CH501648A - Verfahren zur Herstellung von v-Triazolyl-(2)-stilbenverbindungen - Google Patents
Verfahren zur Herstellung von v-Triazolyl-(2)-stilbenverbindungenInfo
- Publication number
- CH501648A CH501648A CH1054768A CH1054768A CH501648A CH 501648 A CH501648 A CH 501648A CH 1054768 A CH1054768 A CH 1054768A CH 1054768 A CH1054768 A CH 1054768A CH 501648 A CH501648 A CH 501648A
- Authority
- CH
- Switzerland
- Prior art keywords
- group
- triazolyl
- formula
- stilbene compounds
- compounds
- Prior art date
Links
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical compound C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 title claims description 11
- PJANXHGTPQOBST-VAWYXSNFSA-N Stilbene Natural products C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 title 1
- 235000021286 stilbenes Nutrition 0.000 title 1
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 11
- 150000002367 halogens Chemical class 0.000 claims abstract description 11
- 125000004442 acylamino group Chemical group 0.000 claims abstract description 10
- 125000003226 pyrazolyl group Chemical group 0.000 claims abstract description 8
- 150000002081 enamines Chemical class 0.000 claims abstract description 6
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims abstract description 3
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims abstract description 3
- 150000001875 compounds Chemical class 0.000 claims description 16
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 150000002431 hydrogen Chemical class 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- 125000003277 amino group Chemical group 0.000 claims description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 150000001879 copper Chemical class 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 3
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 3
- 230000010933 acylation Effects 0.000 claims description 2
- 238000005917 acylation reaction Methods 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 claims description 2
- 125000003107 substituted aryl group Chemical group 0.000 claims description 2
- 230000001419 dependent effect Effects 0.000 claims 2
- 150000002148 esters Chemical class 0.000 abstract description 3
- 229920000742 Cotton Polymers 0.000 abstract description 2
- 150000001447 alkali salts Chemical class 0.000 abstract description 2
- 229920003023 plastic Polymers 0.000 abstract description 2
- 239000004033 plastic Substances 0.000 abstract description 2
- 210000002268 wool Anatomy 0.000 abstract description 2
- 125000003368 amide group Chemical group 0.000 abstract 1
- 150000001408 amides Chemical class 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 150000004699 copper complex Chemical class 0.000 abstract 1
- 229920000642 polymer Polymers 0.000 abstract 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 150000008049 diazo compounds Chemical class 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- -1 naphthyl radicals Chemical class 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- 239000003795 chemical substances by application Substances 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- WXLLOFPIDAKJGK-UHFFFAOYSA-N [2-(2-phenylethenyl)phenyl]hydrazine Chemical class NNC1=CC=CC=C1C=CC1=CC=CC=C1 WXLLOFPIDAKJGK-UHFFFAOYSA-N 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 4
- 230000008878 coupling Effects 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- BBVIDBNAYOIXOE-UHFFFAOYSA-N 1,2,4-oxadiazole Chemical class C=1N=CON=1 BBVIDBNAYOIXOE-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- 150000005840 aryl radicals Chemical class 0.000 description 3
- 125000002843 carboxylic acid group Chemical group 0.000 description 3
- NRPMBSHHBFFYBF-VMPITWQZSA-N ethyl (e)-3-(4-aminophenyl)prop-2-enoate Chemical compound CCOC(=O)\C=C\C1=CC=C(N)C=C1 NRPMBSHHBFFYBF-VMPITWQZSA-N 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- BIEFDNUEROKZRA-UHFFFAOYSA-N 2-(2-phenylethenyl)aniline Chemical class NC1=CC=CC=C1C=CC1=CC=CC=C1 BIEFDNUEROKZRA-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 238000005282 brightening Methods 0.000 description 2
- 125000005392 carboxamide group Chemical group NC(=O)* 0.000 description 2
- 150000001733 carboxylic acid esters Chemical class 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- JMANVNJQNLATNU-UHFFFAOYSA-N oxalonitrile Chemical compound N#CC#N JMANVNJQNLATNU-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- MLNKXLRYCLKJSS-RMKNXTFCSA-N (2e)-2-hydroxyimino-1-phenylethanone Chemical compound O\N=C\C(=O)C1=CC=CC=C1 MLNKXLRYCLKJSS-RMKNXTFCSA-N 0.000 description 1
- JOLPMPPNHIACPD-ZZXKWVIFSA-N (e)-3-(4-aminophenyl)prop-2-enoic acid Chemical compound NC1=CC=C(\C=C\C(O)=O)C=C1 JOLPMPPNHIACPD-ZZXKWVIFSA-N 0.000 description 1
- UPUZSBSTYMFQCK-RMKNXTFCSA-N (ne)-n-[1-(2-nitrophenyl)ethylidene]hydroxylamine Chemical compound O\N=C(/C)C1=CC=CC=C1[N+]([O-])=O UPUZSBSTYMFQCK-RMKNXTFCSA-N 0.000 description 1
- TXVWTOBHDDIASC-UHFFFAOYSA-N 1,2-diphenylethene-1,2-diamine Chemical class C=1C=CC=CC=1C(N)=C(N)C1=CC=CC=C1 TXVWTOBHDDIASC-UHFFFAOYSA-N 0.000 description 1
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 1
- YTZPUTADNGREHA-UHFFFAOYSA-N 2h-benzo[e]benzotriazole Chemical group C1=CC2=CC=CC=C2C2=NNN=C21 YTZPUTADNGREHA-UHFFFAOYSA-N 0.000 description 1
- IMHBKHIZPZRECU-UHFFFAOYSA-N 3-methoxy-1-phenylprop-2-en-1-one Chemical compound COC=CC(=O)C1=CC=CC=C1 IMHBKHIZPZRECU-UHFFFAOYSA-N 0.000 description 1
- YXFWFUSVDJIVIV-UHFFFAOYSA-N 4-nitro-2h-triazole Chemical compound [O-][N+](=O)C=1C=NNN=1 YXFWFUSVDJIVIV-UHFFFAOYSA-N 0.000 description 1
- XDVZFVQLRRGUKX-UHFFFAOYSA-N 5,5-diamino-2-[2-(2-sulfophenyl)ethenyl]cyclohexa-1,3-diene-1-sulfonic acid Chemical compound C1=CC(N)(N)CC(S(O)(=O)=O)=C1C=CC1=CC=CC=C1S(O)(=O)=O XDVZFVQLRRGUKX-UHFFFAOYSA-N 0.000 description 1
- QBHYFEWQILVXEN-UHFFFAOYSA-N 5-amino-2-(2-phenylethenyl)benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1C=CC1=CC=CC=C1 QBHYFEWQILVXEN-UHFFFAOYSA-N 0.000 description 1
- GHBWBMDGBCKAQU-OWOJBTEDSA-N 5-amino-2-[(e)-2-(4-nitro-2-sulfophenyl)ethenyl]benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1\C=C\C1=CC=C([N+]([O-])=O)C=C1S(O)(=O)=O GHBWBMDGBCKAQU-OWOJBTEDSA-N 0.000 description 1
- LQEJEARNIFDTMO-UHFFFAOYSA-N 5-amino-2-[2-(4-chlorophenyl)ethenyl]benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1C=CC1=CC=C(Cl)C=C1 LQEJEARNIFDTMO-UHFFFAOYSA-N 0.000 description 1
- REJHVSOVQBJEBF-OWOJBTEDSA-N 5-azaniumyl-2-[(e)-2-(4-azaniumyl-2-sulfonatophenyl)ethenyl]benzenesulfonate Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1\C=C\C1=CC=C(N)C=C1S(O)(=O)=O REJHVSOVQBJEBF-OWOJBTEDSA-N 0.000 description 1
- DFUKNZYWDNICNG-UHFFFAOYSA-N 5-methyl-3-(3-methylphenyl)-1,2,4-oxadiazole Chemical compound O1C(C)=NC(C=2C=C(C)C=CC=2)=N1 DFUKNZYWDNICNG-UHFFFAOYSA-N 0.000 description 1
- OEDUIFSDODUDRK-UHFFFAOYSA-N 5-phenyl-1h-pyrazole Chemical class N1N=CC=C1C1=CC=CC=C1 OEDUIFSDODUDRK-UHFFFAOYSA-N 0.000 description 1
- BNDRECGBDISUAI-UHFFFAOYSA-N 6-(2-phenylethenyl)cyclohexa-2,4-diene-1,1-disulfonic acid Chemical compound OS(=O)(=O)C1(S(O)(=O)=O)C=CC=CC1C=CC1=CC=CC=C1 BNDRECGBDISUAI-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- REJHVSOVQBJEBF-UHFFFAOYSA-N DSD-acid Natural products OS(=O)(=O)C1=CC(N)=CC=C1C=CC1=CC=C(N)C=C1S(O)(=O)=O REJHVSOVQBJEBF-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 229920001756 Polyvinyl chloride acetate Polymers 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 230000000397 acetylating effect Effects 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 125000005362 aryl sulfone group Chemical group 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- BJFLSHMHTPAZHO-UHFFFAOYSA-N benzotriazole Chemical compound [CH]1C=CC=C2N=NN=C21 BJFLSHMHTPAZHO-UHFFFAOYSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000003262 carboxylic acid ester group Chemical group [H]C([H])([*:2])OC(=O)C([H])([H])[*:1] 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000009232 chiropractic Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 229910000366 copper(II) sulfate Inorganic materials 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- UEUURYZTMLPUEE-VOTSOKGWSA-N ethyl (e)-3-(3-aminophenyl)prop-2-enoate Chemical compound CCOC(=O)\C=C\C1=CC=CC(N)=C1 UEUURYZTMLPUEE-VOTSOKGWSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- VCSGRXIKJCLEAN-UHFFFAOYSA-N methyl 3-(3-aminophenyl)prop-2-enoate Chemical group COC(=O)C=CC1=CC=CC(N)=C1 VCSGRXIKJCLEAN-UHFFFAOYSA-N 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- GYHABVOHCVLHTG-UHFFFAOYSA-N phenyl-(5-phenyl-1,2,4-oxadiazol-3-yl)methanone Chemical compound C=1C=CC=CC=1C(=O)C(N=1)=NOC=1C1=CC=CC=C1 GYHABVOHCVLHTG-UHFFFAOYSA-N 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003217 pyrazoles Chemical class 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/04—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles
- C07D249/06—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles with aryl radicals directly attached to ring atoms
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06L—DRY-CLEANING, WASHING OR BLEACHING FIBRES, FILAMENTS, THREADS, YARNS, FABRICS, FEATHERS OR MADE-UP FIBROUS GOODS; BLEACHING LEATHER OR FURS
- D06L4/00—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs
- D06L4/60—Optical bleaching or brightening
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Coloring (AREA)
- Detergent Compositions (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF48193A DE1287550B (de) | 1966-01-18 | 1966-01-18 | Aufhellungsmittel |
| DEF0048452 | 1966-02-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH501648A true CH501648A (de) | 1971-01-15 |
Family
ID=25977082
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1054768A CH501648A (de) | 1966-01-18 | 1967-01-17 | Verfahren zur Herstellung von v-Triazolyl-(2)-stilbenverbindungen |
| CH762768A CH458275A (de) | 1966-01-18 | 1967-01-17 | Verwendung von v-Triazolyl-(2)-stilbenverbindungen als optische Aufhellungsmittel mit Ausnahme der Behandlung von Textilfasern in der Textilindustrie |
| CH63867A CH466846A (de) | 1966-01-18 | 1967-01-17 | Verwendung von v-Triazolyl-(2)-stilbenverbindungen zum optischen Aufhellen von Textilmaterialien |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH762768A CH458275A (de) | 1966-01-18 | 1967-01-17 | Verwendung von v-Triazolyl-(2)-stilbenverbindungen als optische Aufhellungsmittel mit Ausnahme der Behandlung von Textilfasern in der Textilindustrie |
| CH63867A CH466846A (de) | 1966-01-18 | 1967-01-17 | Verwendung von v-Triazolyl-(2)-stilbenverbindungen zum optischen Aufhellen von Textilmaterialien |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3453268A (en:Method) |
| AT (1) | AT270568B (en:Method) |
| BE (1) | BE692847A (en:Method) |
| CH (3) | CH501648A (en:Method) |
| DE (2) | DE1287550B (en:Method) |
| ES (1) | ES335773A1 (en:Method) |
| FR (1) | FR1508550A (en:Method) |
| GB (1) | GB1132314A (en:Method) |
| IL (1) | IL27211A (en:Method) |
| NL (1) | NL6700811A (en:Method) |
| SE (1) | SE316743B (en:Method) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3871898A (en) * | 1969-11-14 | 1975-03-18 | Ciba Geigy Ag | Process for the optical brightening of organic fibre material |
| US3817990A (en) * | 1970-06-17 | 1974-06-18 | Gaf Corp | Triazole brighteners |
| US3923677A (en) * | 1971-03-31 | 1975-12-02 | Ciba Geigy Ag | 2-Stilbenyl-4-styryl-v-triazoles, their use for the optical brightening of organic materials, and processes for their manufacture |
| CH554391A (de) * | 1971-03-31 | 1974-09-30 | Ciba Geigy Ag | Verwendung von 2-stilbenyl-4-styryl-v-triazolen zum optischen aufhellen von organischen materialien ausserhalb der textilindustrie. |
| US3940388A (en) * | 1971-05-26 | 1976-02-24 | Sandoz Ltd., (Sandoz Ag) | Triazolylstyryl triazoles |
| CH561707A5 (en:Method) * | 1971-12-17 | 1975-05-15 | Sandoz Ag | |
| DE2248820C3 (de) * | 1972-10-05 | 1978-11-02 | Bayer Ag, 5090 Leverkusen | Dikalium-4,4'-bis-(4-phenyl-2-vtriazolyl)-stilben-2,2'-disulfonat, dessen Herstellung und Verwendung als optischer Aufheller |
| DE2816511A1 (de) * | 1977-04-19 | 1978-10-26 | Ciba Geigy Ag | Neue stilbenverbindungen |
| CN102333914A (zh) | 2009-03-06 | 2012-01-25 | 亨斯迈先进材料(瑞士)有限公司 | 酶催化的纺织物漂白-增白方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1008248B (de) * | 1955-06-15 | 1957-05-16 | Bayer Ag | Aufhellungsmittel |
| NL209687A (en:Method) * | 1955-08-10 |
-
1966
- 1966-01-18 DE DEF48193A patent/DE1287550B/de active Pending
- 1966-02-17 DE DE19661594844 patent/DE1594844A1/de active Pending
- 1966-12-30 SE SE17986/66A patent/SE316743B/xx unknown
-
1967
- 1967-01-04 IL IL27211A patent/IL27211A/en unknown
- 1967-01-05 US US607391A patent/US3453268A/en not_active Expired - Lifetime
- 1967-01-05 AT AT12467A patent/AT270568B/de active
- 1967-01-17 CH CH1054768A patent/CH501648A/de not_active IP Right Cessation
- 1967-01-17 CH CH762768A patent/CH458275A/de unknown
- 1967-01-17 CH CH63867A patent/CH466846A/de unknown
- 1967-01-18 FR FR91520A patent/FR1508550A/fr not_active Expired
- 1967-01-18 NL NL6700811A patent/NL6700811A/xx unknown
- 1967-01-18 ES ES0335773A patent/ES335773A1/es not_active Expired
- 1967-01-18 BE BE692847D patent/BE692847A/xx unknown
- 1967-01-18 GB GB2601/67A patent/GB1132314A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IL27211A (en) | 1971-05-26 |
| BE692847A (en:Method) | 1967-07-03 |
| NL6700811A (en:Method) | 1967-07-19 |
| CH466846A (de) | 1969-02-14 |
| CH458275A (de) | 1968-06-30 |
| FR1508550A (fr) | 1968-01-05 |
| DE1287550B (de) | 1969-01-23 |
| SE316743B (en:Method) | 1969-11-03 |
| GB1132314A (en) | 1968-10-30 |
| CH63867A4 (de) | 1968-09-13 |
| ES335773A1 (es) | 1967-12-01 |
| US3453268A (en) | 1969-07-01 |
| AT270568B (de) | 1969-05-12 |
| DE1594844A1 (de) | 1971-05-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH501648A (de) | Verfahren zur Herstellung von v-Triazolyl-(2)-stilbenverbindungen | |
| EP0014344A1 (de) | Cumarinverbindungen, Verfahren zu ihrer Herstellung und deren Verwendung als Weisstöner und Laserfarbstoffe | |
| DE1670914C3 (de) | Verfahren zur Herstellung von 2-Aryl-v-triazolen | |
| DE1594845C3 (de) | Substituierte v-Triazol-(2)-yl-cumarinverbindungen und deren Verwendung als Aufhellungsmittel | |
| DE1670969A1 (de) | 3-[Pyrazolyl-(1)]-7-[v-triazolyl-(2)]-cumarine | |
| US3459744A (en) | V-triazole-(2)-stilbenes | |
| DE1805371A1 (de) | Optische Bleichmittel,Verfahren zu deren Herstellung sowie deren Anwendung | |
| US4005098A (en) | Triazolyl-coumarins | |
| DE1917740A1 (de) | 4-v-Triazolyl-4'-phenylstilbene | |
| DE1077222B (de) | Verfahren zur Herstellung von Benzimidazolylidenverbindungen | |
| DE1594850A1 (de) | Aufhellungsmittel | |
| DE404647C (de) | Verfahren zur Herstellung von Pyrazolonfarbstoffen | |
| DE2131788C3 (de) | Verfahren zur Herstellung von 7-Pyrazolylcumarinen | |
| CH523896A (de) | Verfahren zur Herstellung von v-Triazolyl-(2)-stilbenen | |
| AT204146B (de) | Verfahren zur Herstellung von kupplungsfähigen Phthalocyaninderivaten | |
| CH232825A (de) | Verfahren zur Herstellung eines Azofarbstoffes. | |
| DE1420011C (de) | Verfahren zur Herstellung von 4,5-Dihalogenpyridazonen-(6) | |
| AT272473B (de) | Verfahren zur Herstellung eines neuen, substantiven, gelben Farbstoffes | |
| DE1543048C3 (de) | Verwendung einer Verbindung als Farbkuppler in farbphotographischem Aufzeichnungsmaterial | |
| CH593967A5 (en) | Optical brighteners for organic materials - consist of quaternised benzofuranyl or naphthofuranyl benzimidazole cpds. | |
| DD274620A1 (de) | Verfahren zur herstellung von reinem 3-cyan-6-methyl-5-(pyrid-4-yl)-1,2-dihydro-pyrid-2-on | |
| DE2133012A1 (de) | Verfahren zur Herstellung von vic.-Triazolen | |
| DE2363138A1 (de) | Pyrazolone-(5), verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE1277857B (de) | Verfahren zur Herstellung von 1, 2-Dialkyl-indazolon-3-hydrazonen | |
| DE1951634A1 (de) | Disazofarbstoffe und Verfahren zu deren Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |