DE1048737B - - Google Patents
Info
- Publication number
- DE1048737B DE1048737B DENDAT1048737D DE1048737DA DE1048737B DE 1048737 B DE1048737 B DE 1048737B DE NDAT1048737 D DENDAT1048737 D DE NDAT1048737D DE 1048737D A DE1048737D A DE 1048737DA DE 1048737 B DE1048737 B DE 1048737B
- Authority
- DE
- Germany
- Prior art keywords
- acid
- parts
- thiolthionophosphoric
- diethyl ester
- ester
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 claims description 5
- 239000000642 acaricide Substances 0.000 claims description 4
- 239000004480 active ingredient Substances 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 239000000969 carrier Substances 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000002253 acid Substances 0.000 description 20
- 150000002148 esters Chemical class 0.000 description 10
- 229910052760 oxygen Inorganic materials 0.000 description 10
- 238000009835 boiling Methods 0.000 description 9
- -1 mercaptomethyl Chemical group 0.000 description 8
- 230000000895 acaricidal effect Effects 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 5
- 241000488583 Panonychus ulmi Species 0.000 description 5
- 230000000749 insecticidal effect Effects 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000002917 insecticide Substances 0.000 description 4
- 231100000419 toxicity Toxicity 0.000 description 4
- 230000001988 toxicity Effects 0.000 description 4
- YVGGHNCTFXOJCH-UHFFFAOYSA-N DDT Chemical compound C1=CC(Cl)=CC=C1C(C(Cl)(Cl)Cl)C1=CC=C(Cl)C=C1 YVGGHNCTFXOJCH-UHFFFAOYSA-N 0.000 description 3
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Divinylene sulfide Natural products C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 241000607479 Yersinia pestis Species 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- 241000238876 Acari Species 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 241000238631 Hexapoda Species 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 241001454293 Tetranychus urticae Species 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- SWXVUIWOUIDPGS-UHFFFAOYSA-N diacetone alcohol Chemical compound CC(=O)CC(C)(C)O SWXVUIWOUIDPGS-UHFFFAOYSA-N 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 231100000194 ovacidal Toxicity 0.000 description 2
- 230000003151 ovacidal effect Effects 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- ITEQSCBLCCNACE-UHFFFAOYSA-N (5,5-dimethyl-3-oxocyclohexen-1-yl) n,n-dimethylcarbamate Chemical compound CN(C)C(=O)OC1=CC(=O)CC(C)(C)C1 ITEQSCBLCCNACE-UHFFFAOYSA-N 0.000 description 1
- JBGWMRAMUROVND-UHFFFAOYSA-N 1-sulfanylidenethiophene Chemical class S=S1C=CC=C1 JBGWMRAMUROVND-UHFFFAOYSA-N 0.000 description 1
- JCRNSBKSAQHNIN-UHFFFAOYSA-N 2,4-dibutylnaphthalene-1-sulfonic acid Chemical compound C1=CC=CC2=C(S(O)(=O)=O)C(CCCC)=CC(CCCC)=C21 JCRNSBKSAQHNIN-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- ZXVONLUNISGICL-UHFFFAOYSA-N 4,6-dinitro-o-cresol Chemical compound CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O ZXVONLUNISGICL-UHFFFAOYSA-N 0.000 description 1
- CSXMWEYGXBNRSN-UHFFFAOYSA-N 5,5-dimethylcyclohex-3-ene-1,3-diol Chemical compound CC1(C)CC(O)CC(O)=C1 CSXMWEYGXBNRSN-UHFFFAOYSA-N 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- 241000239290 Araneae Species 0.000 description 1
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 1
- 239000005749 Copper compound Substances 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical group OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- RYYWUUFWQRZTIU-UHFFFAOYSA-N Thiophosphoric acid Chemical compound OP(O)(S)=O RYYWUUFWQRZTIU-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 150000001880 copper compounds Chemical class 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 231100000086 high toxicity Toxicity 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002731 mercury compounds Chemical class 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000000199 molecular distillation Methods 0.000 description 1
- 150000005002 naphthylamines Chemical class 0.000 description 1
- 230000001473 noxious effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 230000007096 poisonous effect Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/06—Phosphorus compounds without P—C bonds
- C07F9/16—Esters of thiophosphoric acids or thiophosphorous acids
- C07F9/165—Esters of thiophosphoric acids
- C07F9/1651—Esters of thiophosphoric acids with hydroxyalkyl compounds with further substituents on alkyl
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH772213X | 1954-06-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1048737B true DE1048737B (enExample) | 1959-01-15 |
Family
ID=4535504
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT1048737D Pending DE1048737B (enExample) | 1954-06-10 | ||
| DEG17346A Expired DE957213C (de) | 1954-06-10 | 1955-06-09 | Verfahren zur Herstellung von neuen Thiolthionophosphorsaeureestern |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEG17346A Expired DE957213C (de) | 1954-06-10 | 1955-06-09 | Verfahren zur Herstellung von neuen Thiolthionophosphorsaeureestern |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2891984A (enExample) |
| BE (1) | BE538871A (enExample) |
| CY (1) | CY166A (enExample) |
| DE (2) | DE957213C (enExample) |
| FR (1) | FR1132520A (enExample) |
| GB (1) | GB772213A (enExample) |
| MY (1) | MY5800037A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1154669B (de) * | 1960-06-10 | 1963-09-19 | Schering Ag | Mittel gegen Spinnmilben |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1072619B (de) * | 1960-01-07 | Farbenfabriken Bayer Aktiengesellschaft, Leverkusen-Bayerwerk | Verfahren zur Herstellung von Thiophosphorsäureestern | |
| US3060217A (en) * | 1957-10-25 | 1962-10-23 | Bayer Ag | Thiophosphoric acid esters |
| DE1102150B (de) * | 1959-05-09 | 1961-03-16 | Bayer Ag | Verfahren zur Herstellung von Thiophosphon- oder -phosphinsaeure-estern |
| US2961458A (en) * | 1958-10-17 | 1960-11-22 | Bayer Ag | Phosphorus containing insecticidal compounds and a process for their production |
| DE1063157B (de) * | 1958-10-18 | 1959-08-13 | Bayer Ag | Verfahren zur Herstellung von Thiophosphorsaeureestern |
| DE1071696B (de) * | 1958-10-18 | 1959-12-24 | Farbenfabriken Bayer Aktiengesellschaft, Leverkusen-Bayerwerk | Verfahren zur Herstellung von Thiophasphorsäureestern |
| DE1116659B (de) * | 1958-11-18 | 1961-11-09 | Bayer Ag | Verfahren zur Herstellung von Fluorphenylmercaptomethylthiol- bzw. -dithiophosphon- oder phosphinsaeureestern |
| BE595664A (enExample) * | 1959-10-02 | |||
| NL289742A (enExample) * | 1962-03-05 | |||
| US3274299A (en) * | 1963-05-17 | 1966-09-20 | Stauffer Chemical Co | O, o-dialkyl nitrophenoxymethyl-phosphorothioates |
| DE1204667C2 (de) * | 1964-01-04 | 1973-01-25 | Bayer Ag | Verfahren zur Herstellung von unsymmetrischen Thionothiolphorsphorsaeureestern |
| US3462530A (en) * | 1964-06-12 | 1969-08-19 | Stauffer Chemical Co | S-chlorophenoxy-methyl,thio,dithio phosphonates or phosphates as insecticides and acaricides |
| IT1168166B (it) * | 1981-09-02 | 1987-05-20 | Montedison Spa | Composizioni acaricide |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2266514A (en) * | 1938-09-09 | 1941-12-16 | American Cyanamid Co | Esters of dithiophosphoric acids |
| US2586655A (en) * | 1948-03-26 | 1952-02-19 | American Cyanamid Co | S-alkoxymethyl-o, o'-dialkyldithiophosphates |
| IT479217A (enExample) * | 1949-10-11 | |||
| DE830509C (de) * | 1950-05-24 | 1952-02-04 | Bayer Ag | Verfahren zur Herstellung von neutralen Estern der Thiophosphorsaeure |
| US2609383A (en) * | 1950-09-30 | 1952-09-02 | Lubrizol Corp | Nitrobenzyl thiophosphate esters |
| US2793224A (en) * | 1954-02-03 | 1957-05-21 | Stauffer Chemical Co | P-chlorophenyl-mercaptomethyl di-alkyl dithiophosphates and their use as insecticides |
-
0
- BE BE538871D patent/BE538871A/xx unknown
- DE DENDAT1048737D patent/DE1048737B/de active Pending
-
1955
- 1955-05-13 US US508297A patent/US2891984A/en not_active Expired - Lifetime
- 1955-06-08 GB GB16536/55A patent/GB772213A/en not_active Expired
- 1955-06-09 DE DEG17346A patent/DE957213C/de not_active Expired
- 1955-06-09 FR FR1132520D patent/FR1132520A/fr not_active Expired
-
1957
- 1957-11-21 CY CY16657A patent/CY166A/xx unknown
-
1958
- 1958-12-31 MY MY195837A patent/MY5800037A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1154669B (de) * | 1960-06-10 | 1963-09-19 | Schering Ag | Mittel gegen Spinnmilben |
Also Published As
| Publication number | Publication date |
|---|---|
| US2891984A (en) | 1959-06-23 |
| DE957213C (de) | 1957-01-31 |
| GB772213A (en) | 1957-04-10 |
| BE538871A (enExample) | |
| CY166A (en) | 1957-11-21 |
| MY5800037A (en) | 1958-12-31 |
| FR1132520A (fr) | 1957-03-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE947208C (de) | Schaedlingsbekaempfungsmittel | |
| DE1048737B (enExample) | ||
| DE2461513A1 (de) | Morpholinderivate | |
| DE1060659B (de) | Schaedlingsbekaempfungsmittel | |
| DE1017848B (de) | Insektizide Mittel | |
| DE2228923C3 (de) | O.S-Dialkyl-N-chloralkylthio-oder -N-phenylthio-thioamidophosphate und Insektizidmischungen, die diese Verbindungen enthalten | |
| DE1147439B (de) | Phosphorsaeureester als insektizide Mittel | |
| DE1148806B (de) | Schaedlingsbekaempfungsmittel | |
| DE1140776B (de) | Schaedlingsbekaempfungsmittel | |
| DE2321522C2 (de) | Insekticides Mittel zur Bekämpfung des Raupenfraßes von Blättern | |
| DE1181200B (de) | Verfahren zur Herstellung des N-Mono-methylamids der O, O-Di-(ª-fluoraethyl)-dithiophosphorylessigsaeure | |
| DE1136328B (de) | Verfahren zur Herstellung von Dithiolphosphorsaeureestern | |
| CH627620A5 (en) | Method and composition for controlling insects and acarids | |
| DE1259331B (de) | Verfahren zur Herstellung von Dithiophosphorsaeureestern | |
| DE1768310C3 (de) | Verfahren zur Herstellung von Thiophosphorsäurederivaten | |
| DE1003494B (de) | Schaedlingsbekaempfungsmittel | |
| DE1955967C (de) | Thiophosphorsäureester und ihre Verwendung als Pesticide | |
| AT291675B (de) | Schädlingsbekämpfungsmittel | |
| DE1493569B2 (de) | Neue aromatische Phosphor- bzw. Phosphonsäureester, Verfahren zu ihrer Herstellung und solche enthaltende insektizide und akarizide Mittel | |
| CH328336A (de) | Verfahren und Mittel zur Milbenbekämpfung | |
| DE1112338B (de) | Schaedlingsbekaempfungsmittel mit insekticider und insbesondere miticider Wirkung | |
| DE1190247B (de) | Mittel zur Bekaempfung von Insekten und Acariden | |
| DE1187849B (de) | Insektizide Mittel | |
| DE1282017B (de) | O,O-Dimethyl-O-(4-methylmercaptophenyl)-phosphat | |
| DE1161079B (de) | Mittel zur Bekaempfung von Insekten und Zecken |