FI83872C - Foerfarande foer framstaellning av terapeutiskt anvaendbara 7-(diaza-eller azabicykloalkyl)-6-fluor-4-oxo-3 -kinolin- eller 1,8-naftyridin-3-karboxylsyror. - Google Patents
Foerfarande foer framstaellning av terapeutiskt anvaendbara 7-(diaza-eller azabicykloalkyl)-6-fluor-4-oxo-3 -kinolin- eller 1,8-naftyridin-3-karboxylsyror. Download PDFInfo
- Publication number
- FI83872C FI83872C FI851471A FI851471A FI83872C FI 83872 C FI83872 C FI 83872C FI 851471 A FI851471 A FI 851471A FI 851471 A FI851471 A FI 851471A FI 83872 C FI83872 C FI 83872C
- Authority
- FI
- Finland
- Prior art keywords
- oxo
- dihydro
- diazabicyclo
- fluoro
- ethyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 35
- 238000002360 preparation method Methods 0.000 title claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 110
- -1 p-aminobenzyl Chemical group 0.000 claims description 56
- 239000002253 acid Substances 0.000 claims description 16
- 150000003839 salts Chemical class 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- UXAWXZDXVOYLII-UHFFFAOYSA-N tert-butyl 2,5-diazabicyclo[2.2.1]heptane-2-carboxylate Chemical compound C1C2N(C(=O)OC(C)(C)C)CC1NC2 UXAWXZDXVOYLII-UHFFFAOYSA-N 0.000 claims description 8
- IRSOAAANOYUKCN-UHFFFAOYSA-N 7-(2,5-diazabicyclo[2.2.2]octan-2-yl)-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C1C(NC2)CCC2N1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=N1 IRSOAAANOYUKCN-UHFFFAOYSA-N 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 5
- OYURSKSJKOIXFH-UHFFFAOYSA-N 7-(2,5-diazabicyclo[2.2.2]octan-2-yl)-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(NC2)CCC2N1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=C1F OYURSKSJKOIXFH-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- ZWLNNJUVRYMXIQ-UHFFFAOYSA-N 1-cyclopropyl-7-(1,4-diazabicyclo[3.2.1]octan-4-yl)-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3C4CCN(C4)CC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 ZWLNNJUVRYMXIQ-UHFFFAOYSA-N 0.000 claims description 3
- RLBUUKCKRXIPKN-UHFFFAOYSA-N 7-(1,4-diazabicyclo[3.2.1]octan-4-yl)-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1CN(C2)CCC2N1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=C1F RLBUUKCKRXIPKN-UHFFFAOYSA-N 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- NTURQZFFJDCTMZ-UHFFFAOYSA-N 1-(2-bromoethyl)-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(CCBr)C=C1 NTURQZFFJDCTMZ-UHFFFAOYSA-N 0.000 claims description 2
- AHPALVNYJYICFF-UHFFFAOYSA-N 1-cyclopropyl-7-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3C4CC(NC4)C3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 AHPALVNYJYICFF-UHFFFAOYSA-N 0.000 claims description 2
- PFDUXKLQTAEQFI-UHFFFAOYSA-N 7-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1C(CN2)CC2C1 PFDUXKLQTAEQFI-UHFFFAOYSA-N 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000001589 carboacyl group Chemical group 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- RMJXPJFRSSZUAS-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-4-oxo-7-(2-propan-2-yl-2,5-diazabicyclo[2.2.1]heptan-5-yl)quinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1C(CN2C(C)C)CC2C1 RMJXPJFRSSZUAS-UHFFFAOYSA-N 0.000 claims 1
- SXDPMFRPUKIDEV-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-7-[5-(2-hydroxyethyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1C(CN2CCO)CC2C1 SXDPMFRPUKIDEV-UHFFFAOYSA-N 0.000 claims 1
- KMEFJHYKEZPYCT-UHFFFAOYSA-N 1-ethyl-6-fluoro-7-(5-methyl-2,5-diazabicyclo[2.2.2]octan-2-yl)-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C1C(N(C2)C)CCC2N1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=N1 KMEFJHYKEZPYCT-UHFFFAOYSA-N 0.000 claims 1
- ZFIVQGDPCGUOLG-UHFFFAOYSA-N CC(CCCCCC)C=1N(C2=NC=C(C=C2C(C1C(=O)O)=O)F)C1CC1 Chemical compound CC(CCCCCC)C=1N(C2=NC=C(C=C2C(C1C(=O)O)=O)F)C1CC1 ZFIVQGDPCGUOLG-UHFFFAOYSA-N 0.000 claims 1
- QMLVECGLEOSESV-RYUDHWBXSA-N Danofloxacin Chemical compound C([C@@H]1C[C@H]2CN1C)N2C(C(=CC=1C(=O)C(C(O)=O)=C2)F)=CC=1N2C1CC1 QMLVECGLEOSESV-RYUDHWBXSA-N 0.000 claims 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 claims 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims 1
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 84
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 72
- 239000000243 solution Substances 0.000 description 57
- 239000000203 mixture Substances 0.000 description 39
- 239000007787 solid Substances 0.000 description 34
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 30
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 29
- 239000011541 reaction mixture Substances 0.000 description 29
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 28
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 23
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 23
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 19
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 18
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- 238000010992 reflux Methods 0.000 description 18
- 238000001914 filtration Methods 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 13
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- 239000000706 filtrate Substances 0.000 description 11
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 10
- 239000002244 precipitate Substances 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 230000000694 effects Effects 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 238000007920 subcutaneous administration Methods 0.000 description 9
- 229960000583 acetic acid Drugs 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 238000001816 cooling Methods 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid group Chemical class S(O)(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- 239000003826 tablet Substances 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 6
- 239000002775 capsule Substances 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 238000001727 in vivo Methods 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 238000000338 in vitro Methods 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 235000019341 magnesium sulphate Nutrition 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- SKYHBWSFRMRRRT-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-yl-1,8-naphthyridine-3-carboxylic acid Chemical compound C12=NC(N3CCNCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 SKYHBWSFRMRRRT-UHFFFAOYSA-N 0.000 description 4
- FKKUVCHFRDLBHN-UHFFFAOYSA-N 1-ethyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C(F)=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 FKKUVCHFRDLBHN-UHFFFAOYSA-N 0.000 description 4
- OXNZWNNMJBOZQO-UHFFFAOYSA-N 7-chloro-1-cyclopropyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C12=NC(Cl)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 OXNZWNNMJBOZQO-UHFFFAOYSA-N 0.000 description 4
- LJYJAEQCLXAHFQ-UHFFFAOYSA-N 7-chloro-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound FC1=C(Cl)N=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 LJYJAEQCLXAHFQ-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- VIIYJRYORKDEHU-UHFFFAOYSA-N N-(8-azabicyclo[3.2.1]octan-1-yl)acetamide hydrochloride Chemical compound Cl.C(C)(=O)NC12CCCC(CC1)N2 VIIYJRYORKDEHU-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 4
- 230000000844 anti-bacterial effect Effects 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 239000002552 dosage form Substances 0.000 description 4
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 4
- 125000000623 heterocyclic group Chemical group 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 239000010410 layer Substances 0.000 description 4
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- FLBAYUMRQUHISI-UHFFFAOYSA-N 1,8-naphthyridine Chemical compound N1=CC=CC2=CC=CN=C21 FLBAYUMRQUHISI-UHFFFAOYSA-N 0.000 description 3
- NMASXYCNDJMMFR-UHFFFAOYSA-N 1-cyclopropyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 NMASXYCNDJMMFR-UHFFFAOYSA-N 0.000 description 3
- MHFJYVWFBPABTI-UHFFFAOYSA-N 1-ethyl-6,7-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 MHFJYVWFBPABTI-UHFFFAOYSA-N 0.000 description 3
- SFKRXQKJTIYUAG-UHFFFAOYSA-N 2,3,4,5-tetrafluorobenzoic acid Chemical compound OC(=O)C1=CC(F)=C(F)C(F)=C1F SFKRXQKJTIYUAG-UHFFFAOYSA-N 0.000 description 3
- MYIPGNFIOPNJBA-UHFFFAOYSA-N 2,5-diazabicyclo[2.2.2]octane;dihydrochloride Chemical compound Cl.Cl.C1NC2CCC1NC2 MYIPGNFIOPNJBA-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 102100020870 La-related protein 6 Human genes 0.000 description 3
- 108050008265 La-related protein 6 Proteins 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 3
- KWDVJYLIAJHEOW-UHFFFAOYSA-N ethyl 3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanoate Chemical compound CCOC(=O)CC(=O)C1=CC(F)=C(F)C(F)=C1F KWDVJYLIAJHEOW-UHFFFAOYSA-N 0.000 description 3
- 239000008098 formaldehyde solution Substances 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- VGXNWKNOHCFGHG-UHFFFAOYSA-N n-(8-benzyl-8-azabicyclo[3.2.1]octan-5-yl)acetamide;hydrochloride Chemical compound Cl.C1CCC2(NC(=O)C)CCC1N2CC1=CC=CC=C1 VGXNWKNOHCFGHG-UHFFFAOYSA-N 0.000 description 3
- 239000008194 pharmaceutical composition Substances 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- FTTATHOUSOIFOQ-UHFFFAOYSA-N 1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine Chemical compound C1NCCN2CCCC21 FTTATHOUSOIFOQ-UHFFFAOYSA-N 0.000 description 2
- OPELDSFLVQSDPM-UHFFFAOYSA-N 1,2,5-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C2C(C(=C(N(C2=CC=C1)F)F)C(=O)O)=O OPELDSFLVQSDPM-UHFFFAOYSA-N 0.000 description 2
- KYCAEEFYFFBAAP-UHFFFAOYSA-N 1,4-diazabicyclo[3.2.1]octane Chemical compound C1C2CCN1CCN2 KYCAEEFYFFBAAP-UHFFFAOYSA-N 0.000 description 2
- CGXLVFZJJOXEDF-UHFFFAOYSA-N 1,8-naphthyridine-3-carboxylic acid Chemical compound N1=CC=CC2=CC(C(=O)O)=CN=C21 CGXLVFZJJOXEDF-UHFFFAOYSA-N 0.000 description 2
- YEGBYBZWOAXYLK-UHFFFAOYSA-N 1-cyclopropyl-7-(2,5-diazabicyclo[2.2.2]octan-2-yl)-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3C4CCC(NC4)C3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 YEGBYBZWOAXYLK-UHFFFAOYSA-N 0.000 description 2
- AMFZGKIUFJNGMU-UHFFFAOYSA-N 1-cyclopropyl-7-ethylsulfonyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C1=C(C(O)=O)C(=O)C=2C=C(F)C(S(=O)(=O)CC)=NC=2N1C1CC1 AMFZGKIUFJNGMU-UHFFFAOYSA-N 0.000 description 2
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 2
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 2
- CFPCKNVBSYLJHT-UHFFFAOYSA-N 3-methyl-3,8-diazabicyclo[3.2.1]octane;dihydrochloride Chemical compound Cl.Cl.C1N(C)CC2CCC1N2 CFPCKNVBSYLJHT-UHFFFAOYSA-N 0.000 description 2
- XNZIHVKLRKGFBS-UHFFFAOYSA-N 8-methyl-3,8-diazabicyclo[3.2.1]octane;dihydrochloride Chemical compound Cl.Cl.C1NCC2CCC1N2C XNZIHVKLRKGFBS-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 208000035143 Bacterial infection Diseases 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- YAVWDJDEOLOYQO-UHFFFAOYSA-N OOOOOOOOOO Chemical compound OOOOOOOOOO YAVWDJDEOLOYQO-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 241000191967 Staphylococcus aureus Species 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 208000022362 bacterial infectious disease Diseases 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- MYSWGUAQZAJSOK-UHFFFAOYSA-N ciprofloxacin Chemical compound C12=CC(N3CCNCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 MYSWGUAQZAJSOK-UHFFFAOYSA-N 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 229940125810 compound 20 Drugs 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- AKMFLNXSGUYKJX-UHFFFAOYSA-N ethyl 4-(6-chloro-3-nitropyridin-2-yl)piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=NC(Cl)=CC=C1[N+]([O-])=O AKMFLNXSGUYKJX-UHFFFAOYSA-N 0.000 description 2
- HISNMGFYFJXXJW-UHFFFAOYSA-N ethyl 4-[6-(cyclopropylamino)-3-fluoropyridin-2-yl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=NC(NC2CC2)=CC=C1F HISNMGFYFJXXJW-UHFFFAOYSA-N 0.000 description 2
- OQLZLQOQVVLZGK-UHFFFAOYSA-N ethyl 4-[6-[acetyl(cyclopropyl)amino]-3-fluoropyridin-2-yl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=NC(N(C2CC2)C(C)=O)=CC=C1F OQLZLQOQVVLZGK-UHFFFAOYSA-N 0.000 description 2
- LNOQURRKNJKKBU-UHFFFAOYSA-N ethyl piperazine-1-carboxylate Chemical compound CCOC(=O)N1CCNCC1 LNOQURRKNJKKBU-UHFFFAOYSA-N 0.000 description 2
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011491 glass wool Substances 0.000 description 2
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- KFSOYEAOVNOZNU-UHFFFAOYSA-N n-(8-benzyl-8-azabicyclo[3.2.1]octan-3-ylidene)hydroxylamine Chemical compound C1C(=NO)CC2CCC1N2CC1=CC=CC=C1 KFSOYEAOVNOZNU-UHFFFAOYSA-N 0.000 description 2
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- JABYJIQOLGWMQW-UHFFFAOYSA-N undec-4-ene Chemical compound CCCCCCC=CCCC JABYJIQOLGWMQW-UHFFFAOYSA-N 0.000 description 2
- APQIUTYORBAGEZ-UHFFFAOYSA-N 1,1-dibromoethane Chemical compound CC(Br)Br APQIUTYORBAGEZ-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- CTBNEKSAJTWOFM-UHFFFAOYSA-N 1,4-diazabicyclo[3.2.1]octane;dihydrochloride Chemical compound Cl.Cl.C1C2CCN1CCN2 CTBNEKSAJTWOFM-UHFFFAOYSA-N 0.000 description 1
- 150000005058 1,8-naphthyridines Chemical class 0.000 description 1
- QXVMVAPREYZESC-UHFFFAOYSA-N 1-cyclopropyl-6,8-difluoro-7-(3-methyl-3,8-diazabicyclo[3.2.1]octan-4-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound CN1CC(N2)CCC2C1C(C=1F)=C(F)C=C(C(C(C(O)=O)=C2)=O)C=1N2C1CC1 QXVMVAPREYZESC-UHFFFAOYSA-N 0.000 description 1
- JONGFFILGKVWNM-UHFFFAOYSA-N 1-cyclopropyl-6,8-difluoro-7-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)-4-oxoquinoline-3-carboxylic acid;hydrochloride Chemical compound Cl.CN1CC2CC1CN2C(C=1F)=C(F)C=C(C(C(C(O)=O)=C2)=O)C=1N2C1CC1 JONGFFILGKVWNM-UHFFFAOYSA-N 0.000 description 1
- HJMZHLRAOZAWAW-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-7-(5-methyl-2,5-diazabicyclo[2.2.2]octan-2-yl)-4h-1,8-naphthyridine-3-carboxylic acid;hydrochloride Chemical compound Cl.CN1CC2CCC1CN2C(C(=CC=1CC(=C2)C(O)=O)F)=NC=1N2C1CC1 HJMZHLRAOZAWAW-UHFFFAOYSA-N 0.000 description 1
- QMLVECGLEOSESV-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-7-(5-methyl-2-aza-5-azoniabicyclo[2.2.1]heptan-2-yl)-4-oxoquinoline-3-carboxylate Chemical compound CN1CC2CC1CN2C(C(=CC=1C(=O)C(C(O)=O)=C2)F)=CC=1N2C1CC1 QMLVECGLEOSESV-UHFFFAOYSA-N 0.000 description 1
- SJVAERFHRGRASE-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-7-(8-methyl-3,8-diazabicyclo[3.2.1]octan-4-yl)-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound CN1C(CN2)CCC1C2C(C(=CC=1C(=O)C(C(O)=O)=C2)F)=NC=1N2C1CC1 SJVAERFHRGRASE-UHFFFAOYSA-N 0.000 description 1
- AKLKDHLCSQCLFE-UHFFFAOYSA-N 1-cyclopropyl-7-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C12=NC(N3C4CC(NC4)C3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 AKLKDHLCSQCLFE-UHFFFAOYSA-N 0.000 description 1
- YSRXWKRXINHWPZ-UHFFFAOYSA-N 1-cyclopropyl-7-(2,5-diazabicyclo[2.2.2]octan-2-yl)-6-fluoro-1,8-naphthyridin-4-one Chemical compound C12N(CC(NC1)CC2)C1=C(C=C2C(C=CN(C2=N1)C1CC1)=O)F YSRXWKRXINHWPZ-UHFFFAOYSA-N 0.000 description 1
- SUGOFCVKWPWSEE-UHFFFAOYSA-N 1-cyclopropyl-7-(2,5-diazabicyclo[2.2.2]octan-2-yl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C12=NC(N3C4CCC(NC4)C3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 SUGOFCVKWPWSEE-UHFFFAOYSA-N 0.000 description 1
- OGZODYXEGYHQOP-UHFFFAOYSA-N 1-cyclopropyl-7-(4-ethoxycarbonylpiperazin-1-yl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C1CN(C(=O)OCC)CCN1C(C(=C1)F)=NC2=C1C(=O)C(C(O)=O)=CN2C1CC1 OGZODYXEGYHQOP-UHFFFAOYSA-N 0.000 description 1
- SPIYPEDQWGWRMN-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-7-(8-methyl-3,8-diazabicyclo[3.2.1]octan-4-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound N1CC(N2C)CCC2C1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=C1F SPIYPEDQWGWRMN-UHFFFAOYSA-N 0.000 description 1
- MGJXIOXOKWLZFS-UHFFFAOYSA-N 1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=CC=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 MGJXIOXOKWLZFS-UHFFFAOYSA-N 0.000 description 1
- QFYXFSPAKRVTGS-UHFFFAOYSA-N 1-ethyl-6-fluoro-7-(3-methyl-3,8-diazabicyclo[3.2.1]octan-2-yl)-4-oxo-1,8-naphthyridine-3-carboxylic acid hydrochloride Chemical compound Cl.CCn1cc(C(O)=O)c(=O)c2cc(F)c(nc12)C1C2CCC(CN1C)N2 QFYXFSPAKRVTGS-UHFFFAOYSA-N 0.000 description 1
- CZRFAAGQISGFHV-UHFFFAOYSA-N 1-ethyl-6-fluoro-7-(5-methyl-2,5-diazabicyclo[2.2.2]octan-2-yl)-4-oxo-1,8-naphthyridine-3-carboxylic acid;hydrochloride Chemical compound Cl.C1C(N(C2)C)CCC2N1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=N1 CZRFAAGQISGFHV-UHFFFAOYSA-N 0.000 description 1
- ZMAOHHOIKHBICV-UHFFFAOYSA-N 1-ethyl-7-ethylsulfanyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound CCN1C=C(C(O)=O)C(=O)C2=C1N=C(SCC)C(F)=C2 ZMAOHHOIKHBICV-UHFFFAOYSA-N 0.000 description 1
- PTCFWANOHXDFOH-UHFFFAOYSA-N 1-ethyl-7-ethylsulfonyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound FC1=C(S(=O)(=O)CC)N=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 PTCFWANOHXDFOH-UHFFFAOYSA-N 0.000 description 1
- ISYQWKOXKGJREA-UHFFFAOYSA-N 2,5-diazabicyclo[2.2.1]heptane;dihydrobromide Chemical compound Br.Br.C1NC2CNC1C2 ISYQWKOXKGJREA-UHFFFAOYSA-N 0.000 description 1
- SOMPEQIPSQFVMO-UHFFFAOYSA-N 2-benzyl-2,5-diazabicyclo[2.2.1]heptane;dihydrobromide Chemical compound Br.Br.C1C(NC2)CC2N1CC1=CC=CC=C1 SOMPEQIPSQFVMO-UHFFFAOYSA-N 0.000 description 1
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- BFVQMOCETIVORP-UHFFFAOYSA-N 2-oxo-1h-1,8-naphthyridine-3-carboxylic acid Chemical compound C1=CN=C2NC(=O)C(C(=O)O)=CC2=C1 BFVQMOCETIVORP-UHFFFAOYSA-N 0.000 description 1
- VOLRSQPSJGXRNJ-UHFFFAOYSA-N 4-nitrobenzyl bromide Chemical compound [O-][N+](=O)C1=CC=C(CBr)C=C1 VOLRSQPSJGXRNJ-UHFFFAOYSA-N 0.000 description 1
- YCAZALSUJDPQPP-UHFFFAOYSA-N 4-oxo-3h-quinoline-3-carboxylic acid Chemical compound C1=CC=C2C(=O)C(C(=O)O)C=NC2=C1 YCAZALSUJDPQPP-UHFFFAOYSA-N 0.000 description 1
- DVLSQHLXPRYYRC-UHFFFAOYSA-N 5-(methoxymethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione Chemical compound COC=C1C(=O)OC(C)(C)OC1=O DVLSQHLXPRYYRC-UHFFFAOYSA-N 0.000 description 1
- UUMQFEURXDWEQQ-UHFFFAOYSA-N 5-benzyl-8-azabicyclo[3.2.1]octane Chemical compound C1CC(N2)CCCC12CC1=CC=CC=C1 UUMQFEURXDWEQQ-UHFFFAOYSA-N 0.000 description 1
- KRBQJNAQTNYREQ-UHFFFAOYSA-N 6,7,8-trifluoro-1-(2-fluoroethyl)-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C=C2C(=O)C(C(=O)O)=CN(CCF)C2=C1F KRBQJNAQTNYREQ-UHFFFAOYSA-N 0.000 description 1
- ISAQBIWYAQHPKI-UHFFFAOYSA-N 7-(1,4-diazabicyclo[3.2.1]octan-4-yl)-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C1CN(C2)CCC2N1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=N1 ISAQBIWYAQHPKI-UHFFFAOYSA-N 0.000 description 1
- WUUUAEZMNSYLMU-UHFFFAOYSA-N 7-(2,5-diazabicyclo[2.2.1]heptan-2-yl)-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1C(CN2)CC2C1 WUUUAEZMNSYLMU-UHFFFAOYSA-N 0.000 description 1
- QFUYXGJHDFNPSY-UHFFFAOYSA-N 7-(2,5-diazabicyclo[2.2.2]octan-2-yl)-1-ethenyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(NC2)CCC2N1C1=C(F)C=C(C(C(C(=O)O)=CN2C=C)=O)C2=C1F QFUYXGJHDFNPSY-UHFFFAOYSA-N 0.000 description 1
- LCVGANIDPZSEMC-UHFFFAOYSA-N 7-(2,5-diazabicyclo[2.2.2]octan-2-yl)-6,8-difluoro-1-(2-fluoroethyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(NC2)CCC2N1C1=C(F)C=C(C(C(C(=O)O)=CN2CCF)=O)C2=C1F LCVGANIDPZSEMC-UHFFFAOYSA-N 0.000 description 1
- BQDVLIDLHOSQHC-UHFFFAOYSA-N 7-(3-aminopyrrolidin-1-yl)-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical class N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCC(N)C1 BQDVLIDLHOSQHC-UHFFFAOYSA-N 0.000 description 1
- JSTMHFGSAKLXGM-UHFFFAOYSA-N 7-(5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CC2CC1CN2CC1=CC=CC=C1 JSTMHFGSAKLXGM-UHFFFAOYSA-N 0.000 description 1
- XPFHGOVBHNSRAE-UHFFFAOYSA-N 7-[5-[(4-aminophenyl)methyl]-2,5-diazabicyclo[2.2.2]octan-2-yl]-1-cyclopropyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C1=CC(N)=CC=C1CN1C(CN2C=3C(=CC=4C(=O)C(C(O)=O)=CN(C=4N=3)C3CC3)F)CCC2C1 XPFHGOVBHNSRAE-UHFFFAOYSA-N 0.000 description 1
- VCJHKCJPMHDQJO-UHFFFAOYSA-N 7-chloro-1-ethyl-6-fluoro-1,8-naphthyridin-4-one Chemical compound FC1=C(Cl)N=C2N(CC)C=CC(=O)C2=C1 VCJHKCJPMHDQJO-UHFFFAOYSA-N 0.000 description 1
- LRNKREBJXFSWPG-UHFFFAOYSA-N 7-ethylsulfanyl-6-fluoro-4-oxo-1H-1,8-naphthyridine-3-carboxylic acid Chemical compound C(C)SC1=C(C=C2C(C(=CNC2=N1)C(=O)O)=O)F LRNKREBJXFSWPG-UHFFFAOYSA-N 0.000 description 1
- VTTPHBIBXCPVID-UHFFFAOYSA-N 7-pyridin-2-ylquinoline Chemical class N1=CC=CC=C1C1=CC=C(C=CC=N2)C2=C1 VTTPHBIBXCPVID-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- DGGKXQQCVPAUEA-UHFFFAOYSA-N 8-azabicyclo[3.2.1]octane Chemical compound C1CCC2CCC1N2 DGGKXQQCVPAUEA-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- LIGFENZXTQKWTF-UHFFFAOYSA-N C(C)OC(C)=O.FC=1C=C2C(C(=CNC2=C(C1F)F)C(=O)O)=O.C(=C)N1C=C(C(C2=CC(=C(C(=C12)F)F)F)=O)C(=O)O Chemical compound C(C)OC(C)=O.FC=1C=C2C(C(=CNC2=C(C1F)F)C(=O)O)=O.C(=C)N1C=C(C(C2=CC(=C(C(=C12)F)F)F)=O)C(=O)O LIGFENZXTQKWTF-UHFFFAOYSA-N 0.000 description 1
- RMHUERZUJJGNTK-UHFFFAOYSA-N C(C)OC(CC(C1=C(C(=C(C(=C1)F)F)F)F)=O)=O.C1(CC1)N1C=C(C(C2=CC(=C(C(=C12)F)F)F)=O)C(=O)O Chemical compound C(C)OC(CC(C1=C(C(=C(C(=C1)F)F)F)F)=O)=O.C1(CC1)N1C=C(C(C2=CC(=C(C(=C12)F)F)F)=O)C(=O)O RMHUERZUJJGNTK-UHFFFAOYSA-N 0.000 description 1
- LHLNRFGOXAVODH-UHFFFAOYSA-N C1(CC1)C1C=C(C(C2=NC(=C(N=C12)O)F)=O)C(=O)O Chemical compound C1(CC1)C1C=C(C(C2=NC(=C(N=C12)O)F)=O)C(=O)O LHLNRFGOXAVODH-UHFFFAOYSA-N 0.000 description 1
- MTXPSEFZEVFZRP-UHFFFAOYSA-N C1(CC1)OC(=O)C1=CNC2=NC(=C(C=C2C1=O)F)N1CCN(CC1)C(=O)OCC Chemical compound C1(CC1)OC(=O)C1=CNC2=NC(=C(C=C2C1=O)F)N1CCN(CC1)C(=O)OCC MTXPSEFZEVFZRP-UHFFFAOYSA-N 0.000 description 1
- RREGGPHXGKPLPF-UHFFFAOYSA-N C12N(CC(NC1)CC2)C2=C1C(C(=CN(C1=CC=C2F)CC)C(=O)O)=O Chemical compound C12N(CC(NC1)CC2)C2=C1C(C(=CN(C1=CC=C2F)CC)C(=O)O)=O RREGGPHXGKPLPF-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- BJBFQSPYEGWDPD-UHFFFAOYSA-N Cl.C(C)N1C=C(C(C2=CC(=C(C(=C12)F)N1C2CN(C(C1)C2)C(C)C)F)=O)C(=O)O Chemical compound Cl.C(C)N1C=C(C(C2=CC(=C(C(=C12)F)N1C2CN(C(C1)C2)C(C)C)F)=O)C(=O)O BJBFQSPYEGWDPD-UHFFFAOYSA-N 0.000 description 1
- QQEXPHFHTJSSFV-UHFFFAOYSA-N Cl.C(C)N1C=C(C(C2=CC(=C(C(=C12)F)N1C2CN(C(C1)CC2)C)F)=O)C(=O)O Chemical compound Cl.C(C)N1C=C(C(C2=CC(=C(C(=C12)F)N1C2CN(C(C1)CC2)C)F)=O)C(=O)O QQEXPHFHTJSSFV-UHFFFAOYSA-N 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 241000588697 Enterobacter cloacae Species 0.000 description 1
- 241000588722 Escherichia Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 244000043261 Hevea brasiliensis Species 0.000 description 1
- 241000588747 Klebsiella pneumoniae Species 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 101100495145 Mus musculus Ccno gene Proteins 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- NIPNSKYNPDTRPC-UHFFFAOYSA-N N-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 NIPNSKYNPDTRPC-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- RSPISYXLHRIGJD-UHFFFAOYSA-N OOOO Chemical compound OOOO RSPISYXLHRIGJD-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000588769 Proteus <enterobacteria> Species 0.000 description 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 241000194017 Streptococcus Species 0.000 description 1
- 241000193998 Streptococcus pneumoniae Species 0.000 description 1
- 241000193996 Streptococcus pyogenes Species 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 101100495142 Xenopus laevis ccno-a gene Proteins 0.000 description 1
- XLUXHEZIGIDTCC-UHFFFAOYSA-N acetonitrile;ethyl acetate Chemical compound CC#N.CCOC(C)=O XLUXHEZIGIDTCC-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000012223 aqueous fraction Substances 0.000 description 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- VDANGULDQQJODZ-UHFFFAOYSA-N chloroprocaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1Cl VDANGULDQQJODZ-UHFFFAOYSA-N 0.000 description 1
- 229960002023 chloroprocaine Drugs 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 229960003405 ciprofloxacin Drugs 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 229940043237 diethanolamine Drugs 0.000 description 1
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical compound CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000003113 dilution method Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000008393 encapsulating agent Substances 0.000 description 1
- FGICMAMEHORFNK-UHFFFAOYSA-N ethyl 1-cyclopropyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylate Chemical compound C12=C(F)C(F)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 FGICMAMEHORFNK-UHFFFAOYSA-N 0.000 description 1
- IVGVYVLHVPTBLC-UHFFFAOYSA-N ethyl 1-cyclopropyl-7-(4-ethoxycarbonylpiperazin-1-yl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C(C(=C1)F)=NC2=C1C(=O)C(C(=O)OCC)=CN2C1CC1 IVGVYVLHVPTBLC-UHFFFAOYSA-N 0.000 description 1
- YYHMZHRWVGIDPJ-UHFFFAOYSA-N ethyl 4-[6-(cyclopropylamino)-3-nitropyridin-2-yl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=NC(NC2CC2)=CC=C1[N+]([O-])=O YYHMZHRWVGIDPJ-UHFFFAOYSA-N 0.000 description 1
- SOCNLGQUISUHKI-UHFFFAOYSA-N ethyl 4-[6-[[2-(cyclopropylmethyl)-2-methyl-4,6-dioxo-1,3-dioxan-5-ylidene]amino]-3-fluoropyridin-2-yl]piperazine-1-carboxylate Chemical compound C(C)OC(=O)N1CCN(CC1)C1=NC(=CC=C1F)N=C1C(OC(OC1=O)(CC1CC1)C)=O SOCNLGQUISUHKI-UHFFFAOYSA-N 0.000 description 1
- UXAXHZHNGAGNFU-UHFFFAOYSA-N ethyl 4-[6-[acetyl(cyclopropyl)amino]-3-nitropyridin-2-yl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=NC(N(C2CC2)C(C)=O)=CC=C1[N+]([O-])=O UXAXHZHNGAGNFU-UHFFFAOYSA-N 0.000 description 1
- 229940012017 ethylenediamine Drugs 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- KIMVTSGNCBGHES-UHFFFAOYSA-N octane;dihydrochloride Chemical compound Cl.Cl.CCCCCCCC KIMVTSGNCBGHES-UHFFFAOYSA-N 0.000 description 1
- ZHVULPDNOFUIML-UHFFFAOYSA-N octane;hydrochloride Chemical compound Cl.CCCCCCCC ZHVULPDNOFUIML-UHFFFAOYSA-N 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000006201 parenteral dosage form Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- DNIAPMSPPWPWGF-UHFFFAOYSA-N propylene glycol Substances CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- DJXNJVFEFSWHLY-UHFFFAOYSA-N quinoline-3-carboxylic acid Chemical class C1=CC=CC2=CC(C(=O)O)=CN=C21 DJXNJVFEFSWHLY-UHFFFAOYSA-N 0.000 description 1
- 150000003248 quinolines Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- PVMKPXIEIWFYDX-UHFFFAOYSA-M sodium;2,3,4,5-tetrafluorobenzoate Chemical compound [Na+].[O-]C(=O)C1=CC(F)=C(F)C(F)=C1F PVMKPXIEIWFYDX-UHFFFAOYSA-M 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 229940031000 streptococcus pneumoniae Drugs 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000011345 viscous material Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
- C07D215/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3 with oxygen atoms in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D451/00—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof
- C07D451/02—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof
- C07D451/04—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof with hetero atoms directly attached in position 3 of the 8-azabicyclo [3.2.1] octane or in position 7 of the 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/08—Bridged systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/08—Bridged systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Food Preservation Except Freezing, Refrigeration, And Drying (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FI903556A FI88040C (fi) | 1984-04-16 | 1990-07-13 | Foerfarande foer framstaellning av terapeutiskt anvaendbara 10-diazabicycloalkyl-9-fluor-7-oxo-pyrido(1,2,3-de)-1,4-benzoxazin-6-karboxylsyraderivat |
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US60093484A | 1984-04-16 | 1984-04-16 | |
| US60093484 | 1984-04-16 | ||
| US06/708,565 US4571396A (en) | 1984-04-16 | 1985-03-11 | Antibacterial agents |
| US70856585 | 1985-03-11 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI851471A0 FI851471A0 (fi) | 1985-04-12 |
| FI851471L FI851471L (fi) | 1985-10-17 |
| FI83872B FI83872B (fi) | 1991-05-31 |
| FI83872C true FI83872C (fi) | 1991-12-30 |
Family
ID=27083756
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI851471A FI83872C (fi) | 1984-04-16 | 1985-04-12 | Foerfarande foer framstaellning av terapeutiskt anvaendbara 7-(diaza-eller azabicykloalkyl)-6-fluor-4-oxo-3 -kinolin- eller 1,8-naftyridin-3-karboxylsyror. |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4571396A (enExample) |
| EP (1) | EP0159174B1 (enExample) |
| JP (1) | JPH072739B2 (enExample) |
| KR (1) | KR900003494B1 (enExample) |
| AR (1) | AR240830A1 (enExample) |
| AU (1) | AU566984B2 (enExample) |
| CA (1) | CA1340695C (enExample) |
| DE (1) | DE3584463D1 (enExample) |
| DK (1) | DK172796B1 (enExample) |
| ES (1) | ES8607969A1 (enExample) |
| FI (1) | FI83872C (enExample) |
| GR (1) | GR850933B (enExample) |
| HU (2) | HU200445B (enExample) |
| IE (1) | IE57803B1 (enExample) |
| IL (1) | IL74882A (enExample) |
| NO (1) | NO162560C (enExample) |
| NZ (1) | NZ211796A (enExample) |
| OA (1) | OA07995A (enExample) |
| PH (1) | PH21385A (enExample) |
| PT (1) | PT80299B (enExample) |
Families Citing this family (64)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4822801A (en) * | 1984-07-20 | 1989-04-18 | Warner-Lambert Company | 4-oxo-1,4-dihydroquinoline-3-carboxylic acid derivative as antibacterial agents |
| US5097032A (en) * | 1984-07-20 | 1992-03-17 | Warner-Lambert Company | Antibacterial agents - II |
| IE58742B1 (en) * | 1984-07-20 | 1993-11-05 | Warner Lambert Co | Substituted-9-fluoro-3-methyl-7-oxo-2,3-dihydro-7h-pyrido[1,2,3-de] [1,4]benzoxauine-6-carboxylic acids; sibstituted-5-amino-6-6fluoro-4-oxo.1,4-dihydroquinoline-3 carboxylic acids; substituted-5-amino-6-fluoro-1,4-dihydro-4-oxo-1.8-naphthyridine-3-carboxylic acids; derivatives thereof; pharmaceutical compositions comprising the compounds; and processes for producing the compounds |
| DE3441788A1 (de) * | 1984-11-15 | 1986-05-15 | Bayer Ag, 5090 Leverkusen | Alkyl-1-cyclopropyl-1,4-dihydro-4-oxo-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| FR2574404B1 (fr) * | 1984-12-12 | 1987-04-24 | Provesan Sa | Derives 1-substitues de l'acide 6-fluoro-7-(pyrrol-1-yl)-1,4-dihydro-4-oxoquinoleine-3-carboxylique, leur preparation et leur application en tant que medicaments |
| DE3508816A1 (de) * | 1985-01-10 | 1986-07-10 | Bayer Ag, 5090 Leverkusen | 6,7-disubstituierte 1-cyclopropyl-1,4-dihydro-4-oxo-1,8-naphtyridin-3-carbonsaeuren |
| US4684648A (en) * | 1985-05-10 | 1987-08-04 | Otsuka Pharmaceutical Company Limited | Antimicrobial 1-substituted phenyl-4-oxoquinoline-3-carboxylic acid compounds and compositions thereof |
| DE3522405A1 (de) * | 1985-06-22 | 1987-01-02 | Bayer Ag | 1,8-verbrueckte 4-chinolon-3-carbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende arzneimittel und ihre verwendung zur herstellung von arzneimitteln |
| DE3522406A1 (de) * | 1985-06-22 | 1987-01-02 | Bayer Ag | Verfahren zur herstellung von 1,8-verbrueckten 4-chinolon-3-carbonsaeuren |
| JPH0635457B2 (ja) * | 1985-06-28 | 1994-05-11 | 杏林製薬株式会社 | ピリドンカルボン酸誘導体およびその製造方法 |
| IN166416B (enExample) * | 1985-09-18 | 1990-05-05 | Pfizer | |
| AU594983B2 (en) * | 1985-10-29 | 1990-03-22 | Dainippon Pharmaceutical Co. Ltd. | Novel quinoline derivatives and processes for preparation thereof |
| DE3601567A1 (de) * | 1986-01-21 | 1987-07-23 | Bayer Ag | 7-(azabicycloalkyl)-chinoloncarbonsaeure- und -naphthyridon-carbonsaeure-derivate |
| DE3606698A1 (de) * | 1986-03-01 | 1987-09-03 | Bayer Ag | 7-(1-pyrrolidinyl)-chinoloncarbonsaeure -derivate |
| US5153204A (en) * | 1986-03-01 | 1992-10-06 | Bayer Aktiengesellschaft | 7-(1-Pyrrolidinyl)-quinolonecarboxylic acid derivatives |
| JPS62215572A (ja) * | 1986-03-17 | 1987-09-22 | Kyorin Pharmaceut Co Ltd | キノロンカルボン酸誘導体 |
| EP0242789A3 (en) * | 1986-04-25 | 1990-09-05 | Dainippon Pharmaceutical Co., Ltd. | Novel quinoline derivates and processes for preparation thereof |
| US4777253A (en) * | 1986-04-25 | 1988-10-11 | Abbott Laboratories | Process for preparation of racemate and optically active ofloxacin and related derivatives |
| GB8612137D0 (en) * | 1986-05-19 | 1986-06-25 | Fujisawa Pharmaceutical Co | Quinolone compounds |
| ATE58538T1 (de) * | 1986-07-04 | 1990-12-15 | Chemie Linz Gmbh | 4-chinolon-3-carbonsaeurederivate, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische praeparate. |
| US4965273A (en) * | 1986-10-08 | 1990-10-23 | Bristol-Myers Company | Certain 1-tertiary-butyl-naphthyridone carboxylic acid derivatives anti-bacterial agents |
| NZ222047A (en) * | 1986-10-08 | 1991-01-29 | Bristol Myers Co | Quinoline - or naphthyridine - carboxylic acid anti-bacterial agents |
| ZA877471B (en) * | 1986-10-08 | 1988-04-05 | Bristol-Myers Company | 1-tertiary-alkyl-substituted naphthyridine-and quinoline-carboxylic acid antibacterial agents |
| DE3639465A1 (de) * | 1986-11-18 | 1988-05-19 | Hoechst Ag | Optisch aktive gyrasehemmer, ihre herstellung und verwendung als antibiotika |
| US5563138A (en) * | 1987-04-16 | 1996-10-08 | Otsuka Pharmaceutical Company, Limited | Benzoheterocyclic compounds |
| JP2640967B2 (ja) * | 1987-04-30 | 1997-08-13 | 大日本製薬株式会社 | キノロンカルボン酸誘導体およびその塩 |
| WO1989000158A1 (en) * | 1987-07-02 | 1989-01-12 | Pfizer Inc. | Bridged-diazabicycloalkyl quinolone carboxylic acids and esters |
| JPS6419069A (en) * | 1987-07-14 | 1989-01-23 | Dainippon Pharmaceutical Co | Production of polyhalogenoquinoline derivative |
| US4923879A (en) * | 1987-07-31 | 1990-05-08 | Warner-Lambert Company | 1,8-Naphthyridines and their use as antibacterial agents |
| US4992546A (en) * | 1987-07-31 | 1991-02-12 | Warner-Lambert Company | Process for preparing 6,8-diazabicyclo[3.2.2]nonane derivatives |
| US4968799A (en) * | 1987-07-31 | 1990-11-06 | Warner-Lambert Company | Antibacterial agents |
| US4962108A (en) * | 1987-07-31 | 1990-10-09 | Warner-Lambert Company | Antibacterial quinoline compounds |
| US4780468A (en) * | 1987-08-07 | 1988-10-25 | Warner-Lambert Company | 8-trifluoromethyl quinolones as antibacterial agents |
| US4851418A (en) * | 1987-08-21 | 1989-07-25 | Warner-Lambert Company | Naphthyridine antibacterial agents containing an α-amino acid in the side chain of the 7-substituent |
| US4929613A (en) * | 1987-08-26 | 1990-05-29 | Warner-Lambert Company | Antibacterial agents |
| US5075319A (en) * | 1987-09-08 | 1991-12-24 | Sterling Drug Inc. | Pyridinyl-quinolone compounds, their preparation and use |
| IT1222833B (it) * | 1987-10-06 | 1990-09-12 | Mediolanum Farmaceutici Srl | Derivati pirido benzotiazinici dotati di elevata attivita' antibatterica e di elevata biodisponibilita' tissutale |
| US4880814A (en) * | 1987-11-13 | 1989-11-14 | Abbott Laboratories | 7-cycloalkyl naphthyridines |
| WO1989005643A1 (en) * | 1987-12-18 | 1989-06-29 | Pfizer Inc. | Heterocyclic-substituted quinoline-carboxylic acids |
| US4920120A (en) | 1988-01-25 | 1990-04-24 | Warner-Lambert Company | Antibacterial agents |
| US5585491A (en) * | 1988-01-25 | 1996-12-17 | Otsuka Pharmaceutical Co., Ltd. | Antibacterial agents |
| JP2844079B2 (ja) * | 1988-05-23 | 1999-01-06 | 塩野義製薬株式会社 | ピリドンカルボン酸系抗菌剤 |
| DE3906365A1 (de) * | 1988-07-15 | 1990-01-18 | Bayer Ag | 7-(1-pyrrolidinyl)-3-chinolon- und -naphthyridoncarbonsaeure-derivate, verfahren sowie substituierte (oxa)diazabicyclooctane und -nonane als zwischenprodukte zu ihrer herstellung, und sie enthaltende antibakterielle mittel und futterzusatzstoffe |
| US5147873A (en) * | 1988-08-23 | 1992-09-15 | Pfizer Inc. | Amino-substituted bridged azabicyclic quinolone carboxylic acids and esters |
| WO1990002123A1 (en) * | 1988-08-23 | 1990-03-08 | Pfizer Inc. | Amino-substituted bridged azabicyclic quinolone carboxylic acids and esters |
| US4895943A (en) * | 1988-10-25 | 1990-01-23 | Pfizer Inc. | Preparation of 1,4-diazabicyclo(3.2.2)nonane |
| US5262417A (en) * | 1988-12-06 | 1993-11-16 | The Upjohn Company | Antibacterial quinolone compounds |
| US5036153A (en) * | 1989-05-11 | 1991-07-30 | Braish Tamim F | Preparation of 2,5-diazabicyclo[2.2.1]heptanes and intermediates |
| US5214051A (en) * | 1989-08-01 | 1993-05-25 | Pfizer Inc. | Thiazolyl and oxazolyl[5,4-c]piperidyl-substituted quinolone-carboxylic acid and related analogs thereof having antibacterial properties are disclosed |
| US5385913A (en) * | 1989-10-06 | 1995-01-31 | Pfizer Inc. | 1,4-dihydro-4-oxo-3-quinoline derivatives as selectively toxic mammalian antibacterial agents |
| FI921475A7 (fi) * | 1989-10-06 | 1992-04-03 | Pfizer | 1,4-dihydro-4-okso-3-kinoliinijohdannaisia selektiivisesti toksisina n isäkkään antibakteerisina aineina |
| DE69020694T2 (de) * | 1989-11-28 | 1996-01-18 | Syntex Inc | Tricyclische Verbindungen. |
| JP2514136B2 (ja) * | 1990-05-02 | 1996-07-10 | アボツト・ラボラトリーズ | キノリジノン型化合物 |
| US5308843A (en) * | 1990-09-11 | 1994-05-03 | Sterling Drug Inc. | Method of inhibiting mammalian topoisomerase II and malignant cell growth in mammals, with substituted (S)-3-methyl-7-oxo-2,3-dihydro-7H-pyrido[1,2,3-de][1,4 ]-benzoxazine(and-benzothiazine)-6-carboxylic acids |
| EP0641339B1 (en) * | 1991-06-19 | 1999-09-15 | Pfizer Inc. | Azaspiro quinolone antibacterial agents |
| US5527910A (en) * | 1992-12-30 | 1996-06-18 | Cheil Foods & Chemicals, Inc. | Pyridone carboxylic acid compounds and their uses for treating infectious diseases caused by bacteria |
| GB2291421A (en) * | 1994-07-16 | 1996-01-24 | Pfizer | A process for preparing a quinoline carboxylic acid |
| JPH08213881A (ja) * | 1995-02-02 | 1996-08-20 | Fujitsu Ltd | 周波数制御回路 |
| TW519542B (en) * | 1996-09-27 | 2003-02-01 | Daiichi Seiyaku Co | Bicyclic amine derivative |
| SE0003795D0 (sv) * | 2000-10-20 | 2000-10-20 | Astrazeneca Ab | Pharmaceutically useful compounds |
| MXPA05002621A (es) * | 2002-09-10 | 2005-05-05 | Pfizer Prod Inc | Compuestos diazabiciclos utiles en el tratamiento de transtornos del sistema nervioso central y otros trastornos. |
| CA2617532A1 (en) | 2005-08-04 | 2007-02-15 | Sirtris Pharmaceuticals, Inc. | Imidazo [2,1-b] thiazole derivatives as sirtuin modulating compounds |
| GB0713602D0 (en) * | 2007-07-12 | 2007-08-22 | Syngenta Participations Ag | Chemical compounds |
| DK2336125T3 (da) * | 2008-04-11 | 2013-04-08 | Janssen Pharmaceutica Nv | Thiazolopyridin-2-yloxy-phenyl- og thioazolopyrazin-2-yloxy-phenyl-aminer som modulatorer af leukotrien-A4-hydrolase |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3907808A (en) * | 1971-05-17 | 1975-09-23 | Sterling Drug Inc | 1,4-Dihydro-4-oxo-7-pyridyl-3-quinolinecarboxylic acid derivatives |
| US3753993A (en) * | 1971-05-17 | 1973-08-21 | Sterling Drug Inc | 1,4-dihydro-4-oxo-7-pyridyl-3-quinoline-carboxylic acid derivatives |
| JPS53141286A (en) * | 1977-05-16 | 1978-12-08 | Kyorin Seiyaku Kk | Novel substituted quinolinecarboxylic acid |
| US4292317A (en) * | 1977-09-20 | 1981-09-29 | Laboratorie Roger Bellon | 1,4-Dihydro-quinoline-3-carboxylic acid derivatives, process for their preparation and compositions containing them |
| AR223983A1 (es) * | 1978-08-25 | 1981-10-15 | Dainippon Pharmaceutical Co | Un procedimiento para-preparar derivados de acido 6-halogeno-4-oxo-7-(1-piperazinil)-1,8-naftiridin-3-carboxilico |
| JPS5845426B2 (ja) * | 1978-09-29 | 1983-10-08 | 杏林製薬株式会社 | 置換キノリンカルボン酸誘導体 |
| JPS5630964A (en) * | 1979-08-22 | 1981-03-28 | Kyorin Pharmaceut Co Ltd | Novel substituted quinolinecarboxylic acid and its preparation |
| JPS5649382A (en) * | 1979-09-28 | 1981-05-02 | Dainippon Pharmaceut Co Ltd | 6-fluoro-7-cyclic amino-1,8-naphthylidine derivative and its salt |
| JPS5746986A (en) * | 1980-09-02 | 1982-03-17 | Dai Ichi Seiyaku Co Ltd | Pyrido(1,2,3-de)(1,4)benzoxazine derivative |
| NO156828C (no) * | 1980-11-10 | 1987-12-02 | Otsuka Pharma Co Ltd | Analogifremgangsm te for fremstilling av antibakterielt virksomme benzoheterocykliske forbindelser. |
| JPS57149286A (en) * | 1981-03-13 | 1982-09-14 | Dai Ichi Seiyaku Co Ltd | 8-aminopyrido(1,2,3-de)(1,4)banzoxazine derivative |
| JPS57203085A (en) * | 1981-06-09 | 1982-12-13 | Dai Ichi Seiyaku Co Ltd | 1,8-cyclic substituted quinoline derivative |
| JPS5872589A (ja) * | 1981-10-28 | 1983-04-30 | Dai Ichi Seiyaku Co Ltd | ピリド〔1,2,3−de〕〔1,4〕ベンゾオキサジン誘導体 |
| JPS58109181A (ja) * | 1981-12-23 | 1983-06-29 | Akira Ito | 浮遊物回収装置 |
| JPS58225092A (ja) * | 1982-06-25 | 1983-12-27 | Dai Ichi Seiyaku Co Ltd | ピリド〔1,2,3−de〕〔1,4〕ベンゾオキサジン−6−カルボン酸誘導体 |
| IE55898B1 (en) * | 1982-09-09 | 1991-02-14 | Warner Lambert Co | Antibacterial agents |
-
1985
- 1985-03-11 US US06/708,565 patent/US4571396A/en not_active Expired - Lifetime
- 1985-03-20 IE IE715/85A patent/IE57803B1/en not_active IP Right Cessation
- 1985-03-25 CA CA000477394A patent/CA1340695C/en not_active Expired - Fee Related
- 1985-04-09 EP EP85302479A patent/EP0159174B1/en not_active Expired - Lifetime
- 1985-04-09 DE DE8585302479T patent/DE3584463D1/de not_active Expired - Fee Related
- 1985-04-09 AU AU40920/85A patent/AU566984B2/en not_active Ceased
- 1985-04-10 AR AR300026A patent/AR240830A1/es active
- 1985-04-11 IL IL74882A patent/IL74882A/xx unknown
- 1985-04-12 FI FI851471A patent/FI83872C/fi not_active IP Right Cessation
- 1985-04-15 DK DK198501696A patent/DK172796B1/da not_active IP Right Cessation
- 1985-04-15 NO NO851501A patent/NO162560C/no not_active IP Right Cessation
- 1985-04-15 PH PH32139A patent/PH21385A/en unknown
- 1985-04-15 HU HU851399A patent/HU200445B/hu not_active IP Right Cessation
- 1985-04-15 ES ES542239A patent/ES8607969A1/es not_active Expired
- 1985-04-15 JP JP60078623A patent/JPH072739B2/ja not_active Expired - Fee Related
- 1985-04-15 NZ NZ211796A patent/NZ211796A/en unknown
- 1985-04-15 HU HU90805A patent/HU201554B/hu not_active IP Right Cessation
- 1985-04-16 KR KR1019850002550A patent/KR900003494B1/ko not_active Expired
- 1985-04-16 GR GR850933A patent/GR850933B/el unknown
- 1985-04-16 OA OA58571A patent/OA07995A/xx unknown
- 1985-04-16 PT PT80299A patent/PT80299B/pt unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI83872C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara 7-(diaza-eller azabicykloalkyl)-6-fluor-4-oxo-3 -kinolin- eller 1,8-naftyridin-3-karboxylsyror. | |
| AU650316B2 (en) | Intermediates for preparing 7-(1-pyrrolidinyl) -3-quinolone- and -naphthyridone- carboxylic acid derivatives | |
| CZ667886A3 (en) | Substituted bridged diazabicycloalkyl quinolonecarboxylic acids, process of their preparation and pharmaceutical compositions in which they are contained | |
| EP0357047B1 (en) | Spiro compounds | |
| CS246065B2 (en) | Method of new 7-substituted cyclic aminonaphthyridine-,quinoline-and benzoxazinecarboxylic acids production | |
| FI113652B (fi) | Uusia kinoloni- tai naftyridonikarboksyylihappojohdannaisia tai niiden suola | |
| NO161370B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive kinolin- og naftyridin-derivater. | |
| JP2003048890A (ja) | キノロン−およびナフチリドン−カルボン酸誘導体類 | |
| PT95642A (pt) | Processo para a preparacao de compostos de quinolona e de composicoes farmaceuticas que os contem | |
| AU600188B2 (en) | Heterocyclic-substituted quinoline-carboxylic acids | |
| DK165635B (da) | 1-cyclopropyl-6-fluor-1,4-dihydro-4-oxo-1,8-naphthyridin-3-carboxy-derivater, farmaceutisk praeparat omfattende saadanne forbindelser, samt fremgangsmaade til fremstilling af forbindelserne | |
| JPS62169789A (ja) | 7−(アザビシクロアルキル)−キノロンカルボン酸及び−ナフチリドンカルボン酸誘導体 | |
| HU219581B (hu) | Új piridon-karbonsav-származékok, eljárás előállításukra, ezeket tartalmazó gyógyszerkészítmények, valamint intermedierek | |
| US4923879A (en) | 1,8-Naphthyridines and their use as antibacterial agents | |
| HU206702B (en) | Process for producing substituted azetidinyl-carboxylic acid derivatives and pharmaceutical compositions containing them | |
| JPH08225567A (ja) | キノロン−及びナフチリドンカルボン酸誘導体 | |
| US4962108A (en) | Antibacterial quinoline compounds | |
| US4968799A (en) | Antibacterial agents | |
| US4992546A (en) | Process for preparing 6,8-diazabicyclo[3.2.2]nonane derivatives | |
| JPH07300472A (ja) | 新規キノロンカルボン酸誘導体およびその製造方法 | |
| CA2443307C (en) | Quinolone- and naphthyridone-carboxylic acid derivatives | |
| IE19970856A1 (en) | 7-(1-Pyrrolidinyl)-3-quinolone and naphthyridone carboxylic acid derivatives, method for their preparation and for substituted mono- and bicyclic pyrrolidine intermediates, and their antibacterial and feed additive compositions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FG | Patent granted |
Owner name: WARNER-LAMBERT COMPANY |
|
| MA | Patent expired |