NL192142C - Fotogeleidend orgaan. - Google Patents
Fotogeleidend orgaan. Download PDFInfo
- Publication number
- NL192142C NL192142C NL8104426A NL8104426A NL192142C NL 192142 C NL192142 C NL 192142C NL 8104426 A NL8104426 A NL 8104426A NL 8104426 A NL8104426 A NL 8104426A NL 192142 C NL192142 C NL 192142C
- Authority
- NL
- Netherlands
- Prior art keywords
- layer
- gas
- photoconductive
- intermediate layer
- image
- Prior art date
Links
- 210000000056 organ Anatomy 0.000 title description 26
- 239000000758 substrate Substances 0.000 claims description 174
- 238000000034 method Methods 0.000 claims description 136
- 238000003384 imaging method Methods 0.000 claims description 128
- 239000000463 material Substances 0.000 claims description 74
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 58
- 125000005843 halogen group Chemical group 0.000 claims description 56
- 125000004429 atom Chemical group 0.000 claims description 48
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 40
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 30
- 229910052710 silicon Inorganic materials 0.000 claims description 27
- 229910052739 hydrogen Inorganic materials 0.000 claims description 20
- 239000011159 matrix material Substances 0.000 claims description 18
- 239000010703 silicon Substances 0.000 claims description 17
- 239000000969 carrier Substances 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 230000035515 penetration Effects 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 239000010410 layer Substances 0.000 description 694
- 239000007789 gas Substances 0.000 description 410
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 105
- 229910004014 SiF4 Inorganic materials 0.000 description 103
- ABTOQLMXBSRXSM-UHFFFAOYSA-N silicon tetrafluoride Chemical compound F[Si](F)(F)F ABTOQLMXBSRXSM-UHFFFAOYSA-N 0.000 description 103
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 89
- 230000015572 biosynthetic process Effects 0.000 description 68
- 238000004544 sputter deposition Methods 0.000 description 58
- 229910052750 molybdenum Inorganic materials 0.000 description 55
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 53
- 239000011733 molybdenum Substances 0.000 description 53
- 229910021417 amorphous silicon Inorganic materials 0.000 description 52
- 238000000151 deposition Methods 0.000 description 52
- 230000008021 deposition Effects 0.000 description 50
- 229910052581 Si3N4 Inorganic materials 0.000 description 49
- HQVNEWCFYHHQES-UHFFFAOYSA-N silicon nitride Chemical compound N12[Si]34N5[Si]62N3[Si]51N64 HQVNEWCFYHHQES-UHFFFAOYSA-N 0.000 description 48
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 43
- 239000011229 interlayer Substances 0.000 description 39
- 238000004519 manufacturing process Methods 0.000 description 36
- 239000000123 paper Substances 0.000 description 31
- -1 polyethylene Polymers 0.000 description 31
- 230000006870 function Effects 0.000 description 30
- 239000000203 mixture Substances 0.000 description 25
- 229910021420 polycrystalline silicon Inorganic materials 0.000 description 25
- 229910052757 nitrogen Inorganic materials 0.000 description 23
- 238000012360 testing method Methods 0.000 description 22
- 229910052736 halogen Inorganic materials 0.000 description 19
- 150000002367 halogens Chemical class 0.000 description 19
- 239000012535 impurity Substances 0.000 description 19
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 18
- 239000012298 atmosphere Substances 0.000 description 18
- 230000005540 biological transmission Effects 0.000 description 17
- 239000000470 constituent Substances 0.000 description 16
- 239000007858 starting material Substances 0.000 description 16
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 16
- 229910052721 tungsten Inorganic materials 0.000 description 16
- 239000010937 tungsten Substances 0.000 description 16
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 12
- 150000001875 compounds Chemical class 0.000 description 12
- 238000011156 evaluation Methods 0.000 description 12
- 229910002804 graphite Inorganic materials 0.000 description 12
- 239000010439 graphite Substances 0.000 description 12
- 238000002360 preparation method Methods 0.000 description 12
- 150000003377 silicon compounds Chemical class 0.000 description 12
- 239000011248 coating agent Substances 0.000 description 11
- 238000000576 coating method Methods 0.000 description 11
- 230000000694 effects Effects 0.000 description 11
- 238000010894 electron beam technology Methods 0.000 description 11
- 229910007264 Si2H6 Inorganic materials 0.000 description 10
- 239000000460 chlorine Substances 0.000 description 10
- 229910052801 chlorine Inorganic materials 0.000 description 10
- 238000001816 cooling Methods 0.000 description 10
- PZPGRFITIJYNEJ-UHFFFAOYSA-N disilane Chemical compound [SiH3][SiH3] PZPGRFITIJYNEJ-UHFFFAOYSA-N 0.000 description 10
- 229910052731 fluorine Inorganic materials 0.000 description 10
- 239000011810 insulating material Substances 0.000 description 10
- 230000008569 process Effects 0.000 description 10
- 230000006641 stabilisation Effects 0.000 description 10
- 238000011105 stabilization Methods 0.000 description 10
- 238000000889 atomisation Methods 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- 150000002500 ions Chemical class 0.000 description 9
- 230000003287 optical effect Effects 0.000 description 9
- 125000004430 oxygen atom Chemical group O* 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- 229910052794 bromium Inorganic materials 0.000 description 8
- 230000001419 dependent effect Effects 0.000 description 8
- 238000002156 mixing Methods 0.000 description 8
- 230000000737 periodic effect Effects 0.000 description 8
- 239000002345 surface coating layer Substances 0.000 description 8
- 229910001179 chromel Inorganic materials 0.000 description 7
- 238000007872 degassing Methods 0.000 description 7
- 239000003085 diluting agent Substances 0.000 description 7
- 150000002366 halogen compounds Chemical class 0.000 description 7
- 150000004756 silanes Chemical class 0.000 description 7
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 6
- 239000011521 glass Substances 0.000 description 6
- 150000004820 halides Chemical class 0.000 description 6
- 229910052734 helium Inorganic materials 0.000 description 6
- 229920002635 polyurethane Polymers 0.000 description 6
- 239000004814 polyurethane Substances 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 5
- 229910005096 Si3H8 Inorganic materials 0.000 description 5
- 229910052782 aluminium Inorganic materials 0.000 description 5
- 229910052786 argon Inorganic materials 0.000 description 5
- 230000008901 benefit Effects 0.000 description 5
- 239000010408 film Substances 0.000 description 5
- 239000011737 fluorine Substances 0.000 description 5
- 230000006698 induction Effects 0.000 description 5
- 229910052740 iodine Inorganic materials 0.000 description 5
- 229920000052 poly(p-xylylene) Polymers 0.000 description 5
- 229920000728 polyester Polymers 0.000 description 5
- 238000005546 reactive sputtering Methods 0.000 description 5
- 238000000682 scanning probe acoustic microscopy Methods 0.000 description 5
- 229910052990 silicon hydride Inorganic materials 0.000 description 5
- 238000004804 winding Methods 0.000 description 5
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- 206010034972 Photosensitivity reaction Diseases 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000000313 electron-beam-induced deposition Methods 0.000 description 4
- 230000007613 environmental effect Effects 0.000 description 4
- 229930195733 hydrocarbon Natural products 0.000 description 4
- 150000002430 hydrocarbons Chemical class 0.000 description 4
- 239000011261 inert gas Substances 0.000 description 4
- 239000011630 iodine Substances 0.000 description 4
- 229910052741 iridium Inorganic materials 0.000 description 4
- 229910052754 neon Inorganic materials 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- 230000036211 photosensitivity Effects 0.000 description 4
- 230000035945 sensitivity Effects 0.000 description 4
- 239000007921 spray Substances 0.000 description 4
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 3
- 229910014263 BrF3 Inorganic materials 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 3
- 229910007260 Si2F6 Inorganic materials 0.000 description 3
- 229910003676 SiBr4 Inorganic materials 0.000 description 3
- 229910003816 SiH2F2 Inorganic materials 0.000 description 3
- 229910003986 SicO Inorganic materials 0.000 description 3
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 3
- 229910052787 antimony Inorganic materials 0.000 description 3
- 150000001540 azides Chemical class 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 229910052804 chromium Inorganic materials 0.000 description 3
- 239000011651 chromium Substances 0.000 description 3
- VNNRSPGTAMTISX-UHFFFAOYSA-N chromium nickel Chemical compound [Cr].[Ni] VNNRSPGTAMTISX-UHFFFAOYSA-N 0.000 description 3
- 229910021419 crystalline silicon Inorganic materials 0.000 description 3
- MGNHOGAVECORPT-UHFFFAOYSA-N difluorosilicon Chemical compound F[Si]F MGNHOGAVECORPT-UHFFFAOYSA-N 0.000 description 3
- 238000010790 dilution Methods 0.000 description 3
- 239000012895 dilution Substances 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 206010016256 fatigue Diseases 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 238000005468 ion implantation Methods 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 3
- 229910001120 nichrome Inorganic materials 0.000 description 3
- 229910052758 niobium Inorganic materials 0.000 description 3
- 150000004767 nitrides Chemical class 0.000 description 3
- 229910017464 nitrogen compound Inorganic materials 0.000 description 3
- 150000002830 nitrogen compounds Chemical class 0.000 description 3
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- 229920000515 polycarbonate Polymers 0.000 description 3
- 239000004417 polycarbonate Substances 0.000 description 3
- 230000000717 retained effect Effects 0.000 description 3
- 229910000077 silane Inorganic materials 0.000 description 3
- AIFMYMZGQVTROK-UHFFFAOYSA-N silicon tetrabromide Chemical compound Br[Si](Br)(Br)Br AIFMYMZGQVTROK-UHFFFAOYSA-N 0.000 description 3
- 238000009751 slip forming Methods 0.000 description 3
- 229920003002 synthetic resin Polymers 0.000 description 3
- 239000000057 synthetic resin Substances 0.000 description 3
- 229910052719 titanium Inorganic materials 0.000 description 3
- SDNBGJALFMSQER-UHFFFAOYSA-N trifluoro(trifluorosilyl)silane Chemical compound F[Si](F)(F)[Si](F)(F)F SDNBGJALFMSQER-UHFFFAOYSA-N 0.000 description 3
- FQFKTKUFHWNTBN-UHFFFAOYSA-N trifluoro-$l^{3}-bromane Chemical compound FBr(F)F FQFKTKUFHWNTBN-UHFFFAOYSA-N 0.000 description 3
- VPAYJEUHKVESSD-UHFFFAOYSA-N trifluoroiodomethane Chemical compound FC(F)(F)I VPAYJEUHKVESSD-UHFFFAOYSA-N 0.000 description 3
- 238000001771 vacuum deposition Methods 0.000 description 3
- 229910052720 vanadium Inorganic materials 0.000 description 3
- 238000007740 vapor deposition Methods 0.000 description 3
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 2
- MGWGWNFMUOTEHG-UHFFFAOYSA-N 4-(3,5-dimethylphenyl)-1,3-thiazol-2-amine Chemical compound CC1=CC(C)=CC(C=2N=C(N)SC=2)=C1 MGWGWNFMUOTEHG-UHFFFAOYSA-N 0.000 description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 206010034960 Photophobia Diseases 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 2
- 229910003910 SiCl4 Inorganic materials 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 229910052785 arsenic Inorganic materials 0.000 description 2
- UAZDIGCOBKKMPU-UHFFFAOYSA-O azanium;azide Chemical compound [NH4+].[N-]=[N+]=[N-] UAZDIGCOBKKMPU-UHFFFAOYSA-O 0.000 description 2
- 229910052797 bismuth Inorganic materials 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- KDKYADYSIPSCCQ-UHFFFAOYSA-N but-1-yne Chemical compound CCC#C KDKYADYSIPSCCQ-UHFFFAOYSA-N 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- 229910052681 coesite Inorganic materials 0.000 description 2
- 229910052906 cristobalite Inorganic materials 0.000 description 2
- 230000006866 deterioration Effects 0.000 description 2
- KBDJQNUZLNUGDS-UHFFFAOYSA-N dibromosilicon Chemical compound Br[Si]Br KBDJQNUZLNUGDS-UHFFFAOYSA-N 0.000 description 2
- 238000009792 diffusion process Methods 0.000 description 2
- 230000005284 excitation Effects 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 229910052733 gallium Inorganic materials 0.000 description 2
- 229910052737 gold Inorganic materials 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 description 2
- 238000005286 illumination Methods 0.000 description 2
- 238000002513 implantation Methods 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 229910052738 indium Inorganic materials 0.000 description 2
- 208000013469 light sensitivity Diseases 0.000 description 2
- 238000011068 loading method Methods 0.000 description 2
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 2
- GVGCUCJTUSOZKP-UHFFFAOYSA-N nitrogen trifluoride Chemical compound FN(F)F GVGCUCJTUSOZKP-UHFFFAOYSA-N 0.000 description 2
- 229910052756 noble gas Inorganic materials 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 239000005033 polyvinylidene chloride Substances 0.000 description 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 229930195734 saturated hydrocarbon Natural products 0.000 description 2
- 229910052814 silicon oxide Inorganic materials 0.000 description 2
- FDNAPBUWERUEDA-UHFFFAOYSA-N silicon tetrachloride Chemical compound Cl[Si](Cl)(Cl)Cl FDNAPBUWERUEDA-UHFFFAOYSA-N 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- 229910052682 stishovite Inorganic materials 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 229910052715 tantalum Inorganic materials 0.000 description 2
- 229910052716 thallium Inorganic materials 0.000 description 2
- 229910052905 tridymite Inorganic materials 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- BQCIDUSAKPWEOX-UHFFFAOYSA-N 1,1-Difluoroethene Chemical compound FC(F)=C BQCIDUSAKPWEOX-UHFFFAOYSA-N 0.000 description 1
- ZQXCQTAELHSNAT-UHFFFAOYSA-N 1-chloro-3-nitro-5-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(Cl)=CC(C(F)(F)F)=C1 ZQXCQTAELHSNAT-UHFFFAOYSA-N 0.000 description 1
- 229910014271 BrF5 Inorganic materials 0.000 description 1
- 241000282461 Canis lupus Species 0.000 description 1
- 241000283074 Equus asinus Species 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- XPDWGBQVDMORPB-UHFFFAOYSA-N Fluoroform Chemical compound FC(F)F XPDWGBQVDMORPB-UHFFFAOYSA-N 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- 239000002033 PVDF binder Substances 0.000 description 1
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 229910007277 Si3 N4 Inorganic materials 0.000 description 1
- XMIJDTGORVPYLW-UHFFFAOYSA-N [SiH2] Chemical compound [SiH2] XMIJDTGORVPYLW-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001343 alkyl silanes Chemical class 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- QQHSIRTYSFLSRM-UHFFFAOYSA-N alumanylidynechromium Chemical compound [Al].[Cr] QQHSIRTYSFLSRM-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- XHVUVQAANZKEKF-UHFFFAOYSA-N bromine pentafluoride Chemical compound FBr(F)(F)(F)F XHVUVQAANZKEKF-UHFFFAOYSA-N 0.000 description 1
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 1
- FTYZKCCJUXJFLT-UHFFFAOYSA-N bromosilicon Chemical compound Br[Si] FTYZKCCJUXJFLT-UHFFFAOYSA-N 0.000 description 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- RWRIWBAIICGTTQ-UHFFFAOYSA-N difluoromethane Chemical compound FCF RWRIWBAIICGTTQ-UHFFFAOYSA-N 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 230000005684 electric field Effects 0.000 description 1
- 230000005670 electromagnetic radiation Effects 0.000 description 1
- 238000001941 electron spectroscopy Methods 0.000 description 1
- 238000001017 electron-beam sputter deposition Methods 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- NBVXSUQYWXRMNV-UHFFFAOYSA-N fluoromethane Chemical compound FC NBVXSUQYWXRMNV-UHFFFAOYSA-N 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- ACGUYXCXAPNIKK-UHFFFAOYSA-N hexachlorophene Chemical compound OC1=C(Cl)C=C(Cl)C(Cl)=C1CC1=C(O)C(Cl)=CC(Cl)=C1Cl ACGUYXCXAPNIKK-UHFFFAOYSA-N 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 239000012216 imaging agent Substances 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 229910052809 inorganic oxide Inorganic materials 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 230000001678 irradiating effect Effects 0.000 description 1
- 238000010030 laminating Methods 0.000 description 1
- 229910052745 lead Inorganic materials 0.000 description 1
- 230000004298 light response Effects 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- YWAKXRMUMFPDSH-UHFFFAOYSA-N pentene Chemical compound CCCC=C YWAKXRMUMFPDSH-UHFFFAOYSA-N 0.000 description 1
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 1
- 229920001083 polybutene Polymers 0.000 description 1
- 229920006267 polyester film Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229920002620 polyvinyl fluoride Polymers 0.000 description 1
- 229920002981 polyvinylidene fluoride Polymers 0.000 description 1
- KNVAYBMMCPLDOZ-UHFFFAOYSA-N propan-2-yl 12-hydroxyoctadecanoate Chemical compound CCCCCCC(O)CCCCCCCCCCC(=O)OC(C)C KNVAYBMMCPLDOZ-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- MWWATHDPGQKSAR-UHFFFAOYSA-N propyne Chemical group CC#C MWWATHDPGQKSAR-UHFFFAOYSA-N 0.000 description 1
- 230000009993 protective function Effects 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- 230000006798 recombination Effects 0.000 description 1
- 238000005215 recombination Methods 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- 229910021332 silicide Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- LIVNPJMFVYWSIS-UHFFFAOYSA-N silicon monoxide Chemical class [Si-]#[O+] LIVNPJMFVYWSIS-UHFFFAOYSA-N 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- IAQRGUVFOMOMEM-ONEGZZNKSA-N trans-but-2-ene Chemical compound C\C=C\C IAQRGUVFOMOMEM-ONEGZZNKSA-N 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
- 238000001947 vapour-phase growth Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/08—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being inorganic
- G03G5/082—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being inorganic and not being incorporated in a bonding material, e.g. vacuum deposited
- G03G5/08214—Silicon-based
- G03G5/08235—Silicon-based comprising three or four silicon-based layers
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/08—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being inorganic
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/08—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being inorganic
- G03G5/082—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being inorganic and not being incorporated in a bonding material, e.g. vacuum deposited
- G03G5/08214—Silicon-based
- G03G5/08221—Silicon-based comprising one or two silicon based layers
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Photoreceptors In Electrophotography (AREA)
- Light Receiving Elements (AREA)
Applications Claiming Priority (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP13411580 | 1980-09-25 | ||
| JP55134114A JPS5758159A (en) | 1980-09-25 | 1980-09-25 | Photoconductive member |
| JP13411480 | 1980-09-25 | ||
| JP13411680 | 1980-09-25 | ||
| JP55134116A JPS5758161A (en) | 1980-09-25 | 1980-09-25 | Photoconductive member |
| JP55134115A JPS5758160A (en) | 1980-09-25 | 1980-09-25 | Photoconductive member |
| JP55137149A JPS5762053A (en) | 1980-09-30 | 1980-09-30 | Photoconductive member |
| JP55137150A JPS5762054A (en) | 1980-09-30 | 1980-09-30 | Photoconductive member |
| JP55137151A JPS5762055A (en) | 1980-09-30 | 1980-09-30 | Photoconductive member |
| JP13714980 | 1980-09-30 | ||
| JP13715080 | 1980-09-30 | ||
| JP13715180 | 1980-09-30 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| NL8104426A NL8104426A (nl) | 1982-04-16 |
| NL192142B NL192142B (nl) | 1996-10-01 |
| NL192142C true NL192142C (nl) | 1997-02-04 |
Family
ID=27552830
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL8104426A NL192142C (nl) | 1980-09-25 | 1981-09-25 | Fotogeleidend orgaan. |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4394426A (OSRAM) |
| AU (1) | AU554181B2 (OSRAM) |
| CA (1) | CA1181628A (OSRAM) |
| DE (1) | DE3152399A1 (OSRAM) |
| FR (1) | FR2490839B1 (OSRAM) |
| GB (1) | GB2087643B (OSRAM) |
| NL (1) | NL192142C (OSRAM) |
| WO (1) | WO1982001261A1 (OSRAM) |
Families Citing this family (47)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4484809B1 (en) * | 1977-12-05 | 1995-04-18 | Plasma Physics Corp | Glow discharge method and apparatus and photoreceptor devices made therewith |
| JPS5795677A (en) * | 1980-12-03 | 1982-06-14 | Kanegafuchi Chem Ind Co Ltd | Amorphous silicon type photoelectric tranducer |
| GB2088628B (en) * | 1980-10-03 | 1985-06-12 | Canon Kk | Photoconductive member |
| US4522905A (en) * | 1982-02-04 | 1985-06-11 | Canon Kk | Amorphous silicon photoconductive member with interface and rectifying layers |
| US4452874A (en) * | 1982-02-08 | 1984-06-05 | Canon Kabushiki Kaisha | Photoconductive member with multiple amorphous Si layers |
| US4452875A (en) * | 1982-02-15 | 1984-06-05 | Canon Kabushiki Kaisha | Amorphous photoconductive member with α-Si interlayers |
| US4536459A (en) * | 1982-03-12 | 1985-08-20 | Canon Kabushiki Kaisha | Photoconductive member having multiple amorphous layers |
| US4490454A (en) * | 1982-03-17 | 1984-12-25 | Canon Kabushiki Kaisha | Photoconductive member comprising multiple amorphous layers |
| JPS58217938A (ja) * | 1982-06-12 | 1983-12-19 | Konishiroku Photo Ind Co Ltd | 電子写真感光体 |
| US5219698A (en) * | 1982-09-27 | 1993-06-15 | Canon Kabushiki Kaisha | Laser imaging method and apparatus for electrophotography |
| JPS5957247A (ja) * | 1982-09-27 | 1984-04-02 | Canon Inc | 電子写真用感光体 |
| US4466380A (en) * | 1983-01-10 | 1984-08-21 | Xerox Corporation | Plasma deposition apparatus for photoconductive drums |
| US4569894A (en) * | 1983-01-14 | 1986-02-11 | Canon Kabushiki Kaisha | Photoconductive member comprising germanium atoms |
| JPS59193463A (ja) * | 1983-04-18 | 1984-11-02 | Canon Inc | 電子写真用光導電部材 |
| JPS59200248A (ja) * | 1983-04-28 | 1984-11-13 | Canon Inc | 像形成部材の製造法 |
| JPS6041046A (ja) * | 1983-08-16 | 1985-03-04 | Kanegafuchi Chem Ind Co Ltd | 電子写真用感光体 |
| US4585721A (en) * | 1983-09-05 | 1986-04-29 | Canon Kabushiki Kaisha | Photoconductive member comprising amorphous germanium, amorphous silicon and nitrogen |
| US4544617A (en) * | 1983-11-02 | 1985-10-01 | Xerox Corporation | Electrophotographic devices containing overcoated amorphous silicon compositions |
| JPS60146251A (ja) * | 1984-01-10 | 1985-08-01 | Sharp Corp | 電子写真用感光体の製造方法 |
| US4619729A (en) * | 1984-02-14 | 1986-10-28 | Energy Conversion Devices, Inc. | Microwave method of making semiconductor members |
| DE3546544C2 (OSRAM) * | 1984-02-28 | 1990-02-15 | Sharp K.K., Osaka, Jp | |
| DE3511315A1 (de) * | 1984-03-28 | 1985-10-24 | Konishiroku Photo Industry Co., Ltd., Tokio/Tokyo | Elektrostatographisches, insbesondere elektrophotographisches aufzeichnungsmaterial |
| US4720443A (en) * | 1984-04-05 | 1988-01-19 | Canon Kabushiki Kaisha | Member having light receiving layer with nonparallel interfaces |
| JPS60212768A (ja) * | 1984-04-06 | 1985-10-25 | Canon Inc | 光受容部材 |
| US4602352A (en) * | 1984-04-17 | 1986-07-22 | University Of Pittsburgh | Apparatus and method for detection of infrared radiation |
| US4603401A (en) * | 1984-04-17 | 1986-07-29 | University Of Pittsburgh | Apparatus and method for infrared imaging |
| US4705732A (en) * | 1984-04-27 | 1987-11-10 | Canon Kabushiki Kaisha | Member having substrate with projecting portions at surface and light receiving layer of amorphous silicon |
| JPS6129847A (ja) * | 1984-07-20 | 1986-02-10 | Minolta Camera Co Ltd | 電子写真感光体 |
| JPH071395B2 (ja) * | 1984-09-27 | 1995-01-11 | 株式会社東芝 | 電子写真感光体 |
| US4613556A (en) * | 1984-10-18 | 1986-09-23 | Xerox Corporation | Heterogeneous electrophotographic imaging members of amorphous silicon and silicon oxide |
| US4849315A (en) * | 1985-01-21 | 1989-07-18 | Xerox Corporation | Processes for restoring hydrogenated and halogenated amorphous silicon imaging members |
| JPS61221752A (ja) * | 1985-03-12 | 1986-10-02 | Sharp Corp | 電子写真感光体 |
| JPH0624238B2 (ja) * | 1985-04-16 | 1994-03-30 | キヤノン株式会社 | フォトセンサアレイの製造方法 |
| US4582773A (en) * | 1985-05-02 | 1986-04-15 | Energy Conversion Devices, Inc. | Electrophotographic photoreceptor and method for the fabrication thereof |
| US4741982A (en) * | 1985-09-13 | 1988-05-03 | Minolta Camera Kabushiki Kaisha | Photosensitive member having undercoat layer of amorphous carbon |
| US4749636A (en) * | 1985-09-13 | 1988-06-07 | Minolta Camera Kabushiki Kaisha | Photosensitive member with hydrogen-containing carbon layer |
| US4743522A (en) * | 1985-09-13 | 1988-05-10 | Minolta Camera Kabushiki Kaisha | Photosensitive member with hydrogen-containing carbon layer |
| US4738912A (en) * | 1985-09-13 | 1988-04-19 | Minolta Camera Kabushiki Kaisha | Photosensitive member having an amorphous carbon transport layer |
| US5166018A (en) * | 1985-09-13 | 1992-11-24 | Minolta Camera Kabushiki Kaisha | Photosensitive member with hydrogen-containing carbon layer |
| US4666806A (en) * | 1985-09-30 | 1987-05-19 | Xerox Corporation | Overcoated amorphous silicon imaging members |
| US4663258A (en) * | 1985-09-30 | 1987-05-05 | Xerox Corporation | Overcoated amorphous silicon imaging members |
| US4885226A (en) * | 1986-01-18 | 1989-12-05 | Sanyo Electric Co., Ltd. | Electrophotographic photosensitive sensor |
| US5000831A (en) * | 1987-03-09 | 1991-03-19 | Minolta Camera Kabushiki Kaisha | Method of production of amorphous hydrogenated carbon layer |
| US4916116A (en) * | 1987-05-06 | 1990-04-10 | Semiconductor Energy Laboratory Co., Ltd. | Method of adding a halogen element into oxide superconducting materials by ion injection |
| JPH02124578A (ja) * | 1988-10-11 | 1990-05-11 | Fuji Xerox Co Ltd | 電子写真感光体 |
| US4957602A (en) * | 1989-06-12 | 1990-09-18 | The United States Of America As Represented By The Secretary Of The Army | Method of modifying the dielectric properties of an organic polymer film |
| DE69326878T2 (de) * | 1992-12-14 | 2000-04-27 | Canon K.K., Tokio/Tokyo | Lichtempfindliches Element mit einer mehrschichtigen Schicht mit erhöhter Wasserstoff oder/und Halogenatom Konzentration im Grenzflächenbereich benachbarter Schichten |
Family Cites Families (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3650737A (en) * | 1968-03-25 | 1972-03-21 | Ibm | Imaging method using photoconductive element having a protective coating |
| US3712810A (en) * | 1970-12-18 | 1973-01-23 | Xerox Corp | Ambipolar photoreceptor and method |
| US4317844A (en) * | 1975-07-28 | 1982-03-02 | Rca Corporation | Semiconductor device having a body of amorphous silicon and method of making the same |
| DE2746967C2 (de) * | 1977-10-19 | 1981-09-24 | Siemens AG, 1000 Berlin und 8000 München | Elektrofotographische Aufzeichnungstrommel |
| AU530905B2 (en) * | 1977-12-22 | 1983-08-04 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member |
| JPS6035059B2 (ja) * | 1977-12-22 | 1985-08-12 | キヤノン株式会社 | 電子写真感光体およびその製造方法 |
| JPS54143645A (en) * | 1978-04-28 | 1979-11-09 | Canon Inc | Image forming member for electrophotography |
| DE2954551C2 (OSRAM) * | 1978-03-03 | 1989-02-09 | Canon K.K., Tokio/Tokyo, Jp | |
| US4217374A (en) * | 1978-03-08 | 1980-08-12 | Energy Conversion Devices, Inc. | Amorphous semiconductors equivalent to crystalline semiconductors |
| US4226898A (en) * | 1978-03-16 | 1980-10-07 | Energy Conversion Devices, Inc. | Amorphous semiconductors equivalent to crystalline semiconductors produced by a glow discharge process |
| JPS54145539A (en) * | 1978-05-04 | 1979-11-13 | Canon Inc | Electrophotographic image forming material |
| JPS54145541A (en) * | 1978-05-04 | 1979-11-13 | Canon Inc | Electrophotographic image forming material |
| JPS54145540A (en) * | 1978-05-04 | 1979-11-13 | Canon Inc | Electrophotographic image forming material |
| JPS54145537A (en) * | 1978-05-04 | 1979-11-13 | Canon Inc | Preparation of electrophotographic image forming material |
| JPS54155046A (en) * | 1978-05-26 | 1979-12-06 | Canon Inc | Method of manufacturing electrophotographic image forming material |
| JPS554040A (en) * | 1978-06-26 | 1980-01-12 | Hitachi Ltd | Photoconductive material |
| JPS557761A (en) * | 1978-07-03 | 1980-01-19 | Canon Inc | Image forming member for electrophotography |
| JPS5820426B2 (ja) * | 1978-10-17 | 1983-04-22 | キヤノン株式会社 | 電子写真感光体 |
| JPS5562779A (en) * | 1978-11-01 | 1980-05-12 | Canon Inc | Preparation of amorphous photoconductive portion material |
| JPS5562780A (en) * | 1978-11-01 | 1980-05-12 | Canon Inc | Preparation of amorphous photoconductive portion material |
| JPS5562781A (en) * | 1978-11-01 | 1980-05-12 | Canon Inc | Preparation of amorphous photoconductive portion material |
| JPS5569149A (en) * | 1978-11-17 | 1980-05-24 | Matsushita Electric Ind Co Ltd | Electrophotographic photosensitive plate |
| JPS5591884A (en) * | 1978-12-28 | 1980-07-11 | Canon Inc | Manufacture of amorphous photoconductive component |
| JPS5589844A (en) * | 1978-12-28 | 1980-07-07 | Canon Inc | Electrophotographic photoreceptor |
| JPS5591885A (en) * | 1978-12-28 | 1980-07-11 | Canon Inc | Amorphous silicon hydride photoconductive layer |
| US4253882A (en) * | 1980-02-15 | 1981-03-03 | University Of Delaware | Multiple gap photovoltaic device |
| JPS574053A (en) * | 1980-06-09 | 1982-01-09 | Canon Inc | Photoconductive member |
| JPS5727263A (en) * | 1980-07-28 | 1982-02-13 | Hitachi Ltd | Electrophotographic photosensitive film |
-
1981
- 1981-09-22 US US06/304,568 patent/US4394426A/en not_active Expired - Lifetime
- 1981-09-24 GB GB8128841A patent/GB2087643B/en not_active Expired
- 1981-09-24 AU AU75648/81A patent/AU554181B2/en not_active Expired
- 1981-09-25 DE DE813152399A patent/DE3152399A1/de active Granted
- 1981-09-25 FR FR8118123A patent/FR2490839B1/fr not_active Expired
- 1981-09-25 NL NL8104426A patent/NL192142C/nl not_active IP Right Cessation
- 1981-09-25 WO PCT/JP1981/000256 patent/WO1982001261A1/ja not_active Ceased
- 1981-09-25 CA CA000386703A patent/CA1181628A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE3152399C2 (OSRAM) | 1988-06-09 |
| AU7564881A (en) | 1982-04-01 |
| US4394426A (en) | 1983-07-19 |
| GB2087643B (en) | 1985-06-12 |
| CA1181628A (en) | 1985-01-29 |
| NL8104426A (nl) | 1982-04-16 |
| DE3152399A1 (en) | 1982-09-23 |
| AU554181B2 (en) | 1986-08-14 |
| WO1982001261A1 (en) | 1982-04-15 |
| FR2490839A1 (fr) | 1982-03-26 |
| FR2490839B1 (fr) | 1986-05-23 |
| GB2087643A (en) | 1982-05-26 |
| NL192142B (nl) | 1996-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL192142C (nl) | Fotogeleidend orgaan. | |
| US4670369A (en) | Image-forming member for electrophotography | |
| US4394425A (en) | Photoconductive member with α-Si(C) barrier layer | |
| JP2509228B2 (ja) | 多層型無定形ケイ素像形成部材 | |
| FR2497604A1 (fr) | Element photoconducteur | |
| JPH0411860B2 (OSRAM) | ||
| US4522905A (en) | Amorphous silicon photoconductive member with interface and rectifying layers | |
| EP0242231A2 (en) | Light receiving member having improved image making efficiencies | |
| US4486521A (en) | Photoconductive member with doped and oxygen containing amorphous silicon layers | |
| US4775606A (en) | Light receiving member comprising amorphous silicon layers for electrophotography | |
| US4532198A (en) | Photoconductive member | |
| US4501807A (en) | Photoconductive member having an amorphous silicon layer | |
| JPS6247303B2 (OSRAM) | ||
| JPH0150905B2 (OSRAM) | ||
| JPS6341059B2 (OSRAM) | ||
| JPH0213297B2 (OSRAM) | ||
| US4780384A (en) | Light receiving member with pairs of an α-Si(M) (H,X) thin layer and an α-Si(C,N,O,) (H,X) thin layer repeatedly laminated | |
| JPH0380307B2 (OSRAM) | ||
| JPS6341060B2 (OSRAM) | ||
| JPS6346408B2 (OSRAM) | ||
| JPH0454946B2 (OSRAM) | ||
| GB2088628A (en) | Photoconductive member | |
| JPS6335979B2 (OSRAM) | ||
| JPH0216512B2 (OSRAM) | ||
| JPS6357781B2 (OSRAM) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BT | A document has been added to the application laid open to public inspection | ||
| BT | A document has been added to the application laid open to public inspection | ||
| A85 | Still pending on 85-01-01 | ||
| BA | A request for search or an international-type search has been filed | ||
| BB | A search report has been drawn up | ||
| BC | A request for examination has been filed | ||
| V4 | Lapsed because of reaching the maximum lifetime of a patent |
Free format text: 20010925 |