical compound [Na+].NC1=CC=C(S([NH-])(=O)=O)C=C1 CGRKCGWEOIQFRD-UHFFFAOYSA-N 0.000 claims 1
- 239000002904 solvent Substances 0.000 claims 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 description 50
- 235000019441 ethanol Nutrition 0.000 description 24
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 16
- 239000000706 filtrate Substances 0.000 description 15
- 239000000203 mixture Substances 0.000 description 13
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- 239000003610 charcoal Substances 0.000 description 9
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 7
- 241001465754 Metazoa Species 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 6
- 230000007062 hydrolysis Effects 0.000 description 6
- 238000006460 hydrolysis reaction Methods 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 150000003254 radicals Chemical group 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 230000001476 alcoholic effect Effects 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000006228 supernatant Substances 0.000 description 4
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 3
- NMRKXWXGVJSXML-UHFFFAOYSA-N 1-cyclohexylpyrazolo[3,4-d]pyrimidin-4-amine Chemical compound N1=CC=2C(N)=NC=NC=2N1C1CCCCC1 NMRKXWXGVJSXML-UHFFFAOYSA-N 0.000 description 3
- PERFWRNKWQXMCO-UHFFFAOYSA-N 2-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine Chemical compound NC1=NC=NC2=NN(C(C)C)C=C21 PERFWRNKWQXMCO-UHFFFAOYSA-N 0.000 description 3
- GRDXCFKBQWDAJH-UHFFFAOYSA-N 4-acetamidobenzenesulfonyl chloride Chemical compound CC(=O)NC1=CC=C(S(Cl)(=O)=O)C=C1 GRDXCFKBQWDAJH-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 125000001033 ether group Chemical group 0.000 description 3
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 3
- 229910003446 platinum oxide Inorganic materials 0.000 description 3
- 150000003230 pyrimidines Chemical class 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- ZAAZBDIZOPOSKB-UHFFFAOYSA-N 1-cyclopentylpyrazolo[3,4-d]pyrimidin-4-amine Chemical compound N1=CC=2C(N)=NC=NC=2N1C1CCCC1 ZAAZBDIZOPOSKB-UHFFFAOYSA-N 0.000 description 2
- XYRVLCQVOLFELO-UHFFFAOYSA-N 1-propan-2-yl-5H-pyrazolo[3,4-d]pyrimidin-4-one Chemical compound N1=CNC(=O)C2=C1N(C(C)C)N=C2 XYRVLCQVOLFELO-UHFFFAOYSA-N 0.000 description 2
- OEICGMPRFOJHKO-UHFFFAOYSA-N 2-(ethoxymethylidene)propanedinitrile Chemical compound CCOC=C(C#N)C#N OEICGMPRFOJHKO-UHFFFAOYSA-N 0.000 description 2
- ZTZVPAVOLCBSOT-UHFFFAOYSA-N 4-methylsulfanyl-2-propan-2-ylpyrazolo[3,4-d]pyrimidine Chemical compound C(C)(C)N1N=C2N=CN=C(C2=C1)SC ZTZVPAVOLCBSOT-UHFFFAOYSA-N 0.000 description 2
- 241000251730 Chondrichthyes Species 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 2
- NXHFZUVHADJHDW-UHFFFAOYSA-N cyclopentylhydrazine Chemical compound NNC1CCCC1 NXHFZUVHADJHDW-UHFFFAOYSA-N 0.000 description 2
- KTMGNAIGXYODKQ-UHFFFAOYSA-N ethyl 2-cyano-3-ethoxyprop-2-enoate Chemical compound CCOC=C(C#N)C(=O)OCC KTMGNAIGXYODKQ-UHFFFAOYSA-N 0.000 description 2
- OMJHZSOAUISRHI-UHFFFAOYSA-N ethyl 3-amino-1-propan-2-ylpyrazole-4-carboxylate Chemical compound CCOC(=O)c1cn(nc1N)C(C)C OMJHZSOAUISRHI-UHFFFAOYSA-N 0.000 description 2
- OFSRMXPYRMMISS-UHFFFAOYSA-N ethyl 5-amino-1-propan-2-ylpyrazole-4-carboxylate Chemical compound CCOC(=O)C=1C=NN(C(C)C)C=1N OFSRMXPYRMMISS-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000035876 healing Effects 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Substances NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 230000001376 precipitating effect Effects 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- HIUMSUSQTXMMCE-UHFFFAOYSA-N 1-butan-2-yl-4-chloropyrazolo[3,4-d]pyrimidine Chemical compound N1=CN=C2N(C(C)CC)N=CC2=C1Cl HIUMSUSQTXMMCE-UHFFFAOYSA-N 0.000 description 1
- SMADNCQAWNZJAC-UHFFFAOYSA-N 1-butan-2-yl-5H-pyrazolo[3,4-d]pyrimidin-4-one Chemical compound C(C)(CC)N1N=CC=2C1=NC=NC2O SMADNCQAWNZJAC-UHFFFAOYSA-N 0.000 description 1
- LFUUCJLUWGGIKX-UHFFFAOYSA-N 1-butan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine Chemical compound N1=CN=C2N(C(C)CC)N=CC2=C1N LFUUCJLUWGGIKX-UHFFFAOYSA-N 0.000 description 1
- OTYWXKVDHFYHOS-UHFFFAOYSA-N 1-cyclohexyl-5H-pyrazolo[3,4-d]pyrimidin-4-one Chemical compound N1=CC=2C(=O)NC=NC=2N1C1CCCCC1 OTYWXKVDHFYHOS-UHFFFAOYSA-N 0.000 description 1
- SATDXXCPAMBXAH-UHFFFAOYSA-N 1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine Chemical compound N1=CN=C2N(C(C)C)N=CC2=C1N SATDXXCPAMBXAH-UHFFFAOYSA-N 0.000 description 1
- MZIDJHWELCEUQN-UHFFFAOYSA-N 2-propan-2-yl-7H-pyrazolo[3,4-d]pyrimidine-4-thione Chemical compound C(C)(C)N1N=C2N=CN=C(C2=C1)S MZIDJHWELCEUQN-UHFFFAOYSA-N 0.000 description 1
- LVJAZWNACGZVRQ-UHFFFAOYSA-N 3-methylbutylhydrazine Chemical compound CC(C)CCNN LVJAZWNACGZVRQ-UHFFFAOYSA-N 0.000 description 1
- CWIZVEZLOAIJFA-UHFFFAOYSA-N 4-acetamidobenzenesulfonic acid hydrochloride Chemical compound Cl.CC(=O)NC1=CC=C(S(O)(=O)=O)C=C1 CWIZVEZLOAIJFA-UHFFFAOYSA-N 0.000 description 1
- MIZMMNBJAJYELG-UHFFFAOYSA-N 4-chloro-1-cyclohexylpyrazolo[3,4-d]pyrimidine Chemical compound N1=CC=2C(Cl)=NC=NC=2N1C1CCCCC1 MIZMMNBJAJYELG-UHFFFAOYSA-N 0.000 description 1
- SSDLXWBYRZAWIP-UHFFFAOYSA-N 5-amino-1-cyclopentylpyrazole-4-carbonitrile Chemical compound NC1=C(C#N)C=NN1C1CCCC1 SSDLXWBYRZAWIP-UHFFFAOYSA-N 0.000 description 1
- FFNKBQRKZRMYCL-UHFFFAOYSA-N 5-amino-1h-pyrazole-4-carbonitrile Chemical compound NC1=NNC=C1C#N FFNKBQRKZRMYCL-UHFFFAOYSA-N 0.000 description 1
- LHCPRYRLDOSKHK-UHFFFAOYSA-N 7-deaza-8-aza-adenine Chemical compound NC1=NC=NC2=C1C=NN2 LHCPRYRLDOSKHK-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- MGMQLLKXFNHMFV-UHFFFAOYSA-N CC(C)N(C=C12)N=C1N=CN=C2NS(C(C=C1)=CC=C1N)(=O)=O Chemical compound CC(C)N(C=C12)N=C1N=CN=C2NS(C(C=C1)=CC=C1N)(=O)=O MGMQLLKXFNHMFV-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- 206010041925 Staphylococcal infections Diseases 0.000 description 1
- 206010061372 Streptococcal infection Diseases 0.000 description 1
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- OFLXLNCGODUUOT-UHFFFAOYSA-N acetohydrazide Chemical compound C\C(O)=N\N OFLXLNCGODUUOT-UHFFFAOYSA-N 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- SFSUYFSIKDDLOL-UHFFFAOYSA-N butan-2-ylhydrazine Chemical compound CCC(C)NN SFSUYFSIKDDLOL-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- LHQRDAIAWDPZGH-UHFFFAOYSA-N cyclohexylhydrazine Chemical compound NNC1CCCCC1 LHQRDAIAWDPZGH-UHFFFAOYSA-N 0.000 description 1
- JZRHODNPRNTXKO-UHFFFAOYSA-N cyclohexylhydrazine;hydrochloride Chemical compound Cl.NNC1CCCCC1 JZRHODNPRNTXKO-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- LDQUOQYBAXYVBZ-UHFFFAOYSA-N ethyl 5-amino-1-butan-2-ylpyrazole-4-carboxylate Chemical compound CCOC(=O)C=1C=NN(C(C)CC)C=1N LDQUOQYBAXYVBZ-UHFFFAOYSA-N 0.000 description 1
- NQLJJSMRVILYQD-UHFFFAOYSA-N ethyl 5-amino-1-cyclohexylpyrazole-4-carboxylate Chemical compound NC1=C(C(=O)OCC)C=NN1C1CCCCC1 NQLJJSMRVILYQD-UHFFFAOYSA-N 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 150000003278 haem Chemical class 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- KJAQRHMKLVGSCG-UHFFFAOYSA-N propan-2-ylhydrazine Chemical compound CC(C)NN KJAQRHMKLVGSCG-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- YZMCKZRAOLZXAZ-UHFFFAOYSA-N sulfisomidine Chemical compound CC1=NC(C)=CC(NS(=O)(=O)C=2C=CC(N)=CC=2)=N1 YZMCKZRAOLZXAZ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH5314957A CH367510A (de) | 1957-11-27 | 1957-11-27 | Verfahren zur Herstellung neuer Sulfonamide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1092922B true DE1092922B (de) | 1960-11-17 |
Family
ID=4518466
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEC17804A Pending DE1092922B (de) | 1957-11-27 | 1958-11-07 | Verfahren zur Herstellung von 4-(p-Amino-benzolsulfonamido)-pyrazolo[3,4-d]pyrimidinen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3036070A (Direct) |
| CH (1) | CH367510A (Direct) |
| DE (1) | DE1092922B (Direct) |
| ES (1) | ES245281A1 (Direct) |
| FR (1) | FR1217070A (Direct) |
| GB (1) | GB889146A (Direct) |
| NL (1) | NL233475A (Direct) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3134933A (en) * | 1962-08-13 | 1964-05-26 | Varian Associates | Adjustable gap magnet |
| GB9114760D0 (en) * | 1991-07-09 | 1991-08-28 | Pfizer Ltd | Therapeutic agents |
| TW444018B (en) | 1992-12-17 | 2001-07-01 | Pfizer | Pyrazolopyrimidines |
| IL135462A0 (en) | 1997-11-12 | 2001-05-20 | Bayer Ag | 2-phenyl substituted imidazotriazinones as phosphodiesterase inhibitors |
| BR0209541A (pt) * | 2001-05-09 | 2004-04-20 | Bayer Healthcare Ag | Uso das imidazotriazinonas 2-fenil-substituìdas |
| DE10232113A1 (de) * | 2002-07-16 | 2004-01-29 | Bayer Ag | Vardenafil Hydrochlorid Trihydrat enthaltende Arzneimittel |
| DE102005009240A1 (de) * | 2005-03-01 | 2006-09-07 | Bayer Healthcare Ag | Arzneiformen mit verbesserten pharmakokinetischen Eigenschaften |
| DE102005009241A1 (de) * | 2005-03-01 | 2006-09-07 | Bayer Healthcare Ag | Arzneiformen mit kontrollierter Bioverfügbarkeit |
| RU2435588C2 (ru) * | 2005-09-29 | 2011-12-10 | Байер Шеринг Фарма Акциенгезельшафт | Ингибиторы фдэ и их комбинации для лечения урологических расстройств |
| JP2010532319A (ja) * | 2007-06-13 | 2010-10-07 | バイエル・シェーリング・ファルマ・アクチェンゲゼルシャフト | 聴覚障害の処置用のpde阻害剤 |
| TW201100427A (en) | 2009-03-31 | 2011-01-01 | Arqule Inc | Substituted heterocyclic compounds |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR876296A (fr) * | 1939-05-23 | 1942-11-02 | Deutsche Hydrierwerke Ag | Perfectionnements apportés aux procédés de fabrication de dérivés de sulfonamides |
| FR880590A (fr) * | 1941-05-14 | 1943-03-30 | Deutsche Hydrierwerke Ag | Perfectionnements apportés aux procédés de fabrication de dérivés de sulfonamides |
| FR882813A (fr) * | 1941-05-14 | 1943-06-16 | Deutsche Hydrierwerke Ag | Perfectionnements apportés aux procédés de fabrication de dérivés de sulfonamides |
| DE834995C (de) * | 1941-06-26 | 1952-03-27 | Boehringer & Soehne Gmbh | Verfahren zur Herstellung bactericid wirkender Purine |
| FR880591A (fr) * | 1941-06-28 | 1943-03-30 | Deutsche Hydrierwerke Ag | Perfectionnements apportés aux procédés de fabrication de dérivés de sulfamidescycliques |
| DE889300C (de) * | 1951-11-03 | 1953-09-10 | Erich Rabald Dr | Verfahren zur Herstellung von Sulfonamiden der aza-Purinreihe |
-
1957
- 1957-11-27 CH CH5314957A patent/CH367510A/de unknown
-
1958
- 1958-11-07 DE DEC17804A patent/DE1092922B/de active Pending
- 1958-11-13 ES ES0245281A patent/ES245281A1/es not_active Expired
- 1958-11-20 FR FR779583A patent/FR1217070A/fr not_active Expired
- 1958-11-21 US US775375A patent/US3036070A/en not_active Expired - Lifetime
- 1958-11-21 NL NL233475D patent/NL233475A/xx unknown
- 1958-11-24 GB GB37828/58A patent/GB889146A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR1217070A (fr) | 1960-05-02 |
| GB889146A (en) | 1962-02-07 |
| NL233475A (Direct) | 1964-01-15 |
| ES245281A1 (es) | 1959-06-01 |
| US3036070A (en) | 1962-05-22 |
| CH367510A (de) | 1963-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2136950A1 (de) | Pyrazolo(3,4 d)pynmidinderivate und deren Salze, Herstellung solcher Substanzen und Arzneimittel mit einem Gehalt daran | |
| DE1092922B (de) | Verfahren zur Herstellung von 4-(p-Amino-benzolsulfonamido)-pyrazolo[3,4-d]pyrimidinen | |
| DE2849537A1 (de) | Substituierte 5-(2-imidazolin-2-yl)- aminopyrimidine und verfahren zu deren herstellung | |
| EP0122580A1 (de) | Pyrimidinderivate, deren Herstellung und pharmazeutische Präparate | |
| DE2461882A1 (de) | Verfahren zur herstellung von 3-amino-1,2,4-oxadiazolen | |
| DE1229096B (de) | Verfahren zur Herstellung von 2-substituierten 3-Amino-pyrazol-4-carbonsaeure-N'-[5-nitrofuryl-(2)-methyliden]-hydraziden | |
| DE933340C (de) | Verfahren zur Herstellung von therapeutisch wertvollen Mitteln der p-Aminobenzolsulfonamid-Reihe | |
| DE671787C (de) | Verfahren zur Darstellung von Pyrimidinverbindungen | |
| DE3879243T2 (de) | Pyrazolderivate, verfahren zu deren herstellung und herbizide, welche diese derivate als wirksubstanz enthalten. | |
| DE1670360A1 (de) | Verfahren zur Herstellung von Derivaten des Piperazins | |
| DE833651C (de) | Verfahren zur Herstellung von neuen Pyrimidinabkoemmlingen | |
| DE951991C (de) | Verfahren zur Herstellung von neuen chlorierten Derivaten des Pyrimidins | |
| DE1620087C (de) | Verfahren zur Herstellung von Imidazolidinonsulfonamidderivaten | |
| DE1470354A1 (de) | Neue 4H-m-Dithiino[5,4-d]-pyrimidine und Verfahren zu ihrer Herstellung | |
| AT256843B (de) | Verfahren zur Herstellung von neuen Dihydrothieno[3,4-d]-pyrimidinen | |
| DE1620087B1 (de) | Verfahren zur Herstellung von Imidazholidinsulfonamidderivaten | |
| AT254878B (de) | Verfahren zur Herstellung von neuen 4H-m-Dithiino[5,4-d]-pyrimidinen | |
| DE941976C (de) | Verfahren zur Herstellung von 2-Amino-naphthostyril-4-sulfonsaeure und ihren Sulfonderivaten | |
| DE730120C (de) | Verfahren zur Darstellung von Sulfonamidverbindungen | |
| DE2306374A1 (de) | Neue 3-substituierte 2-oxo-4-hydroxy1,2,3,4-tetrahydrochinazolin-4-carbonsaeureamide | |
| AT209345B (de) | Verfahren zur Herstellung von neuen, im Pyrazolkern substituierten Pyrazolo-pyrimidinen | |
| DE1445662C (de) | 4- eckige Klammer auf 2-(5-Nitrofuryl)vinyl eckige Klammer zu -pyrimidine und Verfahren zu ihrer Herstellung | |
| DE1106331B (de) | Verfahren zur Herstellung von Pyrazolo[3, 4-d]pyrimidinen | |
| CH385226A (de) | Verfahren zur Herstellung neuer Sulfonamide | |
| AT351033B (de) | Verfahren zur herstellung von neuen benzyl- pyrimidinen und deren salzen |