AT397179B - Osmotische vorrichtung für die abgabe eines wirkstoffes - Google Patents
Osmotische vorrichtung für die abgabe eines wirkstoffes Download PDFInfo
- Publication number
- AT397179B AT397179B AT0072784A AT72784A AT397179B AT 397179 B AT397179 B AT 397179B AT 0072784 A AT0072784 A AT 0072784A AT 72784 A AT72784 A AT 72784A AT 397179 B AT397179 B AT 397179B
- Authority
- AT
- Austria
- Prior art keywords
- layer
- active ingredient
- wall
- cellulose
- osmotic
- Prior art date
Links
- 230000003204 osmotic effect Effects 0.000 title claims description 111
- 239000013543 active substance Substances 0.000 title claims description 41
- 239000004480 active ingredient Substances 0.000 claims description 106
- 239000007788 liquid Substances 0.000 claims description 54
- 239000000463 material Substances 0.000 claims description 32
- 229920002678 cellulose Polymers 0.000 claims description 26
- 239000001913 cellulose Substances 0.000 claims description 24
- 239000000126 substance Substances 0.000 claims description 22
- 239000000203 mixture Substances 0.000 claims description 20
- 239000012229 microporous material Substances 0.000 claims description 14
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 claims description 9
- 229930195725 Mannitol Natural products 0.000 claims description 8
- 229920002301 cellulose acetate Polymers 0.000 claims description 8
- 239000000594 mannitol Substances 0.000 claims description 8
- 235000010355 mannitol Nutrition 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 claims description 5
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 claims description 5
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 claims description 5
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 claims description 5
- 239000002195 soluble material Substances 0.000 claims description 4
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 claims description 3
- 229920001747 Cellulose diacetate Polymers 0.000 claims description 3
- 229920002284 Cellulose triacetate Polymers 0.000 claims description 3
- 229920001479 Hydroxyethyl methyl cellulose Polymers 0.000 claims description 3
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 claims description 3
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 claims description 3
- 229920013820 alkyl cellulose Polymers 0.000 claims description 3
- 239000001923 methylcellulose Substances 0.000 claims description 3
- 235000010981 methylcellulose Nutrition 0.000 claims description 3
- 239000001267 polyvinylpyrrolidone Substances 0.000 claims description 3
- 229920000036 polyvinylpyrrolidone Polymers 0.000 claims description 3
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 claims description 3
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 claims description 2
- 239000004354 Hydroxyethyl cellulose Substances 0.000 claims description 2
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 claims description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 2
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 claims description 2
- 239000001863 hydroxypropyl cellulose Substances 0.000 claims description 2
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 claims description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 2
- 238000000807 solvent casting Methods 0.000 claims 1
- 239000010410 layer Substances 0.000 description 135
- 239000011148 porous material Substances 0.000 description 41
- 229920000642 polymer Polymers 0.000 description 25
- 239000003814 drug Substances 0.000 description 20
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 150000001875 compounds Chemical class 0.000 description 17
- 229940079593 drug Drugs 0.000 description 17
- 239000000243 solution Substances 0.000 description 17
- -1 polychlorethylene Polymers 0.000 description 16
- 238000000034 method Methods 0.000 description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 14
- 239000002904 solvent Substances 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 9
- LVDKZNITIUWNER-UHFFFAOYSA-N Bronopol Chemical compound OCC(Br)(CO)[N+]([O-])=O LVDKZNITIUWNER-UHFFFAOYSA-N 0.000 description 8
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 8
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 8
- 229960001855 mannitol Drugs 0.000 description 8
- 239000003139 biocide Substances 0.000 description 7
- 229960003168 bronopol Drugs 0.000 description 7
- 239000008187 granular material Substances 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 239000005715 Fructose Substances 0.000 description 6
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 description 6
- 229930091371 Fructose Natural products 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 6
- 229930006000 Sucrose Natural products 0.000 description 6
- 150000004676 glycans Chemical class 0.000 description 6
- 230000035699 permeability Effects 0.000 description 6
- 229920001282 polysaccharide Polymers 0.000 description 6
- 239000005017 polysaccharide Substances 0.000 description 6
- 239000005720 sucrose Substances 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 230000003115 biocidal effect Effects 0.000 description 5
- 239000008121 dextrose Substances 0.000 description 5
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 5
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 5
- 230000002706 hydrostatic effect Effects 0.000 description 5
- 239000012528 membrane Substances 0.000 description 5
- 229960004011 methenamine Drugs 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- 230000008569 process Effects 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 4
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 229920001577 copolymer Polymers 0.000 description 4
- 238000012377 drug delivery Methods 0.000 description 4
- 239000012729 immediate-release (IR) formulation Substances 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 239000008101 lactose Substances 0.000 description 4
- 229960001375 lactose Drugs 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 229920002635 polyurethane Polymers 0.000 description 4
- 239000004814 polyurethane Substances 0.000 description 4
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 4
- 229910052939 potassium sulfate Inorganic materials 0.000 description 4
- 235000011151 potassium sulphates Nutrition 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 229910001220 stainless steel Inorganic materials 0.000 description 4
- 239000010935 stainless steel Substances 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 108010010803 Gelatin Proteins 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- 239000004793 Polystyrene Substances 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 230000000996 additive effect Effects 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 150000001720 carbohydrates Chemical class 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- SWXVUIWOUIDPGS-UHFFFAOYSA-N diacetone alcohol Chemical compound CC(=O)CC(C)(C)O SWXVUIWOUIDPGS-UHFFFAOYSA-N 0.000 description 3
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 3
- 238000005516 engineering process Methods 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 239000008103 glucose Substances 0.000 description 3
- TWNIBLMWSKIRAT-VFUOTHLCSA-N levoglucosan Chemical group O[C@@H]1[C@@H](O)[C@H](O)[C@H]2CO[C@@H]1O2 TWNIBLMWSKIRAT-VFUOTHLCSA-N 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 210000002700 urine Anatomy 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- AGBXYHCHUYARJY-UHFFFAOYSA-N 2-phenylethenesulfonic acid Chemical compound OS(=O)(=O)C=CC1=CC=CC=C1 AGBXYHCHUYARJY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000008186 active pharmaceutical agent Substances 0.000 description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 2
- DKPFZGUDAPQIHT-UHFFFAOYSA-N butyl acetate Chemical compound CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 2
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 229910000389 calcium phosphate Inorganic materials 0.000 description 2
- 235000011010 calcium phosphates Nutrition 0.000 description 2
- 235000014633 carbohydrates Nutrition 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 229920006217 cellulose acetate butyrate Polymers 0.000 description 2
- 238000000975 co-precipitation Methods 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 238000009792 diffusion process Methods 0.000 description 2
- 238000005553 drilling Methods 0.000 description 2
- 230000003628 erosive effect Effects 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 230000035558 fertility Effects 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000008240 homogeneous mixture Substances 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 235000012907 honey Nutrition 0.000 description 2
- 230000036571 hydration Effects 0.000 description 2
- 238000006703 hydration reaction Methods 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- 238000002386 leaching Methods 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 239000002357 osmotic agent Substances 0.000 description 2
- XNLICIUVMPYHGG-UHFFFAOYSA-N pentan-2-one Chemical compound CCCC(C)=O XNLICIUVMPYHGG-UHFFFAOYSA-N 0.000 description 2
- 229920001515 polyalkylene glycol Polymers 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 229920000447 polyanionic polymer Polymers 0.000 description 2
- 229920000867 polyelectrolyte Polymers 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229920005862 polyol Polymers 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 239000012047 saturated solution Substances 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 230000032258 transport Effects 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical group ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- JSZOAYXJRCEYSX-UHFFFAOYSA-N 1-nitropropane Chemical compound CCC[N+]([O-])=O JSZOAYXJRCEYSX-UHFFFAOYSA-N 0.000 description 1
- GZCGUPFRVQAUEE-UHFFFAOYSA-N 2,3,4,5,6-pentahydroxyhexanal Chemical compound OCC(O)C(O)C(O)C(O)C=O GZCGUPFRVQAUEE-UHFFFAOYSA-N 0.000 description 1
- RPZANUYHRMRTTE-UHFFFAOYSA-N 2,3,4-trimethoxy-6-(methoxymethyl)-5-[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxyoxane;1-[[3,4,5-tris(2-hydroxybutoxy)-6-[4,5,6-tris(2-hydroxybutoxy)-2-(2-hydroxybutoxymethyl)oxan-3-yl]oxyoxan-2-yl]methoxy]butan-2-ol Chemical compound COC1C(OC)C(OC)C(COC)OC1OC1C(OC)C(OC)C(OC)OC1COC.CCC(O)COC1C(OCC(O)CC)C(OCC(O)CC)C(COCC(O)CC)OC1OC1C(OCC(O)CC)C(OCC(O)CC)C(OCC(O)CC)OC1COCC(O)CC RPZANUYHRMRTTE-UHFFFAOYSA-N 0.000 description 1
- UCEXMJMSILZCHZ-UHFFFAOYSA-N 2-[(4-butoxybenzoyl)amino]acetic acid Chemical compound CCCCOC1=CC=C(C(=O)NCC(O)=O)C=C1 UCEXMJMSILZCHZ-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- SATHPVQTSSUFFW-UHFFFAOYSA-N 4-[6-[(3,5-dihydroxy-4-methoxyoxan-2-yl)oxymethyl]-3,5-dihydroxy-4-methoxyoxan-2-yl]oxy-2-(hydroxymethyl)-6-methyloxane-3,5-diol Chemical compound OC1C(OC)C(O)COC1OCC1C(O)C(OC)C(O)C(OC2C(C(CO)OC(C)C2O)O)O1 SATHPVQTSSUFFW-UHFFFAOYSA-N 0.000 description 1
- GJCOSYZMQJWQCA-UHFFFAOYSA-N 9H-xanthene Chemical compound C1=CC=C2CC3=CC=CC=C3OC2=C1 GJCOSYZMQJWQCA-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- WSVLPVUVIUVCRA-KPKNDVKVSA-N Alpha-lactose monohydrate Chemical compound O.O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O WSVLPVUVIUVCRA-KPKNDVKVSA-N 0.000 description 1
- 239000001904 Arabinogalactan Substances 0.000 description 1
- 229920000189 Arabinogalactan Polymers 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 229920000623 Cellulose acetate phthalate Polymers 0.000 description 1
- DQEFEBPAPFSJLV-UHFFFAOYSA-N Cellulose propionate Chemical compound CCC(=O)OCC1OC(OC(=O)CC)C(OC(=O)CC)C(OC(=O)CC)C1OC1C(OC(=O)CC)C(OC(=O)CC)C(OC(=O)CC)C(COC(=O)CC)O1 DQEFEBPAPFSJLV-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- WQZGKKKJIJFFOK-WHZQZERISA-N D-aldose Chemical compound OC[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@H]1O WQZGKKKJIJFFOK-WHZQZERISA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- WQZGKKKJIJFFOK-QTVWNMPRSA-N D-mannopyranose Chemical compound OC[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-QTVWNMPRSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 229920000855 Fucoidan Polymers 0.000 description 1
- SQUHHTBVTRBESD-UHFFFAOYSA-N Hexa-Ac-myo-Inositol Natural products CC(=O)OC1C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O SQUHHTBVTRBESD-UHFFFAOYSA-N 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- WQZGKKKJIJFFOK-VSOAQEOCSA-N L-altropyranose Chemical compound OC[C@@H]1OC(O)[C@H](O)[C@@H](O)[C@H]1O WQZGKKKJIJFFOK-VSOAQEOCSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 229910021569 Manganese fluoride Inorganic materials 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 229920002821 Modacrylic Polymers 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004693 Polybenzimidazole Substances 0.000 description 1
- 239000004642 Polyimide Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- OKTJLQBMTBEEJV-UHFFFAOYSA-N acetic acid;methylcarbamic acid Chemical compound CC(O)=O.CNC(O)=O OKTJLQBMTBEEJV-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003619 algicide Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- WQZGKKKJIJFFOK-PHYPRBDBSA-N alpha-D-galactose Chemical compound OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@H]1O WQZGKKKJIJFFOK-PHYPRBDBSA-N 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000000420 anogeissus latifolia wall. gum Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 235000019312 arabinogalactan Nutrition 0.000 description 1
- 239000010692 aromatic oil Substances 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 238000000498 ball milling Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- MKJXYGKVIBWPFZ-UHFFFAOYSA-L calcium lactate Chemical compound [Ca+2].CC(O)C([O-])=O.CC(O)C([O-])=O MKJXYGKVIBWPFZ-UHFFFAOYSA-L 0.000 description 1
- 239000001527 calcium lactate Substances 0.000 description 1
- 235000011086 calcium lactate Nutrition 0.000 description 1
- 229960002401 calcium lactate Drugs 0.000 description 1
- 229960001714 calcium phosphate Drugs 0.000 description 1
- 238000003490 calendering Methods 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000005587 carbonate group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 229940081734 cellulose acetate phthalate Drugs 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 229920006218 cellulose propionate Polymers 0.000 description 1
- 230000001055 chewing effect Effects 0.000 description 1
- 229920000891 common polymer Polymers 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000000599 controlled substance Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- WJTCGQSWYFHTAC-UHFFFAOYSA-N cyclooctane Chemical compound C1CCCCCCC1 WJTCGQSWYFHTAC-UHFFFAOYSA-N 0.000 description 1
- 239000004914 cyclooctane Substances 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- PFBUKDPBVNJDEW-UHFFFAOYSA-N dichlorocarbene Chemical group Cl[C]Cl PFBUKDPBVNJDEW-UHFFFAOYSA-N 0.000 description 1
- CTNMMTCXUUFYAP-UHFFFAOYSA-L difluoromanganese Chemical compound F[Mn]F CTNMMTCXUUFYAP-UHFFFAOYSA-L 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- KZTYYGOKRVBIMI-UHFFFAOYSA-N diphenyl sulfone Chemical group C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 150000002016 disaccharides Chemical class 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 235000010944 ethyl methyl cellulose Nutrition 0.000 description 1
- 210000003746 feather Anatomy 0.000 description 1
- 238000000855 fermentation Methods 0.000 description 1
- 230000004151 fermentation Effects 0.000 description 1
- 230000009969 flowable effect Effects 0.000 description 1
- 235000013373 food additive Nutrition 0.000 description 1
- 239000002778 food additive Substances 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 229930182830 galactose Natural products 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 235000001727 glucose Nutrition 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 235000019314 gum ghatti Nutrition 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 229920013821 hydroxy alkyl cellulose Polymers 0.000 description 1
- 229920003063 hydroxymethyl cellulose Polymers 0.000 description 1
- 229940031574 hydroxymethyl cellulose Drugs 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000012994 industrial processing Methods 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 239000003049 inorganic solvent Substances 0.000 description 1
- CDAISMWEOUEBRE-GPIVLXJGSA-N inositol Chemical compound O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@H](O)[C@@H]1O CDAISMWEOUEBRE-GPIVLXJGSA-N 0.000 description 1
- 229960000367 inositol Drugs 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 229940011051 isopropyl acetate Drugs 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000011254 layer-forming composition Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 229920003087 methylethyl cellulose Polymers 0.000 description 1
- 150000002772 monosaccharides Chemical class 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- MCSAJNNLRCFZED-UHFFFAOYSA-N nitroethane Chemical compound CC[N+]([O-])=O MCSAJNNLRCFZED-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000000474 nursing effect Effects 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 1
- 229920002492 poly(sulfone) Polymers 0.000 description 1
- 229920001281 polyalkylene Polymers 0.000 description 1
- 229920002480 polybenzimidazole Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 229920001721 polyimide Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920000131 polyvinylidene Polymers 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 229960003253 procainamide hydrochloride Drugs 0.000 description 1
- ABTXGJFUQRCPNH-UHFFFAOYSA-N procainamide hydrochloride Chemical compound [H+].[Cl-].CCN(CC)CCNC(=O)C1=CC=C(N)C=C1 ABTXGJFUQRCPNH-UHFFFAOYSA-N 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940065347 propoxyphene hydrochloride Drugs 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 230000005180 public health Effects 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 239000003128 rodenticide Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- CDAISMWEOUEBRE-UHFFFAOYSA-N scyllo-inosotol Natural products OC1C(O)C(O)C(O)C(O)C1O CDAISMWEOUEBRE-UHFFFAOYSA-N 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 1
- 235000010234 sodium benzoate Nutrition 0.000 description 1
- 239000004299 sodium benzoate Substances 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 235000011083 sodium citrates Nutrition 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000000935 solvent evaporation Methods 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000003206 sterilizing agent Substances 0.000 description 1
- 238000013517 stratification Methods 0.000 description 1
- 229920001909 styrene-acrylic polymer Polymers 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- OKUCEQDKBKYEJY-UHFFFAOYSA-N tert-butyl 3-(methylamino)pyrrolidine-1-carboxylate Chemical compound CNC1CCN(C(=O)OC(C)(C)C)C1 OKUCEQDKBKYEJY-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- PVNIQBQSYATKKL-UHFFFAOYSA-N tripalmitin Chemical compound CCCCCCCCCCCCCCCC(=O)OCC(OC(=O)CCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCC PVNIQBQSYATKKL-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 238000000108 ultra-filtration Methods 0.000 description 1
- 229940045136 urea Drugs 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 229920003169 water-soluble polymer Polymers 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 229920001285 xanthan gum Polymers 0.000 description 1
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 1
- 229910000368 zinc sulfate Inorganic materials 0.000 description 1
- 229960001763 zinc sulfate Drugs 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/0002—Galenical forms characterised by the drug release technique; Application systems commanded by energy
- A61K9/0004—Osmotic delivery systems; Sustained release driven by osmosis, thermal energy or gas
Landscapes
- Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Veterinary Medicine (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Preparation (AREA)
- Separation Using Semi-Permeable Membranes (AREA)
- External Artificial Organs (AREA)
- Infusion, Injection, And Reservoir Apparatuses (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT150889A AT396056B (de) | 1983-03-04 | 1989-06-20 | Verfahren zur herstellung einer vorrichtung zur kontinuierlichen abgabe eines wirkstoffes, insbesondere eines arzneimittels an eine waesserige verwendungsumgebung |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/472,333 US4576604A (en) | 1983-03-04 | 1983-03-04 | Osmotic system with instant drug availability |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA72784A ATA72784A (de) | 1993-07-15 |
| AT397179B true AT397179B (de) | 1994-02-25 |
Family
ID=23875096
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT0072784A AT397179B (de) | 1983-03-04 | 1984-03-02 | Osmotische vorrichtung für die abgabe eines wirkstoffes |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4576604A (OSRAM) |
| JP (1) | JPS59167513A (OSRAM) |
| AT (1) | AT397179B (OSRAM) |
| AU (1) | AU568621B2 (OSRAM) |
| BE (1) | BE898820A (OSRAM) |
| BR (1) | BR8400997A (OSRAM) |
| CA (1) | CA1242122A (OSRAM) |
| CH (1) | CH660124A5 (OSRAM) |
| DE (1) | DE3407873A1 (OSRAM) |
| DK (1) | DK162470C (OSRAM) |
| ES (1) | ES530268A0 (OSRAM) |
| FR (1) | FR2541896B1 (OSRAM) |
| GB (1) | GB2135880B (OSRAM) |
| IE (1) | IE56606B1 (OSRAM) |
| IL (1) | IL71112A (OSRAM) |
| IT (1) | IT1182253B (OSRAM) |
| MX (1) | MX165227B (OSRAM) |
| NL (1) | NL192720C (OSRAM) |
| NO (1) | NO170667C (OSRAM) |
| NZ (1) | NZ206988A (OSRAM) |
| SE (1) | SE459847B (OSRAM) |
| ZA (1) | ZA84259B (OSRAM) |
Families Citing this family (121)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU571922B2 (en) * | 1984-01-26 | 1988-04-28 | Schering Agrochemicals Limited | Veterinary implants comprising melatonin and derivatives thereof |
| US4618487A (en) * | 1984-07-06 | 1986-10-21 | Alza Corporation | Device for administering calcium ascorbate |
| US4769027A (en) * | 1984-08-15 | 1988-09-06 | Burroughs Wellcome Co. | Delivery system |
| US4624847A (en) * | 1985-04-22 | 1986-11-25 | Alza Corporation | Drug delivery device for programmed delivery of beneficial drug |
| US4786501A (en) * | 1985-07-15 | 1988-11-22 | International Minerals & Chemical Corp. | Cylindrical implants for the controlled release of growth hormones |
| US4643731A (en) * | 1985-08-16 | 1987-02-17 | Alza Corporation | Means for providing instant agent from agent dispensing system |
| US4698062A (en) * | 1985-10-30 | 1987-10-06 | Alza Corporation | Medical device for pulsatile transdermal delivery of biologically active agents |
| US4898733A (en) * | 1985-11-04 | 1990-02-06 | International Minerals & Chemical Corp. | Layered, compression molded device for the sustained release of a beneficial agent |
| US4662880A (en) * | 1986-03-14 | 1987-05-05 | Alza Corporation | Pseudoephedrine, brompheniramine therapy |
| EP0247709B1 (en) * | 1986-04-17 | 1991-01-02 | Alza Corporation | Chlorpheniramine therapy |
| US4857330A (en) * | 1986-04-17 | 1989-08-15 | Alza Corporation | Chlorpheniramine therapy |
| US4842867A (en) * | 1986-05-09 | 1989-06-27 | Alza Corporation | Pulsed drug delivery of doxylamine |
| AU601736B2 (en) * | 1986-05-23 | 1990-09-20 | Sanofi Sante Nutrition Animale Sa | Coated veterinary implants |
| GB8626098D0 (en) * | 1986-10-31 | 1986-12-03 | Euro Celtique Sa | Controlled release hydromorphone composition |
| ATE75394T1 (de) * | 1986-11-14 | 1992-05-15 | Ciba Geigy Ag | Orales osmotisches system fuer metoprolol mit verbesserten formulierungseigenschaften. |
| JPS63135179A (ja) * | 1986-11-26 | 1988-06-07 | 立花 俊郎 | 薬物の経皮投与具 |
| US4801461A (en) | 1987-01-28 | 1989-01-31 | Alza Corporation | Pseudoephedrine dosage form |
| US5023076A (en) * | 1987-02-27 | 1991-06-11 | Alza Corporation | Lamina comprising carboxyvinyl polymer |
| US4915952A (en) * | 1987-02-27 | 1990-04-10 | Alza Corporation | Composition comprising drug, HPC, HPMC and PEO |
| US4810502A (en) * | 1987-02-27 | 1989-03-07 | Alza Corporation | Pseudoephedrine brompheniramine therapy |
| GB2206046B (en) * | 1987-06-25 | 1991-04-03 | Alza Corp | Multi-unit delivery system |
| US4892739A (en) * | 1988-04-25 | 1990-01-09 | Ciba-Geigy Corporation | Osmotic continuous dispensing oral delivery system containing a pharmaceutically acceptable active agent having a improved core membrane adhesion properties |
| GR1000252B (el) * | 1988-09-02 | 1992-05-12 | Alza Corp | Μορφη δοσολογιας συνισταμενη απο ταχεια απελευθερωση δραστικου παραγοντα ακολουθουμενη απο βραδεια απελευθερωση δραστικου παραγοντα. |
| US5034229A (en) * | 1988-12-13 | 1991-07-23 | Alza Corporation | Dispenser for increasing feed conversion of hog |
| US4969884A (en) * | 1988-12-28 | 1990-11-13 | Alza Corporation | Osmotically driven syringe |
| DK469989D0 (da) * | 1989-09-22 | 1989-09-22 | Bukh Meditec | Farmaceutisk praeparat |
| US5200197A (en) * | 1989-11-16 | 1993-04-06 | Alza Corporation | Contraceptive pill |
| US5045082A (en) * | 1990-01-10 | 1991-09-03 | Alza Corporation | Long-term delivery device including loading dose |
| US5071607A (en) * | 1990-01-31 | 1991-12-10 | Alza Corporatino | Method and apparatus for forming a hole in a drug dispensing device |
| US5190763A (en) * | 1990-05-07 | 1993-03-02 | Alza Corporation | Dosage form indicated for the management of abnormal posture, tremor and involuntary movement |
| US5192550A (en) * | 1990-05-07 | 1993-03-09 | Alza Corporation | Dosage form for treating central nervous system disorders |
| US5221536A (en) * | 1990-05-07 | 1993-06-22 | Alza Corporation | Dosage form indicated for the management of abnormal posture, tremor and involuntary movement |
| US5187100A (en) * | 1990-05-29 | 1993-02-16 | Lifescan, Inc. | Dispersion to limit penetration of aqueous solutions into a membrane |
| US5128145A (en) * | 1990-06-13 | 1992-07-07 | Alza Corporation | Dosage form for Parkinson's disease, spasticity and muscle spasms |
| DK0542926T3 (da) * | 1990-08-07 | 1995-05-15 | Pfizer | Brug af grænsefladepolymeriserede membraner i frigivelsesanordninger |
| US5178867A (en) * | 1991-08-19 | 1993-01-12 | Alza Corporation | Dosage form for delivering drug in short-time period |
| US5407686A (en) * | 1991-11-27 | 1995-04-18 | Sidmak Laboratories, Inc. | Sustained release composition for oral administration of active ingredient |
| US5429822A (en) * | 1992-03-13 | 1995-07-04 | Cambridge Scientific, Inc. | Biodegradable bursting release system |
| US6440457B1 (en) * | 1993-05-27 | 2002-08-27 | Alza Corporation | Method of administering antidepressant dosage form |
| US6746691B2 (en) | 1993-09-20 | 2004-06-08 | Kos Pharmaceuticals, Inc. | Intermediate release nicotinic acid compositions for treating hyperlipidemia having unique biopharmaceutical characteristics |
| US20060263428A1 (en) * | 1993-09-20 | 2006-11-23 | Eugenio Cefali | Methods for treating hyperlipidemia with intermediate release nicotinic acid compositions having unique biopharmaceutical characteristics |
| US6080428A (en) | 1993-09-20 | 2000-06-27 | Bova; David J. | Nicotinic acid compositions for treating hyperlipidemia and related methods therefor |
| US6676967B1 (en) * | 1993-09-20 | 2004-01-13 | Kos Pharmaceuticals, Inc. | Methods for reducing flushing in individuals being treated with nicotinic acid for hyperlipidemia |
| US6818229B1 (en) | 1993-09-20 | 2004-11-16 | Kos Pharmaceuticals, Inc. | Intermediate release nicotinic acid compositions for treating hyperlipidemia |
| US6129930A (en) | 1993-09-20 | 2000-10-10 | Bova; David J. | Methods and sustained release nicotinic acid compositions for treating hyperlipidemia at night |
| US5540665A (en) * | 1994-01-31 | 1996-07-30 | Alza Corporation | Gas driven dispensing device and gas generating engine therefor |
| US5460826A (en) * | 1994-06-27 | 1995-10-24 | Alza Corporation | Morphine therapy |
| US5595752A (en) * | 1994-07-01 | 1997-01-21 | Monsanto Company | Increasing dressing percentage and carcass weight in finishing beef cattle |
| US5672357A (en) * | 1994-07-01 | 1997-09-30 | Monsanto Company | Method and device for implantation of large diameter objects in bovines |
| US5529787A (en) * | 1994-07-07 | 1996-06-25 | Alza Corporation | Hydromorphone therapy |
| US5914131A (en) * | 1994-07-07 | 1999-06-22 | Alza Corporation | Hydromorphone therapy |
| US6491945B1 (en) * | 1994-09-16 | 2002-12-10 | Alza Corporation | Hydrocodone therapy |
| US6283951B1 (en) * | 1996-10-11 | 2001-09-04 | Transvascular, Inc. | Systems and methods for delivering drugs to selected locations within the body |
| WO1997033566A2 (en) * | 1996-03-12 | 1997-09-18 | Alza Corporation | Composition and dosage form comprising opioid antagonist |
| US6919373B1 (en) * | 1996-11-12 | 2005-07-19 | Alza Corporation | Methods and devices for providing prolonged drug therapy |
| US5948787A (en) | 1997-02-28 | 1999-09-07 | Alza Corporation | Compositions containing opiate analgesics |
| ES2203963T3 (es) * | 1997-05-30 | 2004-04-16 | Osmotica Corp. | Dispositivo osmotico multicapa. |
| US8524277B2 (en) * | 1998-03-06 | 2013-09-03 | Alza Corporation | Extended release dosage form |
| US20020127254A1 (en) * | 1998-06-25 | 2002-09-12 | Lavipharm Laboratories Inc. | Devices for local and systemic delivery of active substance and methods of manufacturing thereof |
| US20090297602A1 (en) * | 1998-11-02 | 2009-12-03 | Devane John G | Modified Release Loxoprofen Compositions |
| US6198966B1 (en) | 1999-02-26 | 2001-03-06 | Medtronic, Inc. | Recirculating implantable drug delivery system |
| WO2000062759A1 (en) | 1999-04-16 | 2000-10-26 | Novo Nordisk A/S | Dry, mouldable drug formulation |
| US6264973B1 (en) * | 1999-08-26 | 2001-07-24 | Fei Enterprises, Ltd. | Apparatus and method for anesthetizing the cervical region of a female |
| WO2001056543A1 (en) | 2000-02-04 | 2001-08-09 | Alza Corporation | Osmotically-driven fluid dispenser and coating composition |
| US6464688B1 (en) | 2000-02-15 | 2002-10-15 | Microsolutions, Inc. | Osmotic pump delivery system with flexible drug compartment |
| WO2002005744A1 (en) * | 2000-07-14 | 2002-01-24 | Novo Nordisk A/S | Method of moulding a pharmaceutical composition in a packaging material |
| DE60212475T2 (de) * | 2001-03-14 | 2007-07-05 | Pfizer Products Inc., Groton | Pharmazeutische Tablette und ein Verfahren zu ihrer Herstellung |
| US6632217B2 (en) * | 2001-04-19 | 2003-10-14 | Microsolutions, Inc. | Implantable osmotic pump |
| US20030228368A1 (en) * | 2001-09-28 | 2003-12-11 | David Wynn | Edible solid composition and dosage form |
| US20040253312A1 (en) | 2001-09-28 | 2004-12-16 | Sowden Harry S. | Immediate release dosage form comprising shell having openings therein |
| EP1429745A2 (en) * | 2001-09-28 | 2004-06-23 | McNEIL-PPC, INC. | Composite dosage forms having an inlaid portion |
| US7122143B2 (en) | 2001-09-28 | 2006-10-17 | Mcneil-Ppc, Inc. | Methods for manufacturing dosage forms |
| US7838026B2 (en) | 2001-09-28 | 2010-11-23 | Mcneil-Ppc, Inc. | Burst-release polymer composition and dosage forms comprising the same |
| US8454997B2 (en) * | 2001-12-18 | 2013-06-04 | Novo Nordisk A/S | Solid dose micro implant |
| EP1458352A1 (en) * | 2001-12-18 | 2004-09-22 | Novo Nordisk A/S | Solid dose micro implant |
| PT1551372T (pt) * | 2002-09-20 | 2018-07-23 | Alpharma Pharmaceuticals Llc | Subunidade de sequestração e composições e métodos relacionados |
| CA2499882C (en) | 2002-09-28 | 2010-11-09 | Mcneil-Ppc, Inc. | Modified release dosage form with two cores |
| US20070077301A1 (en) * | 2002-12-23 | 2007-04-05 | Meyer Glenn A | Venlafaxine osmotic device formulation |
| US8029822B2 (en) * | 2003-05-22 | 2011-10-04 | Osmotica Kereskedelmi és Seolgáltató KFT | Rupturing controlled release device having a preformed passageway |
| CN103788089A (zh) * | 2003-09-17 | 2014-05-14 | 詹森药业有限公司 | 作为血清素受体调节剂的稠合杂环化合物 |
| AU2004314693B2 (en) * | 2003-09-26 | 2011-04-07 | Alza Corporation | Drug coating providing high drug loading and methods for providing the same |
| NZ546183A (en) * | 2003-09-26 | 2011-04-29 | Alza Corp | Controlled release formulations exhibiting an ascending rate of release |
| ATE504288T1 (de) * | 2003-09-26 | 2011-04-15 | Alza Corp | Oros-push-stick für die kontrollierte abgabe von wirkstoffen |
| JP5563731B2 (ja) * | 2003-09-26 | 2014-07-30 | アルザ・コーポレーシヨン | オピオイドおよび非オピオイド鎮痛薬の制御放出製剤 |
| US20050129764A1 (en) * | 2003-12-11 | 2005-06-16 | Vergez Juan A. | Osmotic device containing licofelone |
| US8067029B2 (en) | 2004-01-13 | 2011-11-29 | Mcneil-Ppc, Inc. | Rapidly disintegrating gelatinous coated tablets |
| US7879354B2 (en) * | 2004-01-13 | 2011-02-01 | Mcneil-Ppc, Inc. | Rapidly disintegrating gelatinous coated tablets |
| US20050196446A1 (en) * | 2004-03-05 | 2005-09-08 | Huang Hai Y. | Polymeric compositions and dosage forms comprising the same |
| US20050196448A1 (en) * | 2004-03-05 | 2005-09-08 | Hai Yong Huang | Polymeric compositions and dosage forms comprising the same |
| US20050196442A1 (en) * | 2004-03-05 | 2005-09-08 | Huang Hai Y. | Polymeric compositions and dosage forms comprising the same |
| US20050196447A1 (en) * | 2004-03-05 | 2005-09-08 | Huang Hai Y. | Polymeric compositions and dosage forms comprising the same |
| US8541026B2 (en) | 2004-09-24 | 2013-09-24 | Abbvie Inc. | Sustained release formulations of opioid and nonopioid analgesics |
| EP1811974A4 (en) * | 2004-11-05 | 2012-03-07 | Glaxosmithkline Llc | PHARMACEUTICAL ANALYSIS DEVICE AND METHOD |
| US20060104931A1 (en) * | 2004-11-12 | 2006-05-18 | Takeshi Fukutome | Cosmetic treatment article comprising substrate and gel composition |
| AR053986A1 (es) | 2004-12-03 | 2007-05-30 | Osmotica Pharmaceutical Argent | Dispositivo osmotico que contiene amantadina y una sal osmotica |
| US7530804B2 (en) * | 2004-12-07 | 2009-05-12 | Mcneil-Ppc, Inc. | System and process for providing at least one opening in dosage forms |
| US20060233882A1 (en) * | 2005-04-15 | 2006-10-19 | Sowden Harry S | Osmotic dosage form |
| US8673352B2 (en) * | 2005-04-15 | 2014-03-18 | Mcneil-Ppc, Inc. | Modified release dosage form |
| CA2578626C (en) | 2005-06-27 | 2011-07-19 | Biovail Laboratories International S.R.L. | Modified-release formulations of a bupropion salt |
| US7598255B2 (en) * | 2005-08-04 | 2009-10-06 | Janssen Pharmaceutica Nv | Pyrimidine compounds as serotonin receptor modulators |
| ATE489079T1 (de) | 2005-12-29 | 2010-12-15 | Osmotica Kereskedelmi Es Szolgaltata Kft | Mehrschichtige tablette mit dreifacher freisetzungskombination |
| US20090069343A1 (en) * | 2006-04-10 | 2009-03-12 | Dunford Paul J | Combination Histamine H1R and H4R Antagonist Therapy for Treating Pruritus |
| US8137327B2 (en) * | 2006-06-16 | 2012-03-20 | Family Health International | Vaginal drug delivery system and method |
| MX2008016372A (es) * | 2006-06-19 | 2009-05-28 | Alpharma Inc | Composiciones farmaceuticas. |
| US20080075768A1 (en) * | 2006-07-21 | 2008-03-27 | Vaughn Jason M | Hydrophobic opioid abuse deterrent delivery system using opioid antagonists |
| US8623418B2 (en) * | 2007-12-17 | 2014-01-07 | Alpharma Pharmaceuticals Llc | Pharmaceutical composition |
| AU2008346870A1 (en) * | 2007-12-17 | 2009-07-16 | Alpharma Pharmaceuticals, Llc | Pharmaceutical composition |
| US20100151014A1 (en) * | 2008-12-16 | 2010-06-17 | Alpharma Pharmaceuticals, Llc | Pharmaceutical composition |
| US20090311335A1 (en) * | 2008-06-12 | 2009-12-17 | Scott Jenkins | Combination of a triptan and an nsaid |
| CN102164576B (zh) | 2008-09-25 | 2013-08-28 | Isp投资公司 | 光滑的高固体含量片剂包衣组合物 |
| DE102008059206A1 (de) * | 2008-11-27 | 2010-06-10 | Bayer Schering Pharma Aktiengesellschaft | Pharmazeutische Darreichungsform enthaltend Nifedipin oder Nisoldipin und einen Angiotensin-II Antagonisten und/oder ein Diuretikum |
| WO2010118232A1 (en) * | 2009-04-09 | 2010-10-14 | Elan Pharma International Limited | Controlled-release clozapine compositions |
| MX2014013320A (es) | 2012-05-07 | 2015-08-10 | Bayer Pharma AG | Procedimiento de fabricacion de una forma de dosificacion farmaceutica que comprende nifedipina y candesartan cilexetilo. |
| JP7064285B2 (ja) | 2013-12-06 | 2022-05-10 | デュレクト コーポレーション | 抗酸化剤を含む組成物、流体分注器、及びそれらに関わる方法 |
| WO2017168174A1 (en) | 2016-04-02 | 2017-10-05 | N4 Pharma Uk Limited | New pharmaceutical forms of sildenafil |
| WO2018002673A1 (en) | 2016-07-01 | 2018-01-04 | N4 Pharma Uk Limited | Novel formulations of angiotensin ii receptor antagonists |
| WO2018115888A1 (en) | 2016-12-21 | 2018-06-28 | N4 Pharma Uk Limited | Novel formulations of aprepitant |
| US9707217B1 (en) | 2017-02-03 | 2017-07-18 | Osmotica Kereskedelmi Es Szolgaltato Kft | Dose-dumping resistant controlled release dosage form |
| CA3069158C (en) | 2017-07-10 | 2024-10-01 | Gel Cap Technologies, LLC | DUAL-DOSAGE CAPSULE FOR RELEASE AND METHODS, DEVICES AND SYSTEMS FOR PRODUCING IT |
| US10744313B2 (en) * | 2017-07-27 | 2020-08-18 | University Of Utah Research Foundation | Therapeutic delivery device |
| KR102864775B1 (ko) * | 2023-05-18 | 2025-09-25 | 주식회사 퍼니스톰 | 실제 환경 정보 활용 게임 제공 시스템, 방법 및 방법을 실행하는 프로그램을 저장하는 기록매체 |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4014334A (en) * | 1976-02-02 | 1977-03-29 | Alza Corporation | Laminated osmotic system for dispensing beneficial agent |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2099402A (en) * | 1934-01-17 | 1937-11-16 | Pratt Food Company | Pill or tablet |
| US2921001A (en) * | 1957-04-16 | 1960-01-12 | Sterling Drug Inc | Multi-layered pill or tablet with indicating lamination |
| US3577512A (en) * | 1968-10-11 | 1971-05-04 | Nat Patent Dev Corp | Sustained release tablets |
| US3625214A (en) * | 1970-05-18 | 1971-12-07 | Alza Corp | Drug-delivery device |
| AU466503B2 (en) * | 1972-06-05 | 1975-10-30 | Alza Corporation | Osmotic dispenser |
| US3845770A (en) * | 1972-06-05 | 1974-11-05 | Alza Corp | Osmatic dispensing device for releasing beneficial agent |
| US4096238A (en) * | 1974-12-23 | 1978-06-20 | Alza Corporation | Method for administering drug to the gastrointestinal tract |
| US4093709A (en) * | 1975-01-28 | 1978-06-06 | Alza Corporation | Drug delivery devices manufactured from poly(orthoesters) and poly(orthocarbonates) |
| US4122157A (en) * | 1977-03-04 | 1978-10-24 | Richardson-Merrell Inc. | Nitrofurantoin sustained release tablet |
| US4256108A (en) * | 1977-04-07 | 1981-03-17 | Alza Corporation | Microporous-semipermeable laminated osmotic system |
| US4200098A (en) * | 1978-10-23 | 1980-04-29 | Alza Corporation | Osmotic system with distribution zone for dispensing beneficial agent |
| US4309996A (en) * | 1980-04-28 | 1982-01-12 | Alza Corporation | System with microporous releasing diffusor |
| JPS5839618A (ja) * | 1981-09-04 | 1983-03-08 | Chugai Pharmaceut Co Ltd | 持続性積層錠剤 |
| US4455143A (en) * | 1982-03-22 | 1984-06-19 | Alza Corporation | Osmotic device for dispensing two different medications |
-
1983
- 1983-03-04 US US06/472,333 patent/US4576604A/en not_active Expired - Lifetime
-
1984
- 1984-01-04 AU AU23068/84A patent/AU568621B2/en not_active Expired
- 1984-01-10 GB GB08400563A patent/GB2135880B/en not_active Expired
- 1984-01-12 ZA ZA84259A patent/ZA84259B/xx unknown
- 1984-01-24 IE IE156/84A patent/IE56606B1/en not_active IP Right Cessation
- 1984-01-31 NZ NZ206988A patent/NZ206988A/en unknown
- 1984-02-02 BE BE0/212327A patent/BE898820A/fr not_active IP Right Cessation
- 1984-02-22 DK DK088884A patent/DK162470C/da not_active IP Right Cessation
- 1984-02-27 NO NO840725A patent/NO170667C/no not_active IP Right Cessation
- 1984-02-29 IL IL71112A patent/IL71112A/xx not_active IP Right Cessation
- 1984-02-29 MX MX200501A patent/MX165227B/es unknown
- 1984-03-01 NL NL8400670A patent/NL192720C/nl not_active IP Right Cessation
- 1984-03-01 BR BR8400997A patent/BR8400997A/pt not_active IP Right Cessation
- 1984-03-01 FR FR8403208A patent/FR2541896B1/fr not_active Expired
- 1984-03-02 AT AT0072784A patent/AT397179B/de not_active IP Right Cessation
- 1984-03-02 SE SE8401185A patent/SE459847B/sv not_active IP Right Cessation
- 1984-03-02 JP JP59040277A patent/JPS59167513A/ja active Granted
- 1984-03-02 CH CH1055/84A patent/CH660124A5/de not_active IP Right Cessation
- 1984-03-02 IT IT67204/84A patent/IT1182253B/it active
- 1984-03-02 CA CA000448709A patent/CA1242122A/en not_active Expired
- 1984-03-02 ES ES530268A patent/ES530268A0/es active Granted
- 1984-03-02 DE DE19843407873 patent/DE3407873A1/de active Granted
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4014334A (en) * | 1976-02-02 | 1977-03-29 | Alza Corporation | Laminated osmotic system for dispensing beneficial agent |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT397179B (de) | Osmotische vorrichtung für die abgabe eines wirkstoffes | |
| AT397180B (de) | Vorrichtung zur kontrollierten abgabe eines wirkstoffes | |
| DE3439722C2 (de) | Osmotische Kapsel | |
| DE68910159T2 (de) | Dosierform für Verabreichung in der Humanmedizin. | |
| DE2640193C2 (de) | Vorrichtung zur Abgabe eines Wirkstoffs durch Osmose und Verfahren zu deren Herstellung | |
| DE3626103C2 (de) | Abgabevorrichtung zur gesteuerten Freisetzung eines Wirkstoffes | |
| DE3687799T2 (de) | Osmotische pumpe fuer lipide. | |
| DE69103153T2 (de) | Darreichungsform für zeitlich variierende modelle der arzneistofffreisetzung. | |
| DE2814709C2 (OSRAM) | ||
| DE3509410C2 (de) | Abgabesystem zur Freisetzung einer Wirkstofformulierung | |
| DE2751587C2 (de) | Durch Osmose wirksame Vorrichtung zur Abgabe eines Arzneimittels und Verfahren zu deren Herstellung | |
| DE68906488T2 (de) | Verwendung von asymmetrischen membranen in abgabevorrichtungen. | |
| DE3015870C2 (de) | Vorrichtung zur Abgabe eines Wirkstoffs durch Diffusion | |
| DE3310096C2 (de) | Durch Osmose wirksame Abgabevorrichtung | |
| DE3310081C2 (de) | Vorrichtung zur Abgabe von zwei unterschiedlichen Wirkstoffen durch Osmose | |
| DE69003392T2 (de) | Dosisform zur oralen verabreichung des hypoglykämischen glipizids. | |
| DE3833282C2 (de) | Osmotische Dosierungsform zur Verabreichung von Isradipin | |
| DE3626362C2 (de) | Abgabevorrichtung zur Freisetzung eines Wirkstoffes an Wiederkäuer | |
| DE69720055T2 (de) | Verabreichungsform zur abgabe von steigenden wirkstoffdosen | |
| DE3613382A1 (de) | Osmotische abgabevorrichtung | |
| DE3613454A1 (de) | Arzneimittelabgabevorrichtung | |
| DE3613433A1 (de) | Osmotische abgabevorrichtung | |
| DE3627618A1 (de) | Abgabesystem zur freisetzung einer wirkstoffzubereitung | |
| DE3626707A1 (de) | Abgabevorrichtung zur freisetzung von calciumascorbat | |
| DE3443586C2 (de) | Osmotisches Abgabesystem |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| REN | Ceased due to non-payment of the annual fee | ||
| ELA | Expired due to lapse of time | ||
| MK07 | Expiry |
Effective date: 20110715 |