NZ210776A - 4-((bicycloheterocyclyl)-methyl and -hetero)-piperidine derivatives and pharmaceutical compositions - Google Patents
4-((bicycloheterocyclyl)-methyl and -hetero)-piperidine derivatives and pharmaceutical compositionsInfo
- Publication number
- NZ210776A NZ210776A NZ210776A NZ21077685A NZ210776A NZ 210776 A NZ210776 A NZ 210776A NZ 210776 A NZ210776 A NZ 210776A NZ 21077685 A NZ21077685 A NZ 21077685A NZ 210776 A NZ210776 A NZ 210776A
- Authority
- NZ
- New Zealand
- Prior art keywords
- formula
- radical
- methyl
- hydrogen
- parts
- Prior art date
Links
- 239000008194 pharmaceutical composition Substances 0.000 title description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 330
- 239000000203 mixture Substances 0.000 claims description 169
- 150000001875 compounds Chemical class 0.000 claims description 166
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 161
- -1 hydroxy, mercapto, isothiocyanato Chemical group 0.000 claims description 143
- 125000000217 alkyl group Chemical group 0.000 claims description 123
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 120
- 229910001868 water Inorganic materials 0.000 claims description 110
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 107
- 229910052739 hydrogen Inorganic materials 0.000 claims description 106
- 239000001257 hydrogen Substances 0.000 claims description 86
- 150000003254 radicals Chemical class 0.000 claims description 80
- 150000003839 salts Chemical class 0.000 claims description 76
- 239000000243 solution Substances 0.000 claims description 76
- 238000000034 method Methods 0.000 claims description 55
- 125000003545 alkoxy group Chemical group 0.000 claims description 54
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 50
- 238000003756 stirring Methods 0.000 claims description 47
- 238000006243 chemical reaction Methods 0.000 claims description 46
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 44
- 125000004414 alkyl thio group Chemical group 0.000 claims description 44
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 40
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 37
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 34
- 239000002904 solvent Substances 0.000 claims description 33
- 150000002431 hydrogen Chemical class 0.000 claims description 32
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 30
- 239000002253 acid Substances 0.000 claims description 28
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 25
- 229910052717 sulfur Inorganic materials 0.000 claims description 25
- 239000012442 inert solvent Substances 0.000 claims description 24
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 23
- 229910052760 oxygen Inorganic materials 0.000 claims description 22
- 239000003153 chemical reaction reagent Substances 0.000 claims description 20
- 125000001424 substituent group Chemical group 0.000 claims description 20
- 239000003795 chemical substances by application Substances 0.000 claims description 19
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 19
- 229910052757 nitrogen Inorganic materials 0.000 claims description 19
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 18
- 238000001816 cooling Methods 0.000 claims description 18
- 125000003396 thiol group Chemical class [H]S* 0.000 claims description 18
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 15
- 125000003342 alkenyl group Chemical group 0.000 claims description 14
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 13
- 125000001261 isocyanato group Chemical group *N=C=O 0.000 claims description 12
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 11
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 11
- 125000003282 alkyl amino group Chemical group 0.000 claims description 10
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 10
- 150000002576 ketones Chemical class 0.000 claims description 10
- 125000000623 heterocyclic group Chemical group 0.000 claims description 9
- 125000001544 thienyl group Chemical group 0.000 claims description 9
- 150000001412 amines Chemical class 0.000 claims description 8
- 125000002837 carbocyclic group Chemical group 0.000 claims description 8
- 125000001810 isothiocyanato group Chemical group *N=C=S 0.000 claims description 8
- 125000000335 thiazolyl group Chemical group 0.000 claims description 8
- 239000004480 active ingredient Substances 0.000 claims description 7
- 239000004202 carbamide Substances 0.000 claims description 7
- 241001465754 Metazoa Species 0.000 claims description 6
- 125000002462 isocyano group Chemical group *[N+]#[C-] 0.000 claims description 6
- 239000000725 suspension Substances 0.000 claims description 6
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 5
- 208000026935 allergic disease Diseases 0.000 claims description 5
- 150000001408 amides Chemical class 0.000 claims description 5
- 125000004122 cyclic group Chemical group 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 5
- 125000002883 imidazolyl group Chemical group 0.000 claims description 5
- 239000002202 Polyethylene glycol Substances 0.000 claims description 4
- 230000002152 alkylating effect Effects 0.000 claims description 4
- 150000001728 carbonyl compounds Chemical class 0.000 claims description 4
- 229910052751 metal Chemical class 0.000 claims description 4
- 239000002184 metal Chemical class 0.000 claims description 4
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 claims description 4
- 229920001223 polyethylene glycol Polymers 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 238000001914 filtration Methods 0.000 claims description 3
- 238000011065 in-situ storage Methods 0.000 claims description 3
- 238000002347 injection Methods 0.000 claims description 3
- 239000007924 injection Substances 0.000 claims description 3
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 claims description 3
- 229910052721 tungsten Inorganic materials 0.000 claims description 3
- 150000001350 alkyl halides Chemical class 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- 239000011248 coating agent Substances 0.000 claims description 2
- 238000000576 coating method Methods 0.000 claims description 2
- 150000004985 diamines Chemical class 0.000 claims description 2
- 229910044991 metal oxide Inorganic materials 0.000 claims description 2
- 150000004706 metal oxides Chemical class 0.000 claims description 2
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 claims description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 claims description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 claims description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 29
- 125000001475 halogen functional group Chemical group 0.000 claims 27
- 125000002541 furyl group Chemical group 0.000 claims 12
- 125000004076 pyridyl group Chemical group 0.000 claims 8
- 230000003266 anti-allergic effect Effects 0.000 claims 7
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 5
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims 4
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 claims 4
- 125000001624 naphthyl group Chemical group 0.000 claims 4
- 125000003373 pyrazinyl group Chemical group 0.000 claims 4
- 125000000168 pyrrolyl group Chemical group 0.000 claims 4
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 claims 3
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 claims 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 claims 2
- 239000000829 suppository Substances 0.000 claims 2
- 101000737090 Agrotis ipsilon Neuropeptide CCHamide-2 Proteins 0.000 claims 1
- 239000001856 Ethyl cellulose Substances 0.000 claims 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 claims 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical group C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 239000011324 bead Substances 0.000 claims 1
- 229920001249 ethyl cellulose Polymers 0.000 claims 1
- 235000019325 ethyl cellulose Nutrition 0.000 claims 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims 1
- 229940102223 injectable solution Drugs 0.000 claims 1
- 235000014655 lactic acid Nutrition 0.000 claims 1
- 239000004310 lactic acid Substances 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 229940068918 polyethylene glycol 400 Drugs 0.000 claims 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 claims 1
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 claims 1
- 229960003415 propylparaben Drugs 0.000 claims 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 claims 1
- 239000004094 surface-active agent Substances 0.000 claims 1
- 238000007910 systemic administration Methods 0.000 claims 1
- 150000003626 triacylglycerols Chemical class 0.000 claims 1
- 239000008215 water for injection Substances 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 270
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 155
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 121
- 239000000047 product Substances 0.000 description 89
- 239000003480 eluent Substances 0.000 description 85
- 239000002585 base Substances 0.000 description 79
- MUBZPKHOEPUJKR-UHFFFAOYSA-L Oxalate Chemical compound [O-]C(=O)C([O-])=O MUBZPKHOEPUJKR-UHFFFAOYSA-L 0.000 description 75
- 239000011541 reaction mixture Substances 0.000 description 65
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 60
- 229960001701 chloroform Drugs 0.000 description 60
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 57
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 51
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 50
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 50
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 45
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 43
- 239000000741 silica gel Substances 0.000 description 42
- 229910002027 silica gel Inorganic materials 0.000 description 42
- 239000000284 extract Substances 0.000 description 41
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 39
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 38
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 36
- 239000003054 catalyst Substances 0.000 description 36
- 238000004440 column chromatography Methods 0.000 description 36
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 35
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 34
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 34
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 31
- 239000000706 filtrate Substances 0.000 description 29
- 150000004682 monohydrates Chemical class 0.000 description 28
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- 229920006395 saturated elastomer Polymers 0.000 description 27
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 26
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Natural products OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 26
- 229910021529 ammonia Inorganic materials 0.000 description 25
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 25
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- 239000000543 intermediate Substances 0.000 description 24
- 239000007858 starting material Substances 0.000 description 23
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 19
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical class C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 19
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 18
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 18
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 18
- 241000700159 Rattus Species 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 239000000908 ammonium hydroxide Substances 0.000 description 18
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 18
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 18
- 229910000029 sodium carbonate Inorganic materials 0.000 description 18
- 239000012258 stirred mixture Substances 0.000 description 18
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 16
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 15
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Substances C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 14
- 238000010992 reflux Methods 0.000 description 14
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 13
- 238000002360 preparation method Methods 0.000 description 13
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 12
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 11
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 11
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 11
- 229920002055 compound 48/80 Polymers 0.000 description 11
- 239000012312 sodium hydride Substances 0.000 description 11
- 229910000104 sodium hydride Inorganic materials 0.000 description 11
- 238000007126 N-alkylation reaction Methods 0.000 description 10
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 10
- 125000005843 halogen group Chemical group 0.000 description 10
- 239000012044 organic layer Substances 0.000 description 10
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 10
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 9
- 239000006185 dispersion Substances 0.000 description 9
- 125000003386 piperidinyl group Chemical group 0.000 description 9
- 238000007363 ring formation reaction Methods 0.000 description 9
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 150000008282 halocarbons Chemical class 0.000 description 8
- 230000003902 lesion Effects 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 7
- 229960000583 acetic acid Drugs 0.000 description 7
- 230000037396 body weight Effects 0.000 description 7
- 230000002829 reductive effect Effects 0.000 description 7
- 239000003826 tablet Substances 0.000 description 7
- UNCQVRBWJWWJBF-UHFFFAOYSA-N 2-chloropyrimidine Chemical compound ClC1=NC=CC=N1 UNCQVRBWJWWJBF-UHFFFAOYSA-N 0.000 description 6
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 6
- 239000004215 Carbon black (E152) Substances 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 6
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 6
- 229930195733 hydrocarbon Natural products 0.000 description 6
- 150000002430 hydrocarbons Chemical class 0.000 description 6
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 6
- 239000005457 ice water Substances 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 6
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 5
- 239000000739 antihistaminic agent Substances 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- 230000002496 gastric effect Effects 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 5
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 5
- 230000003389 potentiating effect Effects 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 210000002784 stomach Anatomy 0.000 description 5
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 5
- 229930192474 thiophene Natural products 0.000 description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 230000001387 anti-histamine Effects 0.000 description 4
- 229940082988 antihypertensives serotonin antagonists Drugs 0.000 description 4
- 239000003420 antiserotonin agent Substances 0.000 description 4
- 125000002619 bicyclic group Chemical group 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- 231100000225 lethality Toxicity 0.000 description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 235000019198 oils Nutrition 0.000 description 4
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 4
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 3
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 3
- UNXVCQNTZLLICF-UHFFFAOYSA-N 2-nitro-n-(pyridin-3-ylmethyl)aniline Chemical compound [O-][N+](=O)C1=CC=CC=C1NCC1=CC=CN=C1 UNXVCQNTZLLICF-UHFFFAOYSA-N 0.000 description 3
- FHFJYPVTDZSRAS-UHFFFAOYSA-N 2-nitro-n-(thiophen-2-ylmethyl)aniline Chemical compound [O-][N+](=O)C1=CC=CC=C1NCC1=CC=CS1 FHFJYPVTDZSRAS-UHFFFAOYSA-N 0.000 description 3
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- GAMYYCRTACQSBR-UHFFFAOYSA-N 4-azabenzimidazole Chemical compound C1=CC=C2NC=NC2=N1 GAMYYCRTACQSBR-UHFFFAOYSA-N 0.000 description 3
- ACOXURKIHJSMAC-UHFFFAOYSA-N 4-piperidin-1-ylbutan-1-amine Chemical compound NCCCCN1CCCCC1 ACOXURKIHJSMAC-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 239000003929 acidic solution Substances 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 3
- 150000008041 alkali metal carbonates Chemical class 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 150000004683 dihydrates Chemical class 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 239000003937 drug carrier Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- 230000000762 glandular Effects 0.000 description 3
- 230000002140 halogenating effect Effects 0.000 description 3
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 3
- 239000012948 isocyanate Substances 0.000 description 3
- 150000002513 isocyanates Chemical class 0.000 description 3
- 150000002540 isothiocyanates Chemical class 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(II) oxide Inorganic materials [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 3
- CHJJGSNFBQVOTG-UHFFFAOYSA-N methylguanidine Chemical compound CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 229940076279 serotonin Drugs 0.000 description 3
- 230000035939 shock Effects 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 3
- QLSJOGIENLKPTF-WLHGVMLRSA-N (e)-but-2-enedioic acid;pyridine Chemical compound C1=CC=NC=C1.OC(=O)\C=C\C(O)=O QLSJOGIENLKPTF-WLHGVMLRSA-N 0.000 description 2
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical group C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 2
- DHTBSHAVYQEYJR-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-5-methyl-2-(piperidin-4-ylmethyl)benzimidazole Chemical compound C1CNCCC1CC1=NC2=CC(C)=CC=C2N1CC1=CC=C(F)C=C1 DHTBSHAVYQEYJR-UHFFFAOYSA-N 0.000 description 2
- NMGLVHXJOMBIJW-UHFFFAOYSA-N 1h-benzimidazole;dihydrochloride Chemical compound Cl.Cl.C1=CC=C2NC=NC2=C1 NMGLVHXJOMBIJW-UHFFFAOYSA-N 0.000 description 2
- HOPOBQARJHMVIY-UHFFFAOYSA-N 2-[4-[[3-[(4-fluorophenyl)methyl]imidazo[4,5-c]pyridin-2-yl]methyl]piperidin-1-yl]ethanamine Chemical compound C1CN(CCN)CCC1CC1=NC2=CC=NC=C2N1CC1=CC=C(F)C=C1 HOPOBQARJHMVIY-UHFFFAOYSA-N 0.000 description 2
- CHADCRXZEVKXCL-UHFFFAOYSA-N 2-amino-n-[4-[4-[[3-(furan-2-ylmethyl)imidazo[4,5-b]pyridin-2-yl]methyl]piperidin-1-yl]butyl]benzamide Chemical compound NC1=CC=CC=C1C(=O)NCCCCN1CCC(CC=2N(C3=NC=CC=C3N=2)CC=2OC=CC=2)CC1 CHADCRXZEVKXCL-UHFFFAOYSA-N 0.000 description 2
- PGXALMVNIRPELS-UHFFFAOYSA-N 2-chloro-1-[(4-fluorophenyl)methyl]benzimidazole Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1Cl PGXALMVNIRPELS-UHFFFAOYSA-N 0.000 description 2
- AYPSHJCKSDNETA-UHFFFAOYSA-N 2-chloro-1h-benzimidazole Chemical compound C1=CC=C2NC(Cl)=NC2=C1 AYPSHJCKSDNETA-UHFFFAOYSA-N 0.000 description 2
- PWOHBNZCQRYWEI-UHFFFAOYSA-N 2-n-(furan-2-ylmethyl)-6-methoxypyridine-2,3-diamine Chemical compound COC1=CC=C(N)C(NCC=2OC=CC=2)=N1 PWOHBNZCQRYWEI-UHFFFAOYSA-N 0.000 description 2
- SMVKMUNFPNCOAV-UHFFFAOYSA-N 2-n-[(4-fluorophenyl)methyl]pyridine-2,3-diamine Chemical compound NC1=CC=CN=C1NCC1=CC=C(F)C=C1 SMVKMUNFPNCOAV-UHFFFAOYSA-N 0.000 description 2
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 2
- BVLOKSAMJQGXLA-UHFFFAOYSA-N 4-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]butanenitrile Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1CC1CCN(CCCC#N)CC1 BVLOKSAMJQGXLA-UHFFFAOYSA-N 0.000 description 2
- KBIWNQVZKHSHTI-UHFFFAOYSA-N 4-n,4-n-dimethylbenzene-1,4-diamine;oxalic acid Chemical compound OC(=O)C(O)=O.CN(C)C1=CC=C(N)C=C1 KBIWNQVZKHSHTI-UHFFFAOYSA-N 0.000 description 2
- AQIWTUYLQLQFOV-UHFFFAOYSA-N 5-chloro-n-[(4-fluorophenyl)methyl]-4-methoxy-2-nitroaniline Chemical compound C1=C(Cl)C(OC)=CC([N+]([O-])=O)=C1NCC1=CC=C(F)C=C1 AQIWTUYLQLQFOV-UHFFFAOYSA-N 0.000 description 2
- FULUTOFLVDWUOH-UHFFFAOYSA-N 6-methoxy-2-n-(pyridin-2-ylmethyl)pyridine-2,3-diamine Chemical compound COC1=CC=C(N)C(NCC=2N=CC=CC=2)=N1 FULUTOFLVDWUOH-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 206010011703 Cyanosis Diseases 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 2
- JCMWSVNNSPUNER-UHFFFAOYSA-N N,O-dimethyltyramine Chemical compound CNCCC1=CC=C(OC)C=C1 JCMWSVNNSPUNER-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- LOBIJWAJHDJYPN-UHFFFAOYSA-N [1-(4-methylphenyl)sulfonylpiperidin-4-yl] methanesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(OS(C)(=O)=O)CC1 LOBIJWAJHDJYPN-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 2
- 239000012670 alkaline solution Substances 0.000 description 2
- 230000000172 allergic effect Effects 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 230000003042 antagnostic effect Effects 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 208000010668 atopic eczema Diseases 0.000 description 2
- 239000003637 basic solution Substances 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 2
- 229910052799 carbon Chemical group 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- HRKQOINLCJTGBK-UHFFFAOYSA-N dihydroxidosulfur Chemical compound OSO HRKQOINLCJTGBK-UHFFFAOYSA-N 0.000 description 2
- HDRXZJPWHTXQRI-BHDTVMLSSA-N diltiazem hydrochloride Chemical compound [Cl-].C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CC[NH+](C)C)C2=CC=CC=C2S1 HDRXZJPWHTXQRI-BHDTVMLSSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 210000005069 ears Anatomy 0.000 description 2
- QABJNOSERNVHDY-UHFFFAOYSA-N ethyl 4-hydroxypiperidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(O)CC1 QABJNOSERNVHDY-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000012634 fragment Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 229960001340 histamine Drugs 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 2
- HYUJUIVFNYHFPA-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-4-methoxy-2-nitroaniline Chemical compound [O-][N+](=O)C1=CC(OC)=CC=C1NCC1=CC=C(F)C=C1 HYUJUIVFNYHFPA-UHFFFAOYSA-N 0.000 description 2
- LLRJMQQFKMGUBC-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-4-nitropyridin-3-amine Chemical compound [O-][N+](=O)C1=CC=NC=C1NCC1=CC=C(F)C=C1 LLRJMQQFKMGUBC-UHFFFAOYSA-N 0.000 description 2
- VHFFCDXROMHTOO-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-5-methoxy-2-nitroaniline Chemical compound COC1=CC=C([N+]([O-])=O)C(NCC=2C=CC(F)=CC=2)=C1 VHFFCDXROMHTOO-UHFFFAOYSA-N 0.000 description 2
- OCWYLVZUXCHTNO-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-6-methoxy-3-nitropyridin-2-amine Chemical compound COC1=CC=C([N+]([O-])=O)C(NCC=2C=CC(F)=CC=2)=N1 OCWYLVZUXCHTNO-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 150000002829 nitrogen Chemical group 0.000 description 2
- 229940100688 oral solution Drugs 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 2
- 229920006324 polyoxymethylene Polymers 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 239000008213 purified water Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 238000010956 selective crystallization Methods 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- ILJOYZVVZZFIKA-UHFFFAOYSA-M sodium;1,1-dioxo-1,2-benzothiazol-3-olate;hydrate Chemical compound O.[Na+].C1=CC=C2C(=O)[N-]S(=O)(=O)C2=C1 ILJOYZVVZZFIKA-UHFFFAOYSA-M 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 125000000464 thioxo group Chemical group S=* 0.000 description 2
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- MLIWQXBKMZNZNF-KUHOPJCQSA-N (2e)-2,6-bis[(4-azidophenyl)methylidene]-4-methylcyclohexan-1-one Chemical compound O=C1\C(=C\C=2C=CC(=CC=2)N=[N+]=[N-])CC(C)CC1=CC1=CC=C(N=[N+]=[N-])C=C1 MLIWQXBKMZNZNF-KUHOPJCQSA-N 0.000 description 1
- YJLIKUSWRSEPSM-WGQQHEPDSA-N (2r,3r,4s,5r)-2-[6-amino-8-[(4-phenylphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1CNC1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O YJLIKUSWRSEPSM-WGQQHEPDSA-N 0.000 description 1
- NRQHBNNTBIDSRK-YRNVUSSQSA-N (4e)-4-[(4-methoxyphenyl)methylidene]-2-methyl-1,3-oxazol-5-one Chemical compound C1=CC(OC)=CC=C1\C=C\1C(=O)OC(C)=N/1 NRQHBNNTBIDSRK-YRNVUSSQSA-N 0.000 description 1
- KPJZHOPZRAFDTN-ZRGWGRIASA-N (6aR,9R)-N-[(2S)-1-hydroxybutan-2-yl]-4,7-dimethyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)N[C@H](CO)CC)C2)=C3C2=CN(C)C3=C1 KPJZHOPZRAFDTN-ZRGWGRIASA-N 0.000 description 1
- ZRPAIVPIYDTPDO-TYYBGVCCSA-N (e)-but-2-enedioic acid;ethanamine Chemical compound CCN.OC(=O)\C=C\C(O)=O ZRPAIVPIYDTPDO-TYYBGVCCSA-N 0.000 description 1
- NDQXKKFRNOPRDW-UHFFFAOYSA-N 1,1,1-triethoxyethane Chemical compound CCOC(C)(OCC)OCC NDQXKKFRNOPRDW-UHFFFAOYSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- PJQIBTFOXWGAEN-UHFFFAOYSA-N 1,2-dimethylbenzimidazole Chemical compound C1=CC=C2N(C)C(C)=NC2=C1 PJQIBTFOXWGAEN-UHFFFAOYSA-N 0.000 description 1
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical class C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 description 1
- IGWGXOHABPCPHZ-UHFFFAOYSA-N 1-(4-methylphenyl)sulfonylpiperidine Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCCCC1 IGWGXOHABPCPHZ-UHFFFAOYSA-N 0.000 description 1
- HOKVWFNELFYZDJ-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-2-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]sulfinylbenzimidazole Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CCC(S(=O)C=2N(C3=CC=CC=C3N=2)CC=2C=CC(F)=CC=2)CC1 HOKVWFNELFYZDJ-UHFFFAOYSA-N 0.000 description 1
- OSRAKZTYNLUUTG-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-2-[[1-(2-pyridin-2-ylethyl)piperidin-4-yl]methyl]benzimidazole Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1CC1CCN(CCC=2N=CC=CC=2)CC1 OSRAKZTYNLUUTG-UHFFFAOYSA-N 0.000 description 1
- QNAJHKWRNPRPBQ-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-2-piperidin-4-yloxybenzimidazole Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1OC1CCNCC1 QNAJHKWRNPRPBQ-UHFFFAOYSA-N 0.000 description 1
- WYLNFJKRWQJRKS-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-2-piperidin-4-ylsulfanylbenzimidazole Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1SC1CCNCC1 WYLNFJKRWQJRKS-UHFFFAOYSA-N 0.000 description 1
- XJEORYXOHUMESL-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]-5-methoxy-2-(piperidin-4-ylmethyl)benzimidazole;dihydrochloride Chemical compound Cl.Cl.C1CNCCC1CC1=NC2=CC(OC)=CC=C2N1CC1=CC=C(F)C=C1 XJEORYXOHUMESL-UHFFFAOYSA-N 0.000 description 1
- PEXIRRAADXQGOM-UHFFFAOYSA-N 1-[(4-methoxyphenyl)methyl]-2-(piperidin-4-ylmethyl)benzimidazole oxalic acid Chemical compound C(C(=O)O)(=O)O.COC1=CC=C(C=C1)CN1C(=NC2=C1C=CC=C2)CC2CCNCC2 PEXIRRAADXQGOM-UHFFFAOYSA-N 0.000 description 1
- IDJANXQTKNIMHT-UHFFFAOYSA-N 1-[(4-methylphenyl)methyl]-2-(piperidin-4-ylmethyl)benzimidazole Chemical compound C1=CC(C)=CC=C1CN1C2=CC=CC=C2N=C1CC1CCNCC1 IDJANXQTKNIMHT-UHFFFAOYSA-N 0.000 description 1
- XIBVNILZEXGMNS-UHFFFAOYSA-N 1-[(5-methylfuran-2-yl)methyl]-2-(piperidin-4-ylmethyl)benzimidazole Chemical compound O1C(C)=CC=C1CN1C2=CC=CC=C2N=C1CC1CCNCC1 XIBVNILZEXGMNS-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- KIEIJXPUFOEEFY-UHFFFAOYSA-N 1H-pyrimidin-6-one trihydrochloride Chemical compound Cl.Cl.Cl.O=C1C=CN=CN1 KIEIJXPUFOEEFY-UHFFFAOYSA-N 0.000 description 1
- WITYIAHCBUYCSY-UHFFFAOYSA-N 1h-[1,3]thiazolo[5,4-b]pyridine-2-thione Chemical compound C1=CN=C2SC(S)=NC2=C1 WITYIAHCBUYCSY-UHFFFAOYSA-N 0.000 description 1
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical compound O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 description 1
- BTLKROSJMNFSQZ-UHFFFAOYSA-N 2,4-dichloro-6-methylpyrimidine Chemical compound CC1=CC(Cl)=NC(Cl)=N1 BTLKROSJMNFSQZ-UHFFFAOYSA-N 0.000 description 1
- IZXIZTKNFFYFOF-UHFFFAOYSA-N 2-Oxazolidone Chemical compound O=C1NCCO1 IZXIZTKNFFYFOF-UHFFFAOYSA-N 0.000 description 1
- JUZCIOCUEPJGNV-UHFFFAOYSA-N 2-[(1-benzylpiperidin-4-yl)methyl]-1-(pyridin-3-ylmethyl)benzimidazole Chemical compound N=1C2=CC=CC=C2N(CC=2C=NC=CC=2)C=1CC(CC1)CCN1CC1=CC=CC=C1 JUZCIOCUEPJGNV-UHFFFAOYSA-N 0.000 description 1
- KOUFRWUPDSLKAT-UHFFFAOYSA-N 2-[(1-benzylpiperidin-4-yl)methyl]-1h-benzimidazole Chemical compound N=1C2=CC=CC=C2NC=1CC(CC1)CCN1CC1=CC=CC=C1 KOUFRWUPDSLKAT-UHFFFAOYSA-N 0.000 description 1
- PHUDOFVKAXHWJD-UHFFFAOYSA-N 2-[(1-benzylpiperidin-4-yl)methyl]-3h-imidazo[4,5-c]pyridine Chemical compound N=1C2=CN=CC=C2NC=1CC(CC1)CCN1CC1=CC=CC=C1 PHUDOFVKAXHWJD-UHFFFAOYSA-N 0.000 description 1
- PQUYZOXDNZDQEX-UHFFFAOYSA-N 2-[4-[(1-benzylbenzimidazol-2-yl)methyl]piperidin-1-yl]ethanamine Chemical compound C1CN(CCN)CCC1CC1=NC2=CC=CC=C2N1CC1=CC=CC=C1 PQUYZOXDNZDQEX-UHFFFAOYSA-N 0.000 description 1
- WIDALERTKHAFPG-UHFFFAOYSA-N 2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]-n-(pyridin-2-ylmethyl)ethanamine Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1CC1CCN(CCNCC=2N=CC=CC=2)CC1 WIDALERTKHAFPG-UHFFFAOYSA-N 0.000 description 1
- SRVSANITKGHZCZ-UHFFFAOYSA-N 2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]acetamide Chemical compound C1CN(CC(=O)N)CCC1CC1=NC2=CC=CC=C2N1CC1=CC=C(F)C=C1 SRVSANITKGHZCZ-UHFFFAOYSA-N 0.000 description 1
- ONPYJUHFEOOXDN-UHFFFAOYSA-N 2-[4-[[3-(furan-2-ylmethyl)imidazo[4,5-b]pyridin-2-yl]methyl]piperidin-1-yl]ethanamine Chemical compound C1CN(CCN)CCC1CC1=NC2=CC=CN=C2N1CC1=CC=CO1 ONPYJUHFEOOXDN-UHFFFAOYSA-N 0.000 description 1
- MVQBYASFRQCWOG-UHFFFAOYSA-N 2-[4-[[3-(thiophen-2-ylmethyl)imidazo[4,5-b]pyridin-2-yl]methyl]piperidin-1-yl]ethanamine Chemical compound C1CN(CCN)CCC1CC1=NC2=CC=CN=C2N1CC1=CC=CS1 MVQBYASFRQCWOG-UHFFFAOYSA-N 0.000 description 1
- NQBHDSZYDVXNKI-UHFFFAOYSA-N 2-[[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]methyl]-1-[(3-methylthiophen-2-yl)methyl]benzimidazole Chemical compound C1=CC(OC)=CC=C1CCN1CCC(CC=2N(C3=CC=CC=C3N=2)CC2=C(C=CS2)C)CC1 NQBHDSZYDVXNKI-UHFFFAOYSA-N 0.000 description 1
- HJYSAEWIPWFIPQ-UHFFFAOYSA-N 2-[[1-[3-(4-fluorophenoxy)propyl]piperidin-4-yl]methyl]-1-[(4-fluorophenyl)methyl]benzimidazole oxalic acid Chemical compound C(C(=O)O)(=O)O.FC1=CC=C(OCCCN2CCC(CC2)CC2=NC3=C(N2CC2=CC=C(C=C2)F)C=CC=C3)C=C1 HJYSAEWIPWFIPQ-UHFFFAOYSA-N 0.000 description 1
- LDCVKTPKFMZEGF-UHFFFAOYSA-N 2-amino-n-[2-[4-[[3-(furan-2-ylmethyl)imidazo[4,5-b]pyridin-2-yl]methyl]piperidin-1-yl]ethyl]benzamide Chemical compound NC1=CC=CC=C1C(=O)NCCN1CCC(CC=2N(C3=NC=CC=C3N=2)CC=2OC=CC=2)CC1 LDCVKTPKFMZEGF-UHFFFAOYSA-N 0.000 description 1
- RXNZFHIEDZEUQM-UHFFFAOYSA-N 2-bromo-1,3-thiazole Chemical compound BrC1=NC=CS1 RXNZFHIEDZEUQM-UHFFFAOYSA-N 0.000 description 1
- ZNPNOVHKCAAQCG-UHFFFAOYSA-N 2-chloro-1-methylpyridin-1-ium Chemical compound C[N+]1=CC=CC=C1Cl ZNPNOVHKCAAQCG-UHFFFAOYSA-N 0.000 description 1
- ABFPKTQEQNICFT-UHFFFAOYSA-M 2-chloro-1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=CC=C1Cl ABFPKTQEQNICFT-UHFFFAOYSA-M 0.000 description 1
- UUOLETYDNTVQDY-UHFFFAOYSA-N 2-chloro-3-nitropyridine Chemical compound [O-][N+](=O)C1=CC=CN=C1Cl UUOLETYDNTVQDY-UHFFFAOYSA-N 0.000 description 1
- PLOHMGUEAHHTKK-UHFFFAOYSA-N 2-chloro-4-n-methylpyridine-3,4-diamine Chemical compound CNC1=CC=NC(Cl)=C1N PLOHMGUEAHHTKK-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- VYSRZETUSAOIMP-UHFFFAOYSA-N 2-furanacetic acid Chemical compound OC(=O)CC1=CC=CO1 VYSRZETUSAOIMP-UHFFFAOYSA-N 0.000 description 1
- NUCHSOWNRSBTJL-UHFFFAOYSA-N 2-methylpyrimidine-4,5-diamine Chemical compound CC1=NC=C(N)C(N)=N1 NUCHSOWNRSBTJL-UHFFFAOYSA-N 0.000 description 1
- TVFORTZHGPWPAE-UHFFFAOYSA-N 2-methylsulfanyl-[1,3]thiazolo[5,4-b]pyridine Chemical compound C1=CN=C2SC(SC)=NC2=C1 TVFORTZHGPWPAE-UHFFFAOYSA-N 0.000 description 1
- MQMINTXYPCQPQE-UHFFFAOYSA-N 2-n-[(4-methylphenyl)methyl]benzene-1,2-diamine Chemical compound C1=CC(C)=CC=C1CNC1=CC=CC=C1N MQMINTXYPCQPQE-UHFFFAOYSA-N 0.000 description 1
- OIVBYXSPOQZYDS-UHFFFAOYSA-N 2-piperidin-1-ylacetamide;dihydrochloride Chemical compound Cl.Cl.NC(=O)CN1CCCCC1 OIVBYXSPOQZYDS-UHFFFAOYSA-N 0.000 description 1
- CLVBVRODHJFTGF-UHFFFAOYSA-N 2-piperidin-1-ylacetonitrile Chemical compound N#CCN1CCCCC1 CLVBVRODHJFTGF-UHFFFAOYSA-N 0.000 description 1
- CHXJXRYXZHSGOT-UHFFFAOYSA-N 2-piperidin-4-ylsulfanyl-1h-benzimidazole Chemical compound C1CNCCC1SC1=NC2=CC=CC=C2N1 CHXJXRYXZHSGOT-UHFFFAOYSA-N 0.000 description 1
- VUMFRFIVUQTAPJ-UHFFFAOYSA-N 2-thiophen-2-ylethyl methanesulfonate Chemical compound CS(=O)(=O)OCCC1=CC=CS1 VUMFRFIVUQTAPJ-UHFFFAOYSA-N 0.000 description 1
- PFLYRWZUNONOBV-UHFFFAOYSA-N 3-(furan-2-ylmethyl)-2-(piperidin-4-ylmethyl)imidazo[4,5-b]pyridine Chemical compound N=1C2=CC=CN=C2N(CC=2OC=CC=2)C=1CC1CCNCC1 PFLYRWZUNONOBV-UHFFFAOYSA-N 0.000 description 1
- MFJXLODMXNVOMK-UHFFFAOYSA-N 3-[(4-fluorophenyl)methyl]-1h-benzimidazole-2-thione Chemical compound C1=CC(F)=CC=C1CN1C(=S)NC2=CC=CC=C21 MFJXLODMXNVOMK-UHFFFAOYSA-N 0.000 description 1
- HOWDJADKDIGVAR-UHFFFAOYSA-N 3-[(4-fluorophenyl)methyl]-2-(piperidin-4-ylmethyl)imidazo[4,5-b]pyridine;dihydrochloride Chemical compound Cl.Cl.C1=CC(F)=CC=C1CN1C2=NC=CC=C2N=C1CC1CCNCC1 HOWDJADKDIGVAR-UHFFFAOYSA-N 0.000 description 1
- CISJAGOOFGOWBG-UHFFFAOYSA-N 3-[2-[4-[[3-[(4-fluorophenyl)methyl]imidazo[4,5-b]pyridin-2-yl]methyl]piperidin-1-yl]ethyl]-1-methyl-2-sulfanylidenequinazolin-4-one Chemical compound S=C1N(C)C2=CC=CC=C2C(=O)N1CCN(CC1)CCC1CC1=NC2=CC=CN=C2N1CC1=CC=C(F)C=C1 CISJAGOOFGOWBG-UHFFFAOYSA-N 0.000 description 1
- IHBVNSPHKMCPST-UHFFFAOYSA-N 3-bromopropanoyl chloride Chemical compound ClC(=O)CCBr IHBVNSPHKMCPST-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- KSDLLCXBVHBCFN-UHFFFAOYSA-N 3-n-[(4-fluorophenyl)methyl]pyridine-2,3-diamine Chemical compound NC1=NC=CC=C1NCC1=CC=C(F)C=C1 KSDLLCXBVHBCFN-UHFFFAOYSA-N 0.000 description 1
- ONKFTKZSASNPJY-UHFFFAOYSA-N 3-nitro-n-(pyridin-2-ylmethyl)pyridin-2-amine Chemical compound [O-][N+](=O)C1=CC=CN=C1NCC1=CC=CC=N1 ONKFTKZSASNPJY-UHFFFAOYSA-N 0.000 description 1
- FXDAEWOXEHMLTC-UHFFFAOYSA-N 3-nitro-n-(thiophen-2-ylmethyl)pyridin-2-amine Chemical compound [O-][N+](=O)C1=CC=CN=C1NCC1=CC=CS1 FXDAEWOXEHMLTC-UHFFFAOYSA-N 0.000 description 1
- WINWBTFTKCIUQK-UHFFFAOYSA-N 4-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]butan-2-one Chemical compound C1CN(CCC(=O)C)CCC1CC1=NC2=CC=CC=C2N1CC1=CC=C(F)C=C1 WINWBTFTKCIUQK-UHFFFAOYSA-N 0.000 description 1
- PPJGWOQSSZLXHO-UHFFFAOYSA-N 4-[[2-(piperidin-4-ylmethyl)benzimidazol-1-yl]methyl]-1,3-thiazole;trihydrobromide Chemical compound Br.Br.Br.N=1C2=CC=CC=C2N(CC=2N=CSC=2)C=1CC1CCNCC1 PPJGWOQSSZLXHO-UHFFFAOYSA-N 0.000 description 1
- JOGMMKIJIMIHDT-UHFFFAOYSA-N 4-[[2-[(1-benzylpiperidin-4-yl)methyl]benzimidazol-1-yl]methyl]-1,3-thiazole Chemical compound N=1C2=CC=CC=C2N(CC=2N=CSC=2)C=1CC(CC1)CCN1CC1=CC=CC=C1 JOGMMKIJIMIHDT-UHFFFAOYSA-N 0.000 description 1
- IFIMTXJWZGOJQP-UHFFFAOYSA-N 4-[[2-[[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]methyl]benzimidazol-1-yl]methyl]-1,3-thiazole;dihydrochloride Chemical compound Cl.Cl.C1=CC(OC)=CC=C1CCN1CCC(CC=2N(C3=CC=CC=C3N=2)CC=2N=CSC=2)CC1 IFIMTXJWZGOJQP-UHFFFAOYSA-N 0.000 description 1
- DALBEPKWEMSQJK-UHFFFAOYSA-N 4-chloro-n-[(4-fluorophenyl)methyl]-5-methoxy-2-nitroaniline Chemical compound C1=C(Cl)C(OC)=CC(NCC=2C=CC(F)=CC=2)=C1[N+]([O-])=O DALBEPKWEMSQJK-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-M 4-hydroxybenzoate Chemical compound OC1=CC=C(C([O-])=O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-M 0.000 description 1
- NHFRGTVSKOPUBK-UHFFFAOYSA-N 4-phenylbutanal Chemical compound O=CCCCC1=CC=CC=C1 NHFRGTVSKOPUBK-UHFFFAOYSA-N 0.000 description 1
- ZBJARNJWKLOYKF-UHFFFAOYSA-N 5-(2-bromoethylsulfanyl)-1-ethyltetrazole Chemical compound CCN1N=NN=C1SCCBr ZBJARNJWKLOYKF-UHFFFAOYSA-N 0.000 description 1
- IGZIQWXDXLUVTI-UHFFFAOYSA-N 5-methoxy-2-nitro-n-(pyridin-2-ylmethyl)aniline Chemical compound COC1=CC=C([N+]([O-])=O)C(NCC=2N=CC=CC=2)=C1 IGZIQWXDXLUVTI-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- FUTSYBVZOWAWAO-UHFFFAOYSA-N 6-(2-bromoethyl)-3,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one Chemical compound CC1=C(CCBr)C(=O)N2C(C)=CSC2=N1 FUTSYBVZOWAWAO-UHFFFAOYSA-N 0.000 description 1
- MJVVZHNFYHFGIP-UHFFFAOYSA-N 6-[2-[4-[[3-(furan-2-ylmethyl)imidazo[4,5-b]pyridin-2-yl]methyl]piperidin-1-yl]ethyl]-3,7-dimethyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one;trihydrochloride Chemical compound Cl.Cl.Cl.O=C1N2C(C)=CSC2=NC(C)=C1CCN(CC1)CCC1CC1=NC2=CC=CN=C2N1CC1=CC=CO1 MJVVZHNFYHFGIP-UHFFFAOYSA-N 0.000 description 1
- GJAQIJSYKGXEBM-UHFFFAOYSA-N 6-chloro-8,9-dimethylpurine Chemical compound N1=CN=C2N(C)C(C)=NC2=C1Cl GJAQIJSYKGXEBM-UHFFFAOYSA-N 0.000 description 1
- KJZYRUQLZCSBSC-UHFFFAOYSA-N 6-chloro-9-methyl-7h-purin-8-one Chemical compound N1=CN=C2N(C)C(O)=NC2=C1Cl KJZYRUQLZCSBSC-UHFFFAOYSA-N 0.000 description 1
- JPLBFZVHIRMSMJ-UHFFFAOYSA-N 6-methoxy-3-nitro-n-(pyridin-2-ylmethyl)pyridin-2-amine Chemical compound COC1=CC=C([N+]([O-])=O)C(NCC=2N=CC=CC=2)=N1 JPLBFZVHIRMSMJ-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- LQVXSNNAFNGRAH-QHCPKHFHSA-N BMS-754807 Chemical compound C([C@@]1(C)C(=O)NC=2C=NC(F)=CC=2)CCN1C(=NN1C=CC=C11)N=C1NC(=NN1)C=C1C1CC1 LQVXSNNAFNGRAH-QHCPKHFHSA-N 0.000 description 1
- GVSUWNMGEPZEQO-UHFFFAOYSA-N Br.S1C=NC=CC1=O Chemical compound Br.S1C=NC=CC1=O GVSUWNMGEPZEQO-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- CJQSNTZFGGPIJL-UHFFFAOYSA-N C(C(=O)O)(=O)O.CN1C(=NC2=C1C=CC=C2)CC2CCNCC2 Chemical compound C(C(=O)O)(=O)O.CN1C(=NC2=C1C=CC=C2)CC2CCNCC2 CJQSNTZFGGPIJL-UHFFFAOYSA-N 0.000 description 1
- 229910014033 C-OH Inorganic materials 0.000 description 1
- PCBZRNYXXCIELG-WYFCWLEVSA-N COC1=CC=C(C[C@H](NC(=O)OC2CCCC3(C2)OOC2(O3)C3CC4CC(C3)CC2C4)C(=O)N[C@@H]2[C@@H](CO)O[C@H]([C@@H]2O)N2C=NC3=C2N=CN=C3N(C)C)C=C1 Chemical compound COC1=CC=C(C[C@H](NC(=O)OC2CCCC3(C2)OOC2(O3)C3CC4CC(C3)CC2C4)C(=O)N[C@@H]2[C@@H](CO)O[C@H]([C@@H]2O)N2C=NC3=C2N=CN=C3N(C)C)C=C1 PCBZRNYXXCIELG-WYFCWLEVSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 1
- 206010009192 Circulatory collapse Diseases 0.000 description 1
- QGPZJNSVTZDPQL-UHFFFAOYSA-N Cl.Cl.C1=CC(OC)=CC=C1CCN1CCC(CC=2N(C3=CC=CC=C3N=2)C2CCCCC2)CC1 Chemical compound Cl.Cl.C1=CC(OC)=CC=C1CCN1CCC(CC=2N(C3=CC=CC=C3N=2)C2CCCCC2)CC1 QGPZJNSVTZDPQL-UHFFFAOYSA-N 0.000 description 1
- 102100024344 Collagen alpha-5(VI) chain Human genes 0.000 description 1
- 229910014570 C—OH Inorganic materials 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- 101000694538 Drosophila melanogaster RuvB-like helicase 1 Proteins 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 208000001762 Gastric Dilatation Diseases 0.000 description 1
- 101000909508 Homo sapiens Collagen alpha-5(VI) chain Proteins 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- UEQUQVLFIPOEMF-UHFFFAOYSA-N Mianserin Chemical compound C1C2=CC=CC=C2N2CCN(C)CC2C2=CC=CC=C21 UEQUQVLFIPOEMF-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 102100035591 POU domain, class 2, transcription factor 2 Human genes 0.000 description 1
- 101710084411 POU domain, class 2, transcription factor 2 Proteins 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 206010039085 Rhinitis allergic Diseases 0.000 description 1
- 235000002357 Ribes grossularia Nutrition 0.000 description 1
- 244000171263 Ribes grossularia Species 0.000 description 1
- 240000007651 Rubus glaucus Species 0.000 description 1
- 235000011034 Rubus glaucus Nutrition 0.000 description 1
- 235000009122 Rubus idaeus Nutrition 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-AKLPVKDBSA-N Sulfur-35 Chemical compound [35S] NINIDFKCEFEMDL-AKLPVKDBSA-N 0.000 description 1
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 1
- 244000299461 Theobroma cacao Species 0.000 description 1
- 235000009470 Theobroma cacao Nutrition 0.000 description 1
- 208000024780 Urticaria Diseases 0.000 description 1
- OSHXRTVCVNSLPD-UHFFFAOYSA-N [1,3]thiazolo[4,5-c]pyridin-2-amine Chemical compound N1=CC=C2SC(N)=NC2=C1 OSHXRTVCVNSLPD-UHFFFAOYSA-N 0.000 description 1
- FIPLAFRCDDWERW-UHFFFAOYSA-N [1,3]thiazolo[4,5-c]pyridine Chemical compound N1=CC=C2SC=NC2=C1 FIPLAFRCDDWERW-UHFFFAOYSA-N 0.000 description 1
- OGWPHTRWLWDCOC-UHFFFAOYSA-N [1,3]thiazolo[5,4-b]pyridin-2-amine Chemical compound C1=CN=C2SC(N)=NC2=C1 OGWPHTRWLWDCOC-UHFFFAOYSA-N 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- 150000000475 acetylene derivatives Chemical class 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 201000010105 allergic rhinitis Diseases 0.000 description 1
- 230000007815 allergy Effects 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- OYTKINVCDFNREN-UHFFFAOYSA-N amifampridine Chemical compound NC1=CC=NC=C1N OYTKINVCDFNREN-UHFFFAOYSA-N 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 238000011888 autopsy Methods 0.000 description 1
- 239000002199 base oil Substances 0.000 description 1
- MYONAGGJKCJOBT-UHFFFAOYSA-N benzimidazol-2-one Chemical compound C1=CC=CC2=NC(=O)N=C21 MYONAGGJKCJOBT-UHFFFAOYSA-N 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- BFAKENXZKHGIGE-UHFFFAOYSA-N bis(2,3,5,6-tetrafluoro-4-iodophenyl)diazene Chemical compound FC1=C(C(=C(C(=C1F)I)F)F)N=NC1=C(C(=C(C(=C1F)F)I)F)F BFAKENXZKHGIGE-UHFFFAOYSA-N 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 230000017531 blood circulation Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- QGJOPFRUJISHPQ-NJFSPNSNSA-N carbon disulfide-14c Chemical compound S=[14C]=S QGJOPFRUJISHPQ-NJFSPNSNSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- CDEIGFNQWMSEKG-UHFFFAOYSA-M chloro-[4-[(2-hydroxynaphthalen-1-yl)diazenyl]phenyl]mercury Chemical compound OC1=CC=C2C=CC=CC2=C1N=NC1=CC=C([Hg]Cl)C=C1 CDEIGFNQWMSEKG-UHFFFAOYSA-M 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- RSUVYMGADVXGOU-BUHFOSPRSA-N cinanserin Chemical compound CN(C)CCCSC1=CC=CC=C1NC(=O)\C=C\C1=CC=CC=C1 RSUVYMGADVXGOU-BUHFOSPRSA-N 0.000 description 1
- 229950001684 cinanserin Drugs 0.000 description 1
- 229940075614 colloidal silicon dioxide Drugs 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 229920001577 copolymer Chemical class 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 1
- JJCFRYNCJDLXIK-UHFFFAOYSA-N cyproheptadine Chemical compound C1CN(C)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 JJCFRYNCJDLXIK-UHFFFAOYSA-N 0.000 description 1
- 229960001140 cyproheptadine Drugs 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 1
- HCUYBXPSSCRKRF-UHFFFAOYSA-N diphosgene Chemical compound ClC(=O)OC(Cl)(Cl)Cl HCUYBXPSSCRKRF-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940069417 doxy Drugs 0.000 description 1
- HALQELOKLVRWRI-VDBOFHIQSA-N doxycycline hyclate Chemical group O.[Cl-].[Cl-].CCO.O=C1C2=C(O)C=CC=C2[C@H](C)[C@@H]2C1=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)[C@@H]([NH+](C)C)[C@@H]1[C@H]2O.O=C1C2=C(O)C=CC=C2[C@H](C)[C@@H]2C1=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)[C@@H]([NH+](C)C)[C@@H]1[C@H]2O HALQELOKLVRWRI-VDBOFHIQSA-N 0.000 description 1
- 238000001647 drug administration Methods 0.000 description 1
- 150000002085 enols Chemical group 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- TYEPWLJHQLYWSR-UHFFFAOYSA-N ethyl 2-isothiocyanatobenzoate Chemical compound CCOC(=O)C1=CC=CC=C1N=C=S TYEPWLJHQLYWSR-UHFFFAOYSA-N 0.000 description 1
- SRKHHAVOORPIJH-UHFFFAOYSA-N ethyl 4-[(1-methylbenzimidazol-2-yl)methyl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1CC1=NC2=CC=CC=C2N1C SRKHHAVOORPIJH-UHFFFAOYSA-N 0.000 description 1
- IJQDDDLEPQQMFA-UHFFFAOYSA-N ethyl 4-[[1-(thiophen-2-ylmethyl)benzimidazol-2-yl]methyl]piperidine-1-carboxylate;hydrochloride Chemical compound Cl.C1CN(C(=O)OCC)CCC1CC1=NC2=CC=CC=C2N1CC1=CC=CS1 IJQDDDLEPQQMFA-UHFFFAOYSA-N 0.000 description 1
- LUBGFMZTGFXIIN-UHFFFAOYSA-N ethyl 4-oxopiperidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(=O)CC1 LUBGFMZTGFXIIN-UHFFFAOYSA-N 0.000 description 1
- 239000007941 film coated tablet Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 210000001156 gastric mucosa Anatomy 0.000 description 1
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 1
- 210000004907 gland Anatomy 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000000938 histamine H1 antagonist Substances 0.000 description 1
- 235000003642 hunger Nutrition 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 239000008172 hydrogenated vegetable oil Substances 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 125000003037 imidazol-2-yl group Chemical group [H]N1C([*])=NC([H])=C1[H] 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- PGLTVOMIXTUURA-UHFFFAOYSA-N iodoacetamide Chemical compound NC(=O)CI PGLTVOMIXTUURA-UHFFFAOYSA-N 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 231100000518 lethal Toxicity 0.000 description 1
- 230000001665 lethal effect Effects 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- BRMYZIKAHFEUFJ-UHFFFAOYSA-L mercury diacetate Chemical compound CC(=O)O[Hg]OC(C)=O BRMYZIKAHFEUFJ-UHFFFAOYSA-L 0.000 description 1
- LWJROJCJINYWOX-UHFFFAOYSA-L mercury dichloride Chemical compound Cl[Hg]Cl LWJROJCJINYWOX-UHFFFAOYSA-L 0.000 description 1
- 229910001511 metal iodide Inorganic materials 0.000 description 1
- WZHJKEUHNJHDLS-QTGUNEKASA-N metergoline Chemical compound C([C@H]1CN([C@H]2[C@@H](C=3C=CC=C4N(C)C=C(C=34)C2)C1)C)NC(=O)OCC1=CC=CC=C1 WZHJKEUHNJHDLS-QTGUNEKASA-N 0.000 description 1
- 229960004650 metergoline Drugs 0.000 description 1
- VPKDCDLSJZCGKE-UHFFFAOYSA-N methanediimine Chemical class N=C=N VPKDCDLSJZCGKE-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- CUGZQXQOKWTTJS-UHFFFAOYSA-N methyl 2-(1-benzylpiperidin-4-yl)ethanimidate;dihydrochloride Chemical compound Cl.Cl.C1CC(CC(=N)OC)CCN1CC1=CC=CC=C1 CUGZQXQOKWTTJS-UHFFFAOYSA-N 0.000 description 1
- UNXVHBOJSCWVCD-UHFFFAOYSA-N methyl 2-isothiocyanatobenzoate Chemical compound COC(=O)C1=CC=CC=C1N=C=S UNXVHBOJSCWVCD-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- BWKQVWQYYSAKHC-UHFFFAOYSA-N methylthiourea;hydroiodide Chemical compound I.CNC(N)=S BWKQVWQYYSAKHC-UHFFFAOYSA-N 0.000 description 1
- 229960001186 methysergide Drugs 0.000 description 1
- 229960003955 mianserin Drugs 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- 210000004877 mucosa Anatomy 0.000 description 1
- RJDWDKMDGAMUIT-UHFFFAOYSA-N n-(furan-2-ylmethyl)-4-methoxy-2-nitroaniline Chemical compound [O-][N+](=O)C1=CC(OC)=CC=C1NCC1=CC=CO1 RJDWDKMDGAMUIT-UHFFFAOYSA-N 0.000 description 1
- PLBIHRNOLHYOBU-UHFFFAOYSA-N n-(furan-2-ylmethyl)-5-methoxy-2-nitroaniline Chemical compound COC1=CC=C([N+]([O-])=O)C(NCC=2OC=CC=2)=C1 PLBIHRNOLHYOBU-UHFFFAOYSA-N 0.000 description 1
- YONDHNQJLWPUJY-UHFFFAOYSA-N n-(furan-2-ylmethyl)-6-methoxy-3-nitropyridin-2-amine Chemical compound COC1=CC=C([N+]([O-])=O)C(NCC=2OC=CC=2)=N1 YONDHNQJLWPUJY-UHFFFAOYSA-N 0.000 description 1
- IRIZISNRAORPAW-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-2-methoxy-6-nitroaniline Chemical compound COC1=CC=CC([N+]([O-])=O)=C1NCC1=CC=C(F)C=C1 IRIZISNRAORPAW-UHFFFAOYSA-N 0.000 description 1
- VCITVZQXQXVEKR-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-3-methoxy-2-nitroaniline Chemical compound COC1=CC=CC(NCC=2C=CC(F)=CC=2)=C1[N+]([O-])=O VCITVZQXQXVEKR-UHFFFAOYSA-N 0.000 description 1
- STQSEWLCSLADTG-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-3-nitropyridin-2-amine Chemical compound [O-][N+](=O)C1=CC=CN=C1NCC1=CC=C(F)C=C1 STQSEWLCSLADTG-UHFFFAOYSA-N 0.000 description 1
- ASYWICDNOQIJQJ-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-3-nitropyridin-4-amine Chemical compound [O-][N+](=O)C1=CN=CC=C1NCC1=CC=C(F)C=C1 ASYWICDNOQIJQJ-UHFFFAOYSA-N 0.000 description 1
- FHDSIVIBUQKOTJ-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]-4,5-dimethoxy-2-nitroaniline Chemical compound C1=C(OC)C(OC)=CC(NCC=2C=CC(F)=CC=2)=C1[N+]([O-])=O FHDSIVIBUQKOTJ-UHFFFAOYSA-N 0.000 description 1
- XVDHPQASEKWQQF-UHFFFAOYSA-N n-[(4-methoxyphenyl)methyl]-3-nitropyridin-2-amine Chemical compound C1=CC(OC)=CC=C1CNC1=NC=CC=C1[N+]([O-])=O XVDHPQASEKWQQF-UHFFFAOYSA-N 0.000 description 1
- PKUPFGXYCXKGJQ-UHFFFAOYSA-N n-[(4-methylphenyl)methyl]-2-nitroaniline Chemical compound C1=CC(C)=CC=C1CNC1=CC=CC=C1[N+]([O-])=O PKUPFGXYCXKGJQ-UHFFFAOYSA-N 0.000 description 1
- JJIAYQOBGONBFJ-UHFFFAOYSA-N n-[(4-methylphenyl)methyl]-3-nitropyridin-2-amine Chemical compound C1=CC(C)=CC=C1CNC1=NC=CC=C1[N+]([O-])=O JJIAYQOBGONBFJ-UHFFFAOYSA-N 0.000 description 1
- XWRYOQFYVVOOAP-UHFFFAOYSA-N n-[2-[4-[[1-(furan-2-ylmethyl)benzimidazol-2-yl]methyl]piperidin-1-yl]ethyl]-2-(2-oxopropylamino)benzamide;oxalic acid Chemical compound OC(=O)C(O)=O.CC(=O)CNC1=CC=CC=C1C(=O)NCCN1CCC(CC=2N(C3=CC=CC=C3N=2)CC=2OC=CC=2)CC1 XWRYOQFYVVOOAP-UHFFFAOYSA-N 0.000 description 1
- NLLAPEPQWDNPGU-UHFFFAOYSA-N n-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]ethyl]-3-methyl-5-nitroimidazol-4-amine Chemical compound CN1C=NC([N+]([O-])=O)=C1NCCN1CCC(CC=2N(C3=CC=CC=C3N=2)CC=2C=CC(F)=CC=2)CC1 NLLAPEPQWDNPGU-UHFFFAOYSA-N 0.000 description 1
- UHOQYNDGMATFMH-UHFFFAOYSA-N n-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]methyl]piperidin-1-yl]ethyl]-n-pyrimidin-2-ylbenzamide Chemical compound C1=CC(F)=CC=C1CN1C2=CC=CC=C2N=C1CC1CCN(CCN(C(=O)C=2C=CC=CC=2)C=2N=CC=CN=2)CC1 UHOQYNDGMATFMH-UHFFFAOYSA-N 0.000 description 1
- DANRUCVFFPGLBO-UHFFFAOYSA-N n-[2-[4-[[3-(furan-2-ylmethyl)imidazo[4,5-b]pyridin-2-yl]methyl]piperidin-1-yl]ethyl]-1,3-thiazol-2-amine;oxalic acid Chemical compound OC(=O)C(O)=O.N=1C=CSC=1NCCN(CC1)CCC1CC1=NC2=CC=CN=C2N1CC1=CC=CO1 DANRUCVFFPGLBO-UHFFFAOYSA-N 0.000 description 1
- VESYCMVACKNABZ-UHFFFAOYSA-N n-[2-[4-[[3-(furan-2-ylmethyl)imidazo[4,5-b]pyridin-2-yl]methyl]piperidin-1-yl]ethyl]-2-(methylamino)benzamide Chemical compound CNC1=CC=CC=C1C(=O)NCCN1CCC(CC=2N(C3=NC=CC=C3N=2)CC=2OC=CC=2)CC1 VESYCMVACKNABZ-UHFFFAOYSA-N 0.000 description 1
- 229960003966 nicotinamide Drugs 0.000 description 1
- 239000011570 nicotinamide Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 229940098462 oral drops Drugs 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 239000003961 penetration enhancing agent Substances 0.000 description 1
- XNLICIUVMPYHGG-UHFFFAOYSA-N pentan-2-one Chemical compound CCCC(C)=O XNLICIUVMPYHGG-UHFFFAOYSA-N 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- LIGACIXOYTUXAW-UHFFFAOYSA-N phenacyl bromide Chemical compound BrCC(=O)C1=CC=CC=C1 LIGACIXOYTUXAW-UHFFFAOYSA-N 0.000 description 1
- IPNPIHIZVLFAFP-UHFFFAOYSA-N phosphorus tribromide Chemical compound BrP(Br)Br IPNPIHIZVLFAFP-UHFFFAOYSA-N 0.000 description 1
- AXKPFOAXAHJUAG-UHFFFAOYSA-N pipamperone Chemical compound C1CC(C(=O)N)(N2CCCCC2)CCN1CCCC(=O)C1=CC=C(F)C=C1 AXKPFOAXAHJUAG-UHFFFAOYSA-N 0.000 description 1
- 229960002776 pipamperone Drugs 0.000 description 1
- FIADGNVRKBPQEU-UHFFFAOYSA-N pizotifen Chemical compound C1CN(C)CCC1=C1C2=CC=CC=C2CCC2=C1C=CS2 FIADGNVRKBPQEU-UHFFFAOYSA-N 0.000 description 1
- 229960004572 pizotifen Drugs 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000012716 precipitator Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 229960005206 pyrazinamide Drugs 0.000 description 1
- DRTZAIDVOGUYSP-UHFFFAOYSA-N pyridin-1-ium;chloride;hydrochloride Chemical compound Cl.Cl.C1=CC=NC=C1 DRTZAIDVOGUYSP-UHFFFAOYSA-N 0.000 description 1
- LJXQPZWIHJMPQQ-UHFFFAOYSA-N pyrimidin-2-amine Chemical compound NC1=NC=CC=N1 LJXQPZWIHJMPQQ-UHFFFAOYSA-N 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 206010040560 shock Diseases 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- DKGZKTPJOSAWFA-UHFFFAOYSA-N spiperone Chemical compound C1=CC(F)=CC=C1C(=O)CCCN1CCC2(C(NCN2C=2C=CC=CC=2)=O)CC1 DKGZKTPJOSAWFA-UHFFFAOYSA-N 0.000 description 1
- 229950001675 spiperone Drugs 0.000 description 1
- 239000004544 spot-on Substances 0.000 description 1
- 230000037351 starvation Effects 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- IOHCGRJBQIIEOU-UHFFFAOYSA-N thiazin-6-one Chemical compound O=C1C=CC=NS1 IOHCGRJBQIIEOU-UHFFFAOYSA-N 0.000 description 1
- YUKQRDCYNOVPGJ-UHFFFAOYSA-N thioacetamide Chemical compound CC(N)=S YUKQRDCYNOVPGJ-UHFFFAOYSA-N 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- FKKJJPMGAWGYPN-UHFFFAOYSA-N thiophen-2-ylmethanamine Chemical compound NCC1=CC=CS1 FKKJJPMGAWGYPN-UHFFFAOYSA-N 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 230000002227 vasoactive effect Effects 0.000 description 1
- 235000012431 wafers Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/26—Heterocyclic compounds containing purine ring systems with an oxygen, sulphur, or nitrogen atom directly attached in position 2 or 6, but not in both
- C07D473/32—Nitrogen atom
- C07D473/34—Nitrogen atom attached in position 6, e.g. adenine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Hydrogenated Pyridines (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US56936984A | 1984-01-09 | 1984-01-09 | |
| US67113584A | 1984-11-13 | 1984-11-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ210776A true NZ210776A (en) | 1988-03-30 |
Family
ID=27075046
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ210776A NZ210776A (en) | 1984-01-09 | 1985-01-07 | 4-((bicycloheterocyclyl)-methyl and -hetero)-piperidine derivatives and pharmaceutical compositions |
Country Status (21)
| Country | Link |
|---|---|
| EP (1) | EP0151826B1 (OSRAM) |
| JP (1) | JPH0768240B2 (OSRAM) |
| KR (2) | KR870001169B1 (OSRAM) |
| AU (1) | AU573673B2 (OSRAM) |
| BG (1) | BG40965A3 (OSRAM) |
| CA (1) | CA1259609A (OSRAM) |
| DE (1) | DE3486121T2 (OSRAM) |
| DK (1) | DK8985A (OSRAM) |
| ES (1) | ES8706668A1 (OSRAM) |
| FI (1) | FI83867C (OSRAM) |
| GR (1) | GR850060B (OSRAM) |
| HU (1) | HU200338B (OSRAM) |
| IE (1) | IE59707B1 (OSRAM) |
| IL (1) | IL74018A (OSRAM) |
| MA (1) | MA20323A1 (OSRAM) |
| NO (1) | NO160849C (OSRAM) |
| NZ (1) | NZ210776A (OSRAM) |
| PH (1) | PH23995A (OSRAM) |
| PT (1) | PT79809B (OSRAM) |
| RO (1) | RO90622A (OSRAM) |
| ZW (1) | ZW485A1 (OSRAM) |
Families Citing this family (59)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0144101B1 (en) * | 1983-11-30 | 1991-02-06 | Janssen Pharmaceutica N.V. | Bicyclic heterocyclyl containing n-(bicyclic heterocyclyl)-4-piperidinamines |
| US4588722A (en) * | 1984-01-09 | 1986-05-13 | Janssen Pharmaceutica N.V. | N-(4-piperidinyl) bicyclic condensed 2-imidazolamine derivatives |
| CA1260474A (en) * | 1984-12-03 | 1989-09-26 | Raymond A. Stokbroekx | Benzoxazol- and benzothiazolamine derivatives |
| US4804663A (en) * | 1985-03-27 | 1989-02-14 | Janssen Pharmaceutica N.V. | 3-piperidinyl-substituted 1,2-benzisoxazoles and 1,2-benzisothiazoles |
| KR930005004B1 (ko) * | 1985-04-15 | 1993-06-11 | 쟈안센 파아마슈우티카 엔. 부이. | 치환된 n-[(4-피페리디닐)알킬]이환 축합 옥사졸아민 및 티아졸아민의 제조방법 |
| GB8515934D0 (en) * | 1985-06-24 | 1985-07-24 | Janssen Pharmaceutica Nv | (4-piperidinomethyl and-hetero)purines |
| FR2587029B1 (fr) * | 1985-09-11 | 1987-10-30 | Synthelabo | Derives de benzimidazole, leur preparation et leur application en therapeutique |
| KR950001015B1 (ko) * | 1986-01-10 | 1995-02-07 | 닛뽕 케미화 가부시끼가이샤 | 술폭시드 유도체의 제조방법 |
| CA1327579C (en) * | 1986-02-03 | 1994-03-08 | Frans Eduard Janssens | Anti-histaminic compositions containing n-heterocyclyl-4-piperidinamines |
| NZ223654A (en) * | 1987-03-09 | 1990-03-27 | Janssen Pharmaceutica Nv | 1-alkyl-substituted-benzimidazole-4-piperidinamines and pharmaceutical compositions |
| US4943580A (en) * | 1987-03-09 | 1990-07-24 | Janssen Pharmaceutica N.V. | Anti-histaminic benzimidazole, imidazopyridine and purine derivatives |
| CA1317939C (en) * | 1987-07-01 | 1993-05-18 | Janssen Pharmaceutica Naamloze Vennootschap | ¬(bicyclic heterocyclyl)methyl and -hetero| substituted hexahydro-1h-azepines and pyrrolidines |
| GB8716313D0 (en) * | 1987-07-10 | 1987-08-19 | Janssen Pharmaceutica Nv | 2-(heterocyclylalkyl)imidazopyridines |
| US4908372A (en) * | 1988-10-13 | 1990-03-13 | Merrell Dow Pharmaceuticals Inc. | Antihistaminic piperidinyl benzimidazoles |
| GB8900380D0 (en) * | 1989-01-09 | 1989-03-08 | Janssen Pharmaceutica Nv | 2-aminopyrimidinone derivatives |
| PH30434A (en) * | 1989-04-07 | 1997-05-09 | Janssen Pharmaceutica Nv | Hydroxyalkylfuranyl derivatives |
| IT1229230B (it) * | 1989-05-08 | 1991-07-26 | Dompe Farmaceutici Spa | Piperidinilimidazopiridine farmacologicamente attive. |
| US5200407A (en) * | 1989-06-29 | 1993-04-06 | Meiji Seika Kaburhiki Kaisha | Azole derivatives and anti-ulcerative composition containing same |
| JP2679745B2 (ja) * | 1989-06-29 | 1997-11-19 | 明治製菓株式会社 | アゾール誘導体及びそれらを有効成分とする抗潰瘍剤 |
| CA2022451C (en) * | 1989-08-03 | 2001-01-23 | Albert Anthony Carr | Anti-psychotic piperidynl benzimidazole compounds |
| GB9000305D0 (en) * | 1990-01-06 | 1990-03-07 | Pfizer Ltd | Anticholinergic agents |
| KR100190299B1 (ko) * | 1990-07-19 | 1999-06-01 | 디르크 반테 | 신규한 옥사졸릴 유도체 |
| US5217980A (en) * | 1990-07-19 | 1993-06-08 | Janssen Pharmaceutica N.V. | Oxazolyl and piperidinyl substituted benimidazolyl compounds |
| WO1992006086A1 (en) * | 1990-10-01 | 1992-04-16 | Janssen Pharmaceutica N.V. | Novel 4-piperidinylcarbonyl derivatives |
| KR100226954B1 (ko) * | 1990-12-14 | 1999-10-15 | 슈테펜엘.네스비트 | 피페리디닐 벤즈이미다졸 유도체, 이를 함유하는 약제학적 조성물 및 이의 제조방법 |
| TW231291B (OSRAM) * | 1992-01-09 | 1994-10-01 | Janssen Pharmaceutica Nv | |
| KR100269756B1 (ko) * | 1992-02-13 | 2000-10-16 | 슈테펜엘.네스비트 | 피페리디닐티아시클릭유도체(Piperidinyl Thiacyclic Derivatives) |
| CA2091204C (en) * | 1992-03-11 | 1997-04-08 | Ronald J. Mattson | Antiischemic-piperazinyl and piperidinyl-cyclohexanes |
| ES2048109B1 (es) * | 1992-07-20 | 1994-12-16 | Espanola Prod Quimicos | Procedimiento de preparacion de nuevos derivados piperidicos del bencimidazol. |
| WO1994021615A1 (en) * | 1993-03-18 | 1994-09-29 | Merck Sharp & Dohme Limited | Benzimidazole derivatives |
| US5521183A (en) * | 1994-08-30 | 1996-05-28 | Allergan | Use of 5-HT ligands as anti-pruritic agents |
| TW429256B (en) * | 1995-12-27 | 2001-04-11 | Janssen Pharmaceutica Nv | 1-(1,2-disubstituted piperidinyl)-4-(benzimidazolyl- and imidazopyridinyl)-piperidine derivatives |
| IL138228A0 (en) * | 1998-03-06 | 2001-10-31 | Janssen Pharmaceutica Nv | Glycine transport inhibitors |
| MXPA02000117A (es) * | 1999-06-28 | 2002-07-02 | Janssen Pharmaceutica Nv | Inhibidores de la replicacion del virus sincitial respiratorio. |
| KR100731271B1 (ko) * | 1999-06-28 | 2007-06-21 | 얀센 파마슈티카 엔.브이. | 호흡기 신시티움 바이러스 복제 억제제 |
| PT1196408E (pt) * | 1999-06-28 | 2005-01-31 | Janssen Pharmaceutica Nv | Inibidores da replicacao do virus sincicial respiratorio |
| TWI225488B (en) * | 1999-12-21 | 2004-12-21 | Janssen Pharmaceutica Nv | Derivatives of homopiperidinyl substituted benzimidazole analogues |
| AR033517A1 (es) | 2000-04-08 | 2003-12-26 | Astrazeneca Ab | Derivados de piperidina, proceso para su preparacion y uso de estos derivados en la fabricacion de medicamentos |
| SK288003B6 (sk) * | 2001-02-24 | 2012-10-02 | Boehringer Ingelheim Pharma Gmbh & Co. Kg | Xanthin derivatives, method for the preparation thereof, pharmaceutical composition containing thereof and their use |
| US7030150B2 (en) * | 2001-05-11 | 2006-04-18 | Trimeris, Inc. | Benzimidazole compounds and antiviral uses thereof |
| BR0210733A (pt) | 2001-07-02 | 2004-07-20 | Astrazeneca Ab | Derivados de piperidina de utilidade úteis como moduladores da atividade do receptor de quimocina |
| US6530660B1 (en) | 2001-08-16 | 2003-03-11 | Contour Optik, Inc. | Eyeglass frame with a reversible arm |
| GB0120461D0 (en) | 2001-08-22 | 2001-10-17 | Astrazeneca Ab | Novel compounds |
| GB0122503D0 (en) | 2001-09-18 | 2001-11-07 | Astrazeneca Ab | Chemical compounds |
| WO2003060475A2 (en) * | 2002-01-10 | 2003-07-24 | Neurogen Corporation | Melanin concentrating hormone receptor ligands: substituted 2-(4-benzyl-piperazin-1-ylmethyl)- and 2-(4-benzyl-diazepan-1-ylmethyl)-1h-benzoimidazole analogues |
| SE0200844D0 (sv) | 2002-03-19 | 2002-03-19 | Astrazeneca Ab | Chemical compounds |
| SE0200843D0 (sv) | 2002-03-19 | 2002-03-19 | Astrazeneca Ab | Chemical compounds |
| US6939877B2 (en) * | 2002-09-12 | 2005-09-06 | Wyeth | Antidepressant piperidine derivatives of heterocycle-fused benzodioxans |
| CA2513529A1 (en) * | 2003-01-17 | 2004-08-19 | Cv Therapeutics Inc. | Substituted heterocyclic compounds useful in the treatment of cardiovascular diseases |
| SE0300957D0 (sv) | 2003-04-01 | 2003-04-01 | Astrazeneca Ab | Chemical compounds |
| KR100640783B1 (ko) | 2004-10-30 | 2006-11-01 | 주식회사 하이닉스반도체 | 노이즈를 줄일 수 있는 데이터 출력 드라이버 |
| JP5078869B2 (ja) | 2005-03-08 | 2012-11-21 | ジヤンセン・フアーマシユーチカ・ナームローゼ・フエンノートシヤツプ | ニューロキニン(nk1)拮抗物質としてのジアザ−スピロ−[4.4]−ノナン誘導体 |
| AU2006270548A1 (en) | 2005-07-21 | 2007-01-25 | Astrazeneca Ab | Novel piperidine derivatives |
| ATE525370T1 (de) * | 2007-10-11 | 2011-10-15 | Glaxo Group Ltd | Phthalazin- und pyridoä3,4- düpyridazinverbindungen als h1-rezeptor- antagonisten |
| DK2611444T3 (en) | 2010-09-02 | 2016-01-11 | Suven Life Sciences Ltd | Heterocyclyl compounds as histamine H3 receptor ligands |
| US10913736B2 (en) * | 2014-08-22 | 2021-02-09 | University Of Washington | Specific inhibitors of methionyl-tRNA synthetase |
| RU2766579C2 (ru) | 2015-07-02 | 2022-03-15 | ХОРАЙЗОН ОРФАН ЭлЭлСи | Цистеаминдиоксигеназа-резистентные аналоги цистеамина и их применение |
| WO2017207340A1 (de) * | 2016-05-31 | 2017-12-07 | Bayer Pharma Aktiengesellschaft | Neue substituierte benzimidazole, verfahren zu ihrer herstellung, pharmazeutische präparate die diese enthalten, sowie deren verwendung zur herstellung von arzneimitteln |
| GB2585700A (en) | 2019-07-12 | 2021-01-20 | Hire Torque Ltd | Hydraulic torque wrench and control system for a hydraulic torque wrench |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2857391A (en) * | 1955-04-15 | 1958-10-21 | Merck & Co Inc | Aminomethylbenzimidazoles |
| GB1260857A (en) * | 1968-07-10 | 1972-01-19 | Hexachimie | IMIDAZO-3H-(4,5-b)-PYRIDINE DERIVATIVES |
| DE2334009A1 (de) * | 1973-07-04 | 1975-01-23 | Boehringer Mannheim Gmbh | Purin-derivate sowie verfahren zu ihrer herstellung |
| SE416649B (sv) * | 1974-05-16 | 1981-01-26 | Haessle Ab | Forfarande for framstellning av foreningar som paverkar magsyrasekretionen |
| US4219559A (en) * | 1979-01-10 | 1980-08-26 | Janssen Pharmaceutica N.V. | N-Heterocyclyl-4-piperidinamines |
| US4335127A (en) * | 1979-01-08 | 1982-06-15 | Janssen Pharmaceutica, N.V. | Piperidinylalkyl quinazoline compounds, composition and method of use |
| US4342870A (en) * | 1980-03-28 | 1982-08-03 | Janssen Pharmaceutica N.V. | Novel 3-(1-piperidinylalkyl)-4H-pyrido[1,2-a]pyrimidin-4-one derivatives |
| PL129375B1 (en) * | 1980-07-24 | 1984-05-31 | Rhone Poulenc Ind | Process for preparing novel derivatives of 2,3,6,7-tetrahydro-thiazole-/3,2-a/-pyrimidin-5-one |
| US4443451A (en) * | 1981-07-15 | 1984-04-17 | Janssen Pharmaceutica N.V. | Bicyclic pyrimidin-5-one derivatives |
| US4634704A (en) * | 1983-10-06 | 1987-01-06 | Janssen Pharmaceutica, N.V. | Anti-allergic five membered heterocyclic ring containing N-(bicyclic heterocycyl)-4-piperidinamines |
| EP0144101B1 (en) * | 1983-11-30 | 1991-02-06 | Janssen Pharmaceutica N.V. | Bicyclic heterocyclyl containing n-(bicyclic heterocyclyl)-4-piperidinamines |
| US4588722A (en) * | 1984-01-09 | 1986-05-13 | Janssen Pharmaceutica N.V. | N-(4-piperidinyl) bicyclic condensed 2-imidazolamine derivatives |
-
1984
- 1984-11-16 PH PH31450A patent/PH23995A/en unknown
- 1984-12-13 KR KR1019840007901A patent/KR870001169B1/ko not_active Expired
- 1984-12-13 DE DE8484201851T patent/DE3486121T2/de not_active Expired - Fee Related
- 1984-12-13 EP EP84201851A patent/EP0151826B1/en not_active Expired - Lifetime
- 1984-12-31 ES ES539281A patent/ES8706668A1/es not_active Expired
-
1985
- 1985-01-07 AU AU37364/85A patent/AU573673B2/en not_active Ceased
- 1985-01-07 NZ NZ210776A patent/NZ210776A/en unknown
- 1985-01-07 CA CA000471589A patent/CA1259609A/en not_active Expired
- 1985-01-08 JP JP60000479A patent/JPH0768240B2/ja not_active Expired - Lifetime
- 1985-01-08 NO NO850085A patent/NO160849C/no unknown
- 1985-01-08 MA MA20547A patent/MA20323A1/fr unknown
- 1985-01-08 IE IE4285A patent/IE59707B1/en not_active IP Right Cessation
- 1985-01-08 RO RO85117252A patent/RO90622A/ro unknown
- 1985-01-08 PT PT79809A patent/PT79809B/pt not_active IP Right Cessation
- 1985-01-08 ZW ZW4/85A patent/ZW485A1/xx unknown
- 1985-01-08 HU HU8561A patent/HU200338B/hu not_active IP Right Cessation
- 1985-01-08 IL IL74018A patent/IL74018A/xx unknown
- 1985-01-08 FI FI850079A patent/FI83867C/fi not_active IP Right Cessation
- 1985-01-08 DK DK8985A patent/DK8985A/da not_active Application Discontinuation
- 1985-01-09 GR GR850060A patent/GR850060B/el unknown
- 1985-01-09 BG BG068329A patent/BG40965A3/xx unknown
-
1987
- 1987-08-13 KR KR1019870008895A patent/KR900001545B1/ko not_active Expired
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NZ210776A (en) | 4-((bicycloheterocyclyl)-methyl and -hetero)-piperidine derivatives and pharmaceutical compositions | |
| US4695575A (en) | 4-[(bicycle heterocyclyl)-methyl and -hetero]-piperidines | |
| EP0099139B1 (en) | Novel n-(bicyclic heterocyclyl)-4-piperidinamines | |
| EP0151824B1 (en) | N-(4-piperidinyl) bicyclic condensed 2-imidazolamine derivatives | |
| US5041448A (en) | (4-piperidinylmethyl and -hetero) purines | |
| US5258380A (en) | (4-piperidinylmethyl and -hetero)purines | |
| EP0145037B1 (en) | N-(bicyclic heterocyclyl)-4-piperidinamines | |
| CA1257258A (en) | Bicyclic heterocyclyl containing n-(bicyclic heterocyclyl)-4-piperidinamines | |
| US4988689A (en) | ((Pharmacologically active bicyclic heterocyclic)methyl and -heteroatom) substituted hexahydro-1H-azepines and pyrrolidines | |
| US4835161A (en) | Anti-histaminic compositions containing n-heterocyclyl-4-piperidinamines | |
| US4695569A (en) | Bicyclic heterocyclyl containing N-(bicyclic heterocyclyl)-4-piperidinamines | |
| US4839374A (en) | 4-((Bicyclic heterocyclyl)-methyl and -hetero)-piperidines | |
| US5151424A (en) | Pharmacologically active (Bicyclic heterocyclyl)methyl and -hetero) substituted hexahydro-1H-azepines and pyrrolidines | |
| US4943580A (en) | Anti-histaminic benzimidazole, imidazopyridine and purine derivatives | |
| US5126339A (en) | Anti-allergic bicyclic heterocyclyl-containing N-(bicyclic heterocyclyl)-4-piperidinamines | |
| US4760074A (en) | Novel-N-(bicyclic heterocyclyl)-4-piperidinamines | |
| USRE33833E (en) | Novel N-(bicyclic heterocyclyl)-4-piperidinamines | |
| US4820822A (en) | Novel N-(bicyclic heterocyclyl)-4-piperidinamines | |
| US4888426A (en) | 1-(5-methyl-furan-2-ylmethyl)-N-(4-piperidinyl)imidazo [4,5-6]pyridine-2-amine | |
| US5025014A (en) | Bicyclic heterocyclyl containing N-(bicyclic heterocyclyl)-4-piperidinamines as pharmaceuticals | |
| US5071846A (en) | Anti-hystaminic [(bicyclic heterocyclyl) methyl and --hetero] substituted hexahydro-1H-azepines and pyrrolidines | |
| CZ16485A3 (cs) | Způsob přípravy 4-/(bicyklyl heterocyklyl) methyl a hetero/-piperidinů | |
| KR880000247B1 (ko) | 4-[(두고리 헤테로시클릴)-메틸 및-헤테로] 피페리딘 유도체의 제조방법 | |
| PH26643A (en) | Bicyclic heterocyclic containing N-(bicyclic hetero-cyclyl)-4-piperidinamines | |
| IE57722B1 (en) | N-(bicyclic heterocyclyl)-4-piperidinamines |