NO122430B - - Google Patents
Download PDFInfo
- Publication number
- NO122430B NO122430B NO2371/69A NO237169A NO122430B NO 122430 B NO122430 B NO 122430B NO 2371/69 A NO2371/69 A NO 2371/69A NO 237169 A NO237169 A NO 237169A NO 122430 B NO122430 B NO 122430B
- Authority
- NO
- Norway
- Prior art keywords
- acid
- water
- group
- solution
- hydroxyethyl
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 52
- 239000002872 contrast media Substances 0.000 claims description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- 125000002252 acyl group Chemical group 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- ZMZGFLUUZLELNE-UHFFFAOYSA-N 2,3,5-triiodobenzoic acid Chemical class OC(=O)C1=CC(I)=CC(I)=C1I ZMZGFLUUZLELNE-UHFFFAOYSA-N 0.000 claims description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 67
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 57
- 239000000243 solution Substances 0.000 description 55
- 239000000047 product Substances 0.000 description 52
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 45
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 38
- -1 N -methylglucamine salts Chemical class 0.000 description 35
- 238000003756 stirring Methods 0.000 description 33
- 239000002253 acid Substances 0.000 description 26
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 25
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 23
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- 239000003610 charcoal Substances 0.000 description 19
- 238000006243 chemical reaction Methods 0.000 description 17
- 239000003795 chemical substances by application Substances 0.000 description 17
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 16
- 238000000034 method Methods 0.000 description 16
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 15
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 13
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 13
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 10
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 10
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 9
- 239000011575 calcium Substances 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- 238000009608 myelography Methods 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 7
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 7
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 7
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- 229960000583 acetic acid Drugs 0.000 description 7
- 150000003863 ammonium salts Chemical class 0.000 description 7
- 239000007864 aqueous solution Substances 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 229910001425 magnesium ion Inorganic materials 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- GGGDNPWHMNJRFN-UHFFFAOYSA-N metrizoic acid Chemical compound CC(=O)N(C)C1=C(I)C(NC(C)=O)=C(I)C(C(O)=O)=C1I GGGDNPWHMNJRFN-UHFFFAOYSA-N 0.000 description 7
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 210000001175 cerebrospinal fluid Anatomy 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 239000012362 glacial acetic acid Substances 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 238000006386 neutralization reaction Methods 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- 159000000000 sodium salts Chemical class 0.000 description 6
- 229910052791 calcium Inorganic materials 0.000 description 5
- 229910001424 calcium ion Inorganic materials 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 150000004820 halides Chemical class 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 229910001415 sodium ion Inorganic materials 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 238000012800 visualization Methods 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 4
- 210000000748 cardiovascular system Anatomy 0.000 description 4
- 230000002526 effect on cardiovascular system Effects 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 238000002329 infrared spectrum Methods 0.000 description 4
- 229910052740 iodine Inorganic materials 0.000 description 4
- 159000000003 magnesium salts Chemical class 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 238000004809 thin layer chromatography Methods 0.000 description 4
- 231100000419 toxicity Toxicity 0.000 description 4
- 230000001988 toxicity Effects 0.000 description 4
- URNNVACKJFTYLF-UHFFFAOYSA-N 3-amino-2,4,6-triiodo-5-methoxycarbonylbenzoic acid Chemical compound NC=1C(=C(C(=O)O)C(=C(C1I)C(=O)OC)I)I URNNVACKJFTYLF-UHFFFAOYSA-N 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 3
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 230000026045 iodination Effects 0.000 description 3
- 238000006192 iodination reaction Methods 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 229960004712 metrizoic acid Drugs 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 238000004816 paper chromatography Methods 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 230000002792 vascular Effects 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- SUJWEKSRVRUWPR-LDCOXPBNSA-N 3-acetamido-2,4,6-triiodo-5-[methyl-[(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl]carbamoyl]benzoic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CN(C)C(=O)C1=C(I)C(NC(C)=O)=C(I)C(C(O)=O)=C1I SUJWEKSRVRUWPR-LDCOXPBNSA-N 0.000 description 2
- NBDAHKQJXVLAID-UHFFFAOYSA-N 5-nitroisophthalic acid Chemical compound OC(=O)C1=CC(C(O)=O)=CC([N+]([O-])=O)=C1 NBDAHKQJXVLAID-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 239000012670 alkaline solution Substances 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 2
- 238000002585 cerebral angiography Methods 0.000 description 2
- 239000002178 crystalline material Substances 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 150000003949 imides Chemical class 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- XTODKGPQRKGHBA-UHFFFAOYSA-N methyl 2-carbonochloridoyl-4-nitrobenzoate Chemical compound COC(=O)C1=CC=C([N+]([O-])=O)C=C1C(Cl)=O XTODKGPQRKGHBA-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- COCJIVDXXCJXND-UHFFFAOYSA-M sodium;iodomethanesulfonate Chemical compound [Na+].[O-]S(=O)(=O)CI COCJIVDXXCJXND-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000011343 solid material Substances 0.000 description 2
- 210000002330 subarachnoid space Anatomy 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- CRVYPNHLIAWRNV-UHFFFAOYSA-N 2,4,6-triiodobenzoic acid Chemical compound OC(=O)C1=C(I)C=C(I)C=C1I CRVYPNHLIAWRNV-UHFFFAOYSA-N 0.000 description 1
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 1
- ZPVQUACUWKFQRQ-UHFFFAOYSA-N 3-(methylamino)-5-nitrobenzoic acid Chemical compound CNC1=CC(C(O)=O)=CC([N+]([O-])=O)=C1 ZPVQUACUWKFQRQ-UHFFFAOYSA-N 0.000 description 1
- KCRICXDTCPODFH-UHFFFAOYSA-N 3-[acetyl(2,3-dihydroxypropyl)amino]-5-[acetyl(methyl)amino]-2,4,6-triiodobenzoic acid Chemical compound OC(CN(C(C)=O)C=1C(=C(C(=O)O)C(=C(C=1I)N(C(C)=O)C)I)I)CO KCRICXDTCPODFH-UHFFFAOYSA-N 0.000 description 1
- KIZMHOODLWAXQV-UHFFFAOYSA-N 3-amino-2,4,6-triiodo-5-[methyl(propanoyl)amino]benzoic acid Chemical compound CCC(=O)N(C)C1=C(I)C(N)=C(I)C(C(O)=O)=C1I KIZMHOODLWAXQV-UHFFFAOYSA-N 0.000 description 1
- LYCCVBLUKJRDOF-UHFFFAOYSA-N 3-amino-4-nitrobenzoic acid Chemical compound NC1=CC(C(O)=O)=CC=C1[N+]([O-])=O LYCCVBLUKJRDOF-UHFFFAOYSA-N 0.000 description 1
- QGGKQIDRZUUHAR-UHFFFAOYSA-N 3-amino-5-methoxycarbonylbenzoic acid Chemical compound COC(=O)C1=CC(N)=CC(C(O)=O)=C1 QGGKQIDRZUUHAR-UHFFFAOYSA-N 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 208000006740 Aseptic Meningitis Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 101100294106 Caenorhabditis elegans nhr-3 gene Proteins 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- 206010051290 Central nervous system lesion Diseases 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZFIVKAOQEXOYFY-UHFFFAOYSA-N Diepoxybutane Chemical compound C1OC1C1OC1 ZFIVKAOQEXOYFY-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical compound OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 1
- 229910004373 HOAc Inorganic materials 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- UXIGWFXRQKWHHA-UHFFFAOYSA-N Iotalamic acid Chemical compound CNC(=O)C1=C(I)C(NC(C)=O)=C(I)C(C(O)=O)=C1I UXIGWFXRQKWHHA-UHFFFAOYSA-N 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- 206010027201 Meningitis aseptic Diseases 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical compound CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 1
- SKVAMSFQUUXELW-UHFFFAOYSA-N NC=1C(=C(C(=O)Cl)C(=C(C=1I)C(=O)OC)I)I Chemical compound NC=1C(=C(C(=O)Cl)C(=C(C=1I)C(=O)OC)I)I SKVAMSFQUUXELW-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 150000001348 alkyl chlorides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 238000005937 allylation reaction Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 210000004289 cerebral ventricle Anatomy 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000004042 decolorization Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 125000004990 dihydroxyalkyl group Chemical group 0.000 description 1
- 229960001484 edetic acid Drugs 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000011874 heated mixture Substances 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical group I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000000640 hydroxylating effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- QQVIHTHCMHWDBS-UHFFFAOYSA-L isophthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC(C([O-])=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-L 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 150000002924 oxiranes Chemical class 0.000 description 1
- 229910003445 palladium oxide Inorganic materials 0.000 description 1
- JQPTYAILLJKUCY-UHFFFAOYSA-N palladium(ii) oxide Chemical compound [O-2].[Pd+2] JQPTYAILLJKUCY-UHFFFAOYSA-N 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000004297 potassium metabisulphite Substances 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000004289 sodium hydrogen sulphite Substances 0.000 description 1
- KICDJMUQRRNNKS-UHFFFAOYSA-M sodium;chloride;hydroiodide Chemical compound [Na+].[Cl-].I KICDJMUQRRNNKS-UHFFFAOYSA-M 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003461 sulfonyl halides Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K49/00—Preparations for testing in vivo
- A61K49/04—X-ray contrast preparations
- A61K49/0433—X-ray contrast preparations containing an organic halogenated X-ray contrast-enhancing agent
Landscapes
- Health & Medical Sciences (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB27497/68A GB1275745A (en) | 1968-06-10 | 1968-06-10 | 2,4,6-triiodobenzoic acid derivatives and their use as x-ray contrast agents |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO122430B true NO122430B (enFirst) | 1971-06-28 |
Family
ID=10260547
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO2371/69A NO122430B (enFirst) | 1968-06-10 | 1969-06-09 |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3702866A (enFirst) |
| JP (1) | JPS4828895B1 (enFirst) |
| BE (1) | BE734257A (enFirst) |
| CH (2) | CH545770A (enFirst) |
| DE (1) | DE1928838A1 (enFirst) |
| DK (1) | DK127105B (enFirst) |
| FR (1) | FR2010563A1 (enFirst) |
| GB (1) | GB1275745A (enFirst) |
| NL (1) | NL150776B (enFirst) |
| NO (1) | NO122430B (enFirst) |
| SE (1) | SE373571B (enFirst) |
Families Citing this family (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2074734A1 (en) * | 1970-01-22 | 1971-10-08 | Guerbet Lab Andre | 3-(n-2-hydroxyethylcarbamyl)-5-(n-methylacetamido)2,4,6-triiodo- benz - acid - radiographic contrast agent |
| NL7102816A (enFirst) * | 1970-03-12 | 1971-09-14 | ||
| FR2085636B1 (enFirst) * | 1970-04-15 | 1973-06-08 | Guerbet Lab Andre | |
| FR2132530B1 (enFirst) * | 1971-04-07 | 1974-08-02 | Guerbet Lab Andre | |
| BE788054A (fr) * | 1971-08-26 | 1973-02-26 | Bracco Ind Chimica Spa | Nouvel agent de contraste radiographique et procede pour le preparer |
| US4138589A (en) * | 1974-06-17 | 1979-02-06 | Mallinckrodt, Inc. | Substituted isophthalamic acids |
| GB1495679A (en) * | 1974-06-17 | 1977-12-21 | Mallinckrodt Inc | Substituted isophthalamic acids |
| JPS5124084U (enFirst) * | 1974-08-12 | 1976-02-21 | ||
| JPS523288U (enFirst) * | 1975-06-24 | 1977-01-11 | ||
| US4125599A (en) * | 1976-08-19 | 1978-11-14 | Mallinckrodt, Inc. | X-ray contrast agents |
| JPS5687034U (enFirst) * | 1979-12-07 | 1981-07-13 | ||
| US4584401A (en) * | 1983-10-20 | 1986-04-22 | Biophysica Foundation | Methods and compositions involving polyhydroxylated polyiodo non-ionic contrast media |
| US5035877A (en) * | 1985-08-09 | 1991-07-30 | Cook Imaging Corporation | Non-ionic contrast media from ionic contrast media |
| FR2610935B1 (fr) * | 1987-02-13 | 1989-09-01 | Guerbet Sa | Polymeres iodes, leurs procedes de preparation et leurs applications comme produits de contraste |
| JPS6446041U (enFirst) * | 1987-05-19 | 1989-03-22 | ||
| JPH01170103U (enFirst) * | 1988-05-17 | 1989-12-01 | ||
| US5603216A (en) * | 1994-08-02 | 1997-02-18 | Corning Incorporated | By-pass adsorber system |
| WO1997022365A1 (en) * | 1995-12-19 | 1997-06-26 | Bracco Research S.A. | Compositions comprising tricodobenzene polymers for imaging the gastrointestinal tract |
| US6723746B2 (en) * | 1998-09-08 | 2004-04-20 | Veritas Pharmaceuticals, Inc. | Functional radiographic imaging methods and agents |
| US6751290B2 (en) | 1998-09-08 | 2004-06-15 | Veritas Pharmaceuticals, Inc. | Radiographic assessment of tissue after exposure to a compound |
| US20010038682A1 (en) * | 1998-09-08 | 2001-11-08 | Jesse Salb | Radiographic assessment of tissue response to compounds |
| US20040170561A1 (en) * | 1998-09-08 | 2004-09-02 | Jesse Salb | Functional radiographic imaging methods and agents |
| US6226352B1 (en) * | 1998-09-08 | 2001-05-01 | Veritas Pharmaceuticals, Inc. | System and method for radiographic imaging of tissue |
| CN1314659C (zh) * | 2006-01-24 | 2007-05-09 | 江苏省原子医学研究所 | 一种碘羟拉酸的制备方法 |
| EP2151466A1 (en) | 2008-08-01 | 2010-02-10 | SiNatur GmbH | Biologically active silicic acid |
| CN101948404B (zh) * | 2010-09-10 | 2013-04-24 | 江苏省原子医学研究所 | 一种碘昔兰中间体的制备方法 |
| EP2471895B1 (en) | 2011-01-04 | 2016-03-09 | Phillips 66 Company | Process to partially upgrade slurry oil |
| CN104812703B (zh) | 2012-12-07 | 2018-05-29 | 埃克森美孚研究工程公司 | 具有改进形态的zsm-5晶体的合成 |
| WO2017105869A1 (en) | 2015-12-16 | 2017-06-22 | Exxonmobil Research And Engineering Company | Methods for upgrading olefin-containing feeds |
| WO2018111543A1 (en) | 2016-12-15 | 2018-06-21 | Exxonmobil Research And Engineering Company | Efficient process for converting heavy oil to gasoline |
| US20180171242A1 (en) | 2016-12-15 | 2018-06-21 | Exxonmobil Research And Engineering Company | Efficient process for upgrading paraffins to gasoline |
| WO2018111538A1 (en) | 2016-12-15 | 2018-06-21 | Exxonmobil Research And Engineering Company | Upgrading hydrocarbons using stoichiometric or below stoichiometric air for catalyst regeneration |
| WO2018111541A1 (en) | 2016-12-15 | 2018-06-21 | Exxonmobil Research And Engineering Company | Process for improving gasoline quality from cracked naphtha |
| US20180170823A1 (en) | 2016-12-15 | 2018-06-21 | Exxonmobil Research And Engineering Company | Efficient process for converting methanol to gasoline |
| WO2018111544A1 (en) | 2016-12-15 | 2018-06-21 | Exxonmobil Research And Engineering Company | Upgrading fuel gas using stoichiometric air for catalyst regeneration |
| CN110015972B (zh) * | 2019-03-13 | 2022-05-03 | 台州学院 | 一种碘普罗胺中间体的制备方法 |
| CN110028419B (zh) * | 2019-04-30 | 2022-01-21 | 台州学院 | 一种碘普罗胺的制备方法 |
-
1968
- 1968-06-10 GB GB27497/68A patent/GB1275745A/en not_active Expired
-
1969
- 1969-06-06 DE DE19691928838 patent/DE1928838A1/de active Pending
- 1969-06-09 FR FR6918916A patent/FR2010563A1/fr not_active Withdrawn
- 1969-06-09 CH CH579972A patent/CH545770A/xx not_active IP Right Cessation
- 1969-06-09 DK DK309869AA patent/DK127105B/da not_active IP Right Cessation
- 1969-06-09 CH CH869469A patent/CH523225A/de not_active IP Right Cessation
- 1969-06-09 US US831696A patent/US3702866A/en not_active Expired - Lifetime
- 1969-06-09 BE BE734257D patent/BE734257A/xx not_active IP Right Cessation
- 1969-06-09 JP JP44044699A patent/JPS4828895B1/ja active Pending
- 1969-06-09 SE SE6908185A patent/SE373571B/xx unknown
- 1969-06-09 NO NO2371/69A patent/NO122430B/no unknown
- 1969-06-09 NL NL696908767A patent/NL150776B/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2010563A1 (enFirst) | 1970-02-20 |
| JPS4828895B1 (enFirst) | 1973-09-05 |
| DE1928838A1 (de) | 1969-12-11 |
| BE734257A (enFirst) | 1969-12-09 |
| CH523225A (de) | 1972-05-31 |
| GB1275745A (en) | 1972-05-24 |
| DK127105B (da) | 1973-09-24 |
| SE373571B (sv) | 1975-02-10 |
| NL6908767A (enFirst) | 1969-12-12 |
| US3702866A (en) | 1972-11-14 |
| CH545770A (enFirst) | 1974-02-15 |
| NL150776B (nl) | 1976-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO122430B (enFirst) | ||
| US3701771A (en) | N-(2,4,6-triiodobenzoyl)-sugar amines | |
| US4021481A (en) | Amido derivatives of 2,4,6-triiodobenzoic acids containing at least one N-hydroxyalkyl and at least two hydroxyl groups | |
| DE2461601C2 (de) | 3-Pyrrolidino-4-phenoxy-5-sulfamoylbenzoesäureester und Verfahren zu ihrer Herstellung | |
| US4364921A (en) | Novel triiodinated isophthalic acid diamides as nonionic X-ray contrast media | |
| DE3731542A1 (de) | Neue dicarbonsaeure-bis(3,5-dicarbamoyl-2,4,6-triiod-anilide), verfahren zu deren herstellung sowie diese enthaltende roentgenkontrastmittel | |
| US3178473A (en) | Process for the n-alkylation of acyl anilides halogen substituted in the nucleus | |
| NO145304B (no) | Fanganordning for lastevogn paa skraabaneheis | |
| DE69807138T2 (de) | Benzoamid-Derivat, antiulcus und antibakterielle Mittel | |
| CH631697A5 (de) | Verfahren zur herstellung neuer jodierter isophthalamsaeure-derivate. | |
| DE3689330T2 (de) | Nichtionische polyolkontrastmittel aus ionischen kontrastmitteln. | |
| DE2409675C3 (de) | 5-Hydroxytryptophan-Derivate und Verfahren zu ihrer Herstellung | |
| DE2335827C2 (de) | 2β-Hydroxy-3α-aminosteroide und Verfahren zu ihrer Herstellung | |
| AT209895B (de) | Verfahren zur Herstellung von 3-Amino-2,4,6-trijodbenzoylverbindungen | |
| NO133427B (enFirst) | ||
| DE2029821A1 (de) | Neue Halogensulfonamide | |
| DE2218647A1 (de) | Neues verfahren zur herstellung von n-(trans-4-hydroxy-cyclohexyl)-(2-amino3,5-dibrom-benzyl)-amin | |
| CH500941A (de) | Verfahren zur Herstellung von Phenäthylaminderivaten | |
| AT344335B (de) | Verfahren zur herstellung von neuen derivaten des vitamins d2 bzw. d3 und des epi-vitamins d2 bzw. d3 | |
| DE2132614A1 (de) | Jodierte N-Acyl-Derivate von aromatischen Amino-Carbonsaeuren | |
| AT248037B (de) | Verfahren zur Herstellung des neuen Lipoylpyridoxamins | |
| KR960007801B1 (ko) | 비이온성 요오드 치환 x선 조영물의 제조방법 | |
| AT347448B (de) | Verfahren zur herstellung von n-alkenyl-2- aminomethyl-pyrrolidinen | |
| AT308754B (de) | Verfahren zur Herstellung von Benzodiazepinderivaten und von Säureadditionssalzen hievon | |
| US1555217A (en) | Process for obtaining amino-benzoyl derivatives of 2-methyl-4-diethylamino-pentanol-5 and 2-methyl-4-dimethyl-amino-pentanol-5 |