NO121950B - - Google Patents
Download PDFInfo
- Publication number
- NO121950B NO121950B NO168123A NO16812367A NO121950B NO 121950 B NO121950 B NO 121950B NO 168123 A NO168123 A NO 168123A NO 16812367 A NO16812367 A NO 16812367A NO 121950 B NO121950 B NO 121950B
- Authority
- NO
- Norway
- Prior art keywords
- lower alkyl
- hydrogen
- phenyl
- benzyl
- formula
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 13
- 150000003839 salts Chemical class 0.000 claims description 13
- -1 trifluoromethyl radicals Chemical class 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 7
- 125000005283 haloketone group Chemical group 0.000 claims description 7
- 150000001350 alkyl halides Chemical class 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical group [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 150000002431 hydrogen Chemical group 0.000 claims description 3
- 150000007522 mineralic acids Chemical class 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 2
- 101150009274 nhr-1 gene Proteins 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 150000002576 ketones Chemical class 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid group Chemical class S(O)(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- FNEQHKCQXDKYEO-UHFFFAOYSA-N 1-benzylpyrrole Chemical compound C1=CC=CN1CC1=CC=CC=C1 FNEQHKCQXDKYEO-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- 239000002269 analeptic agent Substances 0.000 description 2
- 230000003555 analeptic effect Effects 0.000 description 2
- 230000000202 analgesic effect Effects 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000003179 convulsant agent Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 150000003233 pyrroles Chemical class 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- GEZGAZKEOUKLBR-UHFFFAOYSA-N 1-phenylpyrrole Chemical compound C1=CC=CN1C1=CC=CC=C1 GEZGAZKEOUKLBR-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 1
- 238000003309 Hoesch reaction Methods 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 108010058846 Ovalbumin Proteins 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N alpha-methyl toluene Natural products CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 230000002322 anti-exudative effect Effects 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-M carbonochloridate Chemical compound [O-]C(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-M 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 231100000132 chronic toxicity testing Toxicity 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- QFXZANXYUCUTQH-UHFFFAOYSA-N ethynol Chemical compound OC#C QFXZANXYUCUTQH-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000002489 hematologic effect Effects 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 229940092253 ovalbumin Drugs 0.000 description 1
- 231100000915 pathological change Toxicity 0.000 description 1
- 230000036285 pathological change Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- TURAMGVWNUTQKH-UHFFFAOYSA-N propa-1,2-dien-1-one Chemical compound C=C=C=O TURAMGVWNUTQKH-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 229940125723 sedative agent Drugs 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 231100000820 toxicity test Toxicity 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/323—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to the ring nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/335—Radicals substituted by nitrogen atoms not forming part of a nitro radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyridine Compounds (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB21779/66A GB1154744A (en) | 1966-05-17 | 1966-05-17 | Disubstituted Aminoethanols |
| GB21778/66A GB1154743A (en) | 1966-05-17 | 1966-05-17 | Aminoethanols |
| GB21777/66A GB1154742A (en) | 1966-05-17 | 1966-05-17 | Pyrrylamino Ketones |
| GB53844/68A GB1154745A (en) | 1966-05-17 | 1966-05-17 | Haloketones |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO121950B true NO121950B (Sortimente) | 1971-05-03 |
Family
ID=27448540
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO168123A NO121950B (Sortimente) | 1966-05-17 | 1967-05-12 | |
| NO168124A NO123034B (Sortimente) | 1966-05-17 | 1967-05-12 |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO168124A NO123034B (Sortimente) | 1966-05-17 | 1967-05-12 |
Country Status (18)
| Country | Link |
|---|---|
| US (3) | US3539589A (Sortimente) |
| AT (1) | AT278770B (Sortimente) |
| BE (2) | BE698567A (Sortimente) |
| BR (1) | BR6789534D0 (Sortimente) |
| CH (2) | CH484108A (Sortimente) |
| CY (1) | CY634A (Sortimente) |
| DE (4) | DE1720018B2 (Sortimente) |
| DK (2) | DK133943B (Sortimente) |
| ES (1) | ES340591A1 (Sortimente) |
| FI (2) | FI48348C (Sortimente) |
| FR (3) | FR6769M (Sortimente) |
| GB (4) | GB1154742A (Sortimente) |
| IL (2) | IL27933A (Sortimente) |
| LU (1) | LU53619A1 (Sortimente) |
| NL (3) | NL141087B (Sortimente) |
| NO (2) | NO121950B (Sortimente) |
| SE (2) | SE313565B (Sortimente) |
| YU (2) | YU32531B (Sortimente) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1345872A (en) * | 1970-09-03 | 1974-02-06 | Wyeth John & Brother Ltd | Amino-and acylamino-pyridine and hydropyridine derivatives |
| JPS5549575B2 (Sortimente) * | 1971-10-30 | 1980-12-12 | ||
| BE790747A (fr) * | 1971-10-30 | 1973-02-15 | Whitefin Holding Sa | Stereo-isomeres du 1-(1'-(0-chloro-benzyl)-pyrrol-2'-yl) -2-dibutyl sec.-amino-ethanol et procede pour leur preparation |
| US3972925A (en) * | 1974-10-29 | 1976-08-03 | Eli Lilly And Company | N-perfluoroacyl-amino acids and derivatives thereof |
| US4029672A (en) * | 1976-02-26 | 1977-06-14 | American Hoechst Corporation | Aminoalkylpyrrolobenzoxazalkanes |
| DE2615117B2 (de) * | 1976-04-07 | 1978-07-20 | Siemens Ag, 1000 Berlin Und 8000 Muenchen | Mit einer Überspannungsschutzanordnung versehener konstantspannungsgeregelter bürstenloser Synchrongenerator |
| BE848465A (fr) | 1976-11-18 | 1977-03-16 | Stereo-isomeres de 1-(1'-benzyl-2' pyrryl)-2-disec.butylaminoethanols a activite analgesique et preparations pharmaceutiques qui les contiennent | |
| US4560770A (en) * | 1983-02-09 | 1985-12-24 | Ciba-Geigy Corporation | Pesticidal compositions based on N-pyrrolylphenyl-N'-benzoylurea compounds |
| US4667039A (en) * | 1983-11-07 | 1987-05-19 | Hoechst-Roussel Pharmaceuticals Inc. | 11-substituted 5H,11H-pyrrolo(2,1-C) (1,4)benzoxazepines as antipsychotic and analgesic agents |
| US5360811A (en) * | 1990-03-13 | 1994-11-01 | Hoechst-Roussel Pharmaceuticals Incorporated | 1-alkyl-, 1-alkenyl-, and 1-alkynylaryl-2-amino-1,3-propanediols and related compounds as anti-inflammatory agents |
| DE4020851A1 (de) * | 1990-06-29 | 1992-01-02 | Cassella Ag | 2-(aminoalkyl)-pyrrolaldehyde, verfahren zu ihrer herstellung und ihre verwendung |
| CN1643587A (zh) * | 2002-03-19 | 2005-07-20 | 拜尔化学品股份公司 | 在光数据载体信息层中作为光吸收化合物的方酸类染料 |
| GB0711776D0 (en) * | 2007-06-18 | 2007-07-25 | Syngenta Participations Ag | Substituted aromatic heterocyclic compounds as fungicides |
| BR122023023216A2 (pt) | 2018-06-27 | 2024-02-20 | Proteostasis Therapeutics, Inc. | Compostos, composição farmacêutica e uso de uma quantidade eficaz de um composto |
| WO2020006269A1 (en) * | 2018-06-27 | 2020-01-02 | Proteostasis Therapeutics, Inc. | Proteasome activity enhancing compounds |
-
1966
- 1966-05-17 GB GB21777/66A patent/GB1154742A/en not_active Expired
- 1966-05-17 GB GB21778/66A patent/GB1154743A/en not_active Expired
- 1966-05-17 GB GB53844/68A patent/GB1154745A/en not_active Expired
- 1966-05-17 GB GB21779/66A patent/GB1154744A/en not_active Expired
-
1967
- 1967-05-08 LU LU53619D patent/LU53619A1/xx unknown
- 1967-05-08 IL IL27933A patent/IL27933A/en unknown
- 1967-05-08 IL IL27934A patent/IL27934A/xx unknown
- 1967-05-08 US US636649A patent/US3539589A/en not_active Expired - Lifetime
- 1967-05-08 US US636625A patent/US3558652A/en not_active Expired - Lifetime
- 1967-05-11 DE DE19671720018 patent/DE1720018B2/de active Granted
- 1967-05-12 DE DE1795841A patent/DE1795841C3/de not_active Expired
- 1967-05-12 NO NO168123A patent/NO121950B/no unknown
- 1967-05-12 NO NO168124A patent/NO123034B/no unknown
- 1967-05-12 DE DE1720019A patent/DE1720019C3/de not_active Expired
- 1967-05-12 AT AT448267A patent/AT278770B/de not_active IP Right Cessation
- 1967-05-12 DE DE1720020A patent/DE1720020B2/de active Granted
- 1967-05-16 DK DK254767AA patent/DK133943B/da unknown
- 1967-05-16 DK DK254867A patent/DK132411C/da active
- 1967-05-16 YU YU0973/67A patent/YU32531B/xx unknown
- 1967-05-16 ES ES340591A patent/ES340591A1/es not_active Expired
- 1967-05-17 BE BE698567D patent/BE698567A/xx unknown
- 1967-05-17 CH CH694267A patent/CH484108A/de not_active IP Right Cessation
- 1967-05-17 SE SE6867/67A patent/SE313565B/xx unknown
- 1967-05-17 FI FI671407A patent/FI48348C/fi active
- 1967-05-17 FI FI671408A patent/FI48349C/fi active
- 1967-05-17 BR BR189534/67A patent/BR6789534D0/pt unknown
- 1967-05-17 NL NL676706839A patent/NL141087B/xx not_active IP Right Cessation
- 1967-05-17 NL NL6706840.A patent/NL156394B/xx not_active IP Right Cessation
- 1967-05-17 NL NL676706841A patent/NL149375B/xx not_active IP Right Cessation
- 1967-05-17 BE BE698568D patent/BE698568A/xx unknown
- 1967-05-17 FR FR106669A patent/FR6769M/fr not_active Expired
- 1967-05-17 FR FR106670A patent/FR6770M/fr not_active Expired
- 1967-05-17 CH CH694067A patent/CH484107A/de not_active IP Right Cessation
- 1967-05-17 SE SE6866/67A patent/SE313564B/xx unknown
- 1967-05-17 FR FR106668A patent/FR6663M/fr not_active Expired
-
1970
- 1970-10-05 US US78262A patent/US3706750A/en not_active Expired - Lifetime
-
1972
- 1972-02-23 CY CY63472A patent/CY634A/xx unknown
-
1973
- 1973-09-04 YU YU2345/73A patent/YU36700B/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO121950B (Sortimente) | ||
| JPS582936B2 (ja) | 5↓−アロイルピロ−ル酢酸およびその塩類の製法 | |
| DE2336399A1 (de) | Substituierte benzamide, verfahren zu deren herstellung und diese verbindungen als wirkstoffe enthaltende pharmazeutische zubereitungen | |
| US4528393A (en) | Derivatives having expectorant activity, the procedure for their preparation and the pharmaceutical compositions which contain them | |
| NO782108L (no) | Nye hexahydropyrimidiner, fremgangsmaate til deres fremstilling og legemidler som inneholder disse forbindelser | |
| CS241016B2 (en) | Method of new n-(2-(or)pyrrolidinylmethyl)-benzamides production substituted in positions 2,3,4,5,6 | |
| NO163597B (no) | Styreinnretning for et ett-eller tosporet kjoeretoey. | |
| DK152752B (da) | Fremgangsmaade til fremstilling af l-sulpirid | |
| NO124430B (Sortimente) | ||
| JPS6055503B2 (ja) | 新規置換ベンズアミド,その製造法およびこれを有効成分とする鎮吐剤 | |
| NO151387B (no) | Innstillingsinnretning for en elektronisk digitalindikator | |
| US3073826A (en) | 3-pyrrolidylmethyl-4-quinazolones | |
| DE1720033A1 (de) | Neue Indolderivate und Verfahren zu ihrer Herstellung | |
| SE450704B (sv) | 3,7-diazabicyklo /3,3,1/ nonaner, forfarande for framstellning och farmaceutisk beredning derav | |
| US3972994A (en) | Disubstituted azabicycloalkanes | |
| NO128025B (Sortimente) | ||
| NO883263L (no) | Fremgangsmaate for fremstilling av terapeutisk aktive benzimidazol-derivater. | |
| US3980674A (en) | 2,3-Disubstituted 7-oxabicyclo-[2.2.1]-5-heptene | |
| US3426017A (en) | Sulfonylurea compounds | |
| US2980693A (en) | Methods for producing same | |
| US2793212A (en) | Substituted benzamidopiperidinopropanes | |
| KR880001715B1 (ko) | 1-푸릴-3,4-디하이드로이소퀴놀린의 제조방법 | |
| US3025294A (en) | New quaternary nu-(substituted-aminoalkyl)-tetrachloroisoindolines | |
| US3378592A (en) | Process for the production of 3, 4-dihydroxybenzyloxyaminehydrobromide | |
| US3576819A (en) | Esters of alpha-(1-substituted-3-pyrrolidinyl)-alpha-phenyl acetic acid |