SU425395A3 - Способ получения [оксо-.9-дигидро-6,9,4н--диоксино - Google Patents
Способ получения [оксо-.9-дигидро-6,9,4н--диоксиноInfo
- Publication number
- SU425395A3 SU425395A3 SU1692116A SU1692116A SU425395A3 SU 425395 A3 SU425395 A3 SU 425395A3 SU 1692116 A SU1692116 A SU 1692116A SU 1692116 A SU1692116 A SU 1692116A SU 425395 A3 SU425395 A3 SU 425395A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- dioxino
- methyl
- quinoline
- general formula
- derivative
- Prior art date
Links
- 238000000034 method Methods 0.000 title description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 32
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 19
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 11
- 150000001875 compounds Chemical class 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 10
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 8
- -1 diethyl methyl Chemical group 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- 230000002262 irrigation Effects 0.000 description 7
- 238000003973 irrigation Methods 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 150000001804 chlorine Chemical class 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 238000005956 quaternization reaction Methods 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 150000003512 tertiary amines Chemical class 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- 230000020477 pH reduction Effects 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 238000007363 ring formation reaction Methods 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 125000006295 amino methylene group Chemical group [H]N(*)C([H])([H])* 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 238000010531 catalytic reduction reaction Methods 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 230000003993 interaction Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- LYKMMUBOEFYJQG-UHFFFAOYSA-N piperoxan Chemical compound C1OC2=CC=CC=C2OC1CN1CCCCC1 LYKMMUBOEFYJQG-UHFFFAOYSA-N 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000008051 alkyl sulfates Chemical class 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- BNBQRQQYDMDJAH-UHFFFAOYSA-N benzodioxan Chemical group C1=CC=C2OCCOC2=C1 BNBQRQQYDMDJAH-UHFFFAOYSA-N 0.000 description 2
- 125000000532 dioxanyl group Chemical group 0.000 description 2
- 125000001033 ether group Chemical group 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000002198 insoluble material Substances 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229940072033 potash Drugs 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 235000015320 potassium carbonate Nutrition 0.000 description 2
- 125000001453 quaternary ammonium group Chemical group 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- VDFVNEFVBPFDSB-UHFFFAOYSA-N 1,3-dioxane Chemical compound C1COCOC1 VDFVNEFVBPFDSB-UHFFFAOYSA-N 0.000 description 1
- MKZHJJQCUIZEDE-UHFFFAOYSA-N 1-[(2-hydroxy-3-naphthalen-1-yloxypropyl)-propan-2-ylamino]-3-naphthalen-1-yloxypropan-2-ol Chemical compound C1=CC=C2C(OCC(O)CN(CC(O)COC=3C4=CC=CC=C4C=CC=3)C(C)C)=CC=CC2=C1 MKZHJJQCUIZEDE-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- MHYNVHMGKMPURK-UHFFFAOYSA-N 3-ethoxy-2-ethoxycarbonylprop-2-enoic acid Chemical compound CCOC=C(C(O)=O)C(=O)OCC MHYNVHMGKMPURK-UHFFFAOYSA-N 0.000 description 1
- 235000019737 Animal fat Nutrition 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241001331845 Equus asinus x caballus Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 241001602876 Nata Species 0.000 description 1
- GJMMXPXHXFHBPK-UHFFFAOYSA-N [P].[Cl] Chemical compound [P].[Cl] GJMMXPXHXFHBPK-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N deuterated chloroform Substances [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical compound CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 1
- BQHDXNZNSPVVKB-UHFFFAOYSA-N diethyl 2-methylidenepropanedioate Chemical compound CCOC(=O)C(=C)C(=O)OCC BQHDXNZNSPVVKB-UHFFFAOYSA-N 0.000 description 1
- DKWOHBPRFZIUQL-UHFFFAOYSA-N dimethyl-methylidene-oxo-$l^{6}-sulfane Chemical compound C[S+](C)([CH2-])=O DKWOHBPRFZIUQL-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000013011 mating Effects 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003248 quinolines Chemical class 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- XMVJITFPVVRMHC-UHFFFAOYSA-N roxarsone Chemical group OC1=CC=C([As](O)(O)=O)C=C1[N+]([O-])=O XMVJITFPVVRMHC-UHFFFAOYSA-N 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/04—1,3-Dioxanes; Hydrogenated 1,3-dioxanes
- C07D319/08—1,3-Dioxanes; Hydrogenated 1,3-dioxanes condensed with carbocyclic rings or ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Furnace Details (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7028912A FR2101004B2 (enExample) | 1970-08-05 | 1970-08-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU425395A3 true SU425395A3 (ru) | 1974-04-25 |
Family
ID=9059833
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1692116A SU425395A3 (ru) | 1970-08-05 | 1971-08-05 | Способ получения [оксо-.9-дигидро-6,9,4н--диоксино |
Country Status (9)
| Country | Link |
|---|---|
| BE (1) | BE770708A (enExample) |
| CH (1) | CH529166A (enExample) |
| DE (1) | DE2139212A1 (enExample) |
| DK (1) | DK130000B (enExample) |
| FR (1) | FR2101004B2 (enExample) |
| GB (2) | GB1348258A (enExample) |
| NO (1) | NO136048C (enExample) |
| SE (1) | SE380263B (enExample) |
| SU (1) | SU425395A3 (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5443000B2 (enExample) * | 1972-07-14 | 1979-12-17 | ||
| NZ603332A (en) | 2010-04-02 | 2014-11-28 | Senomyx Inc | Sweet flavor modifier |
| MX336378B (es) | 2011-08-12 | 2016-01-15 | Senomyx Inc | Modificador del sabor dulce. |
| AU2015343463A1 (en) | 2014-11-07 | 2017-06-15 | Senomyx, Inc. | Substituted 4-amino-5-(cyclohexyloxy)quinoline-3-carboxylic acids as sweet flavor modifiers |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH509345A (de) * | 1967-12-21 | 1971-06-30 | Ciba Geigy Ag | Verfahren zur Herstellung von neuen Chinolinderivaten |
-
1970
- 1970-08-05 FR FR7028912A patent/FR2101004B2/fr not_active Expired
-
1971
- 1971-07-30 BE BE770708A patent/BE770708A/xx unknown
- 1971-08-04 DK DK381571A patent/DK130000B/da unknown
- 1971-08-04 SE SE1001371A patent/SE380263B/xx unknown
- 1971-08-04 CH CH1150071A patent/CH529166A/fr not_active IP Right Cessation
- 1971-08-04 NO NO292071A patent/NO136048C/no unknown
- 1971-08-05 DE DE19712139212 patent/DE2139212A1/de active Pending
- 1971-08-05 GB GB3684671A patent/GB1348258A/en not_active Expired
- 1971-08-05 SU SU1692116A patent/SU425395A3/ru active
- 1971-08-05 GB GB3037471A patent/GB1348259A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DK130000C (enExample) | 1975-05-20 |
| NO136048C (no) | 1977-07-13 |
| FR2101004A2 (enExample) | 1972-03-31 |
| SE380263B (sv) | 1975-11-03 |
| BE770708A (fr) | 1971-12-01 |
| DE2139212A1 (de) | 1972-02-10 |
| CH529166A (fr) | 1972-10-15 |
| FR2101004B2 (enExample) | 1974-02-01 |
| DK130000B (da) | 1974-12-09 |
| NO136048B (enExample) | 1977-04-04 |
| GB1348259A (en) | 1974-03-13 |
| GB1348258A (en) | 1974-03-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69723846T2 (de) | Verfahren zur Herstellung von Sildenafil | |
| DE1543810A1 (de) | Verfahren zur Herstellung von Mono-omega-halogenalkylaminen | |
| DE1445121A1 (de) | 2-Methyl-3-allylmercaptomethyl-6-chlor-7-sulfamyl-3,4-dihydro-1,2,4-benzothiadiazin-1,1-dioxyd und dessen pharmazeutisch geeignete Salze mit Basen und Verfahren zur Herstellung dieser Verbindungen | |
| DK154563B (da) | Fremgangsmaade til fremstilling af en racemisk eller optisk aktiv (+)-thiolacton eller (+)-bioton | |
| SU509231A3 (ru) | Способ получени производныхморфолина | |
| WO1987000841A1 (en) | New theophylline derivatives and method for the production thereof | |
| SU425395A3 (ru) | Способ получения [оксо-.9-дигидро-6,9,4н--диоксино | |
| US4131617A (en) | Preparation of new isobutylramide derivatives | |
| DE1670523A1 (de) | Verfahren zur Herstellung neuer substituierter Aminopyridine | |
| US2895992A (en) | Process for the production of benzoic | |
| JP2004500324A (ja) | ピペラジン環含有化合物の新規の合成及び結晶化 | |
| US2640829A (en) | Isoquinolyl heterocyclic ethers | |
| DE1176660B (de) | Verfahren zur Herstellung von triaryl-substituierten Imidazolinonen-4(5) | |
| SU852172A3 (ru) | Способ получени производныхизОХиНОлиНА или иХ СОлЕй | |
| JPH0116837B2 (enExample) | ||
| DE2114884A1 (de) | Basisch substituierte Derivate des 1(2H)-Phthalazinons | |
| DE1001684B (de) | Verfahren zur Herstellung von Thiophenylpyridylaminen | |
| US2442865A (en) | Heteboctcuc substituted fhenacxl | |
| AT200579B (de) | Verfahren zur Herstellung der neuen 5-Dibenzo[b,f]azepine | |
| SU482039A3 (ru) | Способ получени бифенилилбутеновых кислот или их производных | |
| US2652401A (en) | Benzothiazole derivatives and method of production | |
| DE1150976B (de) | Verfahren zur Herstellung von als Psychotherapeutica geeigneten basischen Fluorenverbindungen | |
| KR810000234B1 (ko) | 벤조 아제핀계 유도체의 제조방법 | |
| CH496714A (de) | Verfahren zur Herstellung von Derivaten des 1,3,4,5-Tetrahydrobenzodiazepins | |
| KR800001312B1 (ko) | 3-(3-카복시-4-하이드록시페닐)-4,5-디하이드로-2-페닐벤즈[e] 인돌의 제조방법 |