KR20090130347A - 치환된 헤테로사이클릭 유도체 및 조성물 및 항균제로서의 이의 약학적 용도 - Google Patents
치환된 헤테로사이클릭 유도체 및 조성물 및 항균제로서의 이의 약학적 용도 Download PDFInfo
- Publication number
- KR20090130347A KR20090130347A KR1020097025640A KR20097025640A KR20090130347A KR 20090130347 A KR20090130347 A KR 20090130347A KR 1020097025640 A KR1020097025640 A KR 1020097025640A KR 20097025640 A KR20097025640 A KR 20097025640A KR 20090130347 A KR20090130347 A KR 20090130347A
- Authority
- KR
- South Korea
- Prior art keywords
- alkyl
- alkoxy
- compound
- carboxylic acid
- mmol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 125000000623 heterocyclic group Chemical group 0.000 title claims description 7
- 239000000203 mixture Substances 0.000 title description 143
- 239000003242 anti bacterial agent Substances 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 209
- 238000000034 method Methods 0.000 claims abstract description 64
- -1 amino, hydroxyl Chemical group 0.000 claims description 120
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 50
- 150000003839 salts Chemical class 0.000 claims description 46
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 38
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 36
- 239000000651 prodrug Substances 0.000 claims description 35
- 229940002612 prodrug Drugs 0.000 claims description 35
- 125000004122 cyclic group Chemical group 0.000 claims description 28
- 229910052736 halogen Inorganic materials 0.000 claims description 28
- 150000002367 halogens Chemical class 0.000 claims description 28
- 229910052739 hydrogen Inorganic materials 0.000 claims description 28
- 239000001257 hydrogen Substances 0.000 claims description 27
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims description 25
- 125000001072 heteroaryl group Chemical group 0.000 claims description 23
- 229910052757 nitrogen Inorganic materials 0.000 claims description 23
- 125000006376 (C3-C10) cycloalkyl group Chemical group 0.000 claims description 21
- 229920006395 saturated elastomer Polymers 0.000 claims description 21
- 150000002431 hydrogen Chemical class 0.000 claims description 19
- 125000003118 aryl group Chemical group 0.000 claims description 18
- 125000000041 C6-C10 aryl group Chemical group 0.000 claims description 17
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 17
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 15
- 239000008194 pharmaceutical composition Substances 0.000 claims description 15
- 239000012453 solvate Substances 0.000 claims description 15
- 239000003814 drug Substances 0.000 claims description 14
- 150000001204 N-oxides Chemical class 0.000 claims description 13
- 125000004429 atom Chemical group 0.000 claims description 13
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 13
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims description 12
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 12
- 238000011282 treatment Methods 0.000 claims description 12
- XJLSEXAGTJCILF-RXMQYKEDSA-N (R)-nipecotic acid zwitterion Chemical compound OC(=O)[C@@H]1CCCNC1 XJLSEXAGTJCILF-RXMQYKEDSA-N 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 125000004470 heterocyclooxy group Chemical group 0.000 claims description 11
- 229910052760 oxygen Inorganic materials 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 125000004104 aryloxy group Chemical group 0.000 claims description 10
- 125000002950 monocyclic group Chemical group 0.000 claims description 10
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 claims description 9
- 125000005843 halogen group Chemical group 0.000 claims description 9
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 9
- 125000004423 acyloxy group Chemical group 0.000 claims description 8
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 8
- 229910052717 sulfur Chemical group 0.000 claims description 8
- 125000002837 carbocyclic group Chemical group 0.000 claims description 7
- 125000005842 heteroatom Chemical group 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 7
- 125000006719 (C6-C10) aryl (C1-C6) alkyl group Chemical group 0.000 claims description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 6
- 241000124008 Mammalia Species 0.000 claims description 6
- 125000002252 acyl group Chemical group 0.000 claims description 6
- 125000002619 bicyclic group Chemical group 0.000 claims description 6
- 239000003085 diluting agent Substances 0.000 claims description 6
- 125000001153 fluoro group Chemical group F* 0.000 claims description 6
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 6
- 239000003981 vehicle Substances 0.000 claims description 6
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 239000003937 drug carrier Substances 0.000 claims description 5
- 125000005553 heteroaryloxy group Chemical group 0.000 claims description 5
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 5
- 239000001301 oxygen Chemical group 0.000 claims description 5
- 239000011593 sulfur Chemical group 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 claims description 4
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 claims description 4
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- ZHEWFNDKFYBUDO-SGUQQXKUSA-N (3r,4r)-1-[3-(2,5-difluorophenyl)cyclobutyl]-4-[(3s)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CC[C@H](O)C2=CC=NC3=CC=C(C=C32)OC)CN1C(C1)CC1C1=CC(F)=CC=C1F ZHEWFNDKFYBUDO-SGUQQXKUSA-N 0.000 claims description 3
- VSLZNKFMVLGHTG-JLYNRWRGSA-N (3r,4r)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-phenylcyclobutyl)piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(O)C2=CC=NC3=CC=C(C=C32)OC)CN1C(C1)CC1C1=CC=CC=C1 VSLZNKFMVLGHTG-JLYNRWRGSA-N 0.000 claims description 3
- 125000004738 (C1-C6) alkyl sulfinyl group Chemical group 0.000 claims description 3
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 claims description 3
- 208000035143 Bacterial infection Diseases 0.000 claims description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 3
- 125000005035 acylthio group Chemical group 0.000 claims description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- 208000022362 bacterial infectious disease Diseases 0.000 claims description 3
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 claims description 3
- XILBJBALCLVHMC-HYFKYTBRSA-N (3r,4r)-1-[3-(2,5-difluorophenyl)cyclobutyl]-4-[(3s)-3-(3-fluoro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CC[C@H](O)C2=C(F)C=NC3=CC=C(C=C32)OC)CN1C(C1)CC1C1=CC(F)=CC=C1F XILBJBALCLVHMC-HYFKYTBRSA-N 0.000 claims description 2
- CXKTZIIMLVMOEE-LFTIPEMBSA-N (3r,4r)-1-[3-(2,5-difluorophenyl)cyclobutyl]-4-[3-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-3-hydroxypropyl]piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(O)C2=C(F)C=NC3=CC=C(N=C32)OC)CN1C(C1)CC1C1=CC(F)=CC=C1F CXKTZIIMLVMOEE-LFTIPEMBSA-N 0.000 claims description 2
- ZZEFVGNVSJWANE-DLHRMPCLSA-N (3r,4r)-1-[3-(2,6-difluorophenyl)cyclobutyl]-4-[3-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-3-hydroxypropyl]piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(O)C2=C(F)C=NC3=CC=C(N=C32)OC)CN1C(C1)CC1C1=C(F)C=CC=C1F ZZEFVGNVSJWANE-DLHRMPCLSA-N 0.000 claims description 2
- FZLRGYMRPZHZOB-SBNFKLEUSA-N (3r,4r)-1-[3-(2,6-difluorophenyl)cyclobutyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(O)C2=CC=NC3=CC=C(C=C32)OC)CN1C(C1)CC1C1=C(F)C=CC=C1F FZLRGYMRPZHZOB-SBNFKLEUSA-N 0.000 claims description 2
- BFTYXXYZLWZEGV-BPZQULEUSA-N (3r,4r)-1-[3-(3,5-difluorophenyl)cyclobutyl]-4-[(3s)-3-(3-fluoro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CC[C@H](O)C2=C(F)C=NC3=CC=C(C=C32)OC)CN1C(C1)CC1C1=CC(F)=CC(F)=C1 BFTYXXYZLWZEGV-BPZQULEUSA-N 0.000 claims description 2
- PYHPYRVGHHVGEC-FYDYYVQNSA-N (3r,4r)-1-[3-(3,5-difluorophenyl)cyclobutyl]-4-[(3s)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CC[C@H](O)C2=CC=NC3=CC=C(C=C32)OC)CN1C(C1)CC1C1=CC(F)=CC(F)=C1 PYHPYRVGHHVGEC-FYDYYVQNSA-N 0.000 claims description 2
- MLOACGQCWTULEX-FDMBSIHWSA-N (3r,4r)-1-[3-(3,5-difluorophenyl)cyclobutyl]-4-[3-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-3-hydroxypropyl]piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(O)C2=C(F)C=NC3=CC=C(N=C32)OC)CN1C(C1)CC1C1=CC(F)=CC(F)=C1 MLOACGQCWTULEX-FDMBSIHWSA-N 0.000 claims description 2
- ODCDHYIGRDDZIS-QLBQJLTJSA-N (3r,4r)-4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(3-phenylcyclobutyl)piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(O)C2=C(Cl)C=NC3=CC=C(C=C32)OC)CN1C(C1)CC1C1=CC=CC=C1 ODCDHYIGRDDZIS-QLBQJLTJSA-N 0.000 claims description 2
- IPWYGDBWTKPKQC-GQSGHFFDSA-N (3r,4r)-4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-[3-(2,5-difluorophenyl)cyclobutyl]piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(O)C2=C(Cl)C=NC3=CC=C(C=C32)OC)CN1C(C1)CC1C1=CC(F)=CC=C1F IPWYGDBWTKPKQC-GQSGHFFDSA-N 0.000 claims description 2
- DWNIGKZSOHHUOF-MAFUSCBLSA-N (3r,4r)-4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-[3-(2,6-difluorophenyl)cyclobutyl]piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(O)C2=C(Cl)C=NC3=CC=C(C=C32)OC)CN1C(C1)CC1C1=C(F)C=CC=C1F DWNIGKZSOHHUOF-MAFUSCBLSA-N 0.000 claims description 2
- NKOZTUDLFMCVOC-QLBQJLTJSA-N (3r,4r)-4-[3-(3-fluoro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(3-phenylcyclobutyl)piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(O)C2=C(F)C=NC3=CC=C(C=C32)OC)CN1C(C1)CC1C1=CC=CC=C1 NKOZTUDLFMCVOC-QLBQJLTJSA-N 0.000 claims description 2
- HMKCREDERPZPTH-UHFFFAOYSA-N 3-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-[3-(2,5-difluorophenyl)cyclobutyl]pyrrolidine-3-carboxylic acid Chemical compound C12=CC(OC)=CC=C2N=CC(Cl)=C1CCCC(C1)(C(O)=O)CCN1C(C1)CC1C1=CC(F)=CC=C1F HMKCREDERPZPTH-UHFFFAOYSA-N 0.000 claims description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 2
- 241000282412 Homo Species 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000005366 cycloalkylthio group Chemical group 0.000 claims description 2
- 125000004785 fluoromethoxy group Chemical group [H]C([H])(F)O* 0.000 claims description 2
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 claims description 2
- 150000003536 tetrazoles Chemical class 0.000 claims description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 2
- 229940124597 therapeutic agent Drugs 0.000 claims 2
- 125000003396 thiol group Chemical class [H]S* 0.000 claims 2
- 241001465754 Metazoa Species 0.000 claims 1
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 125000002346 iodo group Chemical group I* 0.000 claims 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 claims 1
- 238000002360 preparation method Methods 0.000 abstract description 45
- 230000008569 process Effects 0.000 abstract description 4
- 239000004599 antimicrobial Substances 0.000 abstract description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 325
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 144
- 238000006243 chemical reaction Methods 0.000 description 129
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 127
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 104
- 239000000047 product Substances 0.000 description 87
- 239000000243 solution Substances 0.000 description 86
- 239000007787 solid Substances 0.000 description 79
- 238000005481 NMR spectroscopy Methods 0.000 description 75
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 69
- 235000019439 ethyl acetate Nutrition 0.000 description 62
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 61
- 238000010828 elution Methods 0.000 description 51
- 239000011541 reaction mixture Substances 0.000 description 50
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 47
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 45
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 44
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 39
- 238000004587 chromatography analysis Methods 0.000 description 38
- 239000002904 solvent Substances 0.000 description 38
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical class CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 34
- 230000014759 maintenance of location Effects 0.000 description 34
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 34
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 33
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 30
- 239000000543 intermediate Substances 0.000 description 30
- 239000003921 oil Substances 0.000 description 30
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 29
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 28
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 28
- 239000010410 layer Substances 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 25
- 238000000746 purification Methods 0.000 description 25
- 238000001819 mass spectrum Methods 0.000 description 23
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 22
- 235000019253 formic acid Nutrition 0.000 description 22
- 239000000741 silica gel Substances 0.000 description 22
- 229910002027 silica gel Inorganic materials 0.000 description 22
- 238000002953 preparative HPLC Methods 0.000 description 21
- 239000000460 chlorine Substances 0.000 description 20
- 239000012044 organic layer Substances 0.000 description 20
- 239000012074 organic phase Substances 0.000 description 18
- 239000011347 resin Substances 0.000 description 18
- 229920005989 resin Polymers 0.000 description 18
- 239000008259 solid foam Substances 0.000 description 17
- 230000000670 limiting effect Effects 0.000 description 16
- 230000002829 reductive effect Effects 0.000 description 16
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 15
- RKOTXQYWCBGZLP-UHFFFAOYSA-N N-[(2,4-difluorophenyl)methyl]-2-ethyl-9-hydroxy-3-methoxy-1,8-dioxospiro[3H-pyrido[1,2-a]pyrazine-4,3'-oxolane]-7-carboxamide Chemical compound CCN1C(OC)C2(CCOC2)N2C=C(C(=O)NCC3=C(F)C=C(F)C=C3)C(=O)C(O)=C2C1=O RKOTXQYWCBGZLP-UHFFFAOYSA-N 0.000 description 14
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 14
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 14
- 239000011734 sodium Substances 0.000 description 14
- 239000007858 starting material Substances 0.000 description 14
- 125000001424 substituent group Chemical group 0.000 description 14
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 13
- 239000012043 crude product Substances 0.000 description 13
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 13
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 12
- 241000191940 Staphylococcus Species 0.000 description 12
- 239000000284 extract Substances 0.000 description 12
- 239000000463 material Substances 0.000 description 12
- 239000002808 molecular sieve Substances 0.000 description 12
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 12
- 239000002253 acid Substances 0.000 description 11
- 239000013058 crude material Substances 0.000 description 11
- 229940079593 drug Drugs 0.000 description 11
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 11
- 239000000725 suspension Substances 0.000 description 11
- 239000003153 chemical reaction reagent Substances 0.000 description 10
- 238000004128 high performance liquid chromatography Methods 0.000 description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 10
- 239000012071 phase Substances 0.000 description 10
- 230000015572 biosynthetic process Effects 0.000 description 9
- 239000012267 brine Substances 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- 238000005341 cation exchange Methods 0.000 description 9
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- 230000001225 therapeutic effect Effects 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 238000002425 crystallisation Methods 0.000 description 8
- 230000008025 crystallization Effects 0.000 description 8
- 238000007127 saponification reaction Methods 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 7
- 150000001299 aldehydes Chemical class 0.000 description 7
- 125000000753 cycloalkyl group Chemical group 0.000 description 7
- SHQSVMDWKBRBGB-UHFFFAOYSA-N cyclobutanone Chemical compound O=C1CCC1 SHQSVMDWKBRBGB-UHFFFAOYSA-N 0.000 description 7
- CSJLBAMHHLJAAS-UHFFFAOYSA-N diethylaminosulfur trifluoride Chemical compound CCN(CC)S(F)(F)F CSJLBAMHHLJAAS-UHFFFAOYSA-N 0.000 description 7
- 239000006260 foam Substances 0.000 description 7
- 238000009472 formulation Methods 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 238000003786 synthesis reaction Methods 0.000 description 7
- CTFXORAUFICMLS-QSVGPNOESA-N (3r,4r)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid Chemical compound C12=CC(OC)=CC=C2N=CC=C1C(O)CC[C@@H]1CCNC[C@@H]1C(O)=O CTFXORAUFICMLS-QSVGPNOESA-N 0.000 description 6
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 6
- 238000003821 enantio-separation Methods 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 125000004430 oxygen atom Chemical group O* 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 238000000926 separation method Methods 0.000 description 6
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 6
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 6
- ULJVFBSXSASUSP-UHFFFAOYSA-N 3-(2,5-difluorophenyl)sulfanylcyclobutan-1-one Chemical compound FC1=CC=C(F)C(SC2CC(=O)C2)=C1 ULJVFBSXSASUSP-UHFFFAOYSA-N 0.000 description 5
- BVQSFCUGCAZOJQ-UHFFFAOYSA-N 3-phenylcyclobutan-1-one Chemical compound C1C(=O)CC1C1=CC=CC=C1 BVQSFCUGCAZOJQ-UHFFFAOYSA-N 0.000 description 5
- 239000007868 Raney catalyst Substances 0.000 description 5
- 229910000564 Raney nickel Inorganic materials 0.000 description 5
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 201000010099 disease Diseases 0.000 description 5
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 238000001030 gas--liquid chromatography Methods 0.000 description 5
- 125000001188 haloalkyl group Chemical group 0.000 description 5
- 208000015181 infectious disease Diseases 0.000 description 5
- 238000004811 liquid chromatography Methods 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 5
- 238000006268 reductive amination reaction Methods 0.000 description 5
- 229940086542 triethylamine Drugs 0.000 description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- BWZVCCNYKMEVEX-UHFFFAOYSA-N 2,4,6-Trimethylpyridine Chemical compound CC1=CC(C)=NC(C)=C1 BWZVCCNYKMEVEX-UHFFFAOYSA-N 0.000 description 4
- LEJRFUDTXRWNFQ-UHFFFAOYSA-N 3-fluoro-6-methoxyquinoline Chemical compound N1=CC(F)=CC2=CC(OC)=CC=C21 LEJRFUDTXRWNFQ-UHFFFAOYSA-N 0.000 description 4
- ZGSDRBWWICYJBU-UHFFFAOYSA-N 3-phenylmethoxycyclobutan-1-ol Chemical compound C1C(O)CC1OCC1=CC=CC=C1 ZGSDRBWWICYJBU-UHFFFAOYSA-N 0.000 description 4
- GPPSQLLIFNWNSB-UHFFFAOYSA-N 3-phenylmethoxycyclobutan-1-one Chemical compound C1C(=O)CC1OCC1=CC=CC=C1 GPPSQLLIFNWNSB-UHFFFAOYSA-N 0.000 description 4
- 108010041052 DNA Topoisomerase IV Proteins 0.000 description 4
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 4
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- 230000000845 anti-microbial effect Effects 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 238000003556 assay Methods 0.000 description 4
- 230000001580 bacterial effect Effects 0.000 description 4
- 239000003638 chemical reducing agent Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- 238000012986 modification Methods 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- 150000002924 oxiranes Chemical class 0.000 description 4
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 125000003367 polycyclic group Chemical group 0.000 description 4
- 125000006239 protecting group Chemical group 0.000 description 4
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- 238000004809 thin layer chromatography Methods 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- MNYBFHYXSRCATK-UHFFFAOYSA-N 1,4-difluoro-2-(3-phenylmethoxycyclobutyl)sulfanylbenzene Chemical compound FC1=CC=C(F)C(SC2CC(C2)OCC=2C=CC=CC=2)=C1 MNYBFHYXSRCATK-UHFFFAOYSA-N 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 3
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 3
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 3
- 150000005646 3-fluoroquinolines Chemical class 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 0 CC1C*(*)CC1 Chemical compound CC1C*(*)CC1 0.000 description 3
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 108020004414 DNA Proteins 0.000 description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 3
- 229910010082 LiAlH Inorganic materials 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 150000004982 aromatic amines Chemical class 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 150000003997 cyclic ketones Chemical class 0.000 description 3
- 238000005695 dehalogenation reaction Methods 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- 125000004438 haloalkoxy group Chemical group 0.000 description 3
- 230000002140 halogenating effect Effects 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 239000012535 impurity Substances 0.000 description 3
- 239000012669 liquid formulation Substances 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- CHNARWNKXNPXOU-UHFFFAOYSA-N methyl 3,3-dimethoxycyclobutane-1-carboxylate Chemical compound COC(=O)C1CC(OC)(OC)C1 CHNARWNKXNPXOU-UHFFFAOYSA-N 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- 239000006201 parenteral dosage form Substances 0.000 description 3
- 244000052769 pathogen Species 0.000 description 3
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 3
- 239000006187 pill Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000004007 reversed phase HPLC Methods 0.000 description 3
- 210000002966 serum Anatomy 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 3
- 239000011877 solvent mixture Substances 0.000 description 3
- 150000003573 thiols Chemical class 0.000 description 3
- TYJRXMZXDBSURR-UWVGGRQHSA-N (1r,2r)-2-phenylcyclopropane-1-carbaldehyde Chemical compound O=C[C@@H]1C[C@H]1C1=CC=CC=C1 TYJRXMZXDBSURR-UWVGGRQHSA-N 0.000 description 2
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 2
- AUHZEENZYGFFBQ-UHFFFAOYSA-N 1,3,5-Me3C6H3 Natural products CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 2
- NXFFJDQHYLNEJK-UHFFFAOYSA-N 2-[4-[(4-chlorophenyl)methyl]-7-fluoro-5-methylsulfonyl-2,3-dihydro-1h-cyclopenta[b]indol-3-yl]acetic acid Chemical compound C1=2C(S(=O)(=O)C)=CC(F)=CC=2C=2CCC(CC(O)=O)C=2N1CC1=CC=C(Cl)C=C1 NXFFJDQHYLNEJK-UHFFFAOYSA-N 0.000 description 2
- OKDGRDCXVWSXDC-UHFFFAOYSA-N 2-chloropyridine Chemical compound ClC1=CC=CC=N1 OKDGRDCXVWSXDC-UHFFFAOYSA-N 0.000 description 2
- RBCXEDQEZDUMHD-UHFFFAOYSA-N 2-fluoropropanedioic acid Chemical compound OC(=O)C(F)C(O)=O RBCXEDQEZDUMHD-UHFFFAOYSA-N 0.000 description 2
- NLEPLDKPYLYCSY-UHFFFAOYSA-N 2-fluoroquinoline Chemical compound C1=CC=CC2=NC(F)=CC=C21 NLEPLDKPYLYCSY-UHFFFAOYSA-N 0.000 description 2
- RRRSEKJRYAVZHS-UHFFFAOYSA-N 3-(2,5-difluorophenyl)sulfanylcyclobutan-1-ol Chemical compound C1C(O)CC1SC1=CC(F)=CC=C1F RRRSEKJRYAVZHS-UHFFFAOYSA-N 0.000 description 2
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 2
- WXNYEKMHBATQNN-UHFFFAOYSA-N 3-hydroxy-3-phenylcyclobutan-1-one Chemical compound C=1C=CC=CC=1C1(O)CC(=O)C1 WXNYEKMHBATQNN-UHFFFAOYSA-N 0.000 description 2
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 2
- FEJUGLKDZJDVFY-UHFFFAOYSA-N 9-borabicyclo(3.3.1)nonane Chemical compound C1CCC2CCCC1B2 FEJUGLKDZJDVFY-UHFFFAOYSA-N 0.000 description 2
- ZRPZPNYZFSJUPA-UHFFFAOYSA-N ARS-1620 Chemical compound Oc1cccc(F)c1-c1c(Cl)cc2c(ncnc2c1F)N1CCN(CC1)C(=O)C=C ZRPZPNYZFSJUPA-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- LFTLOKWAGJYHHR-UHFFFAOYSA-N N-methylmorpholine N-oxide Chemical compound CN1(=O)CCOCC1 LFTLOKWAGJYHHR-UHFFFAOYSA-N 0.000 description 2
- MHABMANUFPZXEB-UHFFFAOYSA-N O-demethyl-aloesaponarin I Natural products O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=C(O)C(C(O)=O)=C2C MHABMANUFPZXEB-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- 206010041925 Staphylococcal infections Diseases 0.000 description 2
- 241000193998 Streptococcus pneumoniae Species 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 101710183280 Topoisomerase Proteins 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000012042 active reagent Substances 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 150000001413 amino acids Chemical group 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 238000009635 antibiotic susceptibility testing Methods 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 238000011914 asymmetric synthesis Methods 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- NKLCNNUWBJBICK-UHFFFAOYSA-N dess–martin periodinane Chemical compound C1=CC=C2I(OC(=O)C)(OC(C)=O)(OC(C)=O)OC(=O)C2=C1 NKLCNNUWBJBICK-UHFFFAOYSA-N 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 230000002255 enzymatic effect Effects 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- FCZCIXQGZOUIDN-UHFFFAOYSA-N ethyl 2-diethoxyphosphinothioyloxyacetate Chemical compound CCOC(=O)COP(=S)(OCC)OCC FCZCIXQGZOUIDN-UHFFFAOYSA-N 0.000 description 2
- 150000004675 formic acid derivatives Chemical class 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 244000000059 gram-positive pathogen Species 0.000 description 2
- 230000012010 growth Effects 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 2
- 238000000099 in vitro assay Methods 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 238000004255 ion exchange chromatography Methods 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 239000003446 ligand Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- QBNOPZJAURRQCE-UHFFFAOYSA-M magnesium;prop-1-yne;bromide Chemical compound [Mg+2].[Br-].CC#[C-] QBNOPZJAURRQCE-UHFFFAOYSA-M 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 229910052987 metal hydride Inorganic materials 0.000 description 2
- 150000004681 metal hydrides Chemical class 0.000 description 2
- 208000015688 methicillin-resistant staphylococcus aureus infectious disease Diseases 0.000 description 2
- 210000000214 mouth Anatomy 0.000 description 2
- MCHICPMEKADEIK-UHFFFAOYSA-N n,3,3-trimethoxy-n-methylcyclobutane-1-carboxamide Chemical compound CON(C)C(=O)C1CC(OC)(OC)C1 MCHICPMEKADEIK-UHFFFAOYSA-N 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000010076 replication Effects 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 2
- 235000019345 sodium thiosulphate Nutrition 0.000 description 2
- 239000008174 sterile solution Substances 0.000 description 2
- 229940031000 streptococcus pneumoniae Drugs 0.000 description 2
- 238000012799 strong cation exchange Methods 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 238000013268 sustained release Methods 0.000 description 2
- 239000012730 sustained-release form Substances 0.000 description 2
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 239000003643 water by type Substances 0.000 description 2
- NJWRLIAINMRBMF-POYBYMJQSA-N (1r,2r)-2-(2,5-difluorophenyl)cyclopropane-1-carbaldehyde Chemical compound FC1=CC=C(F)C([C@H]2[C@@H](C2)C=O)=C1 NJWRLIAINMRBMF-POYBYMJQSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- MXGZZCOXTWCXGG-UHFFFAOYSA-N (3-phenylmethoxycyclobutyl) methanesulfonate Chemical compound C1C(OS(=O)(=O)C)CC1OCC1=CC=CC=C1 MXGZZCOXTWCXGG-UHFFFAOYSA-N 0.000 description 1
- MCVALJSUJLPNCW-ILYUPCCFSA-N (3r,4r)-1-(1,2,2a,7b-tetrahydrocyclobuta[b][1]benzothiol-2-yl)-4-[(3s)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid Chemical compound C12SC3=CC=CC=C3C1CC2N(C[C@@H]1C(O)=O)CC[C@H]1CC[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 MCVALJSUJLPNCW-ILYUPCCFSA-N 0.000 description 1
- FOHBRGFKYMGTCP-KZLJTRQPSA-N (3r,4r)-1-(5-fluoro-2,3-dihydro-1h-inden-1-yl)-4-[(3s)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid Chemical compound C1CC2=CC(F)=CC=C2C1N(C[C@@H]1C(O)=O)CC[C@H]1CC[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 FOHBRGFKYMGTCP-KZLJTRQPSA-N 0.000 description 1
- FOHBRGFKYMGTCP-MRPMHNBMSA-N (3r,4r)-1-(5-fluoro-2,3-dihydro-1h-inden-1-yl)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid Chemical compound C1CC2=CC(F)=CC=C2C1N(C[C@@H]1C(O)=O)CC[C@H]1CCC(O)C1=CC=NC2=CC=C(OC)C=C21 FOHBRGFKYMGTCP-MRPMHNBMSA-N 0.000 description 1
- PNORMYYLFXPDMA-GLLIGUQLSA-N (3r,4r)-1-[3-(2,5-difluorophenyl)sulfanylcyclobutyl]-4-[(3s)-3-(3-fluoro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CC[C@H](O)C2=C(F)C=NC3=CC=C(C=C32)OC)CN1C(C1)CC1SC1=CC(F)=CC=C1F PNORMYYLFXPDMA-GLLIGUQLSA-N 0.000 description 1
- VQYHTDATYUEUAC-PSWZUUQDSA-N (3r,4r)-1-[3-(2-fluorophenyl)cyclobutyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(O)C2=CC=NC3=CC=C(C=C32)OC)CN1C(C1)CC1C1=CC=CC=C1F VQYHTDATYUEUAC-PSWZUUQDSA-N 0.000 description 1
- NUEHQXHSQLORPI-YKONPOJVSA-N (3r,4r)-1-[3-(3-ethyl-1,2,4-oxadiazol-5-yl)cyclobutyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid Chemical compound CCC1=NOC(C2CC(C2)N2C[C@@H]([C@H](CCC(O)C=3C4=CC(OC)=CC=C4N=CC=3)CC2)C(O)=O)=N1 NUEHQXHSQLORPI-YKONPOJVSA-N 0.000 description 1
- CTFXORAUFICMLS-PZPSRYQVSA-N (3r,4r)-4-[(3r)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid Chemical compound C([C@@H](O)C1=CC=NC2=CC=C(C=C21)OC)C[C@@H]1CCNC[C@@H]1C(O)=O CTFXORAUFICMLS-PZPSRYQVSA-N 0.000 description 1
- DPDQPSZOUDFQPH-VGXUOWJOSA-N (3r,4r)-4-[(3s)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-phenylcyclobutyl)piperidine-3-carboxamide Chemical compound C([C@H]([C@H](C1)C(N)=O)CC[C@H](O)C2=CC=NC3=CC=C(C=C32)OC)CN1C(C1)CC1C1=CC=CC=C1 DPDQPSZOUDFQPH-VGXUOWJOSA-N 0.000 description 1
- CTFXORAUFICMLS-PUECVXPYSA-N (3r,4r)-4-[(3s)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid Chemical compound C([C@H](O)C1=CC=NC2=CC=C(C=C21)OC)C[C@@H]1CCNC[C@@H]1C(O)=O CTFXORAUFICMLS-PUECVXPYSA-N 0.000 description 1
- HUWSYYUFYUZWNZ-VAGPFHTCSA-N (3r,4r)-4-[3-(6-methoxyquinolin-4-yl)-3-(methylamino)propyl]-1-(3-phenylcyclobutyl)piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(NC)C=2C3=CC(OC)=CC=C3N=CC=2)CN1C(C1)CC1C1=CC=CC=C1 HUWSYYUFYUZWNZ-VAGPFHTCSA-N 0.000 description 1
- LZTNJXWCLKWSPU-VICJMVCCSA-N (3r,4r)-4-[3-(6-methoxyquinolin-4-yl)-3-morpholin-4-ylpropyl]-1-(3-phenylcyclobutyl)piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(C2=CC=NC3=CC=C(C=C32)OC)N2CCOCC2)CN1C(C1)CC1C1=CC=CC=C1 LZTNJXWCLKWSPU-VICJMVCCSA-N 0.000 description 1
- BHPBOCTUPISDAC-UAINRMNXSA-N (3r,4r)-4-[3-(6-methoxyquinolin-4-yl)-3-oxopropyl]-1-(3-phenylcyclobutyl)piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(=O)C2=CC=NC3=CC=C(C=C32)OC)CN1C(C1)CC1C1=CC=CC=C1 BHPBOCTUPISDAC-UAINRMNXSA-N 0.000 description 1
- DZDOKLPBRVMOSM-UQFWTALVSA-N (3r,4r)-4-[3-(azetidin-1-yl)-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-phenylcyclobutyl)piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(C2=CC=NC3=CC=C(C=C32)OC)N2CCC2)CN1C(C1)CC1C1=CC=CC=C1 DZDOKLPBRVMOSM-UQFWTALVSA-N 0.000 description 1
- LBSRDSCUMWQBFH-KSLJEZLESA-N (3r,4r)-4-[3-(dimethylamino)-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-phenylcyclobutyl)piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(C2=CC=NC3=CC=C(C=C32)OC)N(C)C)CN1C(C1)CC1C1=CC=CC=C1 LBSRDSCUMWQBFH-KSLJEZLESA-N 0.000 description 1
- ZVYHKXMWLULPBO-URPGGWSMSA-N (3r,4r)-4-[3-[6-(difluoromethoxy)quinolin-4-yl]-3-hydroxypropyl]-1-(3-phenylcyclobutyl)piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(O)C=2C3=CC(OC(F)F)=CC=C3N=CC=2)CN1C(C1)CC1C1=CC=CC=C1 ZVYHKXMWLULPBO-URPGGWSMSA-N 0.000 description 1
- GUTMDZKMZZVJPA-WULZSNEESA-N (3r,4r)-4-[3-amino-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-phenylcyclobutyl)piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(N)C2=CC=NC3=CC=C(C=C32)OC)CN1C(C1)CC1C1=CC=CC=C1 GUTMDZKMZZVJPA-WULZSNEESA-N 0.000 description 1
- QKKWMHPYHNPALB-WULZSNEESA-N (3r,4r)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-phenylcyclobutyl)piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(F)C2=CC=NC3=CC=C(C=C32)OC)CN1C(C1)CC1C1=CC=CC=C1 QKKWMHPYHNPALB-WULZSNEESA-N 0.000 description 1
- BTXXYKREQCTYOY-URPGGWSMSA-N (3r,4r)-4-[3-hydroxy-3-(6-hydroxyquinolin-4-yl)propyl]-1-(3-phenylcyclobutyl)piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(O)C=2C3=CC(O)=CC=C3N=CC=2)CN1C(C1)CC1C1=CC=CC=C1 BTXXYKREQCTYOY-URPGGWSMSA-N 0.000 description 1
- OMPHJLIULIZAKF-POJZJIJJSA-N (3r,4r)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(1-pyridin-2-ylazetidin-3-yl)piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(O)C2=CC=NC3=CC=C(C=C32)OC)CN1C(C1)CN1C1=CC=CC=N1 OMPHJLIULIZAKF-POJZJIJJSA-N 0.000 description 1
- QSDDNMDOQFIMTP-GSTJEPRTSA-N (3r,4r)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-hydroxy-3-phenylcyclobutyl)piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(O)C2=CC=NC3=CC=C(C=C32)OC)CN1C(C1)CC1(O)C1=CC=CC=C1 QSDDNMDOQFIMTP-GSTJEPRTSA-N 0.000 description 1
- DPDQPSZOUDFQPH-JLYNRWRGSA-N (3r,4r)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-phenylcyclobutyl)piperidine-3-carboxamide Chemical compound C([C@H]([C@H](C1)C(N)=O)CCC(O)C2=CC=NC3=CC=C(C=C32)OC)CN1C(C1)CC1C1=CC=CC=C1 DPDQPSZOUDFQPH-JLYNRWRGSA-N 0.000 description 1
- LTFVEURJZBINIB-HOXSOIRFSA-N (3r,4r)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[1-(pyridin-2-ylmethyl)azetidin-3-yl]piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(O)C2=CC=NC3=CC=C(C=C32)OC)CN1C(C1)CN1CC1=CC=CC=N1 LTFVEURJZBINIB-HOXSOIRFSA-N 0.000 description 1
- QEJVNHMVHDTURP-RQVKUWFRSA-N (3r,4r)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(5-methyl-1,2-oxazol-3-yl)cyclobutyl]piperidine-3-carboxylic acid Chemical compound C([C@H]([C@H](C1)C(O)=O)CCC(O)C2=CC=NC3=CC=C(C=C32)OC)CN1C(C1)CC1C=1C=C(C)ON=1 QEJVNHMVHDTURP-RQVKUWFRSA-N 0.000 description 1
- KNGSADMORRGIPY-YPSMEVTNSA-N (3r,4r)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[[(1r,2r)-2-phenylcyclopropyl]methyl]piperidine-3-carboxylic acid Chemical compound C1([C@@H]2C[C@H]2CN2CC[C@H]([C@H](C2)C(O)=O)CCC(O)C2=CC=NC3=CC=C(C=C32)OC)=CC=CC=C1 KNGSADMORRGIPY-YPSMEVTNSA-N 0.000 description 1
- ZUZFMVASKBRIGS-XHNGYCAMSA-N (3r,4r)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-methylpiperidine-3-carboxylic acid Chemical compound C12=CC(OC)=CC=C2N=CC=C1C(O)CC[C@@H]1CCN(C)C[C@@H]1C(O)=O ZUZFMVASKBRIGS-XHNGYCAMSA-N 0.000 description 1
- BMUNSRYYYSDJPZ-CRUYRKLPSA-N (3r,4r)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-n-methyl-1-(3-phenylcyclobutyl)piperidine-3-carboxamide Chemical compound C([C@@H]([C@@H](CC1)CCC(O)C=2C3=CC(OC)=CC=C3N=CC=2)C(=O)NC)N1C(C1)CC1C1=CC=CC=C1 BMUNSRYYYSDJPZ-CRUYRKLPSA-N 0.000 description 1
- AQJFPIGOJMGXLQ-UHFFFAOYSA-N (5-fluoro-2,3-dihydro-1h-inden-1-yl) methanesulfonate Chemical compound FC1=CC=C2C(OS(=O)(=O)C)CCC2=C1 AQJFPIGOJMGXLQ-UHFFFAOYSA-N 0.000 description 1
- 125000006823 (C1-C6) acyl group Chemical group 0.000 description 1
- 125000005862 (C1-C6)alkanoyl group Chemical group 0.000 description 1
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 1
- ZGYIXVSQHOKQRZ-COIATFDQSA-N (e)-n-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3s)-oxolan-3-yl]oxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide Chemical compound N#CC1=CN=C2C=C(O[C@@H]3COCC3)C(NC(=O)/C=C/CN(C)C)=CC2=C1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ZGYIXVSQHOKQRZ-COIATFDQSA-N 0.000 description 1
- HDPNBNXLBDFELL-UHFFFAOYSA-N 1,1,1-trimethoxyethane Chemical compound COC(C)(OC)OC HDPNBNXLBDFELL-UHFFFAOYSA-N 0.000 description 1
- 125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 description 1
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 1
- 125000004529 1,2,3-triazinyl group Chemical group N1=NN=C(C=C1)* 0.000 description 1
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 description 1
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 description 1
- 125000003363 1,3,5-triazinyl group Chemical group N1=C(N=CN=C1)* 0.000 description 1
- 125000005960 1,4-diazepanyl group Chemical group 0.000 description 1
- 125000005940 1,4-dioxanyl group Chemical group 0.000 description 1
- HKDFRDIIELOLTJ-UHFFFAOYSA-N 1,4-dithianyl Chemical group [CH]1CSCCS1 HKDFRDIIELOLTJ-UHFFFAOYSA-N 0.000 description 1
- 125000005962 1,4-oxazepanyl group Chemical group 0.000 description 1
- FLBAYUMRQUHISI-UHFFFAOYSA-N 1,8-naphthyridine Chemical compound N1=CC=CC2=CC=CN=C21 FLBAYUMRQUHISI-UHFFFAOYSA-N 0.000 description 1
- OGFAWKRXZLGJSK-UHFFFAOYSA-N 1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone Chemical compound OC1=CC(O)=CC=C1C(=O)CC1=CC=C([N+]([O-])=O)C=C1 OGFAWKRXZLGJSK-UHFFFAOYSA-N 0.000 description 1
- RCPAVJXGLFKACE-UHFFFAOYSA-N 1-(2,5-difluorophenyl)ethanol Chemical compound CC(O)C1=CC(F)=CC=C1F RCPAVJXGLFKACE-UHFFFAOYSA-N 0.000 description 1
- CMKPHQYBNKXFJO-UHFFFAOYSA-N 1-(3,3-dimethoxycyclobutyl)but-2-yn-1-one Chemical compound COC1(OC)CC(C(=O)C#CC)C1 CMKPHQYBNKXFJO-UHFFFAOYSA-N 0.000 description 1
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- GPIGJTTWDSVJTJ-BUVFEPMLSA-N 1-o-tert-butyl 3-o-methyl (3r,4r)-4-[(3s)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-1,3-dicarboxylate Chemical compound COC(=O)[C@H]1CN(C(=O)OC(C)(C)C)CC[C@H]1CC[C@H](O)C1=CC=NC2=CC=C(OC)C=C12 GPIGJTTWDSVJTJ-BUVFEPMLSA-N 0.000 description 1
- OZQKUZWSOGLHGS-UHFFFAOYSA-N 1-o-tert-butyl 4-o-methyl 4-(2-oxoethoxy)piperidine-1,4-dicarboxylate Chemical compound O=CCOC1(C(=O)OC)CCN(C(=O)OC(C)(C)C)CC1 OZQKUZWSOGLHGS-UHFFFAOYSA-N 0.000 description 1
- YCWRLBFFWYMHAQ-UHFFFAOYSA-N 1-phenylpyrrolidine-2,4-dione Chemical compound O=C1CC(=O)CN1C1=CC=CC=C1 YCWRLBFFWYMHAQ-UHFFFAOYSA-N 0.000 description 1
- UFMBERDMCRCVSM-UHFFFAOYSA-N 1h-cinnolin-4-one Chemical compound C1=CC=C2C(O)=CN=NC2=C1 UFMBERDMCRCVSM-UHFFFAOYSA-N 0.000 description 1
- LIHVFFFGWFBSAT-UHFFFAOYSA-N 2,2-difluoropropanedioic acid Chemical compound OC(=O)C(F)(F)C(O)=O LIHVFFFGWFBSAT-UHFFFAOYSA-N 0.000 description 1
- VVVOJODFBWBNBI-UHFFFAOYSA-N 2,5-difluorobenzaldehyde Chemical compound FC1=CC=C(F)C(C=O)=C1 VVVOJODFBWBNBI-UHFFFAOYSA-N 0.000 description 1
- KNKYDUZBONCWES-UHFFFAOYSA-N 2-(1-fluoro-3-phenylmethoxycyclobutyl)pyridine Chemical compound C1C(F)(C=2N=CC=CC=2)CC1OCC1=CC=CC=C1 KNKYDUZBONCWES-UHFFFAOYSA-N 0.000 description 1
- YGTUPRIZNBMOFV-UHFFFAOYSA-N 2-(4-hydroxybenzoyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC=C(O)C=C1 YGTUPRIZNBMOFV-UHFFFAOYSA-N 0.000 description 1
- IMRWILPUOVGIMU-UHFFFAOYSA-N 2-bromopyridine Chemical compound BrC1=CC=CC=N1 IMRWILPUOVGIMU-UHFFFAOYSA-N 0.000 description 1
- KUOHTIBWFUNFFJ-UHFFFAOYSA-N 2-chloro-6-fluoro-3-methoxyquinoxaline Chemical compound FC1=CC=C2N=C(Cl)C(OC)=NC2=C1 KUOHTIBWFUNFFJ-UHFFFAOYSA-N 0.000 description 1
- CSDSSGBPEUDDEE-UHFFFAOYSA-N 2-formylpyridine Chemical compound O=CC1=CC=CC=N1 CSDSSGBPEUDDEE-UHFFFAOYSA-N 0.000 description 1
- VFUFXHFSNCESKR-VIFPVBQESA-N 2-methoxy-8-[(2r)-oxiran-2-yl]-1,5-naphthyridine Chemical compound C12=NC(OC)=CC=C2N=CC=C1[C@@H]1CO1 VFUFXHFSNCESKR-VIFPVBQESA-N 0.000 description 1
- JMTMSDXUXJISAY-UHFFFAOYSA-N 2H-benzotriazol-4-ol Chemical compound OC1=CC=CC2=C1N=NN2 JMTMSDXUXJISAY-UHFFFAOYSA-N 0.000 description 1
- PGCURFJDDYCSBO-UHFFFAOYSA-N 2a,7b-dihydro-1h-cyclobuta[b][1]benzothiol-2-one Chemical compound C1=CC=C2C3CC(=O)C3SC2=C1 PGCURFJDDYCSBO-UHFFFAOYSA-N 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- WWPNBDFXAYRBJB-UHFFFAOYSA-N 3-(2,6-difluorophenyl)cyclobutan-1-one Chemical compound FC1=CC=CC(F)=C1C1CC(=O)C1 WWPNBDFXAYRBJB-UHFFFAOYSA-N 0.000 description 1
- ZNHOEHONJNYTDA-UHFFFAOYSA-N 3-(2-fluorophenyl)cyclobutan-1-one Chemical compound FC1=CC=CC=C1C1CC(=O)C1 ZNHOEHONJNYTDA-UHFFFAOYSA-N 0.000 description 1
- COVLBGUOFHZQIL-UHFFFAOYSA-N 3-(3-methyl-1,2,4-oxadiazol-5-yl)cyclobutan-1-one Chemical compound CC1=NOC(C2CC(=O)C2)=N1 COVLBGUOFHZQIL-UHFFFAOYSA-N 0.000 description 1
- NIWQDSGHLSBPDX-UHFFFAOYSA-N 3-(3-methyl-1,2-oxazol-5-yl)cyclobutan-1-one Chemical compound O1N=C(C)C=C1C1CC(=O)C1 NIWQDSGHLSBPDX-UHFFFAOYSA-N 0.000 description 1
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 1
- ACPYGZVNDNYVPM-UHFFFAOYSA-N 3-(4-chlorophenyl)cyclopentan-1-one Chemical compound C1=CC(Cl)=CC=C1C1CC(=O)CC1 ACPYGZVNDNYVPM-UHFFFAOYSA-N 0.000 description 1
- KPLOCKYAJIMPQB-UHFFFAOYSA-N 3-(5-methyl-1,2-thiazol-3-yl)cyclobutan-1-one Chemical compound S1C(C)=CC(C2CC(=O)C2)=N1 KPLOCKYAJIMPQB-UHFFFAOYSA-N 0.000 description 1
- UYADWGCHVZCTEC-UHFFFAOYSA-N 3-(5-methyl-1,3,4-oxadiazol-2-yl)cyclobutan-1-one Chemical compound O1C(C)=NN=C1C1CC(=O)C1 UYADWGCHVZCTEC-UHFFFAOYSA-N 0.000 description 1
- YGYGASJNJTYNOL-CQSZACIVSA-N 3-[(4r)-2,2-dimethyl-1,1-dioxothian-4-yl]-5-(4-fluorophenyl)-1h-indole-7-carboxamide Chemical compound C1CS(=O)(=O)C(C)(C)C[C@@H]1C1=CNC2=C(C(N)=O)C=C(C=3C=CC(F)=CC=3)C=C12 YGYGASJNJTYNOL-CQSZACIVSA-N 0.000 description 1
- IENOFRJPUPTEMI-UHFFFAOYSA-N 3-oxocyclobutane-1-carboxylic acid Chemical compound OC(=O)C1CC(=O)C1 IENOFRJPUPTEMI-UHFFFAOYSA-N 0.000 description 1
- TYUULSNADYPSMV-UHFFFAOYSA-N 3-phenoxycyclobutan-1-one Chemical compound C1C(=O)CC1OC1=CC=CC=C1 TYUULSNADYPSMV-UHFFFAOYSA-N 0.000 description 1
- BRIOTUVMMUZPBB-UHFFFAOYSA-N 3-phenylmethoxy-1-pyridin-2-ylcyclobutan-1-ol Chemical compound C1C(O)(C=2N=CC=CC=2)CC1OCC1=CC=CC=C1 BRIOTUVMMUZPBB-UHFFFAOYSA-N 0.000 description 1
- CLWMBQYHAMQQJB-UHFFFAOYSA-N 3-pyridin-2-ylcyclobutan-1-ol Chemical compound C1C(O)CC1C1=CC=CC=N1 CLWMBQYHAMQQJB-UHFFFAOYSA-N 0.000 description 1
- ILAPGZJFOXHKOV-UHFFFAOYSA-N 3-pyridin-2-ylcyclobutan-1-one Chemical compound C1C(=O)CC1C1=CC=CC=N1 ILAPGZJFOXHKOV-UHFFFAOYSA-N 0.000 description 1
- UAAGMINLHNPXIJ-UHFFFAOYSA-N 4-[2-(3-fluoro-6-methoxyquinolin-4-yl)-2-hydroxyethoxy]-1-(3-phenylcyclobutyl)piperidine-4-carboxylic acid Chemical compound C12=CC(OC)=CC=C2N=CC(F)=C1C(O)COC(CC1)(C(O)=O)CCN1C(C1)CC1C1=CC=CC=C1 UAAGMINLHNPXIJ-UHFFFAOYSA-N 0.000 description 1
- AQHXKKADWRGVDR-UHFFFAOYSA-N 4-[3-(3-chloro-6-methoxyquinolin-4-yl)-3-hydroxypropyl]-1-(3-phenylcyclobutyl)piperidine-4-carboxylic acid Chemical compound C12=CC(OC)=CC=C2N=CC(Cl)=C1C(O)CCC(CC1)(C(O)=O)CCN1C(C1)CC1C1=CC=CC=C1 AQHXKKADWRGVDR-UHFFFAOYSA-N 0.000 description 1
- OGOQQGSDJNRGOW-UHFFFAOYSA-N 4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]-1-(1-pyridin-2-ylazetidin-3-yl)piperidine-4-carboxylic acid Chemical compound C12=CC(OC)=CC=C2N=CC(Cl)=C1CCCC(CC1)(C(O)=O)CCN1C(C1)CN1C1=CC=CC=N1 OGOQQGSDJNRGOW-UHFFFAOYSA-N 0.000 description 1
- HLHVUOHREYMCOT-UHFFFAOYSA-N 4-[3-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)propyl]-1-(3-phenylcyclobutyl)piperidine-4-carboxylic acid Chemical compound C12=NC(OC)=CC=C2N=CC(F)=C1CCCC(CC1)(C(O)=O)CCN1C(C1)CC1C1=CC=CC=C1 HLHVUOHREYMCOT-UHFFFAOYSA-N 0.000 description 1
- IYWCITYVIVGOAU-JEAXGXKQSA-N 4-[[(2r)-2-(3-chloro-6-methoxyquinolin-4-yl)-2-hydroxyethyl]amino]-1-(3-phenylcyclobutyl)azepane-4-carboxylic acid Chemical compound C([C@H](O)C1=C(Cl)C=NC2=CC=C(C=C21)OC)NC(CC1)(C(O)=O)CCCN1C(C1)CC1C1=CC=CC=C1 IYWCITYVIVGOAU-JEAXGXKQSA-N 0.000 description 1
- RYBXFQVDQJQGHE-JEAXGXKQSA-N 4-[[(2r)-2-(3-fluoro-6-methoxyquinolin-4-yl)-2-hydroxyethyl]amino]-1-(3-phenylcyclobutyl)azepane-4-carboxylic acid Chemical compound C([C@H](O)C1=C(F)C=NC2=CC=C(C=C21)OC)NC(CC1)(C(O)=O)CCCN1C(C1)CC1C1=CC=CC=C1 RYBXFQVDQJQGHE-JEAXGXKQSA-N 0.000 description 1
- HWTRJOSETBEJTB-BOCUVKOASA-N 4-[[(2r)-2-hydroxy-2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]amino]-1-(3-phenylcyclobutyl)azepane-4-carboxylic acid Chemical compound C([C@H](O)C1=CC=NC2=CC=C(N=C21)OC)NC(CC1)(C(O)=O)CCCN1C(C1)CC1C1=CC=CC=C1 HWTRJOSETBEJTB-BOCUVKOASA-N 0.000 description 1
- JDFCHVHQFYEEEO-PIVQAISJSA-N 4-[[(2r)-2-hydroxy-2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]amino]azepane-4-carboxylic acid Chemical compound C([C@H](O)C1=CC=NC2=CC=C(N=C21)OC)NC1(C(O)=O)CCCNCC1 JDFCHVHQFYEEEO-PIVQAISJSA-N 0.000 description 1
- BTOJSYRZQZOMOK-UHFFFAOYSA-N 4-chloro-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidine Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1C2=NC=NC(Cl)=C2C=C1 BTOJSYRZQZOMOK-UHFFFAOYSA-N 0.000 description 1
- YNVIAXULFXXTLV-UHFFFAOYSA-N 5-bromo-3-methoxyquinoline Chemical compound C1=CC=C(Br)C2=CC(OC)=CN=C21 YNVIAXULFXXTLV-UHFFFAOYSA-N 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 108020000946 Bacterial DNA Proteins 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-NJFSPNSNSA-N Carbon-14 Chemical compound [14C] OKTJSMMVPCPJKN-NJFSPNSNSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VOPWNXZWBYDODV-UHFFFAOYSA-N Chlorodifluoromethane Chemical compound FC(F)Cl VOPWNXZWBYDODV-UHFFFAOYSA-N 0.000 description 1
- KGFMPHICBUSYIA-KXZZFNPWSA-N Cl.Cl.N1CC(C1)N1C[C@@H]([C@@H](CC1)CCC(C1=CC=NC2=CC=C(C=C12)OC)O)C(=O)O Chemical compound Cl.Cl.N1CC(C1)N1C[C@@H]([C@@H](CC1)CCC(C1=CC=NC2=CC=C(C=C12)OC)O)C(=O)O KGFMPHICBUSYIA-KXZZFNPWSA-N 0.000 description 1
- PMPVIKIVABFJJI-UHFFFAOYSA-N Cyclobutane Chemical compound C1CCC1 PMPVIKIVABFJJI-UHFFFAOYSA-N 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 description 1
- AEMOLEFTQBMNLQ-AQKNRBDQSA-N D-glucopyranuronic acid Chemical compound OC1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O AEMOLEFTQBMNLQ-AQKNRBDQSA-N 0.000 description 1
- 230000004543 DNA replication Effects 0.000 description 1
- 238000006646 Dess-Martin oxidation reaction Methods 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 1
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 238000003820 Medium-pressure liquid chromatography Methods 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 241000872931 Myoporum sandwicense Species 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-L Phosphate ion(2-) Chemical compound OP([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-L 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- 241000194017 Streptococcus Species 0.000 description 1
- 241000193996 Streptococcus pyogenes Species 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 1
- ADSXDBCZNVXTRD-UHFFFAOYSA-N [Mg]C1=CC=CC=C1 Chemical compound [Mg]C1=CC=CC=C1 ADSXDBCZNVXTRD-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- PXAJQJMDEXJWFB-UHFFFAOYSA-N acetone oxime Chemical compound CC(C)=NO PXAJQJMDEXJWFB-UHFFFAOYSA-N 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000004450 alkenylene group Chemical group 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- DQPBABKTKYNPMH-UHFFFAOYSA-N amino hydrogen sulfate Chemical compound NOS(O)(=O)=O DQPBABKTKYNPMH-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000012538 ammonium bicarbonate Nutrition 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 239000012223 aqueous fraction Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-L aspartate group Chemical class N[C@@H](CC(=O)[O-])C(=O)[O-] CKLJMWTZIZZHCS-REOHCLBHSA-L 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- FUMVYRKHAKPCGY-UHFFFAOYSA-N azanium;acetonitrile;hydroxide;hydrate Chemical compound [NH4+].O.[OH-].CC#N FUMVYRKHAKPCGY-UHFFFAOYSA-N 0.000 description 1
- 125000003725 azepanyl group Chemical group 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 125000004069 aziridinyl group Chemical group 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000004604 benzisothiazolyl group Chemical group S1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- BVCRERJDOOBZOH-UHFFFAOYSA-N bicyclo[2.2.1]heptanyl Chemical group C1C[C+]2CC[C-]1C2 BVCRERJDOOBZOH-UHFFFAOYSA-N 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M bisulphate group Chemical group S([O-])(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000005277 cation exchange chromatography Methods 0.000 description 1
- 230000032823 cell division Effects 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 150000005829 chemical entities Chemical class 0.000 description 1
- 238000004296 chiral HPLC Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 230000007012 clinical effect Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000005170 cycloalkyloxycarbonyl group Chemical group 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- UJMBCHVRTIOTKC-UHFFFAOYSA-N cyclobutylbenzene Chemical compound C1CCC1C1=CC=CC=C1 UJMBCHVRTIOTKC-UHFFFAOYSA-N 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 229940127089 cytotoxic agent Drugs 0.000 description 1
- 125000005508 decahydronaphthalenyl group Chemical group 0.000 description 1
- 230000001934 delay Effects 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 229910052805 deuterium Inorganic materials 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 238000000113 differential scanning calorimetry Methods 0.000 description 1
- 125000004852 dihydrofuranyl group Chemical group O1C(CC=C1)* 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-M dihydrogenphosphate Chemical compound OP(O)([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-M 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- ZVXHZSXYHFBIEW-UHFFFAOYSA-N dimethyl 2-fluoropropanedioate Chemical compound COC(=O)C(F)C(=O)OC ZVXHZSXYHFBIEW-UHFFFAOYSA-N 0.000 description 1
- 229950010286 diolamine Drugs 0.000 description 1
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 1
- 229910000396 dipotassium phosphate Inorganic materials 0.000 description 1
- 235000019797 dipotassium phosphate Nutrition 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000009510 drug design Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000012156 elution solvent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 229940031098 ethanolamine Drugs 0.000 description 1
- VFRSADQPWYCXDG-LEUCUCNGSA-N ethyl (2s,5s)-5-methylpyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CCOC(=O)[C@@H]1CC[C@H](C)N1 VFRSADQPWYCXDG-LEUCUCNGSA-N 0.000 description 1
- MFRMXQNFJFZQLS-UHFFFAOYSA-N ethyl 4-[3-(3-chloro-6-methoxyquinolin-4-yl)propyl]piperidine-4-carboxylate Chemical compound ClC=1C=NC2=CC=C(OC)C=C2C=1CCCC1(C(=O)OCC)CCNCC1 MFRMXQNFJFZQLS-UHFFFAOYSA-N 0.000 description 1
- OSSYHFWFQMUDMG-UHFFFAOYSA-N ethyl 4-[3-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)propyl]piperidine-4-carboxylate Chemical compound FC=1C=NC2=CC=C(OC)N=C2C=1CCCC1(C(=O)OCC)CCNCC1 OSSYHFWFQMUDMG-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000010408 film Substances 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- GNBHRKFJIUUOQI-UHFFFAOYSA-N fluorescein Chemical compound O1C(=O)C2=CC=CC=C2C21C1=CC=C(O)C=C1OC1=CC(O)=CC=C21 GNBHRKFJIUUOQI-UHFFFAOYSA-N 0.000 description 1
- 238000000806 fluorine-19 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229960001731 gluceptate Drugs 0.000 description 1
- KWMLJOLKUYYJFJ-VFUOTHLCSA-N glucoheptonic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)C(O)=O KWMLJOLKUYYJFJ-VFUOTHLCSA-N 0.000 description 1
- 229940050410 gluconate Drugs 0.000 description 1
- 229940097042 glucuronate Drugs 0.000 description 1
- 229960002449 glycine Drugs 0.000 description 1
- 239000007902 hard capsule Substances 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 150000002390 heteroarenes Chemical class 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-M hexadecanoate Chemical compound CCCCCCCCCCCCCCCC([O-])=O IPCSVZSSVZVIGE-UHFFFAOYSA-M 0.000 description 1
- 229950000177 hibenzate Drugs 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- USZLCYNVCCDPLQ-UHFFFAOYSA-N hydron;n-methoxymethanamine;chloride Chemical compound Cl.CNOC USZLCYNVCCDPLQ-UHFFFAOYSA-N 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000002458 infectious effect Effects 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229950000886 isetionate Drugs 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000004628 isothiazolidinyl group Chemical group S1N(CCC1)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000002502 liposome Substances 0.000 description 1
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 1
- ANYSGBYRTLOUPO-UHFFFAOYSA-N lithium tetramethylpiperidide Chemical compound [Li]N1C(C)(C)CCCC1(C)C ANYSGBYRTLOUPO-UHFFFAOYSA-N 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 238000011866 long-term treatment Methods 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 1
- IUYHWZFSGMZEOG-UHFFFAOYSA-M magnesium;propane;chloride Chemical compound [Mg+2].[Cl-].C[CH-]C IUYHWZFSGMZEOG-UHFFFAOYSA-M 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 231100000682 maximum tolerated dose Toxicity 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 229960003194 meglumine Drugs 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- SGFHXWJMYMNURF-DYVFJYSZSA-N methyl (3r,4r)-4-[3-(6-methoxyquinolin-4-yl)-3-oxopropyl]piperidine-3-carboxylate Chemical compound COC(=O)[C@H]1CNCC[C@H]1CCC(=O)C1=CC=NC2=CC=C(OC)C=C12 SGFHXWJMYMNURF-DYVFJYSZSA-N 0.000 description 1
- BCQSASPGWMQPEL-XHNGYCAMSA-N methyl (3r,4r)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylate Chemical compound COC(=O)[C@H]1CNCC[C@H]1CCC(O)C1=CC=NC2=CC=C(OC)C=C12 BCQSASPGWMQPEL-XHNGYCAMSA-N 0.000 description 1
- RUTRXSXNELSCPP-UHFFFAOYSA-N methyl 4-oxopiperidine-2-carboxylate Chemical compound COC(=O)C1CC(=O)CCN1 RUTRXSXNELSCPP-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 125000006431 methyl cyclopropyl group Chemical group 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- NQMRYBIKMRVZLB-UHFFFAOYSA-N methylamine hydrochloride Chemical compound [Cl-].[NH3+]C NQMRYBIKMRVZLB-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 229960003085 meticillin Drugs 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 230000008450 motivation Effects 0.000 description 1
- 230000003232 mucoadhesive effect Effects 0.000 description 1
- AEXITZJSLGALNH-UHFFFAOYSA-N n'-hydroxyethanimidamide Chemical compound CC(N)=NO AEXITZJSLGALNH-UHFFFAOYSA-N 0.000 description 1
- JEUXZUSUYIHGNL-UHFFFAOYSA-N n,n-diethylethanamine;hydrate Chemical compound O.CCN(CC)CC JEUXZUSUYIHGNL-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- RIVIDPPYRINTTH-UHFFFAOYSA-N n-ethylpropan-2-amine Chemical compound CCNC(C)C RIVIDPPYRINTTH-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005487 naphthalate group Chemical group 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- XJLSEXAGTJCILF-UHFFFAOYSA-N nipecotic acid Chemical compound OC(=O)C1CCCNC1 XJLSEXAGTJCILF-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 229950004864 olamine Drugs 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- PXQPEWDEAKTCGB-UHFFFAOYSA-N orotic acid Chemical compound OC(=O)C1=CC(=O)NC(=O)N1 PXQPEWDEAKTCGB-UHFFFAOYSA-N 0.000 description 1
- 230000001151 other effect Effects 0.000 description 1
- 238000000643 oven drying Methods 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000003551 oxepanyl group Chemical group 0.000 description 1
- 125000003566 oxetanyl group Chemical group 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 125000003544 oxime group Chemical group 0.000 description 1
- 125000000466 oxiranyl group Chemical group 0.000 description 1
- 238000006213 oxygenation reaction Methods 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- HXEACLLIILLPRG-UHFFFAOYSA-N pipecolic acid Chemical compound OC(=O)C1CCCCN1 HXEACLLIILLPRG-UHFFFAOYSA-N 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- HWYNYLXTVJYPOW-UHFFFAOYSA-N piperidine-1,3-dicarboxylic acid Chemical compound OC(=O)C1CCCN(C(O)=O)C1 HWYNYLXTVJYPOW-UHFFFAOYSA-N 0.000 description 1
- IIKFXOLJMNWWCH-UHFFFAOYSA-N piperidine-1,4-dicarboxylic acid Chemical compound OC(=O)C1CCN(C(O)=O)CC1 IIKFXOLJMNWWCH-UHFFFAOYSA-N 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- LZMJNVRJMFMYQS-UHFFFAOYSA-N poseltinib Chemical compound C1CN(C)CCN1C(C=C1)=CC=C1NC1=NC(OC=2C=C(NC(=O)C=C)C=CC=2)=C(OC=C2)C2=N1 LZMJNVRJMFMYQS-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 238000000634 powder X-ray diffraction Methods 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 230000005180 public health Effects 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 150000003248 quinolines Chemical class 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000005215 recombination Methods 0.000 description 1
- 230000006798 recombination Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 238000002390 rotary evaporation Methods 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000006104 solid solution Substances 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 230000009747 swallowing Effects 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- LFXITLUWXUDOKG-QWHCGFSZSA-N tert-butyl (3r,4r)-3-ethenyl-4-(3-methoxy-3-oxopropyl)piperidine-1-carboxylate Chemical compound COC(=O)CC[C@@H]1CCN(C(=O)OC(C)(C)C)C[C@@H]1C=C LFXITLUWXUDOKG-QWHCGFSZSA-N 0.000 description 1
- VMKIXWAFFVLJCK-UHFFFAOYSA-N tert-butyl 3-oxoazetidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CC(=O)C1 VMKIXWAFFVLJCK-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000003507 tetrahydrothiofenyl group Chemical group 0.000 description 1
- 125000004632 tetrahydrothiopyranyl group Chemical group S1C(CCCC1)* 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- 125000005306 thianaphthenyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- AHDDRJBFJBDEPW-DTWKUNHWSA-N trans-2-Phenylcyclopropanecarboxylic acid Chemical compound OC(=O)[C@@H]1C[C@H]1C1=CC=CC=C1 AHDDRJBFJBDEPW-DTWKUNHWSA-N 0.000 description 1
- ONDSBJMLAHVLMI-UHFFFAOYSA-N trimethylsilyldiazomethane Chemical compound C[Si](C)(C)[CH-][N+]#N ONDSBJMLAHVLMI-UHFFFAOYSA-N 0.000 description 1
- 229910052722 tritium Inorganic materials 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 238000013022 venting Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/06—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Public Health (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Veterinary Medicine (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US91690607P | 2007-05-09 | 2007-05-09 | |
| US60/916,906 | 2007-05-09 |
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1020127000612A Division KR20120011093A (ko) | 2007-05-09 | 2008-04-29 | 치환된 헤테로사이클릭 유도체 및 조성물 및 항균제로서의 이의 약학적 용도 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| KR20090130347A true KR20090130347A (ko) | 2009-12-22 |
Family
ID=39865577
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1020097025640A Ceased KR20090130347A (ko) | 2007-05-09 | 2008-04-29 | 치환된 헤테로사이클릭 유도체 및 조성물 및 항균제로서의 이의 약학적 용도 |
| KR1020127000612A Withdrawn KR20120011093A (ko) | 2007-05-09 | 2008-04-29 | 치환된 헤테로사이클릭 유도체 및 조성물 및 항균제로서의 이의 약학적 용도 |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| KR1020127000612A Withdrawn KR20120011093A (ko) | 2007-05-09 | 2008-04-29 | 치환된 헤테로사이클릭 유도체 및 조성물 및 항균제로서의 이의 약학적 용도 |
Country Status (17)
| Country | Link |
|---|---|
| US (3) | US20080280879A1 (enExample) |
| EP (2) | EP2481735A1 (enExample) |
| JP (1) | JP2010526130A (enExample) |
| KR (2) | KR20090130347A (enExample) |
| CN (1) | CN101679357A (enExample) |
| AR (1) | AR066478A1 (enExample) |
| AU (1) | AU2008249745B2 (enExample) |
| CA (1) | CA2685888A1 (enExample) |
| CL (1) | CL2008001367A1 (enExample) |
| IL (1) | IL201830A0 (enExample) |
| MX (1) | MX2009012117A (enExample) |
| PA (1) | PA8779801A1 (enExample) |
| PE (1) | PE20090240A1 (enExample) |
| TW (1) | TW200902518A (enExample) |
| UY (1) | UY31071A1 (enExample) |
| WO (1) | WO2008139288A2 (enExample) |
| ZA (1) | ZA200907761B (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN102471235A (zh) * | 2009-07-11 | 2012-05-23 | 拜耳医药股份有限公司 | 利用环烷基的放射性标记方法 |
| MA41169A (fr) | 2014-12-17 | 2017-10-24 | Acraf | Composés antibactériens à large spectre d'activité |
| JP2019517546A (ja) | 2016-06-08 | 2019-06-24 | アジェンデ・キミケ・リウニテ・アンジェリニ・フランチェスコ・ア・チ・エレ・ア・エフェ・ソシエタ・ペル・アチオニAziende Chimiche Riunite Angelini Francesco A.C.R.A.F.Societa Per Azioni | 新しい抗菌性化合物 |
| JP6755775B2 (ja) * | 2016-11-04 | 2020-09-16 | 富士アミドケミカル株式会社 | 4−フルオロイソキノリンの製法 |
| CN108627579B (zh) * | 2017-03-24 | 2020-12-01 | 上海安谱实验科技股份有限公司 | Pbt制品中多环芳烃的提取方法 |
| CA3087051A1 (en) * | 2017-12-26 | 2019-07-04 | Cytokinetics, Incorporated | Process for the preparation of an amino-pyrimidine and intermediates thereof |
| MX2021005314A (es) | 2018-11-09 | 2021-08-24 | Vivace Therapeutics Inc | Compuestos biciclicos. |
| PL3956033T3 (pl) | 2019-04-16 | 2025-06-09 | Vivace Therapeutics, Inc. | Związki bicykliczne |
| CN111848423B (zh) * | 2019-04-30 | 2022-10-14 | 尚科生物医药(上海)有限公司 | 3-氧代环丁基氨基甲酸叔丁酯的制备方法 |
| US11753413B2 (en) | 2020-06-19 | 2023-09-12 | Incyte Corporation | Substituted pyrrolo[2,1-f][1,2,4]triazine compounds as JAK2 V617F inhibitors |
| WO2021257857A1 (en) | 2020-06-19 | 2021-12-23 | Incyte Corporation | Naphthyridinone compounds as jak2 v617f inhibitors |
| US11767323B2 (en) | 2020-07-02 | 2023-09-26 | Incyte Corporation | Tricyclic pyridone compounds as JAK2 V617F inhibitors |
| KR20230057341A (ko) | 2020-07-02 | 2023-04-28 | 인사이트 코포레이션 | Jak2 v617f 억제제로서 삼환계 우레아 화합물 |
| WO2022046989A1 (en) | 2020-08-27 | 2022-03-03 | Incyte Corporation | Tricyclic urea compounds as jak2 v617f inhibitors |
| WO2022140231A1 (en) | 2020-12-21 | 2022-06-30 | Incyte Corporation | Deazaguaine compounds as jak2 v617f inhibitors |
| AR125273A1 (es) | 2021-02-25 | 2023-07-05 | Incyte Corp | Lactamas espirocíclicas como inhibidores de jak2 v617f |
| PT4426434T (pt) | 2021-11-02 | 2025-11-24 | Flare Therapeutics Inc | Agonistas inversos de pparg e suas utilizações |
| PE20251706A1 (es) | 2022-03-17 | 2025-07-02 | Incyte Corp | Compuestos de urea triciclica como inhibidores de v617f de jak2 |
Family Cites Families (60)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3869461A (en) * | 1968-07-02 | 1975-03-04 | Hoffmann La Roche | Intermediates for quinine, quinidine and derivatives thereof |
| US4096146A (en) * | 1968-07-02 | 1978-06-20 | Hoffmann-La Roche Inc. | 4-[5(R)-Alkyl(or alkenyl)-4(S)-quinuclidin-2(S) or 2(R)-ylcarbonyl]-quinolines, antipodes or racemates thereof and processes for their preparation |
| US3828048A (en) * | 1970-10-14 | 1974-08-06 | Res Et D Applic Scient Sogeras | Alkylsulfonic derivatives of quinine alkaloids |
| US4002757A (en) * | 1974-12-26 | 1977-01-11 | A. H. Robins Company, Incorporated | N-(1-substituted-3-pyrrolidinyl)-4-quinolinecarboxamides |
| PT66682B (pt) * | 1976-06-18 | 1978-11-15 | Ind Biolog Francaise | /(quinolyl-4)-propyl-1/-4 piperidines leur preparation et leur utilisation comme medicaments /(quinolyl-4)-propyl/-4 piperidines leur preparation et leur utilisation comme medicaments |
| NL7908031A (nl) * | 1979-11-01 | 1981-06-01 | Acf Chemiefarma Nv | Nieuwe chinolinederivaten en farmaceutische preparaten die een dergelijke verbinding bevatten, alsmede werk- wijze voor het bereiden van deze verbindingen. |
| FR2471981A1 (fr) * | 1979-12-21 | 1981-06-26 | Pharmindustrie | Nouveaux derives de la (piperidyl-4)-2 (quinolyl-4)-1 ethanone, produits intermediaires et procedes pour leur preparation, et leur utilisation comme medicaments |
| FR2495470A1 (fr) * | 1980-12-05 | 1982-06-11 | Pharmindustrie | Nouveaux medicaments a base de derives de (quinolyl-4)-1 (piperidyl-4)-2 ethanol ou (quinolyl-4)-1 (piperidyl-4)-3 propanol |
| US4757079A (en) * | 1986-06-24 | 1988-07-12 | Dynamac Corporaton | Anti-hypertensive piperidine compounds |
| FI95572C (fi) * | 1987-06-22 | 1996-02-26 | Eisai Co Ltd | Menetelmä lääkeaineena käyttökelpoisen piperidiinijohdannaisten tai sen farmaseuttisen suolan valmistamiseksi |
| US5260331A (en) * | 1989-01-02 | 1993-11-09 | John Wyeth & Brother Limited | Composition for treating depression with (S- or O-heteroaryl)alkyl amines |
| FR2642069B1 (fr) * | 1989-01-20 | 1991-04-12 | Rhone Poulenc Sante | Nouveaux derives du benzopyranne, leur preparation et les compositions pharmaceutiques qui les contiennent |
| DE69121225T2 (de) * | 1990-04-06 | 1997-02-06 | Eisai Co Ltd | Feste orale zubereitung mit einer catecholverbindung |
| JPH0772176B2 (ja) * | 1991-04-03 | 1995-08-02 | コリア リサーチ インスティチュート オブ ケミカル テクノロジイ | 2―キノリノン誘導体 |
| CA2075154A1 (en) * | 1991-08-06 | 1993-02-07 | Neelakantan Balasubramanian | Peptide aldehydes as antithrombotic agents |
| GB9216297D0 (en) * | 1991-08-15 | 1992-09-16 | Ici Plc | Therapeutic agents |
| FR2695126B1 (fr) * | 1992-08-27 | 1994-11-10 | Sanofi Elf | Dérivés d'acide thiényl ou pyrrolyl carboxyliques, leur préparation et médicaments les contenant. |
| DE4321030A1 (de) * | 1993-06-24 | 1995-01-05 | Bayer Ag | 4-bicyclisch substituierte Dihydropyridine, Verfahren zu ihrer Herstellung und ihre Verwendung in Arzneimittel |
| GB9318691D0 (en) * | 1993-09-09 | 1993-10-27 | Merck Sharp & Dohme | Therapeutic agents |
| US5512581A (en) * | 1994-07-18 | 1996-04-30 | Abbott Laboratories | Iminoxycarboxylates and derivatives as inhibitors of leukotriene biosynthesis |
| US5721103A (en) * | 1994-12-30 | 1998-02-24 | Ligand Pharmaceuticals Incorporated | Trienoic retinoid compounds and methods |
| US5741789A (en) * | 1995-01-17 | 1998-04-21 | Eli Lilly And Company | Compounds having effects on serotonin-related systems |
| DE69633196D1 (de) * | 1995-10-16 | 2004-09-23 | Fujisawa Pharmaceutical Co | Heterocyclische verbindungen als h+-atpasen |
| DE19613329A1 (de) * | 1996-04-03 | 1997-10-09 | Hoechst Schering Agrevo Gmbh | Substituierte Pyridine/Pyrimidine, Verfahren zu ihrer Herstellung und ihre Verwendung als Schädlingsbekämpfungsmittel |
| CA2254769A1 (en) * | 1996-05-20 | 1997-11-27 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| WO1997044322A1 (en) * | 1996-05-20 | 1997-11-27 | Darwin Discovery Limited | Quinoline sulfonamides as tnf inhibitors and as pde-iv inhibitors |
| WO1997044037A1 (en) * | 1996-05-20 | 1997-11-27 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| US6147088A (en) * | 1996-05-20 | 2000-11-14 | Merck & Co., Inc. | Antagonists of gonadotropin releasing hormone |
| HRP970371A2 (en) * | 1996-07-13 | 1998-08-31 | Kathryn Jane Smith | Heterocyclic compounds |
| WO1998013350A1 (en) * | 1996-09-25 | 1998-04-02 | Zeneca Limited | Qinoline derivatives inhibiting the effect of growth factors such as vegf |
| US6274598B1 (en) * | 1996-10-28 | 2001-08-14 | The United States Of America As Represented By The Secretary Of The Army | Methods for treating antibiotic-resistant infections |
| US6767991B1 (en) * | 1997-08-11 | 2004-07-27 | Boehringer Ingelheim (Canada) Ltd. | Hepatitis C inhibitor peptides |
| GB9800569D0 (en) * | 1998-01-12 | 1998-03-11 | Glaxo Group Ltd | Heterocyclic compounds |
| EP1051413B1 (en) | 1998-01-26 | 2003-06-04 | SmithKline Beecham plc | Quinoline derivatives as antibacterials |
| US6172087B1 (en) * | 1998-06-03 | 2001-01-09 | Gpi Nil Holding, Inc. | N-oxide of heterocyclic ester, amide, thioester, or ketone hair growth compositions and uses |
| US6303627B1 (en) * | 1998-06-19 | 2001-10-16 | Eli Lilly And Company | Inhibitors of serotonin reuptake |
| US6323180B1 (en) * | 1998-08-10 | 2001-11-27 | Boehringer Ingelheim (Canada) Ltd | Hepatitis C inhibitor tri-peptides |
| GB9819384D0 (en) * | 1998-09-04 | 1998-10-28 | Cerebrus Ltd | Chemical compounds II |
| GB9822440D0 (en) * | 1998-10-14 | 1998-12-09 | Smithkline Beecham Plc | Medicaments |
| GB9822450D0 (en) * | 1998-10-14 | 1998-12-09 | Smithkline Beecham Plc | Medicaments |
| EP1144404A1 (en) * | 1999-01-20 | 2001-10-17 | Smithkline Beecham Plc | Piperidinylquinolines as protein tyrosine kinase inhibitors |
| GB9910580D0 (en) * | 1999-05-08 | 1999-07-07 | Zeneca Ltd | Chemical compounds |
| GB9910579D0 (en) * | 1999-05-08 | 1999-07-07 | Zeneca Ltd | Chemical compounds |
| US6403610B1 (en) * | 1999-09-17 | 2002-06-11 | Aventis Pharma S.A. | Quinolylpropylpiperidine derivatives, their preparation and the compositions which comprise them |
| FR2798656B1 (fr) * | 1999-09-17 | 2004-12-17 | Aventis Pharma Sa | Derives de la quinolyl propyl piperidine, leur preparation et les compositions qui les contiennent |
| DE60140545D1 (enExample) * | 2000-03-31 | 2009-12-31 | Nippon Shinyaku Co Ltd | |
| US6803369B1 (en) * | 2000-07-25 | 2004-10-12 | Smithkline Beecham Corporation | Compounds and methods for the treatment of neoplastic disease |
| PL211125B1 (pl) * | 2000-09-11 | 2012-04-30 | Novartis Vaccines & Diagnostic | Pochodne chinolinonu jako inhibitory kinazy tyrozynowej, kompozycje je zawierające i ich zastosowanie |
| US6603005B2 (en) * | 2000-11-15 | 2003-08-05 | Aventis Pharma S.A. | Heterocyclylalkylpiperidine derivatives, their preparation and compositions containing them |
| US6693125B2 (en) * | 2001-01-24 | 2004-02-17 | Combinatorx Incorporated | Combinations of drugs (e.g., a benzimidazole and pentamidine) for the treatment of neoplastic disorders |
| US6650463B2 (en) * | 2001-03-13 | 2003-11-18 | Seiko Epson Corporation | Electrophoretic display device |
| US6602884B2 (en) * | 2001-03-13 | 2003-08-05 | Aventis Pharma S.A. | Quinolylpropylpiperidine derivatives, their preparation, and compositions containing them |
| GB0112836D0 (en) | 2001-05-25 | 2001-07-18 | Smithkline Beecham Plc | Medicaments |
| GB0118238D0 (en) | 2001-07-26 | 2001-09-19 | Smithkline Beecham Plc | Medicaments |
| US6787671B2 (en) * | 2002-01-15 | 2004-09-07 | Board Of Trustees Of Michigan State University | Catalytic osmium-assisted oxidative cleavage of olefins |
| FR2842807A1 (fr) * | 2002-07-23 | 2004-01-30 | Aventis Pharma Sa | Derives de la quinolyl propyl piperidine, procede et intermediaires de preparation et compositions les renfermant |
| DE10316081A1 (de) * | 2003-04-08 | 2004-10-21 | Morphochem AG Aktiengesellschaft für kombinatorische Chemie | Neue Verbindungen mit antibakterieller Aktivität |
| US7348434B2 (en) | 2003-08-08 | 2008-03-25 | Antony Bigot | 4-substituted quinoline derivatives, method and intermediates for their preparation and pharmaceutical compositions containing them |
| FR2867472B1 (fr) | 2004-03-12 | 2008-07-18 | Aventis Pharma Sa | Derives de quinoleines-4-substituees, leurs procede et intermediaires de preparation et les compositions pharmaceutiques qui les contiennent |
| WO2007042325A1 (de) * | 2005-10-13 | 2007-04-19 | Morphochem Aktiengesellschaft für kombinatorische Chemie | 5-chinolinderivate mit antibakterieller aktivität |
-
2008
- 2008-04-29 AU AU2008249745A patent/AU2008249745B2/en not_active Ceased
- 2008-04-29 EP EP12165102A patent/EP2481735A1/en not_active Withdrawn
- 2008-04-29 EP EP08737576A patent/EP2155716A2/en not_active Withdrawn
- 2008-04-29 CA CA002685888A patent/CA2685888A1/en not_active Abandoned
- 2008-04-29 KR KR1020097025640A patent/KR20090130347A/ko not_active Ceased
- 2008-04-29 MX MX2009012117A patent/MX2009012117A/es not_active Application Discontinuation
- 2008-04-29 CN CN200880020428A patent/CN101679357A/zh active Pending
- 2008-04-29 JP JP2010507014A patent/JP2010526130A/ja not_active Withdrawn
- 2008-04-29 KR KR1020127000612A patent/KR20120011093A/ko not_active Withdrawn
- 2008-04-29 WO PCT/IB2008/001076 patent/WO2008139288A2/en not_active Ceased
- 2008-05-07 AR ARP080101937A patent/AR066478A1/es not_active Application Discontinuation
- 2008-05-07 PE PE2008000800A patent/PE20090240A1/es not_active Application Discontinuation
- 2008-05-08 TW TW097117046A patent/TW200902518A/zh unknown
- 2008-05-08 US US12/117,071 patent/US20080280879A1/en not_active Abandoned
- 2008-05-08 UY UY31071A patent/UY31071A1/es not_active Application Discontinuation
- 2008-05-09 CL CL2008001367A patent/CL2008001367A1/es unknown
- 2008-05-09 PA PA20088779801A patent/PA8779801A1/es unknown
-
2009
- 2009-10-29 IL IL201830A patent/IL201830A0/en unknown
- 2009-11-04 ZA ZA200907761A patent/ZA200907761B/xx unknown
-
2010
- 2010-12-20 US US12/972,620 patent/US20110092480A1/en not_active Abandoned
-
2011
- 2011-11-22 US US13/302,151 patent/US20120065188A1/en not_active Abandoned
Also Published As
| Publication number | Publication date |
|---|---|
| US20120065188A1 (en) | 2012-03-15 |
| KR20120011093A (ko) | 2012-02-06 |
| IL201830A0 (en) | 2010-06-16 |
| WO2008139288A2 (en) | 2008-11-20 |
| CN101679357A (zh) | 2010-03-24 |
| AU2008249745A1 (en) | 2008-11-20 |
| US20110092480A1 (en) | 2011-04-21 |
| MX2009012117A (es) | 2009-11-23 |
| TW200902518A (en) | 2009-01-16 |
| PE20090240A1 (es) | 2009-03-19 |
| EP2481735A1 (en) | 2012-08-01 |
| CA2685888A1 (en) | 2008-11-20 |
| PA8779801A1 (es) | 2009-01-23 |
| AR066478A1 (es) | 2009-08-19 |
| UY31071A1 (es) | 2009-01-05 |
| AU2008249745B2 (en) | 2012-01-12 |
| WO2008139288A3 (en) | 2009-03-26 |
| CL2008001367A1 (es) | 2008-11-07 |
| EP2155716A2 (en) | 2010-02-24 |
| ZA200907761B (en) | 2010-08-25 |
| JP2010526130A (ja) | 2010-07-29 |
| US20080280879A1 (en) | 2008-11-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR20090130347A (ko) | 치환된 헤테로사이클릭 유도체 및 조성물 및 항균제로서의 이의 약학적 용도 | |
| JP7334211B2 (ja) | 置換4-ベンジル及び4-ベンゾイルピペリジン誘導体 | |
| KR100862879B1 (ko) | Hiv 인테그라제의 n-치환된 하이드록시피리미디논 카복스아미드 억제제 | |
| TWI330081B (en) | New compounds, their preparations and their use in treatment and/or prevention of disease associated with glycogen synthase kinase-3 | |
| AU2019228568B2 (en) | Piperidinyl-3-(aryloxy)propanamides and propanoates | |
| TW202309039A (zh) | 用於靶向布魯頓氏酪胺酸激酶降解之化合物 | |
| WO2022152852A1 (en) | Antagonists of mrgx2 | |
| TW202345838A (zh) | 稠合噠嗪衍生物 | |
| TW202515541A (zh) | 補體因子b抑制劑及其用途 | |
| AU2025205323A1 (en) | Fused heterocycles as 5-ht2a receptor agonists | |
| KR20230083276A (ko) | 오토탁신 억제제 화합물 | |
| CA2887375A1 (en) | Inhibitors of dna gyrase for the treatment of bacterial infections | |
| AU2017332232A1 (en) | 6-membered cyclic amines or lactames substituted with urea and phenyl | |
| JP2023527792A (ja) | Tlr2調節剤化合物、医薬組成物、及びそれらの使用 | |
| HK1139664A (en) | Substituted heterocyclic derivatives and compositions and their pharmaceutical use as antibacterials | |
| TW202430512A (zh) | 類木瓜蛋白酶(PLpro)抑制劑 | |
| HK1252794B (en) | Substituted 4-benzyl and 4-benzoyl piperidine derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A201 | Request for examination | ||
| PA0105 | International application |
Patent event date: 20091208 Patent event code: PA01051R01D Comment text: International Patent Application |
|
| PA0201 | Request for examination | ||
| PG1501 | Laying open of application | ||
| PE0902 | Notice of grounds for rejection |
Comment text: Notification of reason for refusal Patent event date: 20111007 Patent event code: PE09021S01D |
|
| A107 | Divisional application of patent | ||
| PA0104 | Divisional application for international application |
Comment text: Divisional Application for International Patent Patent event code: PA01041R01D Patent event date: 20120109 |
|
| E601 | Decision to refuse application | ||
| PE0601 | Decision on rejection of patent |
Patent event date: 20120117 Comment text: Decision to Refuse Application Patent event code: PE06012S01D Patent event date: 20111007 Comment text: Notification of reason for refusal Patent event code: PE06011S01I |