NO174506B - Analogifremgangsmaate ved fremstilling av terapeutisk aktive forbindelser - Google Patents
Analogifremgangsmaate ved fremstilling av terapeutisk aktive forbindelser Download PDFInfo
- Publication number
- NO174506B NO174506B NO854321A NO854321A NO174506B NO 174506 B NO174506 B NO 174506B NO 854321 A NO854321 A NO 854321A NO 854321 A NO854321 A NO 854321A NO 174506 B NO174506 B NO 174506B
- Authority
- NO
- Norway
- Prior art keywords
- hal
- solution
- compound
- formula
- quinoline
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 26
- 238000002360 preparation method Methods 0.000 title claims abstract description 6
- 238000000034 method Methods 0.000 title claims description 10
- 150000003839 salts Chemical class 0.000 claims abstract description 11
- 125000001424 substituent group Chemical group 0.000 claims abstract description 9
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 8
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 7
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 6
- 150000002367 halogens Chemical class 0.000 claims abstract description 6
- 125000005843 halogen group Chemical group 0.000 claims abstract 2
- 229910052799 carbon Inorganic materials 0.000 claims description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 150000001721 carbon Chemical group 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 238000009833 condensation Methods 0.000 claims description 4
- 230000005494 condensation Effects 0.000 claims description 4
- 239000007858 starting material Substances 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 3
- PUPULQCZPABFPH-UHFFFAOYSA-N 2-[3-(quinolin-2-ylmethoxy)phenyl]heptan-2-ol Chemical compound CCCCCC(C)(O)C1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 PUPULQCZPABFPH-UHFFFAOYSA-N 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 125000005493 quinolyl group Chemical group 0.000 claims description 2
- 238000006467 substitution reaction Methods 0.000 claims description 2
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 claims description 2
- PIESJVRMEIITQU-UHFFFAOYSA-N 7-phenoxy-2-[3-(quinolin-2-ylmethoxy)phenyl]heptan-2-ol Chemical compound C=1C=CC(OCC=2N=C3C=CC=CC3=CC=2)=CC=1C(O)(C)CCCCCOC1=CC=CC=C1 PIESJVRMEIITQU-UHFFFAOYSA-N 0.000 claims 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 abstract description 4
- 125000003545 alkoxy group Chemical group 0.000 abstract description 2
- 125000001589 carboacyl group Chemical group 0.000 abstract description 2
- 229910052757 nitrogen Inorganic materials 0.000 abstract description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen(.) Chemical compound [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 abstract description 2
- 125000003118 aryl group Chemical group 0.000 abstract 3
- 229910052760 oxygen Inorganic materials 0.000 abstract 3
- 239000001301 oxygen Substances 0.000 abstract 3
- 229910052717 sulfur Inorganic materials 0.000 abstract 3
- 239000011593 sulfur Substances 0.000 abstract 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 2
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 2
- CREXVNNSNOKDHW-UHFFFAOYSA-N azaniumylideneazanide Chemical group N[N] CREXVNNSNOKDHW-UHFFFAOYSA-N 0.000 abstract 1
- 125000003107 substituted aryl group Chemical group 0.000 abstract 1
- 230000001225 therapeutic effect Effects 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 69
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 42
- 239000000243 solution Substances 0.000 description 35
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 30
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 239000007787 solid Substances 0.000 description 17
- 239000000203 mixture Substances 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 15
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 13
- 239000000741 silica gel Substances 0.000 description 13
- 229910002027 silica gel Inorganic materials 0.000 description 13
- 239000012267 brine Substances 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 12
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 11
- 239000003039 volatile agent Substances 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 238000004587 chromatography analysis Methods 0.000 description 9
- 239000007788 liquid Substances 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- 150000002576 ketones Chemical class 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- DDEAEWMDOSXKBX-UHFFFAOYSA-N 2-(chloromethyl)quinoline Chemical compound C1=CC=CC2=NC(CCl)=CC=C21 DDEAEWMDOSXKBX-UHFFFAOYSA-N 0.000 description 6
- IAVREABSGIHHMO-UHFFFAOYSA-N 3-hydroxybenzaldehyde Chemical compound OC1=CC=CC(C=O)=C1 IAVREABSGIHHMO-UHFFFAOYSA-N 0.000 description 6
- KGIJOOYOSFUGPC-CABOLEKPSA-N 5-HETE Natural products CCCCC\C=C/C\C=C/C\C=C/C=C/[C@H](O)CCCC(O)=O KGIJOOYOSFUGPC-CABOLEKPSA-N 0.000 description 6
- KGIJOOYOSFUGPC-MSFIICATSA-N 5-Hydroxyeicosatetraenoic acid Chemical compound CCCCCC=CCC=CCC=C\C=C\[C@@H](O)CCCC(O)=O KGIJOOYOSFUGPC-MSFIICATSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 5
- 239000003480 eluent Substances 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 235000019341 magnesium sulphate Nutrition 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 239000007818 Grignard reagent Substances 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 150000004795 grignard reagents Chemical class 0.000 description 4
- 239000010410 layer Substances 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000006482 condensation reaction Methods 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 229910000039 hydrogen halide Inorganic materials 0.000 description 3
- 239000012433 hydrogen halide Substances 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- -1 lithium aluminum hydride Chemical compound 0.000 description 3
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 3
- 238000005303 weighing Methods 0.000 description 3
- IEBXKAMPDSGJFA-UHFFFAOYSA-N 1-(3-hydroxyphenyl)-2,2-dimethylhexan-1-one Chemical compound CCCCC(C)(C)C(=O)C1=CC=CC(O)=C1 IEBXKAMPDSGJFA-UHFFFAOYSA-N 0.000 description 2
- LHFXTLCYZARWLB-UHFFFAOYSA-N 1-[3-(quinolin-2-ylmethoxy)phenyl]hexan-1-one Chemical compound CCCCCC(=O)C1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 LHFXTLCYZARWLB-UHFFFAOYSA-N 0.000 description 2
- WDETYCRYUBGKCE-UHFFFAOYSA-N 2-(chloromethyl)quinolin-1-ium;chloride Chemical compound Cl.C1=CC=CC2=NC(CCl)=CC=C21 WDETYCRYUBGKCE-UHFFFAOYSA-N 0.000 description 2
- WNGRHTGNGQSCTL-UHFFFAOYSA-N 5-bromopentoxybenzene Chemical compound BrCCCCCOC1=CC=CC=C1 WNGRHTGNGQSCTL-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- 102000003820 Lipoxygenases Human genes 0.000 description 2
- 108090000128 Lipoxygenases Proteins 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 102100022364 Polyunsaturated fatty acid 5-lipoxygenase Human genes 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 2
- 229910000024 caesium carbonate Inorganic materials 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 159000000003 magnesium salts Chemical class 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 239000004533 oil dispersion Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- LEHBURLTIWGHEM-UHFFFAOYSA-N pyridinium chlorochromate Chemical compound [O-][Cr](Cl)(=O)=O.C1=CC=[NH+]C=C1 LEHBURLTIWGHEM-UHFFFAOYSA-N 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 235000009518 sodium iodide Nutrition 0.000 description 2
- 239000011343 solid material Substances 0.000 description 2
- 238000001308 synthesis method Methods 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- IBODDUNKEPPBKW-UHFFFAOYSA-N 1,5-dibromopentane Chemical compound BrCCCCCBr IBODDUNKEPPBKW-UHFFFAOYSA-N 0.000 description 1
- YUWMKUYZYSWEAH-UHFFFAOYSA-N 1-(3-hydroxyphenyl)hexan-1-one Chemical compound CCCCCC(=O)C1=CC=CC(O)=C1 YUWMKUYZYSWEAH-UHFFFAOYSA-N 0.000 description 1
- GNQQKIMXEGMXHV-UHFFFAOYSA-N 1-[3-[[[3-(1-hydroxyhexyl)phenyl]-phenylmethoxy]-phenylmethyl]phenyl]hexan-1-ol Chemical compound CCCCCC(O)C1=CC=CC(C(OC(C=2C=CC=CC=2)C=2C=C(C=CC=2)C(O)CCCCC)C=2C=CC=CC=2)=C1 GNQQKIMXEGMXHV-UHFFFAOYSA-N 0.000 description 1
- OBPXAMHRBGRFRE-UHFFFAOYSA-N 2,2-dimethyl-1-[3-(quinolin-2-ylmethoxy)phenyl]hexan-1-one Chemical compound CCCCC(C)(C)C(=O)C1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 OBPXAMHRBGRFRE-UHFFFAOYSA-N 0.000 description 1
- CTQMCZUHPABXNZ-UHFFFAOYSA-N 2-methyl-1-[3-(quinolin-2-ylmethoxy)phenyl]hexan-1-ol Chemical compound CCCCC(C)C(O)C1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 CTQMCZUHPABXNZ-UHFFFAOYSA-N 0.000 description 1
- RGNOMOYQWHWISI-UHFFFAOYSA-N 2-methyl-1-[3-(quinolin-2-ylmethoxy)phenyl]hexan-1-one Chemical compound CCCCC(C)C(=O)C1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 RGNOMOYQWHWISI-UHFFFAOYSA-N 0.000 description 1
- UOXWCVKSXDUIIQ-UHFFFAOYSA-N 3,3-dimethyl-7-phenoxy-2-[3-(quinolin-2-ylmethoxy)phenyl]heptan-2-ol Chemical compound C=1C=CC(OCC=2N=C3C=CC=CC3=CC=2)=CC=1C(C)(O)C(C)(C)CCCCOC1=CC=CC=C1 UOXWCVKSXDUIIQ-UHFFFAOYSA-N 0.000 description 1
- WHTOUZVXKPHWMV-UHFFFAOYSA-N 3-(1-hydroxy-6-phenoxyhexyl)phenol Chemical compound C=1C=CC(O)=CC=1C(O)CCCCCOC1=CC=CC=C1 WHTOUZVXKPHWMV-UHFFFAOYSA-N 0.000 description 1
- OEELSOIUBJARFL-UHFFFAOYSA-N 3-(1-hydroxy-6-phenylmethoxyhexyl)phenol Chemical compound C=1C=CC(O)=CC=1C(O)CCCCCOCC1=CC=CC=C1 OEELSOIUBJARFL-UHFFFAOYSA-N 0.000 description 1
- VFFVFTQDHRZVCF-UHFFFAOYSA-N 3-(2-hydroxyheptan-2-yl)phenol Chemical compound CCCCCC(C)(O)C1=CC=CC(O)=C1 VFFVFTQDHRZVCF-UHFFFAOYSA-N 0.000 description 1
- IEFWWMUTPDTSOB-UHFFFAOYSA-N 3-methyl-1-[3-(quinolin-2-ylmethoxy)phenyl]butane-1,3-diol Chemical compound CC(C)(O)CC(O)C1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 IEFWWMUTPDTSOB-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- CJTIIENSKNSEFX-UHFFFAOYSA-N 5,5,5-trifluoro-1-(3-hydroxyphenyl)pentan-1-one Chemical compound OC1=CC=CC(C(=O)CCCC(F)(F)F)=C1 CJTIIENSKNSEFX-UHFFFAOYSA-N 0.000 description 1
- BYBTZXMAYSKSNX-UHFFFAOYSA-N 5,5,5-trifluoro-1-[3-(quinolin-2-ylmethoxy)phenyl]pentan-1-one Chemical compound FC(F)(F)CCCC(=O)C1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 BYBTZXMAYSKSNX-UHFFFAOYSA-N 0.000 description 1
- HIYAVKIYRIFSCZ-CYEMHPAKSA-N 5-(methylamino)-2-[[(2S,3R,5R,6S,8R,9R)-3,5,9-trimethyl-2-[(2S)-1-oxo-1-(1H-pyrrol-2-yl)propan-2-yl]-1,7-dioxaspiro[5.5]undecan-8-yl]methyl]-1,3-benzoxazole-4-carboxylic acid Chemical compound O=C([C@@H](C)[C@H]1O[C@@]2([C@@H](C[C@H]1C)C)O[C@@H]([C@@H](CC2)C)CC=1OC2=CC=C(C(=C2N=1)C(O)=O)NC)C1=CC=CN1 HIYAVKIYRIFSCZ-CYEMHPAKSA-N 0.000 description 1
- PZLSEUJXKMVYDQ-UHFFFAOYSA-N 6,6,6-trifluoro-1-[3-(quinolin-2-ylmethoxy)phenyl]hexan-1-one Chemical compound FC(F)(F)CCCCC(=O)C1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 PZLSEUJXKMVYDQ-UHFFFAOYSA-N 0.000 description 1
- IBWXSCCLJMHENK-UHFFFAOYSA-N 6-phenoxy-1-[3-(quinolin-2-ylmethoxy)phenyl]hexan-1-ol Chemical compound C=1C=CC(OCC=2N=C3C=CC=CC3=CC=2)=CC=1C(O)CCCCCOC1=CC=CC=C1 IBWXSCCLJMHENK-UHFFFAOYSA-N 0.000 description 1
- 108010093579 Arachidonate 5-lipoxygenase Proteins 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 101000620009 Homo sapiens Polyunsaturated fatty acid 5-lipoxygenase Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 1
- 239000000867 Lipoxygenase Inhibitor Substances 0.000 description 1
- 229940122142 Lipoxygenase inhibitor Drugs 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical group [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- GOPYZMJAIPBUGX-UHFFFAOYSA-N [O-2].[O-2].[Mn+4] Chemical class [O-2].[O-2].[Mn+4] GOPYZMJAIPBUGX-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- SMWDFEZZVXVKRB-UHFFFAOYSA-N anhydrous quinoline Natural products N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 1
- 230000003266 anti-allergic effect Effects 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229940114079 arachidonic acid Drugs 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- HIYAVKIYRIFSCZ-UHFFFAOYSA-N calcium ionophore A23187 Natural products N=1C2=C(C(O)=O)C(NC)=CC=C2OC=1CC(C(CC1)C)OC1(C(CC1C)C)OC1C(C)C(=O)C1=CC=CN1 HIYAVKIYRIFSCZ-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 1
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical group C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- GCFHZZWXZLABBL-UHFFFAOYSA-N ethanol;hexane Chemical compound CCO.CCCCCC GCFHZZWXZLABBL-UHFFFAOYSA-N 0.000 description 1
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- KDCIHNCMPUBDKT-UHFFFAOYSA-N hexane;propan-2-one Chemical compound CC(C)=O.CCCCCC KDCIHNCMPUBDKT-UHFFFAOYSA-N 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002617 leukotrienes Chemical class 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- JRQAVOSEAWZPCC-UHFFFAOYSA-N methyl 4-oxo-4-[3-(quinolin-2-ylmethoxy)phenyl]butanoate Chemical compound COC(=O)CCC(=O)C1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 JRQAVOSEAWZPCC-UHFFFAOYSA-N 0.000 description 1
- 210000000440 neutrophil Anatomy 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- WHRAMHWTLGRJHH-UHFFFAOYSA-M sodium;3-formylphenolate Chemical compound [Na+].[O-]C1=CC=CC(C=O)=C1 WHRAMHWTLGRJHH-UHFFFAOYSA-M 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 150000003509 tertiary alcohols Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/12—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/23—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring containing hydroxy or O-metal groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/673—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by change of size of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/575—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/782—Ketones containing a keto group bound to a six-membered aromatic ring polycyclic
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/794—Ketones containing a keto group bound to a six-membered aromatic ring having unsaturation outside an aromatic ring
- C07C49/796—Ketones containing a keto group bound to a six-membered aromatic ring having unsaturation outside an aromatic ring polycyclic
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/82—Ketones containing a keto group bound to a six-membered aromatic ring containing hydroxy groups
- C07C49/825—Ketones containing a keto group bound to a six-membered aromatic ring containing hydroxy groups all hydroxy groups bound to the ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/84—Ketones containing a keto group bound to a six-membered aromatic ring containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C50/00—Quinones
- C07C50/26—Quinones containing groups having oxygen atoms singly bound to carbon atoms
- C07C50/32—Quinones containing groups having oxygen atoms singly bound to carbon atoms the quinoid structure being part of a condensed ring system having two rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C65/00—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C65/21—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing ether groups, groups, groups, or groups
- C07C65/24—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing ether groups, groups, groups, or groups polycyclic
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/84—Nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/12—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D215/14—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/227—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/40—Radicals substituted by oxygen atoms
- C07D307/42—Singly bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/16—Radicals substituted by singly bound hetero atoms other than halogen by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/54—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D333/56—Radicals substituted by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US66643084A | 1984-10-30 | 1984-10-30 | |
US73679585A | 1985-05-22 | 1985-05-22 |
Publications (3)
Publication Number | Publication Date |
---|---|
NO854321L NO854321L (no) | 1986-05-02 |
NO174506B true NO174506B (no) | 1994-02-07 |
NO174506C NO174506C (fr) | 1994-05-18 |
Family
ID=27099462
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NO854321A NO174506B (no) | 1984-10-30 | 1985-10-29 | Analogifremgangsmaate ved fremstilling av terapeutisk aktive forbindelser |
Country Status (10)
Country | Link |
---|---|
EP (1) | EP0181568A3 (fr) |
KR (1) | KR860003226A (fr) |
AR (1) | AR243870A1 (fr) |
AU (1) | AU595489B2 (fr) |
CA (1) | CA1304088C (fr) |
DK (1) | DK497885A (fr) |
ES (1) | ES8704461A1 (fr) |
FI (1) | FI854259L (fr) |
NO (1) | NO174506B (fr) |
NZ (1) | NZ213986A (fr) |
Families Citing this family (105)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4547509A (en) * | 1983-01-03 | 1985-10-15 | Usv Pharmaceutical Corp. | 5,6,7-Quinoline carbanilates and method of treating ischemic heart disease therewith |
CA1261835A (fr) * | 1984-08-20 | 1989-09-26 | Masaaki Toda | Benz(thio) amides fusionnes |
US4625034A (en) * | 1985-02-04 | 1986-11-25 | Usv Pharmaceutical Corp. | 1,2-Dihydro; 1,2,3,4-tetrahydro; 5,8 dihydro; and 5,6,7,8-tetrahydroquinoline derivatives |
US4839369A (en) * | 1985-04-16 | 1989-06-13 | Rorer Pharmaceutical Corporation | Aryl and heteroaryl ethers as agents for the treatment of hypersensitive ailments |
DK282986A (da) * | 1985-06-18 | 1987-02-24 | Merck Frosst Canada Inc | Substitueret quinolin og farmaceutisk praeparat indeholdende en saadan forbindelse |
ZA865090B (en) * | 1985-07-22 | 1988-02-24 | Riker Laboratories Inc | Substituted di-t-butylphenols |
US5237070A (en) * | 1985-07-22 | 1993-08-17 | Riker Laboratories, Inc. | Substituted DI-t-butylphenols |
US4716178A (en) * | 1985-07-22 | 1987-12-29 | Riker Laboratories, Inc. | Substituted di-t-butylphenols |
US4732978A (en) * | 1985-10-03 | 1988-03-22 | American Home Products Corporation | Novel substituted naphthyloxymethyl quinoline derivatives as anti-inflammatory and antiallergy agents |
EP0219307A3 (fr) * | 1985-10-16 | 1987-10-14 | Merck Frosst Canada Inc. | Quinoléines 2-substituées |
ATE68789T1 (de) * | 1985-10-16 | 1991-11-15 | Merck Frosst Canada Inc | 2-substituierte chinoline. |
DE3617183A1 (de) * | 1985-11-16 | 1987-05-27 | Bayer Ag | Substituierte benzylether |
CA1297109C (fr) * | 1986-01-17 | 1992-03-10 | Dieter Binder | Derives 2-pyridinyl ou 2-quinolinylmethoxythiophene |
GB2185741B (en) * | 1986-01-27 | 1989-10-25 | American Home Prod | Heterocyclic sulphonamides |
AU6907687A (en) * | 1986-02-18 | 1987-08-20 | Rorer Pharmaceutical Corporation | Composition for treatment of asthmatic conditions using phenoxymethyl quinolines |
DE3632329A1 (de) * | 1986-09-24 | 1988-03-31 | Bayer Ag | Substituierte phenylsulfonamide |
US5202336A (en) * | 1986-09-24 | 1993-04-13 | Bayer Aktiengesellschaft | Antiflammatory quinolin methoxy phenylsulphonamides |
DE3789100T2 (de) * | 1986-12-26 | 1994-05-19 | Teijin Ltd | Aromatische Derivate und ihre Herstellungsweise. |
JPH01502755A (ja) * | 1987-03-18 | 1989-09-21 | アメリカン・ホーム・プロダクツ・コーポレイション | スルホニルカルボキシアミド |
US5049572A (en) * | 1987-04-06 | 1991-09-17 | Riker Laboratories, Inc. | Substituted di-t-butylphenols and anti-allergic use thereof |
US5103037A (en) * | 1987-04-06 | 1992-04-07 | Riker Laboratories, Inc. | Substituted di-t-butylphenols |
JPS63258854A (ja) * | 1987-04-16 | 1988-10-26 | Mitsubishi Kasei Corp | カルボキシスチレン誘導体およびそれを有効成分とする薬剤 |
DK196688A (da) * | 1987-04-28 | 1988-10-29 | Fujisawa Pharmaceutical Co | Bicykliske forbindelser og fremgangsmaade til fremstilling deraf |
DE3872937T2 (de) * | 1987-05-11 | 1993-01-21 | Ono Pharmaceutical Co | Benzoylaminophenoxybuttersaeure-derivate. |
GB8711802D0 (en) * | 1987-05-19 | 1987-06-24 | Fujisawa Pharmaceutical Co | Dithioacetal compounds |
US4968710A (en) * | 1987-11-13 | 1990-11-06 | Riker Laboratories, Inc. | Substituted di-t-butylphenols and anti-allergic use thereof |
US5066822A (en) * | 1987-11-13 | 1991-11-19 | Riker Laboratories, Inc | Di-t-butylphenols substituted by an alkoxy or benzyloxy group or a benzylthio group |
US5204358A (en) * | 1987-11-25 | 1993-04-20 | Merck Frosst Canada, Inc. | Hetaryl styryl quinolines as leukotriene inhibitors |
US5104882A (en) * | 1987-11-25 | 1992-04-14 | Merck Frosst Canada, Inc. | Diarylstrylquinoline diacids and pharmaceutical compositions thereof |
DE3814504A1 (de) * | 1988-04-29 | 1989-11-09 | Bayer Ag | (alpha)-substituierte 4-(chinolin-2-yl-methoxy)phenylessigsaeuren und -ester, verfahren zu ihrer herstellung und ihre verwendung in arzneimitteln |
DE3900261A1 (de) * | 1988-05-31 | 1989-12-07 | Bayer Ag | Substituierte 4-(chinolin-2-yl-methoxy) phenyl-essigsaeure-derivate |
EP0349062A1 (fr) * | 1988-06-27 | 1990-01-03 | Merck Frosst Canada Inc. | Acides quinolineétheralkanoiques |
ZA894913B (en) * | 1988-07-12 | 1990-03-28 | Ici Pharma | Heterocyclic compounds |
US5219881A (en) * | 1988-12-23 | 1993-06-15 | Imperial Chemical Industries Plc | Cyclic ether derivatives |
GB8927287D0 (en) * | 1988-12-23 | 1990-01-31 | Ici Plc | Cyclic ether derivatives |
NZ231735A (en) * | 1988-12-23 | 1992-04-28 | Ici Plc | Alcohol/ether derivatives, preparation and pharmaceutical compositions thereof |
US5214069A (en) * | 1988-12-23 | 1993-05-25 | Imperial Chemical Industries Plc | Alcohol and ether derivatives |
IL92620A0 (en) * | 1988-12-23 | 1990-08-31 | Ici Pharma | Cycloalkane derivatives |
GB8926981D0 (en) * | 1988-12-23 | 1990-01-17 | Ici Plc | Heterocyclic derivatives |
US5089495A (en) * | 1989-01-30 | 1992-02-18 | Imperial Chemical Industries Plc | Heterocyclic thiazole derivatives and pharmaceutical compositions comprising said derivatives |
IL93343A0 (en) * | 1989-02-28 | 1990-11-29 | Ici Plc | Heterocyclic cycloalkanes |
IE70521B1 (en) * | 1989-02-28 | 1996-12-11 | Zeneca Pharma Sa | Heterocycles with inhibitory activity of 5-lipoxygenase |
US5236919A (en) * | 1989-02-28 | 1993-08-17 | Imperial Chemical Industries Plc | Quinoxalinyl derivatives suitable for use in leukotriene mediated disease |
IE66512B1 (en) * | 1989-02-28 | 1996-01-10 | Ici Plc | Heterocyclic ethers as 5-lipoxygenase inhibitors |
US5196419A (en) * | 1989-02-28 | 1993-03-23 | Imperial Chemical Industries Plc | Heterocyclic cyclic ethers |
US5202326A (en) * | 1989-02-28 | 1993-04-13 | Imperial Chemical Industries Plc | Heterocyclic ethers |
US5134148A (en) * | 1989-02-28 | 1992-07-28 | Imperial Chemical Industries Plc | Heterocycles for use as inhibitors of leukotrienes |
US5217977A (en) * | 1989-02-28 | 1993-06-08 | Imperial Chemical Industries Plc | Heterocyclic cycloalkanes |
WO1990012006A1 (fr) * | 1989-04-07 | 1990-10-18 | Pfizer Inc. | 1-[3-(heteroarylmethoxy)phenyle]alcanols substitues, et composes associes pour le traitement de l'asthme, de l'arthrite et de maladies apparentees |
NZ233752A (en) * | 1989-05-24 | 1993-05-26 | Merck Frosst Canada Inc | Substituted quinoline derivatives, preparation and pharmaceutical compositions thereof |
IE64358B1 (en) * | 1989-07-18 | 1995-07-26 | Ici Plc | Diaryl ether heterocycles |
US5214070A (en) * | 1989-07-18 | 1993-05-25 | Imperial Chemical Industries Plc | Diaryl ether cycloalkanes |
IE902113A1 (en) * | 1989-07-18 | 1991-06-19 | Ici Plc | Diaryl ether cyclic ethers |
ES2057415T3 (es) * | 1989-07-26 | 1994-10-16 | Ici Plc | Derivados biciclicos. |
US4904674A (en) * | 1989-08-16 | 1990-02-27 | Hoechst-Roussel Pharmaceuticals Inc. | 1-(Benzo[b]thienyl)-2-(thienyl)ethenes and related compounds useful as anti-inflammatory agents |
US5272145A (en) * | 1989-08-22 | 1993-12-21 | Merck Frosst Canada, Inc. | (Quinolin-2-ylmethoxy)indoles as inhibitors of the biosynthesis of leukotrienes |
US5204344A (en) * | 1989-08-22 | 1993-04-20 | Merck Frosst Canada, Inc. | (Quinolin-2-ylmethoxy)indoles as inhibitors of the biosynthesis of leukotrienes |
DE3927930A1 (de) * | 1989-08-24 | 1991-02-28 | Bayer Ag | Cyclisch substituierte (chinolin-2-yl-methoxy)phenyl-essig-saeure-derivate |
DE3927931A1 (de) * | 1989-08-24 | 1991-02-28 | Bayer Ag | Disubstituierte (chinolin-2-yl-methoxy)phenylessigsaeure-derivate |
GB9018134D0 (en) * | 1989-09-29 | 1990-10-03 | Ici Plc | Heterocyclic derivatives |
ES2083526T3 (es) * | 1990-06-21 | 1996-04-16 | Zeneca Ltd | Derivados piranicos biciclicos y su uso como inhibidores de 5-lipoxigenasa. |
IE911919A1 (en) * | 1990-06-21 | 1992-01-01 | Zeneca Ltd | Bicyclic heterocyclic compounds |
IE911853A1 (en) * | 1990-06-21 | 1992-01-01 | Ici Plc | Heterocyclene derivatives |
US5254581A (en) * | 1990-06-21 | 1993-10-19 | Imperial Chemical Industries Plc | Pyran derivatives and their use as inhibitors of 5-lipoxygenase |
US4996214A (en) * | 1990-06-28 | 1991-02-26 | Smithkline Beecham Corporation | Quinolinyl substituted phenyl/thioalkanoic acid substituted propionic acids and leucotriene antagonist use thereof |
GB9113137D0 (en) * | 1990-07-13 | 1991-08-07 | Ici Plc | Thioxo heterocycles |
US5272173A (en) * | 1990-11-28 | 1993-12-21 | Imperial Chemical Industries Plc | 5-lipoxygenase inhibitors |
IE913866A1 (en) * | 1990-11-28 | 1992-06-03 | Ici Plc | Aryl derivatives |
IE914005A1 (en) * | 1990-12-14 | 1992-06-17 | Zeneca Ltd | Novel intermediates |
CA2058254A1 (fr) * | 1991-01-15 | 1992-07-16 | John Francis Kingston | Derives de benzodioxole |
US5258399A (en) * | 1991-01-17 | 1993-11-02 | Imperial Chemical Industries Plc | Sulphonamide derivatives |
AU645159B2 (en) * | 1991-01-17 | 1994-01-06 | Ici Pharma | Sulphonamide derivatives |
EP0505122A1 (fr) * | 1991-03-21 | 1992-09-23 | Zeneca Limited | Dérivés alpha, alpha-dialkylbenzyle |
GB9214120D0 (en) * | 1991-07-25 | 1992-08-12 | Ici Plc | Therapeutic amides |
US5389650A (en) * | 1991-09-30 | 1995-02-14 | Merck Frosst Canada, Inc. | (Azaarylmethoxy)indoles as inhibitors of leukotriene biosynthesis |
US5290798A (en) * | 1991-09-30 | 1994-03-01 | Merck Frosst Canada, Inc. | (hetero-arylmethoxy)indoles as inhibitors of leukotriene biosynthesis |
US5308850A (en) * | 1991-09-30 | 1994-05-03 | Merck Frosst Canada, Inc. | (Bicyclic-hetero-arylmethoxy)indoles as inhibitors of leukotriene biosynthesis |
US5190968A (en) * | 1991-09-30 | 1993-03-02 | Merck Frosst Canada, Inc. | (Polycyclic-arylmethoxy) indoles as inhibitors of leukotriene biosynthesis |
EP0540165A1 (fr) * | 1991-10-03 | 1993-05-05 | Zeneca Limited | Dérivés d'acide alcanoique |
EP0639975A1 (fr) * | 1991-12-06 | 1995-03-01 | Smithkline Beecham Corporation | Composes de pyridine heterocyclique substituee et leurs utilisations |
GB9127252D0 (en) * | 1991-12-23 | 1992-02-19 | Boots Co Plc | Therapeutic agents |
GB9300894D0 (en) * | 1992-02-07 | 1993-03-10 | Zeneca Ltd | Oxime derivatives |
WO1993016069A1 (fr) * | 1992-02-13 | 1993-08-19 | Merck Frosst Canada Inc. | (alcoxy azaaromatique) indoles inhibiteurs de biosynthese de leucotriene |
US5506227A (en) * | 1992-04-13 | 1996-04-09 | Merck Frosst Canada, Inc. | Pyridine-substituted benzyl alcohols as leukotriene antagonists |
CA2094465A1 (fr) * | 1992-04-23 | 1993-10-24 | Pierre Andre Raymond Bruneau | Derives de cycloalcane |
CA2095006A1 (fr) * | 1992-05-12 | 1993-11-13 | Philip Neil Edwards | Derives oxime |
CA2095005A1 (fr) * | 1992-05-12 | 1993-11-13 | Philip Neil Edwards | Derives hydroxylamine |
IL105558A (en) * | 1992-05-18 | 1998-04-05 | Zeneca Ltd | Tertiary carbinols with channel activity potassium process for their preparation and pharmaceutical preparations containing them |
DE4219765A1 (de) * | 1992-06-17 | 1993-12-23 | Bayer Ag | Substituierte (Benzothiazolyl- und Chinoxalyl-methoxy)phenylessigsäurederivate |
AU4444393A (en) * | 1992-09-01 | 1994-03-10 | Zeneca Limited | Pyrrolidine derivatives |
GB9305295D0 (en) * | 1993-03-15 | 1993-05-05 | Zeneca Ltd | Therapeutic compounds |
US5374635A (en) * | 1993-03-29 | 1994-12-20 | Merck Frosst Canada, Inc. | Furo[3,2-b]pyridines and thieno[3,2-b]pyridines as inhibitors of leukotriene biosynthesis |
GB9310095D0 (en) * | 1993-05-17 | 1993-06-30 | Zeneca Ltd | Therapeutic compounds |
GB9312891D0 (en) * | 1993-06-22 | 1993-08-04 | Boots Co Plc | Therapeutic agents |
KR100437580B1 (ko) * | 1995-03-14 | 2004-07-16 | 노파르티스 아게 | 삼치환된페닐유도체 |
US6197993B1 (en) | 1996-07-02 | 2001-03-06 | Ono Pharmaceutical Co., Ltd. | Naphthyloxyacetic acid derivatives and a pharmaceutical composition comprising them as an active ingredient |
EP0845451A4 (fr) * | 1995-07-26 | 1999-10-13 | Ono Pharmaceutical Co | Derives d'acide naphtyloxyacetique et medicaments integrant ces derives comme principes actifs |
TW544448B (en) | 1997-07-11 | 2003-08-01 | Novartis Ag | Pyridine derivatives |
US7067539B2 (en) | 2001-02-08 | 2006-06-27 | Schering Corporation | Cannabinoid receptor ligands |
US7507767B2 (en) | 2001-02-08 | 2009-03-24 | Schering Corporation | Cannabinoid receptor ligands |
MXPA04004674A (es) | 2001-11-14 | 2004-08-12 | Schering Corp | Ligados de los receptors de los canabinodies. |
AU2003243637A1 (en) | 2002-06-19 | 2004-01-06 | Schering Corporation | Cannabinoid receptor agonists |
TW200505902A (en) | 2003-03-20 | 2005-02-16 | Schering Corp | Cannabinoid receptor ligands |
SE0400234D0 (sv) | 2004-02-06 | 2004-02-06 | Active Biotech Ab | New compounds, methods for their preparation and use thereof |
AU2008213147A1 (en) | 2007-02-06 | 2008-08-14 | Chelsea Therapeutics, Inc. | New compounds, methods for their preparation and use thereof |
Family Cites Families (56)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
BE754405A (fr) * | 1969-08-05 | 1971-02-04 | Thomae Gmbh Dr K | Nouveaux beta-aryl-2-aminoalcoxystyrenes |
US3793328A (en) * | 1969-11-03 | 1974-02-19 | Upjohn Co | 8benzoyl 1,2,3,4 tetrahydroquinoline |
GB1357212A (en) * | 1971-06-25 | 1974-06-19 | Labaz | Benzothiophene derivatives and process for preparing the same |
US4053607A (en) * | 1972-04-04 | 1977-10-11 | Beecham Group Limited | Aryloxypyridine for treating hyperglycaemia |
FR2201883B1 (fr) * | 1972-10-05 | 1975-10-31 | Roussel Uclaf | |
CH603638A5 (en) * | 1973-03-02 | 1978-08-31 | Ciba Geigy Ag | 2-(piperidino or tetrahydropyrido) benzofurans |
DE2415867A1 (de) * | 1974-04-02 | 1975-10-09 | Merck Patent Gmbh | Phenoxyalkanolderivate und verfahren zu ihrer herstellung |
GB1456323A (en) * | 1974-06-06 | 1976-11-24 | Labaz | Benzothiophenes process for preparing them and pharmaceutical compositions containing the same |
US4024273A (en) * | 1974-06-20 | 1977-05-17 | Smithkline Corporation | Coronary vasodilator and anti-anginal compositions comprising substituted benzofurans and benzothiophenes and methods of producing coronary vasodilation and anti-anginal activity |
US3947470A (en) * | 1974-06-20 | 1976-03-30 | Smithkline Corporation | Substituted benzofurans and benzothiophenes |
US3989838A (en) * | 1975-09-22 | 1976-11-02 | Smithkline Corporation | Uricosuric compositions and method of producing uricosuria and hypouricemia |
US4255585A (en) * | 1975-10-22 | 1981-03-10 | Centre European De Recherches Pharmacologique | Benzoheterocyclic derivatives of phenoxyacetic acid |
US4017632A (en) * | 1975-10-22 | 1977-04-12 | Centre European De Recherches Pharmacologiques C.E.R.P.H.A. | Phenoxyacetic acid derivatives |
US4133814A (en) * | 1975-10-28 | 1979-01-09 | Eli Lilly And Company | 2-Phenyl-3-aroylbenzothiophenes useful as antifertility agents |
ZA775350B (en) * | 1976-12-23 | 1978-07-26 | Ciba Geigy Ag | Substituted 5-amino-2-pyridinecarboxylic acids |
US4092334A (en) * | 1977-07-28 | 1978-05-30 | International Flavors & Fragrances Inc. | 5-Acyl-2-(furfurylthio)dihydro-2,5-dialkyl-3-[2H]furanones |
EP0002408A1 (fr) * | 1977-11-26 | 1979-06-13 | SOCIETE DE RECHERCHES INDUSTRIELLES S.O.R.I. Société anonyme dite: | Nouveaux composés phénoxy-alcanols substitués, leur procédé de préparation et leur application en thérapeutique |
US4325729A (en) * | 1977-12-13 | 1982-04-20 | Ciba-Geigy Corporation | Herbicidal and plant growth regulating pyridyloxy-phenoxy-propionic acid derivatives |
LU79008A1 (de) * | 1978-02-03 | 1979-09-06 | Byk Gulden Lomberg Chem Fab | W-(n-alkyl-n-benzoyl-amino)-phenylalkansaeuren,ihre verwendung und herstellung sowie sie enthaltende arzneimittel |
US4263040A (en) * | 1978-02-18 | 1981-04-21 | Kumiai Chemical Industry Co., Ltd. | Phenoxyphenoxy unsaturated derivatives and herbicidal composition |
FR2426045A2 (fr) * | 1978-05-19 | 1979-12-14 | Meiji Seika Kaisha | Esters d'acide 5-alkoxy-picoliniques, procede pour leur preparation et composition anti-hypertensive contenant ces esters |
GB2030131B (en) * | 1978-09-12 | 1982-12-22 | Taiyo Pharma Ind | Process for producing 2-(4-(2-thienyl-carbonyl) phenyl) propionic acid |
JPS6033389B2 (ja) * | 1979-02-22 | 1985-08-02 | 日産化学工業株式会社 | 複素環エ−テル系フェノシキ脂肪酸誘導体、その製造法および該誘導体を含有する除草剤 |
US4236912A (en) * | 1979-03-05 | 1980-12-02 | The Dow Chemical Company | Quinolinyloxyphenoxy and quinolyinylthiophenoxy alkanoic acids and derivatives thereof and methods of herbicidal use |
JPS5923309B2 (ja) * | 1979-04-11 | 1984-06-01 | 工業技術院長 | ホルミルスチリル基をもつキノリン誘導体とその製法 |
JPS584712B2 (ja) * | 1979-07-04 | 1983-01-27 | 工業技術院長 | アセタ−ル基をもつ含窒素複素環化合物及びその製造方法 |
AU541697B2 (en) * | 1979-11-19 | 1985-01-17 | Ici Australia Limited | Quinoline derivatives |
USRE31624E (en) * | 1979-11-26 | 1984-07-03 | Forsyth Dental Infirmary For Children | Method of treating inflammation |
JPS56115784A (en) * | 1980-02-15 | 1981-09-11 | Tanabe Seiyaku Co Ltd | Novel pyridinecarboxamide derivative and its preparation |
DE3006351A1 (de) * | 1980-02-20 | 1981-09-17 | Basf Ag, 6700 Ludwigshafen | 2- ((3-amino-2- hydroxy-propoxy)-styryl )-verbindungen |
DE3171475D1 (en) * | 1980-05-31 | 1985-08-29 | Ciba Geigy Ag | Aryl-phenyl-acetylene compounds |
JPS5732279A (en) * | 1980-08-05 | 1982-02-20 | Mitsubishi Petrochem Co Ltd | Preparation of alpha- 5-benzoyl-2-thienyl propionic acid |
DE3101544A1 (de) * | 1981-01-20 | 1982-08-19 | Hoechst Ag, 6000 Frankfurt | "chinolinoxy-phenoxypropionsaeurederivate, verfahren zu ihrer herstellung und ihre verwendung als herbizide" |
EP0063418B1 (fr) * | 1981-04-16 | 1984-10-03 | Imperial Chemical Industries Plc | Dérivés des acides indanyloxy- et tétralinyloxy-phénoxy-propioniques, leur procédé de préparation, procédés herbicides et compositions herbicides les utilisant |
DE3120099A1 (de) * | 1981-05-20 | 1982-12-09 | Max-Planck-Gesellschaft zur Förderung der Wissenschaften e.V., 3400 Göttingen | Neues arzneimittel mit wirkung auf das zentralnervensystem |
DE3205150A1 (de) * | 1982-02-13 | 1983-08-18 | Celamerck Gmbh & Co Kg, 6507 Ingelheim | Pyridinderivate, ihre herstellung und verwendung |
CH651034A5 (de) * | 1982-05-12 | 1985-08-30 | Hoffmann La Roche | Chroman-, thiochroman- oder 1,2,3,4-tetrahydrochinolinderivate und ihre verwendung als arzneimittel-wirkstoffe. |
US4522647A (en) * | 1982-07-30 | 1985-06-11 | Zoecon Corporation | Substituted phenoxyalkanediones and their herbicidal method of use |
US4520199A (en) * | 1982-08-13 | 1985-05-28 | Zoecon Corporation | Alkoxy substituted phenoxy alkanoic acid esters |
US4469872A (en) * | 1982-08-20 | 1984-09-04 | Zoecon Corporation | Substituted pyridyloxyphenoxyhydroxyketones |
JPS5973579A (ja) * | 1982-10-19 | 1984-04-25 | Kotobuki Seiyaku Kk | ベンゾフラン又はベンゾチオフェン誘導体,この化合物を有効成分とする尿酸排泄剤及びその製造方法 |
US4464533A (en) * | 1982-11-08 | 1984-08-07 | Ppg Industries, Inc. | Herbicidally active quinoline or quinoxaline benzoate derivatives |
IE56702B1 (en) * | 1982-12-01 | 1991-11-06 | Usv Pharma Corp | Antiinflammatory antiallergic compounds |
JPS59152891A (ja) * | 1983-02-18 | 1984-08-31 | Yamada Kagaku Kogyo Kk | 発色性記録材料 |
ZA848416B (en) * | 1983-11-10 | 1986-06-25 | Dow Chemical Co | Fluorophenoxy compounds,herbicidal compositions and methods |
JPS60110887A (ja) * | 1983-11-18 | 1985-06-17 | Shiyouno Tamie | α−アルキル化酢酸誘導体の製造方法 |
JPS60172964A (ja) * | 1984-02-15 | 1985-09-06 | Tanabe Seiyaku Co Ltd | 桂皮酸誘導体及びその製法 |
HU195492B (en) * | 1984-07-27 | 1988-05-30 | Boehringer Biochemia Srl | Process for producing 2-substituted thiazolidine derivatives with antitussive and mucus regulating action and pharmaceuticals comprising these compounds as active ingredient |
DE3431004A1 (de) * | 1984-08-23 | 1986-03-06 | Hoechst Ag, 6230 Frankfurt | Neue 3-pyridylverbindungen und verfahren zu ihrer herstellung |
US4625034A (en) * | 1985-02-04 | 1986-11-25 | Usv Pharmaceutical Corp. | 1,2-Dihydro; 1,2,3,4-tetrahydro; 5,8 dihydro; and 5,6,7,8-tetrahydroquinoline derivatives |
DE3508903A1 (de) * | 1985-03-13 | 1986-09-18 | Hoechst Ag, 6230 Frankfurt | Neue 3-pyridylmethylnaphtylderivate, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
US4839369A (en) * | 1985-04-16 | 1989-06-13 | Rorer Pharmaceutical Corporation | Aryl and heteroaryl ethers as agents for the treatment of hypersensitive ailments |
DK282986A (da) * | 1985-06-18 | 1987-02-24 | Merck Frosst Canada Inc | Substitueret quinolin og farmaceutisk praeparat indeholdende en saadan forbindelse |
EP0206772A3 (fr) * | 1985-06-20 | 1988-05-11 | E.I. Du Pont De Nemours And Company | Dérivés d'acide aryloxybenzèneacétique herbicides |
US4732978A (en) * | 1985-10-03 | 1988-03-22 | American Home Products Corporation | Novel substituted naphthyloxymethyl quinoline derivatives as anti-inflammatory and antiallergy agents |
EP0219307A3 (fr) * | 1985-10-16 | 1987-10-14 | Merck Frosst Canada Inc. | Quinoléines 2-substituées |
-
1985
- 1985-10-29 NO NO854321A patent/NO174506B/no unknown
- 1985-10-29 NZ NZ213986A patent/NZ213986A/xx unknown
- 1985-10-30 AU AU49264/85A patent/AU595489B2/en not_active Ceased
- 1985-10-30 DK DK497885A patent/DK497885A/da not_active Application Discontinuation
- 1985-10-30 KR KR1019850008032A patent/KR860003226A/ko not_active Application Discontinuation
- 1985-10-30 EP EP85113830A patent/EP0181568A3/fr not_active Withdrawn
- 1985-10-30 AR AR85302113A patent/AR243870A1/es active
- 1985-10-30 ES ES549012A patent/ES8704461A1/es not_active Expired
- 1985-10-30 FI FI854259A patent/FI854259L/fi not_active IP Right Cessation
- 1985-10-30 CA CA000494211A patent/CA1304088C/fr not_active Expired - Lifetime
Also Published As
Publication number | Publication date |
---|---|
EP0181568A3 (fr) | 1989-04-26 |
FI854259L (fi) | 1986-05-01 |
NO854321L (no) | 1986-05-02 |
DK497885A (da) | 1986-05-01 |
AR243870A1 (es) | 1993-09-30 |
DK497885D0 (da) | 1985-10-30 |
EP0181568A2 (fr) | 1986-05-21 |
KR860003226A (ko) | 1986-05-21 |
ES549012A0 (es) | 1987-04-16 |
AU4926485A (en) | 1986-05-08 |
FI854259A0 (fi) | 1985-10-30 |
NZ213986A (en) | 1989-07-27 |
NO174506C (fr) | 1994-05-18 |
AU595489B2 (en) | 1990-04-05 |
CA1304088C (fr) | 1992-06-23 |
ES8704461A1 (es) | 1987-04-16 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
NO174506B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive forbindelser | |
Boekelheide et al. | Syntheses of pyrrocolines unsubstituted in the five-membered ring1 | |
US3931205A (en) | Substituted alkanoic acids and derivatives | |
US4259338A (en) | Benzofuranyl-tetrahydropyridines and -piperidines, their acid addition salts and antidepressant preparations thereof | |
NO760993L (fr) | ||
NO145657B (no) | Analogifremgangsmaate for fremstilling av fysiologisk aktive alkenderivater. | |
Sundberg et al. | o-Styrylnitrene route to 2-substituted indoles. Pyrolysis of o-azidostyrenes | |
NO137440B (no) | Analogifremgangsm}te for fremstilling av terapeutisk aktive pleuromutiliner | |
NO141800B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive benzomorfaner | |
EP0242167B1 (fr) | Carboxamides hétérocycliques | |
NO163552B (no) | Sammensatt understell. | |
HU185133B (en) | Process for producing 1-hydroxy-octahydro-benzo-bracket-c-bracket closed-quinolines and derivatives | |
NO142865B (no) | Analogifremgangsmaate ved fremstilling av nye terapeutisk aktive karbazoler | |
NO803453L (no) | Fremgangsmaate ved fremstilling av piperidylbenzimidazolonderivater | |
NO163597B (no) | Styreinnretning for et ett-eller tosporet kjoeretoey. | |
JPS584781A (ja) | テトラヒドロピリジン及びピペリジン誘導体の製法 | |
NO172643B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive benzopyranolderivater | |
GB2056435A (en) | Novel Tetrahydropyridine and Piperidine Substituted Benzofuranes and Related Compounds | |
CA2179634C (fr) | Analgesiques a base de 4-arylisoindole | |
NO121212B (fr) | ||
US3316272A (en) | Heterocyclic derivatives of triphenyl-ethylenes, triphenylethanes and triphenylethanols | |
US5175297A (en) | Methyl-quinoline derivatives as mefloquin intermediates and process for preparation thereof | |
NO149353B (no) | Fremgangsmaate ved fremstilling av 6-klor-alfa-metylkarbazol-2-eddiksyre | |
SU1017167A3 (ru) | Способ получени @ -5-ацетамидо-4,5,6,7-тетрагидро-2н-бензо/с/пиррола | |
NO133448B (fr) |