TW499412B - Aminoguanidines and alkoxyguanidines as protease inhibitors - Google Patents
Aminoguanidines and alkoxyguanidines as protease inhibitors Download PDFInfo
- Publication number
- TW499412B TW499412B TW086117721A TW86117721A TW499412B TW 499412 B TW499412 B TW 499412B TW 086117721 A TW086117721 A TW 086117721A TW 86117721 A TW86117721 A TW 86117721A TW 499412 B TW499412 B TW 499412B
- Authority
- TW
- Taiwan
- Prior art keywords
- alkyl
- group
- methyl
- hydrogen
- phenoxy
- Prior art date
Links
- HAMNKKUPIHEESI-UHFFFAOYSA-N aminoguanidine Chemical class NNC(N)=N HAMNKKUPIHEESI-UHFFFAOYSA-N 0.000 title claims abstract description 11
- 229940042399 direct acting antivirals protease inhibitors Drugs 0.000 title description 4
- 239000000137 peptide hydrolase inhibitor Substances 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 276
- 238000000034 method Methods 0.000 claims abstract description 62
- 210000004369 blood Anatomy 0.000 claims abstract description 27
- 239000008280 blood Substances 0.000 claims abstract description 27
- 230000002401 inhibitory effect Effects 0.000 claims abstract description 21
- 150000003839 salts Chemical class 0.000 claims abstract description 21
- 230000015572 biosynthetic process Effects 0.000 claims abstract description 20
- 108090000190 Thrombin Proteins 0.000 claims abstract description 19
- 229960004072 thrombin Drugs 0.000 claims abstract description 19
- 208000007536 Thrombosis Diseases 0.000 claims abstract description 9
- 239000003146 anticoagulant agent Substances 0.000 claims abstract description 9
- 241000124008 Mammalia Species 0.000 claims abstract description 8
- 229940127219 anticoagulant drug Drugs 0.000 claims abstract description 7
- 239000012453 solvate Substances 0.000 claims abstract description 7
- 230000005764 inhibitory process Effects 0.000 claims abstract description 6
- 230000017531 blood circulation Effects 0.000 claims abstract description 5
- 238000003860 storage Methods 0.000 claims abstract description 5
- -1 carboxyfluorenylamino Chemical group 0.000 claims description 389
- 125000000217 alkyl group Chemical group 0.000 claims description 259
- 238000011049 filling Methods 0.000 claims description 177
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 155
- 229910052739 hydrogen Inorganic materials 0.000 claims description 128
- 239000001257 hydrogen Substances 0.000 claims description 127
- 230000002079 cooperative effect Effects 0.000 claims description 99
- 229910052757 nitrogen Inorganic materials 0.000 claims description 95
- 125000003118 aryl group Chemical group 0.000 claims description 90
- 239000011541 reaction mixture Substances 0.000 claims description 83
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 76
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 74
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 73
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims description 67
- 150000002431 hydrogen Chemical class 0.000 claims description 61
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 57
- 125000003545 alkoxy group Chemical group 0.000 claims description 57
- 125000000623 heterocyclic group Chemical group 0.000 claims description 50
- 239000002904 solvent Substances 0.000 claims description 50
- JPGMSPJHRKUMDF-UHFFFAOYSA-N 2-propoxyguanidine Chemical compound CCCONC(N)=N JPGMSPJHRKUMDF-UHFFFAOYSA-N 0.000 claims description 48
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 claims description 48
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 48
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 40
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 38
- 150000001412 amines Chemical class 0.000 claims description 36
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 36
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 35
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 33
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Substances CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 32
- 239000002585 base Substances 0.000 claims description 32
- 239000002253 acid Substances 0.000 claims description 31
- 125000004432 carbon atom Chemical group C* 0.000 claims description 31
- 239000000460 chlorine Substances 0.000 claims description 31
- 125000003282 alkyl amino group Chemical group 0.000 claims description 30
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 29
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 claims description 28
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 claims description 28
- 229960004198 guanidine Drugs 0.000 claims description 28
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 27
- 238000006243 chemical reaction Methods 0.000 claims description 26
- UTGPVFBEPVTJQT-UHFFFAOYSA-N 2-propoxyguanidine;hydrochloride Chemical compound Cl.CCCONC(N)=N UTGPVFBEPVTJQT-UHFFFAOYSA-N 0.000 claims description 23
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 23
- 229910052736 halogen Inorganic materials 0.000 claims description 21
- 150000002367 halogens Chemical class 0.000 claims description 21
- 125000005842 heteroatom Chemical group 0.000 claims description 21
- 125000001424 substituent group Chemical group 0.000 claims description 21
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 20
- 229910052760 oxygen Inorganic materials 0.000 claims description 20
- 239000001301 oxygen Substances 0.000 claims description 20
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 claims description 19
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 19
- 125000004076 pyridyl group Chemical group 0.000 claims description 19
- 229910052717 sulfur Inorganic materials 0.000 claims description 19
- 239000003153 chemical reaction reagent Substances 0.000 claims description 18
- 125000006413 ring segment Chemical group 0.000 claims description 17
- 229910052801 chlorine Inorganic materials 0.000 claims description 16
- 229920006395 saturated elastomer Polymers 0.000 claims description 16
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 15
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 15
- 125000000304 alkynyl group Chemical group 0.000 claims description 14
- 125000003277 amino group Chemical group 0.000 claims description 14
- 125000001072 heteroaryl group Chemical group 0.000 claims description 13
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 13
- 150000003254 radicals Chemical class 0.000 claims description 13
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 12
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 12
- 125000001624 naphthyl group Chemical group 0.000 claims description 12
- 125000001544 thienyl group Chemical group 0.000 claims description 11
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 10
- 229910052799 carbon Inorganic materials 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 10
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 10
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 10
- 239000008194 pharmaceutical composition Substances 0.000 claims description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims description 7
- 239000011593 sulfur Chemical group 0.000 claims description 7
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 7
- 206010014561 Emphysema Diseases 0.000 claims description 6
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 6
- 238000001631 haemodialysis Methods 0.000 claims description 6
- 230000000322 hemodialysis Effects 0.000 claims description 6
- 230000002829 reductive effect Effects 0.000 claims description 6
- 150000001335 aliphatic alkanes Chemical class 0.000 claims description 5
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 claims description 5
- 125000005138 alkoxysulfonyl group Chemical group 0.000 claims description 4
- 150000003973 alkyl amines Chemical class 0.000 claims description 4
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 4
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 claims description 4
- 239000011707 mineral Substances 0.000 claims description 4
- 230000017854 proteolysis Effects 0.000 claims description 4
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 4
- 208000037803 restenosis Diseases 0.000 claims description 4
- 108010049003 Fibrinogen Proteins 0.000 claims description 3
- 102000008946 Fibrinogen Human genes 0.000 claims description 3
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims description 3
- 206010061218 Inflammation Diseases 0.000 claims description 3
- 206010033645 Pancreatitis Diseases 0.000 claims description 3
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical group N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 claims description 3
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 3
- 125000005087 alkynylcarbonyl group Chemical group 0.000 claims description 3
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 claims description 3
- 150000001721 carbon Chemical group 0.000 claims description 3
- 229940012952 fibrinogen Drugs 0.000 claims description 3
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 3
- 230000004054 inflammatory process Effects 0.000 claims description 3
- 238000006467 substitution reaction Methods 0.000 claims description 3
- 238000001356 surgical procedure Methods 0.000 claims description 3
- YJUCKBVXGJBLAJ-UHFFFAOYSA-N 2-(cyclopropylmethoxy)guanidine Chemical compound NC(N)=NOCC1CC1 YJUCKBVXGJBLAJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 claims description 2
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 claims description 2
- XGLOTIMKDGLOKV-UHFFFAOYSA-N C1=CC=CC=2C3=CC=CC=C3CC12.[C] Chemical compound C1=CC=CC=2C3=CC=CC=C3CC12.[C] XGLOTIMKDGLOKV-UHFFFAOYSA-N 0.000 claims description 2
- 229910002651 NO3 Inorganic materials 0.000 claims description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims description 2
- ZPTNXZFPAYZAAH-UHFFFAOYSA-N acetic acid 2-propoxyguanidine Chemical compound CC(O)=O.CC(O)=O.CCCONC(N)=N ZPTNXZFPAYZAAH-UHFFFAOYSA-N 0.000 claims description 2
- 150000001409 amidines Chemical class 0.000 claims description 2
- 125000004230 chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 claims description 2
- NYECIYTUCHIPAM-UHFFFAOYSA-N ethyl 2-[[2-[3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenoxy]sulfonylphenyl]sulfonyl-(pyridin-2-ylmethyl)amino]acetate;dihydrochloride Chemical compound Cl.Cl.C=1C=CC=C(S(=O)(=O)OC=2C=C(OCCCONC(N)=N)C=C(C)C=2)C=1S(=O)(=O)N(CC(=O)OCC)CC1=CC=CC=N1 NYECIYTUCHIPAM-UHFFFAOYSA-N 0.000 claims description 2
- 239000007789 gas Substances 0.000 claims description 2
- 150000007857 hydrazones Chemical class 0.000 claims description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 2
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 claims description 2
- 229910052702 rhenium Inorganic materials 0.000 claims description 2
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 claims description 2
- 229910052727 yttrium Inorganic materials 0.000 claims description 2
- FZYOQVJRSDIMPO-UHFFFAOYSA-N Cl.Cl.CCCONC(N)=N Chemical compound Cl.Cl.CCCONC(N)=N FZYOQVJRSDIMPO-UHFFFAOYSA-N 0.000 claims 5
- 125000000747 amidyl group Chemical group [H][N-]* 0.000 claims 3
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 claims 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 claims 2
- 125000002349 hydroxyamino group Chemical group [H]ON([H])[*] 0.000 claims 2
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 claims 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims 2
- PCTMTFRHKVHKIS-BMFZQQSSSA-N (1s,3r,4e,6e,8e,10e,12e,14e,16e,18s,19r,20r,21s,25r,27r,30r,31r,33s,35r,37s,38r)-3-[(2r,3s,4s,5s,6r)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-19,25,27,30,31,33,35,37-octahydroxy-18,20,21-trimethyl-23-oxo-22,39-dioxabicyclo[33.3.1]nonatriaconta-4,6,8,10 Chemical compound C1C=C2C[C@@H](OS(O)(=O)=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2.O[C@H]1[C@@H](N)[C@H](O)[C@@H](C)O[C@H]1O[C@H]1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]2C(O)=O)O[C@H]2C1 PCTMTFRHKVHKIS-BMFZQQSSSA-N 0.000 claims 1
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims 1
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 claims 1
- TZPLKLONJQKJMZ-UHFFFAOYSA-N 2-(cyclopropylmethoxy)guanidine hydrochloride Chemical compound Cl.NC(=N)NOCC1CC1 TZPLKLONJQKJMZ-UHFFFAOYSA-N 0.000 claims 1
- IMSODMZESSGVBE-UHFFFAOYSA-N 2-Oxazoline Chemical compound C1CN=CO1 IMSODMZESSGVBE-UHFFFAOYSA-N 0.000 claims 1
- 125000003504 2-oxazolinyl group Chemical group O1C(=NCC1)* 0.000 claims 1
- HKMTVMBEALTRRR-UHFFFAOYSA-N Benzo[a]fluorene Chemical group C1=CC=CC2=C3CC4=CC=CC=C4C3=CC=C21 HKMTVMBEALTRRR-UHFFFAOYSA-N 0.000 claims 1
- 102100027612 Kallikrein-11 Human genes 0.000 claims 1
- KQJQICVXLJTWQD-UHFFFAOYSA-N N-Methylthiourea Chemical compound CNC(N)=S KQJQICVXLJTWQD-UHFFFAOYSA-N 0.000 claims 1
- 208000006011 Stroke Diseases 0.000 claims 1
- 101710152431 Trypsin-like protease Proteins 0.000 claims 1
- KOBXKDMFRDNQHI-UHFFFAOYSA-N [3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenyl] 2-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylbenzenesulfonate;hydrochloride Chemical compound Cl.CC1=CC(OCCCONC(N)=N)=CC(OS(=O)(=O)C=2C(=CC=CC=2)S(=O)(=O)N2CCN(CC2)C=2N=CC=CN=2)=C1 KOBXKDMFRDNQHI-UHFFFAOYSA-N 0.000 claims 1
- ZUDWESOSPOPPNL-UHFFFAOYSA-N [3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenyl] 2-[methyl(pyridin-3-ylmethyl)sulfamoyl]benzenesulfonate;dihydrochloride Chemical compound Cl.Cl.C=1C=CC=C(S(=O)(=O)OC=2C=C(OCCCONC(N)=N)C=C(C)C=2)C=1S(=O)(=O)N(C)CC1=CC=CN=C1 ZUDWESOSPOPPNL-UHFFFAOYSA-N 0.000 claims 1
- OZVUITMGMBWQMY-UHFFFAOYSA-N [3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenyl] isoquinoline-5-sulfonate;hydrochloride Chemical compound Cl.CC1=CC(OCCCONC(N)=N)=CC(OS(=O)(=O)C=2C3=CC=NC=C3C=CC=2)=C1 OZVUITMGMBWQMY-UHFFFAOYSA-N 0.000 claims 1
- 238000005054 agglomeration Methods 0.000 claims 1
- 230000002776 aggregation Effects 0.000 claims 1
- 150000008052 alkyl sulfonates Chemical class 0.000 claims 1
- 229910052786 argon Inorganic materials 0.000 claims 1
- 125000003435 aroyl group Chemical group 0.000 claims 1
- 125000005418 aryl aryl group Chemical group 0.000 claims 1
- 125000005518 carboxamido group Chemical group 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- 208000028867 ischemia Diseases 0.000 claims 1
- SRJOCJYGOFTFLH-UHFFFAOYSA-N isonipecotic acid Chemical compound OC(=O)C1CCNCC1 SRJOCJYGOFTFLH-UHFFFAOYSA-N 0.000 claims 1
- JCDWETOKTFWTHA-UHFFFAOYSA-N methylsulfonylbenzene Chemical compound CS(=O)(=O)C1=CC=CC=C1 JCDWETOKTFWTHA-UHFFFAOYSA-N 0.000 claims 1
- 125000004043 oxo group Chemical group O=* 0.000 claims 1
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 claims 1
- 125000002080 perylenyl group Chemical group C1(=CC=C2C=CC=C3C4=CC=CC5=CC=CC(C1=C23)=C45)* 0.000 claims 1
- CSHWQDPOILHKBI-UHFFFAOYSA-N peryrene Natural products C1=CC(C2=CC=CC=3C2=C2C=CC=3)=C3C2=CC=CC3=C1 CSHWQDPOILHKBI-UHFFFAOYSA-N 0.000 claims 1
- 229960003424 phenylacetic acid Drugs 0.000 claims 1
- 239000003279 phenylacetic acid Substances 0.000 claims 1
- RMVRSNDYEFQCLF-UHFFFAOYSA-O phenylsulfanium Chemical compound [SH2+]C1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-O 0.000 claims 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 claims 1
- 125000004646 sulfenyl group Chemical group S(*)* 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 100
- 102000035195 Peptidases Human genes 0.000 abstract description 17
- 108091005804 Peptidases Proteins 0.000 abstract description 17
- 108090000317 Chymotrypsin Proteins 0.000 abstract description 10
- 239000004365 Protease Substances 0.000 abstract description 10
- 229960002376 chymotrypsin Drugs 0.000 abstract description 10
- 238000004519 manufacturing process Methods 0.000 abstract description 9
- 108090000631 Trypsin Proteins 0.000 abstract description 7
- 102000004142 Trypsin Human genes 0.000 abstract description 7
- 210000001772 blood platelet Anatomy 0.000 abstract description 7
- 239000003112 inhibitor Substances 0.000 abstract description 7
- 239000000463 material Substances 0.000 abstract description 7
- 239000012588 trypsin Substances 0.000 abstract description 7
- 229960001322 trypsin Drugs 0.000 abstract description 7
- 102000009123 Fibrin Human genes 0.000 abstract description 6
- 108010073385 Fibrin Proteins 0.000 abstract description 6
- BWGVNKXGVNDBDI-UHFFFAOYSA-N Fibrin monomer Chemical compound CNC(=O)CNC(=O)CN BWGVNKXGVNDBDI-UHFFFAOYSA-N 0.000 abstract description 6
- 229950003499 fibrin Drugs 0.000 abstract description 6
- 239000000543 intermediate Substances 0.000 abstract description 6
- 230000003389 potentiating effect Effects 0.000 abstract description 5
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 abstract description 5
- 108010088842 Fibrinolysin Proteins 0.000 abstract description 4
- 229940012957 plasmin Drugs 0.000 abstract description 4
- 108010074860 Factor Xa Proteins 0.000 abstract description 2
- 238000000502 dialysis Methods 0.000 abstract description 2
- 108010036927 trypsin-like serine protease Proteins 0.000 abstract description 2
- 230000002785 anti-thrombosis Effects 0.000 abstract 2
- 208000005189 Embolism Diseases 0.000 abstract 1
- 239000003937 drug carrier Substances 0.000 abstract 1
- 150000004677 hydrates Chemical class 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 284
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 252
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 192
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 124
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 112
- 239000000243 solution Substances 0.000 description 112
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Natural products OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 94
- 239000011734 sodium Substances 0.000 description 77
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 76
- 239000011159 matrix material Substances 0.000 description 68
- 238000002474 experimental method Methods 0.000 description 67
- 238000005160 1H NMR spectroscopy Methods 0.000 description 65
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 63
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 60
- 229910001868 water Inorganic materials 0.000 description 60
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 59
- 238000001819 mass spectrum Methods 0.000 description 57
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 48
- 238000005481 NMR spectroscopy Methods 0.000 description 48
- 238000003818 flash chromatography Methods 0.000 description 48
- 239000012267 brine Substances 0.000 description 41
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 41
- CDUQMGQIHYISOP-UHFFFAOYSA-N 2-cyano-3-phenylprop-2-enoic acid Chemical compound OC(=O)C(C#N)=CC1=CC=CC=C1 CDUQMGQIHYISOP-UHFFFAOYSA-N 0.000 description 35
- 239000007787 solid Substances 0.000 description 35
- 239000000706 filtrate Substances 0.000 description 34
- 235000019441 ethanol Nutrition 0.000 description 31
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 30
- 239000003921 oil Substances 0.000 description 30
- 235000019198 oils Nutrition 0.000 description 30
- 229960005335 propanol Drugs 0.000 description 30
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 30
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 28
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 27
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 27
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 27
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 26
- 125000004181 carboxyalkyl group Chemical group 0.000 description 25
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 24
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 22
- 239000000126 substance Substances 0.000 description 22
- 239000007864 aqueous solution Substances 0.000 description 21
- 125000000753 cycloalkyl group Chemical group 0.000 description 20
- 239000000047 product Substances 0.000 description 20
- 239000012230 colorless oil Substances 0.000 description 18
- 125000003710 aryl alkyl group Chemical group 0.000 description 17
- 238000011282 treatment Methods 0.000 description 17
- 229960000583 acetic acid Drugs 0.000 description 16
- 235000011054 acetic acid Nutrition 0.000 description 16
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 16
- 239000000284 extract Substances 0.000 description 16
- 239000012279 sodium borohydride Substances 0.000 description 16
- 229910000033 sodium borohydride Inorganic materials 0.000 description 16
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 16
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 15
- 201000010099 disease Diseases 0.000 description 15
- 238000001914 filtration Methods 0.000 description 15
- 150000002466 imines Chemical class 0.000 description 15
- 239000010410 layer Substances 0.000 description 15
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 14
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 14
- 229960000789 guanidine hydrochloride Drugs 0.000 description 14
- PRAARDGLAWZXML-UHFFFAOYSA-N o-propylhydroxylamine Chemical compound CCCON PRAARDGLAWZXML-UHFFFAOYSA-N 0.000 description 14
- 238000003756 stirring Methods 0.000 description 14
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 13
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 13
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 12
- 125000003342 alkenyl group Chemical group 0.000 description 12
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 12
- 239000000741 silica gel Substances 0.000 description 12
- 229910002027 silica gel Inorganic materials 0.000 description 12
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 11
- 230000000694 effects Effects 0.000 description 11
- 239000002024 ethyl acetate extract Substances 0.000 description 11
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 11
- 238000002360 preparation method Methods 0.000 description 11
- 229930192474 thiophene Natural products 0.000 description 11
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 10
- 108090000790 Enzymes Proteins 0.000 description 10
- 102000004190 Enzymes Human genes 0.000 description 10
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical compound NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 description 10
- 229940088598 enzyme Drugs 0.000 description 10
- PXZQEOJJUGGUIB-UHFFFAOYSA-N isoindolin-1-one Chemical group C1=CC=C2C(=O)NCC2=C1 PXZQEOJJUGGUIB-UHFFFAOYSA-N 0.000 description 10
- 238000004949 mass spectrometry Methods 0.000 description 10
- 238000000746 purification Methods 0.000 description 10
- 125000004103 aminoalkyl group Chemical group 0.000 description 9
- 238000010168 coupling process Methods 0.000 description 9
- 238000010511 deprotection reaction Methods 0.000 description 9
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 9
- 239000003814 drug Substances 0.000 description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 9
- PJJJBBJSCAKJQF-UHFFFAOYSA-N guanidinium chloride Chemical compound [Cl-].NC(N)=[NH2+] PJJJBBJSCAKJQF-UHFFFAOYSA-N 0.000 description 9
- 239000012299 nitrogen atmosphere Substances 0.000 description 9
- 239000012074 organic phase Substances 0.000 description 9
- 125000006239 protecting group Chemical group 0.000 description 9
- 238000003786 synthesis reaction Methods 0.000 description 9
- 101150041968 CDC13 gene Proteins 0.000 description 8
- 239000000872 buffer Substances 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 8
- 238000001704 evaporation Methods 0.000 description 8
- 230000008020 evaporation Effects 0.000 description 8
- 239000000651 prodrug Substances 0.000 description 8
- 229940002612 prodrug Drugs 0.000 description 8
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 8
- 229940124530 sulfonamide Drugs 0.000 description 8
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 7
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 7
- 229940035437 1,3-propanediol Drugs 0.000 description 7
- 125000004104 aryloxy group Chemical group 0.000 description 7
- 230000008878 coupling Effects 0.000 description 7
- 238000005859 coupling reaction Methods 0.000 description 7
- 239000012043 crude product Substances 0.000 description 7
- GUDMZGLFZNLYEY-UHFFFAOYSA-N cyclopropylmethanol Chemical compound OCC1CC1 GUDMZGLFZNLYEY-UHFFFAOYSA-N 0.000 description 7
- 210000000265 leukocyte Anatomy 0.000 description 7
- 239000012528 membrane Substances 0.000 description 7
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- 150000003456 sulfonamides Chemical class 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- WXTMDXOMEHJXQO-UHFFFAOYSA-N 2,5-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC(O)=CC=C1O WXTMDXOMEHJXQO-UHFFFAOYSA-N 0.000 description 6
- ZZLCFHIKESPLTH-UHFFFAOYSA-N 4-Methylbiphenyl Chemical compound C1=CC(C)=CC=C1C1=CC=CC=C1 ZZLCFHIKESPLTH-UHFFFAOYSA-N 0.000 description 6
- LKDMKWNDBAVNQZ-UHFFFAOYSA-N 4-[[1-[[1-[2-[[1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)NC(C)C(=O)NC(C)C(=O)N1CCCC1C(=O)NC(C(=O)NC=1C=CC(=CC=1)[N+]([O-])=O)CC1=CC=CC=C1 LKDMKWNDBAVNQZ-UHFFFAOYSA-N 0.000 description 6
- NBKPNAMTHBIMLA-UHFFFAOYSA-N 5-methylbenzene-1,3-diol;hydrate Chemical compound O.CC1=CC(O)=CC(O)=C1 NBKPNAMTHBIMLA-UHFFFAOYSA-N 0.000 description 6
- 108090000617 Cathepsin G Proteins 0.000 description 6
- 102000004173 Cathepsin G Human genes 0.000 description 6
- 108010014173 Factor X Proteins 0.000 description 6
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 6
- 108010022999 Serine Proteases Proteins 0.000 description 6
- 102000012479 Serine Proteases Human genes 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 239000002178 crystalline material Substances 0.000 description 6
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 6
- 229940079593 drug Drugs 0.000 description 6
- 229940012426 factor x Drugs 0.000 description 6
- 239000012458 free base Substances 0.000 description 6
- 238000001840 matrix-assisted laser desorption--ionisation time-of-flight mass spectrometry Methods 0.000 description 6
- 125000002757 morpholinyl group Chemical group 0.000 description 6
- 239000012312 sodium hydride Substances 0.000 description 6
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 6
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 6
- 239000003868 thrombin inhibitor Substances 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-diisopropylethylamine Substances CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 5
- 108010067372 Pancreatic elastase Proteins 0.000 description 5
- 102000016387 Pancreatic elastase Human genes 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- 101000712605 Theromyzon tessulatum Theromin Proteins 0.000 description 5
- 229940122388 Thrombin inhibitor Drugs 0.000 description 5
- 102000003990 Urokinase-type plasminogen activator Human genes 0.000 description 5
- 108090000435 Urokinase-type plasminogen activator Proteins 0.000 description 5
- 125000005262 alkoxyamine group Chemical group 0.000 description 5
- 125000005422 alkyl sulfonamido group Chemical group 0.000 description 5
- 239000004305 biphenyl Substances 0.000 description 5
- 235000010290 biphenyl Nutrition 0.000 description 5
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 5
- 125000004663 dialkyl amino group Chemical group 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 238000009472 formulation Methods 0.000 description 5
- 125000005843 halogen group Chemical group 0.000 description 5
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 5
- BAVYZALUXZFZLV-UHFFFAOYSA-N mono-methylamine Natural products NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 229910052763 palladium Inorganic materials 0.000 description 5
- 239000000546 pharmaceutical excipient Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 108090000623 proteins and genes Proteins 0.000 description 5
- 102000004169 proteins and genes Human genes 0.000 description 5
- 230000009467 reduction Effects 0.000 description 5
- 238000006722 reduction reaction Methods 0.000 description 5
- 229960005356 urokinase Drugs 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- QTLDNGFPYAWPLR-UHFFFAOYSA-N 2,1$l^{6},3$l^{6}-benzoxadithiole 1,1,3,3-tetraoxide Chemical compound C1=CC=C2S(=O)(=O)OS(=O)(=O)C2=C1 QTLDNGFPYAWPLR-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- TUQRQDBYDAKEGM-UHFFFAOYSA-N CC(O)=O.CCCONC(N)=N Chemical compound CC(O)=O.CCCONC(N)=N TUQRQDBYDAKEGM-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 4
- 206010027476 Metastases Diseases 0.000 description 4
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 4
- 102100033174 Neutrophil elastase Human genes 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 150000001299 aldehydes Chemical class 0.000 description 4
- 230000023555 blood coagulation Effects 0.000 description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 238000004364 calculation method Methods 0.000 description 4
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 4
- 230000000875 corresponding effect Effects 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- 125000000131 cyclopropyloxy group Chemical group C1(CC1)O* 0.000 description 4
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical class C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 4
- 239000008298 dragée Substances 0.000 description 4
- 238000010828 elution Methods 0.000 description 4
- 238000000605 extraction Methods 0.000 description 4
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 4
- 125000002636 imidazolinyl group Chemical group 0.000 description 4
- 239000011777 magnesium Substances 0.000 description 4
- 229940050176 methyl chloride Drugs 0.000 description 4
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 4
- 235000019419 proteases Nutrition 0.000 description 4
- 238000006268 reductive amination reaction Methods 0.000 description 4
- 238000010898 silica gel chromatography Methods 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 4
- 150000003512 tertiary amines Chemical class 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- XDLNRRRJZOJTRW-UHFFFAOYSA-N thiohypochlorous acid Chemical compound ClS XDLNRRRJZOJTRW-UHFFFAOYSA-N 0.000 description 4
- 239000003643 water by type Substances 0.000 description 4
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 3
- XPJTUCSESGEMOI-UHFFFAOYSA-N 2-methylsulfonylbenzenesulfonyl chloride Chemical compound CS(=O)(=O)C1=CC=CC=C1S(Cl)(=O)=O XPJTUCSESGEMOI-UHFFFAOYSA-N 0.000 description 3
- GNFTZDOKVXKIBK-UHFFFAOYSA-N 3-(2-methoxyethoxy)benzohydrazide Chemical compound COCCOC1=CC=CC(C(=O)NN)=C1 GNFTZDOKVXKIBK-UHFFFAOYSA-N 0.000 description 3
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 3
- 208000024827 Alzheimer disease Diseases 0.000 description 3
- FGUUSXIOTUKUDN-IBGZPJMESA-N C1(=CC=CC=C1)N1C2=C(NC([C@H](C1)NC=1OC(=NN=1)C1=CC=CC=C1)=O)C=CC=C2 Chemical compound C1(=CC=CC=C1)N1C2=C(NC([C@H](C1)NC=1OC(=NN=1)C1=CC=CC=C1)=O)C=CC=C2 FGUUSXIOTUKUDN-IBGZPJMESA-N 0.000 description 3
- QUHRINUJKYWMPL-UHFFFAOYSA-N Cl.O=C=S Chemical compound Cl.O=C=S QUHRINUJKYWMPL-UHFFFAOYSA-N 0.000 description 3
- 229920000858 Cyclodextrin Polymers 0.000 description 3
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 3
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 3
- 206010051055 Deep vein thrombosis Diseases 0.000 description 3
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 3
- 208000000059 Dyspnea Diseases 0.000 description 3
- 206010013975 Dyspnoeas Diseases 0.000 description 3
- 108010010803 Gelatin Proteins 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 3
- 108010028275 Leukocyte Elastase Proteins 0.000 description 3
- 238000006751 Mitsunobu reaction Methods 0.000 description 3
- 206010028980 Neoplasm Diseases 0.000 description 3
- 206010040070 Septic Shock Diseases 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 206010047249 Venous thrombosis Diseases 0.000 description 3
- CYPXYWDSUBFAGZ-UHFFFAOYSA-N [3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenyl] 2-cyanobenzenesulfonate;hydrochloride Chemical compound Cl.CC1=CC(OCCCONC(N)=N)=CC(OS(=O)(=O)C=2C(=CC=CC=2)C#N)=C1 CYPXYWDSUBFAGZ-UHFFFAOYSA-N 0.000 description 3
- HLMOWVJEQDTZRJ-UHFFFAOYSA-N [3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenyl] 2-methoxybenzenesulfonate Chemical compound COC1=CC=CC=C1S(=O)(=O)OC1=CC(C)=CC(OCCCONC(N)=N)=C1 HLMOWVJEQDTZRJ-UHFFFAOYSA-N 0.000 description 3
- 230000002159 abnormal effect Effects 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 125000005139 alkynylsulfonyl group Chemical group 0.000 description 3
- 125000003368 amide group Chemical group 0.000 description 3
- 206010003246 arthritis Diseases 0.000 description 3
- 238000002306 biochemical method Methods 0.000 description 3
- 239000012455 biphasic mixture Substances 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 239000007853 buffer solution Substances 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000005111 carboxyalkoxy group Chemical group 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 210000004027 cell Anatomy 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- 230000004087 circulation Effects 0.000 description 3
- 125000004122 cyclic group Chemical group 0.000 description 3
- 238000013461 design Methods 0.000 description 3
- 230000020764 fibrinolysis Effects 0.000 description 3
- 239000003527 fibrinolytic agent Substances 0.000 description 3
- 235000013312 flour Nutrition 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 229960005219 gentisic acid Drugs 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 125000002883 imidazolyl group Chemical group 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 125000001786 isothiazolyl group Chemical group 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Substances [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 3
- 230000009401 metastasis Effects 0.000 description 3
- 208000010125 myocardial infarction Diseases 0.000 description 3
- 210000000440 neutrophil Anatomy 0.000 description 3
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 3
- NIHNNTQXNPWCJQ-UHFFFAOYSA-N o-biphenylenemethane Natural products C1=CC=C2CC3=CC=CC=C3C2=C1 NIHNNTQXNPWCJQ-UHFFFAOYSA-N 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 125000002971 oxazolyl group Chemical group 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 230000037361 pathway Effects 0.000 description 3
- BNIXVQGCZULYKV-UHFFFAOYSA-N pentachloroethane Chemical compound ClC(Cl)C(Cl)(Cl)Cl BNIXVQGCZULYKV-UHFFFAOYSA-N 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 3
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 3
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 3
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 3
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 3
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 3
- 125000000168 pyrrolyl group Chemical group 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000000600 sorbitol Substances 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 210000002784 stomach Anatomy 0.000 description 3
- 208000011580 syndromic disease Diseases 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- 235000012222 talc Nutrition 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 3
- 210000001519 tissue Anatomy 0.000 description 3
- 239000002753 trypsin inhibitor Substances 0.000 description 3
- 210000003462 vein Anatomy 0.000 description 3
- IKTARNWCNSRHGM-UHFFFAOYSA-N (2-hydroxyphenyl) 2-nitrobenzenesulfonate Chemical compound OC1=CC=CC=C1OS(=O)(=O)C1=CC=CC=C1[N+]([O-])=O IKTARNWCNSRHGM-UHFFFAOYSA-N 0.000 description 2
- XQXSSRWVLRSYFE-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 2-cyanobenzenesulfonate Chemical compound CC1=CC(O)=CC(OS(=O)(=O)C=2C(=CC=CC=2)C#N)=C1 XQXSSRWVLRSYFE-UHFFFAOYSA-N 0.000 description 2
- XTLOYSWIGPAIQL-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 2-methylsulfonylbenzenesulfonate Chemical compound CC1=CC(O)=CC(OS(=O)(=O)C=2C(=CC=CC=2)S(C)(=O)=O)=C1 XTLOYSWIGPAIQL-UHFFFAOYSA-N 0.000 description 2
- ABURZMNVRVIFEQ-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 5-chloro-2-methoxybenzenesulfonate Chemical compound COC1=CC=C(Cl)C=C1S(=O)(=O)OC1=CC(C)=CC(O)=C1 ABURZMNVRVIFEQ-UHFFFAOYSA-N 0.000 description 2
- USVVENVKYJZFMW-ONEGZZNKSA-N (e)-carboxyiminocarbamic acid Chemical compound OC(=O)\N=N\C(O)=O USVVENVKYJZFMW-ONEGZZNKSA-N 0.000 description 2
- HZQLUIZFUXNFHK-UHFFFAOYSA-N 1-(bromomethyl)-4-phenylbenzene Chemical group C1=CC(CBr)=CC=C1C1=CC=CC=C1 HZQLUIZFUXNFHK-UHFFFAOYSA-N 0.000 description 2
- VKVZIEIOKBAKMI-UHFFFAOYSA-N 1-(dibromomethyl)-2-phenylbenzene Chemical group BrC(Br)C1=CC=CC=C1C1=CC=CC=C1 VKVZIEIOKBAKMI-UHFFFAOYSA-N 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- JENQWNVHFRXNBZ-UHFFFAOYSA-N 2-(benzenesulfonyl)benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1S(=O)(=O)C1=CC=CC=C1 JENQWNVHFRXNBZ-UHFFFAOYSA-N 0.000 description 2
- WNPXUCYRKHVMAD-UHFFFAOYSA-N 2-(benzylideneamino)guanidine Chemical group NC(N)=NN=CC1=CC=CC=C1 WNPXUCYRKHVMAD-UHFFFAOYSA-N 0.000 description 2
- PRVCUCWJCHSCLW-UHFFFAOYSA-N 2-[methyl(2-phenylethyl)sulfamoyl]benzenesulfonyl chloride Chemical compound C=1C=CC=C(S(Cl)(=O)=O)C=1S(=O)(=O)N(C)CCC1=CC=CC=C1 PRVCUCWJCHSCLW-UHFFFAOYSA-N 0.000 description 2
- CBMRZJUMXRMBBQ-UHFFFAOYSA-N 2-ethoxyguanidine Chemical compound CCON=C(N)N CBMRZJUMXRMBBQ-UHFFFAOYSA-N 0.000 description 2
- WLPZGLWVUUJJTB-UHFFFAOYSA-N 2-morpholin-4-ylsulfonylaniline Chemical compound NC1=CC=CC=C1S(=O)(=O)N1CCOCC1 WLPZGLWVUUJJTB-UHFFFAOYSA-N 0.000 description 2
- ISQFAZPDFYZPSH-UHFFFAOYSA-N 2-morpholin-4-ylsulfonylbenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1S(=O)(=O)N1CCOCC1 ISQFAZPDFYZPSH-UHFFFAOYSA-N 0.000 description 2
- IQUPABOKLQSFBK-UHFFFAOYSA-N 2-nitrophenol Chemical compound OC1=CC=CC=C1[N+]([O-])=O IQUPABOKLQSFBK-UHFFFAOYSA-N 0.000 description 2
- RQFUZUMFPRMVDX-UHFFFAOYSA-N 3-Bromo-1-propanol Chemical compound OCCCBr RQFUZUMFPRMVDX-UHFFFAOYSA-N 0.000 description 2
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 2
- CQEFJGDLGWJIRV-UHFFFAOYSA-N 3-methylsulfonylbenzenesulfonyl chloride Chemical compound CS(=O)(=O)C1=CC=CC(S(Cl)(=O)=O)=C1 CQEFJGDLGWJIRV-UHFFFAOYSA-N 0.000 description 2
- NXJKHLDWXHCTMN-UHFFFAOYSA-N 4-(2-nitrophenyl)sulfonylmorpholine Chemical compound [O-][N+](=O)C1=CC=CC=C1S(=O)(=O)N1CCOCC1 NXJKHLDWXHCTMN-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- 206010009900 Colitis ulcerative Diseases 0.000 description 2
- 108010028774 Complement C1 Proteins 0.000 description 2
- 102000016917 Complement C1 Human genes 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 201000010374 Down Syndrome Diseases 0.000 description 2
- 206010014824 Endotoxic shock Diseases 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 108060005987 Kallikrein Proteins 0.000 description 2
- 102000001399 Kallikrein Human genes 0.000 description 2
- 108010076876 Keratins Proteins 0.000 description 2
- 102000011782 Keratins Human genes 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 208000032376 Lung infection Diseases 0.000 description 2
- 108010006035 Metalloproteases Proteins 0.000 description 2
- 102000005741 Metalloproteases Human genes 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- NIPNSKYNPDTRPC-UHFFFAOYSA-N N-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 NIPNSKYNPDTRPC-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 102000001938 Plasminogen Activators Human genes 0.000 description 2
- 108010001014 Plasminogen Activators Proteins 0.000 description 2
- 229920002565 Polyethylene Glycol 400 Polymers 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N Propene Chemical compound CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 206010060862 Prostate cancer Diseases 0.000 description 2
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 2
- 108010094028 Prothrombin Proteins 0.000 description 2
- 102100027378 Prothrombin Human genes 0.000 description 2
- 201000004681 Psoriasis Diseases 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 239000002262 Schiff base Substances 0.000 description 2
- 150000004753 Schiff bases Chemical class 0.000 description 2
- 208000034189 Sclerosis Diseases 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 201000006704 Ulcerative Colitis Diseases 0.000 description 2
- 208000007814 Unstable Angina Diseases 0.000 description 2
- DWOWIGCIHNPYKH-UHFFFAOYSA-N [3-(3-aminooxypropoxy)-5-methoxyphenyl] 2-methylsulfonylbenzenesulfonate Chemical compound COC1=CC(OCCCON)=CC(OS(=O)(=O)C=2C(=CC=CC=2)S(C)(=O)=O)=C1 DWOWIGCIHNPYKH-UHFFFAOYSA-N 0.000 description 2
- FKUPDWZCYOILMH-UHFFFAOYSA-N [3-(3-aminooxypropoxy)-5-methylphenyl] 2-cyanobenzenesulfonate Chemical compound CC1=CC(OCCCON)=CC(OS(=O)(=O)C=2C(=CC=CC=2)C#N)=C1 FKUPDWZCYOILMH-UHFFFAOYSA-N 0.000 description 2
- FXTFPYPXUIFMFF-UHFFFAOYSA-N [3-(3-aminooxypropoxy)-5-methylphenyl] isoquinoline-5-sulfonate Chemical compound CC1=CC(OCCCON)=CC(OS(=O)(=O)C=2C3=CC=NC=C3C=CC=2)=C1 FXTFPYPXUIFMFF-UHFFFAOYSA-N 0.000 description 2
- YTOWMDNANZTQSD-UHFFFAOYSA-N [3-[3-(diaminomethylideneamino)oxypropoxy]-5-ethylphenyl] 2-methylsulfonylbenzenesulfonate;hydrochloride Chemical compound Cl.CCC1=CC(OCCCONC(N)=N)=CC(OS(=O)(=O)C=2C(=CC=CC=2)S(C)(=O)=O)=C1 YTOWMDNANZTQSD-UHFFFAOYSA-N 0.000 description 2
- UUNONKDXVQACNH-UHFFFAOYSA-N [3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenyl] 2,4-bis(methylsulfonyl)benzenesulfonate;hydrochloride Chemical compound Cl.CC1=CC(OCCCONC(N)=N)=CC(OS(=O)(=O)C=2C(=CC(=CC=2)S(C)(=O)=O)S(C)(=O)=O)=C1 UUNONKDXVQACNH-UHFFFAOYSA-N 0.000 description 2
- LCPLUPDSNDJWMA-UHFFFAOYSA-N [3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenyl] 5-chloro-2-methoxybenzenesulfonate;hydrochloride Chemical compound Cl.COC1=CC=C(Cl)C=C1S(=O)(=O)OC1=CC(C)=CC(OCCCONC(N)=N)=C1 LCPLUPDSNDJWMA-UHFFFAOYSA-N 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- WDJHALXBUFZDSR-UHFFFAOYSA-N acetoacetic acid Chemical compound CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 239000012190 activator Substances 0.000 description 2
- 125000006241 alcohol protecting group Chemical group 0.000 description 2
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 2
- 125000005137 alkenylsulfonyl group Chemical group 0.000 description 2
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 230000003110 anti-inflammatory effect Effects 0.000 description 2
- 125000005140 aralkylsulfonyl group Chemical group 0.000 description 2
- 125000005421 aryl sulfonamido group Chemical group 0.000 description 2
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- 108010051210 beta-Fructofuranosidase Proteins 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 229910052797 bismuth Inorganic materials 0.000 description 2
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- NZXRFGHWGPEIEZ-UHFFFAOYSA-N carbamimidoylazanium;2,2,2-trifluoroacetate Chemical compound NC(N)=N.OC(=O)C(F)(F)F NZXRFGHWGPEIEZ-UHFFFAOYSA-N 0.000 description 2
- 150000001728 carbonyl compounds Chemical class 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 2
- 230000002612 cardiopulmonary effect Effects 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 238000002512 chemotherapy Methods 0.000 description 2
- 230000035602 clotting Effects 0.000 description 2
- 230000015271 coagulation Effects 0.000 description 2
- 238000005345 coagulation Methods 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 2
- 239000002027 dichloromethane extract Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 208000009190 disseminated intravascular coagulation Diseases 0.000 description 2
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 description 2
- 210000002889 endothelial cell Anatomy 0.000 description 2
- 239000010685 fatty oil Substances 0.000 description 2
- ULITUPMHIDVLLV-UHFFFAOYSA-N formonitrile;sodium Chemical compound [Na].N#C ULITUPMHIDVLLV-UHFFFAOYSA-N 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 210000000224 granular leucocyte Anatomy 0.000 description 2
- DXTIKTAIYCJTII-UHFFFAOYSA-N guanidine acetate Chemical compound CC([O-])=O.NC([NH3+])=N DXTIKTAIYCJTII-UHFFFAOYSA-N 0.000 description 2
- 125000005553 heteroaryloxy group Chemical group 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000005113 hydroxyalkoxy group Chemical group 0.000 description 2
- 125000001041 indolyl group Chemical group 0.000 description 2
- 208000027866 inflammatory disease Diseases 0.000 description 2
- 208000014674 injury Diseases 0.000 description 2
- 239000001573 invertase Substances 0.000 description 2
- 235000011073 invertase Nutrition 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000000842 isoxazolyl group Chemical group 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- SASNBVQSOZSTPD-UHFFFAOYSA-N n-methylphenethylamine Chemical compound CNCCC1=CC=CC=C1 SASNBVQSOZSTPD-UHFFFAOYSA-N 0.000 description 2
- 230000014508 negative regulation of coagulation Effects 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- XOKSLPVRUOBDEW-UHFFFAOYSA-N pinane Chemical compound CC1CCC2C(C)(C)C1C2 XOKSLPVRUOBDEW-UHFFFAOYSA-N 0.000 description 2
- 229940127126 plasminogen activator Drugs 0.000 description 2
- 229920000747 poly(lactic acid) Polymers 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 239000004626 polylactic acid Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 125000006308 propyl amino group Chemical group 0.000 description 2
- 235000019833 protease Nutrition 0.000 description 2
- 230000002797 proteolythic effect Effects 0.000 description 2
- 229940039716 prothrombin Drugs 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- 125000002098 pyridazinyl group Chemical group 0.000 description 2
- LEHBURLTIWGHEM-UHFFFAOYSA-N pyridinium chlorochromate Chemical compound [O-][Cr](Cl)(=O)=O.C1=CC=[NH+]C=C1 LEHBURLTIWGHEM-UHFFFAOYSA-N 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- HFHDHCJBZVLPGP-UHFFFAOYSA-N schardinger α-dextrin Chemical compound O1C(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(O)C2O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC2C(O)C(O)C1OC2CO HFHDHCJBZVLPGP-UHFFFAOYSA-N 0.000 description 2
- 210000000329 smooth muscle myocyte Anatomy 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 235000000346 sugar Nutrition 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 150000003573 thiols Chemical class 0.000 description 2
- 229960000103 thrombolytic agent Drugs 0.000 description 2
- 201000005665 thrombophilia Diseases 0.000 description 2
- 230000008733 trauma Effects 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical class [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- 230000029663 wound healing Effects 0.000 description 2
- MTCFGRXMJLQNBG-REOHCLBHSA-N (2S)-2-Amino-3-hydroxypropansäure Chemical compound OC[C@H](N)C(O)=O MTCFGRXMJLQNBG-REOHCLBHSA-N 0.000 description 1
- FDGZEABDEHHINM-UHFFFAOYSA-N (3-ethyl-5-hydroxyphenyl) 2-methylsulfonylbenzenesulfonate Chemical compound CCC1=CC(O)=CC(OS(=O)(=O)C=2C(=CC=CC=2)S(C)(=O)=O)=C1 FDGZEABDEHHINM-UHFFFAOYSA-N 0.000 description 1
- QNFFUMFYEKJONF-UHFFFAOYSA-N (3-hydroxy-5-methoxyphenyl) 2-methylsulfonylbenzenesulfonate Chemical compound COC1=CC(O)=CC(OS(=O)(=O)C=2C(=CC=CC=2)S(C)(=O)=O)=C1 QNFFUMFYEKJONF-UHFFFAOYSA-N 0.000 description 1
- PVEFUDIXDYZOOF-UHFFFAOYSA-N (3-hydroxy-5-methylphenyl) 2-methoxybenzenesulfonate Chemical compound COC1=CC=CC=C1S(=O)(=O)OC1=CC(C)=CC(O)=C1 PVEFUDIXDYZOOF-UHFFFAOYSA-N 0.000 description 1
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 description 1
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 description 1
- YKYIFUROKBDHCY-ONEGZZNKSA-N (e)-4-ethoxy-1,1,1-trifluorobut-3-en-2-one Chemical group CCO\C=C\C(=O)C(F)(F)F YKYIFUROKBDHCY-ONEGZZNKSA-N 0.000 description 1
- MDUQQNWSTJAPCW-UHFFFAOYSA-N (ethyl-$l^{2}-azanyl)ethane Chemical compound CC[N]CC MDUQQNWSTJAPCW-UHFFFAOYSA-N 0.000 description 1
- XMKLTEGSALONPH-UHFFFAOYSA-N 1,2,4,5-tetrazinane-3,6-dione Chemical compound O=C1NNC(=O)NN1 XMKLTEGSALONPH-UHFFFAOYSA-N 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- YIWGJFPJRAEKMK-UHFFFAOYSA-N 1-(2H-benzotriazol-5-yl)-3-methyl-8-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione Chemical compound CN1C(=O)N(c2ccc3n[nH]nc3c2)C2(CCN(CC2)C(=O)c2cnc(NCc3cccc(OC(F)(F)F)c3)nc2)C1=O YIWGJFPJRAEKMK-UHFFFAOYSA-N 0.000 description 1
- HMUNWXXNJPVALC-UHFFFAOYSA-N 1-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C(CN1CC2=C(CC1)NN=N2)=O HMUNWXXNJPVALC-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- RMSGQZDGSZOJMU-UHFFFAOYSA-N 1-butyl-2-phenylbenzene Chemical group CCCCC1=CC=CC=C1C1=CC=CC=C1 RMSGQZDGSZOJMU-UHFFFAOYSA-N 0.000 description 1
- YRGAYAGBVIXNAQ-UHFFFAOYSA-N 1-chloro-4-methoxybenzene Chemical compound COC1=CC=C(Cl)C=C1 YRGAYAGBVIXNAQ-UHFFFAOYSA-N 0.000 description 1
- JWMKUKRBNODZFA-UHFFFAOYSA-N 1-ethoxy-2-methylbenzene Chemical compound CCOC1=CC=CC=C1C JWMKUKRBNODZFA-UHFFFAOYSA-N 0.000 description 1
- IHDIQTKIKDGWHM-UHFFFAOYSA-N 1-ethoxycarbonyl-2-ethylcyclopropane-1-carboxylic acid Chemical compound CCOC(=O)C1(C(O)=O)CC1CC IHDIQTKIKDGWHM-UHFFFAOYSA-N 0.000 description 1
- WLXGQMVCYPUOLM-UHFFFAOYSA-N 1-hydroxyethanesulfonic acid Chemical compound CC(O)S(O)(=O)=O WLXGQMVCYPUOLM-UHFFFAOYSA-N 0.000 description 1
- SHVYWPPXMYGUOX-UHFFFAOYSA-N 1-methoxy-1-propylguanidine Chemical compound CON(C(=N)N)CCC SHVYWPPXMYGUOX-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- RMVOEKSHKZRBIM-UHFFFAOYSA-N 1-methyl-3-propoxybenzene Chemical compound CCCOC1=CC=CC(C)=C1 RMVOEKSHKZRBIM-UHFFFAOYSA-N 0.000 description 1
- RKMNQXFECVRTNI-UHFFFAOYSA-N 1-methylcyclohexa-2,4-dien-1-ol Chemical compound CC1(O)CC=CC=C1 RKMNQXFECVRTNI-UHFFFAOYSA-N 0.000 description 1
- RECMXJOGNNTEBG-UHFFFAOYSA-N 1-phenylmethoxyethanol Chemical compound CC(O)OCC1=CC=CC=C1 RECMXJOGNNTEBG-UHFFFAOYSA-N 0.000 description 1
- 229940044613 1-propanol Drugs 0.000 description 1
- CLFQABLXSHOUCL-UHFFFAOYSA-N 2,4-bis(methylsulfonyl)benzenesulfonyl chloride Chemical compound CS(=O)(=O)C1=CC=C(S(Cl)(=O)=O)C(S(C)(=O)=O)=C1 CLFQABLXSHOUCL-UHFFFAOYSA-N 0.000 description 1
- QXEALSQICJTWJS-UHFFFAOYSA-N 2-(3-phenoxypropoxy)guanidine Chemical compound NC(N)=NOCCCOC1=CC=CC=C1 QXEALSQICJTWJS-UHFFFAOYSA-N 0.000 description 1
- DZRRFXIGJMIHGM-UHFFFAOYSA-N 2-(propylamino)guanidine Chemical compound CCCNN=C(N)N DZRRFXIGJMIHGM-UHFFFAOYSA-N 0.000 description 1
- LNLMUCJNOGBKPX-UHFFFAOYSA-N 2-[3-[3-methyl-5-[methyl-(2-methylsulfonylphenyl)sulfonylamino]phenoxy]propoxy]guanidine;hydrochloride Chemical compound Cl.C=1C=CC=C(S(C)(=O)=O)C=1S(=O)(=O)N(C)C1=CC(C)=CC(OCCCONC(N)=N)=C1 LNLMUCJNOGBKPX-UHFFFAOYSA-N 0.000 description 1
- JQMFQLVAJGZSQS-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)NC1=CC2=C(NC(O2)=O)C=C1 JQMFQLVAJGZSQS-UHFFFAOYSA-N 0.000 description 1
- ZZNJGTBIIZXTIZ-UHFFFAOYSA-N 2-[carboxymethyl-[2-[3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenoxy]sulfonylphenyl]sulfonylamino]acetic acid Chemical compound CC1=CC(OCCCONC(N)=N)=CC(OS(=O)(=O)C=2C(=CC=CC=2)S(=O)(=O)N(CC(O)=O)CC(O)=O)=C1 ZZNJGTBIIZXTIZ-UHFFFAOYSA-N 0.000 description 1
- TVTJUIAKQFIXCE-HUKYDQBMSA-N 2-amino-9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-ynyl-1H-purine-6,8-dione Chemical compound NC=1NC(C=2N(C(N(C=2N=1)[C@@H]1O[C@@H]([C@H]([C@H]1O)F)CO)=O)CC#C)=O TVTJUIAKQFIXCE-HUKYDQBMSA-N 0.000 description 1
- MGRLVKZNTGMJKE-UHFFFAOYSA-N 2-amino-n-methyl-n-(2-phenylethyl)benzenesulfonamide Chemical compound C=1C=CC=C(N)C=1S(=O)(=O)N(C)CCC1=CC=CC=C1 MGRLVKZNTGMJKE-UHFFFAOYSA-N 0.000 description 1
- WTRIMJTZOOLIFZ-UHFFFAOYSA-N 2-bromo-2-methylpropanamide Chemical compound CC(C)(Br)C(N)=O WTRIMJTZOOLIFZ-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- DZEKABRTTKTJTG-UHFFFAOYSA-N 2-chloro-4-methylsulfonylbenzenesulfonyl chloride Chemical compound CS(=O)(=O)C1=CC=C(S(Cl)(=O)=O)C(Cl)=C1 DZEKABRTTKTJTG-UHFFFAOYSA-N 0.000 description 1
- XHRCFGDFESIFRG-UHFFFAOYSA-N 2-chloro-n-ethyl-n-[(2-methylphenyl)methyl]ethanamine Chemical compound ClCCN(CC)CC1=CC=CC=C1C XHRCFGDFESIFRG-UHFFFAOYSA-N 0.000 description 1
- KMVZDSQHLDGKGV-UHFFFAOYSA-N 2-chlorobenzenesulfonyl chloride Chemical compound ClC1=CC=CC=C1S(Cl)(=O)=O KMVZDSQHLDGKGV-UHFFFAOYSA-N 0.000 description 1
- ODZTXUXIYGJLMC-UHFFFAOYSA-N 2-hydroxycyclohexan-1-one Chemical compound OC1CCCCC1=O ODZTXUXIYGJLMC-UHFFFAOYSA-N 0.000 description 1
- LUTDLYPHDVQSHT-UHFFFAOYSA-N 2-hydroxycyclopentan-1-one Chemical compound OC1CCCC1=O LUTDLYPHDVQSHT-UHFFFAOYSA-N 0.000 description 1
- KQDJTBPASNJQFQ-UHFFFAOYSA-N 2-iodophenol Chemical compound OC1=CC=CC=C1I KQDJTBPASNJQFQ-UHFFFAOYSA-N 0.000 description 1
- 125000006020 2-methyl-1-propenyl group Chemical group 0.000 description 1
- IBWLHILCVXHJGA-UHFFFAOYSA-N 2-methylbenzene-1,3-diol hydrate Chemical compound O.Cc1c(O)cccc1O IBWLHILCVXHJGA-UHFFFAOYSA-N 0.000 description 1
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 1
- HBZMMTAMDTYYIT-UHFFFAOYSA-N 2-methylsulfonylbenzenesulfonic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1S(O)(=O)=O HBZMMTAMDTYYIT-UHFFFAOYSA-N 0.000 description 1
- WPHUUIODWRNJLO-UHFFFAOYSA-N 2-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC=CC=C1S(Cl)(=O)=O WPHUUIODWRNJLO-UHFFFAOYSA-N 0.000 description 1
- KCMCIQNPQUSQKQ-UHFFFAOYSA-N 2-oxido-1,2,5-oxadiazol-2-ium Chemical group [O-][N+]1=CC=NO1 KCMCIQNPQUSQKQ-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- UDIPIOHLDFSMLR-UHFFFAOYSA-N 2-phenylmethoxypropane-1,3-diol Chemical compound OCC(CO)OCC1=CC=CC=C1 UDIPIOHLDFSMLR-UHFFFAOYSA-N 0.000 description 1
- VSWICNJIUPRZIK-UHFFFAOYSA-N 2-piperideine Chemical compound C1CNC=CC1 VSWICNJIUPRZIK-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- YLZOPXRUQYQQID-UHFFFAOYSA-N 3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]propan-1-one Chemical compound N1N=NC=2CN(CCC=21)CCC(=O)N1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F YLZOPXRUQYQQID-UHFFFAOYSA-N 0.000 description 1
- JBDALVUQSBGPGG-UHFFFAOYSA-N 3-[benzyl-[2-[3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenoxy]sulfonylphenyl]sulfonylamino]propanoic acid Chemical compound CC1=CC(OCCCONC(N)=N)=CC(OS(=O)(=O)C=2C(=CC=CC=2)S(=O)(=O)N(CCC(O)=O)CC=2C=CC=CC=2)=C1 JBDALVUQSBGPGG-UHFFFAOYSA-N 0.000 description 1
- 229940018563 3-aminophenol Drugs 0.000 description 1
- DCBCSMXGLXAXDM-UHFFFAOYSA-N 3-aminophenol;hydrochloride Chemical compound [Cl-].[NH3+]C1=CC=CC(O)=C1 DCBCSMXGLXAXDM-UHFFFAOYSA-N 0.000 description 1
- RRWSCYULIDBTSN-UHFFFAOYSA-N 3-cyano-2-phenylprop-2-enoic acid Chemical compound N#CC=C(C(=O)O)C1=CC=CC=C1 RRWSCYULIDBTSN-UHFFFAOYSA-N 0.000 description 1
- TWEVQGUWCLBRMJ-UHFFFAOYSA-N 3-hydroxycyclohexanone Chemical compound OC1CCCC(=O)C1 TWEVQGUWCLBRMJ-UHFFFAOYSA-N 0.000 description 1
- GULNLSGTYCQLLM-UHFFFAOYSA-N 3-hydroxycyclopentan-1-one Chemical compound OC1CCC(=O)C1 GULNLSGTYCQLLM-UHFFFAOYSA-N 0.000 description 1
- XCMAYGDQKTWICK-UHFFFAOYSA-N 3-methylquinoline-8-sulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC2=CC(C)=CN=C21 XCMAYGDQKTWICK-UHFFFAOYSA-N 0.000 description 1
- FUCYABRIJPUVAT-UHFFFAOYSA-N 3-phenylmethoxypropan-1-ol Chemical compound OCCCOCC1=CC=CC=C1 FUCYABRIJPUVAT-UHFFFAOYSA-N 0.000 description 1
- XMIIGOLPHOKFCH-UHFFFAOYSA-N 3-phenylpropionic acid Chemical compound OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 1
- LVSAKQCUCVBEEL-UHFFFAOYSA-N 4,5-dihydroimidazole-1-carboximidamide Chemical compound NC(=N)N1CCN=C1 LVSAKQCUCVBEEL-UHFFFAOYSA-N 0.000 description 1
- UKZSZLMBZKZOQQ-UHFFFAOYSA-N 4-[benzenesulfonyl(methyl)amino]benzoic acid Chemical compound C=1C=CC=CC=1S(=O)(=O)N(C)C1=CC=C(C(O)=O)C=C1 UKZSZLMBZKZOQQ-UHFFFAOYSA-N 0.000 description 1
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 1
- TYJOQICPGZGYDT-UHFFFAOYSA-N 4-methylsulfonylbenzenesulfonyl chloride Chemical compound CS(=O)(=O)C1=CC=C(S(Cl)(=O)=O)C=C1 TYJOQICPGZGYDT-UHFFFAOYSA-N 0.000 description 1
- XKWZLZLVNFUCBL-UHFFFAOYSA-N 4-methylsulfonylpiperidine Chemical group CS(=O)(=O)C1CCNCC1 XKWZLZLVNFUCBL-UHFFFAOYSA-N 0.000 description 1
- FEXIEMAAKBNTFK-UHFFFAOYSA-N 4-nitropyridine Chemical compound [O-][N+](=O)C1=CC=NC=C1 FEXIEMAAKBNTFK-UHFFFAOYSA-N 0.000 description 1
- VRJHQPZVIGNGMX-UHFFFAOYSA-N 4-piperidinone Chemical compound O=C1CCNCC1 VRJHQPZVIGNGMX-UHFFFAOYSA-N 0.000 description 1
- UYIBSOGLVFILMU-UHFFFAOYSA-N 5-chloro-2-methoxybenzenesulfonic acid Chemical compound COC1=CC=C(Cl)C=C1S(O)(=O)=O UYIBSOGLVFILMU-UHFFFAOYSA-N 0.000 description 1
- MSFGJICDOLGZQK-UHFFFAOYSA-N 5-ethylbenzene-1,3-diol Chemical compound CCC1=CC(O)=CC(O)=C1 MSFGJICDOLGZQK-UHFFFAOYSA-N 0.000 description 1
- DEXFNLNNUZKHNO-UHFFFAOYSA-N 6-[3-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-3-oxopropyl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)C(CCC1=CC2=C(NC(O2)=O)C=C1)=O DEXFNLNNUZKHNO-UHFFFAOYSA-N 0.000 description 1
- RJGDLECROOVPJO-UHFFFAOYSA-N 9h-fluorene-1-carboximidamide Chemical compound C1C2=CC=CC=C2C2=C1C(C(=N)N)=CC=C2 RJGDLECROOVPJO-UHFFFAOYSA-N 0.000 description 1
- 229930000680 A04AD01 - Scopolamine Natural products 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- OQLZINXFSUDMHM-UHFFFAOYSA-N Acetamidine Chemical compound CC(N)=N OQLZINXFSUDMHM-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 208000031295 Animal disease Diseases 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 206010004446 Benign prostatic hyperplasia Diseases 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- QJYWSSXJVJAEOX-UHFFFAOYSA-N C(#N)N=C(N)[N+](=O)[O-] Chemical compound C(#N)N=C(N)[N+](=O)[O-] QJYWSSXJVJAEOX-UHFFFAOYSA-N 0.000 description 1
- GRUAMYHRVOSBEE-UHFFFAOYSA-N C(C)(=O)O.C1(CC1)CONC(=N)N Chemical compound C(C)(=O)O.C1(CC1)CONC(=N)N GRUAMYHRVOSBEE-UHFFFAOYSA-N 0.000 description 1
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 description 1
- BLFCQOINAPWLMV-UHFFFAOYSA-N CC(O)=O.CC(O)=O.NC(N)=N Chemical compound CC(O)=O.CC(O)=O.NC(N)=N BLFCQOINAPWLMV-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 208000024172 Cardiovascular disease Diseases 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 241000790917 Dioxys <bee> Species 0.000 description 1
- 229940123900 Direct thrombin inhibitor Drugs 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- 241001125671 Eretmochelys imbricata Species 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- 108010014172 Factor V Proteins 0.000 description 1
- 229940123583 Factor Xa inhibitor Drugs 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 208000018522 Gastrointestinal disease Diseases 0.000 description 1
- 206010018364 Glomerulonephritis Diseases 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 101000933179 Homo sapiens Cathepsin G Proteins 0.000 description 1
- 101000851058 Homo sapiens Neutrophil elastase Proteins 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- STECJAGHUSJQJN-GAUPFVANSA-N Hyoscine Natural products C1([C@H](CO)C(=O)OC2C[C@@H]3N([C@H](C2)[C@@H]2[C@H]3O2)C)=CC=CC=C1 STECJAGHUSJQJN-GAUPFVANSA-N 0.000 description 1
- 241000239218 Limulus Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- 208000019693 Lung disease Diseases 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- NSCSMQNWQMZTJO-UHFFFAOYSA-N N(=NC(=O)C1NCCCC1)C(=O)C1NCCCC1 Chemical compound N(=NC(=O)C1NCCCC1)C(=O)C1NCCCC1 NSCSMQNWQMZTJO-UHFFFAOYSA-N 0.000 description 1
- STECJAGHUSJQJN-UHFFFAOYSA-N N-Methyl-scopolamin Natural products C1C(C2C3O2)N(C)C3CC1OC(=O)C(CO)C1=CC=CC=C1 STECJAGHUSJQJN-UHFFFAOYSA-N 0.000 description 1
- MKYBYDHXWVHEJW-UHFFFAOYSA-N N-[1-oxo-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propan-2-yl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(C(C)NC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 MKYBYDHXWVHEJW-UHFFFAOYSA-N 0.000 description 1
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 208000002193 Pain Diseases 0.000 description 1
- 208000016222 Pancreatic disease Diseases 0.000 description 1
- 208000018737 Parkinson disease Diseases 0.000 description 1
- 102000057297 Pepsin A Human genes 0.000 description 1
- 108090000284 Pepsin A Proteins 0.000 description 1
- 208000009362 Pneumococcal Pneumonia Diseases 0.000 description 1
- 206010035728 Pneumonia pneumococcal Diseases 0.000 description 1
- 229930182556 Polyacetal Natural products 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 229920001710 Polyorthoester Polymers 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 229940122144 Prostaglandin receptor antagonist Drugs 0.000 description 1
- 208000004403 Prostatic Hyperplasia Diseases 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- 206010063837 Reperfusion injury Diseases 0.000 description 1
- 235000004443 Ricinus communis Nutrition 0.000 description 1
- 108010000303 Secretory Proteinase Inhibitory Proteins Proteins 0.000 description 1
- 102000002255 Secretory Proteinase Inhibitory Proteins Human genes 0.000 description 1
- 229940124639 Selective inhibitor Drugs 0.000 description 1
- 206010040047 Sepsis Diseases 0.000 description 1
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical class [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- PJANXHGTPQOBST-VAWYXSNFSA-N Stilbene Natural products C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 description 1
- 108010023197 Streptokinase Proteins 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 238000006859 Swern oxidation reaction Methods 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- 108090001109 Thermolysin Proteins 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 102000003790 Thrombin receptors Human genes 0.000 description 1
- 108090000166 Thrombin receptors Proteins 0.000 description 1
- 108090000373 Tissue Plasminogen Activator Proteins 0.000 description 1
- 102000003978 Tissue Plasminogen Activator Human genes 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 208000036142 Viral infection Diseases 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- FHKPLLOSJHHKNU-INIZCTEOSA-N [(3S)-3-[8-(1-ethyl-5-methylpyrazol-4-yl)-9-methylpurin-6-yl]oxypyrrolidin-1-yl]-(oxan-4-yl)methanone Chemical compound C(C)N1N=CC(=C1C)C=1N(C2=NC=NC(=C2N=1)O[C@@H]1CN(CC1)C(=O)C1CCOCC1)C FHKPLLOSJHHKNU-INIZCTEOSA-N 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- YAINYZJQSQEGND-UHFFFAOYSA-N [1-(hydroxymethyl)cyclopropyl]methanol Chemical compound OCC1(CO)CC1 YAINYZJQSQEGND-UHFFFAOYSA-N 0.000 description 1
- JAWMENYCRQKKJY-UHFFFAOYSA-N [3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-ylmethyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-en-8-yl]-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]methanone Chemical compound N1N=NC=2CN(CCC=21)CC1=NOC2(C1)CCN(CC2)C(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F JAWMENYCRQKKJY-UHFFFAOYSA-N 0.000 description 1
- OUDRGJGWONTIBP-UHFFFAOYSA-N [3-(2-hydroxyethoxy)-5-methylphenyl] 2-methylsulfonylbenzenesulfonate Chemical compound CC1=CC(OCCO)=CC(OS(=O)(=O)C=2C(=CC=CC=2)S(C)(=O)=O)=C1 OUDRGJGWONTIBP-UHFFFAOYSA-N 0.000 description 1
- ABYOZGOSROUICA-UHFFFAOYSA-N [3-(3-aminooxypropoxy)-5-methylphenyl] 2-chlorobenzenesulfonate Chemical compound CC1=CC(OCCCON)=CC(OS(=O)(=O)C=2C(=CC=CC=2)Cl)=C1 ABYOZGOSROUICA-UHFFFAOYSA-N 0.000 description 1
- VHNWHUYPEBKWEV-UHFFFAOYSA-N [3-(3-aminooxypropoxy)-5-methylphenyl] 2-methoxybenzenesulfonate Chemical compound COC1=CC=CC=C1S(=O)(=O)OC1=CC(C)=CC(OCCCON)=C1 VHNWHUYPEBKWEV-UHFFFAOYSA-N 0.000 description 1
- OTSOWYDCAIEQEC-UHFFFAOYSA-N [3-(3-aminooxypropoxy)-5-methylphenyl] 2-nitrobenzenesulfonate Chemical compound CC1=CC(OCCCON)=CC(OS(=O)(=O)C=2C(=CC=CC=2)[N+]([O-])=O)=C1 OTSOWYDCAIEQEC-UHFFFAOYSA-N 0.000 description 1
- GOXXOLMVJZEPLS-UHFFFAOYSA-N [3-(3-aminooxypropoxy)-5-methylphenyl] 5-chloro-2-methoxybenzenesulfonate Chemical compound COC1=CC=C(Cl)C=C1S(=O)(=O)OC1=CC(C)=CC(OCCCON)=C1 GOXXOLMVJZEPLS-UHFFFAOYSA-N 0.000 description 1
- OUELYMDOEHMNLB-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 2-chlorobenzenesulfonate Chemical compound CC1=CC(OCCCO)=CC(OS(=O)(=O)C=2C(=CC=CC=2)Cl)=C1 OUELYMDOEHMNLB-UHFFFAOYSA-N 0.000 description 1
- CCLFENFVBPPMFR-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 2-cyanobenzenesulfonate Chemical compound CC1=CC(OCCCO)=CC(OS(=O)(=O)C=2C(=CC=CC=2)C#N)=C1 CCLFENFVBPPMFR-UHFFFAOYSA-N 0.000 description 1
- QAWYVGJELIINGP-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 2-methoxybenzenesulfonate Chemical compound COC1=CC=CC=C1S(=O)(=O)OC1=CC(C)=CC(OCCCO)=C1 QAWYVGJELIINGP-UHFFFAOYSA-N 0.000 description 1
- XIUALEINWXXCMC-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 2-methylsulfonylbenzenesulfonate Chemical compound CC1=CC(OCCCO)=CC(OS(=O)(=O)C=2C(=CC=CC=2)S(C)(=O)=O)=C1 XIUALEINWXXCMC-UHFFFAOYSA-N 0.000 description 1
- GKBNNYQXQBIQQI-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 2-nitrobenzenesulfonate Chemical compound CC1=CC(OCCCO)=CC(OS(=O)(=O)C=2C(=CC=CC=2)[N+]([O-])=O)=C1 GKBNNYQXQBIQQI-UHFFFAOYSA-N 0.000 description 1
- OGSFTVYKYGBKOM-UHFFFAOYSA-N [3-(3-hydroxypropoxy)-5-methylphenyl] 5-chloro-2-methoxybenzenesulfonate Chemical compound COC1=CC=C(Cl)C=C1S(=O)(=O)OC1=CC(C)=CC(OCCCO)=C1 OGSFTVYKYGBKOM-UHFFFAOYSA-N 0.000 description 1
- FRMXICRIZXGCIZ-UHFFFAOYSA-N [3-[2-(diaminomethylideneamino)oxyethoxy]-5-methylphenyl] 2-methylsulfonylbenzenesulfonate Chemical compound CC1=CC(OCCONC(N)=N)=CC(OS(=O)(=O)C=2C(=CC=CC=2)S(C)(=O)=O)=C1 FRMXICRIZXGCIZ-UHFFFAOYSA-N 0.000 description 1
- ARSCIJHPBOYODI-UHFFFAOYSA-N [3-[3-(1,3-dioxoisoindol-2-yl)oxypropoxy]-5-methoxyphenyl] 2-methylsulfonylbenzenesulfonate Chemical compound C=1C(OC)=CC(OCCCON2C(C3=CC=CC=C3C2=O)=O)=CC=1OS(=O)(=O)C1=CC=CC=C1S(C)(=O)=O ARSCIJHPBOYODI-UHFFFAOYSA-N 0.000 description 1
- UEXWQHPQODDZQG-UHFFFAOYSA-N [3-[3-(1,3-dioxoisoindol-2-yl)oxypropoxy]-5-methylphenyl] 5-chloro-2-methoxybenzenesulfonate Chemical compound COC1=CC=C(Cl)C=C1S(=O)(=O)OC1=CC(C)=CC(OCCCON2C(C3=CC=CC=C3C2=O)=O)=C1 UEXWQHPQODDZQG-UHFFFAOYSA-N 0.000 description 1
- ZCRWDWTYYRDFMD-UHFFFAOYSA-N [3-[3-(diaminomethylideneamino)oxypropoxy]-5-ethylphenyl] 2-methylsulfonylbenzenesulfonate Chemical compound CCC1=CC(OCCCONC(N)=N)=CC(OS(=O)(=O)C=2C(=CC=CC=2)S(C)(=O)=O)=C1 ZCRWDWTYYRDFMD-UHFFFAOYSA-N 0.000 description 1
- DHSRDOQTUZDZAQ-UHFFFAOYSA-N [3-[3-(diaminomethylideneamino)oxypropoxy]-5-methoxyphenyl] 2-methylsulfonylbenzenesulfonate Chemical compound COC1=CC(OCCCON=C(N)N)=CC(OS(=O)(=O)C=2C(=CC=CC=2)S(C)(=O)=O)=C1 DHSRDOQTUZDZAQ-UHFFFAOYSA-N 0.000 description 1
- NSGYFLCEIDRAGG-UHFFFAOYSA-N [3-[3-(diaminomethylideneamino)oxypropoxy]-5-methoxyphenyl] 2-methylsulfonylbenzenesulfonate;hydrochloride Chemical compound Cl.COC1=CC(OCCCONC(N)=N)=CC(OS(=O)(=O)C=2C(=CC=CC=2)S(C)(=O)=O)=C1 NSGYFLCEIDRAGG-UHFFFAOYSA-N 0.000 description 1
- DQRZUOURYRLPFC-UHFFFAOYSA-N [3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenyl] 2,4-bis(methylsulfonyl)benzenesulfonate Chemical compound CC1=CC(OCCCON=C(N)N)=CC(OS(=O)(=O)C=2C(=CC(=CC=2)S(C)(=O)=O)S(C)(=O)=O)=C1 DQRZUOURYRLPFC-UHFFFAOYSA-N 0.000 description 1
- WPGWRMRTZRSQDZ-UHFFFAOYSA-N [3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenyl] 2-(benzenesulfonyl)benzenesulfonate Chemical compound CC1=CC(OCCCON=C(N)N)=CC(OS(=O)(=O)C=2C(=CC=CC=2)S(=O)(=O)C=2C=CC=CC=2)=C1 WPGWRMRTZRSQDZ-UHFFFAOYSA-N 0.000 description 1
- FLHZRSUZSYGVOC-UHFFFAOYSA-N [3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenyl] 2-(hydroxyamino)benzenesulfonate Chemical compound CC1=CC(OCCCON=C(N)N)=CC(OS(=O)(=O)C=2C(=CC=CC=2)NO)=C1 FLHZRSUZSYGVOC-UHFFFAOYSA-N 0.000 description 1
- OZBQCTRYTMTTSK-UHFFFAOYSA-N [3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenyl] 2-[ethyl(pyridin-4-ylmethyl)sulfamoyl]benzenesulfonate Chemical compound C=1C=CC=C(S(=O)(=O)OC=2C=C(OCCCONC(N)=N)C=C(C)C=2)C=1S(=O)(=O)N(CC)CC1=CC=NC=C1 OZBQCTRYTMTTSK-UHFFFAOYSA-N 0.000 description 1
- HSTLQTVKLZUFES-UHFFFAOYSA-N [3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenyl] 2-aminobenzenesulfonate;hydrochloride Chemical compound Cl.CC1=CC(OCCCONC(N)=N)=CC(OS(=O)(=O)C=2C(=CC=CC=2)N)=C1 HSTLQTVKLZUFES-UHFFFAOYSA-N 0.000 description 1
- GRMUCAFYWSZSCW-UHFFFAOYSA-N [3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenyl] 2-chlorobenzenesulfonate Chemical compound CC1=CC(OCCCONC(N)=N)=CC(OS(=O)(=O)C=2C(=CC=CC=2)Cl)=C1 GRMUCAFYWSZSCW-UHFFFAOYSA-N 0.000 description 1
- QTDOSZWBVAHDOS-UHFFFAOYSA-N [3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenyl] 5-chloro-2-methoxybenzenesulfonate Chemical compound COC1=CC=C(Cl)C=C1S(=O)(=O)OC1=CC(C)=CC(OCCCONC(N)=N)=C1 QTDOSZWBVAHDOS-UHFFFAOYSA-N 0.000 description 1
- MUPVGVBOUNXYGB-UHFFFAOYSA-N [3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenyl] isoquinoline-5-sulfonate Chemical compound CC1=CC(OCCCONC(N)=N)=CC(OS(=O)(=O)C=2C3=CC=NC=C3C=CC=2)=C1 MUPVGVBOUNXYGB-UHFFFAOYSA-N 0.000 description 1
- ZXNGDIYZGOCMRA-UHFFFAOYSA-N [N].NC=N Chemical compound [N].NC=N ZXNGDIYZGOCMRA-UHFFFAOYSA-N 0.000 description 1
- 239000004015 abortifacient agent Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 230000001800 adrenalinergic effect Effects 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000005090 alkenylcarbonyl group Chemical group 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 1
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 1
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 description 1
- 125000005079 alkoxycarbonylmethyl group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- AFVLVVWMAFSXCK-VMPITWQZSA-N alpha-cyano-4-hydroxycinnamic acid Chemical group OC(=O)C(\C#N)=C\C1=CC=C(O)C=C1 AFVLVVWMAFSXCK-VMPITWQZSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000002431 aminoalkoxy group Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 238000002399 angioplasty Methods 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 229940127090 anticoagulant agent Drugs 0.000 description 1
- 229940127218 antiplatelet drug Drugs 0.000 description 1
- 208000011775 arteriosclerosis disease Diseases 0.000 description 1
- 125000005129 aryl carbonyl group Chemical group 0.000 description 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- QUDHEEURMMWGNR-UHFFFAOYSA-N benzene-1,4-diol;hydrate Chemical compound O.OC1=CC=C(O)C=C1 QUDHEEURMMWGNR-UHFFFAOYSA-N 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- XDFORSMZCYHNBG-UHFFFAOYSA-N benzonitrile;hydrochloride Chemical compound Cl.N#CC1=CC=CC=C1 XDFORSMZCYHNBG-UHFFFAOYSA-N 0.000 description 1
- 125000004619 benzopyranyl group Chemical group O1C(C=CC2=C1C=CC=C2)* 0.000 description 1
- 125000005874 benzothiadiazolyl group Chemical group 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N beta-hydroxyethanesulfonic acid Natural products OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 238000005842 biochemical reaction Methods 0.000 description 1
- 229920002988 biodegradable polymer Polymers 0.000 description 1
- 239000004621 biodegradable polymer Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000002051 biphasic effect Effects 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 239000010836 blood and blood product Substances 0.000 description 1
- 229940125691 blood product Drugs 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000010504 bond cleavage reaction Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000004799 bromophenyl group Chemical group 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- RYTLGWCJESCDMY-UHFFFAOYSA-N carbamimidoyl chloride Chemical compound NC(Cl)=N RYTLGWCJESCDMY-UHFFFAOYSA-N 0.000 description 1
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000005102 carbonylalkoxy group Chemical group 0.000 description 1
- 230000006315 carbonylation Effects 0.000 description 1
- 238000005810 carbonylation reaction Methods 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 229940099898 chlorophyllin Drugs 0.000 description 1
- 235000019805 chlorophyllin Nutrition 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000037012 chymotrypsin-like activity Effects 0.000 description 1
- 238000011278 co-treatment Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 229940125851 compound 27 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 229910000366 copper(II) sulfate Inorganic materials 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 201000007717 corneal ulcer Diseases 0.000 description 1
- 238000007887 coronary angioplasty Methods 0.000 description 1
- 229920006037 cross link polymer Polymers 0.000 description 1
- 238000001723 curing Methods 0.000 description 1
- 150000003997 cyclic ketones Chemical class 0.000 description 1
- 239000009937 cyclo 3 Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 229940097362 cyclodextrins Drugs 0.000 description 1
- HXCKCCRKGXHOBK-UHFFFAOYSA-N cycloheptane Chemical compound [CH]1CCCCCC1 HXCKCCRKGXHOBK-UHFFFAOYSA-N 0.000 description 1
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 1
- 125000006547 cyclononyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- UFULAYFCSOUIOV-UHFFFAOYSA-N cysteamine Chemical compound NCCS UFULAYFCSOUIOV-UHFFFAOYSA-N 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 229920000359 diblock copolymer Polymers 0.000 description 1
- 235000019700 dicalcium phosphate Nutrition 0.000 description 1
- JSYGRUBHOCKMGQ-UHFFFAOYSA-N dichloramine Chemical compound ClNCl JSYGRUBHOCKMGQ-UHFFFAOYSA-N 0.000 description 1
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 230000001079 digestive effect Effects 0.000 description 1
- 108091007734 digestive enzymes Proteins 0.000 description 1
- 102000038379 digestive enzymes Human genes 0.000 description 1
- 125000005805 dimethoxy phenyl group Chemical group 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical group C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 1
- WUERIJJOLNKVMO-UHFFFAOYSA-L dipotassium;benzene-1,2-disulfonate Chemical compound [K+].[K+].[O-]S(=O)(=O)C1=CC=CC=C1S([O-])(=O)=O WUERIJJOLNKVMO-UHFFFAOYSA-L 0.000 description 1
- 230000006806 disease prevention Effects 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229960003638 dopamine Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 230000002849 elastaseinhibitory effect Effects 0.000 description 1
- 239000012156 elution solvent Substances 0.000 description 1
- 230000003511 endothelial effect Effects 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 239000002532 enzyme inhibitor Substances 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- SDBRIWOFXBTAHD-UHFFFAOYSA-N ethyl 3-[benzyl-[2-[3-[3-(diaminomethylideneamino)oxypropoxy]-5-methylphenoxy]sulfonylphenyl]sulfonylamino]propanoate;hydrochloride Chemical compound Cl.C=1C=CC=C(S(=O)(=O)OC=2C=C(OCCCONC(N)=N)C=C(C)C=2)C=1S(=O)(=O)N(CCC(=O)OCC)CC1=CC=CC=C1 SDBRIWOFXBTAHD-UHFFFAOYSA-N 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 230000008713 feedback mechanism Effects 0.000 description 1
- HOXINJBQVZWYGZ-UHFFFAOYSA-N fenbutatin oxide Chemical compound C=1C=CC=CC=1C(C)(C)C[Sn](O[Sn](CC(C)(C)C=1C=CC=CC=1)(CC(C)(C)C=1C=CC=CC=1)CC(C)(C)C=1C=CC=CC=1)(CC(C)(C)C=1C=CC=CC=1)CC(C)(C)C1=CC=CC=C1 HOXINJBQVZWYGZ-UHFFFAOYSA-N 0.000 description 1
- 230000003480 fibrinolytic effect Effects 0.000 description 1
- HDVRLUFGYQYLFJ-UHFFFAOYSA-N flamenol Chemical compound COC1=CC(O)=CC(O)=C1 HDVRLUFGYQYLFJ-UHFFFAOYSA-N 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- RMBPEFMHABBEKP-UHFFFAOYSA-N fluorene Chemical compound C1=CC=C2C3=C[CH]C=CC3=CC2=C1 RMBPEFMHABBEKP-UHFFFAOYSA-N 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000006005 fluoroethoxy group Chemical group 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 210000004051 gastric juice Anatomy 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 210000002216 heart Anatomy 0.000 description 1
- 230000023597 hemostasis Effects 0.000 description 1
- 230000002439 hemostatic effect Effects 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 102000052896 human CTSG Human genes 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 239000000017 hydrogel Substances 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- TUJKJAMUKRIRHC-UHFFFAOYSA-N hydroxyl Chemical compound [OH] TUJKJAMUKRIRHC-UHFFFAOYSA-N 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 229940031704 hydroxypropyl methylcellulose phthalate Drugs 0.000 description 1
- 229920003132 hydroxypropyl methylcellulose phthalate Polymers 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 230000028993 immune response Effects 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 239000002860 inorganic solvent mixture Substances 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 230000006623 intrinsic pathway Effects 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 239000003591 leukocyte elastase inhibitor Substances 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 231100001225 mammalian toxicity Toxicity 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 230000007721 medicinal effect Effects 0.000 description 1
- 229960003151 mercaptamine Drugs 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- SDDKIZNHOCEXTF-UHFFFAOYSA-N methyl carbamimidothioate Chemical compound CSC(N)=N SDDKIZNHOCEXTF-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- NQMRYBIKMRVZLB-UHFFFAOYSA-N methylamine hydrochloride Chemical compound [Cl-].[NH3+]C NQMRYBIKMRVZLB-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 1
- CCUZKOLVVYXTFE-UHFFFAOYSA-N methylsulfonylsulfanylbenzene Chemical compound CS(=O)(=O)SC1=CC=CC=C1 CCUZKOLVVYXTFE-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- GLGNSAPAWZUDRT-UHFFFAOYSA-N morpholine-4-sulfonic acid Chemical compound OS(=O)(=O)N1CCOCC1 GLGNSAPAWZUDRT-UHFFFAOYSA-N 0.000 description 1
- VMGAPWLDMVPYIA-HIDZBRGKSA-N n'-amino-n-iminomethanimidamide Chemical compound N\N=C\N=N VMGAPWLDMVPYIA-HIDZBRGKSA-N 0.000 description 1
- KYFCFAAKJKNOBW-UHFFFAOYSA-N n,n-difluorohydroxylamine Chemical class ON(F)F KYFCFAAKJKNOBW-UHFFFAOYSA-N 0.000 description 1
- XEBPBJPZBUSUEO-UHFFFAOYSA-N n-(diaminomethylidene)formamide Chemical compound NC(=N)NC=O XEBPBJPZBUSUEO-UHFFFAOYSA-N 0.000 description 1
- MDHWZWLXNDRYAO-UHFFFAOYSA-N n-(pyridin-4-ylmethyl)benzenesulfonamide Chemical compound C=1C=CC=CC=1S(=O)(=O)NCC1=CC=NC=C1 MDHWZWLXNDRYAO-UHFFFAOYSA-N 0.000 description 1
- VBEGHXKAFSLLGE-UHFFFAOYSA-N n-phenylnitramide Chemical compound [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 230000001537 neural effect Effects 0.000 description 1
- 230000004770 neurodegeneration Effects 0.000 description 1
- 208000015122 neurodegenerative disease Diseases 0.000 description 1
- 210000002569 neuron Anatomy 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- ZNPKAOCQMDJBIK-UHFFFAOYSA-N nitrocyanamide Chemical compound [O-][N+](=O)NC#N ZNPKAOCQMDJBIK-UHFFFAOYSA-N 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- YHNRUSMOYCDMJS-UHFFFAOYSA-N o-(cyclopropylmethyl)hydroxylamine Chemical compound NOCC1CC1 YHNRUSMOYCDMJS-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000008183 oral pharmaceutical preparation Substances 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002892 organic cations Chemical class 0.000 description 1
- 239000003791 organic solvent mixture Substances 0.000 description 1
- 229940019331 other antithrombotic agent in atc Drugs 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- AICOOMRHRUFYCM-ZRRPKQBOSA-N oxazine, 1 Chemical compound C([C@@H]1[C@H](C(C[C@]2(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@]21C)=O)CC1=CC2)C[C@H]1[C@@]1(C)[C@H]2N=C(C(C)C)OC1 AICOOMRHRUFYCM-ZRRPKQBOSA-N 0.000 description 1
- 125000005968 oxazolinyl group Chemical group 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 208000024691 pancreas disease Diseases 0.000 description 1
- 210000001819 pancreatic juice Anatomy 0.000 description 1
- 229940111202 pepsin Drugs 0.000 description 1
- 238000005897 peptide coupling reaction Methods 0.000 description 1
- 239000012026 peptide coupling reagents Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000005561 phenanthryl group Chemical group 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- 229940117803 phenethylamine Drugs 0.000 description 1
- KSSNXJHPEFVKHY-UHFFFAOYSA-N phenol;hydrate Chemical compound O.OC1=CC=CC=C1 KSSNXJHPEFVKHY-UHFFFAOYSA-N 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000005954 phenoxathiinyl group Chemical group 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- FVZVCSNXTFCBQU-UHFFFAOYSA-N phosphanyl Chemical group [PH2] FVZVCSNXTFCBQU-UHFFFAOYSA-N 0.000 description 1
- SRHXVXDPXODKQP-UHFFFAOYSA-N phosphinoline Chemical group P1=CC=CC2=CC=CC=C21 SRHXVXDPXODKQP-UHFFFAOYSA-N 0.000 description 1
- 150000003904 phospholipids Chemical class 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229930006728 pinane Natural products 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000000106 platelet aggregation inhibitor Substances 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 239000002745 poly(ortho ester) Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229940068918 polyethylene glycol 400 Drugs 0.000 description 1
- 229920000656 polylysine Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000000164 protein isolation Methods 0.000 description 1
- 108010014806 prothrombinase complex Proteins 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 238000011002 quantification Methods 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000003410 quininyl group Chemical group 0.000 description 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- VHXJRLYFEJAIAM-UHFFFAOYSA-N quinoline-2-sulfonyl chloride Chemical compound C1=CC=CC2=NC(S(=O)(=O)Cl)=CC=C21 VHXJRLYFEJAIAM-UHFFFAOYSA-N 0.000 description 1
- JUYUYCIJACTHMK-UHFFFAOYSA-N quinoline-8-sulfonyl chloride Chemical compound C1=CN=C2C(S(=O)(=O)Cl)=CC=CC2=C1 JUYUYCIJACTHMK-UHFFFAOYSA-N 0.000 description 1
- BOLDJAUMGUJJKM-LSDHHAIUSA-N renifolin D Natural products CC(=C)[C@@H]1Cc2c(O)c(O)ccc2[C@H]1CC(=O)c3ccc(O)cc3O BOLDJAUMGUJJKM-LSDHHAIUSA-N 0.000 description 1
- 230000010076 replication Effects 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 238000002390 rotary evaporation Methods 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- STECJAGHUSJQJN-FWXGHANASA-N scopolamine Chemical compound C1([C@@H](CO)C(=O)O[C@H]2C[C@@H]3N([C@H](C2)[C@@H]2[C@H]3O2)C)=CC=CC=C1 STECJAGHUSJQJN-FWXGHANASA-N 0.000 description 1
- 229960002646 scopolamine Drugs 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 230000036303 septic shock Effects 0.000 description 1
- 239000003001 serine protease inhibitor Substances 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- COEZWFYORILMOM-UHFFFAOYSA-M sodium 4-[(2,4-dihydroxyphenyl)diazenyl]benzenesulfonate Chemical compound [Na+].OC1=CC(O)=CC=C1N=NC1=CC=C(S([O-])(=O)=O)C=C1 COEZWFYORILMOM-UHFFFAOYSA-M 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000012439 solid excipient Substances 0.000 description 1
- 230000007928 solubilization Effects 0.000 description 1
- 238000005063 solubilization Methods 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical compound C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 1
- 235000021286 stilbenes Nutrition 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 208000022218 streptococcal pneumonia Diseases 0.000 description 1
- 229960005202 streptokinase Drugs 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000007940 sugar coated tablet Substances 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- GPTONYMQFTZPKC-UHFFFAOYSA-N sulfamethoxydiazine Chemical compound N1=CC(OC)=CN=C1NS(=O)(=O)C1=CC=C(N)C=C1 GPTONYMQFTZPKC-UHFFFAOYSA-N 0.000 description 1
- 229960002229 sulfametoxydiazine Drugs 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical compound [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- UDYFLDICVHJSOY-UHFFFAOYSA-N sulfur trioxide-pyridine complex Substances O=S(=O)=O.C1=CC=NC=C1 UDYFLDICVHJSOY-UHFFFAOYSA-N 0.000 description 1
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 230000008685 targeting Effects 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 1
- 230000002537 thrombolytic effect Effects 0.000 description 1
- 230000001732 thrombotic effect Effects 0.000 description 1
- 229960000187 tissue plasminogen activator Drugs 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-N trans-cinnamic acid Chemical compound OC(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-N 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 1
- GBXQPDCOMJJCMJ-UHFFFAOYSA-M trimethyl-[6-(trimethylazaniumyl)hexyl]azanium;bromide Chemical compound [Br-].C[N+](C)(C)CCCCCC[N+](C)(C)C GBXQPDCOMJJCMJ-UHFFFAOYSA-M 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical group CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- FIQMHBFVRAXMOP-UHFFFAOYSA-N triphenylphosphane oxide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)C1=CC=CC=C1 FIQMHBFVRAXMOP-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 230000001810 trypsinlike Effects 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 230000009385 viral infection Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/63—Esters of sulfonic acids
- C07C309/72—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/73—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton to carbon atoms of non-condensed six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/04—Antihaemorrhagics; Procoagulants; Haemostatic agents; Antifibrinolytic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/63—Esters of sulfonic acids
- C07C309/72—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/75—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing singly-bound oxygen atoms bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/63—Esters of sulfonic acids
- C07C309/72—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/76—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing nitrogen atoms, not being part of nitro or nitroso groups, bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/63—Esters of sulfonic acids
- C07C309/72—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/77—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing carboxyl groups bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/16—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/16—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom
- C07C311/17—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom to an acyclic carbon atom of a hydrocarbon radical substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/16—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom
- C07C311/18—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom to an acyclic carbon atom of a hydrocarbon radical substituted by nitrogen atoms, not being part of nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/16—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom
- C07C311/19—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to hydrogen atoms or to an acyclic carbon atom to an acyclic carbon atom of a hydrocarbon radical substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/21—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/14—Sulfones; Sulfoxides having sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/64—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and sulfur atoms, not being part of thio groups, bound to the same carbon skeleton
- C07C323/66—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and sulfur atoms, not being part of thio groups, bound to the same carbon skeleton containing sulfur atoms of sulfo, esterified sulfo or halosulfonyl groups, bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/92—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with a hetero atom directly attached to the ring nitrogen atom
- C07D211/96—Sulfur atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/42—Radicals substituted by singly-bound nitrogen atoms having hetero atoms attached to the substituent nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/36—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/22—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the nitrogen-containing ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/125—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/13—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/22—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with hetero atoms directly attached to ring nitrogen atoms
- C07D295/26—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/66—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/02—Systems containing only non-condensed rings with a three-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Medicinal Chemistry (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Hematology (AREA)
- Diabetes (AREA)
- Rheumatology (AREA)
- Pain & Pain Management (AREA)
- Urology & Nephrology (AREA)
- Vascular Medicine (AREA)
- Cardiology (AREA)
- Heart & Thoracic Surgery (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Peptides Or Proteins (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Hydrogenated Pyridines (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Furan Compounds (AREA)
- Pyridine Compounds (AREA)
- Pyrrole Compounds (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
- Quinoline Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Materials For Medical Uses (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US3182296P | 1996-11-26 | 1996-11-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| TW499412B true TW499412B (en) | 2002-08-21 |
Family
ID=21861593
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| TW086117721A TW499412B (en) | 1996-11-26 | 1997-11-25 | Aminoguanidines and alkoxyguanidines as protease inhibitors |
Country Status (24)
| Country | Link |
|---|---|
| US (5) | US6235778B1 (enFirst) |
| EP (1) | EP0944590B1 (enFirst) |
| JP (1) | JP2001506606A (enFirst) |
| KR (1) | KR100587546B1 (enFirst) |
| CN (1) | CN1237961A (enFirst) |
| AR (1) | AR008327A1 (enFirst) |
| AT (1) | ATE214693T1 (enFirst) |
| AU (1) | AU725058B2 (enFirst) |
| BR (1) | BR9713328A (enFirst) |
| CA (1) | CA2273023C (enFirst) |
| DE (1) | DE69711222T2 (enFirst) |
| DK (1) | DK0944590T3 (enFirst) |
| EA (1) | EA002740B1 (enFirst) |
| ES (1) | ES2174309T3 (enFirst) |
| HU (1) | HUP0000733A3 (enFirst) |
| IL (1) | IL130102A (enFirst) |
| IN (1) | IN190530B (enFirst) |
| NO (1) | NO314140B1 (enFirst) |
| NZ (1) | NZ336093A (enFirst) |
| PL (1) | PL333434A1 (enFirst) |
| PT (1) | PT944590E (enFirst) |
| TW (1) | TW499412B (enFirst) |
| WO (1) | WO1998023565A2 (enFirst) |
| ZA (1) | ZA9710646B (enFirst) |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TWI222441B (en) | 1997-11-26 | 2004-10-21 | Dimensional Pharm Inc | Heteroaryl aminoguanidines and alkoxyguanidines and their use as protease inhibitors |
| US6344486B1 (en) | 1998-04-03 | 2002-02-05 | 3-Dimensional Pharmaceuticals, Inc. | Benzamide and sulfonamide substituted aminoguanidines and alkoxyguanidines as protease inhibitors |
| NZ508005A (en) | 1998-04-24 | 2003-05-30 | Dimensional Pharm Inc | Amino acid amidinohydrazones, alkoxyguanidines and aminoguanidines useful as serine protease inhibitors |
| NZ508669A (en) * | 1998-06-11 | 2003-06-30 | Dimensional Pharm Inc | Pyrazinone protease inhibitors |
| US7704958B1 (en) | 1999-03-05 | 2010-04-27 | Bio Holding, Inc. | Methods and compositions for inhibiting apoptosis using serine protease inhibitors |
| US6544541B1 (en) * | 1999-06-02 | 2003-04-08 | Cardiovascular Solutions, Inc. | Devices and compounds for treating arterial restenosis |
| AU2001278927A1 (en) | 2000-07-17 | 2002-01-30 | 3-Dimensional Pharmaceuticals, Inc. | Cyclic oxyguanidine pyrazinones as protease inhibitors |
| WO2002012207A1 (en) | 2000-08-04 | 2002-02-14 | 3-Dimensional Pharmaceuticals, Inc. | Cyclic oxyguanidine protease inhibitors |
| KR100371008B1 (ko) * | 2000-08-05 | 2003-02-06 | 조동련 | 혈소판 응집 억제제 부착 스텐트의 그 제조 방법 |
| UA75093C2 (en) * | 2000-10-06 | 2006-03-15 | Dimensional Pharm Inc | Aminopyridinyl-,aminoguanidinyl-, and alkoxyguanidinesubstituted phenylsubstituted phenylacetamides as protease inhibitors |
| CA2455951A1 (en) * | 2001-08-03 | 2003-02-20 | The Board Of Trustees Of The Leland Stanford Junior University | Bi-directional synthesis of oligoguanidine transport agents |
| US20060264608A1 (en) * | 2001-08-03 | 2006-11-23 | Wender Paul A | Bi-directional synthesis of oligoguanidine transport agents |
| AU2003234382B2 (en) * | 2002-05-13 | 2010-07-08 | Becton, Dickinson And Company | Protease inhibitor sample collection system |
| DK2520654T3 (en) | 2003-08-26 | 2017-05-01 | Univ Colorado Regents | Inhibitors of serine protease activity and their use in methods and compositions for the treatment of bacterial infections |
| GB0507577D0 (en) | 2005-04-14 | 2005-05-18 | Novartis Ag | Organic compounds |
| CN101213172A (zh) * | 2005-06-30 | 2008-07-02 | 拜尔农作物科学股份公司 | 具有杀虫作用的(二取代丙烯基)苯基烷基取代的杂环类化合物的改良的制备方法 |
| US20070202140A1 (en) * | 2005-12-22 | 2007-08-30 | Veltri Enrico P | Thrombin receptor antagonists as prophylaxis to complications from cardiopulmonary surgery |
| BRPI0722082A8 (pt) | 2006-12-26 | 2018-03-13 | Lantheus Medical Imaging Inc | ligantes para imagiologia da inervação cardíaca |
| CA2762611C (en) * | 2009-05-20 | 2017-03-28 | Sekisui Medical Co., Ltd. | Blood coagulation time prolonging agent |
| AU2011253052B2 (en) * | 2010-05-11 | 2015-05-14 | Lantheus Medical Imaging, Inc. | Compositions, methods and systems for the synthesis and use of imaging agents |
| JP2014506253A (ja) | 2010-12-31 | 2014-03-13 | コリドー ファーマシューティカルズ インコーポレイテッド | アルギナーゼ阻害剤およびその使用法 |
| CN103702556A (zh) | 2011-05-17 | 2014-04-02 | 维利科医疗公司 | 使用唾液酸酶抑制剂改进的血小板保存 |
| US9788539B2 (en) | 2011-05-17 | 2017-10-17 | Velico Medical, Inc. | Platelet protection solution having beta-galactosidase and sialidase inhibitors |
| CN102850451B (zh) * | 2011-06-29 | 2014-05-07 | 辽宁诺康生物制药有限责任公司 | 具有抑制纤溶酶活性的重组textilinin-1及其制备方法和应用 |
| EP2836230B1 (en) * | 2012-04-12 | 2022-09-07 | The Trustees Of The University Of Pennsylvania | Filovirus consensus antigens, nucleic acid constructs and vaccines made therefrom, and methods of using same |
| WO2014055988A1 (en) | 2012-10-05 | 2014-04-10 | Velico Medical, Inc. | Platelet additive solution having a beta-galactosidase inhibitor |
| WO2014120886A1 (en) | 2013-01-30 | 2014-08-07 | Velico Medical, Inc. | Platelet additive solution having a self-assembling hydrogel-forming peptide |
| US9555016B2 (en) | 2013-06-10 | 2017-01-31 | Covidien Lp | Lytic agents for use in treating intravascular clots |
| CN107382869A (zh) * | 2017-08-01 | 2017-11-24 | 李凯 | 一种治疗中风后遗症的化合物及制备方法和应用 |
| GB2568550B (en) * | 2017-11-21 | 2021-06-30 | Univ Cape Town | Method of synthesising 6-deoxy-6-amino-ß-d-glucopyranoside-containing polymers |
| CN116234799A (zh) * | 2020-07-20 | 2023-06-06 | 深圳迈瑞生物医疗电子股份有限公司 | 一种组合物的血小板解聚用途、解聚试剂及解聚方法 |
| GB202108544D0 (en) * | 2021-06-15 | 2021-07-28 | Z Factor Ltd | Compounds and their use for the treatment of alpha1-antitrypsin deficiency |
| CN115772196A (zh) * | 2021-09-08 | 2023-03-10 | 赛诺哈勃药业(成都)有限公司 | 一种纤溶酶抑制活性的化合物、其制备方法及应用 |
Family Cites Families (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3131218A (en) | 1961-02-15 | 1964-04-28 | Smith Kline French Lab | N-amino guanidine derivatives |
| US3271448A (en) * | 1961-11-21 | 1966-09-06 | Pfizer & Co C | Phenoxyalkyl aminoguanidines |
| BE663481A (enFirst) | 1964-05-05 | |||
| US3413303A (en) | 1965-09-27 | 1968-11-26 | Ciba Geigy Corp | Aralkenyloxyguanidines |
| JPS57178739A (en) | 1981-04-27 | 1982-11-04 | Mitsubishi Heavy Ind Ltd | Bead supplying device for tire molding machine |
| US4429146A (en) * | 1982-04-15 | 1984-01-31 | Gaf Corporation | Substituted diphenyl ether herbicides and process for use |
| JPS6229566A (ja) | 1985-07-30 | 1987-02-07 | Taiyo Yakuhin Kogyo Kk | 新規グアニジノメチル安息香酸誘導体 |
| DE3929582A1 (de) | 1989-09-06 | 1991-03-07 | Hoechst Ag | Benzoylguanidine, verfahren zu ihrer herstellung, ihre verwendung als medikament sowie sie enthaltendes medikament |
| EP0604022A1 (en) | 1992-12-22 | 1994-06-29 | Advanced Cardiovascular Systems, Inc. | Multilayered biodegradable stent and method for its manufacture |
| TW257757B (enFirst) | 1993-03-03 | 1995-09-21 | Boehringer Mannheim Gmbh | |
| GB9318637D0 (en) | 1993-09-08 | 1993-10-27 | Ferring Res Ltd | Enzyme inhibitors |
| US6087479A (en) | 1993-09-17 | 2000-07-11 | Nitromed, Inc. | Localized use of nitric oxide-adducts to prevent internal tissue damage |
| US5466811A (en) | 1994-07-18 | 1995-11-14 | Merck & Co., Inc. | Dioxolenylmethyl carbamates pro moieties for amine drugs |
| EP0761251B1 (en) | 1994-10-17 | 2004-12-29 | Kabushikikaisha Igaki Iryo Sekkei | Drug-releasing stent |
| US5643580A (en) | 1994-10-17 | 1997-07-01 | Surface Genesis, Inc. | Biocompatible coating, medical device using the same and methods |
| US5637113A (en) | 1994-12-13 | 1997-06-10 | Advanced Cardiovascular Systems, Inc. | Polymer film for wrapping a stent structure |
| DE19514104C2 (de) * | 1995-04-13 | 1997-05-28 | Behringwerke Ag | Beschichtung für in den Blutstrom oder in das Gewebe des menschlichen Körpers einbringbares Biomaterial |
| HU211262A9 (hu) | 1995-05-12 | 1995-11-28 | Hoechst Ag | Benzoil-guanidinek |
| PL325954A1 (en) | 1995-09-29 | 1998-08-17 | Dimiensional Pharmaceuticals 3 | Guanidinic protease inhibitors |
| US5792769A (en) | 1995-09-29 | 1998-08-11 | 3-Dimensional Pharmaceuticals, Inc. | Guanidino protease inhibitors |
| GB9525620D0 (en) | 1995-12-15 | 1996-02-14 | Glaxo Group Ltd | Chemical compounds |
| HUP9902256A3 (en) | 1995-12-29 | 2000-01-28 | Dimensional Pharm Inc | Amidino protease inhibitors and pharmaceutical compositions containing them |
| ES2273365T3 (es) | 1996-03-29 | 2007-05-01 | Ortho-Mcneil Pharmaceutical, Inc. | Amidinohidrazonas utiles como inhibidores de proteasa. |
| SE9602646D0 (sv) | 1996-07-04 | 1996-07-04 | Astra Ab | Pharmaceutically-useful compounds |
-
1997
- 1997-11-25 TW TW086117721A patent/TW499412B/zh not_active IP Right Cessation
- 1997-11-26 NZ NZ336093A patent/NZ336093A/xx unknown
- 1997-11-26 US US08/979,234 patent/US6235778B1/en not_active Expired - Lifetime
- 1997-11-26 JP JP52482998A patent/JP2001506606A/ja not_active Ceased
- 1997-11-26 WO PCT/US1997/021649 patent/WO1998023565A2/en not_active Ceased
- 1997-11-26 EA EA199900544A patent/EA002740B1/ru not_active IP Right Cessation
- 1997-11-26 ES ES97948537T patent/ES2174309T3/es not_active Expired - Lifetime
- 1997-11-26 ZA ZA9710646A patent/ZA9710646B/xx unknown
- 1997-11-26 CA CA002273023A patent/CA2273023C/en not_active Expired - Fee Related
- 1997-11-26 PL PL97333434A patent/PL333434A1/xx not_active Application Discontinuation
- 1997-11-26 AT AT97948537T patent/ATE214693T1/de not_active IP Right Cessation
- 1997-11-26 DK DK97948537T patent/DK0944590T3/da active
- 1997-11-26 IL IL13010297A patent/IL130102A/xx not_active IP Right Cessation
- 1997-11-26 AR ARP970105565A patent/AR008327A1/es active IP Right Grant
- 1997-11-26 BR BR9713328-0A patent/BR9713328A/pt not_active Application Discontinuation
- 1997-11-26 DE DE69711222T patent/DE69711222T2/de not_active Expired - Fee Related
- 1997-11-26 EP EP97948537A patent/EP0944590B1/en not_active Expired - Lifetime
- 1997-11-26 IN IN2232CA1997 patent/IN190530B/en unknown
- 1997-11-26 KR KR1019997004642A patent/KR100587546B1/ko not_active Expired - Fee Related
- 1997-11-26 PT PT97948537T patent/PT944590E/pt unknown
- 1997-11-26 CN CN97199940A patent/CN1237961A/zh active Pending
- 1997-11-26 AU AU54584/98A patent/AU725058B2/en not_active Ceased
- 1997-11-26 HU HU0000733A patent/HUP0000733A3/hu unknown
-
1999
- 1999-05-25 NO NO19992512A patent/NO314140B1/no unknown
-
2000
- 2000-11-28 US US09/722,363 patent/US6638931B1/en not_active Expired - Lifetime
-
2001
- 2001-03-16 US US09/809,293 patent/US6518310B2/en not_active Expired - Lifetime
-
2003
- 2003-02-06 US US10/359,078 patent/US6706765B2/en not_active Expired - Lifetime
- 2003-04-22 US US10/419,972 patent/US6730783B2/en not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| TW499412B (en) | Aminoguanidines and alkoxyguanidines as protease inhibitors | |
| TWI222441B (en) | Heteroaryl aminoguanidines and alkoxyguanidines and their use as protease inhibitors | |
| US7928137B2 (en) | Meta-benzamidine derivatives as serine protease inhibitors | |
| RU2167864C2 (ru) | Производные индолин-2-она, способ их получения и содержащие их фармацевтические композиции | |
| US6436925B1 (en) | Substituted benzamides, their production and their use as cysteine protease inhibitors | |
| JP5771524B2 (ja) | アリール−フェニル−スルホンアミド−シクロアルキル化合物とその使用 | |
| CN101912382B (zh) | 2-苯基丙酸衍生物及含有它们的药物组合物 | |
| US7312235B2 (en) | Benzamide inhibitors of factor Xa | |
| JP5840492B2 (ja) | アリール−フェニル−スルホンアミド−フェニレン化合物とその使用 | |
| JP2003500383A (ja) | 第Xa因子阻害剤 | |
| US20030114448A1 (en) | Inhibitors of factor Xa | |
| JP2003500376A (ja) | Xa因子の阻害剤 | |
| JPH11508242A (ja) | アリールスルホニルアミノベンゼン誘導体およびXa因子阻害物質としてのその使用 | |
| JP2003509412A (ja) | Xa因子阻害剤 | |
| WO2001012600A9 (en) | INHIBITORS OF FACTOR Xa | |
| BRPI0014076B1 (pt) | BENZAMIDAS E INIBIDORES CORRELATOS DO FATOR Xa | |
| US6720317B1 (en) | Inhibitors of factor Xa | |
| ES2213786T3 (es) | Inhibidores de la amidino-proteasa. | |
| SK206292A3 (en) | Pharmacologicaly effective hydrazine derivatives and method of their manufacture | |
| CN105198789A (zh) | 取代3-吲哚类Bcl-2蛋白抑制剂及制备方法和应用 | |
| CN107001333A (zh) | 多杂芳基组蛋白脱乙酰基酶抑制剂及其治疗用途 | |
| CN118440056A (zh) | 基于crbn配体诱导irak4降解的化合物及其制备方法和应用 | |
| US11390591B2 (en) | 2,4,6-trisubstituted s-triazine compound, preparation method therefor, and use thereof | |
| JPH11269140A (ja) | 分化誘導剤 | |
| AU1770001A (en) | Beta-amino acid-, aspartic acid- and diaminopropionic-based inhibitors of factorxa |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| GD4A | Issue of patent certificate for granted invention patent | ||
| MM4A | Annulment or lapse of patent due to non-payment of fees |