CH623579A5 - - Google Patents
Download PDFInfo
- Publication number
- CH623579A5 CH623579A5 CH452276A CH452276A CH623579A5 CH 623579 A5 CH623579 A5 CH 623579A5 CH 452276 A CH452276 A CH 452276A CH 452276 A CH452276 A CH 452276A CH 623579 A5 CH623579 A5 CH 623579A5
- Authority
- CH
- Switzerland
- Prior art keywords
- ethylene
- bis
- dimethylaminophenyl
- compounds
- group
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 38
- -1 ethylene compound Chemical class 0.000 claims description 31
- 239000005977 Ethylene Substances 0.000 claims description 26
- 239000003593 chromogenic compound Substances 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 12
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 10
- 239000000463 material Substances 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 7
- 230000008569 process Effects 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 6
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 5
- GQWAOUOHRMHSHL-UHFFFAOYSA-N 4-ethenyl-n,n-dimethylaniline Chemical group CN(C)C1=CC=C(C=C)C=C1 GQWAOUOHRMHSHL-UHFFFAOYSA-N 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 4
- OJHOCVDKOATZFS-UHFFFAOYSA-N n,n-ditert-butyl-4-ethenylaniline Chemical group CC(C)(C)N(C(C)(C)C)C1=CC=C(C=C)C=C1 OJHOCVDKOATZFS-UHFFFAOYSA-N 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 125000001246 bromo group Chemical group Br* 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 125000004442 acylamino group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000000950 dibromo group Chemical group Br* 0.000 claims description 2
- 125000003963 dichloro group Chemical group Cl* 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- KAVBRFJCUBOPFC-UHFFFAOYSA-N n,n-dibutyl-4-ethenylaniline Chemical group CCCCN(CCCC)C1=CC=C(C=C)C=C1 KAVBRFJCUBOPFC-UHFFFAOYSA-N 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 2
- ZQCZHPZBXTVVLE-UHFFFAOYSA-N N-[5-(dimethylamino)-2-ethenylphenyl]acetamide Chemical group N(C(=O)C)C1=C(C=CC(=C1)N(C)C)C=C ZQCZHPZBXTVVLE-UHFFFAOYSA-N 0.000 claims 1
- 125000003277 amino group Chemical group 0.000 claims 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims 1
- 238000010521 absorption reaction Methods 0.000 description 23
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 20
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 15
- 150000008064 anhydrides Chemical class 0.000 description 14
- 239000000126 substance Substances 0.000 description 14
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 8
- 229920001568 phenolic resin Polymers 0.000 description 8
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 description 7
- 238000000862 absorption spectrum Methods 0.000 description 7
- 239000007795 chemical reaction product Substances 0.000 description 7
- 239000005011 phenolic resin Substances 0.000 description 7
- 230000002378 acidificating effect Effects 0.000 description 6
- 239000004927 clay Substances 0.000 description 6
- 238000001228 spectrum Methods 0.000 description 6
- AKHSBAVQPIRVAG-UHFFFAOYSA-N 4h-isochromene-1,3-dione Chemical compound C1=CC=C2C(=O)OC(=O)CC2=C1 AKHSBAVQPIRVAG-UHFFFAOYSA-N 0.000 description 5
- 150000004715 keto acids Chemical class 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- 239000000758 substrate Substances 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 4
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- MMIUVGRZSMZLQE-UHFFFAOYSA-N oxane-2,3,6-trione Chemical compound O=C1CCC(=O)C(=O)O1 MMIUVGRZSMZLQE-UHFFFAOYSA-N 0.000 description 4
- AUHHYELHRWCWEZ-UHFFFAOYSA-N tetrachlorophthalic anhydride Chemical compound ClC1=C(Cl)C(Cl)=C2C(=O)OC(=O)C2=C1Cl AUHHYELHRWCWEZ-UHFFFAOYSA-N 0.000 description 4
- 229920002554 vinyl polymer Polymers 0.000 description 4
- WNZQDUSMALZDQF-UHFFFAOYSA-N 2-benzofuran-1(3H)-one Chemical class C1=CC=C2C(=O)OCC2=C1 WNZQDUSMALZDQF-UHFFFAOYSA-N 0.000 description 3
- ROFZMKDROVBLNY-UHFFFAOYSA-N 4-nitro-2-benzofuran-1,3-dione Chemical compound [O-][N+](=O)C1=CC=CC2=C1C(=O)OC2=O ROFZMKDROVBLNY-UHFFFAOYSA-N 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 230000031700 light absorption Effects 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical group C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- IZJDCINIYIMFGX-UHFFFAOYSA-N benzo[f][2]benzofuran-1,3-dione Chemical compound C1=CC=C2C=C3C(=O)OC(=O)C3=CC2=C1 IZJDCINIYIMFGX-UHFFFAOYSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- MCQOWYALZVKMAR-UHFFFAOYSA-N furo[3,4-b]pyridine-5,7-dione Chemical compound C1=CC=C2C(=O)OC(=O)C2=N1 MCQOWYALZVKMAR-UHFFFAOYSA-N 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 150000002596 lactones Chemical group 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- NFKMAYYHLXEVDM-UHFFFAOYSA-N 3-(1h-indol-3-yl)-3h-2-benzofuran-1-one Chemical class C12=CC=CC=C2C(=O)OC1C1=CNC2=CC=CC=C12 NFKMAYYHLXEVDM-UHFFFAOYSA-N 0.000 description 1
- PYSRRFNXTXNWCD-UHFFFAOYSA-N 3-(2-phenylethenyl)furan-2,5-dione Chemical compound O=C1OC(=O)C(C=CC=2C=CC=CC=2)=C1 PYSRRFNXTXNWCD-UHFFFAOYSA-N 0.000 description 1
- JEXCBTXFJQTLFP-UHFFFAOYSA-N 3-nitro-3h-2-benzofuran-1-one Chemical compound C1=CC=C2C([N+](=O)[O-])OC(=O)C2=C1 JEXCBTXFJQTLFP-UHFFFAOYSA-N 0.000 description 1
- GAIPRQZXSYSCRD-UHFFFAOYSA-N 4,5-dichloro-2-benzofuran-1,3-dione Chemical compound ClC1=CC=C2C(=O)OC(=O)C2=C1Cl GAIPRQZXSYSCRD-UHFFFAOYSA-N 0.000 description 1
- HBWITNNIJDLPLS-UHFFFAOYSA-N 4-[1-[4-(dimethylamino)phenyl]ethenyl]-n,n-dimethylaniline Chemical group C1=CC(N(C)C)=CC=C1C(=C)C1=CC=C(N(C)C)C=C1 HBWITNNIJDLPLS-UHFFFAOYSA-N 0.000 description 1
- BTTRMCQEPDPCPA-UHFFFAOYSA-N 4-chlorophthalic anhydride Chemical compound ClC1=CC=C2C(=O)OC(=O)C2=C1 BTTRMCQEPDPCPA-UHFFFAOYSA-N 0.000 description 1
- TWWAWPHAOPTQEU-UHFFFAOYSA-N 4-methyl-2-benzofuran-1,3-dione Chemical compound CC1=CC=CC2=C1C(=O)OC2=O TWWAWPHAOPTQEU-UHFFFAOYSA-N 0.000 description 1
- WKOPFKCDGGWLAV-UHFFFAOYSA-N 5-(dimethylamino)-2-benzofuran-1,3-dione Chemical compound CN(C)C1=CC=C2C(=O)OC(=O)C2=C1 WKOPFKCDGGWLAV-UHFFFAOYSA-N 0.000 description 1
- ZOXBWJMCXHTKNU-UHFFFAOYSA-N 5-methyl-2-benzofuran-1,3-dione Chemical compound CC1=CC=C2C(=O)OC(=O)C2=C1 ZOXBWJMCXHTKNU-UHFFFAOYSA-N 0.000 description 1
- MMVIDXVHQANYAE-UHFFFAOYSA-N 5-nitro-2-benzofuran-1,3-dione Chemical compound [O-][N+](=O)C1=CC=C2C(=O)OC(=O)C2=C1 MMVIDXVHQANYAE-UHFFFAOYSA-N 0.000 description 1
- UYPMEGMZCYYSAH-UHFFFAOYSA-N 7-oxatricyclo[7.2.2.22,5]pentadeca-1(12),2(15),3,5(14),9(13),10-hexaene-6,8-dione Chemical compound C1=CC2=CC=C1C(=O)OC(=O)C1=CC=C2C=C1 UYPMEGMZCYYSAH-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 0 CC(*)[C@]([C@@](*)[C@](C)N=O)O Chemical compound CC(*)[C@]([C@@](*)[C@](C)N=O)O 0.000 description 1
- 206010024769 Local reaction Diseases 0.000 description 1
- GRSMWKLPSNHDHA-UHFFFAOYSA-N Naphthalic anhydride Chemical compound C1=CC(C(=O)OC2=O)=C3C2=CC=CC3=C1 GRSMWKLPSNHDHA-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229920000147 Styrene maleic anhydride Polymers 0.000 description 1
- QHWKHLYUUZGSCW-UHFFFAOYSA-N Tetrabromophthalic anhydride Chemical compound BrC1=C(Br)C(Br)=C2C(=O)OC(=O)C2=C1Br QHWKHLYUUZGSCW-UHFFFAOYSA-N 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- HPTYUNKZVDYXLP-UHFFFAOYSA-N aluminum;trihydroxy(trihydroxysilyloxy)silane;hydrate Chemical compound O.[Al].[Al].O[Si](O)(O)O[Si](O)(O)O HPTYUNKZVDYXLP-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical compound O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- KFKMGUPDWTWQFM-UHFFFAOYSA-N furo[3,4-c]pyridine-1,3-dione Chemical compound N1=CC=C2C(=O)OC(=O)C2=C1 KFKMGUPDWTWQFM-UHFFFAOYSA-N 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- 229910052621 halloysite Inorganic materials 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 230000005577 local transmission Effects 0.000 description 1
- BYVCTYDTPSKPRM-UHFFFAOYSA-N naphthalene-1-carbonyl naphthalene-1-carboxylate Chemical compound C1=CC=C2C(C(OC(=O)C=3C4=CC=CC=C4C=CC=3)=O)=CC=CC2=C1 BYVCTYDTPSKPRM-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003613 toluenes Chemical class 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/87—Benzo [c] furans; Hydrogenated benzo [c] furans
- C07D307/88—Benzo [c] furans; Hydrogenated benzo [c] furans with one oxygen atom directly attached in position 1 or 3
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/124—Duplicating or marking methods; Sheet materials for use therein using pressure to make a masked colour visible, e.g. to make a coloured support visible, to create an opaque or transparent pattern, or to form colour by uniting colour-forming components
- B41M5/132—Chemical colour-forming components; Additives or binders therefor
- B41M5/136—Organic colour formers, e.g. leuco dyes
- B41M5/145—Organic colour formers, e.g. leuco dyes with a lactone or lactam ring
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/26—Thermography ; Marking by high energetic means, e.g. laser otherwise than by burning, and characterised by the material used
- B41M5/30—Thermography ; Marking by high energetic means, e.g. laser otherwise than by burning, and characterised by the material used using chemical colour formers
- B41M5/323—Organic colour formers, e.g. leuco dyes
- B41M5/327—Organic colour formers, e.g. leuco dyes with a lactone or lactam ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/30—Indoles; Hydrogenated indoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to carbon atoms of the hetero ring
- C07D209/32—Oxygen atoms
- C07D209/36—Oxygen atoms in position 3, e.g. adrenochrome
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/92—Naphthofurans; Hydrogenated naphthofurans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D313/00—Heterocyclic compounds containing rings of more than six members having one oxygen atom as the only ring hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D313/00—Heterocyclic compounds containing rings of more than six members having one oxygen atom as the only ring hetero atom
- C07D313/16—Eight-membered rings
- C07D313/20—Eight-membered rings condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Color Printing (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/566,851 US4020056A (en) | 1975-04-10 | 1975-04-10 | Di-vinyl phthalides color formers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH623579A5 true CH623579A5 (enExample) | 1981-06-15 |
Family
ID=24264658
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH452276A CH623579A5 (enExample) | 1975-04-10 | 1976-04-12 |
Country Status (7)
| Country | Link |
|---|---|
| US (2) | US4020056A (enExample) |
| JP (2) | JPS585940B2 (enExample) |
| CA (1) | CA1055942A (enExample) |
| CH (1) | CH623579A5 (enExample) |
| DE (1) | DE2614944C2 (enExample) |
| FR (1) | FR2306986A1 (enExample) |
| GB (1) | GB1496296A (enExample) |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4020056A (en) * | 1975-04-10 | 1977-04-26 | Ncr Corporation | Di-vinyl phthalides color formers |
| EP0062544B1 (en) * | 1981-04-08 | 1987-09-30 | Kanzaki Paper Manufacturing Company Limited | New phthalide derivatives, process for preparing the same and recording system utilizing the same as colourless chromogenic material |
| JPS57167979A (en) * | 1981-04-08 | 1982-10-16 | Kanzaki Paper Mfg Co Ltd | Phthalide derivative, its preparation, recording material using it |
| JPS58157779A (ja) * | 1982-03-13 | 1983-09-19 | Kanzaki Paper Mfg Co Ltd | フタリド誘導体、その製造方法およびその誘導体を用いた感熱記録体 |
| JPS6027589A (ja) * | 1983-07-26 | 1985-02-12 | Kanzaki Paper Mfg Co Ltd | 記録体 |
| US4730057A (en) * | 1985-01-17 | 1988-03-08 | Kanzaki Paper Manufacturing Co., Ltd. | Phthalide derivatives useful as colorless chromogenic material |
| JPS61202883A (ja) * | 1985-03-06 | 1986-09-08 | Kanzaki Paper Mfg Co Ltd | 感圧複写紙 |
| US4761396A (en) * | 1986-02-12 | 1988-08-02 | Kanzaki Paper Manufacturing Co., Ltd. | Heat-sensitive recording material |
| DE3775598D1 (de) * | 1986-04-15 | 1992-02-13 | Yamada Chem Co | Divinylverbindungen und unter verwendung dieser verbindungen hergestelltes chromogenes aufzeichnungsmaterial. |
| US4814320A (en) * | 1986-04-15 | 1989-03-21 | Yamada Chemical Co., Ltd. | Heat-sensitive recording material |
| DE3773035D1 (de) * | 1986-04-16 | 1991-10-24 | Yamada Chem Co | Divinylverbindungen und unter verwendung dieser verbindungen hergestelltes chromogenes aufzeichnungsmaterial. |
| US4826806A (en) * | 1986-07-31 | 1989-05-02 | Shin Nisso Kako Co., Ltd. | Fluoran compounds and color forming recording materials using same |
| DE3727201C1 (de) * | 1986-08-14 | 1988-03-10 | Ricoh Kk | Faerbende Phthalid-Verbindungen und diese als faerbenden Bestandteil enthaltende Aufzeichnungsmaterialien |
| GB2198139B (en) * | 1986-09-22 | 1991-01-23 | Fuji Photo Film Co Ltd | Polymerizable dye precursor and color-forming recording material containing the same |
| GB8628914D0 (en) * | 1986-12-03 | 1987-01-07 | Wiggins Teape Group Ltd | Colour former manufacture |
| JPH0764987B2 (ja) * | 1987-02-13 | 1995-07-12 | 富士写真フイルム株式会社 | 近赤外ロイコ染料及び該染料を含む記録材料 |
| DE3836797A1 (de) * | 1987-10-29 | 1989-05-11 | Ricoh Kk | Leukofarbstoffe |
| FR2622591B1 (fr) * | 1987-10-29 | 1992-10-16 | Ricoh Kk | Colorant leuco et materiau d'enregistrement le comportant, utile notamment comme feuille autocopiante sensible a la chaleur ou a la pression |
| US4977131A (en) * | 1988-05-24 | 1990-12-11 | Moore Business Forms, Inc. | OCR scannable carbonless copying system and a method of producing OCR scannable images therewith |
| US4970308A (en) * | 1989-08-23 | 1990-11-13 | Appleton Papers Inc. | Di(bis-(indolyl)ethylenyl)tetrahalophtalides |
| EP0386992A3 (en) * | 1989-03-08 | 1991-06-12 | Appleton Papers Inc. | Colour formers for recording sheets |
| US5116978A (en) * | 1989-03-08 | 1992-05-26 | Appleton Papers Inc. | Process for bis(indolyl)ethylene synthesis |
| US4996328A (en) * | 1989-03-08 | 1991-02-26 | Appleton Papers Inc. | Bis-(indolyl)ethylenes |
| US4985392A (en) * | 1989-04-21 | 1991-01-15 | Minnesota Mining And Manufacturing Company | Colored thermographic media |
| US5039821A (en) * | 1989-08-23 | 1991-08-13 | Appleton Papers Inc. | Process for producing di[bis-(indolyl)ethylenyl]tetrahalophthalides |
| US5242884A (en) * | 1991-03-15 | 1993-09-07 | Kanzaki Paper Manufacturing Co., Ltd. | Heat-sensitive recording material |
| US5200519A (en) * | 1992-01-03 | 1993-04-06 | Appleton Papers Inc. | Mono(indolylethylenyl)phthalides |
| JP3579136B2 (ja) | 1995-07-19 | 2004-10-20 | 富士写真フイルム株式会社 | 画像形成方法 |
| US8053494B2 (en) * | 2003-10-06 | 2011-11-08 | Nocopi Technologies, Inc. | Invisible ink and scratch pad |
| US20050165131A1 (en) * | 2003-10-06 | 2005-07-28 | Terry Stovold | Invisible ink |
| US20050075420A1 (en) * | 2003-10-06 | 2005-04-07 | Terry Stovold | Invisible ink |
| JP4713303B2 (ja) * | 2005-11-07 | 2011-06-29 | 王子製紙株式会社 | 記録シート |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3491117A (en) * | 1967-01-30 | 1970-01-20 | Ncr Co | Indole substituted pyromellitides |
| US3491112A (en) * | 1967-01-30 | 1970-01-20 | Ncr Co | 3-(phenyl)-3-(heterocyclic-substituted)-phthalides |
| US3594369A (en) * | 1969-01-21 | 1971-07-20 | Ncr Co | 3,5(6)-disubstituted-3-(para-diloweralkyl-aminophenyl) phthalides |
| BE755646A (fr) * | 1969-09-02 | 1971-02-15 | Eastman Kodak Co | Nouvelle composition photoconductrice et produit la contenant |
| SE394868B (sv) * | 1970-07-08 | 1977-07-18 | Yamamoto Kagaku Gosei Kk | Tryckkensligt kopiepapper, hos vilket som fergbildare anvendes ett bensylaminofluoranderivat |
| US3825561A (en) * | 1970-10-12 | 1974-07-23 | Sumitomo Chemical Co | Fluoran compounds |
| US3736337A (en) * | 1971-04-27 | 1973-05-29 | Ncr Co | Tetrahalogenated chromogenic compounds and their use |
| DE2259409C2 (de) * | 1971-12-06 | 1985-10-10 | Appleton Papers Inc., Appleton, Wis. | Chromogene Furo[3,4-b]pyridin-7-one und -pyrazin-5-one |
| BE793349A (fr) * | 1971-12-24 | 1973-04-16 | Hodogaya Chemical Co Ltd | Composes de fluorane et papiers de copie sensibles a la pression en contenant |
| US3804855A (en) * | 1972-03-22 | 1974-04-16 | Ncr | Naphthalide compounds |
| JPS517575B2 (enExample) * | 1973-03-23 | 1976-03-09 | ||
| US3930108A (en) * | 1974-11-21 | 1975-12-30 | Moore Business Forms Inc | 9-(4-Aminophenyl polymethine)-9-xanthenol compounds and pressure sensitive system therewith |
| US3928685A (en) * | 1974-11-21 | 1975-12-23 | Moore Business Forms Inc | 1-Hydroxy-1-(4-aminophenyl polymethine) naphthalan compounds and pressure-sensitive recording system therewith |
| US4022771A (en) * | 1975-04-10 | 1977-05-10 | Ncr Corporation | Aminophenyl lactone compounds containing an ethyleno group |
| US4026883A (en) * | 1975-04-10 | 1977-05-31 | Ncr Corporation | Derivatives of dianhydrides as vinyl color formers |
| US4020056A (en) * | 1975-04-10 | 1977-04-26 | Ncr Corporation | Di-vinyl phthalides color formers |
-
1975
- 1975-04-10 US US05/566,851 patent/US4020056A/en not_active Expired - Lifetime
- 1975-11-04 CA CA238,991A patent/CA1055942A/en not_active Expired
-
1976
- 1976-01-20 JP JP51005389A patent/JPS585940B2/ja not_active Expired
- 1976-03-15 GB GB10240/76A patent/GB1496296A/en not_active Expired
- 1976-04-07 DE DE2614944A patent/DE2614944C2/de not_active Expired
- 1976-04-09 FR FR7610426A patent/FR2306986A1/fr active Granted
- 1976-04-12 CH CH452276A patent/CH623579A5/de not_active IP Right Cessation
-
1977
- 1977-04-25 US US05/790,628 patent/US4107428A/en not_active Expired - Lifetime
-
1980
- 1980-01-16 JP JP344980A patent/JPS55115456A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DE2614944C2 (de) | 1983-12-08 |
| GB1496296A (en) | 1977-12-30 |
| JPS51121035A (en) | 1976-10-22 |
| FR2306986A1 (fr) | 1976-11-05 |
| CA1055942A (en) | 1979-06-05 |
| JPS55115456A (en) | 1980-09-05 |
| FR2306986B1 (enExample) | 1978-11-17 |
| US4020056A (en) | 1977-04-26 |
| US4107428A (en) | 1978-08-15 |
| JPS585940B2 (ja) | 1983-02-02 |
| DE2614944A1 (de) | 1976-10-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH623579A5 (enExample) | ||
| DE2615024C2 (de) | Chromogene Verbindungen, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Aufzeichnungsmaterialien | |
| DE1795737C3 (de) | 3-(p-Aminophenyl)-3-(3-indolyl)phthalide und ihre Anwendung in druckempfindlichem Aufzeichnungsmaterial | |
| DE1671545C2 (de) | Druckempfindliches Kopierpapier | |
| DE2265233A1 (de) | Neue farbstoffbildner und ihre verwendung | |
| DE2412640A1 (de) | Druckempfindliches kopierpapier mit einem gehalt an lacton-verbindung einer pyridincarbonsaeure | |
| CH621091A5 (enExample) | ||
| DE2130845B2 (de) | Dibenzylaminofluorane, ihre Her stellung und Verwendung | |
| DE2163658A1 (de) | Druckempfindliches Kopierpapier | |
| DE1421395A1 (de) | UEberzuege und Abdruckverfahren unter Verwendung von Phenolen und von gefaerbten Produkten derselben | |
| DE2520148C2 (enExample) | ||
| DE2423534A1 (de) | Nitrophthalide, verfahren zu ihrer herstellung und ihre verwendung in druckempfindlichen aufzeichnungssystemen | |
| DE1421394C3 (de) | Beschichtungsmasse fur Aufzeichnungs und Vervielfältigungsverfahren und da mit hergestellter Kopiersatz | |
| DE3116815A1 (de) | Chromogenes material | |
| EP0003726B1 (de) | Substituierte Diaminophthalide, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbbildner in druckempfindlichen oder wärmeempfindlichen Aufzeichnungsmaterialien | |
| DE2314540C2 (de) | 2(H)-Benzopyrane und deren Verwendung | |
| CH628339A5 (de) | Verfahren zum herstellen neuer chromogener verbindungen und deren verwendung. | |
| DE2263292C3 (de) | Fluoranverbindungen und druckempfindliches Kopierpapier | |
| DE2355742A1 (de) | Lactonverbindungen der pyridincarbonsaeure und druckempfindliche kopierpapiere, die diese enthalten | |
| DE3018546A1 (de) | Neue fluorane, verfahren zu deren herstellung und markierungssysteme | |
| CH621350A5 (enExample) | ||
| DE2229032C3 (de) | Hektographisches Farbblatt | |
| DE2515306A1 (de) | Pyrazoloxanthen-verbindungen, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2231136C3 (de) | Hektographisches Farbblatt | |
| DE2151034C3 (de) | Verwendung von Leucauraminverbindungen für hektographische Farbblätter |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |