NO124032B - - Google Patents
Download PDFInfo
- Publication number
- NO124032B NO124032B NO4445/69A NO444569A NO124032B NO 124032 B NO124032 B NO 124032B NO 4445/69 A NO4445/69 A NO 4445/69A NO 444569 A NO444569 A NO 444569A NO 124032 B NO124032 B NO 124032B
- Authority
- NO
- Norway
- Prior art keywords
- general formula
- compounds
- carbon atoms
- alkyl group
- group
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 236
- 238000000034 method Methods 0.000 claims description 73
- 125000004432 carbon atom Chemical group C* 0.000 claims description 66
- 125000000217 alkyl group Chemical group 0.000 claims description 63
- 239000002253 acid Substances 0.000 claims description 49
- 239000003960 organic solvent Substances 0.000 claims description 35
- 239000001257 hydrogen Substances 0.000 claims description 31
- 229910052739 hydrogen Inorganic materials 0.000 claims description 31
- 150000003839 salts Chemical class 0.000 claims description 30
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 19
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 18
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 18
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 18
- 229910052794 bromium Inorganic materials 0.000 claims description 18
- 239000000460 chlorine Substances 0.000 claims description 18
- 229910052801 chlorine Inorganic materials 0.000 claims description 18
- 238000002360 preparation method Methods 0.000 claims description 18
- 229910052799 carbon Inorganic materials 0.000 claims description 16
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 15
- 229910052731 fluorine Inorganic materials 0.000 claims description 15
- 239000011737 fluorine Substances 0.000 claims description 15
- 150000002431 hydrogen Chemical class 0.000 claims description 12
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 12
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 11
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 11
- 239000007868 Raney catalyst Substances 0.000 claims description 10
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- 229910052783 alkali metal Inorganic materials 0.000 claims description 9
- 229910052757 nitrogen Inorganic materials 0.000 claims description 9
- 125000003277 amino group Chemical group 0.000 claims description 7
- 230000003197 catalytic effect Effects 0.000 claims description 7
- 150000001340 alkali metals Chemical class 0.000 claims description 6
- 238000005984 hydrogenation reaction Methods 0.000 claims description 6
- 239000002841 Lewis acid Substances 0.000 claims description 5
- 239000002585 base Substances 0.000 claims description 5
- 150000007517 lewis acids Chemical class 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 4
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims 1
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 119
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 92
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 91
- 239000000203 mixture Substances 0.000 description 82
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 71
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 52
- 238000006243 chemical reaction Methods 0.000 description 46
- 238000002844 melting Methods 0.000 description 43
- 230000008018 melting Effects 0.000 description 43
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 42
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 39
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 35
- -1 alkyl carbamate Chemical compound 0.000 description 32
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 26
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 238000001953 recrystallisation Methods 0.000 description 24
- 239000000706 filtrate Substances 0.000 description 23
- 238000010992 reflux Methods 0.000 description 23
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 22
- 239000012074 organic phase Substances 0.000 description 21
- 238000009835 boiling Methods 0.000 description 20
- 239000007858 starting material Substances 0.000 description 20
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 20
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 18
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- 238000003756 stirring Methods 0.000 description 18
- 239000002904 solvent Substances 0.000 description 17
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 14
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 13
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 13
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 11
- CNGVSGYSESBAPV-UHFFFAOYSA-N 7-(dimethylamino)-4-phenyl-1-propan-2-ylquinazolin-2-one Chemical compound CN(C1=CC=C2C(=NC(N(C2=C1)C(C)C)=O)C1=CC=CC=C1)C CNGVSGYSESBAPV-UHFFFAOYSA-N 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- 239000002244 precipitate Substances 0.000 description 10
- 239000011592 zinc chloride Substances 0.000 description 10
- 235000005074 zinc chloride Nutrition 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- 229960000583 acetic acid Drugs 0.000 description 9
- 238000001704 evaporation Methods 0.000 description 9
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 9
- 239000003921 oil Substances 0.000 description 9
- AVRPFRMDMNDIDH-UHFFFAOYSA-N 1h-quinazolin-2-one Chemical class C1=CC=CC2=NC(O)=NC=C21 AVRPFRMDMNDIDH-UHFFFAOYSA-N 0.000 description 8
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- 230000008020 evaporation Effects 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 7
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 7
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 7
- 229910052740 iodine Inorganic materials 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- 230000007306 turnover Effects 0.000 description 7
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- 150000004292 cyclic ethers Chemical class 0.000 description 6
- 150000004820 halides Chemical class 0.000 description 6
- 229910052742 iron Inorganic materials 0.000 description 6
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 230000035484 reaction time Effects 0.000 description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- AZGLONODIYNFMA-UHFFFAOYSA-N C(C)(C)N1C(N=C(C2=CC(=C(C=C12)C)[N+](=O)[O-])C1=CC=CC=C1)=O Chemical compound C(C)(C)N1C(N=C(C2=CC(=C(C=C12)C)[N+](=O)[O-])C1=CC=CC=C1)=O AZGLONODIYNFMA-UHFFFAOYSA-N 0.000 description 5
- OWIKHYCFFJSOEH-UHFFFAOYSA-N Isocyanic acid Chemical compound N=C=O OWIKHYCFFJSOEH-UHFFFAOYSA-N 0.000 description 5
- XLJMAIOERFSOGZ-UHFFFAOYSA-N anhydrous cyanic acid Natural products OC#N XLJMAIOERFSOGZ-UHFFFAOYSA-N 0.000 description 5
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 5
- 238000003776 cleavage reaction Methods 0.000 description 5
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 5
- 239000002609 medium Substances 0.000 description 5
- 230000007017 scission Effects 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- LZRAAFPKTJCSRX-UHFFFAOYSA-N 4-(benzenecarboximidoyl)-1-N,1-N-dimethyl-3-N-propan-2-ylbenzene-1,3-diamine Chemical compound CN(C1=CC(=C(C(C2=CC=CC=C2)=N)C=C1)NC(C)C)C LZRAAFPKTJCSRX-UHFFFAOYSA-N 0.000 description 4
- IRYSZSFTIKQARZ-UHFFFAOYSA-N 7-morpholin-4-yl-4-phenyl-1-propan-2-ylquinazolin-2-one Chemical compound C(C)(C)N1C(N=C(C2=CC=C(C=C12)N1CCOCC1)C1=CC=CC=C1)=O IRYSZSFTIKQARZ-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 4
- 230000009286 beneficial effect Effects 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 4
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- HRPHZUAPQWJPCZ-UHFFFAOYSA-N (2-chloro-5-nitrophenyl)-phenylmethanone Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(C(=O)C=2C=CC=CC=2)=C1 HRPHZUAPQWJPCZ-UHFFFAOYSA-N 0.000 description 3
- CFOWPTBVYZGHFL-UHFFFAOYSA-N 2-amino-4-morpholin-4-ylbenzonitrile Chemical compound C1=C(C#N)C(N)=CC(N2CCOCC2)=C1 CFOWPTBVYZGHFL-UHFFFAOYSA-N 0.000 description 3
- QLMARGYNEQASGA-UHFFFAOYSA-N 4-(4-chloro-3-nitrophenyl)morpholine Chemical compound C1=C(Cl)C([N+](=O)[O-])=CC(N2CCOCC2)=C1 QLMARGYNEQASGA-UHFFFAOYSA-N 0.000 description 3
- WLBZNBJVMSNGQC-UHFFFAOYSA-N 4-(dimethylamino)-2-nitrobenzonitrile Chemical compound CN(C)C1=CC=C(C#N)C([N+]([O-])=O)=C1 WLBZNBJVMSNGQC-UHFFFAOYSA-N 0.000 description 3
- AHAKSKWSLHPGIM-UHFFFAOYSA-N 4-morpholin-4-yl-2-nitrobenzonitrile Chemical compound C1=C(C#N)C([N+](=O)[O-])=CC(N2CCOCC2)=C1 AHAKSKWSLHPGIM-UHFFFAOYSA-N 0.000 description 3
- ICPXMFSOUJYSHU-UHFFFAOYSA-N 6-(dimethylamino)-7-methyl-4-phenyl-1-propan-2-ylquinazolin-2-one Chemical compound C(C)(C)N1C(N=C(C2=CC(=C(C=C12)C)N(C)C)C1=CC=CC=C1)=O ICPXMFSOUJYSHU-UHFFFAOYSA-N 0.000 description 3
- NGOQYHLCIYJJAU-UHFFFAOYSA-N 6-nitro-4-phenyl-1-propan-2-ylquinazolin-2-one Chemical compound N=1C(=O)N(C(C)C)C2=CC=C([N+]([O-])=O)C=C2C=1C1=CC=CC=C1 NGOQYHLCIYJJAU-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- SEUMUDSEKPSGQU-UHFFFAOYSA-N C(C)(C)N1C(NC(C2=CC(=C(C=C12)C)N(C)C)C1=CC=CC=C1)=O Chemical compound C(C)(C)N1C(NC(C2=CC(=C(C=C12)C)N(C)C)C1=CC=CC=C1)=O SEUMUDSEKPSGQU-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- KIYLOYFQTWNSLH-UHFFFAOYSA-N [5-nitro-2-(propan-2-ylamino)phenyl]-phenylmethanone Chemical compound CC(C)NC1=CC=C([N+]([O-])=O)C=C1C(=O)C1=CC=CC=C1 KIYLOYFQTWNSLH-UHFFFAOYSA-N 0.000 description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 3
- 230000002349 favourable effect Effects 0.000 description 3
- 230000036571 hydration Effects 0.000 description 3
- 238000006703 hydration reaction Methods 0.000 description 3
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- 150000007529 inorganic bases Chemical class 0.000 description 3
- GRHBQAYDJPGGLF-UHFFFAOYSA-N isothiocyanic acid Chemical compound N=C=S GRHBQAYDJPGGLF-UHFFFAOYSA-N 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 3
- 238000007070 tosylation reaction Methods 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- WUSHGMMTXAGGMG-UHFFFAOYSA-N 2-amino-4-(dimethylamino)benzonitrile Chemical compound CN(C)C1=CC=C(C#N)C(N)=C1 WUSHGMMTXAGGMG-UHFFFAOYSA-N 0.000 description 2
- MILSHCXOTIXTPM-UHFFFAOYSA-N 4-(dimethylamino)-2-(propan-2-ylamino)benzonitrile Chemical compound CN(C1=CC(=C(C#N)C=C1)NC(C)C)C MILSHCXOTIXTPM-UHFFFAOYSA-N 0.000 description 2
- IQYSWEANDOKQJM-UHFFFAOYSA-N 6-amino-4-phenyl-1-propan-2-ylquinazolin-2-one Chemical compound NC=1C=C2C(=NC(N(C2=CC1)C(C)C)=O)C1=CC=CC=C1 IQYSWEANDOKQJM-UHFFFAOYSA-N 0.000 description 2
- PHIVTMIMLYCWBA-UHFFFAOYSA-N 7-methyl-6-morpholin-4-yl-4-phenyl-1-propan-2-ylquinazolin-2-one Chemical compound C(C)(C)N1C(N=C(C2=CC(=C(C=C12)C)N1CCOCC1)C1=CC=CC=C1)=O PHIVTMIMLYCWBA-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical group [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- PFUUEZRQEPXGQU-UHFFFAOYSA-N [4-methyl-2-(propan-2-ylamino)phenyl]-phenylmethanone Chemical compound CC(C)NC1=CC(C)=CC=C1C(=O)C1=CC=CC=C1 PFUUEZRQEPXGQU-UHFFFAOYSA-N 0.000 description 2
- GPZKSWHZJHXYGB-UHFFFAOYSA-N [4-methyl-5-nitro-2-(propan-2-ylamino)phenyl]-phenylmethanone Chemical compound C(C)(C)NC1=C(C(=O)C2=CC=CC=C2)C=C(C(=C1)C)[N+](=O)[O-] GPZKSWHZJHXYGB-UHFFFAOYSA-N 0.000 description 2
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 238000005937 allylation reaction Methods 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 235000008504 concentrate Nutrition 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 2
- 150000002540 isothiocyanates Chemical class 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- AJFDBNQQDYLMJN-UHFFFAOYSA-N n,n-diethylacetamide Chemical compound CCN(CC)C(C)=O AJFDBNQQDYLMJN-UHFFFAOYSA-N 0.000 description 2
- RYVLOOXFFIFQEN-UHFFFAOYSA-N n-[4-(1-oxo-3,4-dihydro-2h-pyrido[4,3-b]indol-5-yl)butyl]acetamide Chemical compound C12=CC=CC=C2N(CCCCNC(=O)C)C2=C1C(=O)NCC2 RYVLOOXFFIFQEN-UHFFFAOYSA-N 0.000 description 2
- 150000002828 nitro derivatives Chemical class 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 239000004323 potassium nitrate Substances 0.000 description 2
- 235000010333 potassium nitrate Nutrition 0.000 description 2
- 239000012286 potassium permanganate Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000006702 propargylation reaction Methods 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 235000012976 tarts Nutrition 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 125000005270 trialkylamine group Chemical group 0.000 description 2
- YINYAGBOKBLJHY-UHFFFAOYSA-N (2-amino-4-methylphenyl)-phenylmethanone Chemical compound NC1=CC(C)=CC=C1C(=O)C1=CC=CC=C1 YINYAGBOKBLJHY-UHFFFAOYSA-N 0.000 description 1
- MAOBFOXLCJIFLV-UHFFFAOYSA-N (2-aminophenyl)-phenylmethanone Chemical class NC1=CC=CC=C1C(=O)C1=CC=CC=C1 MAOBFOXLCJIFLV-UHFFFAOYSA-N 0.000 description 1
- UJHSIDUUJPTLDY-UHFFFAOYSA-N (2-nitrophenyl)-phenylmethanone Chemical compound [O-][N+](=O)C1=CC=CC=C1C(=O)C1=CC=CC=C1 UJHSIDUUJPTLDY-UHFFFAOYSA-N 0.000 description 1
- FOZVXADQAHVUSV-UHFFFAOYSA-N 1-bromo-2-(2-bromoethoxy)ethane Chemical compound BrCCOCCBr FOZVXADQAHVUSV-UHFFFAOYSA-N 0.000 description 1
- BJNZHRVKTMSBRQ-UHFFFAOYSA-N 1-nitro-1-phenylurea Chemical class NC(=O)N([N+]([O-])=O)C1=CC=CC=C1 BJNZHRVKTMSBRQ-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- PAHBKKVJOKXQKC-UHFFFAOYSA-N 2-amino-4-chloro-5-(dimethylamino)benzonitrile Chemical compound CN(C)C1=CC(C#N)=C(N)C=C1Cl PAHBKKVJOKXQKC-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- FOHHWGVAOVDVLP-UHFFFAOYSA-N 4-chloro-3-nitroaniline Chemical compound NC1=CC=C(Cl)C([N+]([O-])=O)=C1 FOHHWGVAOVDVLP-UHFFFAOYSA-N 0.000 description 1
- WRAYOMVGECIHRK-UHFFFAOYSA-N 6-(dimethylamino)-4-phenyl-1-propan-2-ylquinazolin-2-one Chemical compound N=1C(=O)N(C(C)C)C2=CC=C(N(C)C)C=C2C=1C1=CC=CC=C1 WRAYOMVGECIHRK-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- ZXMWQSNOCNATQL-UHFFFAOYSA-N C(C)(C)N(C=1C=C2C(=NC(N(C2=CC1)C(C)C)=O)C1=CC=CC=C1)C(C)C Chemical compound C(C)(C)N(C=1C=C2C(=NC(N(C2=CC1)C(C)C)=O)C1=CC=CC=C1)C(C)C ZXMWQSNOCNATQL-UHFFFAOYSA-N 0.000 description 1
- NOIBSEAVQZNZRH-UHFFFAOYSA-N C(C)(C)N1C(N=C(C2=CC(=CC=C12)N1CCOCC1)C1=CC=CC=C1)=O Chemical compound C(C)(C)N1C(N=C(C2=CC(=CC=C12)N1CCOCC1)C1=CC=CC=C1)=O NOIBSEAVQZNZRH-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 1
- 235000010650 Hyssopus officinalis Nutrition 0.000 description 1
- 240000001812 Hyssopus officinalis Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- FZFUMPDCEVCISZ-UHFFFAOYSA-N N.N=C=S Chemical class N.N=C=S FZFUMPDCEVCISZ-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001339 alkali metal compounds Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000012431 aqueous reaction media Substances 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940045348 brown mixture Drugs 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 239000000679 carrageenan Substances 0.000 description 1
- 229940113118 carrageenan Drugs 0.000 description 1
- 235000010418 carrageenan Nutrition 0.000 description 1
- 229920001525 carrageenan Polymers 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000004699 copper complex Chemical class 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 229960003280 cupric chloride Drugs 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000000855 fermentation Methods 0.000 description 1
- 230000004151 fermentation Effects 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000012943 hotmelt Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 239000000411 inducer Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 150000002641 lithium Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- CMUOJBJRZUHRMU-UHFFFAOYSA-N nitrourea Chemical compound NC(=O)N[N+]([O-])=O CMUOJBJRZUHRMU-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- KVNYFPKFSJIPBJ-UHFFFAOYSA-N ortho-diethylbenzene Natural products CCC1=CC=CC=C1CC KVNYFPKFSJIPBJ-UHFFFAOYSA-N 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- DGPMXBLZPJPMIH-UHFFFAOYSA-N phenyl-[2-(propan-2-ylamino)phenyl]methanone Chemical compound CC(C)NC1=CC=CC=C1C(=O)C1=CC=CC=C1 DGPMXBLZPJPMIH-UHFFFAOYSA-N 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 150000003112 potassium compounds Chemical class 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Inorganic materials [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 230000001052 transient effect Effects 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- UHVMMEOXYDMDKI-JKYCWFKZSA-L zinc;1-(5-cyanopyridin-2-yl)-3-[(1s,2s)-2-(6-fluoro-2-hydroxy-3-propanoylphenyl)cyclopropyl]urea;diacetate Chemical compound [Zn+2].CC([O-])=O.CC([O-])=O.CCC(=O)C1=CC=C(F)C([C@H]2[C@H](C2)NC(=O)NC=2N=CC(=CC=2)C#N)=C1O UHVMMEOXYDMDKI-JKYCWFKZSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/06—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by halogen atoms or nitro radicals
- C07D295/073—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by halogen atoms or nitro radicals with the ring nitrogen atoms and the substituents separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US00775201A US3723432A (en) | 1968-11-12 | 1968-11-12 | 1-substituted-4-aryl-2(1h)-quinazolinones and their preparation |
Publications (1)
Publication Number | Publication Date |
---|---|
NO124032B true NO124032B (enEXAMPLES) | 1972-02-21 |
Family
ID=25103642
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NO4445/69A NO124032B (enEXAMPLES) | 1968-11-12 | 1969-11-10 |
Country Status (19)
Country | Link |
---|---|
US (2) | US3723432A (enEXAMPLES) |
AT (4) | AT319949B (enEXAMPLES) |
BE (1) | BE741529A (enEXAMPLES) |
BG (10) | BG16042A3 (enEXAMPLES) |
BR (1) | BR6914095D0 (enEXAMPLES) |
CH (1) | CH521972A (enEXAMPLES) |
DE (1) | DE1956384C3 (enEXAMPLES) |
DK (1) | DK129347B (enEXAMPLES) |
ES (1) | ES373377A1 (enEXAMPLES) |
FR (1) | FR2024830B1 (enEXAMPLES) |
GB (1) | GB1282612A (enEXAMPLES) |
IE (1) | IE33933B1 (enEXAMPLES) |
IL (1) | IL33348A (enEXAMPLES) |
NL (1) | NL6916514A (enEXAMPLES) |
NO (1) | NO124032B (enEXAMPLES) |
OA (1) | OA03829A (enEXAMPLES) |
PL (1) | PL72695B1 (enEXAMPLES) |
SE (2) | SE376917B (enEXAMPLES) |
ZA (1) | ZA697910B (enEXAMPLES) |
Families Citing this family (37)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3923803A (en) * | 1968-07-18 | 1975-12-02 | Sumitomo Chemical Co | 2(1H)-Quinozalinones and process therefor |
US3642791A (en) * | 1969-08-13 | 1972-02-15 | Sandoz Ag | Morpholino-1-substituted-2(1h)-quinazolinones |
US4208343A (en) * | 1970-10-30 | 1980-06-17 | Westinghouse Electric Corp. | 2,4 Diamino benzonitrile |
BE785937A (fr) * | 1971-07-08 | 1973-01-08 | Sandoz Sa | Nouveaux derives de la quinazoline, leur preparation et leur application comme medicaments |
US3937705A (en) * | 1972-03-09 | 1976-02-10 | Sandoz, Inc. | 1-isopropyl-7-methyl-4-(p-fluorophenyl)-2(1h)-quinazolinone |
US4064246A (en) * | 1976-10-12 | 1977-12-20 | Sandoz, Inc. | Hydroxymethyl-substituted-2(1H)-quinazolinones |
US4071516A (en) * | 1976-08-20 | 1978-01-31 | Sandoz, Inc. | 4-(Acyloxyphenyl)-quinazolin-2(1H)-ones |
US4160092A (en) * | 1977-06-16 | 1979-07-03 | E. I. Du Pont De Nemours And Company | Quinazolinone oxides and their use as intermediates for pharmaceutical agents |
US4224328A (en) * | 1979-04-11 | 1980-09-23 | Sandoz, Inc. | Methods with 1-substituted-4-aryl-quinazolin-2(1H)-ones and thiones and pyrido[2,3-d]pyrimidin-2-ones as platelet aggregation inhibitors |
CH645362A5 (de) * | 1979-07-05 | 1984-09-28 | Sandoz Ag | Verfahren zur herstellung von 4-phenyl-2(1h)-chinazolinonen. |
FR2676042B1 (fr) * | 1991-05-02 | 1993-07-23 | Commissariat Energie Atomique | Procede de preparation d'un borohydrure de metal alcalin tel que le borohydrure de lithium. |
US6545004B1 (en) * | 1999-10-27 | 2003-04-08 | Cytokinetics, Inc. | Methods and compositions utilizing quinazolinones |
US7230000B1 (en) | 1999-10-27 | 2007-06-12 | Cytokinetics, Incorporated | Methods and compositions utilizing quinazolinones |
AR038658A1 (es) * | 2001-06-15 | 2005-01-26 | Novartis Ag | Derivados de 4-aril-2(1h) quinazolinona y 4-aril-quinazolina 2-sustituidas, un proceso para su preparacion, composiciones farmaceuticas y el uso de dichos derivados para la preparacion de un medicamento |
AU2002346471A1 (en) * | 2001-11-20 | 2003-06-10 | Cytokinetics, Inc. | Process for the racemization of chiral quinazolinones |
CA2475879A1 (en) * | 2002-02-15 | 2003-08-28 | Cytokinetics, Inc. | Synthesis of quinazolinones |
WO2003097053A1 (en) | 2002-05-09 | 2003-11-27 | Cytokinetics, Inc. | Compounds, compositions, and methods |
US7166595B2 (en) * | 2002-05-09 | 2007-01-23 | Cytokinetics, Inc. | Compounds, methods and compositions |
EP1513820A4 (en) * | 2002-05-23 | 2006-09-13 | Cytokinetics Inc | COMPOUNDS, COMPOSITIONS AND METHODS |
AU2003236527A1 (en) * | 2002-06-14 | 2003-12-31 | Cytokinetics, Inc. | Compounds, compositions, and methods |
US7211580B2 (en) * | 2002-07-23 | 2007-05-01 | Cytokinetics, Incorporated | Compounds, compositions, and methods |
AU2003262747A1 (en) * | 2002-08-21 | 2004-03-11 | Cytokinetics, Inc. | Compounds, compositions, and methods |
EP1558083A4 (en) * | 2002-09-30 | 2008-04-16 | Cytokinetics Inc | COMPOUNDS, COMPOSITIONS AND METHODS |
GB0230015D0 (en) * | 2002-12-23 | 2003-01-29 | Novartis Ag | Organic compounds |
US7439241B2 (en) | 2003-05-27 | 2008-10-21 | Galderma Laboratories, Inc. | Compounds, formulations, and methods for treating or preventing rosacea |
US8410102B2 (en) | 2003-05-27 | 2013-04-02 | Galderma Laboratories Inc. | Methods and compositions for treating or preventing erythema |
JP2007510652A (ja) * | 2003-11-03 | 2007-04-26 | サイトキネティクス・インコーポレーテッド | ピリミジン−4−オン化合物、組成物、および方法 |
WO2005046588A2 (en) * | 2003-11-07 | 2005-05-26 | Cytokinetics, Inc. | Compounds, compositions, and methods |
US7439254B2 (en) * | 2003-12-08 | 2008-10-21 | Cytokinetics, Inc. | Compounds, compositions, and methods |
EP2173724B1 (en) * | 2007-06-22 | 2012-12-05 | ArQule, Inc. | Quinazolinone compounds and methods of use thereof |
US8058469B2 (en) * | 2008-11-03 | 2011-11-15 | Sabic Innovative Plastics Ip B.V. | Method for making carbamates, ureas and isocyanates |
EP2329849B1 (en) | 2009-11-18 | 2015-04-29 | Galderma Research & Development | Combination of alpha-2 adrenergic receptor agonist and non-steroidal anti-inflammatory agent for treating or preventing an inflammatory skin disorder |
US8394800B2 (en) * | 2009-11-19 | 2013-03-12 | Galderma Laboratories, L.P. | Method for treating psoriasis |
WO2011117378A2 (en) | 2010-03-26 | 2011-09-29 | Galderma Research & Development | Improved methods and compositions for safe and effective treatment of telangiectasia |
KR101707704B1 (ko) | 2010-03-26 | 2017-02-16 | 갈데르마 리써어치 앤드 디벨로프먼트 | 홍반의 유효하고 안전한 치료를 위한 개선된 방법 및 조성물 |
BR112013009578B1 (pt) | 2010-10-21 | 2020-10-20 | Galderma S.A. | composição tópica em gel e uso de uma composição tópica em gel |
US8053427B1 (en) | 2010-10-21 | 2011-11-08 | Galderma R&D SNC | Brimonidine gel composition |
Family Cites Families (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3452041A (en) * | 1965-05-19 | 1969-06-24 | American Home Prod | Hydantoin compounds and methods of preparation |
-
1968
- 1968-11-12 BG BG015055A patent/BG16042A3/bg unknown
- 1968-11-12 US US00775201A patent/US3723432A/en not_active Expired - Lifetime
-
1969
- 1969-10-31 GB GB53620/69A patent/GB1282612A/en not_active Expired
- 1969-10-31 CH CH1624569A patent/CH521972A/de not_active IP Right Cessation
- 1969-11-03 NL NL6916514A patent/NL6916514A/xx not_active Application Discontinuation
- 1969-11-07 FR FR696938404A patent/FR2024830B1/fr not_active Expired
- 1969-11-10 BG BG014695A patent/BG16039A3/bg unknown
- 1969-11-10 IE IE1526/69A patent/IE33933B1/xx unknown
- 1969-11-10 BG BG015469A patent/BG16043A3/bg unknown
- 1969-11-10 BG BG014692A patent/BG16036A3/bg unknown
- 1969-11-10 AT AT993071A patent/AT319949B/de not_active IP Right Cessation
- 1969-11-10 BG BG014694A patent/BG16038A3/bg unknown
- 1969-11-10 BG BG014696A patent/BG16040A3/bg unknown
- 1969-11-10 BG BG013325A patent/BG16188A3/bg unknown
- 1969-11-10 AT AT993571A patent/AT310176B/de not_active IP Right Cessation
- 1969-11-10 NO NO4445/69A patent/NO124032B/no unknown
- 1969-11-10 BE BE741529A patent/BE741529A/xx unknown
- 1969-11-10 BG BG014693A patent/BG16037A3/bg unknown
- 1969-11-10 OA OA53783A patent/OA03829A/xx unknown
- 1969-11-10 AT AT993271A patent/AT319950B/de not_active IP Right Cessation
- 1969-11-10 DE DE1956384A patent/DE1956384C3/de not_active Expired
- 1969-11-10 ES ES373377A patent/ES373377A1/es not_active Expired
- 1969-11-10 AT AT1053269A patent/AT310169B/de not_active IP Right Cessation
- 1969-11-11 SE SE7213438A patent/SE376917B/xx unknown
- 1969-11-11 DK DK597169AA patent/DK129347B/da unknown
- 1969-11-11 IL IL33348A patent/IL33348A/xx unknown
- 1969-11-11 SE SE6915448A patent/SE374920B/xx unknown
- 1969-11-11 BR BR214095/69A patent/BR6914095D0/pt unknown
- 1969-11-12 PL PL1969136872A patent/PL72695B1/pl unknown
- 1969-11-12 ZA ZA697910A patent/ZA697910B/xx unknown
-
1970
- 1970-05-16 BG BG014697A patent/BG16041A3/bg unknown
- 1970-08-13 BG BG015468A patent/BG15573A3/bg unknown
-
1972
- 1972-12-08 US US313531A patent/US3925548A/en not_active Expired - Lifetime
Also Published As
Similar Documents
Publication | Publication Date | Title |
---|---|---|
NO124032B (enEXAMPLES) | ||
AU704133B2 (en) | Pharmaceutically active quinazoline compounds | |
EP0260817A1 (en) | Quinazolinediones and pyridopyrimidinediones | |
NO851862L (no) | Fremgangsmaate ved fremstilling av nye pyrrolobenzimidazoler | |
JPH0739387B2 (ja) | 新規1−ベンジル−アミノアルキル−ピロリジノン化合物及びその製造方法 | |
US4841076A (en) | Benzopyran derivatives | |
EP0104522B1 (en) | New pyrazolo(3,4-b)pyridine derivatives and process for producing them | |
NO117129B (enEXAMPLES) | ||
HU217116B (hu) | Tiazolidin-2,4-dion-származékok, sóik, valamint eljárás a vegyületek és az ezeket tartalmazó gyógyászati készítmények előállítására | |
DE2609289A1 (de) | Verfahren zur herstellung von neuen indolylalkylpiperidinen | |
JP2000508299A (ja) | 抗ウイルス作用を有する置換キノリン誘導体 | |
KR100753353B1 (ko) | 졸미트립탄 화합물의 제조방법 | |
IL116384A (en) | Ylidene compounds and their preparation | |
HU196188B (en) | Process for preparing new quinazolindione-derivatives and medical compounds containing them | |
US4748280A (en) | Certain chlorination process for preparing 2-chloro-1,1,1-(C1 -C6) | |
EP0127412B1 (en) | Imidazolidinedione derivatives | |
CA1117525A (en) | 2,3-polymethylene-4-oxo-4h-pyrido /1,2-a/ pyrimidines and process for the preparation thereof | |
US3829446A (en) | Oxobenzofuran intermediates | |
US3764600A (en) | 1-substituted-quinazoline-2(1h)-thiones | |
WO1993013092A1 (en) | Imidazolidinedione derivatives | |
US3819627A (en) | 1-substituted-3,4-dihydro-2(1h)-quinazolinones | |
NO853751L (no) | Fremgangsm¨te for fremstilling av 8-halogen-5,6-dialkoksyk inazolin-2,4-dioner og deres salter. | |
CN112300149A (zh) | 一种盐酸阿罗洛尔的制备方法 | |
Koppe et al. | On the regiochemistry of the alkylation of tert-butyl N-[6-butyl-1, 2-dihydro-2-oxo-3-pyridylmethyl] carbamate: Precursor of a series of potent angiotensin II receptor antagonists | |
US4229450A (en) | Carbamates of homolysergols (8β-hydrohyethylergolines) and compositions thereof |