UA78731C2 - Indol-2-carboxamides as inhibitors of xa factor - Google Patents
Indol-2-carboxamides as inhibitors of xa factor Download PDFInfo
- Publication number
- UA78731C2 UA78731C2 UA20040604882A UA20040604882A UA78731C2 UA 78731 C2 UA78731 C2 UA 78731C2 UA 20040604882 A UA20040604882 A UA 20040604882A UA 20040604882 A UA20040604882 A UA 20040604882A UA 78731 C2 UA78731 C2 UA 78731C2
- Authority
- UA
- Ukraine
- Prior art keywords
- indole
- carboxylic acid
- chlorothiophen
- isoxazol
- ylmethyl
- Prior art date
Links
- 239000003112 inhibitor Substances 0.000 title abstract description 12
- VFHUJFBEFDVZPJ-UHFFFAOYSA-N 1h-indole-2-carboxamide Chemical class C1=CC=C2NC(C(=O)N)=CC2=C1 VFHUJFBEFDVZPJ-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 328
- 238000000034 method Methods 0.000 claims abstract description 197
- 239000000825 pharmaceutical preparation Substances 0.000 claims abstract description 13
- -1 phenylpyridyl Chemical group 0.000 claims description 220
- ZRQQXFMGYSOKDF-UHFFFAOYSA-N 1-propan-2-ylpiperidin-4-amine Chemical compound CC(C)N1CCC(N)CC1 ZRQQXFMGYSOKDF-UHFFFAOYSA-N 0.000 claims description 195
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 152
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 142
- 239000000203 mixture Substances 0.000 claims description 137
- 125000000217 alkyl group Chemical group 0.000 claims description 132
- 150000003254 radicals Chemical class 0.000 claims description 108
- HCUARRIEZVDMPT-UHFFFAOYSA-N indolyl-2-carboxylic acid Natural products C1=CC=C2NC(C(=O)O)=CC2=C1 HCUARRIEZVDMPT-UHFFFAOYSA-N 0.000 claims description 74
- 150000001408 amides Chemical class 0.000 claims description 69
- 239000002253 acid Substances 0.000 claims description 68
- 125000001072 heteroaryl group Chemical group 0.000 claims description 53
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 47
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 44
- 150000003839 salts Chemical class 0.000 claims description 44
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 42
- 229910052736 halogen Inorganic materials 0.000 claims description 39
- 125000003118 aryl group Chemical group 0.000 claims description 38
- 150000002367 halogens Chemical class 0.000 claims description 38
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 37
- 125000004122 cyclic group Chemical group 0.000 claims description 36
- 125000002950 monocyclic group Chemical group 0.000 claims description 35
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 32
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 28
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 claims description 28
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 claims description 27
- 229910052757 nitrogen Inorganic materials 0.000 claims description 27
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 24
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 23
- 125000002619 bicyclic group Chemical group 0.000 claims description 22
- 150000001412 amines Chemical class 0.000 claims description 20
- 125000005842 heteroatom Chemical group 0.000 claims description 20
- 125000001041 indolyl group Chemical group 0.000 claims description 20
- 229920006395 saturated elastomer Polymers 0.000 claims description 20
- 150000007513 acids Chemical class 0.000 claims description 19
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 18
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 18
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 17
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 17
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 17
- 229910052717 sulfur Inorganic materials 0.000 claims description 17
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims description 16
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 16
- 125000004076 pyridyl group Chemical group 0.000 claims description 16
- 239000011593 sulfur Chemical group 0.000 claims description 16
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 claims description 15
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 15
- 125000000524 functional group Chemical group 0.000 claims description 15
- 125000000623 heterocyclic group Chemical group 0.000 claims description 15
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 15
- 229910052760 oxygen Chemical group 0.000 claims description 15
- 239000001301 oxygen Chemical group 0.000 claims description 15
- 229910052799 carbon Inorganic materials 0.000 claims description 14
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 14
- 150000003536 tetrazoles Chemical class 0.000 claims description 13
- 125000001544 thienyl group Chemical group 0.000 claims description 13
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 12
- KBXWLAQHWUNMMX-UHFFFAOYSA-N 1-(4-methoxyphenyl)indole-2-carboxylic acid Chemical compound C1=CC(OC)=CC=C1N1C2=CC=CC=C2C=C1C(O)=O KBXWLAQHWUNMMX-UHFFFAOYSA-N 0.000 claims description 11
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 11
- 125000002883 imidazolyl group Chemical group 0.000 claims description 11
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 11
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 11
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 claims description 10
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 claims description 10
- 125000002947 alkylene group Chemical group 0.000 claims description 10
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 10
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 10
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 10
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 10
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 claims description 9
- CIISBYKBBMFLEZ-UHFFFAOYSA-N 1,2-oxazolidine Chemical compound C1CNOC1 CIISBYKBBMFLEZ-UHFFFAOYSA-N 0.000 claims description 9
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical compound C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 claims description 9
- XQRNOQYMHPJDCY-UHFFFAOYSA-N 1-cyclopropylpiperidin-4-amine Chemical compound C1CC(N)CCN1C1CC1 XQRNOQYMHPJDCY-UHFFFAOYSA-N 0.000 claims description 9
- UFETTXCVHFVMPU-UHFFFAOYSA-N 1-ethylpiperidin-4-amine Chemical compound CCN1CCC(N)CC1 UFETTXCVHFVMPU-UHFFFAOYSA-N 0.000 claims description 9
- QWENRTYMTSOGBR-UHFFFAOYSA-N 1H-1,2,3-Triazole Chemical compound C=1C=NNN=1 QWENRTYMTSOGBR-UHFFFAOYSA-N 0.000 claims description 9
- POXWDTQUDZUOGP-UHFFFAOYSA-N 1h-1,4-diazepine Chemical compound N1C=CC=NC=C1 POXWDTQUDZUOGP-UHFFFAOYSA-N 0.000 claims description 9
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 9
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 claims description 9
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 9
- MSRJJSCOWHWGGX-UHFFFAOYSA-N 2h-1,3-diazepine Chemical compound C1N=CC=CC=N1 MSRJJSCOWHWGGX-UHFFFAOYSA-N 0.000 claims description 9
- WEQPBCSPRXFQQS-UHFFFAOYSA-N 4,5-dihydro-1,2-oxazole Chemical compound C1CC=NO1 WEQPBCSPRXFQQS-UHFFFAOYSA-N 0.000 claims description 9
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 claims description 9
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 9
- DPOPAJRDYZGTIR-UHFFFAOYSA-N Tetrazine Chemical compound C1=CN=NN=N1 DPOPAJRDYZGTIR-UHFFFAOYSA-N 0.000 claims description 9
- 125000002541 furyl group Chemical group 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 229910052740 iodine Inorganic materials 0.000 claims description 9
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 claims description 9
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 9
- IWELDVXSEVIIGI-UHFFFAOYSA-N piperazin-2-one Chemical compound O=C1CNCCN1 IWELDVXSEVIIGI-UHFFFAOYSA-N 0.000 claims description 9
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 claims description 9
- 239000002243 precursor Substances 0.000 claims description 9
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 9
- 125000000335 thiazolyl group Chemical group 0.000 claims description 9
- LRANPJDWHYRCER-UHFFFAOYSA-N 1,2-diazepine Chemical compound N1C=CC=CC=N1 LRANPJDWHYRCER-UHFFFAOYSA-N 0.000 claims description 8
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 8
- 125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- XYOVOXDWRFGKEX-UHFFFAOYSA-N azepine Chemical compound N1C=CC=CC=C1 XYOVOXDWRFGKEX-UHFFFAOYSA-N 0.000 claims description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 8
- 125000001786 isothiazolyl group Chemical group 0.000 claims description 8
- 125000002971 oxazolyl group Chemical group 0.000 claims description 8
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 claims description 8
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 8
- IYCMYOWBZQNVBV-UHFFFAOYSA-N (1-propan-2-ylpiperidin-4-yl)methanamine Chemical compound CC(C)N1CCC(CN)CC1 IYCMYOWBZQNVBV-UHFFFAOYSA-N 0.000 claims description 7
- FYADHXFMURLYQI-UHFFFAOYSA-N 1,2,4-triazine Chemical compound C1=CN=NC=N1 FYADHXFMURLYQI-UHFFFAOYSA-N 0.000 claims description 7
- XUKZYTNPGQPSGF-UHFFFAOYSA-N 1-(3-chlorophenyl)indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1C1=CC=CC(Cl)=C1 XUKZYTNPGQPSGF-UHFFFAOYSA-N 0.000 claims description 7
- NBNWLLXCAIOATK-UHFFFAOYSA-N 1-[(3-methoxyphenyl)methyl]indole-2-carboxylic acid Chemical compound COC1=CC=CC(CN2C3=CC=CC=C3C=C2C(O)=O)=C1 NBNWLLXCAIOATK-UHFFFAOYSA-N 0.000 claims description 7
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 claims description 7
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 7
- 125000005010 perfluoroalkyl group Chemical group 0.000 claims description 7
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 7
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 claims description 6
- PZALFFWPXFOLRF-UHFFFAOYSA-N C(C)OC(=O)OC(C)OC(C)OC(=O)OCC Chemical compound C(C)OC(=O)OC(C)OC(C)OC(=O)OCC PZALFFWPXFOLRF-UHFFFAOYSA-N 0.000 claims description 6
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 claims description 6
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 claims description 6
- 125000004494 ethyl ester group Chemical group 0.000 claims description 6
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 claims description 6
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 claims description 6
- SJGALSBBFTYSBA-UHFFFAOYSA-N oxaziridine Chemical compound C1NO1 SJGALSBBFTYSBA-UHFFFAOYSA-N 0.000 claims description 6
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 claims description 6
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 claims description 6
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 6
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 claims description 6
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 claims description 6
- IBBLKSWSCDAPIF-UHFFFAOYSA-N thiopyran Chemical compound S1C=CC=C=C1 IBBLKSWSCDAPIF-UHFFFAOYSA-N 0.000 claims description 6
- 125000001425 triazolyl group Chemical group 0.000 claims description 6
- DNUTZBZXLPWRJG-UHFFFAOYSA-N 1-Piperidine carboxylic acid Chemical compound OC(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-N 0.000 claims description 5
- SYMMPPWYYXRLJX-UHFFFAOYSA-N 1-propan-2-ylpyrrolidin-3-amine Chemical compound CC(C)N1CCC(N)C1 SYMMPPWYYXRLJX-UHFFFAOYSA-N 0.000 claims description 5
- ZUEKSECYPXHXAQ-UHFFFAOYSA-N 1-pyrimidin-4-ylpiperidin-4-amine Chemical compound C1CC(N)CCN1C1=CC=NC=N1 ZUEKSECYPXHXAQ-UHFFFAOYSA-N 0.000 claims description 5
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 claims description 5
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 claims description 5
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 claims description 5
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 claims description 5
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 5
- 229910052796 boron Inorganic materials 0.000 claims description 5
- 125000002843 carboxylic acid group Chemical group 0.000 claims description 5
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 claims description 5
- 125000003386 piperidinyl group Chemical group 0.000 claims description 5
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 claims description 5
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 5
- 125000006565 (C4-C7) cyclic group Chemical group 0.000 claims description 4
- KDMMRRCLTYHTRA-UHFFFAOYSA-N 1-[(2-chlorophenyl)methyl]indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1CC1=CC=CC=C1Cl KDMMRRCLTYHTRA-UHFFFAOYSA-N 0.000 claims description 4
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 claims description 4
- GOLVGZOPWLLUSF-UHFFFAOYSA-N 1-ethylpyrrolidin-3-amine Chemical compound CCN1CCC(N)C1 GOLVGZOPWLLUSF-UHFFFAOYSA-N 0.000 claims description 4
- RJWLLQWLBMJCFD-UHFFFAOYSA-N 4-methylpiperazin-1-amine Chemical compound CN1CCN(N)CC1 RJWLLQWLBMJCFD-UHFFFAOYSA-N 0.000 claims description 4
- WHLOJVAAKSVMKB-UHFFFAOYSA-N 4-propan-2-ylpiperazin-1-amine Chemical compound CC(C)N1CCN(N)CC1 WHLOJVAAKSVMKB-UHFFFAOYSA-N 0.000 claims description 4
- HPBOVGJJLBWHOA-UHFFFAOYSA-N C1(CCCCC1)C(=O)OC(C)OC(C)OC(=O)C1CCCCC1 Chemical compound C1(CCCCC1)C(=O)OC(C)OC(C)OC(=O)C1CCCCC1 HPBOVGJJLBWHOA-UHFFFAOYSA-N 0.000 claims description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 claims description 4
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 claims description 4
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 4
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 4
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 claims description 4
- 150000001721 carbon Chemical group 0.000 claims description 4
- 238000009833 condensation Methods 0.000 claims description 4
- 230000005494 condensation Effects 0.000 claims description 4
- 125000002993 cycloalkylene group Chemical group 0.000 claims description 4
- 125000003384 isochromanyl group Chemical group C1(OCCC2=CC=CC=C12)* 0.000 claims description 4
- 125000005956 isoquinolyl group Chemical group 0.000 claims description 4
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 4
- 125000005494 pyridonyl group Chemical group 0.000 claims description 4
- 125000005493 quinolyl group Chemical group 0.000 claims description 4
- CZSRXHJVZUBEGW-UHFFFAOYSA-N 1,2-thiazolidine Chemical compound C1CNSC1 CZSRXHJVZUBEGW-UHFFFAOYSA-N 0.000 claims description 3
- 125000005871 1,3-benzodioxolyl group Chemical group 0.000 claims description 3
- ABADUMLIAZCWJD-UHFFFAOYSA-N 1,3-dioxole Chemical compound C1OC=CO1 ABADUMLIAZCWJD-UHFFFAOYSA-N 0.000 claims description 3
- FJTSSHUVCCKRBA-UHFFFAOYSA-N 1-(2-chloropyrimidin-4-yl)piperidin-4-amine Chemical compound C1CC(N)CCN1C1=CC=NC(Cl)=N1 FJTSSHUVCCKRBA-UHFFFAOYSA-N 0.000 claims description 3
- ILMDRDDKNWKCNX-UHFFFAOYSA-N 1-(2-methoxyethyl)piperidin-4-amine Chemical compound COCCN1CCC(N)CC1 ILMDRDDKNWKCNX-UHFFFAOYSA-N 0.000 claims description 3
- ZXVWFOMYPHVUGO-UHFFFAOYSA-N 1-(2-methylpropyl)piperidin-4-amine Chemical compound CC(C)CN1CCC(N)CC1 ZXVWFOMYPHVUGO-UHFFFAOYSA-N 0.000 claims description 3
- NLHBHVGPMMXWIM-UHFFFAOYSA-N 1-(4-aminopiperidin-1-yl)ethanone Chemical compound CC(=O)N1CCC(N)CC1 NLHBHVGPMMXWIM-UHFFFAOYSA-N 0.000 claims description 3
- ZCYVGFQRDRGDJM-UHFFFAOYSA-N 1-propylpiperidin-4-amine Chemical compound CCCN1CCC(N)CC1 ZCYVGFQRDRGDJM-UHFFFAOYSA-N 0.000 claims description 3
- ZHKJHQBOAJQXQR-UHFFFAOYSA-N 1H-azirine Chemical compound N1C=C1 ZHKJHQBOAJQXQR-UHFFFAOYSA-N 0.000 claims description 3
- IIEQJSIHKZXTHY-UHFFFAOYSA-N 2,2-dimethylpropanoyloxymethoxymethyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCOCOC(=O)C(C)(C)C IIEQJSIHKZXTHY-UHFFFAOYSA-N 0.000 claims description 3
- JECYNCQXXKQDJN-UHFFFAOYSA-N 2-(2-methylhexan-2-yloxymethyl)oxirane Chemical compound CCCCC(C)(C)OCC1CO1 JECYNCQXXKQDJN-UHFFFAOYSA-N 0.000 claims description 3
- MPPMMKDXSXSUTG-UHFFFAOYSA-N 2-(4-aminopiperidin-1-yl)-n-methylacetamide Chemical compound CNC(=O)CN1CCC(N)CC1 MPPMMKDXSXSUTG-UHFFFAOYSA-N 0.000 claims description 3
- ZGYLBJLUOKJLRB-UHFFFAOYSA-N 2-(4-aminopiperidin-1-yl)acetonitrile Chemical compound NC1CCN(CC#N)CC1 ZGYLBJLUOKJLRB-UHFFFAOYSA-N 0.000 claims description 3
- NMWIFNPFFNFXPB-UHFFFAOYSA-N 2-(4-aminopiperidin-1-yl)ethanol Chemical compound NC1CCN(CCO)CC1 NMWIFNPFFNFXPB-UHFFFAOYSA-N 0.000 claims description 3
- MGADZUXDNSDTHW-UHFFFAOYSA-N 2H-pyran Chemical compound C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 claims description 3
- KGWNRZLPXLBMPS-UHFFFAOYSA-N 2h-1,3-oxazine Chemical compound C1OC=CC=N1 KGWNRZLPXLBMPS-UHFFFAOYSA-N 0.000 claims description 3
- NTYABNDBNKVWOO-UHFFFAOYSA-N 2h-1,3-thiazine Chemical compound C1SC=CC=N1 NTYABNDBNKVWOO-UHFFFAOYSA-N 0.000 claims description 3
- YHWMFDLNZGIJSD-UHFFFAOYSA-N 2h-1,4-oxazine Chemical compound C1OC=CN=C1 YHWMFDLNZGIJSD-UHFFFAOYSA-N 0.000 claims description 3
- ZAISDHPZTZIFQF-UHFFFAOYSA-N 2h-1,4-thiazine Chemical compound C1SC=CN=C1 ZAISDHPZTZIFQF-UHFFFAOYSA-N 0.000 claims description 3
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 claims description 3
- AGIJRRREJXSQJR-UHFFFAOYSA-N 2h-thiazine Chemical compound N1SC=CC=C1 AGIJRRREJXSQJR-UHFFFAOYSA-N 0.000 claims description 3
- XKTYXVDYIKIYJP-UHFFFAOYSA-N 3h-dioxole Chemical compound C1OOC=C1 XKTYXVDYIKIYJP-UHFFFAOYSA-N 0.000 claims description 3
- GUUULVAMQJLDSY-UHFFFAOYSA-N 4,5-dihydro-1,2-thiazole Chemical compound C1CC=NS1 GUUULVAMQJLDSY-UHFFFAOYSA-N 0.000 claims description 3
- IHERZVGWOOXGGV-UHFFFAOYSA-N 4-aminopiperidine-1-carbaldehyde Chemical compound NC1CCN(C=O)CC1 IHERZVGWOOXGGV-UHFFFAOYSA-N 0.000 claims description 3
- AHZIDBXGSJQKLX-UHFFFAOYSA-N 4-aminopiperidine-1-carboxamide Chemical compound NC1CCN(C(N)=O)CC1 AHZIDBXGSJQKLX-UHFFFAOYSA-N 0.000 claims description 3
- AHAPEYABSDOBIP-UHFFFAOYSA-N 4-ethylpiperazin-1-amine Chemical compound CCN1CCN(N)CC1 AHAPEYABSDOBIP-UHFFFAOYSA-N 0.000 claims description 3
- HWCHRKZMGLGYBW-UHFFFAOYSA-N CC(C)N(CC1)CCC1N.COC1=CC=C(CN2C3=CC=CC=C3C=C2C(O)=O)C=C1 Chemical compound CC(C)N(CC1)CCC1N.COC1=CC=C(CN2C3=CC=CC=C3C=C2C(O)=O)C=C1 HWCHRKZMGLGYBW-UHFFFAOYSA-N 0.000 claims description 3
- GEAXQZLZUYQYKZ-UHFFFAOYSA-N CC(C)N(CC1)CCC1N.OC(C1=CC2=CC=CC=C2N1CC(C=C1)=CC=C1Cl)=O Chemical compound CC(C)N(CC1)CCC1N.OC(C1=CC2=CC=CC=C2N1CC(C=C1)=CC=C1Cl)=O GEAXQZLZUYQYKZ-UHFFFAOYSA-N 0.000 claims description 3
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 claims description 3
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 claims description 3
- JZFICWYCTCCINF-UHFFFAOYSA-N Thiadiazin Chemical compound S=C1SC(C)NC(C)N1CCN1C(=S)SC(C)NC1C JZFICWYCTCCINF-UHFFFAOYSA-N 0.000 claims description 3
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 claims description 3
- OOFGXDQWDNJDIS-UHFFFAOYSA-N oxathiolane Chemical compound C1COSC1 OOFGXDQWDNJDIS-UHFFFAOYSA-N 0.000 claims description 3
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 claims description 3
- XSROQCDVUIHRSI-UHFFFAOYSA-N thietane Chemical compound C1CSC1 XSROQCDVUIHRSI-UHFFFAOYSA-N 0.000 claims description 3
- KQKQMDNBLKHSEQ-UHFFFAOYSA-N 1-[(4-chlorophenyl)methyl]indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1CC1=CC=C(Cl)C=C1 KQKQMDNBLKHSEQ-UHFFFAOYSA-N 0.000 claims description 2
- AXJHGZQKOZQHQC-UHFFFAOYSA-N 1-[2-(4-chloroanilino)-2-oxoethyl]indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1CC(=O)NC1=CC=C(Cl)C=C1 AXJHGZQKOZQHQC-UHFFFAOYSA-N 0.000 claims description 2
- GZWFMQMAEUUNCC-UHFFFAOYSA-N 1-cyclohexylpiperidin-4-amine Chemical compound C1CC(N)CCN1C1CCCCC1 GZWFMQMAEUUNCC-UHFFFAOYSA-N 0.000 claims description 2
- HJJXAKRPWXVQGP-UHFFFAOYSA-N 1-cyclopentylpiperidin-4-amine Chemical compound C1CC(N)CCN1C1CCCC1 HJJXAKRPWXVQGP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004484 1-methylpiperidin-4-yl group Chemical group CN1CCC(CC1)* 0.000 claims description 2
- PFMIIYUHSYSWGH-UHFFFAOYSA-N CC(C)N(CC1)CCC1N.COC1=CC=CC(CN(C(C(O)=O)=CC2=C3)C2=CC=C3[N+]([O-])=O)=C1 Chemical compound CC(C)N(CC1)CCC1N.COC1=CC=CC(CN(C(C(O)=O)=CC2=C3)C2=CC=C3[N+]([O-])=O)=C1 PFMIIYUHSYSWGH-UHFFFAOYSA-N 0.000 claims description 2
- VXZXIJQREFBLSI-UHFFFAOYSA-N CC(C)N(CC1)CCC1N.COC1=CC=CC(CN2C3=CC=CC=C3C=C2C(O)=O)=C1 Chemical compound CC(C)N(CC1)CCC1N.COC1=CC=CC(CN2C3=CC=CC=C3C=C2C(O)=O)=C1 VXZXIJQREFBLSI-UHFFFAOYSA-N 0.000 claims description 2
- MUYLFCNXISOLHE-UHFFFAOYSA-N CC(C)N(CC1)CCC1N.OC(C1=CC2=CC=CC=C2N1C(C=C1)=CC=C1Cl)=O Chemical compound CC(C)N(CC1)CCC1N.OC(C1=CC2=CC=CC=C2N1C(C=C1)=CC=C1Cl)=O MUYLFCNXISOLHE-UHFFFAOYSA-N 0.000 claims description 2
- DKZXVLNRKHILGD-UHFFFAOYSA-N CC(C)N(CC1)CCC1N.OC(C1=CC2=CC=CC=C2N1C1=CC(Cl)=CC(Cl)=C1)=O Chemical compound CC(C)N(CC1)CCC1N.OC(C1=CC2=CC=CC=C2N1C1=CC(Cl)=CC(Cl)=C1)=O DKZXVLNRKHILGD-UHFFFAOYSA-N 0.000 claims description 2
- GRLVMUYWPALQEI-UHFFFAOYSA-N CC(C)N(CC1)CCC1N.OC(C1=CC2=CC=CC=C2N1CC(C=C1)=CC=C1OC(F)(F)F)=O Chemical compound CC(C)N(CC1)CCC1N.OC(C1=CC2=CC=CC=C2N1CC(C=C1)=CC=C1OC(F)(F)F)=O GRLVMUYWPALQEI-UHFFFAOYSA-N 0.000 claims description 2
- CMSUOZLMYNTYGT-UHFFFAOYSA-N CC(C)N(CC1)CCC1N.OC(C1=CC2=CC=CC=C2N1CC(C=CC(Cl)=C1)=C1Cl)=O Chemical compound CC(C)N(CC1)CCC1N.OC(C1=CC2=CC=CC=C2N1CC(C=CC(Cl)=C1)=C1Cl)=O CMSUOZLMYNTYGT-UHFFFAOYSA-N 0.000 claims description 2
- ZVENHIGCSFWIPB-UHFFFAOYSA-N CC(C)N(CC1)CCC1N.OC(C1=CC2=CC=CC=C2N1CC(C=CC=C1)=C1Cl)=O Chemical compound CC(C)N(CC1)CCC1N.OC(C1=CC2=CC=CC=C2N1CC(C=CC=C1)=C1Cl)=O ZVENHIGCSFWIPB-UHFFFAOYSA-N 0.000 claims description 2
- WURWCQNBSIGGRE-UHFFFAOYSA-N CC(C)N(CC1)CCC1N.OC(C1=CC2=CC=CC=C2N1CC1=CC(Cl)=CC(Cl)=C1)=O Chemical compound CC(C)N(CC1)CCC1N.OC(C1=CC2=CC=CC=C2N1CC1=CC(Cl)=CC(Cl)=C1)=O WURWCQNBSIGGRE-UHFFFAOYSA-N 0.000 claims description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 2
- 239000005977 Ethylene Substances 0.000 claims description 2
- 229920006063 Lamide® Polymers 0.000 claims description 2
- 229910052770 Uranium Inorganic materials 0.000 claims description 2
- 150000001541 aziridines Chemical class 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropyl acetate Chemical compound CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 claims description 2
- 150000003053 piperidines Chemical class 0.000 claims description 2
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 claims description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 claims description 2
- 229930192474 thiophene Natural products 0.000 claims description 2
- 230000009466 transformation Effects 0.000 claims description 2
- CKJNUZNMWOVDFN-UHFFFAOYSA-N methanone Chemical compound O=[CH-] CKJNUZNMWOVDFN-UHFFFAOYSA-N 0.000 claims 9
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 claims 3
- UOCPLRLVNRLSHU-UHFFFAOYSA-N (3-pyridin-4-yl-4,5-dihydro-1,2-oxazol-5-yl)methanamine Chemical compound O1C(CN)CC(C=2C=CN=CC=2)=N1 UOCPLRLVNRLSHU-UHFFFAOYSA-N 0.000 claims 1
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims 1
- JGJGATZSBDRWIU-UHFFFAOYSA-N 1-(3-methoxyphenyl)indole-2-carboxylic acid Chemical compound COC1=CC=CC(N2C3=CC=CC=C3C=C2C(O)=O)=C1 JGJGATZSBDRWIU-UHFFFAOYSA-N 0.000 claims 1
- HUJXRKYMGBLFMK-UHFFFAOYSA-N 1-pentan-3-ylpiperidin-4-amine Chemical compound CCC(CC)N1CCC(N)CC1 HUJXRKYMGBLFMK-UHFFFAOYSA-N 0.000 claims 1
- SYOANZBNGDEJFH-UHFFFAOYSA-N 2,5-dihydro-1h-triazole Chemical compound C1NNN=C1 SYOANZBNGDEJFH-UHFFFAOYSA-N 0.000 claims 1
- JGZVUTYDEVUNMK-UHFFFAOYSA-N 5-carboxy-2',7'-dichlorofluorescein Chemical compound C12=CC(Cl)=C(O)C=C2OC2=CC(O)=C(Cl)C=C2C21OC(=O)C1=CC(C(=O)O)=CC=C21 JGZVUTYDEVUNMK-UHFFFAOYSA-N 0.000 claims 1
- 241001024304 Mino Species 0.000 claims 1
- 235000014787 Vitis vinifera Nutrition 0.000 claims 1
- 240000006365 Vitis vinifera Species 0.000 claims 1
- KVXNKFYSHAUJIA-UHFFFAOYSA-N acetic acid;ethoxyethane Chemical compound CC(O)=O.CCOCC KVXNKFYSHAUJIA-UHFFFAOYSA-N 0.000 claims 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims 1
- RWTNPBWLLIMQHL-UHFFFAOYSA-N fexofenadine Chemical compound C1=CC(C(C)(C(O)=O)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 RWTNPBWLLIMQHL-UHFFFAOYSA-N 0.000 claims 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims 1
- 108010074860 Factor Xa Proteins 0.000 abstract description 34
- 230000000694 effects Effects 0.000 abstract description 21
- 230000005764 inhibitory process Effects 0.000 abstract description 18
- 238000002360 preparation method Methods 0.000 abstract description 16
- 230000023555 blood coagulation Effects 0.000 abstract description 12
- 230000002265 prevention Effects 0.000 abstract description 11
- 239000003814 drug Substances 0.000 abstract description 9
- 208000001435 Thromboembolism Diseases 0.000 abstract description 6
- 239000004480 active ingredient Substances 0.000 abstract description 6
- 208000024172 Cardiovascular disease Diseases 0.000 abstract description 5
- 230000008569 process Effects 0.000 abstract description 5
- 230000002441 reversible effect Effects 0.000 abstract description 4
- 238000002560 therapeutic procedure Methods 0.000 abstract description 3
- 230000002785 anti-thrombosis Effects 0.000 abstract description 2
- 108010054265 Factor VIIa Proteins 0.000 abstract 4
- 229940012414 factor viia Drugs 0.000 abstract 4
- 238000011321 prophylaxis Methods 0.000 abstract 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 164
- 238000009826 distribution Methods 0.000 description 164
- 230000000155 isotopic effect Effects 0.000 description 163
- 239000000243 solution Substances 0.000 description 130
- 230000002829 reductive effect Effects 0.000 description 129
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 120
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 113
- 239000000047 product Substances 0.000 description 113
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 111
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 105
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 89
- 239000002904 solvent Substances 0.000 description 87
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 86
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 73
- 239000011541 reaction mixture Substances 0.000 description 70
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 63
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 53
- 239000007787 solid Substances 0.000 description 53
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 47
- 238000003756 stirring Methods 0.000 description 45
- AQEFLFZSWDEAIP-UHFFFAOYSA-N di-tert-butyl ether Chemical compound CC(C)(C)OC(C)(C)C AQEFLFZSWDEAIP-UHFFFAOYSA-N 0.000 description 42
- 235000011054 acetic acid Nutrition 0.000 description 40
- VFRSADQPWYCXDG-LEUCUCNGSA-N ethyl (2s,5s)-5-methylpyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CCOC(=O)[C@@H]1CC[C@H](C)N1 VFRSADQPWYCXDG-LEUCUCNGSA-N 0.000 description 40
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 39
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 38
- 230000015572 biosynthetic process Effects 0.000 description 37
- 238000006243 chemical reaction Methods 0.000 description 37
- 238000002953 preparative HPLC Methods 0.000 description 33
- 238000003786 synthesis reaction Methods 0.000 description 31
- 238000010828 elution Methods 0.000 description 29
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 28
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 27
- 239000000651 prodrug Substances 0.000 description 27
- 229940002612 prodrug Drugs 0.000 description 27
- 238000004108 freeze drying Methods 0.000 description 25
- 239000000741 silica gel Substances 0.000 description 25
- 229910002027 silica gel Inorganic materials 0.000 description 25
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 24
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 24
- 125000001424 substituent group Chemical group 0.000 description 24
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 21
- 239000012044 organic layer Substances 0.000 description 20
- 238000004587 chromatography analysis Methods 0.000 description 19
- 238000001914 filtration Methods 0.000 description 19
- 239000007858 starting material Substances 0.000 description 19
- 150000002475 indoles Chemical class 0.000 description 18
- 239000012071 phase Substances 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 17
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 16
- 238000005481 NMR spectroscopy Methods 0.000 description 16
- 238000000746 purification Methods 0.000 description 16
- 239000007864 aqueous solution Substances 0.000 description 15
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 15
- 239000000126 substance Substances 0.000 description 14
- UBIXPIXAVFHKMM-UHFFFAOYSA-N 3-(bromomethyl)-5-(5-chlorothiophen-2-yl)-1,2-oxazole Chemical compound S1C(Cl)=CC=C1C1=CC(CBr)=NO1 UBIXPIXAVFHKMM-UHFFFAOYSA-N 0.000 description 12
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 12
- 238000005804 alkylation reaction Methods 0.000 description 11
- 150000002148 esters Chemical class 0.000 description 11
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 11
- BCIIMDOZSUCSEN-UHFFFAOYSA-N piperidin-4-amine Chemical compound NC1CCNCC1 BCIIMDOZSUCSEN-UHFFFAOYSA-N 0.000 description 11
- 238000005160 1H NMR spectroscopy Methods 0.000 description 10
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- 239000003795 chemical substances by application Substances 0.000 description 10
- 238000005755 formation reaction Methods 0.000 description 10
- WSFSSNUMVMOOMR-BJUDXGSMSA-N methanone Chemical compound O=[11CH2] WSFSSNUMVMOOMR-BJUDXGSMSA-N 0.000 description 10
- 239000002244 precipitate Substances 0.000 description 10
- 239000012047 saturated solution Substances 0.000 description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 229940054051 antipsychotic indole derivative Drugs 0.000 description 9
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 9
- 239000003921 oil Substances 0.000 description 9
- UQUFONQTPPAJAO-UHFFFAOYSA-N 1-(4-methoxyphenyl)-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound C1=CC(OC)=CC=C1N1C2=CC=CC=C2C=C1C(=O)NC1CCN(C(C)C)CC1 UQUFONQTPPAJAO-UHFFFAOYSA-N 0.000 description 8
- MUABQYJAPOQWCH-UHFFFAOYSA-N 1h-indole-2,5-dicarboxylic acid Chemical compound OC(=O)C1=CC=C2NC(C(=O)O)=CC2=C1 MUABQYJAPOQWCH-UHFFFAOYSA-N 0.000 description 8
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical group NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 8
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 8
- 230000029936 alkylation Effects 0.000 description 8
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 229960002449 glycine Drugs 0.000 description 8
- 235000013905 glycine and its sodium salt Nutrition 0.000 description 8
- 230000002401 inhibitory effect Effects 0.000 description 8
- GINABUAPACIWCA-UHFFFAOYSA-N n-propan-2-ylpiperidin-4-amine Chemical compound CC(C)NC1CCNCC1 GINABUAPACIWCA-UHFFFAOYSA-N 0.000 description 8
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 8
- 125000003367 polycyclic group Chemical group 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- YFCIFWOJYYFDQP-PTWZRHHISA-N 4-[3-amino-6-[(1S,3S,4S)-3-fluoro-4-hydroxycyclohexyl]pyrazin-2-yl]-N-[(1S)-1-(3-bromo-5-fluorophenyl)-2-(methylamino)ethyl]-2-fluorobenzamide Chemical compound CNC[C@@H](NC(=O)c1ccc(cc1F)-c1nc(cnc1N)[C@H]1CC[C@H](O)[C@@H](F)C1)c1cc(F)cc(Br)c1 YFCIFWOJYYFDQP-PTWZRHHISA-N 0.000 description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 7
- 102000004190 Enzymes Human genes 0.000 description 7
- 108090000790 Enzymes Proteins 0.000 description 7
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 7
- 208000007536 Thrombosis Diseases 0.000 description 7
- 238000004458 analytical method Methods 0.000 description 7
- 239000003146 anticoagulant agent Substances 0.000 description 7
- 150000001735 carboxylic acids Chemical class 0.000 description 7
- 239000003153 chemical reaction reagent Substances 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- 229910052801 chlorine Inorganic materials 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 229940088598 enzyme Drugs 0.000 description 7
- 239000006260 foam Substances 0.000 description 7
- 230000003993 interaction Effects 0.000 description 7
- 150000004702 methyl esters Chemical class 0.000 description 7
- 238000006268 reductive amination reaction Methods 0.000 description 7
- 239000012312 sodium hydride Substances 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- 239000000758 substrate Substances 0.000 description 7
- 239000003826 tablet Substances 0.000 description 7
- VRGVVJHPLVPFRR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1.C1CSCCN1 VRGVVJHPLVPFRR-UHFFFAOYSA-N 0.000 description 7
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 7
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 7
- ILJYDQMZEQMUBB-UHFFFAOYSA-N (4-pyridin-4-ylphenyl)methanamine Chemical compound C1=CC(CN)=CC=C1C1=CC=NC=C1 ILJYDQMZEQMUBB-UHFFFAOYSA-N 0.000 description 6
- OLNYNTKNRVFVBI-UHFFFAOYSA-N 7-methyl-1h-indole-2-carboxylic acid Chemical compound CC1=CC=CC2=C1NC(C(O)=O)=C2 OLNYNTKNRVFVBI-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 125000002252 acyl group Chemical group 0.000 description 6
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 6
- 229910052786 argon Inorganic materials 0.000 description 6
- 238000003556 assay Methods 0.000 description 6
- 239000003480 eluent Substances 0.000 description 6
- 125000004185 ester group Chemical group 0.000 description 6
- 238000004128 high performance liquid chromatography Methods 0.000 description 6
- 229910052763 palladium Inorganic materials 0.000 description 6
- KBOGICFUPOMDKS-UHFFFAOYSA-N piperidin-4-ylcarbamic acid Chemical compound OC(=O)NC1CCNCC1 KBOGICFUPOMDKS-UHFFFAOYSA-N 0.000 description 6
- 125000006239 protecting group Chemical group 0.000 description 6
- 208000037803 restenosis Diseases 0.000 description 6
- VOAAEKKFGLPLLU-UHFFFAOYSA-N (4-methoxyphenyl)boronic acid Chemical compound COC1=CC=C(B(O)O)C=C1 VOAAEKKFGLPLLU-UHFFFAOYSA-N 0.000 description 5
- FONDLKIFZSPAPN-UHFFFAOYSA-N 1-[(3-methoxyphenyl)methyl]-5-nitro-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound COC1=CC=CC(CN2C3=CC=C(C=C3C=C2C(=O)NC2CCN(CC2)C(C)C)[N+]([O-])=O)=C1 FONDLKIFZSPAPN-UHFFFAOYSA-N 0.000 description 5
- SKZUXKOWTWFPPH-UHFFFAOYSA-N 1-propan-2-ylpiperidin-4-amine;hydrochloride Chemical compound Cl.CC(C)N1CCC(N)CC1 SKZUXKOWTWFPPH-UHFFFAOYSA-N 0.000 description 5
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 5
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 5
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 5
- 125000002015 acyclic group Chemical group 0.000 description 5
- 125000003277 amino group Chemical group 0.000 description 5
- 210000004369 blood Anatomy 0.000 description 5
- 239000008280 blood Substances 0.000 description 5
- 230000015271 coagulation Effects 0.000 description 5
- 238000005345 coagulation Methods 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- FMASTMURQSHELY-UHFFFAOYSA-N n-(4-fluoro-2-methylphenyl)-3-methyl-n-[(2-methyl-1h-indol-4-yl)methyl]pyridine-4-carboxamide Chemical compound C1=CC=C2NC(C)=CC2=C1CN(C=1C(=CC(F)=CC=1)C)C(=O)C1=CC=NC=C1C FMASTMURQSHELY-UHFFFAOYSA-N 0.000 description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 5
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 4
- JBQWQBSRIAGTJT-UHFFFAOYSA-N 3-ethylmorpholine Chemical compound CCC1COCCN1 JBQWQBSRIAGTJT-UHFFFAOYSA-N 0.000 description 4
- OMDMAZNVKWBUDD-UHFFFAOYSA-N 5-methylsulfonyl-1h-indole-2-carboxylic acid Chemical compound CS(=O)(=O)C1=CC=C2NC(C(O)=O)=CC2=C1 OMDMAZNVKWBUDD-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 4
- 241000282414 Homo sapiens Species 0.000 description 4
- 108090000190 Thrombin Proteins 0.000 description 4
- 108010000499 Thromboplastin Proteins 0.000 description 4
- 102000002262 Thromboplastin Human genes 0.000 description 4
- 230000001154 acute effect Effects 0.000 description 4
- 229940127219 anticoagulant drug Drugs 0.000 description 4
- HRQGCQVOJVTVLU-UHFFFAOYSA-N bis(chloromethyl) ether Chemical compound ClCOCCl HRQGCQVOJVTVLU-UHFFFAOYSA-N 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- CVDGHGWEHQIJTE-UHFFFAOYSA-N bromo(bromomethoxy)methane Chemical compound BrCOCBr CVDGHGWEHQIJTE-UHFFFAOYSA-N 0.000 description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 4
- 230000020764 fibrinolysis Effects 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 4
- 125000004043 oxo group Chemical group O=* 0.000 description 4
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 238000006722 reduction reaction Methods 0.000 description 4
- 238000001356 surgical procedure Methods 0.000 description 4
- 229960004072 thrombin Drugs 0.000 description 4
- GQJKDHLNWBITEP-UHFFFAOYSA-N 1-(4-chlorophenyl)indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1C1=CC=C(Cl)C=C1 GQJKDHLNWBITEP-UHFFFAOYSA-N 0.000 description 3
- SYYLBTHATZNOSE-UHFFFAOYSA-N 1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]indole-2-carboxylic acid Chemical compound C1=CC=C2N(CC(=O)OC(C)(C)C)C(C(O)=O)=CC2=C1 SYYLBTHATZNOSE-UHFFFAOYSA-N 0.000 description 3
- REXUYBKPWIPONM-UHFFFAOYSA-N 2-bromoacetonitrile Chemical compound BrCC#N REXUYBKPWIPONM-UHFFFAOYSA-N 0.000 description 3
- NQNQKLBWDARKDG-UHFFFAOYSA-N 4-amino-1-piperidinecarboxylic acid Chemical compound NC1CCN(C(O)=O)CC1 NQNQKLBWDARKDG-UHFFFAOYSA-N 0.000 description 3
- SXFVRIRMDXONCT-UHFFFAOYSA-N 4-bromo-1h-indole-2-carboxylic acid Chemical compound C1=CC=C2NC(C(=O)O)=CC2=C1Br SXFVRIRMDXONCT-UHFFFAOYSA-N 0.000 description 3
- ZZAVIQXQBBOHBB-UHFFFAOYSA-N 4-methoxy-1h-indole-2-carboxylic acid Chemical compound COC1=CC=CC2=C1C=C(C(O)=O)N2 ZZAVIQXQBBOHBB-UHFFFAOYSA-N 0.000 description 3
- FUQOTYRCMBZFOL-UHFFFAOYSA-N 5-chloro-1H-indole-2-carboxylic acid Chemical compound ClC1=CC=C2NC(C(=O)O)=CC2=C1 FUQOTYRCMBZFOL-UHFFFAOYSA-N 0.000 description 3
- LHFOJSCXLFKDIR-UHFFFAOYSA-N 5-nitro-1h-indole-2-carboxylic acid Chemical compound [O-][N+](=O)C1=CC=C2NC(C(=O)O)=CC2=C1 LHFOJSCXLFKDIR-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 208000032843 Hemorrhage Diseases 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 3
- 108091034117 Oligonucleotide Proteins 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical class CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 241000256856 Vespidae Species 0.000 description 3
- 230000009471 action Effects 0.000 description 3
- 230000003213 activating effect Effects 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 125000003342 alkenyl group Chemical group 0.000 description 3
- 125000000304 alkynyl group Chemical group 0.000 description 3
- 238000002399 angioplasty Methods 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 239000012300 argon atmosphere Substances 0.000 description 3
- 238000006254 arylation reaction Methods 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 208000034158 bleeding Diseases 0.000 description 3
- 230000000740 bleeding effect Effects 0.000 description 3
- 238000006555 catalytic reaction Methods 0.000 description 3
- 238000011097 chromatography purification Methods 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 125000006165 cyclic alkyl group Chemical group 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- PQVSTLUFSYVLTO-UHFFFAOYSA-N ethyl n-ethoxycarbonylcarbamate Chemical compound CCOC(=O)NC(=O)OCC PQVSTLUFSYVLTO-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000012634 fragment Substances 0.000 description 3
- 239000007903 gelatin capsule Substances 0.000 description 3
- 125000000593 indol-1-yl group Chemical group [H]C1=C([H])C([H])=C2N([*])C([H])=C([H])C2=C1[H] 0.000 description 3
- KMAKOBLIOCQGJP-UHFFFAOYSA-N indole-3-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=CNC2=C1 KMAKOBLIOCQGJP-UHFFFAOYSA-N 0.000 description 3
- 150000002476 indolines Chemical class 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium hydroxide monohydrate Substances [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 3
- 229940040692 lithium hydroxide monohydrate Drugs 0.000 description 3
- NNKPHNTWNILINE-UHFFFAOYSA-N n-cyclopropyl-3-fluoro-4-methyl-5-[3-[[1-[2-[2-(methylamino)ethoxy]phenyl]cyclopropyl]amino]-2-oxopyrazin-1-yl]benzamide Chemical compound CNCCOC1=CC=CC=C1C1(NC=2C(N(C=3C(=C(F)C=C(C=3)C(=O)NC3CC3)C)C=CN=2)=O)CC1 NNKPHNTWNILINE-UHFFFAOYSA-N 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- IYPZRUYMFDWKSS-UHFFFAOYSA-N piperazin-1-amine Chemical compound NN1CCNCC1 IYPZRUYMFDWKSS-UHFFFAOYSA-N 0.000 description 3
- 125000004193 piperazinyl group Chemical group 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000000523 sample Substances 0.000 description 3
- 238000007127 saponification reaction Methods 0.000 description 3
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 238000010561 standard procedure Methods 0.000 description 3
- 230000002537 thrombolytic effect Effects 0.000 description 3
- ICIJWOWQUHHETJ-UHFFFAOYSA-N (3,5-dichlorophenyl)methanamine Chemical compound NCC1=CC(Cl)=CC(Cl)=C1 ICIJWOWQUHHETJ-UHFFFAOYSA-N 0.000 description 2
- UWYZHKAOTLEWKK-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline Chemical compound C1=CC=C2CNCCC2=C1 UWYZHKAOTLEWKK-UHFFFAOYSA-N 0.000 description 2
- LBUJPTNKIBCYBY-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline Chemical compound C1=CC=C2CCCNC2=C1 LBUJPTNKIBCYBY-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- FWQFUPSGNFFGTA-UHFFFAOYSA-N 1-[(3-methoxyphenyl)methyl]-n-(4-pyridin-4-ylphenyl)indole-2-carboxamide Chemical compound COC1=CC=CC(CN2C3=CC=CC=C3C=C2C(=O)NC=2C=CC(=CC=2)C=2C=CN=CC=2)=C1 FWQFUPSGNFFGTA-UHFFFAOYSA-N 0.000 description 2
- NCLBAGOCKYQNRE-UHFFFAOYSA-N 1-chloro-4-[2-[2-(4-chlorophenyl)ethoxy]ethyl]benzene Chemical compound C1=CC(Cl)=CC=C1CCOCCC1=CC=C(Cl)C=C1 NCLBAGOCKYQNRE-UHFFFAOYSA-N 0.000 description 2
- ONZWFHWHTYZZLM-UHFFFAOYSA-N 1-chloroethyl cyclohexyl carbonate Chemical compound CC(Cl)OC(=O)OC1CCCCC1 ONZWFHWHTYZZLM-UHFFFAOYSA-N 0.000 description 2
- YVRGKFXJZCTTRB-UHFFFAOYSA-N 1-chloroethyl ethyl carbonate Chemical compound CCOC(=O)OC(C)Cl YVRGKFXJZCTTRB-UHFFFAOYSA-N 0.000 description 2
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 2
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 description 2
- XYHKNCXZYYTLRG-UHFFFAOYSA-N 1h-imidazole-2-carbaldehyde Chemical compound O=CC1=NC=CN1 XYHKNCXZYYTLRG-UHFFFAOYSA-N 0.000 description 2
- GBQRSEVKSZQWFF-UHFFFAOYSA-N 1h-indole-2,4-dicarboxylic acid Chemical compound C1=CC=C2NC(C(=O)O)=CC2=C1C(O)=O GBQRSEVKSZQWFF-UHFFFAOYSA-N 0.000 description 2
- PAQZWJGSJMLPMG-UHFFFAOYSA-N 2,4,6-tripropyl-1,3,5,2$l^{5},4$l^{5},6$l^{5}-trioxatriphosphinane 2,4,6-trioxide Chemical compound CCCP1(=O)OP(=O)(CCC)OP(=O)(CCC)O1 PAQZWJGSJMLPMG-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- LSTRKXWIZZZYAS-UHFFFAOYSA-N 2-bromoacetyl bromide Chemical compound BrCC(Br)=O LSTRKXWIZZZYAS-UHFFFAOYSA-N 0.000 description 2
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 2
- KLDLRDSRCMJKGM-UHFFFAOYSA-N 3-[chloro-(2-oxo-1,3-oxazolidin-3-yl)phosphoryl]-1,3-oxazolidin-2-one Chemical compound C1COC(=O)N1P(=O)(Cl)N1CCOC1=O KLDLRDSRCMJKGM-UHFFFAOYSA-N 0.000 description 2
- REWOVIRPQVDGPH-UHFFFAOYSA-N 3-cyano-1h-indole-2-carboxylic acid Chemical compound C1=CC=C2C(C#N)=C(C(=O)O)NC2=C1 REWOVIRPQVDGPH-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- LHFYAXMRBAGZCL-UHFFFAOYSA-N 4-(propan-2-ylamino)piperidine-1-carboxylic acid Chemical compound CC(C)NC1CCN(C(O)=O)CC1 LHFYAXMRBAGZCL-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- XYWIPYBIIRTJMM-IBGZPJMESA-N 4-[[(2S)-2-[4-[5-chloro-2-[4-(trifluoromethyl)triazol-1-yl]phenyl]-5-methoxy-2-oxopyridin-1-yl]butanoyl]amino]-2-fluorobenzamide Chemical compound CC[C@H](N1C=C(OC)C(=CC1=O)C1=C(C=CC(Cl)=C1)N1C=C(N=N1)C(F)(F)F)C(=O)NC1=CC(F)=C(C=C1)C(N)=O XYWIPYBIIRTJMM-IBGZPJMESA-N 0.000 description 2
- ONCKEPHPTBVRKM-UHFFFAOYSA-N 4-aminopiperazine-1-carboxylic acid Chemical compound NN1CCN(C(O)=O)CC1 ONCKEPHPTBVRKM-UHFFFAOYSA-N 0.000 description 2
- PVMNPAUTCMBOMO-UHFFFAOYSA-N 4-chloropyridine Chemical compound ClC1=CC=NC=C1 PVMNPAUTCMBOMO-UHFFFAOYSA-N 0.000 description 2
- XGAFCCUNHIMIRV-UHFFFAOYSA-N 4-chloropyridine;hydron;chloride Chemical compound Cl.ClC1=CC=NC=C1 XGAFCCUNHIMIRV-UHFFFAOYSA-N 0.000 description 2
- MCNQUWLLXZZZAC-UHFFFAOYSA-N 4-cyano-1-(2,4-dichlorophenyl)-5-(4-methoxyphenyl)-n-piperidin-1-ylpyrazole-3-carboxamide Chemical compound C1=CC(OC)=CC=C1C1=C(C#N)C(C(=O)NN2CCCCC2)=NN1C1=CC=C(Cl)C=C1Cl MCNQUWLLXZZZAC-UHFFFAOYSA-N 0.000 description 2
- VLVCDUSVTXIWGW-UHFFFAOYSA-N 4-iodoaniline Chemical compound NC1=CC=C(I)C=C1 VLVCDUSVTXIWGW-UHFFFAOYSA-N 0.000 description 2
- XOHZQGAYUHOJPR-UHFFFAOYSA-N 4-pyridin-3-yl-1,3-thiazol-2-amine Chemical compound S1C(N)=NC(C=2C=NC=CC=2)=C1 XOHZQGAYUHOJPR-UHFFFAOYSA-N 0.000 description 2
- STWODXDTKGTVCJ-UHFFFAOYSA-N 4-pyrrolidin-1-ylpiperidine Chemical compound C1CCCN1C1CCNCC1 STWODXDTKGTVCJ-UHFFFAOYSA-N 0.000 description 2
- WRDWWAVNELMWAM-UHFFFAOYSA-N 4-tert-butylaniline Chemical compound CC(C)(C)C1=CC=C(N)C=C1 WRDWWAVNELMWAM-UHFFFAOYSA-N 0.000 description 2
- YAULOOYNCJDPPU-UHFFFAOYSA-N 5-bromo-1h-indole-2-carboxylic acid Chemical compound BrC1=CC=C2NC(C(=O)O)=CC2=C1 YAULOOYNCJDPPU-UHFFFAOYSA-N 0.000 description 2
- GPOKALMQWKCZPG-UHFFFAOYSA-N 5-chloro-1-[(3-methoxyphenyl)methyl]indole-2-carboxylic acid Chemical compound COC1=CC=CC(CN2C3=CC=C(Cl)C=C3C=C2C(O)=O)=C1 GPOKALMQWKCZPG-UHFFFAOYSA-N 0.000 description 2
- MAXBVGJEFDMHNV-UHFFFAOYSA-N 5-chloropyridin-2-amine Chemical compound NC1=CC=C(Cl)C=N1 MAXBVGJEFDMHNV-UHFFFAOYSA-N 0.000 description 2
- DAITVOCMWPNFTL-UHFFFAOYSA-N 5-methyl-1h-indole-2-carboxylic acid Chemical compound CC1=CC=C2NC(C(O)=O)=CC2=C1 DAITVOCMWPNFTL-UHFFFAOYSA-N 0.000 description 2
- MVCLSAMNMAWXFQ-UHFFFAOYSA-N 5-phenylmethoxy-1h-indole-2-carboxylic acid Chemical compound C=1C=C2NC(C(=O)O)=CC2=CC=1OCC1=CC=CC=C1 MVCLSAMNMAWXFQ-UHFFFAOYSA-N 0.000 description 2
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 2
- WFWYWVZGUUCHBL-UHFFFAOYSA-N 7-(aminomethyl)quinazolin-4-amine Chemical compound NC1=NC=NC2=CC(CN)=CC=C21 WFWYWVZGUUCHBL-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 206010053567 Coagulopathies Diseases 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 241001274216 Naso Species 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 108091005804 Peptidases Proteins 0.000 description 2
- 102000035195 Peptidases Human genes 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000004365 Protease Substances 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 208000007814 Unstable Angina Diseases 0.000 description 2
- 206010047249 Venous thrombosis Diseases 0.000 description 2
- 230000002159 abnormal effect Effects 0.000 description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 2
- 206010000891 acute myocardial infarction Diseases 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 208000015294 blood coagulation disease Diseases 0.000 description 2
- 239000003130 blood coagulation factor inhibitor Substances 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- VXIVSQZSERGHQP-UHFFFAOYSA-N chloroacetamide Chemical compound NC(=O)CCl VXIVSQZSERGHQP-UHFFFAOYSA-N 0.000 description 2
- 239000003593 chromogenic compound Substances 0.000 description 2
- 150000001879 copper Chemical class 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- VLNZUSMTOFYNPS-UHFFFAOYSA-N diethylphosphorylformonitrile Chemical compound CCP(=O)(CC)C#N VLNZUSMTOFYNPS-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 125000001033 ether group Chemical group 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 2
- 230000023597 hemostasis Effects 0.000 description 2
- 235000012907 honey Nutrition 0.000 description 2
- 150000002430 hydrocarbons Chemical group 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- ORTFAQDWJHRMNX-UHFFFAOYSA-N hydroxidooxidocarbon(.) Chemical group O[C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-N 0.000 description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 2
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 description 2
- 125000003037 imidazol-2-yl group Chemical group [H]N1C([*])=NC([H])=C1[H] 0.000 description 2
- 125000002140 imidazol-4-yl group Chemical group [H]N1C([H])=NC([*])=C1[H] 0.000 description 2
- 239000007943 implant Substances 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- SEOVTRFCIGRIMH-UHFFFAOYSA-N indole-3-acetic acid Chemical compound C1=CC=C2C(CC(=O)O)=CNC2=C1 SEOVTRFCIGRIMH-UHFFFAOYSA-N 0.000 description 2
- JYGFTBXVXVMTGB-UHFFFAOYSA-N indolin-2-one Chemical compound C1=CC=C2NC(=O)CC2=C1 JYGFTBXVXVMTGB-UHFFFAOYSA-N 0.000 description 2
- 230000028709 inflammatory response Effects 0.000 description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000004551 isoquinolin-3-yl group Chemical group C1=NC(=CC2=CC=CC=C12)* 0.000 description 2
- 239000004310 lactic acid Substances 0.000 description 2
- 235000014655 lactic acid Nutrition 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- 239000003094 microcapsule Substances 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- DBNQIOANXZVWIP-UHFFFAOYSA-N n,n-dimethyl-1,1-bis[(2-methylpropan-2-yl)oxy]methanamine Chemical compound CC(C)(C)OC(N(C)C)OC(C)(C)C DBNQIOANXZVWIP-UHFFFAOYSA-N 0.000 description 2
- SESXBIFUTWZZOU-UHFFFAOYSA-N n-piperidin-4-ylpyridin-4-amine Chemical compound C1CNCCC1NC1=CC=NC=C1 SESXBIFUTWZZOU-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- JMJRYTGVHCAYCT-UHFFFAOYSA-N oxan-4-one Chemical compound O=C1CCOCC1 JMJRYTGVHCAYCT-UHFFFAOYSA-N 0.000 description 2
- 125000000160 oxazolidinyl group Chemical group 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 125000004574 piperidin-2-yl group Chemical group N1C(CCCC1)* 0.000 description 2
- VHBNPKSIIFEKSA-UHFFFAOYSA-N piperidin-4-ylmethylcarbamic acid Chemical compound OC(=O)NCC1CCNCC1 VHBNPKSIIFEKSA-UHFFFAOYSA-N 0.000 description 2
- 229920005862 polyol Polymers 0.000 description 2
- 150000003077 polyols Chemical class 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 108010014806 prothrombinase complex Proteins 0.000 description 2
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 2
- QLULGIRFKAWHOJ-UHFFFAOYSA-N pyridin-4-ylboronic acid Chemical compound OB(O)C1=CC=NC=C1 QLULGIRFKAWHOJ-UHFFFAOYSA-N 0.000 description 2
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 2
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 125000006413 ring segment Chemical group 0.000 description 2
- 239000012266 salt solution Substances 0.000 description 2
- XIIOFHFUYBLOLW-UHFFFAOYSA-N selpercatinib Chemical compound OC(COC=1C=C(C=2N(C=1)N=CC=2C#N)C=1C=NC(=CC=1)N1CC2N(C(C1)C2)CC=1C=NC(=CC=1)OC)(C)C XIIOFHFUYBLOLW-UHFFFAOYSA-N 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000003001 serine protease inhibitor Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical class [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 239000007790 solid phase Substances 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- 150000003457 sulfones Chemical class 0.000 description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 2
- 238000005694 sulfonylation reaction Methods 0.000 description 2
- 150000003462 sulfoxides Chemical class 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000005958 tetrahydrothienyl group Chemical group 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 150000003568 thioethers Chemical class 0.000 description 2
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 2
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Chemical compound O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 125000004417 unsaturated alkyl group Chemical group 0.000 description 2
- 230000002792 vascular Effects 0.000 description 2
- BZMMRNKDONDVIB-UHFFFAOYSA-N (1-ethoxycyclopropyl)oxy-trimethylsilane Chemical compound CCOC1(O[Si](C)(C)C)CC1 BZMMRNKDONDVIB-UHFFFAOYSA-N 0.000 description 1
- WGTSIPPZBCZNRU-UHFFFAOYSA-N (1-propan-2-ylpiperidin-4-yl)carbamic acid Chemical compound CC(C)N1CCC(NC(O)=O)CC1 WGTSIPPZBCZNRU-UHFFFAOYSA-N 0.000 description 1
- DOMQFIFVDIAOOT-ROUUACIJSA-N (2S,3R)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylpyridin-3-yl)-1,2,4-triazol-3-yl]-3-(5-methylpyrimidin-2-yl)butane-2-sulfonamide Chemical compound COC1=C(C(=CC=C1)OC)N1C(=NN=C1C=1C=NC=C(C=1)C)NS(=O)(=O)[C@@H](C)[C@H](C)C1=NC=C(C=N1)C DOMQFIFVDIAOOT-ROUUACIJSA-N 0.000 description 1
- DKYRKAIKWFHQHM-UHFFFAOYSA-N (3,5-dichlorophenyl)boronic acid Chemical compound OB(O)C1=CC(Cl)=CC(Cl)=C1 DKYRKAIKWFHQHM-UHFFFAOYSA-N 0.000 description 1
- SDEAGACSNFSZCU-UHFFFAOYSA-N (3-chlorophenyl)boronic acid Chemical compound OB(O)C1=CC=CC(Cl)=C1 SDEAGACSNFSZCU-UHFFFAOYSA-N 0.000 description 1
- NLLGFYPSWCMUIV-UHFFFAOYSA-N (3-methoxyphenyl)boronic acid Chemical compound COC1=CC=CC(B(O)O)=C1 NLLGFYPSWCMUIV-UHFFFAOYSA-N 0.000 description 1
- XRNVSPDQTPVECU-UHFFFAOYSA-N (4-bromophenyl)methanamine Chemical compound NCC1=CC=C(Br)C=C1 XRNVSPDQTPVECU-UHFFFAOYSA-N 0.000 description 1
- ARMLPWLSNRQUPV-UHFFFAOYSA-N (4-bromophenyl)methylcarbamic acid Chemical compound OC(=O)NCC1=CC=C(Br)C=C1 ARMLPWLSNRQUPV-UHFFFAOYSA-N 0.000 description 1
- CAYQIZIAYYNFCS-UHFFFAOYSA-N (4-chlorophenyl)boronic acid Chemical compound OB(O)C1=CC=C(Cl)C=C1 CAYQIZIAYYNFCS-UHFFFAOYSA-N 0.000 description 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- UKGJZDSUJSPAJL-YPUOHESYSA-N (e)-n-[(1r)-1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-3-[2-propyl-6-(trifluoromethyl)pyridin-3-yl]prop-2-enamide Chemical compound CCCC1=NC(C(F)(F)F)=CC=C1\C=C\C(=O)N[C@H](C)C1=CC(F)=C(NS(C)(=O)=O)C(F)=C1 UKGJZDSUJSPAJL-YPUOHESYSA-N 0.000 description 1
- ZGYIXVSQHOKQRZ-COIATFDQSA-N (e)-n-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3s)-oxolan-3-yl]oxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide Chemical compound N#CC1=CN=C2C=C(O[C@@H]3COCC3)C(NC(=O)/C=C/CN(C)C)=CC2=C1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ZGYIXVSQHOKQRZ-COIATFDQSA-N 0.000 description 1
- UKVYVZLTGQVOPX-IHWYPQMZSA-N (z)-3-aminobut-2-enoic acid Chemical compound C\C(N)=C\C(O)=O UKVYVZLTGQVOPX-IHWYPQMZSA-N 0.000 description 1
- RKOUFQLNMRAACI-UHFFFAOYSA-N 1,1,1-trifluoro-2-iodoethane Chemical compound FC(F)(F)CI RKOUFQLNMRAACI-UHFFFAOYSA-N 0.000 description 1
- 125000004605 1,2,3,4-tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 1
- 125000004607 1,2,3,4-tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 description 1
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 1
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 1
- 125000004517 1,2,5-thiadiazolyl group Chemical group 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- CFGDUGSIBUXRMR-UHFFFAOYSA-N 1,2-dihydropyrrol-2-ide Chemical compound C=1C=[C-]NC=1 CFGDUGSIBUXRMR-UHFFFAOYSA-N 0.000 description 1
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- ZFLRKAMKGYNFPH-UHFFFAOYSA-N 1,3-dichloro-5-(chloromethyl)benzene Chemical compound ClCC1=CC(Cl)=CC(Cl)=C1 ZFLRKAMKGYNFPH-UHFFFAOYSA-N 0.000 description 1
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- OGYGFUAIIOPWQD-UHFFFAOYSA-N 1,3-thiazolidine Chemical compound C1CSCN1 OGYGFUAIIOPWQD-UHFFFAOYSA-N 0.000 description 1
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical compound C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 description 1
- RILCBGJDWRQLDL-UHFFFAOYSA-N 1-(1-methyl-2H-pyridin-4-yl)piperazine Chemical compound CN1CC=C(C=C1)N1CCNCC1 RILCBGJDWRQLDL-UHFFFAOYSA-N 0.000 description 1
- APWRZPQBPCAXFP-UHFFFAOYSA-N 1-(1-oxo-2H-isoquinolin-5-yl)-5-(trifluoromethyl)-N-[2-(trifluoromethyl)pyridin-4-yl]pyrazole-4-carboxamide Chemical compound O=C1NC=CC2=C(C=CC=C12)N1N=CC(=C1C(F)(F)F)C(=O)NC1=CC(=NC=C1)C(F)(F)F APWRZPQBPCAXFP-UHFFFAOYSA-N 0.000 description 1
- JJGAYYBQGNJNJQ-UHFFFAOYSA-N 1-(2,2,2-trifluoroethyl)piperidin-4-amine Chemical compound NC1CCN(CC(F)(F)F)CC1 JJGAYYBQGNJNJQ-UHFFFAOYSA-N 0.000 description 1
- CPMKXPQXWCSHCS-UHFFFAOYSA-N 1-(2-chloropyrimidin-4-yl)piperidin-4-amine;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C1CC(N)CCN1C1=CC=NC(Cl)=N1 CPMKXPQXWCSHCS-UHFFFAOYSA-N 0.000 description 1
- VCGSBVBNHNWXMC-UHFFFAOYSA-N 1-(3,5-dichlorophenyl)indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1C1=CC(Cl)=CC(Cl)=C1 VCGSBVBNHNWXMC-UHFFFAOYSA-N 0.000 description 1
- PHYBBHZCDQLDTJ-UHFFFAOYSA-N 1-(3-methoxybenzoyl)indole-2-carboxylic acid Chemical compound COC1=CC=CC(C(=O)N2C3=CC=CC=C3C=C2C(O)=O)=C1 PHYBBHZCDQLDTJ-UHFFFAOYSA-N 0.000 description 1
- BVSIBCJUGIVAKQ-UHFFFAOYSA-N 1-(3-methoxyphenyl)-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound COC1=CC=CC(N2C3=CC=CC=C3C=C2C(=O)NC2CCN(CC2)C(C)C)=C1 BVSIBCJUGIVAKQ-UHFFFAOYSA-N 0.000 description 1
- PLCKSNLLWTWSJC-UHFFFAOYSA-N 1-(3-methoxyphenyl)sulfonylindole-2-carboxylic acid Chemical compound COC1=CC=CC(S(=O)(=O)N2C3=CC=CC=C3C=C2C(O)=O)=C1 PLCKSNLLWTWSJC-UHFFFAOYSA-N 0.000 description 1
- PURSZYWBIQIANP-UHFFFAOYSA-N 1-(bromomethyl)-2-chlorobenzene Chemical compound ClC1=CC=CC=C1CBr PURSZYWBIQIANP-UHFFFAOYSA-N 0.000 description 1
- LZIYAIRGDHSVED-UHFFFAOYSA-N 1-(bromomethyl)-3-chlorobenzene Chemical compound ClC1=CC=CC(CBr)=C1 LZIYAIRGDHSVED-UHFFFAOYSA-N 0.000 description 1
- ZKSOJQDNSNJIQW-UHFFFAOYSA-N 1-(bromomethyl)-3-methoxybenzene Chemical compound COC1=CC=CC(CBr)=C1 ZKSOJQDNSNJIQW-UHFFFAOYSA-N 0.000 description 1
- JDNPUJCKXLOHOW-UHFFFAOYSA-N 1-(bromomethyl)-4-(trifluoromethoxy)benzene Chemical compound FC(F)(F)OC1=CC=C(CBr)C=C1 JDNPUJCKXLOHOW-UHFFFAOYSA-N 0.000 description 1
- CCAWDIFJOBKBSE-UHFFFAOYSA-N 1-(chloromethyl)-3,5-dimethoxybenzene Chemical compound COC1=CC(CCl)=CC(OC)=C1 CCAWDIFJOBKBSE-UHFFFAOYSA-N 0.000 description 1
- MOHYOXXOKFQHDC-UHFFFAOYSA-N 1-(chloromethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1 MOHYOXXOKFQHDC-UHFFFAOYSA-N 0.000 description 1
- XZYLSJPLCLKCMR-UHFFFAOYSA-N 1-(pyridin-4-ylmethyl)piperazine Chemical compound C=1C=NC=CC=1CN1CCNCC1 XZYLSJPLCLKCMR-UHFFFAOYSA-N 0.000 description 1
- KXIXHISTUVHOCY-UHFFFAOYSA-N 1-Isopropyl-Piperidine Natural products CC(C)N1CCCCC1 KXIXHISTUVHOCY-UHFFFAOYSA-N 0.000 description 1
- CZCYDHPRQQYRNO-UHFFFAOYSA-N 1-[(1,7-dichloroisoquinolin-3-yl)methyl]indole-2-carboxylic acid Chemical compound C1=C(Cl)C=C2C(Cl)=NC(CN3C4=CC=CC=C4C=C3C(=O)O)=CC2=C1 CZCYDHPRQQYRNO-UHFFFAOYSA-N 0.000 description 1
- PYKUMPNYIMWHHN-UHFFFAOYSA-N 1-[(1-methylimidazol-2-yl)methyl]piperidin-4-amine Chemical compound CN1C=CN=C1CN1CCC(N)CC1 PYKUMPNYIMWHHN-UHFFFAOYSA-N 0.000 description 1
- OGZPXUGZOKKVSQ-UHFFFAOYSA-N 1-[(2,4-dichlorophenyl)methyl]indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1CC1=CC=C(Cl)C=C1Cl OGZPXUGZOKKVSQ-UHFFFAOYSA-N 0.000 description 1
- PVDKWERHFVOLOH-UHFFFAOYSA-N 1-[(2-chlorophenyl)methyl]-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=CC=CC=C2N1CC1=CC=CC=C1Cl PVDKWERHFVOLOH-UHFFFAOYSA-N 0.000 description 1
- GLYSMLQYMKZMKC-UHFFFAOYSA-N 1-[(3,5-dimethoxyphenyl)methyl]-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound COC1=CC(OC)=CC(CN2C3=CC=CC=C3C=C2C(=O)NC2CCN(CC2)C(C)C)=C1 GLYSMLQYMKZMKC-UHFFFAOYSA-N 0.000 description 1
- CVPGDWLGSKSTNB-UHFFFAOYSA-N 1-[(3-chlorophenyl)methyl]indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1CC1=CC=CC(Cl)=C1 CVPGDWLGSKSTNB-UHFFFAOYSA-N 0.000 description 1
- BWFWPGPBRJZFKC-UHFFFAOYSA-N 1-[(3-methoxyphenyl)methyl]-5-methyl-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound COC1=CC=CC(CN2C3=CC=C(C)C=C3C=C2C(=O)NC2CCN(CC2)C(C)C)=C1 BWFWPGPBRJZFKC-UHFFFAOYSA-N 0.000 description 1
- BZQFXVVHJMEYGC-UHFFFAOYSA-N 1-[(3-methoxyphenyl)methyl]-5-phenylmethoxy-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound COC1=CC=CC(CN2C3=CC=C(OCC=4C=CC=CC=4)C=C3C=C2C(=O)NC2CCN(CC2)C(C)C)=C1 BZQFXVVHJMEYGC-UHFFFAOYSA-N 0.000 description 1
- AVAVKXFPPIKFLU-UHFFFAOYSA-N 1-[2-(2,4-dichlorophenyl)ethyl]indole-2-carboxylic acid Chemical compound OC(=O)C1=CC2=CC=CC=C2N1CCC1=CC=C(Cl)C=C1Cl AVAVKXFPPIKFLU-UHFFFAOYSA-N 0.000 description 1
- YZUPZGFPHUVJKC-UHFFFAOYSA-N 1-bromo-2-methoxyethane Chemical compound COCCBr YZUPZGFPHUVJKC-UHFFFAOYSA-N 0.000 description 1
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 1
- BTUGGGLMQBJCBN-UHFFFAOYSA-N 1-iodo-2-methylpropane Chemical compound CC(C)CI BTUGGGLMQBJCBN-UHFFFAOYSA-N 0.000 description 1
- UEBFLTZXUXZPJO-UHFFFAOYSA-N 1-methylimidazole-2-carbaldehyde Chemical compound CN1C=CN=C1C=O UEBFLTZXUXZPJO-UHFFFAOYSA-N 0.000 description 1
- FLQSRSQNICPZIH-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-amine Chemical compound CS(=O)(=O)N1CCC(N)CC1 FLQSRSQNICPZIH-UHFFFAOYSA-N 0.000 description 1
- YJBJPTXFLMTWCS-UHFFFAOYSA-N 1-propan-2-yl-N-(1-propan-2-ylpiperidin-4-yl)piperidin-4-amine Chemical compound C1CN(C(C)C)CCC1NC1CCN(C(C)C)CC1 YJBJPTXFLMTWCS-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- MXQDWYDUBAAGAF-UHFFFAOYSA-N 1-pyrimidin-4-ylpiperidin-4-amine;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C1CC(N)CCN1C1=CC=NC=N1 MXQDWYDUBAAGAF-UHFFFAOYSA-N 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000005955 1H-indazolyl group Chemical group 0.000 description 1
- MBNROFBGTNXXMX-UHFFFAOYSA-N 1h-indole-2,3-dicarboxylic acid Chemical compound C1=CC=C2C(C(O)=O)=C(C(=O)O)NC2=C1 MBNROFBGTNXXMX-UHFFFAOYSA-N 0.000 description 1
- OHZAHWOAMVVGEL-UHFFFAOYSA-N 2,2'-bithiophene Chemical compound C1=CSC(C=2SC=CC=2)=C1 OHZAHWOAMVVGEL-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- IRSVDHPYXFLLDS-UHFFFAOYSA-N 2,4-dichloro-1-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1Cl IRSVDHPYXFLLDS-UHFFFAOYSA-N 0.000 description 1
- BTTNYQZNBZNDOR-UHFFFAOYSA-N 2,4-dichloropyrimidine Chemical compound ClC1=CC=NC(Cl)=N1 BTTNYQZNBZNDOR-UHFFFAOYSA-N 0.000 description 1
- JIJGKPVJAALUQQ-UHFFFAOYSA-N 2-(2,4-dichlorophenyl)ethanol Chemical compound OCCC1=CC=C(Cl)C=C1Cl JIJGKPVJAALUQQ-UHFFFAOYSA-N 0.000 description 1
- UPPGEJSCUZMCMW-UHFFFAOYSA-N 2-(3-methoxyphenyl)ethanol Chemical compound COC1=CC=CC(CCO)=C1 UPPGEJSCUZMCMW-UHFFFAOYSA-N 0.000 description 1
- HZFRKZWBVUJYDA-UHFFFAOYSA-N 2-(4-chlorophenyl)ethanol Chemical compound OCCC1=CC=C(Cl)C=C1 HZFRKZWBVUJYDA-UHFFFAOYSA-N 0.000 description 1
- ITNVXASBWCQERP-UHFFFAOYSA-N 2-(bromomethyl)-5-(5-chlorothiophen-2-yl)-1,3,4-thiadiazole Chemical compound S1C(Cl)=CC=C1C1=NN=C(CBr)S1 ITNVXASBWCQERP-UHFFFAOYSA-N 0.000 description 1
- IMSODMZESSGVBE-UHFFFAOYSA-N 2-Oxazoline Chemical compound C1CN=CO1 IMSODMZESSGVBE-UHFFFAOYSA-N 0.000 description 1
- VRPJIFMKZZEXLR-UHFFFAOYSA-N 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid Chemical compound CC(C)(C)OC(=O)NCC(O)=O VRPJIFMKZZEXLR-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- IOYOCGYWSORTCV-UHFFFAOYSA-N 2-amino-1-(4-aminopiperidin-1-yl)ethanone Chemical compound NCC(=O)N1CCC(N)CC1 IOYOCGYWSORTCV-UHFFFAOYSA-N 0.000 description 1
- QKNYBSVHEMOAJP-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydron;chloride Chemical compound Cl.OCC(N)(CO)CO QKNYBSVHEMOAJP-UHFFFAOYSA-N 0.000 description 1
- KHMNCHDUSFCTGK-UHFFFAOYSA-N 2-aminophenylacetic acid Chemical class NC1=CC=CC=C1CC(O)=O KHMNCHDUSFCTGK-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- 125000006029 2-methyl-2-butenyl group Chemical group 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- CGCWRLDEYHZQCW-UHFFFAOYSA-N 2-nitrophenylpyruvic acid Chemical class OC(=O)C(=O)CC1=CC=CC=C1[N+]([O-])=O CGCWRLDEYHZQCW-UHFFFAOYSA-N 0.000 description 1
- PLAZTCDQAHEYBI-UHFFFAOYSA-N 2-nitrotoluene Chemical class CC1=CC=CC=C1[N+]([O-])=O PLAZTCDQAHEYBI-UHFFFAOYSA-N 0.000 description 1
- VSWICNJIUPRZIK-UHFFFAOYSA-N 2-piperideine Chemical compound C1CNC=CC1 VSWICNJIUPRZIK-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 1
- YZBIEKKAKFEWIL-UHFFFAOYSA-N 3-(2-carboxyethyl)-6-chloro-1h-indole-2-carboxylic acid Chemical compound ClC1=CC=C2C(CCC(=O)O)=C(C(O)=O)NC2=C1 YZBIEKKAKFEWIL-UHFFFAOYSA-N 0.000 description 1
- KQSJKIFUOUFTQO-UHFFFAOYSA-N 3-(2-ethoxy-2-oxoethyl)-1h-indole-2-carboxylic acid Chemical compound C1=CC=C2C(CC(=O)OCC)=C(C(O)=O)NC2=C1 KQSJKIFUOUFTQO-UHFFFAOYSA-N 0.000 description 1
- BJPTVUHDNMMUSO-UHFFFAOYSA-N 3-(bromomethyl)-1,7-dichloroisoquinoline Chemical compound C1=C(CBr)N=C(Cl)C2=CC(Cl)=CC=C21 BJPTVUHDNMMUSO-UHFFFAOYSA-N 0.000 description 1
- ORRDZVRYRNYLMB-UHFFFAOYSA-N 3-(bromomethyl)benzamide Chemical compound NC(=O)C1=CC=CC(CBr)=C1 ORRDZVRYRNYLMB-UHFFFAOYSA-N 0.000 description 1
- JKSRJLOJDZYJLA-UHFFFAOYSA-N 3-(chloromethyl)-5-(4-chlorophenyl)-1,2-oxazole Chemical compound O1N=C(CCl)C=C1C1=CC=C(Cl)C=C1 JKSRJLOJDZYJLA-UHFFFAOYSA-N 0.000 description 1
- YGYGASJNJTYNOL-CQSZACIVSA-N 3-[(4r)-2,2-dimethyl-1,1-dioxothian-4-yl]-5-(4-fluorophenyl)-1h-indole-7-carboxamide Chemical compound C1CS(=O)(=O)C(C)(C)C[C@@H]1C1=CNC2=C(C(N)=O)C=C(C=3C=CC(F)=CC=3)C=C12 YGYGASJNJTYNOL-CQSZACIVSA-N 0.000 description 1
- SRVXSISGYBMIHR-UHFFFAOYSA-N 3-[3-[3-(2-amino-2-oxoethyl)phenyl]-5-chlorophenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid Chemical compound S1C(C)=CN=C1C(CC(O)=O)C1=CC(Cl)=CC(C=2C=C(CC(N)=O)C=CC=2)=C1 SRVXSISGYBMIHR-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical class NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 1
- IHBSBVLRBQGEMQ-UHFFFAOYSA-N 3-fluoro-2,4,6-trimethylpyridine Chemical compound CC1=CC(C)=C(F)C(C)=N1 IHBSBVLRBQGEMQ-UHFFFAOYSA-N 0.000 description 1
- CELKOWQJPVJKIL-UHFFFAOYSA-N 3-fluoropyridine Chemical compound FC1=CC=CN=C1 CELKOWQJPVJKIL-UHFFFAOYSA-N 0.000 description 1
- MVKZEMKDJLLFEP-UHFFFAOYSA-N 3-iodo-1-methylindole-2-carboxylic acid Chemical compound C1=CC=C2N(C)C(C(O)=O)=C(I)C2=C1 MVKZEMKDJLLFEP-UHFFFAOYSA-N 0.000 description 1
- BKUHHQRXJHGQCF-UHFFFAOYSA-N 3-iodo-1h-indole-2-carboxylic acid Chemical compound C1=CC=C2C(I)=C(C(=O)O)NC2=C1 BKUHHQRXJHGQCF-UHFFFAOYSA-N 0.000 description 1
- JHJKSEKUZNJKGO-UHFFFAOYSA-N 3-methoxybenzenesulfonyl chloride Chemical compound COC1=CC=CC(S(Cl)(=O)=O)=C1 JHJKSEKUZNJKGO-UHFFFAOYSA-N 0.000 description 1
- RUQIUASLAXJZIE-UHFFFAOYSA-N 3-methoxybenzoyl chloride Chemical compound COC1=CC=CC(C(Cl)=O)=C1 RUQIUASLAXJZIE-UHFFFAOYSA-N 0.000 description 1
- NCXGWFIXUJHVLI-UHFFFAOYSA-N 3-methyl-2-indolic acid Chemical compound C1=CC=C2C(C)=C(C(O)=O)NC2=C1 NCXGWFIXUJHVLI-UHFFFAOYSA-N 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- UDFORAXSNZZHCQ-UHFFFAOYSA-N 3h-indole-2-carboxylic acid Chemical compound C1=CC=C2CC(C(=O)O)=NC2=C1 UDFORAXSNZZHCQ-UHFFFAOYSA-N 0.000 description 1
- DHXISZKSSIWRLH-UHFFFAOYSA-N 4,6-dichloro-1h-indole-2-carboxylic acid Chemical compound C1=C(Cl)C=C2NC(C(=O)O)=CC2=C1Cl DHXISZKSSIWRLH-UHFFFAOYSA-N 0.000 description 1
- GDCKIKSQIWWVNR-UHFFFAOYSA-N 4,6-dimethoxy-1h-indole-2-carboxylic acid Chemical compound COC1=CC(OC)=C2C=C(C(O)=O)NC2=C1 GDCKIKSQIWWVNR-UHFFFAOYSA-N 0.000 description 1
- LMYQVAQDBJJBEM-UHFFFAOYSA-N 4,7-dichloro-1h-indole-2-carboxylic acid Chemical compound C1=CC(Cl)=C2NC(C(=O)O)=CC2=C1Cl LMYQVAQDBJJBEM-UHFFFAOYSA-N 0.000 description 1
- FJWNGDWJFIQNEG-UHFFFAOYSA-N 4,7-dimethoxy-1h-indole-2-carboxylic acid Chemical compound COC1=CC=C(OC)C2=C1C=C(C(O)=O)N2 FJWNGDWJFIQNEG-UHFFFAOYSA-N 0.000 description 1
- DXGLNXJHHJNUHD-UHFFFAOYSA-N 4,7-dimethyl-1h-indole-2-carboxylic acid Chemical compound CC1=CC=C(C)C2=C1C=C(C(O)=O)N2 DXGLNXJHHJNUHD-UHFFFAOYSA-N 0.000 description 1
- UEJQTBKTWJQBRN-UHFFFAOYSA-N 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole Chemical compound ClCC1=CSC(C=2C=CC(Cl)=CC=2)=N1 UEJQTBKTWJQBRN-UHFFFAOYSA-N 0.000 description 1
- QCLFSYYUWPUWQR-UHFFFAOYSA-N 4-(chloromethyl)-5-methyl-1,3-dioxol-2-one Chemical compound CC=1OC(=O)OC=1CCl QCLFSYYUWPUWQR-UHFFFAOYSA-N 0.000 description 1
- MOVKDRSEEJWXRI-UHFFFAOYSA-N 4-(trifluoromethyl)-1h-indole-2-carboxylic acid Chemical compound C1=CC=C2NC(C(=O)O)=CC2=C1C(F)(F)F MOVKDRSEEJWXRI-UHFFFAOYSA-N 0.000 description 1
- XYTQLEKYLFGMGB-UHFFFAOYSA-N 4-[(2-methylpropan-2-yl)oxy]pyridine Chemical compound CC(C)(C)OC1=CC=NC=C1 XYTQLEKYLFGMGB-UHFFFAOYSA-N 0.000 description 1
- VJPPLCNBDLZIFG-ZDUSSCGKSA-N 4-[(3S)-3-(but-2-ynoylamino)piperidin-1-yl]-5-fluoro-2,3-dimethyl-1H-indole-7-carboxamide Chemical compound C(C#CC)(=O)N[C@@H]1CN(CCC1)C1=C2C(=C(NC2=C(C=C1F)C(=O)N)C)C VJPPLCNBDLZIFG-ZDUSSCGKSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- FPLDDZRJTOXFCB-UHFFFAOYSA-N 4-amino-3-iodobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1I FPLDDZRJTOXFCB-UHFFFAOYSA-N 0.000 description 1
- WUCPCORZZJWVHG-UHFFFAOYSA-N 4-bromo-2-propylthiophene Chemical compound CCCC1=CC(Br)=CS1 WUCPCORZZJWVHG-UHFFFAOYSA-N 0.000 description 1
- VXZHQADIRFFCMJ-UHFFFAOYSA-N 4-chloro-1h-indole-2-carboxylic acid Chemical compound C1=CC=C2NC(C(=O)O)=CC2=C1Cl VXZHQADIRFFCMJ-UHFFFAOYSA-N 0.000 description 1
- CSFDTBRRIBJILD-UHFFFAOYSA-N 4-chloro-2-fluoroaniline Chemical compound NC1=CC=C(Cl)C=C1F CSFDTBRRIBJILD-UHFFFAOYSA-N 0.000 description 1
- AEOMOQMOFDQVQH-UHFFFAOYSA-N 4-methoxy-1-[(3-methoxyphenyl)methyl]-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound COC1=CC=CC(CN2C3=CC=CC(OC)=C3C=C2C(=O)NC2CCN(CC2)C(C)C)=C1 AEOMOQMOFDQVQH-UHFFFAOYSA-N 0.000 description 1
- QMSCXKCJGFIXDF-UHFFFAOYSA-N 4-methyl-1h-indole-2-carboxylic acid Chemical compound CC1=CC=CC2=C1C=C(C(O)=O)N2 QMSCXKCJGFIXDF-UHFFFAOYSA-N 0.000 description 1
- UNKDCRUEJJZIIB-UHFFFAOYSA-N 4-piperidin-4-yloxypyridine Chemical compound C1CNCCC1OC1=CC=NC=C1 UNKDCRUEJJZIIB-UHFFFAOYSA-N 0.000 description 1
- KNDQGPOMRXDESL-UHFFFAOYSA-N 4-propan-2-ylpiperidin-1-amine Chemical compound CC(C)C1CCN(N)CC1 KNDQGPOMRXDESL-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- UZHQHNDRVITJPL-UHFFFAOYSA-N 5,6-dimethoxy-1h-indole-2-carboxylic acid Chemical compound C1=C(OC)C(OC)=CC2=C1NC(C(O)=O)=C2 UZHQHNDRVITJPL-UHFFFAOYSA-N 0.000 description 1
- QILAXMNESNFYJG-UHFFFAOYSA-N 5,7-dichloro-1h-indole-2-carboxylic acid Chemical compound ClC1=CC(Cl)=C2NC(C(=O)O)=CC2=C1 QILAXMNESNFYJG-UHFFFAOYSA-N 0.000 description 1
- WVZUEYDXSLBMEK-UHFFFAOYSA-N 5,7-difluoro-1h-indole-2-carboxylic acid Chemical compound FC1=CC(F)=C2NC(C(=O)O)=CC2=C1 WVZUEYDXSLBMEK-UHFFFAOYSA-N 0.000 description 1
- HBGBCVMONHPTMC-UHFFFAOYSA-N 5-(bromomethyl)-2-(5-chlorothiophen-2-yl)-1,3-thiazole Chemical compound S1C(Cl)=CC=C1C1=NC=C(CBr)S1 HBGBCVMONHPTMC-UHFFFAOYSA-N 0.000 description 1
- BZFMYQAAPNZQHL-UHFFFAOYSA-N 5-(bromomethyl)-3-(5-chlorothiophen-2-yl)-1,2-oxazole Chemical compound S1C(Cl)=CC=C1C1=NOC(CBr)=C1 BZFMYQAAPNZQHL-UHFFFAOYSA-N 0.000 description 1
- LGOOOJLVNCQMNA-UHFFFAOYSA-N 5-(chloromethyl)-3-(4-chlorophenyl)-2h-oxadiazole Chemical compound N1OC(CCl)=CN1C1=CC=C(Cl)C=C1 LGOOOJLVNCQMNA-UHFFFAOYSA-N 0.000 description 1
- BIMHWDJKNOMNLD-UHFFFAOYSA-N 5-Hydroxyindole-2-carboxylic acid Chemical compound OC1=CC=C2NC(C(=O)O)=CC2=C1 BIMHWDJKNOMNLD-UHFFFAOYSA-N 0.000 description 1
- YUMRTSLYUVLHQK-UHFFFAOYSA-N 5-bromo-3-methyl-1h-indole-2-carboxylic acid Chemical compound C1=C(Br)C=C2C(C)=C(C(O)=O)NC2=C1 YUMRTSLYUVLHQK-UHFFFAOYSA-N 0.000 description 1
- PCHBMNCFKJKQPA-UHFFFAOYSA-N 5-chlorothiophen-2-amine Chemical compound NC1=CC=C(Cl)S1 PCHBMNCFKJKQPA-UHFFFAOYSA-N 0.000 description 1
- AXAUNIVIEFHPSY-UHFFFAOYSA-N 5-cyano-1h-indole-2-carboxylic acid Chemical compound N#CC1=CC=C2NC(C(=O)O)=CC2=C1 AXAUNIVIEFHPSY-UHFFFAOYSA-N 0.000 description 1
- WTXBRZCVLDTWLP-UHFFFAOYSA-N 5-fluoro-1H-indole-2-carboxylic acid Chemical compound FC1=CC=C2NC(C(=O)O)=CC2=C1 WTXBRZCVLDTWLP-UHFFFAOYSA-N 0.000 description 1
- OVGNNEOTSYEFRR-UHFFFAOYSA-N 5-methoxy-1-[(3-methoxyphenyl)methyl]-n-(1-propan-2-ylpiperidin-4-yl)indole-2-carboxamide Chemical compound COC1=CC=CC(CN2C3=CC=C(OC)C=C3C=C2C(=O)NC2CCN(CC2)C(C)C)=C1 OVGNNEOTSYEFRR-UHFFFAOYSA-N 0.000 description 1
- YEBJVSLNUMZXRJ-UHFFFAOYSA-N 5-methoxyindole-2-carboxylic acid Chemical compound COC1=CC=C2NC(C(O)=O)=CC2=C1 YEBJVSLNUMZXRJ-UHFFFAOYSA-N 0.000 description 1
- OFKCWDHRSIVZST-UHFFFAOYSA-N 7-(2,2-dimethylpropanoylamino)-1h-indole-2-carboxylic acid Chemical compound CC(C)(C)C(=O)NC1=CC=CC2=C1NC(C(O)=O)=C2 OFKCWDHRSIVZST-UHFFFAOYSA-N 0.000 description 1
- MITRMAZEKYLIQC-UHFFFAOYSA-N 7-(bromomethyl)quinazolin-4-amine Chemical compound BrCC1=CC=C2C(N)=NC=NC2=C1 MITRMAZEKYLIQC-UHFFFAOYSA-N 0.000 description 1
- KKJUPNGICOCCDW-UHFFFAOYSA-N 7-N,N-Dimethylamino-1,2,3,4,5-pentathiocyclooctane Chemical compound CN(C)C1CSSSSSC1 KKJUPNGICOCCDW-UHFFFAOYSA-N 0.000 description 1
- UJHWOZFZLVVMIX-UHFFFAOYSA-N 7-[(4-methoxyphenyl)sulfonylamino]-1h-indole-2-carboxylic acid Chemical compound C1=CC(OC)=CC=C1S(=O)(=O)NC1=CC=CC2=C1NC(C(O)=O)=C2 UJHWOZFZLVVMIX-UHFFFAOYSA-N 0.000 description 1
- CZBVGARLPABUQC-UHFFFAOYSA-N 7-[[3-(trifluoromethyl)benzoyl]amino]-1h-indole-2-carboxylic acid Chemical compound C=12NC(C(=O)O)=CC2=CC=CC=1NC(=O)C1=CC=CC(C(F)(F)F)=C1 CZBVGARLPABUQC-UHFFFAOYSA-N 0.000 description 1
- BIUCOFQROHIAEO-UHFFFAOYSA-N 7-nitroindole-2-carboxylic acid Chemical compound C1=CC([N+]([O-])=O)=C2NC(C(=O)O)=CC2=C1 BIUCOFQROHIAEO-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 206010001052 Acute respiratory distress syndrome Diseases 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- 208000037260 Atherosclerotic Plaque Diseases 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 108010017384 Blood Proteins Proteins 0.000 description 1
- 102000004506 Blood Proteins Human genes 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- NMOZPGLLDPWJEC-UHFFFAOYSA-N C(C)(C)(C)OC(=O)N1C(=C(C2=CC=CC=C12)C)C(=O)O Chemical compound C(C)(C)(C)OC(=O)N1C(=C(C2=CC=CC=C12)C)C(=O)O NMOZPGLLDPWJEC-UHFFFAOYSA-N 0.000 description 1
- BFVIXUFXKMERNY-UHFFFAOYSA-N C1(CC1)N1CCC(CC1)NC(O)=O Chemical compound C1(CC1)N1CCC(CC1)NC(O)=O BFVIXUFXKMERNY-UHFFFAOYSA-N 0.000 description 1
- RXZIOPPIDRGYBT-UHFFFAOYSA-N CC(C)N(CC1)CCC1N.COC(C=C1)=CC=C1N1C2=CC=CC=C2C=C1C(O)=O Chemical compound CC(C)N(CC1)CCC1N.COC(C=C1)=CC=C1N1C2=CC=CC=C2C=C1C(O)=O RXZIOPPIDRGYBT-UHFFFAOYSA-N 0.000 description 1
- TVVHCIFHVIWSTD-UHFFFAOYSA-N CC(C)N(CC1)CCC1N.OC(C1=CC2=CC=CC=C2N1CC(N=C(C1=C2)Cl)=CC1=CC=C2Cl)=O Chemical compound CC(C)N(CC1)CCC1N.OC(C1=CC2=CC=CC=C2N1CC(N=C(C1=C2)Cl)=CC1=CC=C2Cl)=O TVVHCIFHVIWSTD-UHFFFAOYSA-N 0.000 description 1
- MJRLHTMCUDJMIT-UHFFFAOYSA-N CN(CC1)CCC1N.OC(C1=CC2=CC=CC=C2N1CC1=NOC(C(S2)=CC=C2Cl)=C1)=O Chemical compound CN(CC1)CCC1N.OC(C1=CC2=CC=CC=C2N1CC1=NOC(C(S2)=CC=C2Cl)=C1)=O MJRLHTMCUDJMIT-UHFFFAOYSA-N 0.000 description 1
- BXLVZDRBGMNPTC-UHFFFAOYSA-N COC1=CC=CC(CCOCCC=2C=C(OC)C=CC=2)=C1 Chemical compound COC1=CC=CC(CCOCCC=2C=C(OC)C=CC=2)=C1 BXLVZDRBGMNPTC-UHFFFAOYSA-N 0.000 description 1
- 101100366336 Caenorhabditis elegans spe-39 gene Proteins 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- 241001466804 Carnivora Species 0.000 description 1
- 241000283153 Cetacea Species 0.000 description 1
- 241001235133 Chetia Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 229910002514 Co–Co Inorganic materials 0.000 description 1
- 206010051055 Deep vein thrombosis Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 244000078127 Eleusine coracana Species 0.000 description 1
- 235000013499 Eleusine coracana subsp coracana Nutrition 0.000 description 1
- 208000005189 Embolism Diseases 0.000 description 1
- 241000490077 Eupetes Species 0.000 description 1
- GISRWBROCYNDME-PELMWDNLSA-N F[C@H]1[C@H]([C@H](NC1=O)COC1=NC=CC2=CC(=C(C=C12)OC)C(=O)N)C Chemical compound F[C@H]1[C@H]([C@H](NC1=O)COC1=NC=CC2=CC(=C(C=C12)OC)C(=O)N)C GISRWBROCYNDME-PELMWDNLSA-N 0.000 description 1
- 108010029144 Factor IIa Proteins 0.000 description 1
- 229940123583 Factor Xa inhibitor Drugs 0.000 description 1
- 108010088842 Fibrinolysin Proteins 0.000 description 1
- 238000006783 Fischer indole synthesis reaction Methods 0.000 description 1
- 229930195212 Fischerindole Natural products 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- WRYCSMQKUKOKBP-UHFFFAOYSA-N Imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229910013504 M-O-M Inorganic materials 0.000 description 1
- 238000006861 Madelung synthesis reaction Methods 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- 239000010022 Myron Substances 0.000 description 1
- 241001439614 Myron Species 0.000 description 1
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-Chlorosuccinimide Substances ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 1
- FEYNFHSRETUBEM-UHFFFAOYSA-N N-[3-(1,1-difluoroethyl)phenyl]-1-(4-methoxyphenyl)-3-methyl-5-oxo-4H-pyrazole-4-carboxamide Chemical compound COc1ccc(cc1)N1N=C(C)C(C(=O)Nc2cccc(c2)C(C)(F)F)C1=O FEYNFHSRETUBEM-UHFFFAOYSA-N 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- WYNCHZVNFNFDNH-UHFFFAOYSA-N Oxazolidine Chemical compound C1COCN1 WYNCHZVNFNFDNH-UHFFFAOYSA-N 0.000 description 1
- 241000282520 Papio Species 0.000 description 1
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 1
- 208000010378 Pulmonary Embolism Diseases 0.000 description 1
- 208000013616 Respiratory Distress Syndrome Diseases 0.000 description 1
- 241000238370 Sepia Species 0.000 description 1
- 206010040047 Sepsis Diseases 0.000 description 1
- 206010040070 Septic Shock Diseases 0.000 description 1
- 108010022999 Serine Proteases Proteins 0.000 description 1
- 102000012479 Serine Proteases Human genes 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229940122388 Thrombin inhibitor Drugs 0.000 description 1
- MZZINWWGSYUHGU-UHFFFAOYSA-J ToTo-1 Chemical compound [I-].[I-].[I-].[I-].C12=CC=CC=C2C(C=C2N(C3=CC=CC=C3S2)C)=CC=[N+]1CCC[N+](C)(C)CCC[N+](C)(C)CCC[N+](C1=CC=CC=C11)=CC=C1C=C1N(C)C2=CC=CC=C2S1 MZZINWWGSYUHGU-UHFFFAOYSA-J 0.000 description 1
- 208000032109 Transient ischaemic attack Diseases 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 108090000631 Trypsin Proteins 0.000 description 1
- 102000004142 Trypsin Human genes 0.000 description 1
- 101150106549 VIPAS39 gene Proteins 0.000 description 1
- 208000036142 Viral infection Diseases 0.000 description 1
- BBAWTPDTGRXPDG-UHFFFAOYSA-N [1,3]thiazolo[4,5-b]pyridine Chemical compound C1=CC=C2SC=NC2=N1 BBAWTPDTGRXPDG-UHFFFAOYSA-N 0.000 description 1
- AGURQGJPANOJHX-UHFFFAOYSA-N [5-(aminomethyl)-4,5-dihydro-1,2-oxazol-3-yl]-pyrrolidin-1-ylmethanone Chemical compound O1C(CN)CC(C(=O)N2CCCC2)=N1 AGURQGJPANOJHX-UHFFFAOYSA-N 0.000 description 1
- 230000003187 abdominal effect Effects 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- 159000000021 acetate salts Chemical class 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 238000007171 acid catalysis Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 208000011341 adult acute respiratory distress syndrome Diseases 0.000 description 1
- 201000000028 adult respiratory distress syndrome Diseases 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- XBGFWVIEJYGZRT-UHFFFAOYSA-N anilino trifluoromethanesulfonate Chemical class FC(F)(F)S(=O)(=O)ONC1=CC=CC=C1 XBGFWVIEJYGZRT-UHFFFAOYSA-N 0.000 description 1
- 238000005349 anion exchange Methods 0.000 description 1
- 230000010100 anticoagulation Effects 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 150000001543 aryl boronic acids Chemical class 0.000 description 1
- 150000001499 aryl bromides Chemical class 0.000 description 1
- 150000001501 aryl fluorides Chemical class 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 125000004931 azocinyl group Chemical group N1=C(C=CC=CC=C1)* 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000004604 benzisothiazolyl group Chemical group S1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 229960004217 benzyl alcohol Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 210000000601 blood cell Anatomy 0.000 description 1
- 230000017531 blood circulation Effects 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- KDPAWGWELVVRCH-UHFFFAOYSA-N bromoacetic acid Chemical compound OC(=O)CBr KDPAWGWELVVRCH-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 125000004623 carbolinyl group Chemical group 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001734 carboxylic acid salts Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000005341 cation exchange Methods 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- DGLFSNZWRYADFC-UHFFFAOYSA-N chembl2334586 Chemical compound C1CCC2=CN=C(N)N=C2C2=C1NC1=CC=C(C#CC(C)(O)C)C=C12 DGLFSNZWRYADFC-UHFFFAOYSA-N 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- 125000004230 chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000010549 co-Evaporation Methods 0.000 description 1
- 230000009852 coagulant defect Effects 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 238000002591 computed tomography Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 238000007887 coronary angioplasty Methods 0.000 description 1
- 208000029078 coronary artery disease Diseases 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- FDODVZVWGKVMBO-UHFFFAOYSA-N cyclohex-2-ene-1,4-diol Chemical compound OC1CCC(O)C=C1 FDODVZVWGKVMBO-UHFFFAOYSA-N 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- CFEWGSQCILPNHD-UHFFFAOYSA-N cyclohexyl 1-(1-cyclohexyloxycarbonyloxyethoxy)ethyl carbonate Chemical compound CC(OC(C)OC(=O)OC1CCCCC1)OC(=O)OC2CCCCC2 CFEWGSQCILPNHD-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- WMKGGPCROCCUDY-PHEQNACWSA-N dibenzylideneacetone Chemical compound C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 WMKGGPCROCCUDY-PHEQNACWSA-N 0.000 description 1
- 229960004132 diethyl ether Drugs 0.000 description 1
- BGRWYRAHAFMIBJ-UHFFFAOYSA-N diisopropylcarbodiimide Natural products CC(C)NC(=O)NC(C)C BGRWYRAHAFMIBJ-UHFFFAOYSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- 230000006806 disease prevention Effects 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000012039 electrophile Substances 0.000 description 1
- 238000007345 electrophilic aromatic substitution reaction Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 239000012374 esterification agent Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229940052303 ethers for general anesthesia Drugs 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N ethyl formate Chemical compound CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- JFSPBVWPKOEZCB-UHFFFAOYSA-N fenfuram Chemical compound O1C=CC(C(=O)NC=2C=CC=CC=2)=C1C JFSPBVWPKOEZCB-UHFFFAOYSA-N 0.000 description 1
- KTWOOEGAPBSYNW-UHFFFAOYSA-N ferrocene Chemical compound [Fe+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 KTWOOEGAPBSYNW-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000003682 fluorination reaction Methods 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000004519 grease Substances 0.000 description 1
- ZRALSGWEFCBTJO-UHFFFAOYSA-N guanidine group Chemical group NC(=N)N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- KRGRHIQRVYJCIG-UHFFFAOYSA-N hydron;1-propan-2-ylpiperidin-4-amine;dichloride Chemical compound Cl.Cl.CC(C)N1CCC(N)CC1 KRGRHIQRVYJCIG-UHFFFAOYSA-N 0.000 description 1
- LFKYBJLFJOOKAE-UHFFFAOYSA-N imidazol-2-ylidenemethanone Chemical compound O=C=C1N=CC=N1 LFKYBJLFJOOKAE-UHFFFAOYSA-N 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- 125000002249 indol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([*])=C([H])C2=C1[H] 0.000 description 1
- 239000003617 indole-3-acetic acid Substances 0.000 description 1
- LPAGFVYQRIESJQ-UHFFFAOYSA-N indoline Chemical class C1=CC=C2NCCC2=C1 LPAGFVYQRIESJQ-UHFFFAOYSA-N 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 239000003978 infusion fluid Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 230000026045 iodination Effects 0.000 description 1
- 238000006192 iodination reaction Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- MGFYSGNNHQQTJW-UHFFFAOYSA-N iodonium Chemical compound [IH2+] MGFYSGNNHQQTJW-UHFFFAOYSA-N 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000005438 isoindazolyl group Chemical group 0.000 description 1
- GWVMLCQWXVFZCN-UHFFFAOYSA-N isoindoline Chemical compound C1=CC=C2CNCC2=C1 GWVMLCQWXVFZCN-UHFFFAOYSA-N 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004254 isoquinolin-1-yl group Chemical group [H]C1=C([H])C2=C([H])C([H])=C([H])C([H])=C2C(*)=N1 0.000 description 1
- 125000004552 isoquinolin-4-yl group Chemical group C1=NC=C(C2=CC=CC=C12)* 0.000 description 1
- 150000002537 isoquinolines Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000003367 kinetic assay Methods 0.000 description 1
- 210000003127 knee Anatomy 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 238000012417 linear regression Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000006138 lithiation reaction Methods 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 210000003141 lower extremity Anatomy 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 125000005905 mesyloxy group Chemical group 0.000 description 1
- 239000002207 metabolite Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- NQPIEWBAWBFGOB-UHFFFAOYSA-N methyl 1h-indole-2-carboxylate Chemical compound C1=CC=C2NC(C(=O)OC)=CC2=C1 NQPIEWBAWBFGOB-UHFFFAOYSA-N 0.000 description 1
- ACBWWWIGOQIBMS-UHFFFAOYSA-N methyl 2-hydroxy-3-phenylmethoxypropanoate Chemical compound COC(=O)C(O)COCC1=CC=CC=C1 ACBWWWIGOQIBMS-UHFFFAOYSA-N 0.000 description 1
- GLCZQTLCVLVFGV-UHFFFAOYSA-N methyl 4-methoxy-1h-indole-2-carboxylate Chemical compound C1=CC=C2NC(C(=O)OC)=CC2=C1OC GLCZQTLCVLVFGV-UHFFFAOYSA-N 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 238000005497 microtitration Methods 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 208000010125 myocardial infarction Diseases 0.000 description 1
- RXHACONSRHCJHC-UHFFFAOYSA-N n-(1-propan-2-ylpiperidin-4-yl)-1-[[4-(trifluoromethoxy)phenyl]methyl]indole-2-carboxamide Chemical compound C1CN(C(C)C)CCC1NC(=O)C1=CC2=CC=CC=C2N1CC1=CC=C(OC(F)(F)F)C=C1 RXHACONSRHCJHC-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 239000007922 nasal spray Substances 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 125000004930 octahydroisoquinolinyl group Chemical group C1(NCCC2CCCC=C12)* 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 230000008816 organ damage Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 150000002913 oxalic acids Chemical class 0.000 description 1
- QNNHQVPFZIFNFK-UHFFFAOYSA-N oxazolo[4,5-b]pyridine Chemical compound C1=CC=C2OC=NC2=N1 QNNHQVPFZIFNFK-UHFFFAOYSA-N 0.000 description 1
- 150000002940 palladium Chemical class 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 238000010647 peptide synthesis reaction Methods 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 125000004934 phenanthridinyl group Chemical group C1(=CC=CC2=NC=C3C=CC=CC3=C12)* 0.000 description 1
- 125000004625 phenanthrolinyl group Chemical group N1=C(C=CC2=CC=C3C=CC=NC3=C12)* 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000005954 phenoxathiinyl group Chemical group 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 1
- RFIOZSIHFNEKFF-UHFFFAOYSA-N piperazine-1-carboxylic acid Chemical compound OC(=O)N1CCNCC1 RFIOZSIHFNEKFF-UHFFFAOYSA-N 0.000 description 1
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 description 1
- 229940012957 plasmin Drugs 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- LZMJNVRJMFMYQS-UHFFFAOYSA-N poseltinib Chemical compound C1CN(C)CCN1C(C=C1)=CC=C1NC1=NC(OC=2C=C(NC(=O)C=C)C=CC=2)=C(OC=C2)C2=N1 LZMJNVRJMFMYQS-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 238000011533 pre-incubation Methods 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 238000003672 processing method Methods 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- IWRRRCZSVINKHU-UHFFFAOYSA-N pyrazol-3-ylidenemethanone Chemical class O=C=C1C=CN=N1 IWRRRCZSVINKHU-UHFFFAOYSA-N 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 1
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 125000004159 quinolin-2-yl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C([H])C(*)=NC2=C1[H] 0.000 description 1
- 125000004548 quinolin-3-yl group Chemical group N1=CC(=CC2=CC=CC=C12)* 0.000 description 1
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
- 230000002285 radioactive effect Effects 0.000 description 1
- 235000002079 ragi Nutrition 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 230000036303 septic shock Effects 0.000 description 1
- 208000013223 septicemia Diseases 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- KXCAEQNNTZANTK-UHFFFAOYSA-N stannane Chemical compound [SnH4] KXCAEQNNTZANTK-UHFFFAOYSA-N 0.000 description 1
- 229910000080 stannane Inorganic materials 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 230000006103 sulfonylation Effects 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 238000004416 surface enhanced Raman spectroscopy Methods 0.000 description 1
- 238000006557 surface reaction Methods 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- CWXPZXBSDSIRCS-UHFFFAOYSA-N tert-butyl piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCNCC1 CWXPZXBSDSIRCS-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 1
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- CBDKQYKMCICBOF-UHFFFAOYSA-N thiazoline Chemical compound C1CN=CS1 CBDKQYKMCICBOF-UHFFFAOYSA-N 0.000 description 1
- 239000003868 thrombin inhibitor Substances 0.000 description 1
- 230000001732 thrombotic effect Effects 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 201000010875 transient cerebral ischemia Diseases 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 125000002827 triflate group Chemical group FC(S(=O)(=O)O*)(F)F 0.000 description 1
- WTVXIBRMWGUIMI-UHFFFAOYSA-N trifluoro($l^{1}-oxidanylsulfonyl)methane Chemical group [O]S(=O)(=O)C(F)(F)F WTVXIBRMWGUIMI-UHFFFAOYSA-N 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 229960001322 trypsin Drugs 0.000 description 1
- 239000012588 trypsin Substances 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 230000009385 viral infection Effects 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 125000001834 xanthenyl group Chemical group C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/08—Vasodilators for multiple indications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- C—CHEMISTRY; METALLURGY
- C04—CEMENTS; CONCRETE; ARTIFICIAL STONE; CERAMICS; REFRACTORIES
- C04B—LIME, MAGNESIA; SLAG; CEMENTS; COMPOSITIONS THEREOF, e.g. MORTARS, CONCRETE OR LIKE BUILDING MATERIALS; ARTIFICIAL STONE; CERAMICS; REFRACTORIES; TREATMENT OF NATURAL STONE
- C04B35/00—Shaped ceramic products characterised by their composition; Ceramics compositions; Processing powders of inorganic compounds preparatory to the manufacturing of ceramic products
- C04B35/622—Forming processes; Processing powders of inorganic compounds preparatory to the manufacturing of ceramic products
- C04B35/626—Preparing or treating the powders individually or as batches ; preparing or treating macroscopic reinforcing agents for ceramic products, e.g. fibres; mechanical aspects section B
- C04B35/63—Preparing or treating the powders individually or as batches ; preparing or treating macroscopic reinforcing agents for ceramic products, e.g. fibres; mechanical aspects section B using additives specially adapted for forming the products, e.g.. binder binders
- C04B35/632—Organic additives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/18—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D209/22—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with an aralkyl radical attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- General Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Ceramic Engineering (AREA)
- Manufacturing & Machinery (AREA)
- Heart & Thoracic Surgery (AREA)
- Cardiology (AREA)
- Inorganic Chemistry (AREA)
- Materials Engineering (AREA)
- Structural Engineering (AREA)
- Hematology (AREA)
- Pain & Pain Management (AREA)
- Rheumatology (AREA)
- Diabetes (AREA)
- Vascular Medicine (AREA)
- Urology & Nephrology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
EP01127809A EP1314733A1 (en) | 2001-11-22 | 2001-11-22 | Indole-2-carboxamides as factor Xa inhibitors |
PCT/EP2002/012500 WO2003044014A1 (en) | 2001-11-22 | 2002-11-08 | Indole-2-carboxamides as factor xa inhibitors |
Publications (1)
Publication Number | Publication Date |
---|---|
UA78731C2 true UA78731C2 (en) | 2007-04-25 |
Family
ID=8179313
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
UA20040604882A UA78731C2 (en) | 2001-11-22 | 2002-08-11 | Indol-2-carboxamides as inhibitors of xa factor |
Country Status (31)
Country | Link |
---|---|
US (3) | US6906084B2 (no) |
EP (2) | EP1314733A1 (no) |
JP (1) | JP4664592B2 (no) |
KR (2) | KR100954508B1 (no) |
CN (1) | CN1283638C (no) |
AR (1) | AR037656A1 (no) |
AU (1) | AU2002351918B2 (no) |
BR (1) | BR0214396A (no) |
CA (1) | CA2467374C (no) |
CO (1) | CO5580764A2 (no) |
EC (1) | ECSP045115A (no) |
HK (1) | HK1070352A1 (no) |
HR (1) | HRP20040453A2 (no) |
HU (1) | HUP0402063A3 (no) |
IL (2) | IL162105A0 (no) |
MA (1) | MA27350A1 (no) |
ME (1) | MEP43008A (no) |
MX (1) | MXPA04004797A (no) |
MY (1) | MY131516A (no) |
NO (1) | NO327466B1 (no) |
NZ (1) | NZ533044A (no) |
OA (1) | OA12727A (no) |
PE (1) | PE20030593A1 (no) |
PL (1) | PL210986B1 (no) |
RS (1) | RS40404A (no) |
RU (1) | RU2299881C2 (no) |
TN (1) | TNSN04091A1 (no) |
TW (1) | TWI291950B (no) |
UA (1) | UA78731C2 (no) |
WO (1) | WO2003044014A1 (no) |
ZA (1) | ZA200402945B (no) |
Families Citing this family (75)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
TW200302088A (en) | 2001-11-14 | 2003-08-01 | Schering Corp | Cannabinoid receptor ligands |
US7358268B2 (en) * | 2002-12-04 | 2008-04-15 | Sanofi-Aventis Deutschland Gmbh | Imidazole derivatives as factor Xa inhibitors |
US7429581B2 (en) * | 2002-12-23 | 2008-09-30 | Sanofi-Aventis Deutschland Gmbh | Pyrazole-derivatives as factor Xa inhibitors |
ATE450533T1 (de) | 2003-02-14 | 2009-12-15 | Glaxo Group Ltd | Carboxamidderivate |
US7539725B2 (en) * | 2003-04-03 | 2009-05-26 | Zix Corporation | Auditor system |
US7317027B2 (en) * | 2003-05-19 | 2008-01-08 | Sanofi-Aventis Deutschland Gmbh | Azaindole-derivatives as factor Xa inhibitors |
EP1479680A1 (en) * | 2003-05-19 | 2004-11-24 | Aventis Pharma Deutschland GmbH | Azaindole derivatives as Factor Xa inhibitors |
US7223780B2 (en) * | 2003-05-19 | 2007-05-29 | Sanofi-Aventis Deutschland Gmbh | Triazole-derivatives as blood clotting enzyme factor Xa inhibitors |
EP1479677A1 (en) * | 2003-05-19 | 2004-11-24 | Aventis Pharma Deutschland GmbH | New indole derivatives as factor xa inhibitors |
US7741341B2 (en) | 2003-05-19 | 2010-06-22 | Sanofi-Aventis Deutschland Gmbh | Benzimidazole-derivatives as factor Xa inhibitors |
EP1479675A1 (en) * | 2003-05-19 | 2004-11-24 | Aventis Pharma Deutschland GmbH | Indazole-derivatives as factor Xa inhibitors |
WO2004108671A1 (en) * | 2003-06-06 | 2004-12-16 | Suven Life Sciences Limited | Substituted indoles with serotonin receptor affinity, process for their preparation and pharmaceutical compositions containing them |
TWI372050B (en) | 2003-07-03 | 2012-09-11 | Astex Therapeutics Ltd | (morpholin-4-ylmethyl-1h-benzimidazol-2-yl)-1h-pyrazoles |
EP1568698A1 (en) * | 2004-02-27 | 2005-08-31 | Aventis Pharma Deutschland GmbH | Pyrrole-derivatives as factor Xa inhibitors |
EP1571154A1 (en) * | 2004-03-03 | 2005-09-07 | Aventis Pharma Deutschland GmbH | Beta-aminoacid-derivatives as factor Xa inhibitors |
KR20070028553A (ko) | 2004-06-18 | 2007-03-12 | 바이올리폭스 에이비 | 염증 치료에 유용한 인돌 |
US7868037B2 (en) | 2004-07-14 | 2011-01-11 | Ptc Therapeutics, Inc. | Methods for treating hepatitis C |
US7772271B2 (en) | 2004-07-14 | 2010-08-10 | Ptc Therapeutics, Inc. | Methods for treating hepatitis C |
US8013006B2 (en) | 2004-07-14 | 2011-09-06 | Ptc Therapeutics, Inc. | Methods for treating hepatitis C |
US7781478B2 (en) | 2004-07-14 | 2010-08-24 | Ptc Therapeutics, Inc. | Methods for treating hepatitis C |
JP2008507518A (ja) | 2004-07-22 | 2008-03-13 | ピーティーシー セラピューティクス,インコーポレーテッド | C型肝炎を治療するためのチエノピリジン |
FR2874015B1 (fr) * | 2004-08-05 | 2006-09-15 | Sanofi Synthelabo | Derives de n-(1h-indolyl)-1h-indole-2-carboxamides, leur preparation et leur application en therapeutique |
AU2005299693B2 (en) | 2004-10-26 | 2012-07-05 | Janssen Pharmaceutica, N.V. | Factor Xa compounds |
AR051984A1 (es) * | 2004-12-08 | 2007-02-21 | Bristol Myers Squibb Co | Compuestos heterociclicos como inhibidores del factor viia |
MX2007008008A (es) | 2004-12-30 | 2007-11-12 | Astex Therapeutics Ltd | Compuestos de pirazol que modulan la actividad de las cinasas cdk, gsk y aurora. |
FR2880625B1 (fr) * | 2005-01-07 | 2007-03-09 | Sanofi Aventis Sa | Derives de n-(heteroaryl)-1h-indole-2-carboxamides, leur preparation et leur application en therapeutique |
KR20070114123A (ko) | 2005-01-19 | 2007-11-29 | 바이올리폭스 에이비 | 염증 치료에 유용한 인돌 |
US8957070B2 (en) | 2005-04-20 | 2015-02-17 | Takeda Pharmaceutical Company Limited | Glucokinase activator compounds, methods of activating glucokinase and methods of treating diabetes and obesity |
FR2888847B1 (fr) | 2005-07-22 | 2007-08-31 | Sanofi Aventis Sa | Derives de n-(heteriaryl)-1-heteorarylalkyl-1h-indole-2- carboxamides, leur preparation et application en therapeutique |
US7977359B2 (en) | 2005-11-04 | 2011-07-12 | Amira Pharmaceuticals, Inc. | 5-lipdxygenase-activating protein (FLAP) inhibitors |
US8399666B2 (en) | 2005-11-04 | 2013-03-19 | Panmira Pharmaceuticals, Llc | 5-lipoxygenase-activating protein (FLAP) inhibitors |
GB2431927B (en) | 2005-11-04 | 2010-03-17 | Amira Pharmaceuticals Inc | 5-Lipoxygenase-activating protein (FLAP) inhibitors |
US8399442B2 (en) | 2005-12-30 | 2013-03-19 | Astex Therapeutics Limited | Pharmaceutical compounds |
JP4912414B2 (ja) * | 2006-01-24 | 2012-04-11 | イーライ リリー アンド カンパニー | インドールスルホンアミド系のプロゲステロン受容体調節物質 |
US7943622B2 (en) | 2006-06-06 | 2011-05-17 | Cornerstone Therapeutics, Inc. | Piperazines, pharmaceutical compositions and methods of use thereof |
EP2049119A2 (en) | 2006-06-29 | 2009-04-22 | Astex Therapeutics Limited | Pharmaceutical combinations of 1-cyclopropyl-3-[3-(5-morphoolin-4-ylmethyl-1h-benzoimidazol-2-yl)-1h-1-pyrazol-4-yl]-urea |
WO2008131000A2 (en) | 2007-04-16 | 2008-10-30 | Abbott Laboratories | 7-substituted indole mcl-1 inhibitors |
AU2008286946B2 (en) * | 2007-08-10 | 2013-11-21 | H. Lundbeck A/S | Heteroaryl amide analogues |
TW200920369A (en) | 2007-10-26 | 2009-05-16 | Amira Pharmaceuticals Inc | 5-lipoxygenase activating protein (flap) inhibitor |
RU2484090C2 (ru) * | 2007-12-07 | 2013-06-10 | Эбботт Гмбх Унд Ко.Кг | 5-галогензамещенные производные оксиндола и их применение для лечения вазопрессинзависимых заболеваний |
MX2010007151A (es) * | 2007-12-27 | 2010-12-06 | Abbott Gmbh & Co Kg | Derivados de oxindol sustituido y su uso para el tratamiento de enfermedades dependientes de la vasopresina. |
WO2009103652A1 (en) | 2008-02-22 | 2009-08-27 | F. Hoffmann-La Roche Ag | Modulators for amyloid beta |
KR20160129109A (ko) | 2008-05-23 | 2016-11-08 | 아미라 파마슈티칼스 인코포레이티드 | 5-리폭시게나아제 활성화 단백질 억제제 |
GB0813144D0 (en) | 2008-07-17 | 2008-08-27 | Glaxo Group Ltd | Novel compounds |
GB0813142D0 (en) | 2008-07-17 | 2008-08-27 | Glaxo Group Ltd | Novel compounds |
PL2448938T3 (pl) | 2009-06-29 | 2014-11-28 | Incyte Holdings Corp | Pirymidynony jako inhibitory PI3K |
US8759359B2 (en) | 2009-12-18 | 2014-06-24 | Incyte Corporation | Substituted heteroaryl fused derivatives as PI3K inhibitors |
US8486967B2 (en) * | 2010-02-17 | 2013-07-16 | Hoffmann-La Roche Inc. | Heteroaryl substituted piperidines |
WO2011130342A1 (en) | 2010-04-14 | 2011-10-20 | Incyte Corporation | FUSED DERIVATIVES AS ΡI3Κδ INHIBITORS |
US9062055B2 (en) | 2010-06-21 | 2015-06-23 | Incyte Corporation | Fused pyrrole derivatives as PI3K inhibitors |
JP5961187B2 (ja) | 2010-12-20 | 2016-08-02 | インサイト・ホールディングス・コーポレイションIncyte Holdings Corporation | Pi3k阻害剤としてのn−(1−(置換フェニル)エチル)−9h−プリン−6−アミン |
US9108984B2 (en) | 2011-03-14 | 2015-08-18 | Incyte Corporation | Substituted diamino-pyrimidine and diamino-pyridine derivatives as PI3K inhibitors |
US9126948B2 (en) | 2011-03-25 | 2015-09-08 | Incyte Holdings Corporation | Pyrimidine-4,6-diamine derivatives as PI3K inhibitors |
FR2974576B1 (fr) * | 2011-04-29 | 2013-07-19 | Sanofi Aventis | Derives de n-[(1h-pyrazol-1-yl)aryl]-1h-indole ou 1h- indazole-3-carboxamide, leur preparation et leurs applications en therapeutique |
HUE030869T2 (en) | 2011-09-02 | 2017-06-28 | Incyte Holdings Corp | Heterocyclic amines as inhibitors of PI3K |
WO2013130703A2 (en) * | 2012-02-29 | 2013-09-06 | Institute For Hepatitis And Virus Research | Binhibitors of hepatitis b virus convalently closed circular dna formation and their method of use |
AR090548A1 (es) | 2012-04-02 | 2014-11-19 | Incyte Corp | Azaheterociclobencilaminas biciclicas como inhibidores de pi3k |
RU2680100C9 (ru) | 2013-03-15 | 2019-04-18 | Плексксикон Инк. | Гетероциклические соединения и их применения |
US20140303121A1 (en) | 2013-03-15 | 2014-10-09 | Plexxikon Inc. | Heterocyclic compounds and uses thereof |
EP3085700B1 (en) * | 2013-12-20 | 2018-10-31 | Institute of Pharmacology and Toxicology Academy of Military Medical Sciences P.L.A. China | Novel piperidine carboxamide compound, preparation method, and usage thereof |
WO2015176625A1 (zh) | 2014-05-22 | 2015-11-26 | 南京明德新药研发股份有限公司 | 作为凝血因子Xa抑制剂的酰肼类化合物 |
WO2015191677A1 (en) | 2014-06-11 | 2015-12-17 | Incyte Corporation | Bicyclic heteroarylaminoalkyl phenyl derivatives as pi3k inhibitors |
US10266526B2 (en) * | 2014-09-10 | 2019-04-23 | Epizyme, Inc. | Substituted 1,2,3-triazoles as SMYD inhibitors for treating cancer |
CA3210002A1 (en) | 2014-12-29 | 2016-07-07 | The United States Of America, As Represented By The Secretary, Department Of Health And Human Services | Small molecule inhibitors of lactate dehydrogenase and methods of use thereof |
AU2016222556B2 (en) | 2015-02-27 | 2020-08-27 | Incyte Holdings Corporation | Salts of Pl3K inhibitor and processes for their preparation |
WO2016183063A1 (en) | 2015-05-11 | 2016-11-17 | Incyte Corporation | Crystalline forms of a pi3k inhibitor |
WO2016183060A1 (en) | 2015-05-11 | 2016-11-17 | Incyte Corporation | Process for the synthesis of a phosphoinositide 3-kinase inhibitor |
EP3313846B1 (en) * | 2015-06-25 | 2020-05-06 | Promega Corporation | Thienopyrrole compounds and uses thereof as inhibitors of oplophorus-derived luciferases |
KR101725451B1 (ko) * | 2016-05-25 | 2017-04-13 | 한국화학연구원 | N-(피페리딘-4-일)-1h-인돌-2-카복스아마이드 유도체, 이의 제조방법 및 이를 유효성분으로 포함하는 유로텐신-ⅱ 수용체 활성 관련 질환의 예방 또는 치료용 약학적 조성물 |
SG11201901690UA (en) * | 2016-10-18 | 2019-03-28 | Chevron Oronite Tech Bv | Marine diesel lubricant oil compositions |
JP7161475B2 (ja) | 2016-12-28 | 2022-10-26 | プロメガ コーポレイション | 官能化nanoluc阻害剤 |
CN110770224B (zh) * | 2017-03-10 | 2022-11-18 | 罗格斯新泽西州立大学 | 作为外排泵抑制剂的吲哚衍生物 |
EP3694855A1 (en) | 2017-10-13 | 2020-08-19 | Plexxikon Inc. | Solid forms of a compound for modulating kinases |
CN116332818B (zh) * | 2021-12-22 | 2023-12-15 | 王喆明 | 四氢吡咯衍生物及其应用 |
TW202345806A (zh) | 2022-03-31 | 2023-12-01 | 美商艾伯維有限公司 | 噻唑并〔5,4-b〕吡啶malt-1抑制劑 |
Family Cites Families (31)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3317524A (en) * | 1965-02-04 | 1967-05-02 | American Home Prod | Substituted 1, 2, 3, 4-tetrahydro-pyrazino[1, 2-a]indoles |
FR2260332A1 (en) * | 1974-02-12 | 1975-09-05 | Delalande Sa | 1-Phenyl-2-aminocarbonyl-indoles - with respiratory analeptic, antiinflammatory analgesic, vasodilator, diuretic and anti-ulcer activity |
US4675332A (en) * | 1984-12-10 | 1987-06-23 | Warner-Lambert Company | Acidic tetrazolyl substituted indole compounds and their use as antiallergy agents |
IE68593B1 (en) * | 1989-12-06 | 1996-06-26 | Sanofi Sa | Heterocyclic substituted acylaminothiazoles their preparation and pharmaceutical compositions containing them |
US5506134A (en) | 1990-10-22 | 1996-04-09 | Corvas International, Inc. | Hypridoma and monoclonal antibody which inhibits blood coagulation tissue factor/factor VIIa complex |
US5833982A (en) | 1991-02-28 | 1998-11-10 | Zymogenetics, Inc. | Modified factor VII |
US5788965A (en) | 1991-02-28 | 1998-08-04 | Novo Nordisk A/S | Modified factor VII |
TW229140B (no) | 1992-06-05 | 1994-09-01 | Shell Internat Res Schappej B V | |
FR2703995B1 (fr) * | 1993-04-16 | 1995-07-21 | Sanofi Elf | 5-acylamino 1,2,4-thiadiazoles, leur preparation et compositions pharmaceutiques en contenant. |
US5518231A (en) | 1993-04-19 | 1996-05-21 | Xerox Corporation | Self adjusting sheet gripping apparatus |
CA2186497C (en) | 1994-04-26 | 2008-06-17 | Fahad Al-Obeidi | Factor xa inhibitors |
WO1997003965A1 (fr) * | 1995-07-18 | 1997-02-06 | Kyowa Hakko Kogyo Co., Ltd. | Derives d'indole |
JPH0987282A (ja) * | 1995-09-21 | 1997-03-31 | Kyowa Hakko Kogyo Co Ltd | チアゾール誘導体 |
WO1997045119A1 (en) * | 1996-05-24 | 1997-12-04 | Novartis Ag | Use of substance p antagonists for treating social phobia |
FR2763337B1 (fr) * | 1997-05-13 | 1999-08-20 | Sanofi Sa | Nouveaux derives du triazole, un procede pour leur preparation et compositions pharmaceutiques les contenant |
GB9716657D0 (en) * | 1997-08-07 | 1997-10-15 | Zeneca Ltd | Chemical compounds |
KR100608472B1 (ko) * | 1997-12-24 | 2006-08-09 | 사노피-아벤티스 도이칠란트 게엠베하 | 인자 Xa의 억제제로서의 인돌 유도체 및 이를 함유하는 약제학적 조성물 |
UA59433C2 (uk) | 1998-01-27 | 2003-09-15 | Авентіс Фармасьютікалс Продактс Інк. | ЗАМІЩЕНІ ОКСОАЗАГЕТЕРОЦИКЛІЧНІ ІНГІБІТОРИ ФАКТОРА Хa ТА ПРОМІЖНІ СПОЛУКИ ДЛЯ ЇХ ОТРИМАННЯ |
EP0987274A1 (en) | 1998-09-15 | 2000-03-22 | Hoechst Marion Roussel Deutschland GmbH | Factor VIIa Inhibitors |
JP4241970B2 (ja) * | 1998-10-30 | 2009-03-18 | 中外製薬株式会社 | アミド結合を有するインドール誘導体、及びモノ又はジアザインドール誘導体 |
JP2001002642A (ja) * | 1999-06-21 | 2001-01-09 | Nippon Nohyaku Co Ltd | 複素環ジカルボン酸ジアミド誘導体及び除草剤並びにその使用方法 |
IL147495A0 (en) | 1999-07-28 | 2002-08-14 | Aventis Pharm Prod Inc | Substituted oxoazaheterocycclyl compounds |
US6486211B1 (en) * | 1999-10-22 | 2002-11-26 | Smithkline Beecham Corporation | Indole compounds |
US6376515B2 (en) | 2000-02-29 | 2002-04-23 | Cor Therapeutics, Inc. | Benzamides and related inhibitors of factor Xa |
US6436965B1 (en) * | 2000-03-02 | 2002-08-20 | Merck Frosst Canada & Co. | PDE IV inhibiting amides, compositions and methods of treatment |
WO2002000647A1 (en) | 2000-06-23 | 2002-01-03 | Bristol-Myers Squibb Pharma Company | Heteroaryl-phenyl substituted factor xa inhibitors |
DE10147672A1 (de) * | 2001-09-27 | 2003-04-10 | Bayer Ag | Substituierte 2,5-Diamidoindole und ihre Verwendung |
TW200302088A (en) * | 2001-11-14 | 2003-08-01 | Schering Corp | Cannabinoid receptor ligands |
EP1479677A1 (en) * | 2003-05-19 | 2004-11-24 | Aventis Pharma Deutschland GmbH | New indole derivatives as factor xa inhibitors |
FR2888847B1 (fr) * | 2005-07-22 | 2007-08-31 | Sanofi Aventis Sa | Derives de n-(heteriaryl)-1-heteorarylalkyl-1h-indole-2- carboxamides, leur preparation et application en therapeutique |
FR2911604B1 (fr) * | 2007-01-19 | 2009-04-17 | Sanofi Aventis Sa | Derives de n-(heteroaryl-1h-indole-2-carboxamides, leur preparation et leur application en therapeutique |
-
2001
- 2001-11-22 EP EP01127809A patent/EP1314733A1/en not_active Withdrawn
-
2002
- 2002-08-11 UA UA20040604882A patent/UA78731C2/uk unknown
- 2002-11-08 KR KR1020047007838A patent/KR100954508B1/ko not_active IP Right Cessation
- 2002-11-08 KR KR1020107003845A patent/KR101033798B1/ko not_active IP Right Cessation
- 2002-11-08 AU AU2002351918A patent/AU2002351918B2/en not_active Ceased
- 2002-11-08 WO PCT/EP2002/012500 patent/WO2003044014A1/en active Application Filing
- 2002-11-08 NZ NZ533044A patent/NZ533044A/en not_active IP Right Cessation
- 2002-11-08 OA OA1200400142A patent/OA12727A/en unknown
- 2002-11-08 BR BR0214396-8A patent/BR0214396A/pt active Search and Examination
- 2002-11-08 JP JP2003545651A patent/JP4664592B2/ja not_active Expired - Fee Related
- 2002-11-08 EP EP02787604.4A patent/EP1451185B1/en not_active Expired - Lifetime
- 2002-11-08 PL PL368949A patent/PL210986B1/pl unknown
- 2002-11-08 CA CA2467374A patent/CA2467374C/en not_active Expired - Fee Related
- 2002-11-08 CN CNB028232488A patent/CN1283638C/zh not_active Expired - Fee Related
- 2002-11-08 MX MXPA04004797A patent/MXPA04004797A/es active IP Right Grant
- 2002-11-08 HU HU0402063A patent/HUP0402063A3/hu unknown
- 2002-11-08 RS YUP-404/04A patent/RS40404A/sr unknown
- 2002-11-08 RU RU2004118710/04A patent/RU2299881C2/ru not_active IP Right Cessation
- 2002-11-08 IL IL16210502A patent/IL162105A0/xx unknown
- 2002-11-08 ME MEP-430/08A patent/MEP43008A/xx unknown
- 2002-11-19 PE PE2002001105A patent/PE20030593A1/es not_active Application Discontinuation
- 2002-11-20 TW TW091133782A patent/TWI291950B/zh not_active IP Right Cessation
- 2002-11-20 AR ARP020104452A patent/AR037656A1/es active IP Right Grant
- 2002-11-21 US US10/301,397 patent/US6906084B2/en not_active Expired - Lifetime
- 2002-11-22 MY MYPI20024375A patent/MY131516A/en unknown
-
2004
- 2004-04-19 ZA ZA2004/02945A patent/ZA200402945B/en unknown
- 2004-04-22 MA MA27647A patent/MA27350A1/fr unknown
- 2004-05-20 EC EC2004005115A patent/ECSP045115A/es unknown
- 2004-05-20 CO CO04046947A patent/CO5580764A2/es active IP Right Grant
- 2004-05-20 IL IL162105A patent/IL162105A/en not_active IP Right Cessation
- 2004-05-21 TN TNP2004000091A patent/TNSN04091A1/en unknown
- 2004-05-21 HR HR20040453A patent/HRP20040453A2/xx not_active Application Discontinuation
- 2004-06-21 NO NO20042592A patent/NO327466B1/no not_active IP Right Cessation
- 2004-08-26 US US10/926,909 patent/US20050043302A1/en not_active Abandoned
-
2005
- 2005-04-07 HK HK05102886A patent/HK1070352A1/xx not_active IP Right Cessation
-
2008
- 2008-05-12 US US12/119,013 patent/US20090069565A1/en not_active Abandoned
Also Published As
Similar Documents
Publication | Publication Date | Title |
---|---|---|
UA78731C2 (en) | Indol-2-carboxamides as inhibitors of xa factor | |
TWI573786B (zh) | 吡咯啶衍生物 | |
JP2021178869A (ja) | Sumo活性化酵素の阻害薬として有用なヘテロアリール化合物 | |
US7196103B2 (en) | Indole derivatives as factor Xa inhibitors | |
EP3538528B1 (en) | Pyrrole amides as alpha v integrin inhibitors | |
US20080280946A1 (en) | Azaindole-Derivatives As Factor Xa Inhibitors | |
JP2011527677A (ja) | Nhe−1阻害剤として有用なピロリジニル及びピペリジニル化合物 | |
AU2005266462A1 (en) | Substituted cyclic urea derivatives, preparation thereof and pharmaceutical use thereof as kinase inhibitors | |
SA05260409B1 (ar) | مثبطات جديده لانزيمات البروتينات المعدنية لهيدانتوين | |
JP5422570B2 (ja) | 凝固第Xa因子及びトロンビンの阻害剤としてのクロロチオフェン−アミド類 | |
KR102217285B1 (ko) | 신규한 3,4-다이하이드로-2h-이소퀴놀린-1-온 및 2,3-다이하이드로-이소인돌-1-온 화합물 | |
EP3004077B1 (en) | New 3,4-dihydro-2h-isoquinoline-1-one and 2,3-dihydro-isoindol-1-one compounds | |
JP4250423B2 (ja) | アリール置換脂環式化合物及びそれを含有する医薬組成物 | |
EP3004076B1 (en) | New 3,4-dihydro-2h-isoquinoline-1-one and 2,3-dihydro-isoindol-1-one compounds | |
JP4733642B2 (ja) | 第Xa因子阻害剤としてのアザインドール−誘導体 | |
UA82100C2 (uk) | Похідні бензимідазолу як інгібітори фактора ха | |
Nishida et al. | Synthesis and evaluation of 1-arylsulfonyl-3-piperazinone derivatives as factor Xa inhibitor | |
WO2015176625A1 (zh) | 作为凝血因子Xa抑制剂的酰肼类化合物 | |
JP2008540589A (ja) | 第Xa因子阻害剤としてのヘテロアリール−カルボン酸(スルファモイルアルキル)アミド−誘導体 | |
KR102322959B1 (ko) | 신규한 3,4-다이하이드로-2h-이소퀴놀린-1-온 및 2,3-다이하이드로-이소인돌-1-온 화합물 | |
CN117964540A (zh) | 一种氘代吡咯磺酰类衍生物、及其制备方法与应用 |