CH626873A5 - - Google Patents
Download PDFInfo
- Publication number
- CH626873A5 CH626873A5 CH380677A CH380677A CH626873A5 CH 626873 A5 CH626873 A5 CH 626873A5 CH 380677 A CH380677 A CH 380677A CH 380677 A CH380677 A CH 380677A CH 626873 A5 CH626873 A5 CH 626873A5
- Authority
- CH
- Switzerland
- Prior art keywords
- aminocarbonyl
- amino
- radical
- methyl
- bis
- Prior art date
Links
- -1 dihydroxyalkyl radical Chemical class 0.000 claims description 57
- 150000001875 compounds Chemical class 0.000 claims description 48
- 239000002872 contrast media Substances 0.000 claims description 16
- 229940039231 contrast media Drugs 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 10
- 150000003254 radicals Chemical class 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 125000006239 protecting group Chemical group 0.000 claims description 7
- 125000004990 dihydroxyalkyl group Chemical group 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 4
- 150000008065 acid anhydrides Chemical class 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- CRVYPNHLIAWRNV-UHFFFAOYSA-N 2,4,6-triiodobenzoic acid Chemical compound OC(=O)C1=C(I)C=C(I)C=C1I CRVYPNHLIAWRNV-UHFFFAOYSA-N 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- HRMQJJGGCUYILB-UHFFFAOYSA-N 2,4,6-triiodobenzoyl chloride Chemical compound ClC(=O)C1=C(I)C=C(I)C=C1I HRMQJJGGCUYILB-UHFFFAOYSA-N 0.000 claims 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 description 27
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 15
- 238000002844 melting Methods 0.000 description 13
- 230000008018 melting Effects 0.000 description 13
- VVODXPFIWOSTQB-UHFFFAOYSA-N 3-amino-2,4,6-triiodobenzoyl chloride Chemical compound NC1=C(I)C=C(I)C(C(Cl)=O)=C1I VVODXPFIWOSTQB-UHFFFAOYSA-N 0.000 description 9
- 238000000354 decomposition reaction Methods 0.000 description 9
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 9
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 8
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 239000007864 aqueous solution Substances 0.000 description 7
- 229910052740 iodine Inorganic materials 0.000 description 7
- 239000011630 iodine Substances 0.000 description 7
- 230000003204 osmotic effect Effects 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 4
- 230000002285 radioactive effect Effects 0.000 description 4
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- DTZMSDADRKLCQE-RFMXWLSYSA-N 3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodo-n-[(2r,3r,4s,5r)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]benzamide Chemical compound CC(=O)N(C)C1=C(I)C(NC(C)=O)=C(I)C(C(=O)N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO)=C1I DTZMSDADRKLCQE-RFMXWLSYSA-N 0.000 description 3
- QSLTVQJXGFJKDS-UHFFFAOYSA-N C(C)(=O)OC(C(=O)C=1C(=C(C(=C(C(=O)[ClH]N)C=1I)I)C(=O)Cl)I)C Chemical compound C(C)(=O)OC(C(=O)C=1C(=C(C(=C(C(=O)[ClH]N)C=1I)I)C(=O)Cl)I)C QSLTVQJXGFJKDS-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 206010029350 Neurotoxicity Diseases 0.000 description 3
- 206010044221 Toxic encephalopathy Diseases 0.000 description 3
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 210000001175 cerebrospinal fluid Anatomy 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 238000009608 myelography Methods 0.000 description 3
- 230000007135 neurotoxicity Effects 0.000 description 3
- 231100000228 neurotoxicity Toxicity 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- DSPIZZQMSHIZLS-UHFFFAOYSA-N 1-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propane Chemical compound CCCOCCOCCOCCOCCC DSPIZZQMSHIZLS-UHFFFAOYSA-N 0.000 description 2
- VDPZDVSLMPQRIR-UHFFFAOYSA-N 2-[2-(2-ethoxyethoxy)ethoxy]-n-methylethanamine Chemical compound CCOCCOCCOCCNC VDPZDVSLMPQRIR-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000004423 acyloxy group Chemical group 0.000 description 2
- YVPYQUNUQOZFHG-UHFFFAOYSA-N amidotrizoic acid Chemical compound CC(=O)NC1=C(I)C(NC(C)=O)=C(I)C(C(O)=O)=C1I YVPYQUNUQOZFHG-UHFFFAOYSA-N 0.000 description 2
- 239000003957 anion exchange resin Substances 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- 239000003729 cation exchange resin Substances 0.000 description 2
- 210000003169 central nervous system Anatomy 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 2
- 229910000397 disodium phosphate Inorganic materials 0.000 description 2
- 235000019800 disodium phosphate Nutrition 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 150000002497 iodine compounds Chemical class 0.000 description 2
- 210000001165 lymph node Anatomy 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- NXUWAAUAPCWASM-UHFFFAOYSA-N n-methyl-3-[2-[2-[2-[3-(methylamino)propoxy]ethoxy]ethoxy]ethoxy]propan-1-amine Chemical compound CNCCCOCCOCCOCCOCCCNC NXUWAAUAPCWASM-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000012266 salt solution Substances 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000001488 sodium phosphate Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- HXOYWCSTHVTLOW-UHFFFAOYSA-N (2,2-dimethyl-1,3-dioxolan-4-yl)methanamine Chemical compound CC1(C)OCC(CN)O1 HXOYWCSTHVTLOW-UHFFFAOYSA-N 0.000 description 1
- HZDNNJABYXNPPV-UHFFFAOYSA-N (2-chloro-2-oxoethyl) acetate Chemical compound CC(=O)OCC(Cl)=O HZDNNJABYXNPPV-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- JXQUTOIQYPRZMP-UHFFFAOYSA-N 1-N-(2,3-dihydroxypropyl)-3-N-[3-[2-[2-[2-[3-[[3-(2,3-dihydroxypropylcarbamoyl)-5-(2-hydroxypropanoylamino)-2,4,6-triiodobenzoyl]-methylamino]propoxy]ethoxy]ethoxy]ethoxy]propyl]-5-(2-hydroxypropanoylamino)-2,4,6-triiodo-3-N-methylbenzene-1,3-dicarboxamide Chemical compound CN(C(C1=C(C(=C(C(=C1I)C(=O)NCC(CO)O)I)NC(C(C)O)=O)I)=O)CCCOCCOCCOCCOCCCN(C)C(C1=C(C(=C(C(=C1I)C(=O)NCC(CO)O)I)NC(C(C)O)=O)I)=O JXQUTOIQYPRZMP-UHFFFAOYSA-N 0.000 description 1
- ADLFBRNPQMLXTQ-UHFFFAOYSA-N 2,2-dimethyl-1,3-dioxan-5-amine Chemical compound CC1(C)OCC(N)CO1 ADLFBRNPQMLXTQ-UHFFFAOYSA-N 0.000 description 1
- GXVUZYLYWKWJIM-UHFFFAOYSA-N 2-(2-aminoethoxy)ethanamine Chemical compound NCCOCCN GXVUZYLYWKWJIM-UHFFFAOYSA-N 0.000 description 1
- KUYYOUXQOPCFDK-UHFFFAOYSA-N 2-[1-(2-aminoethoxy)ethoxy]ethanamine Chemical compound NCCOC(C)OCCN KUYYOUXQOPCFDK-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- IFZOPNLVYZYSMQ-UHFFFAOYSA-N 2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethanamine Chemical compound NCCOCCOCCOCCOCCN IFZOPNLVYZYSMQ-UHFFFAOYSA-N 0.000 description 1
- UXFQFBNBSPQBJW-UHFFFAOYSA-N 2-amino-2-methylpropane-1,3-diol Chemical compound OCC(N)(C)CO UXFQFBNBSPQBJW-UHFFFAOYSA-N 0.000 description 1
- KJJPLEZQSCZCKE-UHFFFAOYSA-N 2-aminopropane-1,3-diol Chemical compound OCC(N)CO KJJPLEZQSCZCKE-UHFFFAOYSA-N 0.000 description 1
- FVUIAOHMTFHVTE-UHFFFAOYSA-N 3-[2-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]ethoxy]propan-1-amine Chemical compound NCCCOCCOCCOCCOCCCN FVUIAOHMTFHVTE-UHFFFAOYSA-N 0.000 description 1
- KSAOLFGTQOVNNT-UHFFFAOYSA-N 3-acetamido-2,4,6-triiodobenzoyl chloride Chemical compound CC(=O)NC1=C(I)C=C(I)C(C(Cl)=O)=C1I KSAOLFGTQOVNNT-UHFFFAOYSA-N 0.000 description 1
- VACJHIUSZPBOOF-UHFFFAOYSA-N 3-aminopropane-1,1-diol Chemical class NCCC(O)O VACJHIUSZPBOOF-UHFFFAOYSA-N 0.000 description 1
- KQIGMPWTAHJUMN-UHFFFAOYSA-N 3-aminopropane-1,2-diol Chemical compound NCC(O)CO KQIGMPWTAHJUMN-UHFFFAOYSA-N 0.000 description 1
- SVXRQSNCKDZGGW-UHFFFAOYSA-N 3-n-(1,3-dihydroxy-2-methylpropan-2-yl)-1-n-[2-[2-[[3-[(1,3-dihydroxy-2-methylpropan-2-yl)carbamoyl]-5-(2-hydroxypropanoylamino)-2,4,6-triiodobenzoyl]amino]ethoxy]ethyl]-5-(2-hydroxypropanoylamino)-2,4,6-triiodobenzene-1,3-dicarboxamide Chemical compound OCC(C)(CO)NC(=O)C1=C(I)C(NC(=O)C(O)C)=C(I)C(C(=O)NCCOCCNC(=O)C=2C(=C(C(=O)NC(C)(CO)CO)C(I)=C(NC(=O)C(C)O)C=2I)I)=C1I SVXRQSNCKDZGGW-UHFFFAOYSA-N 0.000 description 1
- AEOSOPDTXCTDRD-UHFFFAOYSA-N 3-n-(1,3-dihydroxy-2-methylpropan-2-yl)-1-n-[3-[2-[2-[2-[3-[[3-[(1,3-dihydroxy-2-methylpropan-2-yl)carbamoyl]-5-(2-hydroxypropanoylamino)-2,4,6-triiodobenzoyl]amino]propoxy]ethoxy]ethoxy]ethoxy]propyl]-5-(2-hydroxypropanoylamino)-2,4,6-triiodobenzene-1,3- Chemical compound OCC(C)(CO)NC(=O)C1=C(I)C(NC(=O)C(O)C)=C(I)C(C(=O)NCCCOCCOCCOCCOCCCNC(=O)C=2C(=C(C(=O)NC(C)(CO)CO)C(I)=C(NC(=O)C(C)O)C=2I)I)=C1I AEOSOPDTXCTDRD-UHFFFAOYSA-N 0.000 description 1
- FBJVWRITWDYUAC-UHFFFAOYSA-N 5-amino-2,4,6-triiodobenzene-1,3-dicarbonyl chloride Chemical compound NC1=C(I)C(C(Cl)=O)=C(I)C(C(Cl)=O)=C1I FBJVWRITWDYUAC-UHFFFAOYSA-N 0.000 description 1
- BDDLHHRCDSJVKV-UHFFFAOYSA-N 7028-40-2 Chemical compound CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O BDDLHHRCDSJVKV-UHFFFAOYSA-N 0.000 description 1
- ZYYOKINVEXFQMD-UHFFFAOYSA-N CC(C(=O)C1=C(C(=C(C(C1I)(C(=O)Cl)NC(=O)N)I)C2COC(OC2)(C)C)I)OC(=O)C Chemical compound CC(C(=O)C1=C(C(=C(C(C1I)(C(=O)Cl)NC(=O)N)I)C2COC(OC2)(C)C)I)OC(=O)C ZYYOKINVEXFQMD-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- SMQYOVYWPWASGU-UHFFFAOYSA-N Iocarmic acid Chemical group OC(=O)C1=C(I)C(C(=O)NC)=C(I)C(NC(=O)CCCCC(=O)NC=2C(=C(C(=O)NC)C(I)=C(C(O)=O)C=2I)I)=C1I SMQYOVYWPWASGU-UHFFFAOYSA-N 0.000 description 1
- UQVKUNBVFSZYLY-UHFFFAOYSA-N N-methyl-3-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]propan-1-amine Chemical compound CNCCCOCCOCCOCCOCCC UQVKUNBVFSZYLY-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- DTVWJAGFYXEJAU-UHFFFAOYSA-N [1-[3-(carbamoylamino)-5-carbonochloridoyl-2,4,6-triiodophenyl]-1-oxopropan-2-yl] acetate Chemical compound NC(=O)NC=1C(=C(C(=C(C(=O)Cl)C=1I)I)C(C(C)OC(C)=O)=O)I DTVWJAGFYXEJAU-UHFFFAOYSA-N 0.000 description 1
- ORXDJVSRAKUZBK-UHFFFAOYSA-N [1-[5-(carbamoylamino)-5-carbonochloridoyl-3-(2,3-dihydroxypropyl)-2,4,6-triiodocyclohexa-1,3-dien-1-yl]-1-oxopropan-2-yl] acetate Chemical compound OC(CC=1C(=C(C(C(C(=O)Cl)(C=1I)NC(=O)N)I)C(C(C)OC(C)=O)=O)I)CO ORXDJVSRAKUZBK-UHFFFAOYSA-N 0.000 description 1
- PQZLQOGLMSANKA-UHFFFAOYSA-N [2-(3,5-dicarbonochloridoyl-2,4,6-triiodoanilino)-2-oxoethyl] acetate Chemical compound CC(=O)OCC(=O)NC1=C(I)C(C(Cl)=O)=C(I)C(C(Cl)=O)=C1I PQZLQOGLMSANKA-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000036760 body temperature Effects 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000013155 cardiography Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229920001577 copolymer Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000012154 double-distilled water Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- IWBOPFCKHIJFMS-UHFFFAOYSA-N ethylene glycol bis(2-aminoethyl) ether Chemical compound NCCOCCOCCN IWBOPFCKHIJFMS-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000000819 hypertonic solution Substances 0.000 description 1
- 229940021223 hypertonic solution Drugs 0.000 description 1
- 238000001361 intraarterial administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 238000005907 ketalization reaction Methods 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 230000001926 lymphatic effect Effects 0.000 description 1
- 210000004324 lymphatic system Anatomy 0.000 description 1
- 210000001365 lymphatic vessel Anatomy 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- MGJXBDMLVWIYOQ-UHFFFAOYSA-N methylazanide Chemical compound [NH-]C MGJXBDMLVWIYOQ-UHFFFAOYSA-N 0.000 description 1
- 229960000554 metrizamide Drugs 0.000 description 1
- 210000000944 nerve tissue Anatomy 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 238000005325 percolation Methods 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 230000005195 poor health Effects 0.000 description 1
- 239000010491 poppyseed oil Substances 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- UFUASNAHBMBJIX-UHFFFAOYSA-N propan-1-one Chemical compound CC[C]=O UFUASNAHBMBJIX-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000035807 sensation Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 210000000278 spinal cord Anatomy 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 210000002330 subarachnoid space Anatomy 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/12—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by halogen atoms or by nitro or nitroso groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH380677A CH626873A5 (enExample) | 1977-03-28 | 1977-03-28 | |
| DE2805928A DE2805928C3 (de) | 1977-03-28 | 1978-02-13 | Alpha,omega-Bis[5-(dihydroxyalkyl) aminocarbonyl-3-hydroxyacylamino-2,4,6- Trijodbenzoyl-amino]-oxaalkane und Verfahren zu ihrer Herstellung sowie Röntgenkontrastmittel mit diesen Verbindungen als schattengebende Komponenten |
| GB6470/78A GB1569242A (en) | 1977-03-28 | 1978-02-17 | Bis-(triiodobenzoylamino)-oxaalkanes for use in x-ray contrast media and process for their preparation |
| SE7802106A SE437513B (sv) | 1977-03-28 | 1978-02-23 | Icke-joniska rontgenkontrastmedel |
| US05/881,567 US4139605A (en) | 1977-03-28 | 1978-02-27 | Water-soluble, non-ionizing, radiopaque compounds and contrast compositions containing the same |
| CA298,854A CA1089489A (en) | 1977-03-28 | 1978-03-14 | Water-soluble, non ionic radioopaque contrast agents (x-ray contrast agents) and process for their production |
| DK119878A DK148783C (da) | 1977-03-28 | 1978-03-16 | Triiodbenzenderivater til anvendelse som roentgenkontrastmidler og roentgenkontrastmidler indeholdende saadanne forbindelser |
| AT0190378A AT362870B (de) | 1977-03-28 | 1978-03-17 | Wasserloesliche, nicht ionische roentgenkontrastmittel |
| NO780991A NO145338C (no) | 1977-03-28 | 1978-03-20 | Roentgenopake forbindelser og roentgenkontrastmidler inneholdende disse. |
| FR7808737A FR2385698B1 (enExample) | 1977-03-28 | 1978-03-24 | |
| JP3493678A JPS53119842A (en) | 1977-03-28 | 1978-03-28 | Oxyalkane derivative process for preparing same and roentgen photograph agent containing same |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH380677A CH626873A5 (enExample) | 1977-03-28 | 1977-03-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH626873A5 true CH626873A5 (enExample) | 1981-12-15 |
Family
ID=4263847
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH380677A CH626873A5 (enExample) | 1977-03-28 | 1977-03-28 |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4139605A (enExample) |
| JP (1) | JPS53119842A (enExample) |
| AT (1) | AT362870B (enExample) |
| CA (1) | CA1089489A (enExample) |
| CH (1) | CH626873A5 (enExample) |
| DE (1) | DE2805928C3 (enExample) |
| DK (1) | DK148783C (enExample) |
| FR (1) | FR2385698B1 (enExample) |
| GB (1) | GB1569242A (enExample) |
| NO (1) | NO145338C (enExample) |
| SE (1) | SE437513B (enExample) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2628517C2 (de) * | 1976-06-23 | 1985-02-21 | Schering AG, 1000 Berlin und 4709 Bergkamen | Dicarbonsäure-bis(3,5-dicarbamoyl-2,4,6-trijodanilid)-Verbindungen, Verfahren zu ihrer Herstellung und Röntgenkontrastmittel |
| US4279887A (en) * | 1978-11-29 | 1981-07-21 | Medi-Physics, Inc. | Amides useful as brain imaging agents |
| US4311853A (en) * | 1979-02-06 | 1982-01-19 | The Radiochemical Centre Limited | Selenium derivatives of thyroxine and tri-iodothyronine |
| US4256729A (en) | 1979-03-23 | 1981-03-17 | Mallinckrodt, Inc. | N,N'-Bis-(2,3-dihydroxypropyl)-2,4,6-triiodo-5-(2-keto-L-gulonamido)isophthalamide and radiological compositions containing same |
| DK273280A (da) * | 1979-06-28 | 1980-12-29 | Schering Ag | Trijoderede 5-aminoisophthalsyrederivater |
| IT1207226B (it) * | 1979-08-09 | 1989-05-17 | Bracco Ind Chimica Spa | Derivati dell'acido 2,4,6-triiodo-isoftalico, metodo per la loro preparazione e mezzi di contrasto che li contengono. |
| DE3038853A1 (de) * | 1980-10-10 | 1982-05-27 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Neue n-hydroxy-alkylierte dicarbonsaeure-bis-(3,5-dicarbamoyl-2,4,6-trijodanilide), deren herstellung und diese enthaltende roentgenkonstrastmittel (ii) |
| DE3044814A1 (de) * | 1980-11-25 | 1982-07-08 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Unsymmetrisch substituierte dicarbonsaeure-bis-(2,4,6-trijod-anilide), deren herstellung und diese enthaltende roentgenkontrastmittel |
| US5191119A (en) * | 1983-10-20 | 1993-03-02 | Cook Imaging Corp. | Process for producing non-ionic radiographic contrast media utilizing N-allylation |
| US4650903A (en) * | 1984-06-21 | 1987-03-17 | The Bf Goodrich Company | Oligomeric amides as synergists for antioxidants and UV stabilizers |
| DE3731542A1 (de) * | 1987-09-17 | 1989-03-30 | Schering Ag | Neue dicarbonsaeure-bis(3,5-dicarbamoyl-2,4,6-triiod-anilide), verfahren zu deren herstellung sowie diese enthaltende roentgenkontrastmittel |
| DE3937118A1 (de) * | 1989-11-03 | 1991-05-08 | Schering Ag | Nichtionische roentgenkontrastmittel mit hohem jodgehalt |
| IT1245853B (it) * | 1990-11-16 | 1994-10-25 | Bracco Spa | 1,3-bis(3-(mono o poliidrossi)acilamino-5-(mono o poliidrossi-alchil) aminocarbonil-2,4,6-triiodo-benzoil-amino)-idrossi- o idrossi-alchil- propani, loro metodo di preparazione e mezzi di contrasto roentgenografici che li contengono |
| DE4109169A1 (de) * | 1991-03-20 | 1992-09-24 | Koehler Chemie Dr Franz | Wasserloesliche nicht ionische roentgenkontrastmittel sowie mittel und verfahren zu ihrer herstellung |
| IT1256162B (it) * | 1992-10-27 | 1995-11-29 | Zambon Spa | Processo per la preparazione di un intermedio della sintesi organica |
| HU216537B (hu) * | 1995-05-23 | 1999-07-28 | Fructamine S.P.A. | Eljárás dikarbonsav-diklorid előállítására, izolálására és tisztítására, és az előállított S-(-)-izomer |
| DE19731591C2 (de) * | 1997-07-17 | 1999-09-16 | Schering Ag | Pharmazeutische Mittel enthaltend perfluoralkylgruppenhaltige Trijodaromaten und ihre Verwendung in der Tumortherapie und interventionellen Radiologie |
| US6751290B2 (en) | 1998-09-08 | 2004-06-15 | Veritas Pharmaceuticals, Inc. | Radiographic assessment of tissue after exposure to a compound |
| US6723746B2 (en) * | 1998-09-08 | 2004-04-20 | Veritas Pharmaceuticals, Inc. | Functional radiographic imaging methods and agents |
| US20040170561A1 (en) * | 1998-09-08 | 2004-09-02 | Jesse Salb | Functional radiographic imaging methods and agents |
| US20010038682A1 (en) * | 1998-09-08 | 2001-11-08 | Jesse Salb | Radiographic assessment of tissue response to compounds |
| US6226352B1 (en) * | 1998-09-08 | 2001-05-01 | Veritas Pharmaceuticals, Inc. | System and method for radiographic imaging of tissue |
| SE520688C2 (sv) * | 2000-04-11 | 2003-08-12 | Bone Support Ab | Ett injicerbart ersättningsmaterial för benmineral |
| SE517168C2 (sv) * | 2000-07-17 | 2002-04-23 | Bone Support Ab | En komposition för ett injicerbart ersättningsmaterial för benmineral |
| SE522098C2 (sv) * | 2001-12-20 | 2004-01-13 | Bone Support Ab | Ett nytt benmineralsubstitut |
| SE0300620D0 (sv) * | 2003-03-05 | 2003-03-05 | Bone Support Ab | A new bone substitute composition |
| SE0302983D0 (sv) * | 2003-11-11 | 2003-11-11 | Bone Support Ab | Anordning för att förse spongiöst ben med benersättnings- och/eller benförstärkningsmaterial och förfarande i samband därmed |
| SE527528C2 (sv) | 2004-06-22 | 2006-04-04 | Bone Support Ab | Anordning för framställning av härdbar massa samt användning av anordningen |
| JP2009539501A (ja) * | 2006-06-06 | 2009-11-19 | ラトガーズ, ザ ステイト ユニバーシティ オブ ニュー ジャージー | ヨウ化ポリマー |
| US7955234B1 (en) | 2007-02-28 | 2011-06-07 | Pursley Michael G | Exercise device and method |
| EP2200656B1 (en) | 2007-10-12 | 2012-12-05 | GE Healthcare AS | Contrast agents |
| US9180137B2 (en) | 2010-02-09 | 2015-11-10 | Bone Support Ab | Preparation of bone cement compositions |
| WO2012136813A2 (en) | 2011-04-07 | 2012-10-11 | Universitetet I Oslo | Agents for medical radar diagnosis |
| TR201807495T4 (tr) | 2013-02-20 | 2018-06-21 | Bone Support Ab | Sertleştirilebilir kemik ikamesine yönelik geliştirilmiş katılaştırma. |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA855739A (en) * | 1970-11-10 | Felder Ernst | Radioopaque compound and method of preparing the same | |
| US3733397A (en) * | 1966-12-02 | 1973-05-15 | Pharmacia Ab | Method for the x-ray visualization of body cavities and a preparation for carrying out the method |
| US3660469A (en) * | 1969-08-04 | 1972-05-02 | Squibb & Sons Inc | Bis-triiodoisophthalamic acid compounds |
| BE795555A (fr) * | 1972-02-16 | 1973-08-16 | Schering Ag | Amides de triiodo-isophtaloyl-monoamino-acide, leur procede de preparation et leur utilisation |
| US4032567A (en) * | 1972-02-16 | 1977-06-28 | Schering Aktiengesellschaft | Triiodoisophthalic acid monoamino acid amides, process for the preparation thereof, and use thereof as x-ray contrast media |
| GB1488903A (en) * | 1974-05-31 | 1977-10-19 | Guerbet Sa | X-ray contrast media |
| AR207465A1 (es) * | 1974-05-31 | 1976-10-08 | Guerbet Lab Andre | Procedimiento de preparacion de derivados de acido triiodoi2,4,6-(triiodo-2,4,6-benzoil)-amino-alcanoilaminobenzoico de acido triiodo-2,4,6-(triiodo-2,4,6-(triiodo-2,4,6-benzoil)-aminoalcanoilaminobenzoil)-amino-alcanoil-aminobenzoico y de acido triiodo-2,4,6-bis((triiodo-2,4,6-fenil)-carbamoil-metil)-aminoalcanoil-aminobenzoico |
| CH608189A5 (enExample) * | 1974-12-13 | 1978-12-29 | Savac Ag | |
| GB1491129A (en) * | 1975-06-04 | 1977-11-09 | Guerbet Sa | Iodo-benzene derivatives and an x-ray contrast medium containing them |
| DE2628517C2 (de) * | 1976-06-23 | 1985-02-21 | Schering AG, 1000 Berlin und 4709 Bergkamen | Dicarbonsäure-bis(3,5-dicarbamoyl-2,4,6-trijodanilid)-Verbindungen, Verfahren zu ihrer Herstellung und Röntgenkontrastmittel |
-
1977
- 1977-03-28 CH CH380677A patent/CH626873A5/de not_active IP Right Cessation
-
1978
- 1978-02-13 DE DE2805928A patent/DE2805928C3/de not_active Expired
- 1978-02-17 GB GB6470/78A patent/GB1569242A/en not_active Expired
- 1978-02-23 SE SE7802106A patent/SE437513B/sv not_active IP Right Cessation
- 1978-02-27 US US05/881,567 patent/US4139605A/en not_active Expired - Lifetime
- 1978-03-14 CA CA298,854A patent/CA1089489A/en not_active Expired
- 1978-03-16 DK DK119878A patent/DK148783C/da not_active IP Right Cessation
- 1978-03-17 AT AT0190378A patent/AT362870B/de not_active IP Right Cessation
- 1978-03-20 NO NO780991A patent/NO145338C/no unknown
- 1978-03-24 FR FR7808737A patent/FR2385698B1/fr not_active Expired
- 1978-03-28 JP JP3493678A patent/JPS53119842A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| FR2385698B1 (enExample) | 1981-04-30 |
| DK148783B (da) | 1985-09-30 |
| NO145338C (no) | 1982-03-03 |
| JPS53119842A (en) | 1978-10-19 |
| GB1569242A (en) | 1980-06-11 |
| JPS5715103B2 (enExample) | 1982-03-29 |
| NO145338B (no) | 1981-11-23 |
| SE437513B (sv) | 1985-03-04 |
| US4139605A (en) | 1979-02-13 |
| SE7802106L (sv) | 1978-09-29 |
| DE2805928A1 (de) | 1978-10-05 |
| DE2805928C3 (de) | 1982-02-25 |
| ATA190378A (de) | 1980-11-15 |
| NO780991L (no) | 1978-09-29 |
| DK119878A (da) | 1978-09-29 |
| FR2385698A1 (enExample) | 1978-10-27 |
| DE2805928B2 (de) | 1981-04-23 |
| CA1089489A (en) | 1980-11-11 |
| AT362870B (de) | 1981-06-25 |
| DK148783C (da) | 1986-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH626873A5 (enExample) | ||
| EP0308364B1 (de) | Neue Dicarbonsäure-bis(3,5-dicarbamoyl-2,4,6-Triiodanilide), Verfahren zu deren Herstellung sowie diese enthaltende Röntgenkontrastmittel | |
| EP0026281B1 (de) | Neue Derivate der 2,4,6-Trijod-isophthalsäure, Verfahren zu deren Herstellung und diese enthaltende Röntgenkontrastmittel | |
| EP0049745B1 (de) | Neue N-Hydroxy-alkylierte Dicarbonsäure-bis-(3,5-dicarbamoyl-2,4,6-trijodanilide), deren Herstellung und diese enthaltende Röntgenkontrastmittel | |
| DE2031724A1 (de) | Neue Röntgenkontrastmittel | |
| DE1928838A1 (de) | Roentgenkontrastmittel und Verfahren zu ihrer Herstellung | |
| EP0023992A1 (de) | Neue Derivate der 2,4,6-Trijod-isophthalsäure, Verfahren zu deren Herstellung und diese enthaltende Röntgenkontrastmittel | |
| DE3150916C2 (enExample) | ||
| EP0317492B1 (de) | Neue substituierte Dicarbonsäure-bis(3,5-dicarbamoyl-2,4,6-triiodanilide), Verfahren zu deren Herstellung sowie diese enthaltende Röntgenkontrastmittel | |
| EP0185130B1 (de) | Neue Derivate der 5-Alkoxy-2,4,6-trijod- und tribrom-isophthalsäure, Verfahren zu ihrer Herstellung und diese enthaltende Röntgenkontrastmittel | |
| CH616403A5 (en) | Process for the preparation of 2,4,6-triodoisophthalamides which are readily soluble in water. | |
| DE2124904C3 (de) | Hydroxy- und Alkoxyacetamido-trijodbenzoesäuren, deren Salze mit physiologisch verträglichen Basen, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Röntgenkontrastmittel | |
| DE2547789C3 (de) | 5-Hydroxypropionylamino-2,4,6-trijodisophthalsäure-bis-(dihydroxypropylamide), Verfahren zu ihrer Herstellung und diese enthaltende Röntgenkontrastmittel | |
| CH420191A (de) | Verfahren zur Herstellung von jodierten Acylaminobenzoesäureamiden und Verwendung derselben als schattengebende Komponente in Röntgenkontrastmitteln | |
| DE2407016A1 (de) | 2-alkoxybenzoylaminosaeuren, verfahren zur herstellung derselben und antipyretisches mittel mit einem gehalt derselben | |
| AT295492B (de) | Verfahren zur Herstellung neuer 2-Phenyl- oder 2-Cyclohexyl-2-hydroxycyclohexancarbonsäuren und deren basischer Ester sowie deren Säureadditions- und quaternärer Salze | |
| DE2201578A1 (de) | Leicht wasserloesliche,nicht ionische Roentgenkontrastmittel und Verfahren zu ihrer Herstellung | |
| AT258464B (de) | Injizierbares Röntgenkontrastmittel | |
| AT309669B (de) | Röntgenkontrastmittel | |
| DE2547789B2 (de) | 5-hydroxypropionylamino-2,4,6-trijod- isophthalsaeure-bis-(dihydroxypropylamide) verfahren zu ihrer herstellung und diese enthaltende roentgenkontrastmittel | |
| DE2422718C3 (de) | S-Alkoxycarbonylaminomethyl-Sacylamino-2,4,6-trijod-benzoesäuren, Verfahren zur deren Herstellung sowie diese enthaltende Röntgenkontrastmittel | |
| AT214069B (de) | Röntgenkontrastmittel | |
| AT334356B (de) | Verfahren zum herstellen des neuen (l,d oder dl) -5-hydroxytryptophan- (l,d oder dl) -glutamats | |
| AT224628B (de) | Verfahren zur Herstellung neuer Aminoalkohole und ihrer Salze | |
| AT317196B (de) | Verfahren zur Herstellung neuer 1-Benzoyloxy-2-niedrig-alkylaminobenzocycloalkanderivate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |