CH621329A5 - - Google Patents
Download PDFInfo
- Publication number
- CH621329A5 CH621329A5 CH270775A CH270775A CH621329A5 CH 621329 A5 CH621329 A5 CH 621329A5 CH 270775 A CH270775 A CH 270775A CH 270775 A CH270775 A CH 270775A CH 621329 A5 CH621329 A5 CH 621329A5
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- carbon atoms
- alkyl
- compounds
- hydrogen
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 60
- 238000002360 preparation method Methods 0.000 claims description 43
- 238000000034 method Methods 0.000 claims description 41
- 239000002253 acid Substances 0.000 claims description 35
- -1 piperidino, morpholino, piperazino, phenylpiperazino Chemical group 0.000 claims description 32
- 150000003839 salts Chemical class 0.000 claims description 31
- 125000004432 carbon atom Chemical group C* 0.000 claims description 29
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- 239000001257 hydrogen Substances 0.000 claims description 18
- 230000003287 optical effect Effects 0.000 claims description 18
- 230000008569 process Effects 0.000 claims description 18
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 17
- 238000006243 chemical reaction Methods 0.000 claims description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 150000002148 esters Chemical class 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 5
- 150000001298 alcohols Chemical class 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 150000008065 acid anhydrides Chemical class 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 229910021529 ammonia Inorganic materials 0.000 claims description 3
- 150000003254 radicals Chemical class 0.000 claims description 3
- 150000003459 sulfonic acid esters Chemical class 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 150000003461 sulfonyl halides Chemical class 0.000 claims description 2
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 claims 1
- 101150065749 Churc1 gene Proteins 0.000 claims 1
- 102100038239 Protein Churchill Human genes 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 54
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 38
- 239000000243 solution Substances 0.000 description 38
- 239000000047 product Substances 0.000 description 37
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 35
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 32
- 239000000203 mixture Substances 0.000 description 28
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 21
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 18
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 16
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 16
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 15
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 14
- 230000000202 analgesic effect Effects 0.000 description 14
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- 241001465754 Metazoa Species 0.000 description 10
- 230000006793 arrhythmia Effects 0.000 description 10
- 206010003119 arrhythmia Diseases 0.000 description 10
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 10
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 9
- 239000012346 acetyl chloride Substances 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 238000012360 testing method Methods 0.000 description 9
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 8
- 235000019341 magnesium sulphate Nutrition 0.000 description 8
- DRLVMOAWNVOSPE-UHFFFAOYSA-N 2-phenylcyclohexan-1-one Chemical compound O=C1CCCCC1C1=CC=CC=C1 DRLVMOAWNVOSPE-UHFFFAOYSA-N 0.000 description 7
- NNJVILVZKWQKPM-UHFFFAOYSA-N Lidocaine Chemical compound CCN(CC)CC(=O)NC1=C(C)C=CC=C1C NNJVILVZKWQKPM-UHFFFAOYSA-N 0.000 description 7
- 239000002585 base Substances 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 229940035676 analgesics Drugs 0.000 description 6
- 239000000730 antalgic agent Substances 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 6
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 6
- 239000003589 local anesthetic agent Substances 0.000 description 6
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 6
- LPMXVESGRSUGHW-HBYQJFLCSA-N ouabain Chemical compound O[C@@H]1[C@H](O)[C@@H](O)[C@H](C)O[C@H]1O[C@@H]1C[C@@]2(O)CC[C@H]3[C@@]4(O)CC[C@H](C=5COC(=O)C=5)[C@@]4(C)C[C@@H](O)[C@@H]3[C@@]2(CO)[C@H](O)C1 LPMXVESGRSUGHW-HBYQJFLCSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- ZHKZBCHUBSBFCZ-UHFFFAOYSA-N 1-(1-hydroxypropan-2-yl)-2-phenylcyclohexan-1-ol Chemical compound OCC(C)C1(O)CCCCC1C1=CC=CC=C1 ZHKZBCHUBSBFCZ-UHFFFAOYSA-N 0.000 description 5
- VKNQPZKJCJNZCT-UHFFFAOYSA-N 2-(1-hydroxy-2-phenylcyclohexyl)propanoic acid Chemical compound OC(=O)C(C)C1(O)CCCCC1C1=CC=CC=C1 VKNQPZKJCJNZCT-UHFFFAOYSA-N 0.000 description 5
- LPMXVESGRSUGHW-UHFFFAOYSA-N Acolongiflorosid K Natural products OC1C(O)C(O)C(C)OC1OC1CC2(O)CCC3C4(O)CCC(C=5COC(=O)C=5)C4(C)CC(O)C3C2(CO)C(O)C1 LPMXVESGRSUGHW-UHFFFAOYSA-N 0.000 description 5
- 241000699670 Mus sp. Species 0.000 description 5
- LPMXVESGRSUGHW-GHYGWZAOSA-N Ouabain Natural products O([C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O1)[C@H]1C[C@@H](O)[C@@]2(CO)[C@@](O)(C1)CC[C@H]1[C@]3(O)[C@@](C)([C@H](C4=CC(=O)OC4)CC3)C[C@@H](O)[C@H]21 LPMXVESGRSUGHW-GHYGWZAOSA-N 0.000 description 5
- 244000166550 Strophanthus gratus Species 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 239000012458 free base Substances 0.000 description 5
- 229960003343 ouabain Drugs 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- RLEOZIQMUJSUMI-UHFFFAOYSA-N 1-(1-morpholin-4-ylpropan-2-yl)-2-phenylcyclohexan-1-ol;hydrochloride Chemical compound Cl.C1CCCC(C=2C=CC=CC=2)C1(O)C(C)CN1CCOCC1 RLEOZIQMUJSUMI-UHFFFAOYSA-N 0.000 description 4
- POPDOWPKMHATOS-UHFFFAOYSA-N 1-[1-(dimethylamino)propan-2-yl]-2-phenylcyclohexan-1-ol Chemical compound CN(C)CC(C)C1(O)CCCCC1C1=CC=CC=C1 POPDOWPKMHATOS-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 4
- 230000003288 anthiarrhythmic effect Effects 0.000 description 4
- 125000001589 carboacyl group Chemical group 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- RLQZIECDMISZHS-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=CC(=O)C(C=2C=CC=CC=2)=C1 RLQZIECDMISZHS-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- XADCESSVHJOZHK-UHFFFAOYSA-N Meperidine Chemical compound C=1C=CC=CC=1C1(C(=O)OCC)CCN(C)CC1 XADCESSVHJOZHK-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 230000003444 anaesthetic effect Effects 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000000460 chlorine Chemical group 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 3
- ARFLASKVLJTEJD-UHFFFAOYSA-N ethyl 2-bromopropanoate Chemical compound CCOC(=O)C(C)Br ARFLASKVLJTEJD-UHFFFAOYSA-N 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 150000002367 halogens Chemical group 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229960005181 morphine Drugs 0.000 description 3
- 230000003533 narcotic effect Effects 0.000 description 3
- 229960000482 pethidine Drugs 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 235000011181 potassium carbonates Nutrition 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- IWBZWAZMDRWOGH-UHFFFAOYSA-N 1-(1-hydroxypropan-2-yl)-2-(4-methoxyphenyl)cyclohexan-1-ol Chemical compound C1=CC(OC)=CC=C1C1C(C(C)CO)(O)CCCC1 IWBZWAZMDRWOGH-UHFFFAOYSA-N 0.000 description 2
- VENOQVYFLMYTLU-UHFFFAOYSA-N 1-(2-hydroxyethyl)-2-(3-methylphenyl)cyclohexan-1-ol Chemical compound CC1=CC=CC(C2C(CCCC2)(O)CCO)=C1 VENOQVYFLMYTLU-UHFFFAOYSA-N 0.000 description 2
- BFFDBMGYCLHGOG-UHFFFAOYSA-N 1-[1-(methylamino)ethyl]-2-phenylcyclohexan-1-ol;hydrochloride Chemical compound Cl.CNC(C)C1(O)CCCCC1C1=CC=CC=C1 BFFDBMGYCLHGOG-UHFFFAOYSA-N 0.000 description 2
- KZFKFDSWAGMTTK-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)cyclohexan-1-one Chemical compound C1=C(OC)C(OC)=CC=C1C1C(=O)CCCC1 KZFKFDSWAGMTTK-UHFFFAOYSA-N 0.000 description 2
- BQHZVXXUIHNXAP-UHFFFAOYSA-N 2-(3-methylphenyl)cyclohexan-1-one Chemical compound CC1=CC=CC(C2C(CCCC2)=O)=C1 BQHZVXXUIHNXAP-UHFFFAOYSA-N 0.000 description 2
- BEBTXYAQBNBPJY-UHFFFAOYSA-N 2-(4-methoxyphenyl)cyclohexan-1-one Chemical compound C1=CC(OC)=CC=C1C1C(=O)CCCC1 BEBTXYAQBNBPJY-UHFFFAOYSA-N 0.000 description 2
- AOGYKGCEFYNAKD-UHFFFAOYSA-N 2-[1-hydroxy-2-(4-methoxyphenyl)cyclohexyl]propanoic acid Chemical compound C1=CC(OC)=CC=C1C1C(C(C)C(O)=O)(O)CCCC1 AOGYKGCEFYNAKD-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical class [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- YVFQYDGBKNOGIX-UHFFFAOYSA-N [2-(3,4-dimethoxyphenyl)-1-[1-(dimethylamino)propan-2-yl]cyclohexyl] 4-methylbenzenesulfonate Chemical compound C1=C(OC)C(OC)=CC=C1C1C(C(C)CN(C)C)(OS(=O)(=O)C=2C=CC(C)=CC=2)CCCC1 YVFQYDGBKNOGIX-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001414 amino alcohols Chemical class 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 229960004194 lidocaine Drugs 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- IOXXVNYDGIXMIP-UHFFFAOYSA-N n-methylprop-2-en-1-amine Chemical compound CNCC=C IOXXVNYDGIXMIP-UHFFFAOYSA-N 0.000 description 2
- DYUWTXWIYMHBQS-UHFFFAOYSA-N n-prop-2-enylprop-2-en-1-amine Chemical compound C=CCNCC=C DYUWTXWIYMHBQS-UHFFFAOYSA-N 0.000 description 2
- TVQPXLMQOZWEBA-UHFFFAOYSA-N nexeridine Chemical compound CN(C)CC(C)C1(OC(C)=O)CCCCC1C1=CC=CC=C1 TVQPXLMQOZWEBA-UHFFFAOYSA-N 0.000 description 2
- YZTJYBJCZXZGCT-UHFFFAOYSA-N phenylpiperazine Chemical compound C1CNCCN1C1=CC=CC=C1 YZTJYBJCZXZGCT-UHFFFAOYSA-N 0.000 description 2
- 235000015497 potassium bicarbonate Nutrition 0.000 description 2
- 239000011736 potassium bicarbonate Substances 0.000 description 2
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- 210000003497 sciatic nerve Anatomy 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- YOEGFCDKQWCDIA-UHFFFAOYSA-N 1-(1-aminopropan-2-yl)-2-phenylcyclohexan-1-ol Chemical compound NCC(C)C1(O)CCCCC1C1=CC=CC=C1 YOEGFCDKQWCDIA-UHFFFAOYSA-N 0.000 description 1
- LHMQLQFVFCGKMX-UHFFFAOYSA-N 1-(2-hydroxyethyl)-2-phenylcyclohexan-1-ol Chemical compound OCCC1(O)CCCCC1C1=CC=CC=C1 LHMQLQFVFCGKMX-UHFFFAOYSA-N 0.000 description 1
- YBEZEXWSGXVVIJ-UHFFFAOYSA-N 1-[1-(dimethylamino)propan-2-yl]-2-(4-methoxyphenyl)cyclohexan-1-ol;hydrochloride Chemical compound Cl.C1=CC(OC)=CC=C1C1C(C(C)CN(C)C)(O)CCCC1 YBEZEXWSGXVVIJ-UHFFFAOYSA-N 0.000 description 1
- JOGBTQMODAFDGX-UHFFFAOYSA-N 1-[1-(dimethylamino)propan-2-yl]-2-(4-phenylmethoxyphenyl)cyclohexan-1-ol;hydrochloride Chemical compound Cl.CN(C)CC(C)C1(O)CCCCC1C(C=C1)=CC=C1OCC1=CC=CC=C1 JOGBTQMODAFDGX-UHFFFAOYSA-N 0.000 description 1
- PVBLJPCMWKGTOH-UHFFFAOYSA-N 1-aminocyclohexan-1-ol Chemical class NC1(O)CCCCC1 PVBLJPCMWKGTOH-UHFFFAOYSA-N 0.000 description 1
- IYUDSTOJSKIUKS-UHFFFAOYSA-N 2-(1-hydroxy-2-phenylcyclohexyl)acetic acid Chemical compound OC(=O)CC1(O)CCCCC1C1=CC=CC=C1 IYUDSTOJSKIUKS-UHFFFAOYSA-N 0.000 description 1
- YXFJLLWNZRJNDC-UHFFFAOYSA-M 2-(1-hydroxy-2-phenylcyclohexyl)propyl-trimethylazanium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.C[N+](C)(C)CC(C)C1(O)CCCCC1C1=CC=CC=C1 YXFJLLWNZRJNDC-UHFFFAOYSA-M 0.000 description 1
- CXRSCELPBXNLGV-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-1-(1-hydroxypropan-2-yl)cyclohexan-1-ol Chemical compound C1=C(OC)C(OC)=CC=C1C1C(C(C)CO)(O)CCCC1 CXRSCELPBXNLGV-UHFFFAOYSA-N 0.000 description 1
- VGIRWKXCAKWIFE-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-1-[1-(dimethylamino)propan-2-yl]cyclohexan-1-ol Chemical compound C1=C(OC)C(OC)=CC=C1C1C(C(C)CN(C)C)(O)CCCC1 VGIRWKXCAKWIFE-UHFFFAOYSA-N 0.000 description 1
- NTCZPFPZYWFKBW-UHFFFAOYSA-N 2-[2-(3,4-dimethoxyphenyl)-1-hydroxycyclohexyl]propanoic acid Chemical compound C1=C(OC)C(OC)=CC=C1C1C(C(C)C(O)=O)(O)CCCC1 NTCZPFPZYWFKBW-UHFFFAOYSA-N 0.000 description 1
- PYNYHMRMZOGVML-UHFFFAOYSA-N 2-bromopropanenitrile Chemical compound CC(Br)C#N PYNYHMRMZOGVML-UHFFFAOYSA-N 0.000 description 1
- XGRINRRETIMNAT-UHFFFAOYSA-N 2-phenyl-1-(1-pyrrolidin-1-ylpropan-2-yl)cyclohexan-1-ol Chemical compound C1CCCC(C=2C=CC=CC=2)C1(O)C(C)CN1CCCC1 XGRINRRETIMNAT-UHFFFAOYSA-N 0.000 description 1
- CWZVAMSYBCLBAV-UHFFFAOYSA-N 2-phenyl-1-[1-(4-phenylpiperazin-1-yl)propan-2-yl]cyclohexan-1-ol Chemical compound C1CCCC(C=2C=CC=CC=2)C1(O)C(C)CN(CC1)CCN1C1=CC=CC=C1 CWZVAMSYBCLBAV-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 1
- NCOCXMDVFQONOG-UHFFFAOYSA-N 4-[2-[1-(dimethylamino)propan-2-yl]-2-hydroxycyclohexyl]phenol Chemical compound CN(C)CC(C)C1(O)CCCCC1C1=CC=C(O)C=C1 NCOCXMDVFQONOG-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- RZKYEQDPDZUERB-UHFFFAOYSA-N Pindone Chemical group C1=CC=C2C(=O)C(C(=O)C(C)(C)C)C(=O)C2=C1 RZKYEQDPDZUERB-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 241000906446 Theraps Species 0.000 description 1
- JVVXZOOGOGPDRZ-SLFFLAALSA-N [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine Chemical compound NC[C@]1(C)CCC[C@]2(C)C3=CC=C(C(C)C)C=C3CC[C@H]21 JVVXZOOGOGPDRZ-SLFFLAALSA-N 0.000 description 1
- WNCSOEYPGVCWNU-UHFFFAOYSA-N [1-[1-(dimethylamino)propan-2-yl]-2-(4-phenylmethoxyphenyl)cyclohexyl] acetate Chemical compound CN(C)CC(C)C1(OC(C)=O)CCCCC1C(C=C1)=CC=C1OCC1=CC=CC=C1 WNCSOEYPGVCWNU-UHFFFAOYSA-N 0.000 description 1
- UTKBLLDLHPDWDU-ODZAUARKSA-N acetic acid;(z)-but-2-enedioic acid Chemical compound CC(O)=O.OC(=O)\C=C/C(O)=O UTKBLLDLHPDWDU-ODZAUARKSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000002830 appetite depressant Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000003542 behavioural effect Effects 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 230000031018 biological processes and functions Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229940125846 compound 25 Drugs 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- DUSOPGSWRABVOE-UHFFFAOYSA-N cyclohexyl acetate;hydrochloride Chemical compound Cl.CC(=O)OC1CCCCC1 DUSOPGSWRABVOE-UHFFFAOYSA-N 0.000 description 1
- JWOSTXBESVWMJW-UHFFFAOYSA-N cyclohexyl sulfamate Chemical class NS(=O)(=O)OC1CCCCC1 JWOSTXBESVWMJW-UHFFFAOYSA-N 0.000 description 1
- HDRXZJPWHTXQRI-BHDTVMLSSA-N diltiazem hydrochloride Chemical compound [Cl-].C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CC[NH+](C)C)C2=CC=CC=C2S1 HDRXZJPWHTXQRI-BHDTVMLSSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 206010013663 drug dependence Diseases 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 230000033001 locomotion Effects 0.000 description 1
- 230000006742 locomotor activity Effects 0.000 description 1
- 230000005226 mechanical processes and functions Effects 0.000 description 1
- LWJROJCJINYWOX-UHFFFAOYSA-L mercury dichloride Chemical compound Cl[Hg]Cl LWJROJCJINYWOX-UHFFFAOYSA-L 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 230000004899 motility Effects 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000004351 phenylcyclohexyl group Chemical group C1(=CC=CC=C1)C1(CCCCC1)* 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 208000011117 substance-related disease Diseases 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229940072358 xylocaine Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/096—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US44780474A | 1974-03-04 | 1974-03-04 | |
| US05/545,074 US3974157A (en) | 1974-03-04 | 1975-01-29 | 1-(Amino-alkyl)-2-aryl-cyclohexane alcohols and esters |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH621329A5 true CH621329A5 (enExample) | 1981-01-30 |
Family
ID=27035098
Family Applications (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH270775A CH621329A5 (enExample) | 1974-03-04 | 1975-03-04 | |
| CH1260278A CH615413A5 (en) | 1974-03-04 | 1978-12-11 | Process for the preparation of novel 1-aminoalkyl-2-arylcyclohexanol compounds |
| CH1260378A CH617921A5 (en) | 1974-03-04 | 1978-12-11 | Process for the preparation of novel 1-aminoalkyl-2-aryl- cyclohexanol compounds |
| CH657979A CH619207A5 (en) | 1974-03-04 | 1979-07-13 | Process for the preparation of novel 1-aminoalkyl-2-arylcyclohexanol compounds |
Family Applications After (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1260278A CH615413A5 (en) | 1974-03-04 | 1978-12-11 | Process for the preparation of novel 1-aminoalkyl-2-arylcyclohexanol compounds |
| CH1260378A CH617921A5 (en) | 1974-03-04 | 1978-12-11 | Process for the preparation of novel 1-aminoalkyl-2-aryl- cyclohexanol compounds |
| CH657979A CH619207A5 (en) | 1974-03-04 | 1979-07-13 | Process for the preparation of novel 1-aminoalkyl-2-arylcyclohexanol compounds |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3974157A (enExample) |
| JP (1) | JPS50157342A (enExample) |
| BE (1) | BE826260A (enExample) |
| CH (4) | CH621329A5 (enExample) |
| DK (2) | DK143698C (enExample) |
| FI (1) | FI60205C (enExample) |
| FR (1) | FR2262974B1 (enExample) |
| GB (1) | GB1474004A (enExample) |
| IE (1) | IE40733B1 (enExample) |
| LU (1) | LU71964A1 (enExample) |
| NL (1) | NL7502450A (enExample) |
| NO (1) | NO140100C (enExample) |
| SE (2) | SE7502407L (enExample) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4115589A (en) * | 1977-05-17 | 1978-09-19 | The Upjohn Company | Compounds, compositions and method of use |
| US4306097A (en) * | 1977-09-13 | 1981-12-15 | Pfizer Inc. | 3-[2-Hydroxy-4-(substituted)phenyl]-cycloalkanol analgesic agents |
| US4366172A (en) * | 1977-09-29 | 1982-12-28 | The Upjohn Company | 4-Amino-cyclohexanols, their pharmaceutical compositions and methods of use |
| FR2472559A1 (fr) * | 1979-12-31 | 1981-07-03 | Cerm Cent Europ Rech Mauvernay | Derives du 1-aminomethyl 2-phenoxy cyclohexanol, procede d'obtention, application en therapeutique et compositions les contenant |
| US4391827A (en) * | 1980-09-08 | 1983-07-05 | Pfizer Inc. | 3-(2-Hydroxy-4-(substituted)phenyl)-cycloalkanone and cycloalkanol analgesic agents and intermediates therefor |
| US4921994A (en) * | 1980-09-19 | 1990-05-01 | Pfizer Inc. | Pharmacologically active 2-hydroxy-4-(substituted) phenyl cycloalkanes and derivatives thereof |
| US4371720A (en) * | 1980-09-19 | 1983-02-01 | Pfizer Inc. | 2-Hydroxy-4-(substituted) phenyl cycloalkanes and derivatives |
| US4486609A (en) * | 1981-03-16 | 1984-12-04 | Pfizer Inc. | Pharmacologically active 4-[2-hydroxy-4-(substituted)phenyl]naphthalen-2(1H)-ones and 2-ols, derivatives thereof and intermediates therefor |
| US4831059A (en) * | 1980-09-19 | 1989-05-16 | Pfizer Inc. | Producing analgesia with pharmacologically active 2-hydroxy-4-(substituted) phenyl cycloalkanes derivatives |
| US4835192A (en) * | 1980-09-19 | 1989-05-30 | Pfizer Inc. | Pharmacologically active 4-[2-hydroxy-4-(substituted)phenyl]naphthalen-2(1H)-ones and 2-ols, derivatives thereof and intermediates therefor |
| US4933475A (en) * | 1980-09-19 | 1990-06-12 | Pfizer, Inc. | Pharmacologically active 4-[2-hydroxy-4-(substituted)phenyl]naphthalen-2(1H)-ones and 2-ols, derivatives thereof and intermediates therefor |
| US4593131A (en) * | 1980-09-19 | 1986-06-03 | Pfizer Inc. | Pharmacologically active 4-[2-hydroxy-4-(substituted)phenyl]naphthalen-2(1H)-ones and 2-ols, derivatives thereof and intermediates therefor |
| US4285867A (en) * | 1980-09-19 | 1981-08-25 | Pfizer Inc. | Pharmacologically active 4-[2-hydroxy-4-(substituted)phenyl]naphthalen-2(1H)-ones and 2-ols, derivatives thereof and intermediates therefor |
| US4739079A (en) * | 1980-09-19 | 1988-04-19 | Pfizer Inc. | Pharmacologically active 4-[2-hydroxy-4-(substituted)phenyl]naphthalen-2(1H)-ones and 2-ols, derivatives thereof and intermediates therefor |
| US4331602A (en) * | 1980-09-19 | 1982-05-25 | Pfizer Inc. | Pharmacologically active 4-[2-hydroxy-4-(substituted]phenyl)naphthalen-2(1H)-ones and 2-ols, derivatives thereof and intermediates therefor |
| JPS57122041A (en) * | 1981-01-21 | 1982-07-29 | Suntory Ltd | Phenylclohexane derivative |
| US4847414A (en) * | 1981-10-19 | 1989-07-11 | Hoechst-Roussel Pharmaceuticals, Inc. | 2'-substituted-spiro[benzofuran-2(3H),1'-cyclohexanes] and intermediates thereof |
| US4535186A (en) * | 1983-04-19 | 1985-08-13 | American Home Products Corporation | 2-Phenyl-2-(1-hydroxycycloalkyl or 1-hydroxycycloalk-2-enyl)ethylamine derivatives |
| EP0134889B1 (en) * | 1983-08-19 | 1987-11-11 | Pennwalt Corporation | Cyclohexane carboxylic acids and derivatives thereof as antidysrhythmic agents |
| GB8405112D0 (en) * | 1984-02-28 | 1984-04-04 | Akzo Nv | Anti-arrhythmic amino-alcohols |
| US4760146A (en) * | 1986-02-18 | 1988-07-26 | Pennwalt Corporation | Cyclohexene carboxylic esters and amides as antidysrhythmic agents |
| US5248830A (en) * | 1989-08-24 | 1993-09-28 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Enantioselective preparation of acetylenic or olefinic substituted cycloalkenyl dihydroxybutyrates and 4-hydroxy-tetrahydro-pyran-2-ones |
| WO1992014692A1 (en) * | 1991-02-11 | 1992-09-03 | Rhone-Poulenc Rorer International (Holdings) Inc. | Enantioselective preparation of acetylenic or olefinic substituted cycloalkenyl dihydroxybutyrates and 4-hydroxy-tetrahydropyran-2-ones |
| NZ260408A (en) | 1993-05-10 | 1996-05-28 | Euro Celtique Sa | Controlled release preparation comprising tramadol |
| US5891471A (en) * | 1993-11-23 | 1999-04-06 | Euro-Celtique, S.A. | Pharmaceutical multiparticulates |
| KR100354702B1 (ko) * | 1993-11-23 | 2002-12-28 | 유로-셀티크 소시에떼 아노뉨 | 약학조성물의제조방법및서방형조성물 |
| US5843480A (en) * | 1994-03-14 | 1998-12-01 | Euro-Celtique, S.A. | Controlled release diamorphine formulation |
| GB9422154D0 (en) * | 1994-11-03 | 1994-12-21 | Euro Celtique Sa | Pharmaceutical compositions and method of producing the same |
| US5965161A (en) | 1994-11-04 | 1999-10-12 | Euro-Celtique, S.A. | Extruded multi-particulates |
| DE19918325A1 (de) | 1999-04-22 | 2000-10-26 | Euro Celtique Sa | Verfahren zur Herstellung von Arzneiformen mit regulierter Wirkstofffreisetzung mittels Extrusion |
| DE10000311A1 (de) * | 2000-01-05 | 2001-07-12 | Gruenenthal Gmbh | Aminomethyl-Phonyl-Cyclohexanonderivate |
| DE10048714A1 (de) * | 2000-09-30 | 2002-04-11 | Gruenenthal Gmbh | 5-Amino-1-penlen-3-ol-Derivate |
| CA2688493C (en) | 2007-05-31 | 2016-04-19 | Sepracor Inc. | Phenyl substituted cycloalkylamines as monoamine reuptake inhibitors |
| US10968209B2 (en) | 2016-05-19 | 2021-04-06 | Glaxosmithkline Intellectual Property (No.2) Limited | TRPV4 antagonist |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2586512A (en) * | 1948-09-15 | 1952-02-19 | Searle & Co | Cyclohexyl-amino-alcohols |
| US2680115A (en) * | 1949-01-28 | 1954-06-01 | Maurice L Tainter | Substituted tertiary-aminoalkyl carbinols |
| US2656386A (en) * | 1951-02-24 | 1953-10-20 | Upjohn Co | Aminoethylhydrocarbonoxycyclohexenes |
| US3652589A (en) * | 1967-07-27 | 1972-03-28 | Gruenenthal Chemie | 1-(m-substituted phenyl)-2-aminomethyl cyclohexanols |
-
1975
- 1975-01-29 US US05/545,074 patent/US3974157A/en not_active Expired - Lifetime
- 1975-02-28 FI FI750601A patent/FI60205C/fi not_active IP Right Cessation
- 1975-02-28 NL NL7502450A patent/NL7502450A/xx not_active Application Discontinuation
- 1975-03-03 DK DK83575A patent/DK143698C/da not_active IP Right Cessation
- 1975-03-03 NO NO750706A patent/NO140100C/no unknown
- 1975-03-04 IE IE459/75A patent/IE40733B1/xx unknown
- 1975-03-04 CH CH270775A patent/CH621329A5/de not_active IP Right Cessation
- 1975-03-04 BE BE153975A patent/BE826260A/xx not_active IP Right Cessation
- 1975-03-04 GB GB891575A patent/GB1474004A/en not_active Expired
- 1975-03-04 JP JP50025688A patent/JPS50157342A/ja active Pending
- 1975-03-04 SE SE7502407A patent/SE7502407L/xx not_active Application Discontinuation
- 1975-03-04 FR FR7506772A patent/FR2262974B1/fr not_active Expired
- 1975-03-04 LU LU71964A patent/LU71964A1/xx unknown
-
1978
- 1978-12-11 CH CH1260278A patent/CH615413A5/de not_active IP Right Cessation
- 1978-12-11 CH CH1260378A patent/CH617921A5/de not_active IP Right Cessation
-
1979
- 1979-07-13 CH CH657979A patent/CH619207A5/de not_active IP Right Cessation
- 1979-08-03 DK DK328479A patent/DK328479A/da not_active Application Discontinuation
-
1982
- 1982-05-14 SE SE8203051A patent/SE8203051L/sv not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| DK328479A (da) | 1979-08-03 |
| DK143698C (da) | 1982-03-08 |
| CH619207A5 (en) | 1980-09-15 |
| IE40733L (en) | 1975-09-04 |
| CH617921A5 (en) | 1980-06-30 |
| US3974157A (en) | 1976-08-10 |
| SE8203051L (sv) | 1982-05-14 |
| FI60205B (fi) | 1981-08-31 |
| IE40733B1 (en) | 1979-08-01 |
| DK143698B (da) | 1981-09-28 |
| FI750601A7 (enExample) | 1975-09-05 |
| NO750706L (enExample) | 1975-09-05 |
| GB1474004A (en) | 1977-05-18 |
| BE826260A (nl) | 1975-06-30 |
| LU71964A1 (enExample) | 1975-08-20 |
| NL7502450A (nl) | 1975-09-08 |
| FR2262974A1 (enExample) | 1975-10-03 |
| DK83575A (enExample) | 1975-09-05 |
| NO140100B (no) | 1979-03-26 |
| CH615413A5 (en) | 1980-01-31 |
| FR2262974B1 (enExample) | 1980-01-25 |
| SE7502407L (enExample) | 1975-09-05 |
| FI60205C (fi) | 1981-12-10 |
| NO140100C (no) | 1979-07-04 |
| JPS50157342A (enExample) | 1975-12-19 |
| AU7877375A (en) | 1976-09-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH621329A5 (enExample) | ||
| DE2500110A1 (de) | 3-aryloxy-3-phenylpropylamine und verfahren zu ihrer herstellung | |
| DE2334404C2 (de) | Alkylthiophenyl-2-n-octylaminoalkohole und deren Salze, Verfahren zu deren Herstellung und pharmazeutische Zubereitung | |
| DE2020864B2 (de) | p-Substituierte 1-Phenoxy-3-alkylaminopropan-2-ole, Herstellungsverfahren und Arzneimittel | |
| DE2807623A1 (de) | Pyrrolidinderivate, verfahren zu ihrer herstellung und sie enthaltende arzneimittel | |
| EP0110869B1 (de) | Thienylessigsäureamidderivate und pharmazeutisch verträgliche Säureadditionssalze hiervon sowie Verfahren zu deren Herstellung | |
| DE2416016A1 (de) | Neue 1- eckige klammer auf beta-(aminocarbonylphenoxy)-aethylamino eckige klammer zu -3- (thiazol-2-oxy)-2-propanole und ihre derivate | |
| DE1643198C3 (enExample) | ||
| DE2656088A1 (de) | Neues benzylalkoholderivat und verfahren zu seiner herstellung | |
| DE2314639A1 (de) | Pharmakodynamisch aktive aminoalkyloximaether | |
| DE2461069A1 (de) | Neue cholesterinsenkende verbindungen | |
| DE1695962A1 (de) | (2-Aminocycloalkyl)hydrochinone und Derivate derselben sowie Verfahren zu ihrer Herstellung | |
| CH636076A5 (de) | Benzylalkoholderivate und verfahren zu deren herstellung. | |
| DE2404328A1 (de) | Verfahren zur herstellung von alpha(l-aralkylaminoalkyl)-aralkoxybenzylalkoholen | |
| AT256816B (de) | Verfahren zur Herstellung von neuen substituierten 1-Phenyl-2-aminoalkanolen und deren Säureadditionssalzen | |
| DE2509053A1 (de) | 1-aminoalkyl-2-aryl-cyclohexanol- verbindungen | |
| DE2560602C2 (de) | Sauerstoffhaltige Diarylamidine | |
| DE2539941C2 (de) | Basische Benzyloxyalkyl-Derivate, deren Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2311067C2 (de) | Diphenylmethoxyäthylamine, Verfahren zu deren Herstellung und Verwendung von Diphenylmethoxyäthylaminen bei der Bekämpfung der Parkinson-Krankheit | |
| CH356121A (de) | Verfahren zur Herstellung von N-monosubstituierten Amiden vona-Aminoalkyl-a-phenyl-essigsäuren | |
| DE2313625C2 (de) | &alpha;-(Aminoalkyl)-4-hydroxy-3-(methylsulfonylmethyl)-benzylalkohole, ihre Salze, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1695944A1 (de) | Verfahren zur Herstellung neuer 1,3-Aminoalkohole | |
| DE2504689A1 (de) | Indanderivate | |
| DD149664A5 (de) | Verfahren zur herstellung von 1,1'-biphenyl-2-yl-alkylamin-derivaten | |
| DE2554863C2 (de) | Thiazolinylidenaminophenylpropionsäure-Derivate, ihre Salze, Verfahren zu ihrer Herstellung und ihre Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |