DD156079A5 - Verfahren zur herstellung neuer nitroalkanolderivate - Google Patents
Verfahren zur herstellung neuer nitroalkanolderivate Download PDFInfo
- Publication number
- DD156079A5 DD156079A5 DD80227422A DD22742280A DD156079A5 DD 156079 A5 DD156079 A5 DD 156079A5 DD 80227422 A DD80227422 A DD 80227422A DD 22742280 A DD22742280 A DD 22742280A DD 156079 A5 DD156079 A5 DD 156079A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- general formula
- nitro
- group
- hydrogen
- item
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 72
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims abstract description 33
- 238000002360 preparation method Methods 0.000 claims abstract description 33
- 239000011541 reaction mixture Substances 0.000 claims abstract description 30
- 238000000034 method Methods 0.000 claims abstract description 28
- VUZPGEIXNYGDJN-UHFFFAOYSA-N 1-nitroethanol Chemical compound CC(O)[N+]([O-])=O VUZPGEIXNYGDJN-UHFFFAOYSA-N 0.000 claims abstract description 20
- -1 nitrofuryl group Chemical group 0.000 claims description 31
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 28
- 239000001257 hydrogen Substances 0.000 claims description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims description 17
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 17
- 239000002585 base Substances 0.000 claims description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 150000008065 acid anhydrides Chemical class 0.000 claims description 8
- 230000010933 acylation Effects 0.000 claims description 8
- 238000005917 acylation reaction Methods 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 8
- 239000007858 starting material Substances 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 claims description 7
- 238000006243 chemical reaction Methods 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 7
- 125000004423 acyloxy group Chemical group 0.000 claims description 6
- 150000002431 hydrogen Chemical class 0.000 claims description 6
- 239000000741 silica gel Substances 0.000 claims description 6
- 229910002027 silica gel Inorganic materials 0.000 claims description 6
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 238000010438 heat treatment Methods 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 4
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 4
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 claims description 3
- 239000005695 Ammonium acetate Substances 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 150000003973 alkyl amines Chemical class 0.000 claims description 3
- 235000019257 ammonium acetate Nutrition 0.000 claims description 3
- 229940043376 ammonium acetate Drugs 0.000 claims description 3
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 claims description 3
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 3
- 125000002541 furyl group Chemical group 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 239000003463 adsorbent Substances 0.000 claims description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 125000005082 alkoxyalkenyl group Chemical group 0.000 claims description 2
- 125000005530 alkylenedioxy group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 238000002955 isolation Methods 0.000 claims description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims 1
- 150000001735 carboxylic acids Chemical class 0.000 claims 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 1
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 abstract description 38
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 abstract description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 abstract description 12
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 abstract description 9
- 239000012346 acetyl chloride Substances 0.000 abstract description 9
- KVFDZFBHBWTVID-UHFFFAOYSA-N cyclohexanecarbaldehyde Chemical compound O=CC1CCCCC1 KVFDZFBHBWTVID-UHFFFAOYSA-N 0.000 abstract description 4
- XSMVLMONDOBMLB-UHFFFAOYSA-N (3-acetyloxy-3-cyclohexyl-2-nitropropyl) acetate Chemical compound CC(=O)OCC([N+]([O-])=O)C(OC(C)=O)C1CCCCC1 XSMVLMONDOBMLB-UHFFFAOYSA-N 0.000 abstract description 3
- 125000005809 3,4,5-trimethoxyphenyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 abstract description 2
- JYLBSFLMMUXJEM-UHFFFAOYSA-N [3-(3-fluorophenyl)-2-nitroprop-2-enyl] acetate Chemical compound CC(=O)OCC([N+]([O-])=O)=CC1=CC=CC(F)=C1 JYLBSFLMMUXJEM-UHFFFAOYSA-N 0.000 abstract 1
- 239000011814 protection agent Substances 0.000 abstract 1
- 238000000926 separation method Methods 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 54
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 32
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 30
- 239000000203 mixture Substances 0.000 description 25
- 239000000047 product Substances 0.000 description 21
- 238000004458 analytical method Methods 0.000 description 20
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 19
- 229960000583 acetic acid Drugs 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 239000012071 phase Substances 0.000 description 8
- 239000001294 propane Substances 0.000 description 8
- 238000009835 boiling Methods 0.000 description 7
- 238000002425 crystallisation Methods 0.000 description 7
- 230000008025 crystallization Effects 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 239000003960 organic solvent Substances 0.000 description 6
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 6
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 5
- OAMZXMDZZWGPMH-UHFFFAOYSA-N ethyl acetate;toluene Chemical compound CCOC(C)=O.CC1=CC=CC=C1 OAMZXMDZZWGPMH-UHFFFAOYSA-N 0.000 description 5
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 5
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 4
- OPHQOIGEOHXOGX-UHFFFAOYSA-N 3,4,5-trimethoxybenzaldehyde Chemical compound COC1=CC(C=O)=CC(OC)=C1OC OPHQOIGEOHXOGX-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- OMIQHZQRNGOZCO-UHFFFAOYSA-N phenylmethanol;propan-2-one Chemical compound CC(C)=O.OCC1=CC=CC=C1 OMIQHZQRNGOZCO-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- WJUFSDZVCOTFON-UHFFFAOYSA-N veratraldehyde Chemical compound COC1=CC=C(C=O)C=C1OC WJUFSDZVCOTFON-UHFFFAOYSA-N 0.000 description 4
- KTCCOCRJFOKLPW-UHFFFAOYSA-N 2-acetyloxypropan-2-yl acetate Chemical compound CC(=O)OC(C)(C)OC(C)=O KTCCOCRJFOKLPW-UHFFFAOYSA-N 0.000 description 3
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 3
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 3
- 239000002262 Schiff base Substances 0.000 description 3
- 150000004753 Schiff bases Chemical class 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 230000004071 biological effect Effects 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- NEHNMFOYXAPHSD-UHFFFAOYSA-N citronellal Chemical compound O=CCC(C)CCC=C(C)C NEHNMFOYXAPHSD-UHFFFAOYSA-N 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 235000011056 potassium acetate Nutrition 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M sodium bicarbonate Substances [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- KZDCMKVLEYCGQX-UDPGNSCCSA-N 2-(diethylamino)ethyl 4-aminobenzoate;(2s,5r,6r)-3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;hydrate Chemical compound O.CCN(CC)CCOC(=O)C1=CC=C(N)C=C1.N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 KZDCMKVLEYCGQX-UDPGNSCCSA-N 0.000 description 2
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 2
- IZCKSXPYEIIZEC-UHFFFAOYSA-N 2-nitro-1-(3,4,5-trimethoxyphenyl)propane-1,3-diol Chemical compound COC1=CC(C(O)C(CO)[N+]([O-])=O)=CC(OC)=C1OC IZCKSXPYEIIZEC-UHFFFAOYSA-N 0.000 description 2
- ISFLMRMEENVDJD-UHFFFAOYSA-N 3-hydroxy-3-nitrobutan-2-one Chemical compound CC(=O)C(C)(O)[N+]([O-])=O ISFLMRMEENVDJD-UHFFFAOYSA-N 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- PVVKNQPMDBTXRS-UHFFFAOYSA-N [3-acetyloxy-2-nitro-3-(4-nitrophenyl)propyl] acetate Chemical compound CC(=O)OCC([N+]([O-])=O)C(OC(C)=O)C1=CC=C([N+]([O-])=O)C=C1 PVVKNQPMDBTXRS-UHFFFAOYSA-N 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 229930003633 citronellal Natural products 0.000 description 2
- 235000000983 citronellal Nutrition 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000005805 dimethoxy phenyl group Chemical group 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000000265 homogenisation Methods 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- SATCULPHIDQDRE-UHFFFAOYSA-N piperonal Chemical compound O=CC1=CC=C2OCOC2=C1 SATCULPHIDQDRE-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- PZSJOBKRSVRODF-UHFFFAOYSA-N vanillin acetate Chemical compound COC1=CC(C=O)=CC=C1OC(C)=O PZSJOBKRSVRODF-UHFFFAOYSA-N 0.000 description 2
- ABUCXZPWLZXBBB-UHFFFAOYSA-N (2-nitro-3-phenylprop-2-enyl) acetate Chemical compound CC(=O)OCC([N+]([O-])=O)=CC1=CC=CC=C1 ABUCXZPWLZXBBB-UHFFFAOYSA-N 0.000 description 1
- UFMWVZVQOIEXQY-UHFFFAOYSA-N (3-acetyloxy-2-nitropentyl) acetate Chemical compound CC(=O)OC(CC)C([N+]([O-])=O)COC(C)=O UFMWVZVQOIEXQY-UHFFFAOYSA-N 0.000 description 1
- XMOXLJFFNVSIII-UHFFFAOYSA-N (3-acetyloxy-2-nitrotetradecyl) acetate Chemical compound CCCCCCCCCCCC(OC(C)=O)C([N+]([O-])=O)COC(C)=O XMOXLJFFNVSIII-UHFFFAOYSA-N 0.000 description 1
- LOGVSHUZHCZOMA-UHFFFAOYSA-N (3-acetyloxy-3-nitropropyl) acetate Chemical compound CC(=O)OCCC(OC(C)=O)[N+]([O-])=O LOGVSHUZHCZOMA-UHFFFAOYSA-N 0.000 description 1
- ARDHFTUSPJXLIR-UHFFFAOYSA-N 1-(3,4-dimethoxyphenyl)-2-nitropropane-1,3-diol Chemical compound COC1=CC=C(C(O)C(CO)[N+]([O-])=O)C=C1OC ARDHFTUSPJXLIR-UHFFFAOYSA-N 0.000 description 1
- HCOPTVVQEVJYSW-UHFFFAOYSA-N 1-nitroethyl acetate Chemical compound [O-][N+](=O)C(C)OC(C)=O HCOPTVVQEVJYSW-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- PIKNVEVCWAAOMJ-UHFFFAOYSA-N 3-fluorobenzaldehyde Chemical compound FC1=CC=CC(C=O)=C1 PIKNVEVCWAAOMJ-UHFFFAOYSA-N 0.000 description 1
- ZRYZBQLXDKPBDU-UHFFFAOYSA-N 4-bromobenzaldehyde Chemical compound BrC1=CC=C(C=O)C=C1 ZRYZBQLXDKPBDU-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- BXRFQSNOROATLV-UHFFFAOYSA-N 4-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(C=O)C=C1 BXRFQSNOROATLV-UHFFFAOYSA-N 0.000 description 1
- RSIWALKZYXPAGW-NSHDSACASA-N 6-(3-fluorophenyl)-3-methyl-7-[(1s)-1-(7h-purin-6-ylamino)ethyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one Chemical compound C=1([C@@H](NC=2C=3N=CNC=3N=CN=2)C)N=C2SC=C(C)N2C(=O)C=1C1=CC=CC(F)=C1 RSIWALKZYXPAGW-NSHDSACASA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- SNHWHJFEISXBOB-UHFFFAOYSA-N NBrO Chemical compound NBrO SNHWHJFEISXBOB-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 101000579646 Penaeus vannamei Penaeidin-1 Proteins 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 235000019484 Rapeseed oil Nutrition 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- IYXQIIAAUONGSG-UHFFFAOYSA-N [3-acetyloxy-2-nitro-3-(3,4,5-trimethoxyphenyl)propyl] acetate Chemical compound COC1=CC(C(OC(C)=O)C(COC(C)=O)[N+]([O-])=O)=CC(OC)=C1OC IYXQIIAAUONGSG-UHFFFAOYSA-N 0.000 description 1
- VWOHFKXHVVPDMB-UHFFFAOYSA-N [3-acetyloxy-3-(4-acetyloxy-3-methoxyphenyl)-2-nitropropyl] acetate Chemical compound COC1=CC(C(OC(C)=O)C(COC(C)=O)[N+]([O-])=O)=CC=C1OC(C)=O VWOHFKXHVVPDMB-UHFFFAOYSA-N 0.000 description 1
- IQNYNCZVUMFKTC-UHFFFAOYSA-N [3-acetyloxy-3-(furan-2-yl)-2-nitropropyl] acetate Chemical compound CC(=O)OCC([N+]([O-])=O)C(OC(C)=O)C1=CC=CO1 IQNYNCZVUMFKTC-UHFFFAOYSA-N 0.000 description 1
- WEVYAHXRMPXWCK-UHFFFAOYSA-N acetonitrile Substances CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 230000000507 anthelmentic effect Effects 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 239000012928 buffer substance Substances 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- IFXRWCGNXVQHOJ-UHFFFAOYSA-N butan-2-one phenylmethanol Chemical compound CCC(C)=O.OCC1=CC=CC=C1 IFXRWCGNXVQHOJ-UHFFFAOYSA-N 0.000 description 1
- HOWJQLVNDUGZBI-UHFFFAOYSA-N butane;propane Chemical compound CCC.CCCC HOWJQLVNDUGZBI-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000005356 cycloalkylalkenyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- HFJRKMMYBMWEAD-UHFFFAOYSA-N dodecanal Chemical compound CCCCCCCCCCCC=O HFJRKMMYBMWEAD-UHFFFAOYSA-N 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- XPFVYQJUAUNWIW-UHFFFAOYSA-N furfuryl alcohol Chemical compound OCC1=CC=CO1 XPFVYQJUAUNWIW-UHFFFAOYSA-N 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229940089454 lauryl aldehyde Drugs 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 239000010451 perlite Substances 0.000 description 1
- 235000019362 perlite Nutrition 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 229940093429 polyethylene glycol 6000 Drugs 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 150000003142 primary aromatic amines Chemical class 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- XMVJITFPVVRMHC-UHFFFAOYSA-N roxarsone Chemical compound OC1=CC=C([As](O)(O)=O)C=C1[N+]([O-])=O XMVJITFPVVRMHC-UHFFFAOYSA-N 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000002639 sodium chloride Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/39—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups
- C07C205/42—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups having nitro groups or esterified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/39—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups
- C07C205/40—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups having nitro groups and esterified hydroxy groups bound to acyclic carbon atoms of the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
- Furan Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU79EE2684A HU179696B (en) | 1979-07-26 | 1979-07-26 | Plant protective compositions with antimicrobial,mainly fungicide activity and process for preparing the active substances |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD156079A5 true DD156079A5 (de) | 1982-07-28 |
Family
ID=10995863
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD80227422A DD156079A5 (de) | 1979-07-26 | 1980-07-25 | Verfahren zur herstellung neuer nitroalkanolderivate |
| DD80222884A DD152272A5 (de) | 1979-07-26 | 1980-07-25 | Pflanzenschutzmittel |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD80222884A DD152272A5 (de) | 1979-07-26 | 1980-07-25 | Pflanzenschutzmittel |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4469703A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5686136A (cg-RX-API-DMAC10.html) |
| AT (2) | AT374168B (cg-RX-API-DMAC10.html) |
| AU (1) | AU535446B2 (cg-RX-API-DMAC10.html) |
| BE (1) | BE884473A (cg-RX-API-DMAC10.html) |
| BG (2) | BG35028A3 (cg-RX-API-DMAC10.html) |
| CH (1) | CH650244A5 (cg-RX-API-DMAC10.html) |
| CS (1) | CS220783B2 (cg-RX-API-DMAC10.html) |
| DD (2) | DD156079A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE3028357A1 (cg-RX-API-DMAC10.html) |
| DK (1) | DK156390C (cg-RX-API-DMAC10.html) |
| ES (1) | ES8105966A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2462416A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB2054594B (cg-RX-API-DMAC10.html) |
| GR (1) | GR69663B (cg-RX-API-DMAC10.html) |
| HU (1) | HU179696B (cg-RX-API-DMAC10.html) |
| IL (1) | IL60586A (cg-RX-API-DMAC10.html) |
| IT (1) | IT1132223B (cg-RX-API-DMAC10.html) |
| NL (1) | NL8004203A (cg-RX-API-DMAC10.html) |
| PL (1) | PL133450B1 (cg-RX-API-DMAC10.html) |
| SU (1) | SU1264838A3 (cg-RX-API-DMAC10.html) |
| YU (1) | YU42675B (cg-RX-API-DMAC10.html) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2259825C9 (ru) * | 2001-06-18 | 2006-04-10 | БиоДием Лимитед | Вещества, проявляющие антимикробную, антигрибковую, антипротозойную активности |
| AU2004215925B2 (en) * | 2003-02-28 | 2009-07-09 | Biodiem Ltd | Growth promotion method |
| AU2003900927A0 (en) * | 2003-02-28 | 2003-03-13 | Biodiem Ltd | Growth promotion method |
| US20060150681A1 (en) * | 2005-01-13 | 2006-07-13 | Owens-Brockway Glass Container Inc. | Glassware molds with cooling arrangement |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2185297A (en) * | 1936-09-23 | 1940-01-02 | Hercules Powder Co Ltd | Organic esters and method for their production |
| US2340268A (en) * | 1940-06-13 | 1944-01-25 | Purdue Research Foundation | Esters of nitrohydroxy compounds |
| US2402776A (en) * | 1944-03-23 | 1946-06-25 | Commercial Solvents Corp | Preparation of water-repellent textiles |
| US2967829A (en) * | 1958-06-27 | 1961-01-10 | Commercial Solvents Corp | Stabilized liquid petroleum lubricant |
| US2976244A (en) * | 1958-06-27 | 1961-03-21 | Commercial Solvents Corp | Petroleum lubricants stabilized with nitroesters |
| US3149031A (en) * | 1961-06-01 | 1964-09-15 | Monsanto Co | Nitroalkyl esters of hydrocarbyl-carboxylic acids as fungicides |
| US3723546A (en) * | 1971-09-17 | 1973-03-27 | Purdue Research Foundation | Selective production of nitro alkanes |
| US3931412A (en) * | 1972-06-28 | 1976-01-06 | Chevron Research Company | Fungus and bacteria control with di-carboxylic acid esters |
| GB1449540A (en) * | 1974-03-21 | 1976-09-15 | Sarabahai Research Centre | Nitrostyrene derivatives process for their preparation and compo sitions containing same |
| HU182730B (en) * | 1976-07-06 | 1984-03-28 | Egyt Gyogyszervegyeszeti Gyar | Plant protectives as well as method for producing the agents |
| US4160035A (en) * | 1976-07-06 | 1979-07-03 | Egyt Gyogyszervegyeszeti Gyar | Plant protecting agents and methods for their use |
| US4219660A (en) * | 1977-06-24 | 1980-08-26 | Hoffmann-La Roche Inc. | Conjugated diene derivatives |
-
1979
- 1979-07-26 HU HU79EE2684A patent/HU179696B/hu not_active IP Right Cessation
-
1980
- 1980-07-14 IL IL60586A patent/IL60586A/xx unknown
- 1980-07-22 NL NL8004203A patent/NL8004203A/nl not_active Application Discontinuation
- 1980-07-23 IT IT23631/80A patent/IT1132223B/it active
- 1980-07-23 ES ES493628A patent/ES8105966A1/es not_active Expired
- 1980-07-24 YU YU1881/80A patent/YU42675B/xx unknown
- 1980-07-24 GB GB8024341A patent/GB2054594B/en not_active Expired
- 1980-07-24 CS CS805237A patent/CS220783B2/cs unknown
- 1980-07-25 DE DE19803028357 patent/DE3028357A1/de active Granted
- 1980-07-25 BG BG051780A patent/BG35028A3/xx unknown
- 1980-07-25 BG BG048612A patent/BG35035A3/xx unknown
- 1980-07-25 DD DD80227422A patent/DD156079A5/de unknown
- 1980-07-25 AU AU60789/80A patent/AU535446B2/en not_active Ceased
- 1980-07-25 BE BE0/201523A patent/BE884473A/fr not_active IP Right Cessation
- 1980-07-25 DD DD80222884A patent/DD152272A5/de unknown
- 1980-07-25 SU SU802954188A patent/SU1264838A3/ru active
- 1980-07-25 GR GR62545A patent/GR69663B/el unknown
- 1980-07-25 DK DK324480A patent/DK156390C/da active
- 1980-07-25 AT AT0387480A patent/AT374168B/de not_active IP Right Cessation
- 1980-07-25 FR FR8016498A patent/FR2462416A1/fr active Granted
- 1980-07-25 CH CH5691/80A patent/CH650244A5/de not_active IP Right Cessation
- 1980-07-26 JP JP10189780A patent/JPS5686136A/ja active Granted
- 1980-07-26 PL PL1980225900A patent/PL133450B1/pl unknown
-
1982
- 1982-02-22 US US06/350,570 patent/US4469703A/en not_active Expired - Fee Related
- 1982-12-07 AT AT0444782A patent/AT384525B/de not_active IP Right Cessation
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2108438C2 (de) | 4-(4-Methoxy-benzyl)-imidazolidin-2-one | |
| DD202152A5 (de) | Verfahren zur herstellung von phenylpiperazinderivaten | |
| AT262274B (de) | Verfahren zur Herstellung neuer Indolderivate | |
| DE3114239C2 (de) | N↑4↑-Carbamoylpiperazinpropanolderivate, Verfahren zu ihrer Herstellung und pharmazeutisches Mittel | |
| DE2234651A1 (de) | Eckige klammer auf 1-(p-chlorbenzoyl)5-methoxy-2-methyl-3-indol eckige klammer zu acetoxyessigsaeure, verfahren zu ihrer herstellung sowie ihre verwendung in arzneimitteln | |
| DD202542A5 (de) | Verfahren zur herstellung von 1-phenyl-2-aminocarbonylindol-verbindungen | |
| EP0087655B1 (de) | Verfahren zur Herstellung von Acemetacin | |
| DD156079A5 (de) | Verfahren zur herstellung neuer nitroalkanolderivate | |
| US2759972A (en) | 2-amino and acylamino-1-(hydrocarbylsulphonylphenyl)-1, 3-propanediols | |
| US4902698A (en) | Benzenesulphonamidopyridyl compounds which are useful as thromboxane A.sub.2 | |
| DE1795543C3 (de) | Indolyl-(3)-alkancarbonsaure-niedrig alkylester | |
| EP0056617B1 (de) | Cycloheptenderivate, Verfahren und Zwischenprodukte für ihre Herstellung, sowie diese enthaltende Arzneimittel | |
| DE2755727A1 (de) | Derivate des 1,2,4-triazolidin- 2,5-dions, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DD209813A5 (de) | Verfahren zur herstellung von cycloalkanderivaten | |
| DE69111541T2 (de) | Neue Indol- und Indolin-Verbindungen. | |
| DE2409313A1 (de) | Neue pyrrolyl-verbindungen und verfahren zu ihrer herstellung | |
| DE2540552A1 (de) | Cycloalkylderivate von 1-aryloxy-3- amino-2-propanolen | |
| US3459799A (en) | Carbonyl containing 1-methyl-2-benzyl-hydrazine compounds | |
| DD157796A5 (de) | Verfahren zur herstellung neuer derivate des 2-amino-aethanols | |
| DE2417464A1 (de) | Neue amine und verfahren zu ihrer herstellung | |
| US4161528A (en) | 1,3-Diphenyl-2-trichloromethyl-imidazolidines | |
| US3415933A (en) | Insecticidal method and compositions comprising heterocyclic carbamic acid esters | |
| JPS5839634A (ja) | 殺ダニ性化合物 | |
| JPS6023642B2 (ja) | 植物保護剤及びその製法 | |
| AT222116B (de) | Verfahren zur Herstellung von neuen, 4-substituierten 1,2-Diaryl-3,5-dioxo-pyrazolidinen |