NL8301656A - Nieuwe aromatische alkaanderivaten en werkwijze voor de bereiding hiervan, evenals insecticidale en acaricidale middelen die deze derivaat als actieve stof bevatten. - Google Patents
Nieuwe aromatische alkaanderivaten en werkwijze voor de bereiding hiervan, evenals insecticidale en acaricidale middelen die deze derivaat als actieve stof bevatten. Download PDFInfo
- Publication number
- NL8301656A NL8301656A NL8301656A NL8301656A NL8301656A NL 8301656 A NL8301656 A NL 8301656A NL 8301656 A NL8301656 A NL 8301656A NL 8301656 A NL8301656 A NL 8301656A NL 8301656 A NL8301656 A NL 8301656A
- Authority
- NL
- Netherlands
- Prior art keywords
- meaning
- methylpentane
- phenoxy
- group
- methyl
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 47
- 238000000034 method Methods 0.000 title claims description 27
- 230000000749 insecticidal effect Effects 0.000 title claims description 21
- 230000000895 acaricidal effect Effects 0.000 title claims description 16
- 239000013543 active substance Substances 0.000 title claims description 15
- 239000003795 chemical substances by application Substances 0.000 title claims description 14
- UNNKKUDWEASWDN-UHFFFAOYSA-N alkannin Natural products CC(=CCC(O)c1cc(O)c2C(=O)C=CC(=O)c2c1O)C UNNKKUDWEASWDN-UHFFFAOYSA-N 0.000 title 1
- -1 Aromatic alkane Chemical class 0.000 claims description 674
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 168
- 150000001875 compounds Chemical class 0.000 claims description 112
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 112
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 38
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 37
- QDKWLJJOYIFEBS-UHFFFAOYSA-N 1-fluoro-4-$l^{1}-oxidanylbenzene Chemical group [O]C1=CC=C(F)C=C1 QDKWLJJOYIFEBS-UHFFFAOYSA-N 0.000 claims description 31
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 20
- 241000238631 Hexapoda Species 0.000 claims description 17
- 239000002904 solvent Substances 0.000 claims description 16
- 239000000284 extract Substances 0.000 claims description 15
- 239000000126 substance Substances 0.000 claims description 15
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- 150000001299 aldehydes Chemical class 0.000 claims description 11
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- 125000005843 halogen group Chemical group 0.000 claims description 10
- 229910052799 carbon Inorganic materials 0.000 claims description 9
- 150000001728 carbonyl compounds Chemical class 0.000 claims description 9
- 150000002576 ketones Chemical class 0.000 claims description 9
- 150000001336 alkenes Chemical class 0.000 claims description 8
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 8
- NYPJDWWKZLNGGM-UHFFFAOYSA-N fenvalerate Chemical compound C=1C=C(Cl)C=CC=1C(C(C)C)C(=O)OC(C#N)C(C=1)=CC=CC=1OC1=CC=CC=C1 NYPJDWWKZLNGGM-UHFFFAOYSA-N 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 7
- 125000001624 naphthyl group Chemical group 0.000 claims description 7
- 230000008569 process Effects 0.000 claims description 7
- 230000009467 reduction Effects 0.000 claims description 7
- 125000001188 haloalkyl group Chemical group 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 241000238876 Acari Species 0.000 claims description 5
- 238000006243 chemical reaction Methods 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 3
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 3
- 150000001298 alcohols Chemical class 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 3
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 3
- 150000002825 nitriles Chemical class 0.000 claims description 3
- 239000004094 surface-active agent Substances 0.000 claims description 3
- 125000006020 2-methyl-1-propenyl group Chemical group 0.000 claims description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims description 2
- PFEFOHMLVFUELJ-UHFFFAOYSA-N 3-sulfanylideneisoindol-1-one Chemical compound C1=CC=C2C(=O)NC(=S)C2=C1 PFEFOHMLVFUELJ-UHFFFAOYSA-N 0.000 claims description 2
- RDHHZPRHIKNBBI-UHFFFAOYSA-N 3a,7a-dihydroisoindole-1,3-dione Chemical compound C1=CC=CC2C(=O)NC(=O)C21 RDHHZPRHIKNBBI-UHFFFAOYSA-N 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- UOAMTSKGCBMZTC-UHFFFAOYSA-N dicofol Chemical compound C=1C=C(Cl)C=CC=1C(C(Cl)(Cl)Cl)(O)C1=CC=C(Cl)C=C1 UOAMTSKGCBMZTC-UHFFFAOYSA-N 0.000 claims description 2
- 230000003647 oxidation Effects 0.000 claims description 2
- 238000007254 oxidation reaction Methods 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 claims description 2
- 125000005554 pyridyloxy group Chemical group 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 125000006019 1-methyl-1-propenyl group Chemical group 0.000 claims 2
- IAQRGUVFOMOMEM-UHFFFAOYSA-N but-2-ene Chemical compound CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 claims 2
- HCJLVWUMMKIQIM-UHFFFAOYSA-M sodium;2,3,4,5,6-pentachlorophenolate Chemical compound [Na+].[O-]C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl HCJLVWUMMKIQIM-UHFFFAOYSA-M 0.000 claims 2
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims 1
- CIFFBTOJCKSRJY-UHFFFAOYSA-N 3α,4,7,7α-tetrahydro-1h-isoindole-1,3(2h)-dione Chemical compound C1C=CCC2C(=O)NC(=O)C21 CIFFBTOJCKSRJY-UHFFFAOYSA-N 0.000 claims 1
- 229910014033 C-OH Inorganic materials 0.000 claims 1
- 229910014570 C—OH Inorganic materials 0.000 claims 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 1
- XNMQEEKYCVKGBD-UHFFFAOYSA-N dimethylacetylene Natural products CC#CC XNMQEEKYCVKGBD-UHFFFAOYSA-N 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- AFABGHUZZDYHJO-UHFFFAOYSA-N dimethyl butane Natural products CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 198
- 239000000203 mixture Substances 0.000 description 91
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 39
- VLKZOEOYAKHREP-UHFFFAOYSA-N methyl pentane Natural products CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 37
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 33
- 238000009472 formulation Methods 0.000 description 27
- 239000000243 solution Substances 0.000 description 26
- 239000011541 reaction mixture Substances 0.000 description 24
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 22
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 20
- 239000000741 silica gel Substances 0.000 description 20
- 229910002027 silica gel Inorganic materials 0.000 description 20
- 238000004440 column chromatography Methods 0.000 description 19
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 15
- 239000003480 eluent Substances 0.000 description 15
- YWAKXRMUMFPDSH-UHFFFAOYSA-N pentene Chemical compound CCCC=C YWAKXRMUMFPDSH-UHFFFAOYSA-N 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000002917 insecticide Substances 0.000 description 12
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 12
- QMMOXUPEWRXHJS-UHFFFAOYSA-N pentene-2 Natural products CCC=CC QMMOXUPEWRXHJS-UHFFFAOYSA-N 0.000 description 12
- 239000001294 propane Substances 0.000 description 12
- 241000251468 Actinopterygii Species 0.000 description 10
- 238000001816 cooling Methods 0.000 description 10
- 240000007594 Oryza sativa Species 0.000 description 9
- 230000000694 effects Effects 0.000 description 9
- 239000004495 emulsifiable concentrate Substances 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 235000007164 Oryza sativa Nutrition 0.000 description 8
- 238000002474 experimental method Methods 0.000 description 8
- 235000009566 rice Nutrition 0.000 description 8
- 125000001424 substituent group Chemical group 0.000 description 8
- DOJJRMAPFAFRKS-UHFFFAOYSA-N 4-[4-(4-ethoxyphenyl)-4-methylpent-1-enyl]-1-fluoro-2-phenoxybenzene Chemical compound C1=CC(OCC)=CC=C1C(C)(C)CC=CC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 DOJJRMAPFAFRKS-UHFFFAOYSA-N 0.000 description 7
- 241000255925 Diptera Species 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 7
- 239000012046 mixed solvent Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 241000196324 Embryophyta Species 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- WRWYGOVGIGCDLE-UHFFFAOYSA-N [O]c1ccccc1F Chemical group [O]c1ccccc1F WRWYGOVGIGCDLE-UHFFFAOYSA-N 0.000 description 6
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 6
- WSDQIHATCCOMLH-UHFFFAOYSA-N phenyl n-(3,5-dichlorophenyl)carbamate Chemical compound ClC1=CC(Cl)=CC(NC(=O)OC=2C=CC=CC=2)=C1 WSDQIHATCCOMLH-UHFFFAOYSA-N 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- MRLGCTNJRREZHZ-UHFFFAOYSA-N 3-phenoxybenzaldehyde Chemical compound O=CC1=CC=CC(OC=2C=CC=CC=2)=C1 MRLGCTNJRREZHZ-UHFFFAOYSA-N 0.000 description 5
- MJGMFKLLOFXJII-UHFFFAOYSA-N 4-[4-(4-ethoxyphenyl)-4-methylpentyl]-1-fluoro-2-phenoxybenzene Chemical compound C1=CC(OCC)=CC=C1C(C)(C)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 MJGMFKLLOFXJII-UHFFFAOYSA-N 0.000 description 5
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 5
- 241000238657 Blattella germanica Species 0.000 description 5
- 231100000053 low toxicity Toxicity 0.000 description 5
- 239000002728 pyrethroid Substances 0.000 description 5
- CEJLIPUOYYASCA-UHFFFAOYSA-N 1-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]-3-(trifluoromethyl)benzene Chemical compound C=1C=CC(C(F)(F)F)=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 CEJLIPUOYYASCA-UHFFFAOYSA-N 0.000 description 4
- IBCPKXHVKXJECK-UHFFFAOYSA-N 1-benzyl-3-[4-(4-ethoxyphenyl)-4-methylpentyl]benzene Chemical compound C1=CC(OCC)=CC=C1C(C)(C)CCCC1=CC=CC(CC=2C=CC=CC=2)=C1 IBCPKXHVKXJECK-UHFFFAOYSA-N 0.000 description 4
- TVCLBMDJILRRQR-UHFFFAOYSA-N 1-chloro-4-(2-methylpentan-2-yl)benzene Chemical compound CCCC(C)(C)C1=CC=C(Cl)C=C1 TVCLBMDJILRRQR-UHFFFAOYSA-N 0.000 description 4
- VBSHDPOAIAJYMV-UHFFFAOYSA-N 1-methyl-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C1=CC(C)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 VBSHDPOAIAJYMV-UHFFFAOYSA-N 0.000 description 4
- GPTKQSXOITXAQH-UHFFFAOYSA-N 3-(4-methoxyphenyl)-3-methylbutan-2-one Chemical compound COC1=CC=C(C(C)(C)C(C)=O)C=C1 GPTKQSXOITXAQH-UHFFFAOYSA-N 0.000 description 4
- 125000006306 4-iodophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1I 0.000 description 4
- 241000218475 Agrotis segetum Species 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- 230000009471 action Effects 0.000 description 4
- 239000003905 agrochemical Substances 0.000 description 4
- 235000013339 cereals Nutrition 0.000 description 4
- 239000004927 clay Substances 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 239000008096 xylene Substances 0.000 description 4
- CUUKIIURFHCYJT-UHFFFAOYSA-N 1-[2-methyl-5-(3-phenoxyphenyl)pent-3-en-2-yl]-3-(trifluoromethyl)benzene Chemical compound C=1C=CC(C(F)(F)F)=CC=1C(C)(C)C=CCC(C=1)=CC=CC=1OC1=CC=CC=C1 CUUKIIURFHCYJT-UHFFFAOYSA-N 0.000 description 3
- FYESMSLKTQDQMU-UHFFFAOYSA-N 1-[2-methyl-5-(3-phenoxyphenyl)pent-4-en-2-yl]-3-(trifluoromethyl)benzene Chemical compound C=1C=CC(C(F)(F)F)=CC=1C(C)(C)CC=CC(C=1)=CC=CC=1OC1=CC=CC=C1 FYESMSLKTQDQMU-UHFFFAOYSA-N 0.000 description 3
- FJWAIHACJPGGBU-UHFFFAOYSA-N 1-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]-4-propan-2-yloxybenzene Chemical compound C1=CC(OC(C)C)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 FJWAIHACJPGGBU-UHFFFAOYSA-N 0.000 description 3
- URYOSTWTHGSTJG-UHFFFAOYSA-N 1-chloro-4-[3-methyl-6-(3-phenoxyphenyl)hexan-3-yl]benzene Chemical compound C=1C=C(Cl)C=CC=1C(C)(CC)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 URYOSTWTHGSTJG-UHFFFAOYSA-N 0.000 description 3
- XOEAHXPADNMWOY-UHFFFAOYSA-N 1-ethoxy-4-(2-methylpentan-2-yl)benzene Chemical compound CCCC(C)(C)C1=CC=C(OCC)C=C1 XOEAHXPADNMWOY-UHFFFAOYSA-N 0.000 description 3
- PIOGWIXROCUEID-UHFFFAOYSA-N 1-ethyl-4-(2-methylpentan-2-yl)benzene Chemical compound C(C)(C)(CCC)C1=CC=C(C=C1)CC PIOGWIXROCUEID-UHFFFAOYSA-N 0.000 description 3
- ORVMFZWEFQJHBW-UHFFFAOYSA-N 1-fluoro-4-[4-(4-methoxyphenyl)-4-methylpentyl]-2-phenoxybenzene Chemical compound C1=CC(OC)=CC=C1C(C)(C)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 ORVMFZWEFQJHBW-UHFFFAOYSA-N 0.000 description 3
- PDKYRVZAKYOGMJ-UHFFFAOYSA-N 1-methoxy-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C1=CC(OC)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 PDKYRVZAKYOGMJ-UHFFFAOYSA-N 0.000 description 3
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 3
- JPOPBFXQDOKVGJ-UHFFFAOYSA-N 3-(4-ethoxyphenyl)-3-methylbutan-2-one Chemical compound CCOC1=CC=C(C(C)(C)C(C)=O)C=C1 JPOPBFXQDOKVGJ-UHFFFAOYSA-N 0.000 description 3
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N 3-Methylbutan-2-one Chemical compound CC(C)C(C)=O SYBYTAAJFKOIEJ-UHFFFAOYSA-N 0.000 description 3
- VLJXXKKOSFGPHI-UHFFFAOYSA-N 3-methylhexane Chemical compound CCCC(C)CC VLJXXKKOSFGPHI-UHFFFAOYSA-N 0.000 description 3
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 3
- ZYCIXJQBBRYYIU-UHFFFAOYSA-N 4-methyl-4-(4-methylphenyl)-1-(3-phenoxyphenyl)pent-1-en-3-one Chemical compound C1=CC(C)=CC=C1C(C)(C)C(=O)C=CC1=CC=CC(OC=2C=CC=CC=2)=C1 ZYCIXJQBBRYYIU-UHFFFAOYSA-N 0.000 description 3
- CJJLBRCHLVJFEK-UHFFFAOYSA-N 5-[2-methyl-5-(3-phenoxyphenyl)pent-3-en-2-yl]-1,3-benzodioxole Chemical compound C=1C=C2OCOC2=CC=1C(C)(C)C=CCC(C=1)=CC=CC=1OC1=CC=CC=C1 CJJLBRCHLVJFEK-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 241000002026 Apamea apamiformis Species 0.000 description 3
- 241001124076 Aphididae Species 0.000 description 3
- 240000007124 Brassica oleracea Species 0.000 description 3
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 3
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 3
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 3
- FIPWRIJSWJWJAI-UHFFFAOYSA-N Butyl carbitol 6-propylpiperonyl ether Chemical compound C1=C(CCC)C(COCCOCCOCCCC)=CC2=C1OCO2 FIPWRIJSWJWJAI-UHFFFAOYSA-N 0.000 description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- 241000252233 Cyprinus carpio Species 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- 244000017020 Ipomoea batatas Species 0.000 description 3
- 235000002678 Ipomoea batatas Nutrition 0.000 description 3
- 241000258242 Siphonaptera Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- PYNNQQSLOXRQCV-UHFFFAOYSA-N [3-[4-(3-bromo-4-ethoxyphenyl)-4-methylpentyl]phenyl]-phenylmethanone Chemical compound C1=C(Br)C(OCC)=CC=C1C(C)(C)CCCC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 PYNNQQSLOXRQCV-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 3
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical class OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 description 3
- FHIVAFMUCKRCQO-UHFFFAOYSA-N diazinon Chemical compound CCOP(=S)(OCC)OC1=CC(C)=NC(C(C)C)=N1 FHIVAFMUCKRCQO-UHFFFAOYSA-N 0.000 description 3
- OEBRKCOSUFCWJD-UHFFFAOYSA-N dichlorvos Chemical compound COP(=O)(OC)OC=C(Cl)Cl OEBRKCOSUFCWJD-UHFFFAOYSA-N 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 3
- VOEYXMAFNDNNED-UHFFFAOYSA-N metolcarb Chemical compound CNC(=O)OC1=CC=CC(C)=C1 VOEYXMAFNDNNED-UHFFFAOYSA-N 0.000 description 3
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 3
- 229960005235 piperonyl butoxide Drugs 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- LNJXZKBHJZAIKQ-UHFFFAOYSA-N 1,1,1,2-tetrachloro-3-(2,3,3,3-tetrachloropropoxy)propane Chemical compound ClC(Cl)(Cl)C(Cl)COCC(Cl)C(Cl)(Cl)Cl LNJXZKBHJZAIKQ-UHFFFAOYSA-N 0.000 description 2
- 125000006013 1,1-difluoroethoxy group Chemical group 0.000 description 2
- UGRMITBWUVWUEB-UHFFFAOYSA-N 1-$l^{1}-oxidanyl-3-methylbenzene Chemical group CC1=CC=CC([O])=C1 UGRMITBWUVWUEB-UHFFFAOYSA-N 0.000 description 2
- WVBBGYLFFNBYRI-UHFFFAOYSA-N 1-benzyl-3-[4-(4-ethoxyphenyl)-4-methylpent-1-enyl]benzene Chemical compound C1=CC(OCC)=CC=C1C(C)(C)CC=CC1=CC=CC(CC=2C=CC=CC=2)=C1 WVBBGYLFFNBYRI-UHFFFAOYSA-N 0.000 description 2
- ZJCXIISKJFKGMP-UHFFFAOYSA-N 1-chloro-4-(3-methylhexan-3-yl)benzene Chemical compound CCCC(C)(CC)C1=CC=C(Cl)C=C1 ZJCXIISKJFKGMP-UHFFFAOYSA-N 0.000 description 2
- BBYFLRDJUQHQNH-UHFFFAOYSA-N 1-fluoro-4-[4-(3-fluoro-4-methylphenyl)-4-methylpentyl]-2-phenoxybenzene Chemical compound C1=C(F)C(C)=CC=C1C(C)(C)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 BBYFLRDJUQHQNH-UHFFFAOYSA-N 0.000 description 2
- SGMVRYQPBRDBLM-UHFFFAOYSA-N 1-fluoro-4-[4-(4-methoxyphenyl)-4-methylpent-1-enyl]-2-phenoxybenzene Chemical compound C1=CC(OC)=CC=C1C(C)(C)CC=CC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 SGMVRYQPBRDBLM-UHFFFAOYSA-N 0.000 description 2
- XOJDVFDVPAPVMW-UHFFFAOYSA-N 1-fluoro-4-[4-(4-methoxyphenyl)-4-methylpent-2-enyl]-2-phenoxybenzene Chemical compound C1=CC(OC)=CC=C1C(C)(C)C=CCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 XOJDVFDVPAPVMW-UHFFFAOYSA-N 0.000 description 2
- RONJTOJZDSYIMG-UHFFFAOYSA-N 1-fluoro-4-[4-methyl-4-(4-propan-2-ylphenyl)pentyl]-2-phenoxybenzene Chemical compound C1=CC(C(C)C)=CC=C1C(C)(C)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 RONJTOJZDSYIMG-UHFFFAOYSA-N 0.000 description 2
- YNEBPLQTZFSKPD-UHFFFAOYSA-N 1-methoxy-4-[2-methyl-5-(3-phenoxyphenyl)pent-3-en-2-yl]benzene Chemical compound C1=CC(OC)=CC=C1C(C)(C)C=CCC1=CC=CC(OC=2C=CC=CC=2)=C1 YNEBPLQTZFSKPD-UHFFFAOYSA-N 0.000 description 2
- JQCSUVJDBHJKNG-UHFFFAOYSA-N 1-methoxy-ethyl Chemical group C[CH]OC JQCSUVJDBHJKNG-UHFFFAOYSA-N 0.000 description 2
- BLWULWRRHWBAFY-UHFFFAOYSA-N 1-methyl-3-(2-methylpentan-2-yl)benzene Chemical compound CCCC(C)(C)C1=CC=CC(C)=C1 BLWULWRRHWBAFY-UHFFFAOYSA-N 0.000 description 2
- SVNWQTGEQPKLNQ-UHFFFAOYSA-N 1-methyl-4-[2-methyl-5-(3-phenoxyphenyl)pent-3-en-2-yl]benzene Chemical compound C1=CC(C)=CC=C1C(C)(C)C=CCC1=CC=CC(OC=2C=CC=CC=2)=C1 SVNWQTGEQPKLNQ-UHFFFAOYSA-N 0.000 description 2
- FEPOSPSDTBOWLY-UHFFFAOYSA-N 1-methyl-4-[2-methyl-5-(3-phenoxyphenyl)pent-4-en-2-yl]benzene Chemical compound C1=CC(C)=CC=C1C(C)(C)CC=CC1=CC=CC(OC=2C=CC=CC=2)=C1 FEPOSPSDTBOWLY-UHFFFAOYSA-N 0.000 description 2
- WSTCAEQXWLCCQH-UHFFFAOYSA-N 2-chloro-4-[5-(4-fluoro-3-phenoxyphenyl)-2-methylpentan-2-yl]-1-methylbenzene Chemical compound C1=C(Cl)C(C)=CC=C1C(C)(C)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 WSTCAEQXWLCCQH-UHFFFAOYSA-N 0.000 description 2
- 125000004791 2-fluoroethoxy group Chemical group FCCO* 0.000 description 2
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 2
- BVYURCFIUPFFDK-UHFFFAOYSA-N 3-(4-chlorophenyl)-3-methylbutan-2-one Chemical compound CC(=O)C(C)(C)C1=CC=C(Cl)C=C1 BVYURCFIUPFFDK-UHFFFAOYSA-N 0.000 description 2
- ZIYLSBHBLCBTJB-UHFFFAOYSA-N 3-methyl-3-(4-methylphenyl)butan-2-one Chemical compound CC(=O)C(C)(C)C1=CC=C(C)C=C1 ZIYLSBHBLCBTJB-UHFFFAOYSA-N 0.000 description 2
- YGHRJJRRZDOVPD-UHFFFAOYSA-N 3-methylbutanal Chemical compound CC(C)CC=O YGHRJJRRZDOVPD-UHFFFAOYSA-N 0.000 description 2
- KZVHMXLDJURMRQ-UHFFFAOYSA-N 4-(4-ethoxyphenyl)-1-(4-fluoro-3-phenoxyphenyl)-4-methylpent-1-en-3-one Chemical compound C1=CC(OCC)=CC=C1C(C)(C)C(=O)C=CC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 KZVHMXLDJURMRQ-UHFFFAOYSA-N 0.000 description 2
- QDKIFIYGNKHERN-UHFFFAOYSA-N 4-(bromomethyl)-1-fluoro-2-phenoxybenzene Chemical compound FC1=CC=C(CBr)C=C1OC1=CC=CC=C1 QDKIFIYGNKHERN-UHFFFAOYSA-N 0.000 description 2
- HDRBIJDBWJTWNU-UHFFFAOYSA-N 4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]phenol Chemical compound C=1C=C(O)C=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 HDRBIJDBWJTWNU-UHFFFAOYSA-N 0.000 description 2
- QTIISHFXPSCNGO-UHFFFAOYSA-N 4-[4-(4-chlorophenyl)-4,5-dimethylhexyl]-1-fluoro-2-phenoxybenzene Chemical compound C=1C=C(Cl)C=CC=1C(C)(C(C)C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 QTIISHFXPSCNGO-UHFFFAOYSA-N 0.000 description 2
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 2
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 2
- JDICMOLUAHZVDS-UHFFFAOYSA-N 4-fluoro-3-phenoxybenzaldehyde Chemical compound FC1=CC=C(C=O)C=C1OC1=CC=CC=C1 JDICMOLUAHZVDS-UHFFFAOYSA-N 0.000 description 2
- FEWIGMWODIRUJM-UHFFFAOYSA-N 4-hexen-3-one Chemical compound CCC(=O)C=CC FEWIGMWODIRUJM-UHFFFAOYSA-N 0.000 description 2
- WYVCRYKTWRUNAP-UHFFFAOYSA-N 4-methyl-1-(3-phenoxyphenyl)-4-[3-(trifluoromethyl)phenyl]pent-1-en-3-one Chemical compound C=1C=CC(C(F)(F)F)=CC=1C(C)(C)C(=O)C=CC(C=1)=CC=CC=1OC1=CC=CC=C1 WYVCRYKTWRUNAP-UHFFFAOYSA-N 0.000 description 2
- SUMOGCZUNXXYRP-UHFFFAOYSA-N 4-methylpentylbenzene Chemical compound CC(C)CCCC1=CC=CC=C1 SUMOGCZUNXXYRP-UHFFFAOYSA-N 0.000 description 2
- 125000004863 4-trifluoromethoxyphenyl group Chemical group [H]C1=C([H])C(OC(F)(F)F)=C([H])C([H])=C1* 0.000 description 2
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 2
- HZHONNGEEREBEP-UHFFFAOYSA-N 5-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]-1,3-benzodioxole Chemical compound C=1C=C2OCOC2=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 HZHONNGEEREBEP-UHFFFAOYSA-N 0.000 description 2
- 241000256118 Aedes aegypti Species 0.000 description 2
- 244000291564 Allium cepa Species 0.000 description 2
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 2
- 241001674044 Blattodea Species 0.000 description 2
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 2
- 241000426497 Chilo suppressalis Species 0.000 description 2
- 241000207199 Citrus Species 0.000 description 2
- 241000254173 Coleoptera Species 0.000 description 2
- 241000490513 Ctenocephalides canis Species 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- 235000010469 Glycine max Nutrition 0.000 description 2
- 241000894055 Haematopinus eurysternus Species 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical group [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 241000721621 Myzus persicae Species 0.000 description 2
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 2
- 241000238814 Orthoptera Species 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium on carbon Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 241000488581 Panonychus citri Species 0.000 description 2
- 241001674048 Phthiraptera Species 0.000 description 2
- 241000227425 Pieris rapae crucivora Species 0.000 description 2
- 241000952063 Polyphagotarsonemus latus Species 0.000 description 2
- 241000254101 Popillia japonica Species 0.000 description 2
- 241000718000 Pulex irritans Species 0.000 description 2
- 241000220324 Pyrus Species 0.000 description 2
- 235000014443 Pyrus communis Nutrition 0.000 description 2
- 241000208422 Rhododendron Species 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 240000004460 Tanacetum coccineum Species 0.000 description 2
- 241000044038 Tenebroides mauritanicus Species 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 241000344246 Tetranychus cinnabarinus Species 0.000 description 2
- 241001454293 Tetranychus urticae Species 0.000 description 2
- 241001182329 Xylotrechus pyrrhoderus Species 0.000 description 2
- 241001136529 Zeugodacus cucurbitae Species 0.000 description 2
- ROVGZAWFACYCSP-MQBLHHJJSA-N [2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OC1C(C)=C(C\C=C/C=C)C(=O)C1 ROVGZAWFACYCSP-MQBLHHJJSA-N 0.000 description 2
- RFBSMAYXYCJROZ-UHFFFAOYSA-N [3-[4-(3-bromo-4-ethoxyphenyl)-4-methylpent-1-enyl]phenyl]-phenylmethanone Chemical compound C1=C(Br)C(OCC)=CC=C1C(C)(C)CC=CC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 RFBSMAYXYCJROZ-UHFFFAOYSA-N 0.000 description 2
- 150000001242 acetic acid derivatives Chemical group 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- CZBZUDVBLSSABA-UHFFFAOYSA-N butylated hydroxyanisole Chemical compound COC1=CC=C(O)C(C(C)(C)C)=C1.COC1=CC=C(O)C=C1C(C)(C)C CZBZUDVBLSSABA-UHFFFAOYSA-N 0.000 description 2
- 235000010354 butylated hydroxytoluene Nutrition 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 235000020971 citrus fruits Nutrition 0.000 description 2
- 229940125898 compound 5 Drugs 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 238000006482 condensation reaction Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 125000002946 cyanobenzyl group Chemical group 0.000 description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 125000004438 haloalkoxy group Chemical group 0.000 description 2
- 238000003898 horticulture Methods 0.000 description 2
- 239000012433 hydrogen halide Substances 0.000 description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000003350 kerosene Substances 0.000 description 2
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000002736 nonionic surfactant Substances 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 229940015367 pyrethrum Drugs 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000779 smoke Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- RBORURQQJIQWBS-QVRNUERCSA-N (4ar,6r,7r,7as)-6-(6-amino-8-bromopurin-9-yl)-2-hydroxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4h-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol Chemical compound C([C@H]1O2)OP(O)(=S)O[C@H]1[C@@H](O)[C@@H]2N1C(N=CN=C2N)=C2N=C1Br RBORURQQJIQWBS-QVRNUERCSA-N 0.000 description 1
- GNEPLYVYORHREW-UHFFFAOYSA-N 1,1,3,3,6-pentamethyl-7-nitro-2h-inden-5-amine Chemical compound CC1=C(N)C=C2C(C)(C)CC(C)(C)C2=C1[N+]([O-])=O GNEPLYVYORHREW-UHFFFAOYSA-N 0.000 description 1
- HEUSUPIOMZUHBX-UHFFFAOYSA-N 1,2-dibromo-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C=1C=C(Br)C(Br)=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 HEUSUPIOMZUHBX-UHFFFAOYSA-N 0.000 description 1
- AKMYYVFIEWNDOM-UHFFFAOYSA-N 1,2-dibromo-4-[5-(4-fluoro-3-phenoxyphenyl)-2-methylpentan-2-yl]benzene Chemical compound C=1C=C(Br)C(Br)=CC=1C(C)(C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 AKMYYVFIEWNDOM-UHFFFAOYSA-N 0.000 description 1
- CZZDPWYZJDIALF-UHFFFAOYSA-N 1,2-dichloro-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C=1C=C(Cl)C(Cl)=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 CZZDPWYZJDIALF-UHFFFAOYSA-N 0.000 description 1
- HRLMRULHCNSMAY-UHFFFAOYSA-N 1,2-dichloro-4-[3-methyl-6-(3-phenoxyphenyl)hexan-3-yl]benzene Chemical compound C=1C=C(Cl)C(Cl)=CC=1C(C)(CC)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 HRLMRULHCNSMAY-UHFFFAOYSA-N 0.000 description 1
- JCAHFANKEVYKRL-UHFFFAOYSA-N 1,2-dichloro-4-[5-[3-(4-fluorophenoxy)phenyl]-2-methylpentan-2-yl]benzene Chemical compound C=1C=C(Cl)C(Cl)=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=C(F)C=C1 JCAHFANKEVYKRL-UHFFFAOYSA-N 0.000 description 1
- PUPAKFKDGONGLH-UHFFFAOYSA-N 1,2-diethoxy-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C1=C(OCC)C(OCC)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 PUPAKFKDGONGLH-UHFFFAOYSA-N 0.000 description 1
- OZWSTVQFLFHTGS-UHFFFAOYSA-N 1,2-diethoxy-4-[3-methyl-6-(3-phenoxyphenyl)hexan-3-yl]benzene Chemical compound C1=C(OCC)C(OCC)=CC=C1C(C)(CC)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 OZWSTVQFLFHTGS-UHFFFAOYSA-N 0.000 description 1
- CVWVRFGUBSVTCF-UHFFFAOYSA-N 1,2-diethyl-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C1=C(CC)C(CC)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 CVWVRFGUBSVTCF-UHFFFAOYSA-N 0.000 description 1
- BNDKTAKTVYRAFF-UHFFFAOYSA-N 1,2-difluoro-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C=1C=C(F)C(F)=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 BNDKTAKTVYRAFF-UHFFFAOYSA-N 0.000 description 1
- LHTGJHUXQHYWMN-UHFFFAOYSA-N 1,2-dimethoxy-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C1=C(OC)C(OC)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 LHTGJHUXQHYWMN-UHFFFAOYSA-N 0.000 description 1
- JSVFEKGQMYIZPN-UHFFFAOYSA-N 1,2-dimethyl-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C1=C(C)C(C)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 JSVFEKGQMYIZPN-UHFFFAOYSA-N 0.000 description 1
- OPGQMJRUKVTMFB-UHFFFAOYSA-N 1,2-ditert-butyl-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C1=C(C(C)(C)C)C(C(C)(C)C)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 OPGQMJRUKVTMFB-UHFFFAOYSA-N 0.000 description 1
- SSTICZYLTSXRDX-UHFFFAOYSA-N 1,2-ditert-butyl-4-[5-(4-fluoro-3-phenoxyphenyl)-2-methylpentan-2-yl]benzene Chemical compound C1=C(C(C)(C)C)C(C(C)(C)C)=CC=C1C(C)(C)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 SSTICZYLTSXRDX-UHFFFAOYSA-N 0.000 description 1
- FJOBEEZFBKYOBD-UHFFFAOYSA-N 1,3-dichloro-5-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C=1C(Cl)=CC(Cl)=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 FJOBEEZFBKYOBD-UHFFFAOYSA-N 0.000 description 1
- PIJOKOJYHXMNIR-UHFFFAOYSA-N 1,3-dichloro-5-[5-(4-fluoro-3-phenoxyphenyl)-2-methylpentan-2-yl]benzene Chemical compound C=1C(Cl)=CC(Cl)=CC=1C(C)(C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 PIJOKOJYHXMNIR-UHFFFAOYSA-N 0.000 description 1
- MYDTUVIZUFWYQN-UHFFFAOYSA-N 1-(2,2-dichloro-1,1-difluoroethoxy)-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C=1C=C(OC(F)(F)C(Cl)Cl)C=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 MYDTUVIZUFWYQN-UHFFFAOYSA-N 0.000 description 1
- IVUKQHAWAFCELT-UHFFFAOYSA-N 1-(2-chloro-1,1-difluoroethoxy)-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C=1C=C(OC(F)(F)CCl)C=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 IVUKQHAWAFCELT-UHFFFAOYSA-N 0.000 description 1
- WVZNKYQGFVATKW-UHFFFAOYSA-N 1-(2-methylpentan-2-yl)-4-prop-2-ynoxybenzene Chemical compound CCCC(C)(C)C1=CC=C(OCC#C)C=C1 WVZNKYQGFVATKW-UHFFFAOYSA-N 0.000 description 1
- BQCZYTGMWBZHAC-UHFFFAOYSA-N 1-(2-methylpentan-2-yl)-4-propan-2-ylbenzene Chemical compound CCCC(C)(C)C1=CC=C(C(C)C)C=C1 BQCZYTGMWBZHAC-UHFFFAOYSA-N 0.000 description 1
- FZCDBGYCFVKRDV-UHFFFAOYSA-N 1-(3-phenoxyphenyl)ethanone Chemical compound CC(=O)C1=CC=CC(OC=2C=CC=CC=2)=C1 FZCDBGYCFVKRDV-UHFFFAOYSA-N 0.000 description 1
- MQPSDTWTFVKMTC-UHFFFAOYSA-N 1-(4-fluoro-3-phenoxyphenyl)-4-(4-methoxyphenyl)-4-methylpent-1-en-3-one Chemical compound C1=CC(OC)=CC=C1C(C)(C)C(=O)C=CC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 MQPSDTWTFVKMTC-UHFFFAOYSA-N 0.000 description 1
- SQOATPJOJLKAAL-UHFFFAOYSA-N 1-(difluoromethoxy)-4-[2-methyl-5-(3-phenoxyphenyl)hept-6-yn-2-yl]benzene Chemical compound C=1C=C(OC(F)F)C=CC=1C(C)(C)CCC(C#C)C(C=1)=CC=CC=1OC1=CC=CC=C1 SQOATPJOJLKAAL-UHFFFAOYSA-N 0.000 description 1
- ISRXFAVYCQTWTE-UHFFFAOYSA-N 1-(difluoromethoxy)-4-[2-methyl-6-(3-phenoxyphenyl)hexan-3-yl]benzene Chemical compound C=1C=C(OC(F)F)C=CC=1C(C(C)C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 ISRXFAVYCQTWTE-UHFFFAOYSA-N 0.000 description 1
- PTCWCJGAGSCMJH-UHFFFAOYSA-N 1-(difluoromethoxy)-4-[3-methyl-6-(3-phenoxyphenyl)hexan-3-yl]benzene Chemical compound C=1C=C(OC(F)F)C=CC=1C(C)(CC)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 PTCWCJGAGSCMJH-UHFFFAOYSA-N 0.000 description 1
- SUUKBFHHOYRAJY-UHFFFAOYSA-N 1-(difluoromethoxy)-4-[5-[3-(4-fluorophenoxy)phenyl]-2-methylpentan-2-yl]benzene Chemical compound C=1C=C(OC(F)F)C=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=C(F)C=C1 SUUKBFHHOYRAJY-UHFFFAOYSA-N 0.000 description 1
- FZTZJCQCEOVFBO-UHFFFAOYSA-N 1-(difluoromethoxy)-4-[6-[3-(4-fluorophenoxy)phenyl]-3-methylhexan-3-yl]benzene Chemical compound C=1C=C(OC(F)F)C=CC=1C(C)(CC)CCCC(C=1)=CC=CC=1OC1=CC=C(F)C=C1 FZTZJCQCEOVFBO-UHFFFAOYSA-N 0.000 description 1
- IIHFRNZZCLJLPT-UHFFFAOYSA-N 1-(difluoromethylsulfanyl)-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C=1C=C(SC(F)F)C=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 IIHFRNZZCLJLPT-UHFFFAOYSA-N 0.000 description 1
- FXEPMYPNDAEHPC-UHFFFAOYSA-N 1-(difluoromethylsulfanyl)-4-[5-[3-(4-fluorophenoxy)phenyl]-2-methylpentan-2-yl]benzene Chemical compound C=1C=C(SC(F)F)C=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=C(F)C=C1 FXEPMYPNDAEHPC-UHFFFAOYSA-N 0.000 description 1
- CQQLIPBDVFIVNN-UHFFFAOYSA-N 1-(methoxymethyl)-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C1=CC(COC)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 CQQLIPBDVFIVNN-UHFFFAOYSA-N 0.000 description 1
- HHDMGLYPYPLMAD-UHFFFAOYSA-N 1-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]-4-(trifluoromethyl)benzene Chemical compound C=1C=C(C(F)(F)F)C=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 HHDMGLYPYPLMAD-UHFFFAOYSA-N 0.000 description 1
- WZSWTPNOTAFJKM-UHFFFAOYSA-N 1-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]-4-(trifluoromethylsulfanyl)benzene Chemical compound C=1C=C(SC(F)(F)F)C=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 WZSWTPNOTAFJKM-UHFFFAOYSA-N 0.000 description 1
- HYBTWWOTPBDJBU-UHFFFAOYSA-N 1-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]-4-phenoxybenzene Chemical compound C=1C=C(OC=2C=CC=CC=2)C=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 HYBTWWOTPBDJBU-UHFFFAOYSA-N 0.000 description 1
- AXQKOSFGWZUGLY-UHFFFAOYSA-N 1-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]-4-prop-1-en-2-ylbenzene Chemical compound C1=CC(C(=C)C)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 AXQKOSFGWZUGLY-UHFFFAOYSA-N 0.000 description 1
- AINYROLHTNPJKB-UHFFFAOYSA-N 1-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]-4-prop-2-ynoxybenzene Chemical compound C=1C=C(OCC#C)C=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 AINYROLHTNPJKB-UHFFFAOYSA-N 0.000 description 1
- BEBPIADPKDFEAJ-UHFFFAOYSA-N 1-[3-methyl-6-(3-phenoxyphenyl)hexan-3-yl]-4-(1,1,2,2-tetrafluoroethoxy)benzene Chemical compound C=1C=C(OC(F)(F)C(F)F)C=CC=1C(C)(CC)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 BEBPIADPKDFEAJ-UHFFFAOYSA-N 0.000 description 1
- DBLCQASTQXSGNO-UHFFFAOYSA-N 1-[3-methyl-6-(3-phenoxyphenyl)hexan-3-yl]-4-propan-2-ylbenzene Chemical compound C=1C=C(C(C)C)C=CC=1C(C)(CC)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 DBLCQASTQXSGNO-UHFFFAOYSA-N 0.000 description 1
- IZDLPNXWRNEJCN-UHFFFAOYSA-N 1-[3-methyl-6-(3-phenoxyphenyl)hexan-3-yl]-4-propoxybenzene Chemical compound C1=CC(OCCC)=CC=C1C(C)(CC)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 IZDLPNXWRNEJCN-UHFFFAOYSA-N 0.000 description 1
- FXLXFQHGHQHGGZ-UHFFFAOYSA-N 1-[4-(3-chloro-4-methoxyphenyl)-4-methylpentyl]-3-fluoro-5-(3-fluorophenoxy)benzene Chemical compound C1=C(Cl)C(OC)=CC=C1C(C)(C)CCCC1=CC(F)=CC(OC=2C=C(F)C=CC=2)=C1 FXLXFQHGHQHGGZ-UHFFFAOYSA-N 0.000 description 1
- UMDQZZITWZPWCK-UHFFFAOYSA-N 1-[4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]phenyl]ethanone Chemical compound C1=CC(C(=O)C)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 UMDQZZITWZPWCK-UHFFFAOYSA-N 0.000 description 1
- WLDHBIRNRNYAAF-UHFFFAOYSA-N 1-[4-[5-(4-fluoro-3-phenoxyphenyl)-2-methylpentan-2-yl]phenyl]-2-methylpropan-1-one Chemical compound C1=CC(C(=O)C(C)C)=CC=C1C(C)(C)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 WLDHBIRNRNYAAF-UHFFFAOYSA-N 0.000 description 1
- BQKMRJWUCXDJNU-UHFFFAOYSA-N 1-[4-methyl-4-(4-nitrophenyl)hexyl]-3-phenoxybenzene Chemical compound C=1C=C([N+]([O-])=O)C=CC=1C(C)(CC)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 BQKMRJWUCXDJNU-UHFFFAOYSA-N 0.000 description 1
- MAOKIWVDNFFFNB-UHFFFAOYSA-N 1-[4-methyl-4-(4-pentoxyphenyl)hexyl]-3-phenoxybenzene Chemical compound C1=CC(OCCCCC)=CC=C1C(C)(CC)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 MAOKIWVDNFFFNB-UHFFFAOYSA-N 0.000 description 1
- ITRBJBRFAILIDL-UHFFFAOYSA-N 1-[4-methyl-4-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]pentyl]-3-phenoxybenzene Chemical compound C=1C=C(OC(F)(F)C(F)(F)F)C=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 ITRBJBRFAILIDL-UHFFFAOYSA-N 0.000 description 1
- IZYALTFFYYRGRZ-UHFFFAOYSA-N 1-[4-methyl-4-[4-(2-methylpropoxy)phenyl]pentyl]-3-phenoxybenzene Chemical compound C1=CC(OCC(C)C)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 IZYALTFFYYRGRZ-UHFFFAOYSA-N 0.000 description 1
- RFLFFJGZHXJIFY-UHFFFAOYSA-N 1-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]methyl]-3-phenoxybenzene Chemical compound ClC(Cl)=CC1C(C)(C)C1CC1=CC=CC(OC=2C=CC=CC=2)=C1 RFLFFJGZHXJIFY-UHFFFAOYSA-N 0.000 description 1
- ZELDYADAFSRUSA-UHFFFAOYSA-N 1-bromo-2-[4-methyl-4-(4-methylphenyl)pentyl]-4-phenoxybenzene Chemical compound C1=CC(C)=CC=C1C(C)(C)CCCC1=CC(OC=2C=CC=CC=2)=CC=C1Br ZELDYADAFSRUSA-UHFFFAOYSA-N 0.000 description 1
- KXRJFFVTJHLQDA-UHFFFAOYSA-N 1-bromo-2-chloro-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C=1C=C(Br)C(Cl)=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 KXRJFFVTJHLQDA-UHFFFAOYSA-N 0.000 description 1
- MOSDJOYAISEHMN-UHFFFAOYSA-N 1-bromo-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C=1C=C(Br)C=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 MOSDJOYAISEHMN-UHFFFAOYSA-N 0.000 description 1
- CUXYNJSZGONVQJ-UHFFFAOYSA-N 1-bromo-4-[3-[4-methyl-4-(4-methylphenyl)pentyl]phenoxy]benzene Chemical compound C1=CC(C)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC(Br)=CC=2)=C1 CUXYNJSZGONVQJ-UHFFFAOYSA-N 0.000 description 1
- RCCPEZKLZXSSRI-UHFFFAOYSA-N 1-chloro-3-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C=1C=CC(Cl)=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 RCCPEZKLZXSSRI-UHFFFAOYSA-N 0.000 description 1
- VSFDFWVUTALFIH-UHFFFAOYSA-N 1-chloro-3-[4-methyl-4-(4-methylphenyl)pentyl]-5-phenoxybenzene Chemical compound C1=CC(C)=CC=C1C(C)(C)CCCC1=CC(Cl)=CC(OC=2C=CC=CC=2)=C1 VSFDFWVUTALFIH-UHFFFAOYSA-N 0.000 description 1
- FKBIRPXIZSRYDA-UHFFFAOYSA-N 1-chloro-4-[2-methyl-1-[(3-phenoxyphenyl)methoxy]propan-2-yl]benzene Chemical compound C=1C=C(Cl)C=CC=1C(C)(C)COCC(C=1)=CC=CC=1OC1=CC=CC=C1 FKBIRPXIZSRYDA-UHFFFAOYSA-N 0.000 description 1
- ITBSVDVXLWGGFU-UHFFFAOYSA-N 1-chloro-4-[2-methyl-5-(3-phenoxyphenyl)hept-6-yn-2-yl]benzene Chemical compound C=1C=C(Cl)C=CC=1C(C)(C)CCC(C#C)C(C=1)=CC=CC=1OC1=CC=CC=C1 ITBSVDVXLWGGFU-UHFFFAOYSA-N 0.000 description 1
- KXRNEATVTIGLBZ-UHFFFAOYSA-N 1-chloro-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C=1C=C(Cl)C=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 KXRNEATVTIGLBZ-UHFFFAOYSA-N 0.000 description 1
- VZDBFKGBOCAVEC-UHFFFAOYSA-N 1-chloro-4-[2-methyl-6-(3-phenoxyphenyl)hexan-3-yl]benzene Chemical compound C=1C=C(Cl)C=CC=1C(C(C)C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 VZDBFKGBOCAVEC-UHFFFAOYSA-N 0.000 description 1
- LSLAEVJEHXIJAE-UHFFFAOYSA-N 1-chloro-4-[4-(4-chlorophenyl)-4-methylpentyl]-2-phenoxybenzene Chemical compound C=1C=C(Cl)C=CC=1C(C)(C)CCCC(C=1)=CC=C(Cl)C=1OC1=CC=CC=C1 LSLAEVJEHXIJAE-UHFFFAOYSA-N 0.000 description 1
- NYNWOPCEUGGALY-UHFFFAOYSA-N 1-chloro-4-[5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C=1C=C(Cl)C=CC=1C(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 NYNWOPCEUGGALY-UHFFFAOYSA-N 0.000 description 1
- SYRMPOMBXBZAGR-UHFFFAOYSA-N 1-cyclopentyloxy-4-[3-methyl-6-(3-phenoxyphenyl)hexan-3-yl]benzene Chemical compound C=1C=C(OC2CCCC2)C=CC=1C(C)(CC)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 SYRMPOMBXBZAGR-UHFFFAOYSA-N 0.000 description 1
- HVDRXQXWXRKKTB-UHFFFAOYSA-N 1-ethenyl-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C=1C=C(C=C)C=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 HVDRXQXWXRKKTB-UHFFFAOYSA-N 0.000 description 1
- BWSWAFWUBHBPLO-UHFFFAOYSA-N 1-ethoxy-2-methoxy-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C1=C(OC)C(OCC)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 BWSWAFWUBHBPLO-UHFFFAOYSA-N 0.000 description 1
- ZOXNDYYEOHIDSR-UHFFFAOYSA-N 1-ethoxy-2-methyl-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C1=C(C)C(OCC)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 ZOXNDYYEOHIDSR-UHFFFAOYSA-N 0.000 description 1
- HDHQDGHXJKGWOR-UHFFFAOYSA-N 1-ethoxy-2-methyl-4-[3-methyl-6-(3-phenoxyphenyl)hexan-3-yl]benzene Chemical compound C1=C(C)C(OCC)=CC=C1C(C)(CC)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 HDHQDGHXJKGWOR-UHFFFAOYSA-N 0.000 description 1
- VPKYFDJCDVQNMZ-UHFFFAOYSA-N 1-ethoxy-3-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound CCOC1=CC=CC(C(C)(C)CCCC=2C=C(OC=3C=CC=CC=3)C=CC=2)=C1 VPKYFDJCDVQNMZ-UHFFFAOYSA-N 0.000 description 1
- UQANPXGMIPYZOV-UHFFFAOYSA-N 1-ethoxy-4-(2-methylpent-3-en-2-yl)benzene Chemical compound C(C)OC1=CC=C(C=C1)C(C=CC)(C)C UQANPXGMIPYZOV-UHFFFAOYSA-N 0.000 description 1
- VJXBFYXOFMNKMU-UHFFFAOYSA-N 1-ethoxy-4-(4-methylpentyl)benzene Chemical compound C(C)OC1=CC=C(C=C1)CCCC(C)C VJXBFYXOFMNKMU-UHFFFAOYSA-N 0.000 description 1
- ASGUPKBIHCQKNM-UHFFFAOYSA-N 1-ethoxy-4-[2-methyl-5-(3-phenoxyphenyl)hept-6-yn-2-yl]benzene Chemical compound C1=CC(OCC)=CC=C1C(C)(C)CCC(C#C)C1=CC=CC(OC=2C=CC=CC=2)=C1 ASGUPKBIHCQKNM-UHFFFAOYSA-N 0.000 description 1
- JYHOMOSEVPKSOV-UHFFFAOYSA-N 1-ethoxy-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C1=CC(OCC)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 JYHOMOSEVPKSOV-UHFFFAOYSA-N 0.000 description 1
- NARHUFKXHBQDAJ-UHFFFAOYSA-N 1-ethoxy-4-[2-methyl-5-(3-phenylsulfanylphenyl)pentan-2-yl]benzene Chemical compound C1=CC(OCC)=CC=C1C(C)(C)CCCC1=CC=CC(SC=2C=CC=CC=2)=C1 NARHUFKXHBQDAJ-UHFFFAOYSA-N 0.000 description 1
- VESABFOFCLLGPW-UHFFFAOYSA-N 1-ethoxy-4-[5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C1=CC(OCC)=CC=C1C(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 VESABFOFCLLGPW-UHFFFAOYSA-N 0.000 description 1
- GWRBXUVXDRLUKX-UHFFFAOYSA-N 1-ethoxy-4-[5-(4-fluoro-3-phenoxyphenyl)-2-methylpentan-2-yl]-2-methoxybenzene Chemical compound C1=C(OC)C(OCC)=CC=C1C(C)(C)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 GWRBXUVXDRLUKX-UHFFFAOYSA-N 0.000 description 1
- LQZZAXVLQKBQTO-UHFFFAOYSA-N 1-ethoxy-4-[5-(4-fluoro-3-phenoxyphenyl)-2-methylpentan-2-yl]-2-methylbenzene Chemical compound C1=C(C)C(OCC)=CC=C1C(C)(C)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 LQZZAXVLQKBQTO-UHFFFAOYSA-N 0.000 description 1
- BCCNOADWRLTERW-UHFFFAOYSA-N 1-ethylsulfanyl-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C1=CC(SCC)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 BCCNOADWRLTERW-UHFFFAOYSA-N 0.000 description 1
- SUYISRATCONAGG-UHFFFAOYSA-N 1-ethylsulfanyl-4-[3-methyl-6-(3-phenoxyphenyl)hexan-3-yl]benzene Chemical compound C1=CC(SCC)=CC=C1C(C)(CC)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 SUYISRATCONAGG-UHFFFAOYSA-N 0.000 description 1
- JOQFNXIHVCHHGH-UHFFFAOYSA-N 1-ethynyl-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C=1C=C(C#C)C=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 JOQFNXIHVCHHGH-UHFFFAOYSA-N 0.000 description 1
- KEIAUEWEESSXER-UHFFFAOYSA-N 1-fluoro-4-(4-methyl-4-phenylpentyl)-2-phenoxybenzene Chemical compound C=1C=CC=CC=1C(C)(C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 KEIAUEWEESSXER-UHFFFAOYSA-N 0.000 description 1
- SJXAOJKTRVLRAG-UHFFFAOYSA-N 1-fluoro-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C=1C=C(F)C=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 SJXAOJKTRVLRAG-UHFFFAOYSA-N 0.000 description 1
- KAMUBQXALUQQHS-UHFFFAOYSA-N 1-fluoro-4-[3-[4-(4-fluorophenyl)-4-methylhexyl]phenoxy]benzene Chemical compound C=1C=C(F)C=CC=1C(C)(CC)CCCC(C=1)=CC=CC=1OC1=CC=C(F)C=C1 KAMUBQXALUQQHS-UHFFFAOYSA-N 0.000 description 1
- QIWZDBTYMICTSB-UHFFFAOYSA-N 1-fluoro-4-[4-[4-(methoxymethyl)phenyl]-4-methylpentyl]-2-phenoxybenzene Chemical compound C1=CC(COC)=CC=C1C(C)(C)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 QIWZDBTYMICTSB-UHFFFAOYSA-N 0.000 description 1
- RARBZNCQQVIVCU-UHFFFAOYSA-N 1-fluoro-4-[4-methyl-4-(4-methylphenyl)pentyl]-2-phenoxybenzene Chemical compound C1=CC(C)=CC=C1C(C)(C)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 RARBZNCQQVIVCU-UHFFFAOYSA-N 0.000 description 1
- JRDNLTUMVGCWFM-UHFFFAOYSA-N 1-fluoro-4-[4-methyl-4-(4-methylsulfanylphenyl)pentyl]-2-phenoxybenzene Chemical compound C1=CC(SC)=CC=C1C(C)(C)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 JRDNLTUMVGCWFM-UHFFFAOYSA-N 0.000 description 1
- ALOQAKWLQMNJNZ-UHFFFAOYSA-N 1-fluoro-4-[4-methyl-4-(4-phenoxyphenyl)pentyl]-2-phenoxybenzene Chemical compound C=1C=C(OC=2C=CC=CC=2)C=CC=1C(C)(C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 ALOQAKWLQMNJNZ-UHFFFAOYSA-N 0.000 description 1
- NECUGFHIBULQOD-UHFFFAOYSA-N 1-fluoro-4-[4-methyl-4-(4-propan-2-yloxyphenyl)pentyl]-2-phenoxybenzene Chemical compound C1=CC(OC(C)C)=CC=C1C(C)(C)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 NECUGFHIBULQOD-UHFFFAOYSA-N 0.000 description 1
- CUNCNWAEIMUEAC-UHFFFAOYSA-N 1-fluoro-4-[4-methyl-4-(4-propan-2-ylsulfanylphenyl)pentyl]-2-phenoxybenzene Chemical compound C1=CC(SC(C)C)=CC=C1C(C)(C)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 CUNCNWAEIMUEAC-UHFFFAOYSA-N 0.000 description 1
- FKUFVDJRYFIFPL-UHFFFAOYSA-N 1-fluoro-4-[4-methyl-4-(4-propoxyphenyl)hexyl]-2-phenoxybenzene Chemical compound C1=CC(OCCC)=CC=C1C(C)(CC)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 FKUFVDJRYFIFPL-UHFFFAOYSA-N 0.000 description 1
- WGPAUSHXFXRRNE-UHFFFAOYSA-N 1-fluoro-4-[4-methyl-4-(4-propoxyphenyl)pentyl]-2-phenoxybenzene Chemical compound O(C1=CC=CC=C1)C=1C=C(C=CC=1F)CCCC(C)(C)C1=CC=C(C=C1)OCCC WGPAUSHXFXRRNE-UHFFFAOYSA-N 0.000 description 1
- FPYXSGYZQLLJJZ-UHFFFAOYSA-N 1-fluoro-4-[4-methyl-4-[3-(trifluoromethyl)phenyl]pentoxy]-2-phenoxybenzene Chemical compound C=1C=CC(C(F)(F)F)=CC=1C(C)(C)CCCOC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 FPYXSGYZQLLJJZ-UHFFFAOYSA-N 0.000 description 1
- IMPGGRCTJYHVAB-UHFFFAOYSA-N 1-fluoro-4-[4-methyl-4-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]pentyl]-2-phenoxybenzene Chemical compound C=1C=C(OC(F)(F)C(F)(F)F)C=CC=1C(C)(C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 IMPGGRCTJYHVAB-UHFFFAOYSA-N 0.000 description 1
- MVKNSQSQIFWATK-UHFFFAOYSA-N 1-fluoro-4-[4-methyl-4-[4-(trifluoromethoxy)phenyl]pentyl]-2-phenoxybenzene Chemical compound C=1C=C(OC(F)(F)F)C=CC=1C(C)(C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 MVKNSQSQIFWATK-UHFFFAOYSA-N 0.000 description 1
- KUNWAUNJUZFMJA-UHFFFAOYSA-N 1-fluoro-4-[4-methyl-4-[4-(trifluoromethylsulfanyl)phenyl]pentyl]-2-phenoxybenzene Chemical compound C=1C=C(SC(F)(F)F)C=CC=1C(C)(C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 KUNWAUNJUZFMJA-UHFFFAOYSA-N 0.000 description 1
- OACMMCFMZCGHCX-UHFFFAOYSA-N 1-iodo-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C=1C=C(I)C=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 OACMMCFMZCGHCX-UHFFFAOYSA-N 0.000 description 1
- DPFGDCMGQBNKAU-UHFFFAOYSA-N 1-methoxy-4-(2-methylpentan-2-yl)benzene Chemical compound CCCC(C)(C)C1=CC=C(OC)C=C1 DPFGDCMGQBNKAU-UHFFFAOYSA-N 0.000 description 1
- GERFODZCOPBYTG-UHFFFAOYSA-N 1-methoxy-4-(4-methylpent-1-enyl)benzene Chemical compound COC1=CC=C(C=C1)C=CCC(C)C GERFODZCOPBYTG-UHFFFAOYSA-N 0.000 description 1
- NWONCHQXVMZZOY-UHFFFAOYSA-N 1-methoxy-4-[2-methyl-5-(3-phenoxyphenyl)pent-4-en-2-yl]benzene Chemical compound C1=CC(OC)=CC=C1C(C)(C)CC=CC1=CC=CC(OC=2C=CC=CC=2)=C1 NWONCHQXVMZZOY-UHFFFAOYSA-N 0.000 description 1
- AVQGIURAJIKTIQ-UHFFFAOYSA-N 1-methoxy-4-[3-methyl-6-(3-phenoxyphenyl)hexan-3-yl]benzene Chemical compound C=1C=C(OC)C=CC=1C(C)(CC)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 AVQGIURAJIKTIQ-UHFFFAOYSA-N 0.000 description 1
- GHTCVPDGKRDKMP-UHFFFAOYSA-N 1-methyl-4-(2-methylpentan-2-yl)benzene Chemical compound CCCC(C)(C)C1=CC=C(C)C=C1 GHTCVPDGKRDKMP-UHFFFAOYSA-N 0.000 description 1
- LCMQLEZWJXKUTG-UHFFFAOYSA-N 1-methyl-4-[3-methyl-6-(3-phenoxyphenyl)hexan-3-yl]benzene Chemical compound C=1C=C(C)C=CC=1C(C)(CC)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 LCMQLEZWJXKUTG-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 1
- ZBRFKTKSJSYLLY-UHFFFAOYSA-N 1-tert-butyl-2-methyl-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C1=C(C(C)(C)C)C(C)=CC(C(C)(C)CCCC=2C=C(OC=3C=CC=CC=3)C=CC=2)=C1 ZBRFKTKSJSYLLY-UHFFFAOYSA-N 0.000 description 1
- YNLUGYFMQSJWRE-UHFFFAOYSA-N 1-tert-butyl-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C1=CC(C(C)(C)C)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 YNLUGYFMQSJWRE-UHFFFAOYSA-N 0.000 description 1
- HBQOVTVVCSYACF-UHFFFAOYSA-N 1-tert-butyl-4-[3-methyl-6-(3-phenoxyphenyl)hexan-3-yl]benzene Chemical compound C=1C=C(C(C)(C)C)C=CC=1C(C)(CC)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 HBQOVTVVCSYACF-UHFFFAOYSA-N 0.000 description 1
- 125000004793 2,2,2-trifluoroethoxy group Chemical group FC(CO*)(F)F 0.000 description 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 1
- TWCOAUGQAVMPMS-UHFFFAOYSA-N 2-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]naphthalene Chemical compound C=1C=C2C=CC=CC2=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 TWCOAUGQAVMPMS-UHFFFAOYSA-N 0.000 description 1
- JTNMWGZFFVWKLE-UHFFFAOYSA-N 2-[3-methyl-6-(3-phenoxyphenyl)hexan-3-yl]naphthalene Chemical compound C=1C=C2C=CC=CC2=CC=1C(C)(CC)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 JTNMWGZFFVWKLE-UHFFFAOYSA-N 0.000 description 1
- GFXRYXNAIVUTJQ-UHFFFAOYSA-N 2-[4-(4-chlorophenyl)-4-methylpentyl]-6-phenoxypyridine Chemical compound C=1C=C(Cl)C=CC=1C(C)(C)CCCC(N=1)=CC=CC=1OC1=CC=CC=C1 GFXRYXNAIVUTJQ-UHFFFAOYSA-N 0.000 description 1
- MYNGBULPGMSRLU-UHFFFAOYSA-N 2-[4-(4-ethoxyphenyl)-4-methylpentyl]-4,5,6,7-tetrahydroisoindole-1,3-dione Chemical compound C1=CC(OCC)=CC=C1C(C)(C)CCCN1C(=O)C(CCCC2)=C2C1=O MYNGBULPGMSRLU-UHFFFAOYSA-N 0.000 description 1
- QSTHVPHEFUGHOC-UHFFFAOYSA-N 2-[4-(4-ethoxyphenyl)-4-methylpentyl]-6-phenoxypyridine Chemical compound C1=CC(OCC)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=N1 QSTHVPHEFUGHOC-UHFFFAOYSA-N 0.000 description 1
- OLUROAHYUITTCQ-UHFFFAOYSA-N 2-[5-(4-fluoro-3-phenoxyphenyl)-2-methylpentan-2-yl]-6-methylnaphthalene Chemical compound C1=CC2=CC(C)=CC=C2C=C1C(C)(C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 OLUROAHYUITTCQ-UHFFFAOYSA-N 0.000 description 1
- IXRYBYWPOMSWGE-UHFFFAOYSA-N 2-benzyl-4-[4-(4-chlorophenyl)-4-methylhexyl]furan Chemical compound C=1C=C(Cl)C=CC=1C(C)(CC)CCCC(C=1)=COC=1CC1=CC=CC=C1 IXRYBYWPOMSWGE-UHFFFAOYSA-N 0.000 description 1
- YTQSLQXMYLYMBB-UHFFFAOYSA-N 2-benzyl-4-[4-(4-chlorophenyl)-4-methylpentyl]furan Chemical compound C=1C=C(Cl)C=CC=1C(C)(C)CCCC(C=1)=COC=1CC1=CC=CC=C1 YTQSLQXMYLYMBB-UHFFFAOYSA-N 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- SAWFLXGUPDIAOD-UHFFFAOYSA-N 2-bromo-1-chloro-4-[5-(4-fluoro-3-phenoxyphenyl)-2-methylpentan-2-yl]benzene Chemical compound C=1C=C(Cl)C(Br)=CC=1C(C)(C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 SAWFLXGUPDIAOD-UHFFFAOYSA-N 0.000 description 1
- ZJFBCVMDSXHSPY-UHFFFAOYSA-N 2-bromo-1-ethoxy-4-[5-(4-fluoro-3-phenoxyphenyl)-2-methylpentan-2-yl]benzene Chemical compound C1=C(Br)C(OCC)=CC=C1C(C)(C)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 ZJFBCVMDSXHSPY-UHFFFAOYSA-N 0.000 description 1
- FRJBKPDRHINPRZ-UHFFFAOYSA-N 2-bromo-1-fluoro-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C=1C=C(F)C(Br)=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 FRJBKPDRHINPRZ-UHFFFAOYSA-N 0.000 description 1
- HOBVNXVJZDKVJF-UHFFFAOYSA-N 2-bromo-1-fluoro-4-[5-(4-fluoro-3-phenoxyphenyl)-2-methylpentan-2-yl]benzene Chemical compound C=1C=C(F)C(Br)=CC=1C(C)(C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 HOBVNXVJZDKVJF-UHFFFAOYSA-N 0.000 description 1
- GPACGNMGFZGJCG-UHFFFAOYSA-N 2-bromo-1-methyl-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C1=C(Br)C(C)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 GPACGNMGFZGJCG-UHFFFAOYSA-N 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- QAYWLPZZXNGLNV-UHFFFAOYSA-N 2-chloro-1-ethoxy-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C1=C(Cl)C(OCC)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 QAYWLPZZXNGLNV-UHFFFAOYSA-N 0.000 description 1
- ZJABUUXHSAWVBQ-UHFFFAOYSA-N 2-chloro-1-ethoxy-4-[3-methyl-6-(3-phenoxyphenyl)hexan-3-yl]benzene Chemical compound C1=C(Cl)C(OCC)=CC=C1C(C)(CC)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 ZJABUUXHSAWVBQ-UHFFFAOYSA-N 0.000 description 1
- NOCLVBADKFSAPU-UHFFFAOYSA-N 2-chloro-1-fluoro-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C=1C=C(F)C(Cl)=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 NOCLVBADKFSAPU-UHFFFAOYSA-N 0.000 description 1
- NDMRVYVFCMMRHK-UHFFFAOYSA-N 2-chloro-1-fluoro-4-[5-(4-fluoro-3-phenoxyphenyl)-2-methylpentan-2-yl]benzene Chemical compound C=1C=C(F)C(Cl)=CC=1C(C)(C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 NDMRVYVFCMMRHK-UHFFFAOYSA-N 0.000 description 1
- LNOZPOXXPULKNM-UHFFFAOYSA-N 2-chloro-1-methoxy-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C1=C(Cl)C(OC)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 LNOZPOXXPULKNM-UHFFFAOYSA-N 0.000 description 1
- MLSUOYNILPQWIZ-UHFFFAOYSA-N 2-chloro-1-methyl-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C1=C(Cl)C(C)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 MLSUOYNILPQWIZ-UHFFFAOYSA-N 0.000 description 1
- LXXZKOPDNSRLOI-UHFFFAOYSA-N 2-chloro-1-methyl-4-[3-methyl-6-(3-phenoxyphenyl)hexan-3-yl]benzene Chemical compound C=1C=C(C)C(Cl)=CC=1C(C)(CC)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 LXXZKOPDNSRLOI-UHFFFAOYSA-N 0.000 description 1
- FALAFFJWXJVSEF-UHFFFAOYSA-N 2-ethoxy-1,3-dimethyl-5-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound C1=C(C)C(OCC)=C(C)C=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 FALAFFJWXJVSEF-UHFFFAOYSA-N 0.000 description 1
- PYHAYRKNRVEHIJ-UHFFFAOYSA-N 2-ethyl-4-[5-(4-fluoro-3-phenoxyphenyl)-2-methylpentan-2-yl]-1-methylbenzene Chemical compound C1=C(C)C(CC)=CC(C(C)(C)CCCC=2C=C(OC=3C=CC=CC=3)C(F)=CC=2)=C1 PYHAYRKNRVEHIJ-UHFFFAOYSA-N 0.000 description 1
- SZDNWULMPAGKSK-UHFFFAOYSA-N 2-fluoro-1-(4-methyl-4-phenylpentyl)-3-phenoxybenzene Chemical compound C=1C=CC=CC=1C(C)(C)CCCC(C=1F)=CC=CC=1OC1=CC=CC=C1 SZDNWULMPAGKSK-UHFFFAOYSA-N 0.000 description 1
- VAUDDXDNNCJENX-UHFFFAOYSA-N 2-methoxy-1,3-dimethyl-5-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene Chemical compound O(C1=CC=CC=C1)C=1C=C(C=CC=1)CCCC(C)(C)C1=CC(=C(C(=C1)C)OC)C VAUDDXDNNCJENX-UHFFFAOYSA-N 0.000 description 1
- DORIXXXWSRLRRM-UHFFFAOYSA-N 2-methyl-6-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]naphthalene Chemical compound C1=CC2=CC(C)=CC=C2C=C1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 DORIXXXWSRLRRM-UHFFFAOYSA-N 0.000 description 1
- MHNNAWXXUZQSNM-UHFFFAOYSA-N 2-methylbut-1-ene Chemical compound CCC(C)=C MHNNAWXXUZQSNM-UHFFFAOYSA-N 0.000 description 1
- GXDHCNNESPLIKD-UHFFFAOYSA-N 2-methylhexane Chemical compound CCCCC(C)C GXDHCNNESPLIKD-UHFFFAOYSA-N 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- VOPXNVSDUXSSEE-UHFFFAOYSA-N 3-(1,3-benzodioxol-5-yl)-3-methylbutan-2-one Chemical compound CC(=O)C(C)(C)C1=CC=C2OCOC2=C1 VOPXNVSDUXSSEE-UHFFFAOYSA-N 0.000 description 1
- HVIMGGWWXFHARR-UHFFFAOYSA-N 3-(3-bromo-4-ethoxyphenyl)-3-methylbutanal Chemical compound CCOC1=CC=C(C(C)(C)CC=O)C=C1Br HVIMGGWWXFHARR-UHFFFAOYSA-N 0.000 description 1
- WIDQKFQRJJNJDH-UHFFFAOYSA-N 3-(4-chlorophenyl)-3-methylpentan-2-one Chemical compound CCC(C)(C(C)=O)C1=CC=C(Cl)C=C1 WIDQKFQRJJNJDH-UHFFFAOYSA-N 0.000 description 1
- ZCZXFVGWZOAXFW-UHFFFAOYSA-N 3-[4-(4-ethoxyphenyl)-4-methylpentyl]-2-methyl-5-prop-2-ynylfuran Chemical compound C1=CC(OCC)=CC=C1C(C)(C)CCCC1=C(C)OC(CC#C)=C1 ZCZXFVGWZOAXFW-UHFFFAOYSA-N 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- RJSKVGQJZQDFQI-UHFFFAOYSA-N 3-methyl-3-[3-(trifluoromethyl)phenyl]butan-2-one Chemical compound CC(=O)C(C)(C)C1=CC=CC(C(F)(F)F)=C1 RJSKVGQJZQDFQI-UHFFFAOYSA-N 0.000 description 1
- CHCCBPDEADMNCI-UHFFFAOYSA-N 3-methylcyclopenten-2-one Natural products CC1=CC(=O)CC1 CHCCBPDEADMNCI-UHFFFAOYSA-N 0.000 description 1
- AFJWMGOTLUUGHF-UHFFFAOYSA-N 4,5,6,7-tetrahydroisoindole-1,3-dione Chemical compound C1CCCC2=C1C(=O)NC2=O AFJWMGOTLUUGHF-UHFFFAOYSA-N 0.000 description 1
- NQJJATWVLHZAAH-UHFFFAOYSA-N 4-(1,3-benzodioxol-5-yl)-4-methyl-1-(3-phenoxyphenyl)pent-1-en-3-one Chemical compound C=1C=C2OCOC2=CC=1C(C)(C)C(=O)C=CC(C=1)=CC=CC=1OC1=CC=CC=C1 NQJJATWVLHZAAH-UHFFFAOYSA-N 0.000 description 1
- OHKMEXJDYACLKF-UHFFFAOYSA-N 4-(2-methoxyphenyl)-4-methyl-1-(3-phenoxyphenyl)pent-1-en-3-one Chemical compound COC1=CC=CC=C1C(C)(C)C(=O)C=CC1=CC=CC(OC=2C=CC=CC=2)=C1 OHKMEXJDYACLKF-UHFFFAOYSA-N 0.000 description 1
- OPMIBQSFIUJNAT-UHFFFAOYSA-N 4-(2-methylpentan-2-yl)phenol Chemical compound CCCC(C)(C)C1=CC=C(O)C=C1 OPMIBQSFIUJNAT-UHFFFAOYSA-N 0.000 description 1
- PHQMXSMKIFCJEO-UHFFFAOYSA-N 4-(4-methoxyphenyl)-4-methyl-1-(3-phenoxyphenyl)pent-1-en-3-one Chemical compound C1=CC(OC)=CC=C1C(C)(C)C(=O)C=CC1=CC=CC(OC=2C=CC=CC=2)=C1 PHQMXSMKIFCJEO-UHFFFAOYSA-N 0.000 description 1
- QOZMLWPEWAOZBY-UHFFFAOYSA-N 4-(diethoxyphosphorylmethyl)-1-fluoro-2-phenoxybenzene Chemical compound CCOP(=O)(OCC)CC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 QOZMLWPEWAOZBY-UHFFFAOYSA-N 0.000 description 1
- ZZLCFHIKESPLTH-UHFFFAOYSA-N 4-Methylbiphenyl Chemical compound C1=CC(C)=CC=C1C1=CC=CC=C1 ZZLCFHIKESPLTH-UHFFFAOYSA-N 0.000 description 1
- XKMIRSKJTZXBBP-UHFFFAOYSA-N 4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzonitrile Chemical compound C=1C=C(C#N)C=CC=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 XKMIRSKJTZXBBP-UHFFFAOYSA-N 0.000 description 1
- RWJCKXOEPQGGDW-UHFFFAOYSA-N 4-[4-(3,4-dimethoxyphenyl)-4-methylpentyl]-1-fluoro-2-phenoxybenzene Chemical compound C1=C(OC)C(OC)=CC=C1C(C)(C)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 RWJCKXOEPQGGDW-UHFFFAOYSA-N 0.000 description 1
- ROZCIKBPSMWPMW-UHFFFAOYSA-N 4-[4-(3-ethoxyphenyl)-4-methylpentyl]-1-fluoro-2-phenoxybenzene Chemical compound CCOC1=CC=CC(C(C)(C)CCCC=2C=C(OC=3C=CC=CC=3)C(F)=CC=2)=C1 ROZCIKBPSMWPMW-UHFFFAOYSA-N 0.000 description 1
- AKDOXPXBFSCXIF-UHFFFAOYSA-N 4-[4-(4-chlorophenyl)-4-methylpentyl]-1-fluoro-2-(3-methylphenoxy)benzene Chemical compound CC1=CC=CC(OC=2C(=CC=C(CCCC(C)(C)C=3C=CC(Cl)=CC=3)C=2)F)=C1 AKDOXPXBFSCXIF-UHFFFAOYSA-N 0.000 description 1
- BGWCATRDFGIARP-UHFFFAOYSA-N 4-[4-(4-chlorophenyl)-4-methylpentyl]-1-fluoro-2-phenoxybenzene Chemical compound C=1C=C(Cl)C=CC=1C(C)(C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 BGWCATRDFGIARP-UHFFFAOYSA-N 0.000 description 1
- LLQMFRDYPUBUCY-UHFFFAOYSA-N 4-[4-(4-chlorophenyl)pentyl]-1-fluoro-2-phenoxybenzene Chemical compound C=1C=C(Cl)C=CC=1C(C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 LLQMFRDYPUBUCY-UHFFFAOYSA-N 0.000 description 1
- LQSSHKWGHCLLJQ-UHFFFAOYSA-N 4-[4-(4-cyclohexyloxyphenyl)-4-methylpentyl]-1-fluoro-2-phenoxybenzene Chemical compound C=1C=C(OC2CCCCC2)C=CC=1C(C)(C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 LQSSHKWGHCLLJQ-UHFFFAOYSA-N 0.000 description 1
- WLZNXDBETUECQM-UHFFFAOYSA-N 4-[4-(4-cyclopentyloxyphenyl)-4-methylpentyl]-1-fluoro-2-phenoxybenzene Chemical compound C=1C=C(OC2CCCC2)C=CC=1C(C)(C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 WLZNXDBETUECQM-UHFFFAOYSA-N 0.000 description 1
- NIEIQBARMKQWCB-UHFFFAOYSA-N 4-[4-(4-ethenoxyphenyl)-4-methylpentyl]-1-fluoro-2-phenoxybenzene Chemical compound C=1C=C(OC=C)C=CC=1C(C)(C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 NIEIQBARMKQWCB-UHFFFAOYSA-N 0.000 description 1
- NHLDDBGXPZKBEH-UHFFFAOYSA-N 4-[4-(4-ethenylphenyl)-4-methylpentyl]-1-fluoro-2-phenoxybenzene Chemical compound C=1C=C(C=C)C=CC=1C(C)(C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 NHLDDBGXPZKBEH-UHFFFAOYSA-N 0.000 description 1
- NEGDTGZXHBIWJN-UHFFFAOYSA-N 4-[4-(4-ethoxyphenyl)-4,5-dimethylhexyl]-1-fluoro-2-phenoxybenzene Chemical compound C1=CC(OCC)=CC=C1C(C)(C(C)C)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 NEGDTGZXHBIWJN-UHFFFAOYSA-N 0.000 description 1
- JGSAXXNXQIHDLS-UHFFFAOYSA-N 4-[4-(4-ethoxyphenyl)-4-methylhexyl]-1-fluoro-2-phenoxybenzene Chemical compound C1=CC(OCC)=CC=C1C(C)(CC)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 JGSAXXNXQIHDLS-UHFFFAOYSA-N 0.000 description 1
- RMANJNOQEVINPB-UHFFFAOYSA-N 4-[4-(4-ethoxyphenyl)-4-methylpent-2-enyl]-1-fluoro-2-phenoxybenzene Chemical compound C1=CC(OCC)=CC=C1C(C)(C)C=CCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 RMANJNOQEVINPB-UHFFFAOYSA-N 0.000 description 1
- LSJZKWWLPSBMJR-UHFFFAOYSA-N 4-[4-(4-ethoxyphenyl)-5-methylhexyl]-1-fluoro-2-phenoxybenzene Chemical compound C1=CC(OCC)=CC=C1C(C(C)C)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 LSJZKWWLPSBMJR-UHFFFAOYSA-N 0.000 description 1
- WOVUDDWUXUSZBP-UHFFFAOYSA-N 4-[4-(4-ethoxyphenyl)hexyl]-1-fluoro-2-phenoxybenzene Chemical compound C1=CC(OCC)=CC=C1C(CC)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 WOVUDDWUXUSZBP-UHFFFAOYSA-N 0.000 description 1
- NBOCQTNZUPTTEI-UHFFFAOYSA-N 4-[4-(hydrazinesulfonyl)phenoxy]benzenesulfonohydrazide Chemical compound C1=CC(S(=O)(=O)NN)=CC=C1OC1=CC=C(S(=O)(=O)NN)C=C1 NBOCQTNZUPTTEI-UHFFFAOYSA-N 0.000 description 1
- BDUKRAQPALJARU-UHFFFAOYSA-N 4-[4-[3,4-di(propan-2-yl)phenyl]-4-methylpentyl]-1-fluoro-2-phenoxybenzene Chemical compound C1=C(C(C)C)C(C(C)C)=CC=C1C(C)(C)CCCC1=CC=C(F)C(OC=2C=CC=CC=2)=C1 BDUKRAQPALJARU-UHFFFAOYSA-N 0.000 description 1
- DWRRYDDUMLGZGA-UHFFFAOYSA-N 4-[4-[4-(difluoromethoxy)phenyl]-4-methylpentyl]-1-fluoro-2-phenoxybenzene Chemical compound C=1C=C(OC(F)F)C=CC=1C(C)(C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 DWRRYDDUMLGZGA-UHFFFAOYSA-N 0.000 description 1
- WZILXPLPDXDMMT-UHFFFAOYSA-N 4-[4-[4-(difluoromethoxy)phenyl]-5-methylhexyl]-1-fluoro-2-phenoxybenzene Chemical compound C=1C=C(OC(F)F)C=CC=1C(C(C)C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 WZILXPLPDXDMMT-UHFFFAOYSA-N 0.000 description 1
- AEPCZZVJGQJOAX-UHFFFAOYSA-N 4-[5-(4-fluoro-3-phenoxyphenyl)-2-methylpentan-2-yl]benzonitrile Chemical compound C=1C=C(C#N)C=CC=1C(C)(C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 AEPCZZVJGQJOAX-UHFFFAOYSA-N 0.000 description 1
- FWUVCASFEYGUNZ-UHFFFAOYSA-N 4-[5-(4-fluoro-3-phenoxyphenyl)-2-methylpentan-2-yl]phenol Chemical compound C=1C=C(O)C=CC=1C(C)(C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 FWUVCASFEYGUNZ-UHFFFAOYSA-N 0.000 description 1
- KEGZOCMJFKIJMM-UHFFFAOYSA-N 4-[6-(4-chlorophenyl)-6-methylhept-1-yn-3-yl]-1-fluoro-2-phenoxybenzene Chemical compound C=1C=C(Cl)C=CC=1C(C)(C)CCC(C#C)C(C=1)=CC=C(F)C=1OC1=CC=CC=C1 KEGZOCMJFKIJMM-UHFFFAOYSA-N 0.000 description 1
- AZZRMKORERJSLN-UHFFFAOYSA-N 4-[6-(4-ethoxyphenyl)-6-methylhept-1-yn-3-yl]-1-fluoro-2-phenoxybenzene Chemical compound C1=CC(OCC)=CC=C1C(C)(C)CCC(C#C)C1=CC=C(F)C(OC=2C=CC=CC=2)=C1 AZZRMKORERJSLN-UHFFFAOYSA-N 0.000 description 1
- RKFZFWKPMXSTJD-UHFFFAOYSA-N 4-[[2-(4-chlorophenyl)-2-methylpropoxy]methyl]-1-fluoro-2-phenoxybenzene Chemical compound C=1C=C(Cl)C=CC=1C(C)(C)COCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 RKFZFWKPMXSTJD-UHFFFAOYSA-N 0.000 description 1
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 1
- IMPPGHMHELILKG-UHFFFAOYSA-N 4-ethoxyaniline Chemical compound CCOC1=CC=C(N)C=C1 IMPPGHMHELILKG-UHFFFAOYSA-N 0.000 description 1
- 125000004861 4-isopropyl phenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- LGAQJENWWYGFSN-UHFFFAOYSA-N 4-methylpent-2-ene Chemical class CC=CC(C)C LGAQJENWWYGFSN-UHFFFAOYSA-N 0.000 description 1
- VYFQFQLVEBJAMG-UHFFFAOYSA-N 5-(4-chlorophenyl)-2-(4-fluoro-3-phenoxyphenyl)-5-methylhexanenitrile Chemical compound C=1C=C(Cl)C=CC=1C(C)(C)CCC(C#N)C(C=1)=CC=C(F)C=1OC1=CC=CC=C1 VYFQFQLVEBJAMG-UHFFFAOYSA-N 0.000 description 1
- YQQQWWQFSWDUKE-UHFFFAOYSA-N 5-(4-chlorophenyl)-5-methyl-2-(3-phenoxyphenyl)hexanenitrile Chemical compound C=1C=C(Cl)C=CC=1C(C)(C)CCC(C#N)C(C=1)=CC=CC=1OC1=CC=CC=C1 YQQQWWQFSWDUKE-UHFFFAOYSA-N 0.000 description 1
- MRJOPRRJQVCXAH-UHFFFAOYSA-N 5-(4-ethoxyphenyl)-5-methyl-2-(3-phenoxyphenyl)heptanenitrile Chemical compound C1=CC(OCC)=CC=C1C(C)(CC)CCC(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 MRJOPRRJQVCXAH-UHFFFAOYSA-N 0.000 description 1
- MGSDCJPFTPFBDZ-UHFFFAOYSA-N 5-(4-ethoxyphenyl)-5-methyl-2-(3-phenoxyphenyl)hexanenitrile Chemical compound C1=CC(OCC)=CC=C1C(C)(C)CCC(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 MGSDCJPFTPFBDZ-UHFFFAOYSA-N 0.000 description 1
- VSBPRBXTUAKKSY-UHFFFAOYSA-N 5-(5-methyl-1,3-dioxan-4-yl)-1,3-benzodioxole Chemical compound CC1COCOC1C1=CC=C(OCO2)C2=C1 VSBPRBXTUAKKSY-UHFFFAOYSA-N 0.000 description 1
- KHEYAEKRHVCARL-UHFFFAOYSA-N 5-[2-methyl-5-(3-phenoxyphenyl)pent-4-en-2-yl]-1,3-benzodioxole Chemical compound C=1C=C2OCOC2=CC=1C(C)(C)CC=CC(C=1)=CC=CC=1OC1=CC=CC=C1 KHEYAEKRHVCARL-UHFFFAOYSA-N 0.000 description 1
- PKZUHZYZVDGOFC-UHFFFAOYSA-N 5-[4-(difluoromethoxy)phenyl]-5-methyl-2-(3-phenoxyphenyl)hexanenitrile Chemical compound C=1C=C(OC(F)F)C=CC=1C(C)(C)CCC(C#N)C(C=1)=CC=CC=1OC1=CC=CC=C1 PKZUHZYZVDGOFC-UHFFFAOYSA-N 0.000 description 1
- OCNKJDIIPQXQNH-UHFFFAOYSA-N 5-[5-(4-fluoro-3-phenoxyphenyl)-2-methylpentan-2-yl]-1,3-benzodioxole Chemical compound C=1C=C2OCOC2=CC=1C(C)(C)CCCC(C=1)=CC=C(F)C=1OC1=CC=CC=C1 OCNKJDIIPQXQNH-UHFFFAOYSA-N 0.000 description 1
- QJQAWQSNMXLUDF-UHFFFAOYSA-N 5-methyl-1,3-dioxane Chemical compound CC1COCOC1 QJQAWQSNMXLUDF-UHFFFAOYSA-N 0.000 description 1
- OBFDDBXKSRKTMZ-UHFFFAOYSA-N 5-methyl-6-propyl-1,3-benzodioxole Chemical compound C1=C(C)C(CCC)=CC2=C1OCO2 OBFDDBXKSRKTMZ-UHFFFAOYSA-N 0.000 description 1
- HFKQFLLUUXHOHU-UHFFFAOYSA-N 6,7-difluoro-9-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]-2,4-dioxabicyclo[3.2.2]nona-1(7),5,8-triene Chemical compound C=1C(=C(C=2F)F)OCOC=2C=1C(C)(C)CCCC(C=1)=CC=CC=1OC1=CC=CC=C1 HFKQFLLUUXHOHU-UHFFFAOYSA-N 0.000 description 1
- 241000863248 Abraxas miranda Species 0.000 description 1
- 241000254032 Acrididae Species 0.000 description 1
- 241000175828 Adoxophyes orana Species 0.000 description 1
- 241001136249 Agriotes lineatus Species 0.000 description 1
- 241000993143 Agromyza Species 0.000 description 1
- 241001155860 Aleurolobus Species 0.000 description 1
- 241000519879 Anomala cuprea Species 0.000 description 1
- 241001427556 Anoplura Species 0.000 description 1
- 241001177135 Anthrenus verbasci Species 0.000 description 1
- 241001600408 Aphis gossypii Species 0.000 description 1
- 241000459392 Apoderus erythrogaster Species 0.000 description 1
- 241000239290 Araneae Species 0.000 description 1
- 241000370685 Arge Species 0.000 description 1
- 241000737455 Arge similis Species 0.000 description 1
- 241000961935 Arorathrips xanthius Species 0.000 description 1
- 241001664281 Asphondylia Species 0.000 description 1
- 241000447770 Athalia japonica Species 0.000 description 1
- 241000902805 Aulacophora Species 0.000 description 1
- 241001367035 Autographa nigrisigna Species 0.000 description 1
- 241000934199 Bactra furfurana Species 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 241000167854 Bourreria succulenta Species 0.000 description 1
- 241000982105 Brevicoryne brassicae Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- FPAPYKWCTLAMDO-UHFFFAOYSA-N C1(=CC=CC=C1)[Al](C1=CC=CC=C1)C1=CC=CC=C1.[Na] Chemical compound C1(=CC=CC=C1)[Al](C1=CC=CC=C1)C1=CC=CC=C1.[Na] FPAPYKWCTLAMDO-UHFFFAOYSA-N 0.000 description 1
- 101150046236 CNR1 gene Proteins 0.000 description 1
- 241000776777 Cacopsylla mali Species 0.000 description 1
- 241001182720 Cacopsylla pyrisuga Species 0.000 description 1
- 101100352919 Caenorhabditis elegans ppm-2 gene Proteins 0.000 description 1
- 241001397056 Calamobius filum Species 0.000 description 1
- 241001313742 Callosobruchus chinensis Species 0.000 description 1
- 244000045232 Canavalia ensiformis Species 0.000 description 1
- 241000769888 Canephora <angiosperm> Species 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 241000533770 Cayaponia Species 0.000 description 1
- VOPWNXZWBYDODV-UHFFFAOYSA-N Chlorodifluoromethane Chemical compound FC(F)Cl VOPWNXZWBYDODV-UHFFFAOYSA-N 0.000 description 1
- 241001374606 Chlorops oryzae Species 0.000 description 1
- 241001219931 Cletus trigonus Species 0.000 description 1
- 241000098289 Cnaphalocrocis medinalis Species 0.000 description 1
- 241000008892 Cnaphalocrocis patnalis Species 0.000 description 1
- 241001137251 Corvidae Species 0.000 description 1
- 241000256059 Culex pipiens Species 0.000 description 1
- 241000256057 Culex quinquefasciatus Species 0.000 description 1
- 241000289763 Dasygaster padockina Species 0.000 description 1
- 241000084475 Delia antiqua Species 0.000 description 1
- 241001205778 Dialeurodes citri Species 0.000 description 1
- 241000162400 Dicladispa armigera Species 0.000 description 1
- 241000709823 Dictyoptera <beetle genus> Species 0.000 description 1
- 241000255601 Drosophila melanogaster Species 0.000 description 1
- 241000459130 Epirhynchites heros Species 0.000 description 1
- 241001522296 Erithacus rubecula Species 0.000 description 1
- 240000001624 Espostoa lanata Species 0.000 description 1
- 235000009161 Espostoa lanata Nutrition 0.000 description 1
- 241001486250 Etiella zinckenella Species 0.000 description 1
- 241000825563 Eurydema Species 0.000 description 1
- 241000073845 Eysarcoris aeneus Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- FSYXMFXBRJFYBS-UHFFFAOYSA-N Furamethrin Chemical compound CC1(C)C(C=C(C)C)C1C(=O)OCC1=CC=C(CC#C)O1 FSYXMFXBRJFYBS-UHFFFAOYSA-N 0.000 description 1
- 241000785585 Gryllotalpa africana Species 0.000 description 1
- 241000730161 Haritalodes derogata Species 0.000 description 1
- 241000258937 Hemiptera Species 0.000 description 1
- 241001299253 Henosepilachna vigintioctopunctata Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 241000257303 Hymenoptera Species 0.000 description 1
- 241001531327 Hyphantria cunea Species 0.000 description 1
- 241001058150 Icerya purchasi Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000725028 Kuwayama Species 0.000 description 1
- 241001470017 Laodelphax striatella Species 0.000 description 1
- 241000981121 Leguminivora glycinivorella Species 0.000 description 1
- 241000255777 Lepidoptera Species 0.000 description 1
- 229910010082 LiAlH Inorganic materials 0.000 description 1
- 241000322707 Liposcelis Species 0.000 description 1
- 241000254022 Locusta migratoria Species 0.000 description 1
- 241001043195 Lyctus brunneus Species 0.000 description 1
- 241000721703 Lymantria dispar Species 0.000 description 1
- 241000337466 Lymantria dispar japonica Species 0.000 description 1
- 239000005949 Malathion Substances 0.000 description 1
- 241000555303 Mamestra brassicae Species 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241000129455 Melanotus fortnumi Species 0.000 description 1
- 241000254099 Melolontha melolontha Species 0.000 description 1
- 239000005916 Methomyl Substances 0.000 description 1
- 241001442207 Monochamus alternatus Species 0.000 description 1
- 240000000249 Morus alba Species 0.000 description 1
- 235000008708 Morus alba Nutrition 0.000 description 1
- 241000257159 Musca domestica Species 0.000 description 1
- 241000409991 Mythimna separata Species 0.000 description 1
- 241001477931 Mythimna unipuncta Species 0.000 description 1
- 101150094405 NAC23 gene Proteins 0.000 description 1
- 241000358422 Nephotettix cincticeps Species 0.000 description 1
- 241001671709 Nezara viridula Species 0.000 description 1
- 241001556089 Nilaparvata lugens Species 0.000 description 1
- 241001036422 Nosopsyllus fasciatus Species 0.000 description 1
- 241001012098 Omiodes indicata Species 0.000 description 1
- 241000346285 Ostrinia furnacalis Species 0.000 description 1
- 241000382928 Oxya Species 0.000 description 1
- 241001622642 Parnara bada Species 0.000 description 1
- 240000004928 Paspalum scrobiculatum Species 0.000 description 1
- 235000003675 Paspalum scrobiculatum Nutrition 0.000 description 1
- 241001517562 Patania Species 0.000 description 1
- 241000517324 Pediculidae Species 0.000 description 1
- 241000517306 Pediculus humanus corporis Species 0.000 description 1
- 241001510001 Periplaneta brunnea Species 0.000 description 1
- 241001510010 Periplaneta fuliginosa Species 0.000 description 1
- 241000736217 Phalera Species 0.000 description 1
- 235000006089 Phaseolus angularis Nutrition 0.000 description 1
- 235000010617 Phaseolus lunatus Nutrition 0.000 description 1
- 241000577218 Phenes Species 0.000 description 1
- 241000720470 Phyllonorycter Species 0.000 description 1
- 241001525802 Phyllonorycter pomonella Species 0.000 description 1
- 241000437063 Phyllotreta striolata Species 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- 240000008670 Pinus densiflora Species 0.000 description 1
- 235000000405 Pinus densiflora Nutrition 0.000 description 1
- 241000691880 Planococcus citri Species 0.000 description 1
- 241000595629 Plodia interpunctella Species 0.000 description 1
- 241000500437 Plutella xylostella Species 0.000 description 1
- 241000539535 Promalactis Species 0.000 description 1
- 241001415024 Psocoptera Species 0.000 description 1
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical class C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 1
- 235000001630 Pyrus pyrifolia var culta Nutrition 0.000 description 1
- 244000079529 Pyrus serotina Species 0.000 description 1
- 241000238680 Rhipicephalus microplus Species 0.000 description 1
- 241001617044 Rhizoglyphus Species 0.000 description 1
- 241000167882 Rhopalosiphum maidis Species 0.000 description 1
- 241000220317 Rosa Species 0.000 description 1
- 241000365764 Scirtothrips dorsalis Species 0.000 description 1
- 241000180219 Sitobion avenae Species 0.000 description 1
- 241000254152 Sitophilus oryzae Species 0.000 description 1
- 241000176086 Sogatella furcifera Species 0.000 description 1
- 241000985245 Spodoptera litura Species 0.000 description 1
- 241001417773 Spulerina Species 0.000 description 1
- 241000283614 Stephanitis nashi Species 0.000 description 1
- 241001508985 Stephanitis pyrioides Species 0.000 description 1
- 241001454295 Tetranychidae Species 0.000 description 1
- 244000269722 Thea sinensis Species 0.000 description 1
- 241000339374 Thrips tabaci Species 0.000 description 1
- 241001414989 Thysanoptera Species 0.000 description 1
- 241000131345 Tipula <genus> Species 0.000 description 1
- 241001238452 Tortrix Species 0.000 description 1
- 241000018137 Trialeurodes vaporariorum Species 0.000 description 1
- 241001193113 Trogium Species 0.000 description 1
- 208000003443 Unconsciousness Diseases 0.000 description 1
- 240000007098 Vigna angularis Species 0.000 description 1
- 235000010711 Vigna angularis Nutrition 0.000 description 1
- 241000353223 Xenopsylla cheopis Species 0.000 description 1
- 241000254234 Xyeloidea Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- SPXSEZMVRJLHQG-XMMPIXPASA-N [(2R)-1-[[4-[(3-phenylmethoxyphenoxy)methyl]phenyl]methyl]pyrrolidin-2-yl]methanol Chemical compound C(C1=CC=CC=C1)OC=1C=C(OCC2=CC=C(CN3[C@H](CCC3)CO)C=C2)C=CC=1 SPXSEZMVRJLHQG-XMMPIXPASA-N 0.000 description 1
- IFUXRJCISRRMQW-UHFFFAOYSA-N [3-[4-(4-ethoxyphenyl)-4-methylpent-1-enyl]phenyl]-phenylmethanone Chemical compound C1=CC(OCC)=CC=C1C(C)(C)CC=CC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 IFUXRJCISRRMQW-UHFFFAOYSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003302 alkenyloxy group Chemical group 0.000 description 1
- 125000005092 alkenyloxycarbonyl group Chemical group 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000005741 alkyl alkenyl group Chemical group 0.000 description 1
- 125000006350 alkyl thio alkyl group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 125000005133 alkynyloxy group Chemical group 0.000 description 1
- 125000005225 alkynyloxycarbonyl group Chemical group 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical class C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 235000014121 butter Nutrition 0.000 description 1
- 239000000073 carbamate insecticide Substances 0.000 description 1
- CVXBEEMKQHEXEN-UHFFFAOYSA-N carbaryl Chemical compound C1=CC=C2C(OC(=O)NC)=CC=CC2=C1 CVXBEEMKQHEXEN-UHFFFAOYSA-N 0.000 description 1
- 229960005286 carbaryl Drugs 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 235000019693 cherries Nutrition 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229940127271 compound 49 Drugs 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- VWWMOACCGFHMEV-UHFFFAOYSA-N dicarbide(2-) Chemical compound [C-]#[C-] VWWMOACCGFHMEV-UHFFFAOYSA-N 0.000 description 1
- JXSJBGJIGXNWCI-UHFFFAOYSA-N diethyl 2-[(dimethoxyphosphorothioyl)thio]succinate Chemical compound CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCC JXSJBGJIGXNWCI-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 210000005069 ears Anatomy 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- PLBUFYJAGQHZCI-UHFFFAOYSA-N ethyl 4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1C(C)(C)CCCC1=CC=CC(OC=2C=CC=CC=2)=C1 PLBUFYJAGQHZCI-UHFFFAOYSA-N 0.000 description 1
- YREQHYQNNWYQCJ-UHFFFAOYSA-N etofenprox Chemical compound C1=CC(OCC)=CC=C1C(C)(C)COCC1=CC=CC(OC=2C=CC=CC=2)=C1 YREQHYQNNWYQCJ-UHFFFAOYSA-N 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000004994 halo alkoxy alkyl group Chemical group 0.000 description 1
- 125000005252 haloacyl group Chemical group 0.000 description 1
- 125000000262 haloalkenyl group Chemical group 0.000 description 1
- 125000005291 haloalkenyloxy group Chemical group 0.000 description 1
- 125000004993 haloalkoxycarbonyl group Chemical group 0.000 description 1
- 125000004995 haloalkylthio group Chemical group 0.000 description 1
- 125000006785 haloalkynyloxycarbonyl group Chemical group 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 231100000086 high toxicity Toxicity 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000000201 insect hormone Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 230000002147 killing effect Effects 0.000 description 1
- 230000001418 larval effect Effects 0.000 description 1
- 208000028454 lice infestation Diseases 0.000 description 1
- 239000003915 liquefied petroleum gas Substances 0.000 description 1
- 229960000453 malathion Drugs 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- UHXUZOCRWCRNSJ-QPJJXVBHSA-N methomyl Chemical compound CNC(=O)O\N=C(/C)SC UHXUZOCRWCRNSJ-QPJJXVBHSA-N 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- WLLGXSLBOPFWQV-OTHKPKEBSA-N molport-035-783-878 Chemical compound C([C@H]1C=C2)[C@H]2C2C1C(=O)N(CC(CC)CCCC)C2=O WLLGXSLBOPFWQV-OTHKPKEBSA-N 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- SNICXCGAKADSCV-UHFFFAOYSA-N nicotine Chemical compound CN1CCCC1C1=CC=CN=C1 SNICXCGAKADSCV-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000003986 organophosphate insecticide Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- LCCNCVORNKJIRZ-UHFFFAOYSA-N parathion Chemical compound CCOP(=S)(OCC)OC1=CC=C([N+]([O-])=O)C=C1 LCCNCVORNKJIRZ-UHFFFAOYSA-N 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- SBNFWQZLDJGRLK-UHFFFAOYSA-N phenothrin Chemical compound CC1(C)C(C=C(C)C)C1C(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 SBNFWQZLDJGRLK-UHFFFAOYSA-N 0.000 description 1
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- YFGYUFNIOHWBOB-UHFFFAOYSA-N pirimicarb Chemical compound CN(C)C(=O)OC1=NC(N(C)C)=NC(C)=C1C YFGYUFNIOHWBOB-UHFFFAOYSA-N 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 210000003689 pubic bone Anatomy 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 230000002940 repellent Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 235000013616 tea Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- RYYWUUFWQRZTIU-UHFFFAOYSA-K thiophosphate Chemical compound [O-]P([O-])([O-])=S RYYWUUFWQRZTIU-UHFFFAOYSA-K 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- JXPOLSKBTUYKJB-UHFFFAOYSA-N xi-2,3-Dimethylhexane Chemical compound CCCC(C)C(C)C JXPOLSKBTUYKJB-UHFFFAOYSA-N 0.000 description 1
- WCJYTPVNMWIZCG-UHFFFAOYSA-N xylylcarb Chemical compound CNC(=O)OC1=CC=C(C)C(C)=C1 WCJYTPVNMWIZCG-UHFFFAOYSA-N 0.000 description 1
- 235000020338 yellow tea Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
- C07D317/54—Radicals substituted by oxygen atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N31/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic oxygen or sulfur compounds
- A01N31/08—Oxygen or sulfur directly attached to an aromatic ring system
- A01N31/14—Ethers
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N31/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic oxygen or sulfur compounds
- A01N31/08—Oxygen or sulfur directly attached to an aromatic ring system
- A01N31/16—Oxygen or sulfur directly attached to an aromatic ring system with two or more oxygen or sulfur atoms directly attached to the same aromatic ring system
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N35/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having two bonds to hetero atoms with at the most one bond to halogen, e.g. aldehyde radical
- A01N35/04—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having two bonds to hetero atoms with at the most one bond to halogen, e.g. aldehyde radical containing aldehyde or keto groups, or thio analogues thereof, directly attached to an aromatic ring system, e.g. acetophenone; Derivatives thereof, e.g. acetals
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/36—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a singly bound oxygen or sulfur atom attached to the same carbon skeleton, this oxygen or sulfur atom not being a member of a carboxylic group or of a thio analogue, or of a derivative thereof, e.g. hydroxy-carboxylic acids
- A01N37/38—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a singly bound oxygen or sulfur atom attached to the same carbon skeleton, this oxygen or sulfur atom not being a member of a carboxylic group or of a thio analogue, or of a derivative thereof, e.g. hydroxy-carboxylic acids having at least one oxygen or sulfur atom attached to an aromatic ring system
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/02—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms
- A01N43/04—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom
- A01N43/06—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom five-membered rings
- A01N43/08—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with one hetero atom five-membered rings with oxygen as the ring hetero atom
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/02—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms
- A01N43/24—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with two or more hetero atoms
- A01N43/26—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with two or more hetero atoms five-membered rings
- A01N43/28—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with two or more hetero atoms five-membered rings with two hetero atoms in positions 1,3
- A01N43/30—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one or more oxygen or sulfur atoms as the only ring hetero atoms with two or more hetero atoms five-membered rings with two hetero atoms in positions 1,3 with two oxygen atoms in positions 1,3, condensed with a carbocyclic ring
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/40—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/205—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring the aromatic ring being a non-condensed ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/215—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring having unsaturation outside the six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/257—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/004—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with organometalhalides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/62—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by hydrogenation of carbon-to-carbon double or triple bonds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/72—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction of compounds containing >C = O groups with the same or other compounds containing >C = O groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/72—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction of compounds containing >C = O groups with the same or other compounds containing >C = O groups
- C07C45/74—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction of compounds containing >C = O groups with the same or other compounds containing >C = O groups combined with dehydration
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/20—Unsaturated compounds containing keto groups bound to acyclic carbon atoms
- C07C49/213—Unsaturated compounds containing keto groups bound to acyclic carbon atoms containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/20—Unsaturated compounds containing keto groups bound to acyclic carbon atoms
- C07C49/213—Unsaturated compounds containing keto groups bound to acyclic carbon atoms containing six-membered aromatic rings
- C07C49/217—Unsaturated compounds containing keto groups bound to acyclic carbon atoms containing six-membered aromatic rings having unsaturation outside the aromatic rings
- C07C49/223—Unsaturated compounds containing keto groups bound to acyclic carbon atoms containing six-membered aromatic rings having unsaturation outside the aromatic rings polycyclic
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/20—Unsaturated compounds containing keto groups bound to acyclic carbon atoms
- C07C49/255—Unsaturated compounds containing keto groups bound to acyclic carbon atoms containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/84—Ketones containing a keto group bound to a six-membered aromatic ring containing ether groups, groups, groups, or groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Wood Science & Technology (AREA)
- Environmental Sciences (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Zoology (AREA)
- Pest Control & Pesticides (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Furan Compounds (AREA)
- Pyridine Compounds (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8247382 | 1982-05-18 | ||
| JP57082473A JPS58201737A (ja) | 1982-05-18 | 1982-05-18 | 新規芳香族アルカン誘導体、その製造法およびそれを有効成分とする殺虫、殺ダニ剤 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NL8301656A true NL8301656A (nl) | 1983-12-16 |
Family
ID=13775474
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL8301656A NL8301656A (nl) | 1982-05-18 | 1983-05-10 | Nieuwe aromatische alkaanderivaten en werkwijze voor de bereiding hiervan, evenals insecticidale en acaricidale middelen die deze derivaat als actieve stof bevatten. |
Country Status (18)
| Country | Link |
|---|---|
| US (2) | US4661501A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS58201737A (cg-RX-API-DMAC7.html) |
| KR (1) | KR870001463B1 (cg-RX-API-DMAC7.html) |
| AU (1) | AU544708B2 (cg-RX-API-DMAC7.html) |
| BR (1) | BR8302590A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1227799A (cg-RX-API-DMAC7.html) |
| CH (1) | CH658046A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE3317908A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2527203B1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB2120664B (cg-RX-API-DMAC7.html) |
| HU (1) | HU191607B (cg-RX-API-DMAC7.html) |
| IN (1) | IN157031B (cg-RX-API-DMAC7.html) |
| IT (1) | IT1203651B (cg-RX-API-DMAC7.html) |
| NL (1) | NL8301656A (cg-RX-API-DMAC7.html) |
| NZ (1) | NZ204104A (cg-RX-API-DMAC7.html) |
| RU (1) | RU1837764C (cg-RX-API-DMAC7.html) |
| SE (1) | SE463455B (cg-RX-API-DMAC7.html) |
| SU (1) | SU1524808A3 (cg-RX-API-DMAC7.html) |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS58201737A (ja) * | 1982-05-18 | 1983-11-24 | Mitsui Toatsu Chem Inc | 新規芳香族アルカン誘導体、その製造法およびそれを有効成分とする殺虫、殺ダニ剤 |
| AU576307B2 (en) * | 1982-09-24 | 1988-08-25 | Commonwealth Scientific And Industrial Research Organisation | Arthropodicidal compounds |
| WO1984001147A1 (en) * | 1982-09-24 | 1984-03-29 | Commw Scient Ind Res Org | Arthropodicidal compounds |
| JPS60115545A (ja) * | 1983-11-25 | 1985-06-22 | Sumitomo Chem Co Ltd | 炭化水素系化合物を有効成分とする殺虫剤 |
| GB8409195D0 (en) * | 1984-04-09 | 1984-05-16 | Elliott M | Pesticides |
| DE3505370A1 (de) * | 1985-02-14 | 1986-08-14 | Schering AG, 1000 Berlin und 4709 Bergkamen | Aromatische alkanderivate, schaedlingsbekaempfungsmittel enthaltend diese verbindungen sowie verfahren zu ihrer herstellung |
| JPH0639430B2 (ja) * | 1985-02-28 | 1994-05-25 | 住友化学工業株式会社 | 炭化水素系化合物およびそれを有効成分とする殺虫、殺ダニ剤 |
| GB2173789B (en) * | 1985-02-28 | 1988-07-13 | Sumitomo Chemical Co | A vinyl or ethynyl substituted aralkyl aryl compound for use as an insecticide/acaricide |
| DE3513041A1 (de) * | 1985-04-09 | 1986-10-16 | Schering AG, Berlin und Bergkamen, 1000 Berlin | Difluorcyclopropanderivate, schaedlingsbekaempfungsmittel enthaltend diese verbindungen sowie verfahren zu ihrer herstellung |
| GB8523464D0 (en) * | 1985-09-23 | 1985-10-30 | Ici Plc | Insecticidal alkenes |
| DE3602169A1 (de) * | 1986-01-22 | 1987-07-23 | Schering Ag | Neue alkan- und alkoxyalkanderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende insektizide und akarizide mittel |
| JPH072666B2 (ja) * | 1986-02-28 | 1995-01-18 | 三井東圧化学株式会社 | 3―(3―ハロゲノ―4―アルコキシフェニル)―3―メチルブタナール類の製造方法 |
| GB8605281D0 (en) * | 1986-03-04 | 1986-04-09 | Ici Plc | Diphenyl ether derivatives |
| US4782094A (en) * | 1986-03-14 | 1988-11-01 | Mitsui Toatsu Chemicals, Inc. | Difluorobromomethoxyphenyl derivative and miticide comprising said derivative as active ingredient |
| US4804653A (en) * | 1986-05-02 | 1989-02-14 | Uniroyal Chemical Company, Inc. | Thiomethyl-substituted organosilane compounds and their use as pesticides |
| CN1025470C (zh) * | 1986-05-31 | 1994-07-20 | 赫彻斯特股份公司 | 含新型硅烷衍生物的农药,杀虫剂和杀螨剂组合物 |
| US4709068A (en) * | 1986-06-02 | 1987-11-24 | Fmc Corporation | Substituted phenyltrialkylsilane insecticides |
| GB8703653D0 (en) * | 1987-02-17 | 1987-03-25 | Ici Plc | Preparation of insecticidally active compounds |
| US4885162A (en) * | 1987-03-26 | 1989-12-05 | Mitsui Toatsu Chemicals, Inc. | Polyolefin resin compositions |
| DE3712752A1 (de) * | 1987-04-15 | 1988-11-03 | Hoechst Ag | Heterocyclische neophananaloga, verfahren zu ihrer herstellung und ihre verwendung als schaedlingsbekaempfungsmittel |
| US4788348A (en) * | 1987-08-12 | 1988-11-29 | Imperial Chemical Industries Plc | Insecticidal alkenes |
| GB8822792D0 (en) * | 1988-09-28 | 1988-11-02 | Ici Plc | Insecticidal compounds |
| US4975451A (en) * | 1989-03-02 | 1990-12-04 | Fmc Corporation | Insecticidal cyclopropyl di(aryl) 2-butenes |
| US5223536A (en) * | 1991-07-23 | 1993-06-29 | Fmc Corporation | 1,4-diaryl-1-cyclopropyl-4-substituted butanes as insecticides and acaricides |
| TW328044B (en) * | 1994-12-01 | 1998-03-11 | Mitsui Toatsu Chemicals | An insecticidal and acaricidal composition |
| US7045519B2 (en) * | 1998-06-19 | 2006-05-16 | Chiron Corporation | Inhibitors of glycogen synthase kinase 3 |
| WO1999065897A1 (en) | 1998-06-19 | 1999-12-23 | Chiron Corporation | Inhibitors of glycogen synthase kinase 3 |
| CN106103398A (zh) * | 2014-01-17 | 2016-11-09 | 巴斯夫欧洲公司 | 用于生产芳基丙烯的方法 |
| CN108251508A (zh) * | 2018-01-29 | 2018-07-06 | 山东师范大学 | 评估水中污染物的神经性毒性的方法 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2079279A (en) * | 1937-05-04 | Reaction products of diphenyloxide | ||
| US4094989A (en) * | 1973-04-18 | 1978-06-13 | Ciba-Geigy Corporation | Methylenedioxy substituted benzene derivatives |
| US4152461A (en) * | 1975-03-26 | 1979-05-01 | Ciba-Geigy Corporation | Pesticidal composition and methods utilizing polyphenoxy alkanes |
| GB1570982A (en) * | 1976-03-05 | 1980-07-09 | Shell Int Research | Substituted benzyl ethers and thioethers |
| SE431085B (sv) * | 1977-09-13 | 1984-01-16 | Pfizer | 3-(2-hydroxi-4-(substituerade)fenyl)cykloalkanoner och -cykloalkanoder och vissa derivat derav till anvendning for farmakologiska och medicinska endamal |
| US4306097A (en) * | 1977-09-13 | 1981-12-15 | Pfizer Inc. | 3-[2-Hydroxy-4-(substituted)phenyl]-cycloalkanol analgesic agents |
| US4397864A (en) * | 1980-05-02 | 1983-08-09 | Mitsuitoatsu Chemicals Inc. | 2-Arylpropyl ether or thioether derivatives and insecticidal and acaricidal agents containing said derivatives |
| JPS5764632A (en) * | 1980-10-09 | 1982-04-19 | Mitsui Toatsu Chem Inc | Novel 2-arylethyl ether derivative and thioether derivative, their production and insecticide and acaricide |
| JPS58201737A (ja) * | 1982-05-18 | 1983-11-24 | Mitsui Toatsu Chem Inc | 新規芳香族アルカン誘導体、その製造法およびそれを有効成分とする殺虫、殺ダニ剤 |
-
1982
- 1982-05-18 JP JP57082473A patent/JPS58201737A/ja active Pending
-
1983
- 1983-05-02 SE SE8302464A patent/SE463455B/sv not_active IP Right Cessation
- 1983-05-03 NZ NZ204104A patent/NZ204104A/en unknown
- 1983-05-05 GB GB08312249A patent/GB2120664B/en not_active Expired
- 1983-05-10 NL NL8301656A patent/NL8301656A/nl not_active Application Discontinuation
- 1983-05-16 HU HU831696A patent/HU191607B/hu not_active IP Right Cessation
- 1983-05-16 CA CA000428240A patent/CA1227799A/en not_active Expired
- 1983-05-17 BR BR8302590A patent/BR8302590A/pt not_active IP Right Cessation
- 1983-05-17 AU AU14619/83A patent/AU544708B2/en not_active Ceased
- 1983-05-17 DE DE19833317908 patent/DE3317908A1/de active Granted
- 1983-05-17 IT IT48307/83A patent/IT1203651B/it active
- 1983-05-17 IN IN614/CAL/83A patent/IN157031B/en unknown
- 1983-05-17 CH CH2669/83A patent/CH658046A5/fr not_active IP Right Cessation
- 1983-05-17 RU SU833600650A patent/RU1837764C/ru active
- 1983-05-18 KR KR1019830002180A patent/KR870001463B1/ko not_active Expired
- 1983-05-18 FR FR8308207A patent/FR2527203B1/fr not_active Expired
-
1984
- 1984-10-22 SU SU843806472A patent/SU1524808A3/ru active
-
1986
- 1986-02-26 US US06/833,675 patent/US4661501A/en not_active Expired - Fee Related
- 1986-11-06 US US06/928,157 patent/US4814340A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| GB2120664A (en) | 1983-12-07 |
| SE8302464L (sv) | 1983-11-19 |
| KR840004703A (ko) | 1984-10-24 |
| FR2527203A1 (fr) | 1983-11-25 |
| DE3317908A1 (de) | 1983-12-22 |
| CA1227799A (en) | 1987-10-06 |
| US4661501A (en) | 1987-04-28 |
| JPS58201737A (ja) | 1983-11-24 |
| RU1837764C (ru) | 1993-08-30 |
| FR2527203B1 (fr) | 1987-06-19 |
| IT1203651B (it) | 1989-02-15 |
| GB8312249D0 (en) | 1983-06-08 |
| US4814340A (en) | 1989-03-21 |
| SU1524808A3 (ru) | 1989-11-23 |
| KR870001463B1 (ko) | 1987-08-12 |
| DE3317908C2 (cg-RX-API-DMAC7.html) | 1993-09-02 |
| HU191607B (en) | 1987-03-30 |
| GB2120664B (en) | 1986-07-30 |
| AU544708B2 (en) | 1985-06-13 |
| IN157031B (cg-RX-API-DMAC7.html) | 1986-01-04 |
| AU1461983A (en) | 1983-11-24 |
| IT8348307A0 (it) | 1983-05-17 |
| CH658046A5 (fr) | 1986-10-15 |
| SE463455B (sv) | 1990-11-26 |
| SE8302464D0 (sv) | 1983-05-02 |
| NZ204104A (en) | 1986-06-11 |
| BR8302590A (pt) | 1984-01-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL8301656A (nl) | Nieuwe aromatische alkaanderivaten en werkwijze voor de bereiding hiervan, evenals insecticidale en acaricidale middelen die deze derivaat als actieve stof bevatten. | |
| DE3117510C2 (cg-RX-API-DMAC7.html) | ||
| US4599362A (en) | 2-aryl-ethyl ether derivatives and insecticidal and acaricidal agents containing said derivatives | |
| KR850000225B1 (ko) | 2-아릴프로필에테르 유도체의 제조방법 | |
| JPS6313412B2 (cg-RX-API-DMAC7.html) | ||
| JPH0439460B2 (cg-RX-API-DMAC7.html) | ||
| JPH0328405B2 (cg-RX-API-DMAC7.html) | ||
| JPH0143A (ja) | 新規2―アリールプロピルエーテル誘導体およびチオエーテル誘導体、その製造法および殺虫、殺ダニ剤 | |
| KR850000259B1 (ko) | 2-아릴프로필티오에테르 유도체의 제조방법 | |
| JPH04261133A (ja) | 新規芳香族アルカン誘導体、その製造法 およびそれを有効成分とする殺虫、殺ダニ剤 | |
| JPS6121615B2 (cg-RX-API-DMAC7.html) | ||
| JPS60109506A (ja) | 殺虫・殺ダニ組成物 | |
| JPS60109505A (ja) | 殺虫,殺ダニ組成物 | |
| JPS60158162A (ja) | メタンスルホネ−ト誘導体およびそれを有効成分とする殺虫組成物 | |
| JPS6042339A (ja) | 新規芳香族アルカン化合物およびそれを有効成分とする殺虫,殺ダニ剤 | |
| JPH0360810B2 (cg-RX-API-DMAC7.html) | ||
| JPS5862104A (ja) | 殺虫および殺ダニ用組成物 | |
| JPH03115203A (ja) | 2―アリールプロピルエーテル誘導体を含む殺虫、殺ダニ剤 | |
| JPS5855406A (ja) | 殺虫殺ダニ用組成物 | |
| JPH032851B2 (cg-RX-API-DMAC7.html) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A1A | A request for search or an international-type search has been filed | ||
| A85 | Still pending on 85-01-01 | ||
| BB | A search report has been drawn up | ||
| BC | A request for examination has been filed | ||
| BV | The patent application has lapsed |