NO862477L - Analogifremgangsmaate for fremstilling av terapeutisk aktive 2-arylimidazol-derivater. - Google Patents
Analogifremgangsmaate for fremstilling av terapeutisk aktive 2-arylimidazol-derivater.Info
- Publication number
- NO862477L NO862477L NO862477A NO862477A NO862477L NO 862477 L NO862477 L NO 862477L NO 862477 A NO862477 A NO 862477A NO 862477 A NO862477 A NO 862477A NO 862477 L NO862477 L NO 862477L
- Authority
- NO
- Norway
- Prior art keywords
- group
- methoxy
- phenyl
- benzimidazole
- ethoxy
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 18
- 238000000034 method Methods 0.000 title claims description 10
- 230000001225 therapeutic effect Effects 0.000 title 1
- -1 benzoyl- Chemical group 0.000 claims description 140
- 150000001875 compounds Chemical class 0.000 claims description 58
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 45
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 43
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 31
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 28
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 claims description 28
- 239000002253 acid Substances 0.000 claims description 22
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 19
- 150000003839 salts Chemical class 0.000 claims description 17
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- 125000001589 carboacyl group Chemical group 0.000 claims description 16
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 16
- 125000003277 amino group Chemical group 0.000 claims description 13
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 13
- 229910052757 nitrogen Inorganic materials 0.000 claims description 13
- 125000004647 alkyl sulfenyl group Chemical group 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 9
- 239000011541 reaction mixture Substances 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- KTBKDODCGZHQFD-UHFFFAOYSA-N 1-[2-(2-methoxy-4-methylsulfonylphenyl)-3h-benzimidazol-5-yl]ethanone Chemical compound COC1=CC(S(C)(=O)=O)=CC=C1C1=NC2=CC=C(C(C)=O)C=C2N1 KTBKDODCGZHQFD-UHFFFAOYSA-N 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims description 6
- NUFRHEGIXIIJHO-UHFFFAOYSA-N n-[4-(6-cyano-1h-benzimidazol-2-yl)-3-methoxyphenyl]methanesulfonamide Chemical compound COC1=CC(NS(C)(=O)=O)=CC=C1C1=NC2=CC=C(C#N)C=C2N1 NUFRHEGIXIIJHO-UHFFFAOYSA-N 0.000 claims description 5
- 125000004423 acyloxy group Chemical group 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 claims description 4
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 claims description 4
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 4
- 150000008064 anhydrides Chemical class 0.000 claims description 4
- 238000006264 debenzylation reaction Methods 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000002071 phenylalkoxy group Chemical group 0.000 claims description 4
- 150000003462 sulfoxides Chemical class 0.000 claims description 4
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 230000007062 hydrolysis Effects 0.000 claims description 3
- 238000006460 hydrolysis reaction Methods 0.000 claims description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 238000006798 ring closing metathesis reaction Methods 0.000 claims description 3
- AJPCBKGVRQPTTJ-UHFFFAOYSA-N 2-(2-methoxy-4-methylsulfanylphenyl)-1h-imidazo[4,5-b]pyridine-6-carbonitrile Chemical compound COC1=CC(SC)=CC=C1C1=NC2=NC=C(C#N)C=C2N1 AJPCBKGVRQPTTJ-UHFFFAOYSA-N 0.000 claims description 2
- HTGDHZCTDYDXSP-UHFFFAOYSA-N 8-(2-methoxy-4-methylsulfinylphenyl)-7h-purin-2-amine Chemical compound COC1=CC(S(C)=O)=CC=C1C1=NC2=NC(N)=NC=C2N1 HTGDHZCTDYDXSP-UHFFFAOYSA-N 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000005530 alkylenedioxy group Chemical group 0.000 claims description 2
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 2
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 claims description 2
- 150000002440 hydroxy compounds Chemical class 0.000 claims description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 2
- LHFPAFLSIKBZTL-UHFFFAOYSA-N methyl n-[4-(3h-imidazo[4,5-c]pyridin-2-yl)-3-methoxyphenyl]carbamate Chemical compound COC1=CC(NC(=O)OC)=CC=C1C1=NC2=CC=NC=C2N1 LHFPAFLSIKBZTL-UHFFFAOYSA-N 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- YPOUEFHWVLMHLQ-UHFFFAOYSA-N [4-(6-acetyl-1h-benzimidazol-2-yl)-3-methoxyphenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=CC=C(C(C)=O)C=C2N1 YPOUEFHWVLMHLQ-UHFFFAOYSA-N 0.000 claims 1
- XGKUIGRGDCUUBI-UHFFFAOYSA-N [4-(6-carbamoyl-1h-benzimidazol-2-yl)-3-methoxyphenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=CC=C(C(N)=O)C=C2N1 XGKUIGRGDCUUBI-UHFFFAOYSA-N 0.000 claims 1
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims 1
- 125000002349 hydroxyamino group Chemical group [H]ON([H])[*] 0.000 claims 1
- 231100000241 scar Toxicity 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 54
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 51
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 48
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 33
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 30
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 24
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 21
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 20
- 229960000583 acetic acid Drugs 0.000 description 16
- 239000002904 solvent Substances 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- 239000012362 glacial acetic acid Substances 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 14
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 238000009835 boiling Methods 0.000 description 12
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 12
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 11
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 10
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 8
- 235000011121 sodium hydroxide Nutrition 0.000 description 8
- 239000011877 solvent mixture Substances 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- 238000003756 stirring Methods 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 230000002265 prevention Effects 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 5
- 238000004440 column chromatography Methods 0.000 description 5
- 239000003480 eluent Substances 0.000 description 5
- 230000003647 oxidation Effects 0.000 description 5
- 238000007254 oxidation reaction Methods 0.000 description 5
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 5
- UOPCPHJGGRTYNC-UHFFFAOYSA-N 2-methoxy-4-methylsulfanylbenzoic acid Chemical compound COC1=CC(SC)=CC=C1C(O)=O UOPCPHJGGRTYNC-UHFFFAOYSA-N 0.000 description 4
- AKHVPZOYHZAQQC-UHFFFAOYSA-N 4-(methanesulfonamido)-2-methoxybenzoic acid Chemical compound COC1=CC(NS(C)(=O)=O)=CC=C1C(O)=O AKHVPZOYHZAQQC-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 102000008186 Collagen Human genes 0.000 description 4
- 108010035532 Collagen Proteins 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 229920001436 collagen Polymers 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 229920000137 polyphosphoric acid Polymers 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- VWLLPPSBBHDXHK-UHFFFAOYSA-N 3,4-diaminobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1N VWLLPPSBBHDXHK-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 241000282326 Felis catus Species 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- KOJABUOCKKZVJN-UHFFFAOYSA-N [4-(4-cyano-1h-benzimidazol-2-yl)-3-methoxyphenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=C(C#N)C=CC=C2N1 KOJABUOCKKZVJN-UHFFFAOYSA-N 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 238000004220 aggregation Methods 0.000 description 3
- 230000002776 aggregation Effects 0.000 description 3
- 230000002785 anti-thrombosis Effects 0.000 description 3
- 230000036772 blood pressure Effects 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 230000009090 positive inotropic effect Effects 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- 229940086542 triethylamine Drugs 0.000 description 3
- GVPJBLBMZNYROA-UHFFFAOYSA-N 1-[2-(2-methoxy-4-methylsulfanylphenyl)-3h-benzimidazol-5-yl]ethanone Chemical compound COC1=CC(SC)=CC=C1C1=NC2=CC=C(C(C)=O)C=C2N1 GVPJBLBMZNYROA-UHFFFAOYSA-N 0.000 description 2
- GIABQLHUSBJSOV-UHFFFAOYSA-N 2-(2-methoxy-4-methylsulfanylphenyl)-3h-benzimidazole-5-sulfonamide Chemical compound COC1=CC(SC)=CC=C1C1=NC2=CC=C(S(N)(=O)=O)C=C2N1 GIABQLHUSBJSOV-UHFFFAOYSA-N 0.000 description 2
- GOANANGSEDWJLZ-UHFFFAOYSA-N 2-(4-ethylsulfanyl-2-methoxyphenyl)-3h-benzimidazole-5-carbonitrile Chemical compound COC1=CC(SCC)=CC=C1C1=NC2=CC=C(C#N)C=C2N1 GOANANGSEDWJLZ-UHFFFAOYSA-N 0.000 description 2
- XLASRXYDAOGJDW-UHFFFAOYSA-N 2-(4-ethylsulfinyl-2-methoxyphenyl)-3h-benzimidazole-5-carbonitrile Chemical compound COC1=CC(S(=O)CC)=CC=C1C1=NC2=CC=C(C#N)C=C2N1 XLASRXYDAOGJDW-UHFFFAOYSA-N 0.000 description 2
- OWVNGNZQLDTUNT-UHFFFAOYSA-N 2-(4-methylsulfanylphenyl)-3h-benzimidazole-5-carbonitrile Chemical compound C1=CC(SC)=CC=C1C1=NC2=CC=C(C#N)C=C2N1 OWVNGNZQLDTUNT-UHFFFAOYSA-N 0.000 description 2
- BAKXWRVHDUKCDB-UHFFFAOYSA-N 2-(4-methylsulfanylphenyl)-6-(trifluoromethyl)-1h-benzimidazole Chemical compound C1=CC(SC)=CC=C1C1=NC2=CC=C(C(F)(F)F)C=C2N1 BAKXWRVHDUKCDB-UHFFFAOYSA-N 0.000 description 2
- PJWITFCRCLTJMJ-UHFFFAOYSA-N 2-(4-methylsulfinylphenyl)-3h-benzimidazole-5-carbonitrile Chemical compound C1=CC(S(=O)C)=CC=C1C1=NC2=CC=C(C#N)C=C2N1 PJWITFCRCLTJMJ-UHFFFAOYSA-N 0.000 description 2
- XVIMQVNKQCRYSV-UHFFFAOYSA-N 2-(4-methylsulfinylphenyl)-6-(trifluoromethyl)-1h-benzimidazole Chemical compound C1=CC(S(=O)C)=CC=C1C1=NC2=CC=C(C(F)(F)F)C=C2N1 XVIMQVNKQCRYSV-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- KWHCPERWLHBLOT-UHFFFAOYSA-N 4-methylsulfanylbenzoic acid Chemical compound CSC1=CC=C(C(O)=O)C=C1 KWHCPERWLHBLOT-UHFFFAOYSA-N 0.000 description 2
- 206010003210 Arteriosclerosis Diseases 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 206010019280 Heart failures Diseases 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 206010027476 Metastases Diseases 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- KDCGOANMDULRCW-UHFFFAOYSA-N Purine Natural products N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- CHKQALUEEULCPZ-UHFFFAOYSA-N amino 2,4,6-trimethylbenzenesulfonate Chemical compound CC1=CC(C)=C(S(=O)(=O)ON)C(C)=C1 CHKQALUEEULCPZ-UHFFFAOYSA-N 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 208000011775 arteriosclerosis disease Diseases 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical compound CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 2
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 230000009401 metastasis Effects 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- KOJOPBLYMUNWAP-UHFFFAOYSA-N methyl 2-(2-methoxy-4-methylsulfanylphenyl)-3h-benzimidazole-5-carboxylate Chemical compound N1C2=CC(C(=O)OC)=CC=C2N=C1C1=CC=C(SC)C=C1OC KOJOPBLYMUNWAP-UHFFFAOYSA-N 0.000 description 2
- FZTIABKCFMFFKZ-UHFFFAOYSA-N methyl 2-(2-methoxy-4-methylsulfinylphenyl)-3h-benzimidazole-5-carboxylate Chemical compound N1C2=CC(C(=O)OC)=CC=C2N=C1C1=CC=C(S(C)=O)C=C1OC FZTIABKCFMFFKZ-UHFFFAOYSA-N 0.000 description 2
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 150000007530 organic bases Chemical group 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 150000004965 peroxy acids Chemical class 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 229960000278 theophylline Drugs 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- RXCOGDYOZQGGMK-UHFFFAOYSA-N (3,4-diaminophenyl)-phenylmethanone Chemical compound C1=C(N)C(N)=CC=C1C(=O)C1=CC=CC=C1 RXCOGDYOZQGGMK-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- OHVLMTFVQDZYHP-UHFFFAOYSA-N 1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-2-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound N1N=NC=2CN(CCC=21)C(CN1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)=O OHVLMTFVQDZYHP-UHFFFAOYSA-N 0.000 description 1
- LRWFULDYZITNCK-UHFFFAOYSA-N 1-[2-(2-methoxy-4-methylsulfinylphenyl)-3h-benzimidazol-5-yl]ethanone Chemical compound COC1=CC(S(C)=O)=CC=C1C1=NC2=CC=C(C(C)=O)C=C2N1 LRWFULDYZITNCK-UHFFFAOYSA-N 0.000 description 1
- MBHAIZLUBOKCLH-UHFFFAOYSA-N 1-[3-methoxy-4-(7h-purin-8-yl)phenyl]-3-methylurea Chemical compound COC1=CC(NC(=O)NC)=CC=C1C1=NC2=NC=NC=C2N1 MBHAIZLUBOKCLH-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- LXFQSRIDYRFTJW-UHFFFAOYSA-M 2,4,6-trimethylbenzenesulfonate Chemical compound CC1=CC(C)=C(S([O-])(=O)=O)C(C)=C1 LXFQSRIDYRFTJW-UHFFFAOYSA-M 0.000 description 1
- FBAOVPVVMDOHPK-UHFFFAOYSA-N 2-(1h-imidazol-2-ylsulfinyl)-1h-imidazole Chemical compound N=1C=CNC=1S(=O)C1=NC=CN1 FBAOVPVVMDOHPK-UHFFFAOYSA-N 0.000 description 1
- JFWBWLHAYKHBFG-UHFFFAOYSA-N 2-(2-methoxy-4-methylsulfanylphenyl)-3h-benzimidazole-5-carbonitrile Chemical compound COC1=CC(SC)=CC=C1C1=NC2=CC=C(C#N)C=C2N1 JFWBWLHAYKHBFG-UHFFFAOYSA-N 0.000 description 1
- SXRRZNOWIVXWML-UHFFFAOYSA-N 2-(2-methoxy-4-methylsulfanylphenyl)-6-(trifluoromethyl)-1h-benzimidazole Chemical compound COC1=CC(SC)=CC=C1C1=NC2=CC=C(C(F)(F)F)C=C2N1 SXRRZNOWIVXWML-UHFFFAOYSA-N 0.000 description 1
- JQUKCPUPFALELS-UHFFFAOYSA-N 2-(2-methoxy-4-methylsulfinylphenyl)-3H-imidazo[4,5-c]pyridine Chemical compound COC1=CC(S(C)=O)=CC=C1C1=NC2=CC=NC=C2N1 JQUKCPUPFALELS-UHFFFAOYSA-N 0.000 description 1
- AZMQEVKOMWNIFQ-UHFFFAOYSA-N 2-(2-methoxy-4-methylsulfinylphenyl)-6-(trifluoromethyl)-1h-benzimidazole Chemical compound COC1=CC(S(C)=O)=CC=C1C1=NC2=CC=C(C(F)(F)F)C=C2N1 AZMQEVKOMWNIFQ-UHFFFAOYSA-N 0.000 description 1
- KTKGSDVHXGOOHT-UHFFFAOYSA-N 2-(2-methoxy-4-methylsulfinylphenyl)-6-methyl-1h-imidazo[4,5-b]pyridine Chemical compound COC1=CC([S+](C)[O-])=CC=C1C1=NC2=CC(C)=CNC2=N1 KTKGSDVHXGOOHT-UHFFFAOYSA-N 0.000 description 1
- QEANPWXFGBWPOV-UHFFFAOYSA-N 2-(2-methoxy-4-phenylmethoxyphenyl)-6-methylsulfonyl-1h-benzimidazole Chemical compound C=1C=C(C=2NC3=CC(=CC=C3N=2)S(C)(=O)=O)C(OC)=CC=1OCC1=CC=CC=C1 QEANPWXFGBWPOV-UHFFFAOYSA-N 0.000 description 1
- XEQBMBUERKKZTI-UHFFFAOYSA-N 2-(2-methoxy-5-methylsulfanylphenyl)-3h-benzimidazole-5-carbonitrile Chemical compound COC1=CC=C(SC)C=C1C1=NC2=CC=C(C#N)C=C2N1 XEQBMBUERKKZTI-UHFFFAOYSA-N 0.000 description 1
- IIRXPCDKFLXSNQ-UHFFFAOYSA-N 2-(2-methoxy-5-methylsulfonylphenyl)-3h-benzimidazole-5-carbonitrile Chemical compound COC1=CC=C(S(C)(=O)=O)C=C1C1=NC2=CC=C(C#N)C=C2N1 IIRXPCDKFLXSNQ-UHFFFAOYSA-N 0.000 description 1
- NKCJPJMULQPLEC-UHFFFAOYSA-N 2-(4-ethylsulfonyl-2-methoxyphenyl)-3h-benzimidazole-5-carbonitrile Chemical compound COC1=CC(S(=O)(=O)CC)=CC=C1C1=NC2=CC=C(C#N)C=C2N1 NKCJPJMULQPLEC-UHFFFAOYSA-N 0.000 description 1
- RCSBFXJLKZLJBM-UHFFFAOYSA-N 2-(4-hydroxy-2-methoxyphenyl)-1H-benzimidazole-4-carbonitrile Chemical compound C(#N)C1=CC=CC=2N=C(NC=21)C1=C(C=C(C=C1)O)OC RCSBFXJLKZLJBM-UHFFFAOYSA-N 0.000 description 1
- MTRFTOKJOQQQTM-UHFFFAOYSA-N 2-(4-methylsulfonylphenyl)-3h-benzimidazole-5-carbonitrile Chemical compound C1=CC(S(=O)(=O)C)=CC=C1C1=NC2=CC=C(C#N)C=C2N1 MTRFTOKJOQQQTM-UHFFFAOYSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- IHCCLXNEEPMSIO-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 IHCCLXNEEPMSIO-UHFFFAOYSA-N 0.000 description 1
- PKNOXLRZOZVZIP-UHFFFAOYSA-N 2-[4-methoxy-2-(2-methylsulfinylethoxy)phenyl]-1h-imidazo[4,5-b]pyridine Chemical compound CS(=O)CCOC1=CC(OC)=CC=C1C1=NC2=NC=CC=C2N1 PKNOXLRZOZVZIP-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- GSLTVFIVJMCNBH-UHFFFAOYSA-N 2-isocyanatopropane Chemical compound CC(C)N=C=O GSLTVFIVJMCNBH-UHFFFAOYSA-N 0.000 description 1
- HPXYPQUUKOWRKM-UHFFFAOYSA-N 2-methoxy-4-methylsulfanylbenzoyl chloride Chemical compound COC1=CC(SC)=CC=C1C(Cl)=O HPXYPQUUKOWRKM-UHFFFAOYSA-N 0.000 description 1
- FKCXCIBNMDDPAU-UHFFFAOYSA-N 2-methoxy-4-phenylmethoxybenzoyl chloride Chemical compound C1=C(C(Cl)=O)C(OC)=CC(OCC=2C=CC=CC=2)=C1 FKCXCIBNMDDPAU-UHFFFAOYSA-N 0.000 description 1
- VIHVLDUNSNGDLU-UHFFFAOYSA-N 2-methoxy-5-methylsulfanylbenzoyl chloride Chemical compound COC1=CC=C(SC)C=C1C(Cl)=O VIHVLDUNSNGDLU-UHFFFAOYSA-N 0.000 description 1
- QULXUUQWVHVHSM-UHFFFAOYSA-N 3,4-diaminobenzenesulfonamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1N QULXUUQWVHVHSM-UHFFFAOYSA-N 0.000 description 1
- MOFUABWYCPKVPJ-UHFFFAOYSA-N 3-(2-methylsulfanylethoxy)naphthalene-2-carboxylic acid Chemical compound CSCCOC1=CC2=CC=CC=C2C=C1C(=O)O MOFUABWYCPKVPJ-UHFFFAOYSA-N 0.000 description 1
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical compound NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 1
- VKQPDHKSUIHUDF-UHFFFAOYSA-N 3-amino-4-nitrobenzonitrile Chemical compound NC1=CC(C#N)=CC=C1[N+]([O-])=O VKQPDHKSUIHUDF-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- MCBMSIOXJWVPIL-UHFFFAOYSA-N 3-methoxy-4-(4-methyl-1H-benzimidazol-2-yl)phenol Chemical compound CC1=CC=CC=2N=C(NC21)C2=C(C=C(C=C2)O)OC MCBMSIOXJWVPIL-UHFFFAOYSA-N 0.000 description 1
- QSAZSRZTSLBQBO-UHFFFAOYSA-N 3-methoxy-4-(6-methylsulfonyl-1H-benzimidazol-2-yl)phenol Chemical compound COC1=C(C=CC(=C1)O)C=1NC2=C(N1)C=CC(=C2)S(=O)(=O)C QSAZSRZTSLBQBO-UHFFFAOYSA-N 0.000 description 1
- ZCLHLRUTLYSBLV-UHFFFAOYSA-N 3-methoxy-4-(7h-purin-8-yl)aniline Chemical compound COC1=CC(N)=CC=C1C1=NC2=NC=NC=C2N1 ZCLHLRUTLYSBLV-UHFFFAOYSA-N 0.000 description 1
- RQWJHUJJBYMJMN-UHFFFAOYSA-N 4-(trifluoromethyl)benzene-1,2-diamine Chemical compound NC1=CC=C(C(F)(F)F)C=C1N RQWJHUJJBYMJMN-UHFFFAOYSA-N 0.000 description 1
- OLJXRTRRJSMURJ-UHFFFAOYSA-N 4-amino-2-methoxybenzoic acid Chemical compound COC1=CC(N)=CC=C1C(O)=O OLJXRTRRJSMURJ-UHFFFAOYSA-N 0.000 description 1
- LWFOZCFJVOGQAM-UHFFFAOYSA-N 4-methylsulfanyl-2-nitroaniline Chemical compound CSC1=CC=C(N)C([N+]([O-])=O)=C1 LWFOZCFJVOGQAM-UHFFFAOYSA-N 0.000 description 1
- RPLDUWFXTVFCGT-UHFFFAOYSA-N 6-chloro-2-(2-methoxy-4-methylsulfinylphenyl)-1h-imidazo[4,5-b]pyridine Chemical compound COC1=CC([S+](C)[O-])=CC=C1C1=NC2=CC(Cl)=CNC2=N1 RPLDUWFXTVFCGT-UHFFFAOYSA-N 0.000 description 1
- ICTKVTZRYXZBBC-UHFFFAOYSA-N 8-(2-methoxy-4-methylsulfanylphenyl)-7h-purin-2-amine Chemical compound COC1=CC(SC)=CC=C1C1=NC2=NC(N)=NC=C2N1 ICTKVTZRYXZBBC-UHFFFAOYSA-N 0.000 description 1
- VCYCFRKSFAXXOL-UHFFFAOYSA-N 8-(2-methoxy-4-methylsulfinylphenyl)-7h-purine Chemical compound COC1=CC(S(C)=O)=CC=C1C1=NC2=NC=NC=C2N1 VCYCFRKSFAXXOL-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- UMPGEGNSLNPTRN-UHFFFAOYSA-N CCONC(=O)C=S(=O)=O Chemical compound CCONC(=O)C=S(=O)=O UMPGEGNSLNPTRN-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 206010061216 Infarction Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- QCURBWROSGGDAC-UHFFFAOYSA-N N-[4-(9H-benzo[f]benzimidazol-2-yl)-3-methoxyphenyl]methanesulfonamide hydrate Chemical compound O.COC1=C(C=CC(=C1)NS(=O)(=O)C)C=1N=C2C(=CC3=CC=CC=C3C2)N1 QCURBWROSGGDAC-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- QGMRQYFBGABWDR-UHFFFAOYSA-M Pentobarbital sodium Chemical compound [Na+].CCCC(C)C1(CC)C(=O)NC(=O)[N-]C1=O QGMRQYFBGABWDR-UHFFFAOYSA-M 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 208000032109 Transient ischaemic attack Diseases 0.000 description 1
- LZJWKQNHGBINRO-UHFFFAOYSA-N [3-methoxy-4-[6-(propan-2-ylcarbamoylamino)-1h-benzimidazol-2-yl]phenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=CC=C(NC(=O)NC(C)C)C=C2N1 LZJWKQNHGBINRO-UHFFFAOYSA-N 0.000 description 1
- HOJJTPJNWYETBA-UHFFFAOYSA-N [4-(4-carbamoyl-1h-benzimidazol-2-yl)-3-methoxyphenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=C(C(N)=O)C=CC=C2N1 HOJJTPJNWYETBA-UHFFFAOYSA-N 0.000 description 1
- NENMAFIMMLCEEQ-UHFFFAOYSA-N [4-(6-amino-1h-benzimidazol-2-yl)-3-methoxyphenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=CC=C(N)C=C2N1 NENMAFIMMLCEEQ-UHFFFAOYSA-N 0.000 description 1
- BICBQCSVKUOJIL-UHFFFAOYSA-N [4-(9H-benzo[f]benzimidazol-2-yl)-3-methoxyphenyl] methanesulfonate Chemical compound CS(=O)(=O)OC1=CC(=C(C=C1)C=1N=C2C(=CC3=CC=CC=C3C2)N1)OC BICBQCSVKUOJIL-UHFFFAOYSA-N 0.000 description 1
- KIBPLMLXLIQEPL-UHFFFAOYSA-N [4-[6-(acetamidomethyl)-1h-benzimidazol-2-yl]-3-methoxyphenyl] methanesulfonate Chemical compound COC1=CC(OS(C)(=O)=O)=CC=C1C1=NC2=CC=C(CNC(C)=O)C=C2N1 KIBPLMLXLIQEPL-UHFFFAOYSA-N 0.000 description 1
- KWCVIECGWDKCOY-UHFFFAOYSA-N [4-[6-(ethylcarbamoylamino)-1h-benzimidazol-2-yl]-3-methoxyphenyl] methanesulfonate Chemical compound N1C2=CC(NC(=O)NCC)=CC=C2N=C1C1=CC=C(OS(C)(=O)=O)C=C1OC KWCVIECGWDKCOY-UHFFFAOYSA-N 0.000 description 1
- GHVZOJONCUEWAV-UHFFFAOYSA-N [K].CCO Chemical compound [K].CCO GHVZOJONCUEWAV-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000005332 alkyl sulfoxy group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 208000007957 amaurosis fugax Diseases 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- OYTKINVCDFNREN-UHFFFAOYSA-N amifampridine Chemical compound NC1=CC=NC=C1N OYTKINVCDFNREN-UHFFFAOYSA-N 0.000 description 1
- 229960004012 amifampridine Drugs 0.000 description 1
- 210000000709 aorta Anatomy 0.000 description 1
- 230000004872 arterial blood pressure Effects 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229940076134 benzene Drugs 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 230000004531 blood pressure lowering effect Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 210000005242 cardiac chamber Anatomy 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 206010008118 cerebral infarction Diseases 0.000 description 1
- 208000026106 cerebrovascular disease Diseases 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000003073 embolic effect Effects 0.000 description 1
- 229960004756 ethanol Drugs 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 210000003191 femoral vein Anatomy 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 229940116364 hard fat Drugs 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000007574 infarction Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229960004592 isopropanol Drugs 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229940057948 magnesium stearate Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 1
- UFXOKLHIOIYFDE-UHFFFAOYSA-N methyl 2-(4-hydroxy-2-methoxyphenyl)-1H-benzimidazole-4-carboxylate Chemical compound COC(=O)C1=CC=CC=2N=C(NC=21)C1=C(C=C(C=C1)O)OC UFXOKLHIOIYFDE-UHFFFAOYSA-N 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 210000004165 myocardium Anatomy 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- FYHMFHYIEVJDOG-UHFFFAOYSA-N n-[4-(6-benzoyl-1h-benzimidazol-2-yl)-3-methoxyphenyl]methanesulfonamide Chemical compound COC1=CC(NS(C)(=O)=O)=CC=C1C1=NC2=CC=C(C(=O)C=3C=CC=CC=3)C=C2N1 FYHMFHYIEVJDOG-UHFFFAOYSA-N 0.000 description 1
- XTBLDMQMUSHDEN-UHFFFAOYSA-N naphthalene-2,3-diamine Chemical compound C1=CC=C2C=C(N)C(N)=CC2=C1 XTBLDMQMUSHDEN-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 231100000500 noncardiotoxic Toxicity 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 1
- 101150032584 oxy-4 gene Proteins 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 229960002275 pentobarbital sodium Drugs 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 210000002381 plasma Anatomy 0.000 description 1
- 210000004623 platelet-rich plasma Anatomy 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- BTGIZHQAAYLQJR-UHFFFAOYSA-N pyridin-1-ium;2,4,6-trimethylbenzenesulfonate Chemical compound C1=CC=[NH+]C=C1.CC1=CC(C)=C(S([O-])(=O)=O)C(C)=C1 BTGIZHQAAYLQJR-UHFFFAOYSA-N 0.000 description 1
- CSNFMBGHUOSBFU-UHFFFAOYSA-N pyrimidine-2,4,5-triamine Chemical compound NC1=NC=C(N)C(N)=N1 CSNFMBGHUOSBFU-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- 229960004793 sucrose Drugs 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- XMFCOYRWYYXZMY-UHFFFAOYSA-N sulmazole Chemical compound COC1=CC(S(C)=O)=CC=C1C1=NC2=NC=CC=C2N1 XMFCOYRWYYXZMY-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 210000002435 tendon Anatomy 0.000 description 1
- IXZDIALLLMRYOU-UHFFFAOYSA-N tert-butyl hypochlorite Chemical compound CC(C)(C)OCl IXZDIALLLMRYOU-UHFFFAOYSA-N 0.000 description 1
- OULAJFUGPPVRBK-UHFFFAOYSA-N tetratriacontan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCO OULAJFUGPPVRBK-UHFFFAOYSA-N 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 230000009424 thromboembolic effect Effects 0.000 description 1
- 201000010875 transient cerebral ischemia Diseases 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/04—Inotropic agents, i.e. stimulants of cardiac contraction; Drugs for heart failure
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/18—Benzimidazoles; Hydrogenated benzimidazoles with aryl radicals directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/02—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6
- C07D473/04—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms
- C07D473/06—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms with radicals containing only hydrogen and carbon atoms, attached in position 1 or 3
- C07D473/08—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms with radicals containing only hydrogen and carbon atoms, attached in position 1 or 3 with methyl radicals in positions 1 and 3, e.g. theophylline
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/26—Heterocyclic compounds containing purine ring systems with an oxygen, sulphur, or nitrogen atom directly attached in position 2 or 6, but not in both
- C07D473/32—Nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Cardiology (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Heart & Thoracic Surgery (AREA)
- Hematology (AREA)
- Vascular Medicine (AREA)
- Urology & Nephrology (AREA)
- Diabetes (AREA)
- Hospice & Palliative Care (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19853522230 DE3522230A1 (de) | 1985-06-21 | 1985-06-21 | Neue 2-arylimidazole, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO862477D0 NO862477D0 (no) | 1986-06-20 |
| NO862477L true NO862477L (no) | 1986-12-22 |
Family
ID=6273829
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO862477A NO862477L (no) | 1985-06-21 | 1986-06-20 | Analogifremgangsmaate for fremstilling av terapeutisk aktive 2-arylimidazol-derivater. |
Country Status (12)
| Country | Link |
|---|---|
| EP (1) | EP0209707A3 (fi) |
| JP (1) | JPS62471A (fi) |
| AU (1) | AU5893286A (fi) |
| DE (1) | DE3522230A1 (fi) |
| DK (1) | DK290986A (fi) |
| ES (3) | ES8800907A1 (fi) |
| FI (1) | FI862623A (fi) |
| GR (1) | GR861583B (fi) |
| HU (1) | HUT42452A (fi) |
| NO (1) | NO862477L (fi) |
| PT (1) | PT82789B (fi) |
| ZA (1) | ZA864602B (fi) |
Families Citing this family (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| LU85544A1 (fr) * | 1984-09-19 | 1986-04-03 | Cird | Derives heterocycliques aromatiques,leur procede de preparation et leur application dans les domaines therapeutique et cosmetique |
| GB8510758D0 (en) * | 1985-04-27 | 1985-06-05 | Wellcome Found | Compounds |
| DE3634066A1 (de) * | 1986-10-07 | 1988-04-21 | Boehringer Mannheim Gmbh | Neue 5-alkylbenzimidazole, verfahren zu ihrer herstellung sowie arzneimittel |
| EP0322149A2 (en) * | 1987-12-22 | 1989-06-28 | Eli Lilly And Company | Hydrates of an inotropic agent |
| GB8804016D0 (en) * | 1988-02-22 | 1988-03-23 | Boots Co Plc | Therapeutic agents |
| IL94390A (en) * | 1989-05-30 | 1996-03-31 | Merck & Co Inc | The 6-membered trans-nitrogen-containing heterocycles are compressed with imidazo and pharmaceutical preparations containing them |
| US5064825A (en) * | 1989-06-01 | 1991-11-12 | Merck & Co., Inc. | Angiotensin ii antagonists |
| JPH06759B2 (ja) * | 1989-09-22 | 1994-01-05 | ファイザー製薬株式会社 | 新規なベンゾイミダゾール化合物 |
| US5208240A (en) * | 1991-03-12 | 1993-05-04 | Merrell Dow Pharmaceuticals Inc. | 8-substituted purines as selective adenosine receptor agents |
| US5506361A (en) * | 1991-05-08 | 1996-04-09 | Theupjohn Company | Imidazobenzoquinones and composition for preventing or treating hypertension or congestive heart failure containing the same |
| JPH05112533A (ja) * | 1991-05-08 | 1993-05-07 | Upjohn Co:The | イミダゾベンゾキノン類およびこれを有効成分とする高血圧・鬱血性心不全の予防・治療剤 |
| US5821258A (en) * | 1994-12-27 | 1998-10-13 | Mitsui Chemicals, Inc. | Phenylbenzimidazole derivatives |
| DK0841924T3 (da) | 1995-08-02 | 2003-02-10 | Univ Newcastle Ventures Ltd | Benzimidazolforbindelser |
| BR9915013A (pt) | 1998-11-03 | 2001-08-07 | Basf Ag | Composto, uso dos mesmos, processo para preparar os mesmos, droga, e, método para detecção in vitro para inibidores parp |
| BR9915381A (pt) * | 1998-11-17 | 2001-08-14 | Basf Ag | Uso de um composto, e, composto |
| DE19918211A1 (de) | 1999-04-22 | 2000-10-26 | Basf Ag | Cycloalkylsubstituierte Benzimidazole, deren Herstellung und Anwendung |
| US6448281B1 (en) | 2000-07-06 | 2002-09-10 | Boehringer Ingelheim (Canada) Ltd. | Viral polymerase inhibitors |
| EP2335700A1 (en) | 2001-07-25 | 2011-06-22 | Boehringer Ingelheim (Canada) Ltd. | Hepatitis C virus polymerase inhibitors with a heterobicylic structure |
| EP1435947B1 (en) | 2001-10-19 | 2007-08-15 | Ortho-McNeil Pharmaceutical, Inc. | 2-phenyl benzimidazoles and imidazo-¬4,5|-pyridines as cds1/chk2-inhibitors and adjuvants to chemotherapy or radiation therapy in the treatment of cancer |
| IL163951A0 (en) * | 2002-04-05 | 2005-12-18 | Cadila Healthcare Ltd | New heterocyclic compounds process for their preparation and pharmaceutical compositions containing them and their use in medicine |
| AU2002368133A1 (en) * | 2002-07-29 | 2004-02-16 | Shizuoka Coffein Co., Ltd. | 1,3-azole derivative and medicinal composition containing the derivative for treatment for thombosis |
| US7098231B2 (en) | 2003-01-22 | 2006-08-29 | Boehringer Ingelheim International Gmbh | Viral polymerase inhibitors |
| US7223785B2 (en) | 2003-01-22 | 2007-05-29 | Boehringer Ingelheim International Gmbh | Viral polymerase inhibitors |
| CA2522562C (en) | 2003-04-17 | 2013-09-03 | Janssen Pharmaceutica N.V. | 2-phenyl-benzimidazol and 2-phenyl-imidazo-`4,5!-pyridine derivatives as checkpoint kinase cds1 (chk2) inhibitors for the treatment of cancer |
| TWI368507B (en) | 2004-02-20 | 2012-07-21 | Boehringer Ingelheim Int | Viral polymerase inhibitors |
| EP1824832B1 (en) | 2004-06-30 | 2011-04-27 | Janssen Pharmaceutica NV | Aryl-substituted benzimidazole and imidazopyridine ethers as anti-cancer agents |
| US7728026B2 (en) | 2005-04-11 | 2010-06-01 | Abbott Laboratories, Inc. | 2-substituted-1 h-benzimidazile-4-carboxamides are PARP inhibitors |
| TWI375673B (en) | 2005-04-11 | 2012-11-01 | Abbott Lab | 1h-benzimidazole-4-carboxamides substituted with a quaternary carbon at the 2-position are potent parp inhibitors |
| US8076365B2 (en) | 2005-08-12 | 2011-12-13 | Boehringer Ingelheim International Gmbh | Viral polymerase inhibitors |
| TW200736229A (en) | 2005-11-15 | 2007-10-01 | Abbott Lab | Substituted 1H-benzimidazole-4-carboxamides are potent PARP inhibitors |
| ATE553104T1 (de) | 2006-05-02 | 2012-04-15 | Abbott Lab | Substituierte 1h-benzimidazol-4-carboxamide als potente parp-hemmer |
| US8067613B2 (en) | 2007-07-16 | 2011-11-29 | Abbott Laboratories | Benzimidazole poly(ADP ribose)polymerase inhibitors |
| WO2010083199A1 (en) | 2009-01-19 | 2010-07-22 | Abbott Laboratories | Benzthiazole inhibitors of poly(adp-ribose)polymerase |
| BR122019003178B1 (pt) * | 2010-12-24 | 2020-04-28 | Sumitomo Chemical Co | método de controle de pestes |
| JP6418151B2 (ja) * | 2013-02-28 | 2018-11-07 | 住友化学株式会社 | 縮合複素環化合物及びその有害生物防除用途 |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1089853A (en) * | 1965-02-25 | 1967-11-08 | Merck & Co Inc | Substituted benzimidazoles and compositions containing them |
| US3669979A (en) * | 1967-12-14 | 1972-06-13 | Gaf Corp | Novel process for the production of 2-benzothiazolyl-phenol and derivatives thereof employing phosphorus trichloride as a catalyst |
| DE2305339C3 (de) * | 1973-02-03 | 1980-05-08 | Dr. Karl Thomae Gmbh, 7950 Biberach | Imidazo [4,5-b] pyridine, ihre Herstellung und ihre Verwendung als Cardiötonica |
| DE2927987A1 (de) * | 1979-07-11 | 1981-02-05 | Thomae Gmbh Dr K | Neue 2-alkoxyphenyl-imidazo eckige klammer auf 4,5-b eckige klammer zu pyridine, deren herstellung und deren verwendung als arzneimittel |
| DE2927988A1 (de) * | 1979-07-11 | 1981-02-05 | Thomae Gmbh Dr K | Neue 8-phenyl-purine, deren herstellung und deren verwendung als arzneimittel |
| DD147317A1 (de) * | 1979-11-23 | 1981-04-01 | Gerald Igel | Einrichtung zur elektrischen stimulation des herzens |
| DE3037464A1 (de) * | 1980-10-03 | 1982-05-19 | Dr. Karl Thomae Gmbh, 7950 Biberach | 6-hydroxy-2-phenyl-imidazo 4,5-b zu pyridine, ihre herstellung und diese sie enthaltende arzneimittel |
| DE3044497A1 (de) * | 1980-11-26 | 1982-06-24 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neues verfahren zur herstellung von imidazo(4,5-b)pyridinen und -pyrimidinen |
| ES8401486A1 (es) * | 1981-11-10 | 1983-12-01 | Wellcome Found | Un procedimiento para la preparacion de nuevos derivados de imidazo (4,5-c)piridina. |
| ZA832938B (en) * | 1982-05-03 | 1984-12-24 | Lilly Co Eli | 2-phenylimidazo(4,5-c)pyridines |
| DE3224512A1 (de) * | 1982-07-01 | 1984-01-05 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue imidazolderivate, ihre herstellung und diese verbindungen enthaltende arzneimittel |
| DE3324115A1 (de) * | 1983-07-05 | 1985-01-17 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue imidazole, ihre herstellung und diese verbindungen enthaltende arzneimittel |
| US4515796A (en) * | 1983-09-08 | 1985-05-07 | Eli Lilly And Company | Certain naphthalenyl imidazo compounds and their pharmaceutical use |
| DE3340076A1 (de) * | 1983-11-05 | 1985-05-15 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue purinderivate, ihre herstellung und diese verbindungen enthaltende arzneimittel |
| DE3346575A1 (de) * | 1983-12-23 | 1985-07-04 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue benzimidazole, ihre herstellung und diese verbindungen enthaltende arzneimittel |
| GR850426B (fi) * | 1984-02-24 | 1985-06-18 | Lilly Co Eli |
-
1985
- 1985-06-21 DE DE19853522230 patent/DE3522230A1/de not_active Withdrawn
-
1986
- 1986-06-11 EP EP86107969A patent/EP0209707A3/de not_active Withdrawn
- 1986-06-18 GR GR861583A patent/GR861583B/el unknown
- 1986-06-19 PT PT82789A patent/PT82789B/pt unknown
- 1986-06-19 FI FI862623A patent/FI862623A/fi not_active IP Right Cessation
- 1986-06-20 DK DK290986A patent/DK290986A/da not_active Application Discontinuation
- 1986-06-20 HU HU862615A patent/HUT42452A/hu unknown
- 1986-06-20 ES ES556338A patent/ES8800907A1/es not_active Expired
- 1986-06-20 AU AU58932/86A patent/AU5893286A/en not_active Abandoned
- 1986-06-20 JP JP61144658A patent/JPS62471A/ja active Pending
- 1986-06-20 NO NO862477A patent/NO862477L/no unknown
- 1986-06-20 ZA ZA864602A patent/ZA864602B/xx unknown
- 1986-12-04 ES ES557241A patent/ES8705864A1/es not_active Expired
- 1986-12-04 ES ES557240A patent/ES8705863A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AU5893286A (en) | 1986-12-24 |
| DE3522230A1 (de) | 1987-01-02 |
| EP0209707A3 (de) | 1989-02-01 |
| ZA864602B (en) | 1988-02-24 |
| PT82789B (de) | 1988-05-17 |
| ES557240A0 (es) | 1987-05-16 |
| HUT42452A (en) | 1987-07-28 |
| NO862477D0 (no) | 1986-06-20 |
| FI862623A0 (fi) | 1986-06-19 |
| JPS62471A (ja) | 1987-01-06 |
| FI862623A (fi) | 1986-12-22 |
| ES557241A0 (es) | 1987-05-16 |
| PT82789A (de) | 1986-07-01 |
| ES8705863A1 (es) | 1987-05-16 |
| DK290986A (da) | 1986-12-22 |
| EP0209707A2 (de) | 1987-01-28 |
| DK290986D0 (da) | 1986-06-20 |
| ES8705864A1 (es) | 1987-05-16 |
| GR861583B (en) | 1986-10-21 |
| ES8800907A1 (es) | 1987-12-01 |
| ES556338A0 (es) | 1987-12-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO862477L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive 2-arylimidazol-derivater. | |
| FI86723C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara 2,3-dihydro-2-oxo-1h-imidazo/4,5-b/kinolinyleterderivat | |
| FI83316C (fi) | Foerfarande foer framstaellning av farmaceutiskt aktiva 1,3-dihydro-2h-imidazo/4,5-b/kinolin-2-onderivat. | |
| AU2008310874B2 (en) | Heterocyclic compounds as CRTH2 receptor antagonists | |
| US4954498A (en) | Tricyclic benzimidazole compounds, pharmaceutical compositions and methods of use | |
| NO832356L (no) | Fremgangsmaate for fremstilling av farmakologisk aktive imidazolderivater. | |
| CZ280696B6 (cs) | Substituované šestičlenné heterocyklické sloučeniny s připojenou imidazo-částí jako protilátky angiotensinu II | |
| US4722929A (en) | Novel 2-phenyl-imidazoles and pharmaceutical compositions containing same | |
| PT95745A (pt) | Processo para a preparacao de derivados imidazolicos condensados com accao antagonista da angiotensina ii e de composicoes farmaceuicas qoe os contem | |
| EP3917911A1 (en) | 15-pgdh inhibitors | |
| NO842684L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive imidazol-derivater | |
| DK145344B (da) | Analogifremgangsmaade til fremstilling af 8-phenyl-puriner eller syreadditionssalte | |
| HU194562B (en) | Process for preparing new, condensed imidazo derivatives and pharmaceuticals comprising the same | |
| NO151287B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive 9-hydrazono-6,7,8,9-tetrahydro-4h-pyrido(1,2-a)-pyrimidinderivater | |
| NO840068L (no) | Heterocyklisk paakondenserte pyrazolo(3,4-d)pyridin-3-ioner | |
| HU195661B (en) | Process for producing new thienopyridones and pharmaceutical compositions containing them | |
| PT88614B (pt) | Processo para a preparacao de antagonistas do factor activador de plaquetas di-hidropiridinicos | |
| JPH0471914B2 (fi) | ||
| NO845169L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive benzimidazol-derivater | |
| US6867211B2 (en) | 4-Pyridyl-and 2,4-pyrimidinyl-substituted pyrrole derivatives and their use in pharmacy | |
| NO164353B (no) | Analogifremgangsmaate til fremstilling av terapeutisk aktive pyridopyrimidiner. | |
| NO854964L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive imidazoderivater. | |
| US5212186A (en) | Cardioactive pyrrolobenzimidazoles | |
| US3176017A (en) | Aroylalkyl derivatives of diazabicyclo-nonanes and-decanes | |
| EA007226B1 (ru) | Производные имидазохинолина |