CS226010B2 - Method of preparing new penemcarboxylic acid derivatives - Google Patents
Method of preparing new penemcarboxylic acid derivatives Download PDFInfo
- Publication number
- CS226010B2 CS226010B2 CS801241A CS124180A CS226010B2 CS 226010 B2 CS226010 B2 CS 226010B2 CS 801241 A CS801241 A CS 801241A CS 124180 A CS124180 A CS 124180A CS 226010 B2 CS226010 B2 CS 226010B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- group
- formula
- compound
- defined above
- alkyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 26
- 239000002253 acid Substances 0.000 title claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 127
- -1 p-methoxybenzyl Chemical group 0.000 claims description 84
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 22
- 150000002148 esters Chemical class 0.000 claims description 20
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 claims description 20
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- 239000001257 hydrogen Substances 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 14
- 150000002431 hydrogen Chemical class 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 12
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 150000003254 radicals Chemical class 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 7
- 125000001506 1,2,3-triazol-5-yl group Chemical group [H]N1N=NC([H])=C1[*] 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 239000007858 starting material Substances 0.000 claims description 6
- USVZHTBPMMSRHY-UHFFFAOYSA-N 8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-9-[2-(2-chlorophenyl)ethyl]purin-6-amine Chemical compound C=1C=2OCOC=2C=C(Br)C=1SC1=NC=2C(N)=NC=NC=2N1CCC1=CC=CC=C1Cl USVZHTBPMMSRHY-UHFFFAOYSA-N 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 claims description 5
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 4
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 4
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 claims description 4
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 claims description 4
- 230000001476 alcoholic effect Effects 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 3
- 238000007363 ring formation reaction Methods 0.000 claims description 3
- 238000006467 substitution reaction Methods 0.000 claims description 3
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 2
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 230000001590 oxidative effect Effects 0.000 claims description 2
- 125000005633 phthalidyl group Chemical group 0.000 claims description 2
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 2
- XLYOFNOQVPJJNP-ZSJDYOACSA-N Heavy water Chemical compound [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 claims 4
- 150000005840 aryl radicals Chemical class 0.000 claims 3
- 125000002853 C1-C4 hydroxyalkyl group Chemical group 0.000 claims 1
- 125000001539 acetonyl group Chemical group [H]C([H])([H])C(=O)C([H])([H])* 0.000 claims 1
- 125000001487 glyoxylate group Chemical class O=C([O-])C(=O)[*] 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- WHMDPDGBKYUEMW-UHFFFAOYSA-N pyridine-2-thiol Chemical compound SC1=CC=CC=N1 WHMDPDGBKYUEMW-UHFFFAOYSA-N 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 81
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 81
- 239000000243 solution Substances 0.000 description 43
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 34
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 31
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- 239000000203 mixture Substances 0.000 description 26
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 24
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 20
- 239000000741 silica gel Substances 0.000 description 20
- 229910002027 silica gel Inorganic materials 0.000 description 20
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 18
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 18
- 238000001704 evaporation Methods 0.000 description 17
- 230000008020 evaporation Effects 0.000 description 17
- 239000000047 product Substances 0.000 description 17
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 16
- 238000001228 spectrum Methods 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 229910052938 sodium sulfate Inorganic materials 0.000 description 15
- 235000011152 sodium sulphate Nutrition 0.000 description 15
- 239000002904 solvent Substances 0.000 description 14
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 12
- 239000003480 eluent Substances 0.000 description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 11
- MNFORVFSTILPAW-UHFFFAOYSA-N azetidin-2-one Chemical compound O=C1CCN1 MNFORVFSTILPAW-UHFFFAOYSA-N 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 238000002329 infrared spectrum Methods 0.000 description 9
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 9
- 239000000706 filtrate Substances 0.000 description 8
- 238000000746 purification Methods 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 7
- 238000004440 column chromatography Methods 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 150000003952 β-lactams Chemical class 0.000 description 7
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 238000001914 filtration Methods 0.000 description 5
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 4
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 4
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 241000191967 Staphylococcus aureus Species 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 2
- IOOQOJULHSGTSE-UHFFFAOYSA-N 2-oxopropyl 2-oxoacetate Chemical compound CC(=O)COC(=O)C=O IOOQOJULHSGTSE-UHFFFAOYSA-N 0.000 description 2
- LLYSCVDKLKLODX-UHFFFAOYSA-N 3-acetyloxy-2-oxopropanoic acid Chemical compound CC(=O)OCC(=O)C(O)=O LLYSCVDKLKLODX-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 description 2
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 229930186147 Cephalosporin Natural products 0.000 description 2
- 229940126062 Compound A Drugs 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 2
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 2
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 2
- 229930182555 Penicillin Natural products 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- 241000588770 Proteus mirabilis Species 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 229940124587 cephalosporin Drugs 0.000 description 2
- 150000001780 cephalosporins Chemical class 0.000 description 2
- 239000013058 crude material Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- RCCPEORTSYDPMB-UHFFFAOYSA-N hydroxy benzenecarboximidothioate Chemical compound OSC(=N)C1=CC=CC=C1 RCCPEORTSYDPMB-UHFFFAOYSA-N 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 239000002198 insoluble material Substances 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- DJANLSNABDFZLA-RQJHMYQMSA-N methyl (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate Chemical compound S1C(C)(C)[C@H](C(=O)OC)N2C(=O)C[C@H]21 DJANLSNABDFZLA-RQJHMYQMSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 150000002960 penicillins Chemical class 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- TVDSBUOJIPERQY-UHFFFAOYSA-N prop-2-yn-1-ol Chemical compound OCC#C TVDSBUOJIPERQY-UHFFFAOYSA-N 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- CYTQBVOFDCPGCX-UHFFFAOYSA-N trimethyl phosphite Chemical compound COP(OC)OC CYTQBVOFDCPGCX-UHFFFAOYSA-N 0.000 description 2
- FIQMHBFVRAXMOP-UHFFFAOYSA-N triphenylphosphane oxide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)C1=CC=CC=C1 FIQMHBFVRAXMOP-UHFFFAOYSA-N 0.000 description 2
- 238000002211 ultraviolet spectrum Methods 0.000 description 2
- MZMJOCVSWOZZEO-UHFFFAOYSA-O (3-amino-1-sulfanylpyridin-1-ium-2-yl) carbamate Chemical compound NC=1C(=[N+](C=CC1)S)OC(N)=O MZMJOCVSWOZZEO-UHFFFAOYSA-O 0.000 description 1
- UBWGXRMRZYHXKB-UHFFFAOYSA-N (4-nitrophenyl)methyl 1-(2-oxoazetidin-1-yl)ethyl carbonate Chemical compound C1CC(=O)N1C(C)OC(=O)OCC1=CC=C([N+]([O-])=O)C=C1 UBWGXRMRZYHXKB-UHFFFAOYSA-N 0.000 description 1
- MHSGOABISYIYKP-UHFFFAOYSA-N (4-nitrophenyl)methyl carbonochloridate Chemical compound [O-][N+](=O)C1=CC=C(COC(Cl)=O)C=C1 MHSGOABISYIYKP-UHFFFAOYSA-N 0.000 description 1
- IKQNRQOUOZJHTR-HWYOQWQTSA-N (5r,6s)-3-(carbamoyloxymethyl)-6-(1-hydroxyethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound S1C(COC(N)=O)=C(C(O)=O)N2C(=O)[C@H](C(O)C)[C@H]21 IKQNRQOUOZJHTR-HWYOQWQTSA-N 0.000 description 1
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- LWBZAWFABLYPDP-UHFFFAOYSA-N 1,2-dihydrotriazole-5-thione;sodium Chemical compound [Na].S=C1C=NNN1 LWBZAWFABLYPDP-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- WPVIUZQMFSKPMN-UHFFFAOYSA-N 1-hydroxyazetidin-2-one Chemical compound ON1CCC1=O WPVIUZQMFSKPMN-UHFFFAOYSA-N 0.000 description 1
- COHASGLTPTWHSU-ZSUJMJGWSA-N 2-oxopropyl (5r,6s)-3-(acetyloxymethyl)-6-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound CC([C@H]1C(N2C(=C(COC(C)=O)S[C@@H]21)C(=O)OCC(C)=O)=O)OC(=O)OCC1=CC=C([N+]([O-])=O)C=C1 COHASGLTPTWHSU-ZSUJMJGWSA-N 0.000 description 1
- UAMUCIJASBKVRX-GNNFCSPASA-N 2-oxopropyl (5r,6s)-3-(carbamoyloxymethyl)-6-(1-hydroxyethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound S1C(COC(N)=O)=C(C(=O)OCC(C)=O)N2C(=O)[C@H](C(O)C)[C@H]21 UAMUCIJASBKVRX-GNNFCSPASA-N 0.000 description 1
- KUAMIWCSTKRJIQ-ZSUJMJGWSA-N 2-oxopropyl (5r,6s)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-6-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound CC([C@H]1C(N2C(=C(CSC=3SC(C)=NN=3)S[C@@H]21)C(=O)OCC(C)=O)=O)OC(=O)OCC1=CC=C([N+]([O-])=O)C=C1 KUAMIWCSTKRJIQ-ZSUJMJGWSA-N 0.000 description 1
- JEXPREAWIQQBCW-ZSUJMJGWSA-N 2-oxopropyl (5r,6s)-6-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-7-oxo-3-(2h-triazol-4-ylsulfanylmethyl)-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound CC([C@H]1C(N2C(=C(CSC3=NNN=C3)S[C@@H]21)C(=O)OCC(C)=O)=O)OC(=O)OCC1=CC=C([N+]([O-])=O)C=C1 JEXPREAWIQQBCW-ZSUJMJGWSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- YACOZGLQCPVCAN-UHFFFAOYSA-N CC(C1CN(C1=O)C(C(=O)OCC(=O)C)Cl)OC(=O)OCC2=CC=C(C=C2)[N+](=O)[O-] Chemical compound CC(C1CN(C1=O)C(C(=O)OCC(=O)C)Cl)OC(=O)OCC2=CC=C(C=C2)[N+](=O)[O-] YACOZGLQCPVCAN-UHFFFAOYSA-N 0.000 description 1
- 125000006519 CCH3 Chemical group 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- GNWUOVJNSFPWDD-XMZRARIVSA-M Cefoxitin sodium Chemical compound [Na+].N([C@]1(OC)C(N2C(=C(COC(N)=O)CS[C@@H]21)C([O-])=O)=O)C(=O)CC1=CC=CS1 GNWUOVJNSFPWDD-XMZRARIVSA-M 0.000 description 1
- 241000147019 Enterobacter sp. Species 0.000 description 1
- ULGZDMOVFRHVEP-RWJQBGPGSA-N Erythromycin Chemical compound O([C@@H]1[C@@H](C)C(=O)O[C@@H]([C@@]([C@H](O)[C@@H](C)C(=O)[C@H](C)C[C@@](C)(O)[C@H](O[C@H]2[C@@H]([C@H](C[C@@H](C)O2)N(C)C)O)[C@H]1C)(C)O)CC)[C@H]1C[C@@](C)(OC)[C@@H](O)[C@H](C)O1 ULGZDMOVFRHVEP-RWJQBGPGSA-N 0.000 description 1
- 241001522878 Escherichia coli B Species 0.000 description 1
- HHLFWLYXYJOTON-UHFFFAOYSA-N Glyoxylic acid Natural products OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 238000012404 In vitro experiment Methods 0.000 description 1
- 241000588747 Klebsiella pneumoniae Species 0.000 description 1
- 241000588754 Klebsiella sp. Species 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000588767 Proteus vulgaris Species 0.000 description 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 1
- 241000607142 Salmonella Species 0.000 description 1
- 241001135268 Salmonella enterica subsp. enterica serovar Derby Species 0.000 description 1
- 241000210647 Salmonella enterica subsp. enterica serovar Montevideo Species 0.000 description 1
- 241000293246 Salmonella enterica subsp. enterica serovar Saintpaul Species 0.000 description 1
- 241000293869 Salmonella enterica subsp. enterica serovar Typhimurium Species 0.000 description 1
- 241000607762 Shigella flexneri Species 0.000 description 1
- 241000194017 Streptococcus Species 0.000 description 1
- 241000396377 Tranes Species 0.000 description 1
- 238000002083 X-ray spectrum Methods 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- WNQZLQTTXWPEPY-UHFFFAOYSA-N acetonitrile oxaldehydic acid Chemical compound C(C=O)(=O)O.C(C)#N WNQZLQTTXWPEPY-UHFFFAOYSA-N 0.000 description 1
- AJNFCZVKDMUHEJ-SECBINFHSA-N acetyloxymethyl (5R)-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound C(C)(=O)OCOC(=O)C1=C(S[C@H]2N1C(C2)=O)CSC1=NN=NN1C AJNFCZVKDMUHEJ-SECBINFHSA-N 0.000 description 1
- SGRDDXNVIPRUDM-OULFWDGXSA-N acetyloxymethyl (5r)-3-(acetyloxymethyl)-6-(1-hydroxyethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound S1C(COC(C)=O)=C(C(=O)OCOC(C)=O)N2C(=O)C(C(O)C)[C@H]21 SGRDDXNVIPRUDM-OULFWDGXSA-N 0.000 description 1
- YJFCRLDRNKKOFM-BETWJMDBSA-N acetyloxymethyl (5r)-3-(acetyloxymethyl)-6-[1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound S([C@@H]12)C(COC(C)=O)=C(C(=O)OCOC(C)=O)N1C(=O)C2C(C)OC(=O)OCC1=CC=C([N+]([O-])=O)C=C1 YJFCRLDRNKKOFM-BETWJMDBSA-N 0.000 description 1
- VSZZHGWKOGMPOW-SNVBAGLBSA-N acetyloxymethyl (5r)-3-(acetyloxymethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound CC(=O)OCOC(=O)C1=C(COC(C)=O)S[C@@H]2CC(=O)N12 VSZZHGWKOGMPOW-SNVBAGLBSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 150000001336 alkenes Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- XKMRRTOUMJRJIA-UHFFFAOYSA-N ammonia nh3 Chemical compound N.N XKMRRTOUMJRJIA-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 1
- 229960000723 ampicillin Drugs 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000005441 aurora Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- AOJDZKCUAATBGE-UHFFFAOYSA-N bromomethane Chemical compound Br[CH2] AOJDZKCUAATBGE-UHFFFAOYSA-N 0.000 description 1
- KIZFHUJKFSNWKO-UHFFFAOYSA-M calcium monohydroxide Chemical compound [Ca]O KIZFHUJKFSNWKO-UHFFFAOYSA-M 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000006355 carbonyl methylene group Chemical group [H]C([H])([*:2])C([*:1])=O 0.000 description 1
- 125000006364 carbonyl oxy methylene group Chemical group [H]C([H])([*:2])OC([*:1])=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 229960002682 cefoxitin Drugs 0.000 description 1
- WRJWRGBVPUUDLA-UHFFFAOYSA-N chlorosulfonyl isocyanate Chemical compound ClS(=O)(=O)N=C=O WRJWRGBVPUUDLA-UHFFFAOYSA-N 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 1
- 229910000396 dipotassium phosphate Inorganic materials 0.000 description 1
- 235000019797 dipotassium phosphate Nutrition 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 208000012479 extrahepatic biliary atresia Diseases 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000005949 ozonolysis reaction Methods 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical compound OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 229940007042 proteus vulgaris Drugs 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000005055 short column chromatography Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- XEUVIIJQTXEFAW-XXZWMEPHSA-M sodium;(5r)-3-(acetyloxymethyl)-6-(1-hydroxyethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound [Na+].S1C(COC(C)=O)=C(C([O-])=O)N2C(=O)C(C(O)C)[C@H]21 XEUVIIJQTXEFAW-XXZWMEPHSA-M 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D499/88—Compounds with a double bond between positions 2 and 3 and a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/06—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D205/08—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams
- C07D205/09—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams with a sulfur atom directly attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/553—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having one nitrogen atom as the only ring hetero atom
- C07F9/568—Four-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Cephalosporin Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS811348A CS226027B2 (cs) | 1979-02-24 | 1981-02-25 | Způsob výroby nových derivátů penemkarboxylové kyseliny |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7906634 | 1979-02-24 | ||
| GB7932591 | 1979-09-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS226010B2 true CS226010B2 (en) | 1984-03-19 |
Family
ID=26270697
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS801241A CS226010B2 (en) | 1979-02-24 | 1980-02-22 | Method of preparing new penemcarboxylic acid derivatives |
Country Status (24)
| Country | Link |
|---|---|
| AT (1) | AT368506B (xx) |
| AU (1) | AU535080B2 (xx) |
| CA (2) | CA1154010A (xx) |
| CH (2) | CH654831A5 (xx) |
| CS (1) | CS226010B2 (xx) |
| DE (1) | DE3006273A1 (xx) |
| DK (1) | DK159448C (xx) |
| ES (2) | ES488886A0 (xx) |
| FI (1) | FI75163C (xx) |
| FR (1) | FR2449690B1 (xx) |
| GB (1) | GB2043639B (xx) |
| GR (1) | GR73623B (xx) |
| HK (1) | HK74487A (xx) |
| HU (1) | HU182664B (xx) |
| IE (1) | IE49407B1 (xx) |
| IT (1) | IT1193922B (xx) |
| LU (1) | LU82192A1 (xx) |
| NL (1) | NL192265C (xx) |
| NO (1) | NO161000C (xx) |
| NZ (1) | NZ192949A (xx) |
| PT (1) | PT70849A (xx) |
| SE (1) | SE449489B (xx) |
| UA (1) | UA6041A1 (xx) |
| YU (1) | YU42964B (xx) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5625110A (en) * | 1978-12-18 | 1981-03-10 | Bristol Myers Co | Antibacterial |
| DE3121510A1 (de) * | 1980-07-04 | 1982-06-16 | Farmitalia Carlo Erba S.p.A., 20159 Milano | 6-alkyl-2-subst.-peneme und verfahren zu ihrer herstellung |
| JPS588084A (ja) * | 1981-07-08 | 1983-01-18 | Takeda Chem Ind Ltd | （６ｒ）−置換−（５ｒ）−ペネム−３−カルボン酸誘導体およびその製造法 |
| EP0180252B1 (en) * | 1981-07-15 | 1989-04-26 | Sumitomo Pharmaceuticals Company, Limited | Process of preparing azetidinone compounds |
| NL8204720A (nl) * | 1981-12-11 | 1983-07-01 | Erba Farmitalia | Werkwijze voor het bereiden van optisch actieve penemverbindingen. |
| NO831160L (no) * | 1982-04-08 | 1983-10-10 | Erba Farmitalia | Fremstilling av substituerte penem-derivater |
| PH21930A (en) * | 1982-11-16 | 1988-04-08 | Ciba Geigy Ag | 6-hydroxy-lower alkylpenem compounds,pharmaceutical composition containing same and method of use thereof |
| DE3372968D1 (en) * | 1982-11-16 | 1987-09-17 | Ciba Geigy Ag | Heterocyclyl-thio compounds, process for their preparation, pharmaceutical compositions containing them and their use |
| GB8300295D0 (en) * | 1983-01-06 | 1983-02-09 | Erba Farmitalia | Penem esters |
| JPS59152387A (ja) * | 1983-02-10 | 1984-08-31 | Shionogi & Co Ltd | 新規ペネム化合物 |
| GB8321677D0 (en) * | 1983-08-11 | 1983-09-14 | Erba Farmitalia | Preparation of penems |
| US4656165A (en) * | 1983-09-02 | 1987-04-07 | Ciba-Geigy Corporation | Aminomethyl penem compounds |
| US4711886A (en) * | 1984-07-02 | 1987-12-08 | Merck & Co., Inc. | β-lactam derivatives as anti-inflammatory and antidegenerative agents |
| US4761408A (en) * | 1984-11-02 | 1988-08-02 | Ciba-Geigy Corporation | Crystalline aminomethyl compound |
| ES2058328T3 (es) * | 1987-02-11 | 1994-11-01 | Ciba Geigy Ag | Acidos beta-lactama carboxilicos biciclicos. |
| US5364768A (en) * | 1987-07-07 | 1994-11-15 | Farmitalia Carlo Erba S.R.L. | Process for the preparation of penems |
| GB2206578B (en) * | 1987-07-07 | 1991-07-03 | Erba Carlo Spa | Process for the preparation of penems |
| IT1286558B1 (it) * | 1996-02-27 | 1998-07-15 | Menarini Farma Ind | Processo per la preparazione di 2-alogenometil-penems e loro uso per la preparazione di penems antibatterici |
| JP3866298B2 (ja) | 1997-12-29 | 2007-01-10 | リサーチ コーポレイション テクノロジーズ，インコーポレイティド | β−ラクタマーゼインヒビターとしての２β−置換化−６−アルキリデンペニシラン酸誘導体 |
| US6407091B1 (en) | 1999-04-15 | 2002-06-18 | Research Corporation Technologies, Inc. | β-lactamase inhibiting compounds |
| US6720445B2 (en) | 2000-12-21 | 2004-04-13 | Beacon Laboratories, Inc. | Acetyloxymethyl esters and methods for using the same |
| CA2454413A1 (en) | 2001-07-24 | 2003-03-13 | Alamx, L.L.C. | 7-alkylidene-3-substituted-3-cephem-4-carboxylates as beta-lactamase inhibitors |
| JP2005525399A (ja) | 2002-04-04 | 2005-08-25 | アラムクス エルエルシー | セリンおよびメタロ−β−ラクタマーゼの阻害剤 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| LU77306A1 (xx) * | 1977-05-09 | 1979-01-18 | ||
| AU3796278A (en) * | 1977-07-13 | 1980-01-17 | Glaxo Group Ltd | Penams and azetidinones |
| US4168314A (en) * | 1977-11-17 | 1979-09-18 | Merck & Co., Inc. | 6-(1'-Hydroxyethyl)-2-aminoethylthio-pen-2-em-3-carboxylic acid |
| US4155912A (en) * | 1977-12-14 | 1979-05-22 | Bristol-Myers Company | 2-Methylpenem-3-carboxylic acid antibiotics |
| JPS54117459A (en) * | 1978-01-20 | 1979-09-12 | Glaxo Group Ltd | Novel lactam compound |
| EP0042026B1 (de) * | 1978-02-02 | 1986-01-08 | Ciba-Geigy Ag | 3,4-Disubstituierte Azetidin-2-onverbindungen und Verfahren zu ihrer Herstellung |
| EP0010358A1 (en) * | 1978-09-20 | 1980-04-30 | Glaxo Group Limited | Beta-lactam compounds, processes for their preparation, compositions containing them, intermediates of use in their preparation and methods for the production thereof |
| JPS5625110A (en) * | 1978-12-18 | 1981-03-10 | Bristol Myers Co | Antibacterial |
| EP0013067A1 (en) * | 1978-12-22 | 1980-07-09 | Beecham Group Plc | Bicyclic beta-lactam antibacterial agents, their use in pharmaceutical compositions, processes for their preparation and intermediates for use in such processes |
-
1980
- 1980-02-19 AT AT0091980A patent/AT368506B/de not_active IP Right Cessation
- 1980-02-19 AU AU55670/80A patent/AU535080B2/en not_active Ceased
- 1980-02-19 GR GR61228A patent/GR73623B/el unknown
- 1980-02-19 GB GB8005476A patent/GB2043639B/en not_active Expired
- 1980-02-19 NL NL8001012A patent/NL192265C/nl not_active IP Right Cessation
- 1980-02-19 IT IT20021/80A patent/IT1193922B/it active
- 1980-02-19 FI FI800493A patent/FI75163C/fi not_active IP Right Cessation
- 1980-02-20 DE DE19803006273 patent/DE3006273A1/de active Granted
- 1980-02-20 YU YU461/80A patent/YU42964B/xx unknown
- 1980-02-20 IE IE338/80A patent/IE49407B1/en not_active IP Right Cessation
- 1980-02-20 PT PT70849A patent/PT70849A/pt not_active IP Right Cessation
- 1980-02-20 CA CA000346011A patent/CA1154010A/en not_active Expired
- 1980-02-21 CH CH2794/84A patent/CH654831A5/de not_active IP Right Cessation
- 1980-02-21 CH CH1400/80A patent/CH651570A5/de not_active IP Right Cessation
- 1980-02-22 DK DK077580A patent/DK159448C/da not_active IP Right Cessation
- 1980-02-22 HU HU80420A patent/HU182664B/hu not_active IP Right Cessation
- 1980-02-22 UA UA2886007A patent/UA6041A1/uk unknown
- 1980-02-22 SE SE8001424A patent/SE449489B/sv not_active IP Right Cessation
- 1980-02-22 NZ NZ192949A patent/NZ192949A/en unknown
- 1980-02-22 LU LU82192A patent/LU82192A1/fr unknown
- 1980-02-22 NO NO800501A patent/NO161000C/no unknown
- 1980-02-22 FR FR8003938A patent/FR2449690B1/fr not_active Expired
- 1980-02-22 CS CS801241A patent/CS226010B2/cs unknown
- 1980-02-23 ES ES488886A patent/ES488886A0/es active Granted
- 1980-10-16 ES ES495977A patent/ES495977A0/es active Granted
-
1986
- 1986-01-14 CA CA000499579A patent/CA1212665B/en not_active Expired
-
1987
- 1987-10-15 HK HK744/87A patent/HK74487A/xx not_active IP Right Cessation
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS226010B2 (en) | Method of preparing new penemcarboxylic acid derivatives | |
| US4482565A (en) | β-Lactam-containing antibacterial agents and β-lactamase inhibitors | |
| CS219291B2 (en) | Method of making the new derivatives of the 6 beta-hydroxyalcylpeniciline acid | |
| KR840000865B1 (ko) | β-락탐-함유 항균제의 제조방법 | |
| US4508649A (en) | Process for preparing optically active penems | |
| US3647786A (en) | Preparation of cephalosporin sulfoxides | |
| DE3008316C2 (de) | 6-β-Jodpenicillansäure-Derivate, Verfahren zu ihrer Herstellung und solche Derivate enthaltende Arzneimittel | |
| US4024152A (en) | 4-Dithio-3-imido-azetidin-2-ones | |
| US3705892A (en) | Rearrangement of penicillin | |
| Brain et al. | Syntheses based on 1, 2-secopenicillins. Part I. Oxidation | |
| US4558042A (en) | β-Lactam-containing antibacterial agents and β-lactamase inhibitors | |
| CS248749B2 (en) | Production method of the 6-(subst.)hydroxymethylpenicilan acids | |
| US4656263A (en) | 6-β-substituted penicillanic acid compound free of the 6-α-epimer | |
| GB2104509A (en) | New synthetic route to optically active 2-penem-3-carboxylic acid derivatives | |
| Ernest | 2‐Oxocephems. Synthesis and Properties of 7‐Acylamino‐2‐oxocephem‐4‐carboxylic Acids | |
| US5043440A (en) | Oxidation process for preparing 4-acyloxy azetidinones in a two-phase system | |
| CA1208205A (en) | Oxidation process | |
| US4347182A (en) | Preparation of penicillanic acid derivatives | |
| US4518530A (en) | 6-β-Substituted penicillanic acids as β-lactamase inhibitors | |
| Numata et al. | NEW CEPHALOSPORINS WITH 7-ACYL GROUPS DERIVED FROM β-KETOACIDS I. 7-(β-KETOACYLAMINO) CEPHALOSPORINS | |
| US5200403A (en) | Inhibition of βlactamase with 6 β-(substituted methyl)-penicillanic acid derivatives | |
| CS226027B2 (cs) | Způsob výroby nových derivátů penemkarboxylové kyseliny | |
| US4554103A (en) | Preparation of 4-acyloxyazetidinones from acyl nitrates and penams | |
| CA1066268A (en) | Process for preparing 3-acyloxymethyl-2-cephem compounds | |
| US4517126A (en) | Penicillanic acid derivative |