FI66818B - Framstaellning av klordioxid - Google Patents
Framstaellning av klordioxid Download PDFInfo
- Publication number
- FI66818B FI66818B FI770852A FI770852A FI66818B FI 66818 B FI66818 B FI 66818B FI 770852 A FI770852 A FI 770852A FI 770852 A FI770852 A FI 770852A FI 66818 B FI66818 B FI 66818B
- Authority
- FI
- Finland
- Prior art keywords
- chlorine dioxide
- chlorate
- reaction medium
- sodium
- acid
- Prior art date
Links
- OSVXSBDYLRYLIG-UHFFFAOYSA-N dioxidochlorine(.) Chemical compound O=Cl=O OSVXSBDYLRYLIG-UHFFFAOYSA-N 0.000 description 54
- 239000004155 Chlorine dioxide Substances 0.000 description 27
- 235000019398 chlorine dioxide Nutrition 0.000 description 27
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 19
- 238000006243 chemical reaction Methods 0.000 description 15
- 239000012429 reaction media Substances 0.000 description 15
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 description 14
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 13
- 239000002253 acid Substances 0.000 description 13
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 description 9
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 8
- 238000000034 method Methods 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 4
- 238000009621 Solvay process Methods 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- -1 chlorate cation Chemical class 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 2
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 2
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 150000001450 anions Chemical group 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000012431 aqueous reaction media Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical class OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- IYGFDEZBVCNBRU-UHFFFAOYSA-L disodium sulfuric acid sulfate Chemical compound [H+].[H+].[H+].[H+].[Na+].[Na+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O IYGFDEZBVCNBRU-UHFFFAOYSA-L 0.000 description 1
- 238000004868 gas analysis Methods 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B11/00—Oxides or oxyacids of halogens; Salts thereof
- C01B11/02—Oxides of chlorine
- C01B11/022—Chlorine dioxide (ClO2)
- C01B11/023—Preparation from chlorites or chlorates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Life Sciences & Earth Sciences (AREA)
- Geology (AREA)
- Inorganic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Description
155^1 M fluKUULUTUSjULKAISU .
LJ ' ' utlAcgningsskript 66 oi o C (45) Γ'.'t-.r.:'1 syö ί'y :j 12 1QS4 ^ ^ (SI) K*.*i/tatCL^ C 01 B 11/02 SUOMI —FINLAND φ) — 770852 (22) HilcmHpMvt — Amaknlm«dt| 17.03.77 (23) AMmpeht—Glldglwtt*s 17.03.77 (41) Talkit hilklMktl —MivM offandlg 20 09 77 Γ—*· 1« "Μ-1**· (44) NMMUimm ). ItMtJrilalMa pm. —
Patani och reghterstyrelMii ' 7 AmOkanutiagdoch«UM*·*poMkärarf 31.08.84 (32)(33)(31) Pyr*«*y «aoMm» Betfrt prtartut ig.03.76 07.05.76 Englanti-England(GB) 11123, 18783 (71) Erco Industries Limited, 2, Gibbs Road, Islington, Ontario, Kanada(CA) (72) Richard Swindells, Caledon, Ontario, Maurice C.J. Fredette, Mississauga, Ontario, Kanada(CA) (7^) Oy Koi ster Ab (5*0 Klooridioksidin valmistus - Framställning av klordioxid
Esillä olevan keksinnön kohteena on menetelmä klooridioksidin valmistamiseksi pelkistämällä kloraattia metanolilla happamassa vesipitoisessa reaktio-väliaineessa, jossa on rikkihappoa kokonaishapponormaalisuuden ollessa ainakin 9, yksikammioisessa reaktioastiässä.
Menetelmälle on tunnusomaista, että reaktioväliaine pidetään kiehumispisteessään alipaineessa ja kyllästetään kloraatin kationin sulfaattisuolalla, joka suola erottuu kiinteässä muodossa.
US-patenttijulkaisussa 2 881 052 on kuvattu klooridioksidien valmistusta pelkistämällä hapanta kloraattivesiliuosta metanolilla. Reaktio on kuitenkin varsin hidas vaatien paljon aikaa ja peräkkäisiä reaktoreita ja lisäksi muodostuu paljon rikkihappoa, reagoimatonta natriumkloraattia ja natriumsulfaattisivutuo-tetta sisältävää päästenestettä. Kloraatin klooridioksidiksi muuttumisen hyötysuhde on varsin pieni eikä yleensä ole yli n. 90%. Tavallisesti reaktioväli-aineeseen puhalletaan ilmaa klooridioksidin laimentamiseksi.
Tämän alan aikaisemman menetelmän, joka yleisesti tunnetaan "Solvay"-menetelmänä, kokonaisreaktio voidaan esittää yhtälöllä 2 NaClO. + 2 IkSO, + CH„0H--> 2 C10„ + 2 NaHSO. + HCHO + 2 Ho0 (1).
3 2 A 3 2 4 L
2 6681 8
On yllättäen havaittu, että Solvay- menetelmän hyötysuhdetta voidaan huomattav asti parantaa käyttämällä suurta kokonaishapponormaalisuutta ja toteuttamalla menetelmä alla yksityiskohtaisesti kuvatussa, yksikammioisessa kehitinhaihdutin-kiteytinastiässä.
On havaittu, että muutettaessa tässä keksinnössä kloraattia kloori-dioksidiksi metanolin käytön hyötysuhde ylittää usein 100%, mikä osoittaa, että metanolin hapetustuotteet formaldehydi ja muurahaishappo esittävät myös osaa tämän keksinnön mukaisessa tehokkaassa klooridioksidin valmistuksessa.
Tässä keksinnössä voidaan käyttää formaldehydia, muurahaishappoa ja muita natriumkloraatin orgaanisia pelkistimiä.
Käsiteltävänä olevan keksinnön yksikammioisessa kehitin—haihdutin— kiteytinastiassa klooridioksidia synnytetään jatkuvatoimisesti reaktioastiassa olevasta reaktioväliaineesta, joka pidetään kiehumapisteessään ko. absoluuttisessa paineessa ja lämpötilassa, joka alittaa klooridioksidin pääasiallisen hajoamis lämpötilan. Reaktioastia pidetään alipaineessa reaktioväliaineen pitämiseksi kiehumapisteessään ja siitä haihtuva vesi käytetään klooridioksidin lai-mennuskaasuna. Käynnistymisen jälkeen kloraatin kationi ja syöttöhapon anioni muodostavat sivutuotehapposuolan, jonka väkevyys kasvaa reaktioväliaineen kyllästymiseen saakka. Tämän jälkeen suola saostuu reaktioastiassa reaktio-väliaineesta ja poistetaan.
Yleensä menetelmä suoritetaan vakio-olosuhteissa, jolloin reaktioastiaan reagenssien mukana lisätty vesi tasapainotetaan reaktioastiasta poistuvalla, lähinnä klooridioksidin laimennuskaasuna toimivalla vedellä. Siten veden taso reaktioastiassa säilyy lähes muuttumattomana.
Tässä keksinnössä reaktioväliaineeseen syötetään kloraattisuolaa, edullisesti natriumkloraattia, rikkihappoa ja metanolia.
Reaktioväliaine on erittäin hapan. Tavallisesti ilmaisulla "happamuus" tarkoitetaan kokonaishappamuutta, joka määritetään titraamalla tunnetun väke-vyisellä natriumhydroksidiliuoksella ennalta määrättyyn pH-loppupisteeseen. Happamuus ilmoitetaan normaalisuutensa, so. vedyn gramma-atomien ekvivalentti-määränä liuos litraa kohti vastaten tiirattua arvoa. Sitä voidaan kutsua "koko-naishapponormaalisuudeksi" ja tässä sillä tarkoitetaan happamuutta ensiksi mainitussa mielessä.
Käsiteltävänä olevassa keksinnössä käytetyn reaktioväliaineen kokonais-happonormaalisuus on suuri eli yli noin 9. Toimittaessa ilman tarkoituksellisesti lisättyjä kloridi-ioneja on havaittu, että rikkihapon kokonaisnormaali-suuden kasvaessa natriumkloraatin klooridioksidiksi muuttumisen hyötysuhde kasvaa.
3 6681 8
Lisäksi havaittiin, että vakio-olosuhteissa reaktioväliaineessa voitiin todeta vaihtelevia määriä natriumkloridia, jotka vähenivät tuntuvasti kokonais-happonortnaalisuuden kasvaessa.
Yllä olevan reaktion (1) mukaisen natriumkloraatin klooridioksidiksi muuttumisen hyötysuhde saattaa kasvaa hyvin suureksi, tavallisesti 99-100%:ksi ja siten se on huomattavasti suurempi kuin tavanomaisessa Solvay-menetelmässä.
Muodostuneen klooridioksidin puhtaus kloorin suhteen kasvaa kokonais-happonormaalisuuden kasvaessa. Tämä osoittaa, että kokonaishapponormaalisuuden kasvaessa reaktio pyrkii yhä enemmän noudattamaan yhtälöä (1).
Tässä keksinnössä sivutuotteena reaktioastiassa reaktioväliaineesta saostuva natriumsulfaatti on natriumbisulfaatin (NaHSO^) tai natriumseskvisulfaatin (Na„H(SO,)„) muodossa.
Tämän natriumsulfaatin happamuuden hyödyntämiseksi se voidaan lisätä toisen klooridioksidia tuottavan menetelmän reaktioväliaineeseen, jossa natrium-kloraatti ja natriumkloridi ja/tai suolahappo reagoivat happamassa vesiväliai-neessa kokonaishapponormaalisuuden ollessa alle noin 4,8. Tällöin hapan natrium-sulfaatti tarjoaa kaiken tai osan klooridioksidin valmistusmenetelmän tarvitsemasta haposta. Tällainen klooridioksidin kaksoisvalmistusmenetelmä on kuvattu yksityiskohtaisesti US-patenttijulkaisussa 3 789 108.
Käsiteltävänä olevan keksinnön mukaisen Solvay-menetelmän hyötysuhteen paranemisen lisäksi ei tarvitse käsitellä rikkihappoa, natriumsulfaattia ja hieman natriumkloraattia sisältävää ylivuotonestettä eikä tarvita laimennuskaasun ulkoista Lähdettä kuten tavanomaisessa Solvay-menetelmässä.
Seuraava esimerkki selventää keksintöä.
ESIMERKKI 1
Klooridioksidikehitintä käytettiin erilaisissa olosuhteissa ja kaikissa tapauksissa määritettiin klooridioksidituoton hyötysuhde ja klooridioksidin puhtaus. Kaikissa tapauksissa kehittimen ainoat syötöt olivat natriumkloraatti-liuos, rikkihappo ja metanoli, reaktioväliaine pidettiin kiehumapisteessään alipaineessa ja natriumbisulfaattia saostui siitä.
Suoritettiin kolme erillisajoa ja olosuhteet ja tulokset ilmenevät alla olevasta taulukosta.
Taulukko 66 81 8 4 ▲jo n*o 1 2 5
Lämpötila 64°C 66°C 74 °C
Paine 114 Hg 106 n Eg 155 ra Hg
Ne·teiden syöttönopoudott CH3OH 100 t 5,1 nl/nin 55 t 5,8 nl/nln 55 * 5,4 nl/nin H2S04 18-n 2,9 nl/nin 9-. 7,0 nl/nln 9-» 5,6 nl/nln
HaClO^ 1,8-n 19,1 nl/nin 1,8-» 58,7 nl/nin 6,74-· 10,5 nl/nln
Kohltlnneateet t H2S04 4,40-n 8,04-n 9,5-n
HaClOj 1,56-* 0,87-n 1,1-n
HaClX 0,59-» 0,04-n 0,005-»
Kiteitä 60 + Ia2S04 Ha5H(S04)2 Ι»5Η(804)2 40 i IaIB04
Klooridiokeidin tuotto 0,21 g/l/nin 0,56 g/l/nin 0,48 g/l/min
Kaasuanalyysi 84 ^ C102 88 ^ ClOg yli 99 i» C102 16 1» Cl2 12 + Cl2 alle 1* Cl2
Hyötysuhde kloraatiata laskettuna 87,7 t 78 * yli 99 *
Hyötysuhde netanolista laskettuna 14 £ 87 * 127 £
Tarvittava syöttö/kg
tuotettua klooridloksidla 1,72 0,28 0,19 kg CH^OH
xNatriumkloridia ei lisätty tarkoituksellisesti, natriumkloraatti-syötössä on epäpuhtautena n. 0,0014 kg NaCl/kg NaClO^.
Il 5 6681 8
Yllä olmn taulukon tuloksitta ilmenee, että reaktioväliaineen kokonais-happoaoruaallauudoB kasvaessa klooridioksidin tuottonopsus kasvaa, kloori-dioksidin puhtaus kasvaa, roaktioväliainssssa olsvan natriumkloridin nftärä vähänsä ja klooridioksidituoton hyötysuhde kulutetusta kloraatista laskettuna kasvaa.
tyypillisen klooridioksidin Solvay-valmistususnetelmän hyötysuhde laskettuna kloMtatin anuttuuisosta klooridioksidiksi on n. 89 ^ netanolitarpeen ollessa 0,091 kg netanolia/kg tuotettua klooridioksidia. Ylläolevista tuloksista iluonos, että toiuittaessa ajon nio 3 olosuhteissa, so. happonor-maalisuuden ollessa yli n. 9 saavutetaan hyötysuhteen tuntuva kasvu*
Siten käsiteltävänä oleva keksintö tarjoaa huoaattavia parannuksia klooridioksidin aikaisempaan Solvay-j»valnistusneneteinään verrattuna.
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1112376 | 1976-03-19 | ||
| GB1112376 | 1976-03-19 | ||
| GB1878376 | 1976-05-07 | ||
| GB1878376 | 1976-05-07 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI770852A7 FI770852A7 (fi) | 1977-09-20 |
| FI66818B true FI66818B (fi) | 1984-08-31 |
| FI66818C FI66818C (fi) | 1984-12-10 |
Family
ID=26248076
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI770851A FI66817C (fi) | 1976-03-19 | 1977-03-17 | Foerfarande foer framstaellning av klordioxid |
| FI770852A FI66818C (fi) | 1976-03-19 | 1977-03-17 | Framstaellning av klordioxid |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI770851A FI66817C (fi) | 1976-03-19 | 1977-03-17 | Foerfarande foer framstaellning av klordioxid |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4081520A (fi) |
| JP (2) | JPS52114493A (fi) |
| AR (1) | AR214879A1 (fi) |
| AT (1) | AT394706B (fi) |
| BR (2) | BR7701679A (fi) |
| CA (3) | CA1080433A (fi) |
| ES (1) | ES457003A1 (fi) |
| FI (2) | FI66817C (fi) |
| FR (1) | FR2344497A1 (fi) |
| NZ (1) | NZ183623A (fi) |
| SE (2) | SE452878B (fi) |
Families Citing this family (67)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4325934A (en) * | 1980-09-22 | 1982-04-20 | Erco Industries Limited | Production of chlorine dioxide with conversion of by-product solid phase sodium acid sulphate to its neutral form |
| US4362707A (en) * | 1981-04-23 | 1982-12-07 | Diamond Shamrock Corporation | Preparation of chlorine dioxide with platinum group metal oxide catalysts |
| CA1181224A (en) * | 1983-06-10 | 1985-01-22 | Erco Industries Limited | High efficiency chlorine dioxide process |
| DE3478104D1 (en) * | 1983-06-10 | 1989-06-15 | Tenneco Canada Inc | Process for the production of chlorine dioxide |
| US4465658A (en) * | 1983-06-13 | 1984-08-14 | Erco Industries Limited | Chlorine dioxide process |
| US4578261A (en) * | 1983-07-01 | 1986-03-25 | Multifibre Process Limited | Method to reduce the potential salt cake content of chlorine dioxide generator spent acids |
| US4486399A (en) * | 1983-07-01 | 1984-12-04 | Multifibre Process Limited | Method to reduce the potential salt cake content of chlorine dioxide generator spent acids |
| US4473540A (en) * | 1983-07-07 | 1984-09-25 | Erco Industries Limited | High efficiency chlorine dioxide process |
| US4627969A (en) * | 1984-09-05 | 1986-12-09 | Tenneco Canada Inc. | Production of chlorine dioxide |
| SE460046B (sv) * | 1987-03-27 | 1989-09-04 | Eka Nobel Ab | Foerfarande foer framstaellning av klordioxid |
| US4839152A (en) * | 1988-03-25 | 1989-06-13 | Olin Corporation | Process for producing an aqueous solution containing chlorine dioxide and chlorine |
| US4886653A (en) * | 1988-03-25 | 1989-12-12 | Olin Corporation | Process and apparatus for producing an aqueous solution containing chlorine dioxide and chlorine |
| SE463669B (sv) * | 1988-06-17 | 1991-01-07 | Eka Nobel Ab | Foerfarande foer framstaellning av klordioxid |
| US5066477A (en) * | 1988-08-10 | 1991-11-19 | Tenneco Canada Inc. | Production of chlorine dioxide |
| SE463670B (sv) * | 1988-10-11 | 1991-01-07 | Eka Nobel Ab | Foerfarande foer framstaellning av klordioxid |
| SE464193B (sv) * | 1988-10-20 | 1991-03-18 | Eka Nobel Ab | Foerfarande foer framstaellning av klordioxid |
| SE463671B (sv) * | 1988-10-25 | 1991-01-07 | Eka Nobel Ab | Foerfarande foer framstaellning av klordioxid |
| SE8804251D0 (sv) * | 1988-11-24 | 1988-11-24 | Alby Klorat Ab | Saett att framstaella klordioxid |
| JPH02121091U (fi) * | 1989-03-17 | 1990-10-01 | ||
| SE465569B (sv) * | 1989-04-18 | 1991-09-30 | Eka Nobel Ab | Foerfarande foer framstaellning av klordioxid |
| CA1338503C (en) * | 1989-09-29 | 1996-08-06 | Russell Ian Derrah | Chlorine dioxide generation |
| JPH0385091U (fi) * | 1989-12-19 | 1991-08-28 | ||
| US5322598A (en) * | 1990-02-06 | 1994-06-21 | Olin Corporation | Chlorine dioxide generation using inert load of sodium perchlorate |
| US5770171A (en) * | 1990-03-05 | 1998-06-23 | Eka Nobel Inc. | Process for production of chlorine dioxide |
| CA2023452C (en) * | 1990-03-05 | 1994-05-24 | Birgitta Sundblad | Process for production of chlorine dioxide |
| EP0532535B2 (en) * | 1990-06-07 | 2003-07-09 | Sterling Canada, Inc. | Electrochemical production of acid chlorate solutions |
| US5198080A (en) * | 1990-06-08 | 1993-03-30 | Tenneco Canada Inc. | Electrochemical processing of aqueous solutions |
| US5122240A (en) * | 1990-06-08 | 1992-06-16 | Tenneco Canada Inc. | Electrochemical processing of aqueous solutions |
| CA2019389A1 (en) * | 1990-06-20 | 1991-12-20 | Maurice C.J. Fredette | Methanol-based chlorine dioxide process |
| SE9002262D0 (sv) * | 1990-06-27 | 1990-06-27 | Eka Nobel Ab | Foerfarande foer framstaellning av klorioxid |
| CA2023733C (en) * | 1990-08-21 | 1998-04-14 | Marek Lipsztajn | Chlorine dioxide generation from chloric acid |
| US5284553A (en) * | 1990-08-22 | 1994-02-08 | Sterling Canada, Inc. | Chlorine dioxide generation from chloric acid |
| SE500043C2 (sv) * | 1990-08-31 | 1994-03-28 | Eka Nobel Ab | Förfarande för kontinuerlig framställning av klordioxid |
| SE500042C2 (sv) * | 1990-08-31 | 1994-03-28 | Eka Nobel Ab | Förfarande för kontinuerlig framställning av klordioxid |
| US5205995A (en) * | 1991-04-22 | 1993-04-27 | Sterling Canada Inc. | Metathesis of acidic by-product of chlorine dioxide generating apparatus |
| US5116595A (en) * | 1991-04-22 | 1992-05-26 | Tenneco Canada Inc. | Metathesis of acidic by-product of chlorine dioxide generating process |
| US5707546A (en) * | 1991-06-17 | 1998-01-13 | Rio Linda Chemical Co., Inc. | Generation and storage of chlorine dioxide in a non-aqueous medium |
| SE500107C2 (sv) * | 1991-06-26 | 1994-04-18 | Eka Nobel Ab | Förfarande för framställning av klordioxid |
| US5277768A (en) * | 1992-04-03 | 1994-01-11 | Sterling Canada, Inc. | Membrane cell washing |
| AU5586394A (en) | 1992-11-09 | 1994-06-08 | Sterling Canada, Inc. | Metathesis of acidic by-product of chlorine dioxide generating process |
| US5376350A (en) * | 1992-12-10 | 1994-12-27 | Eka Nobel Ab | Plug flow process for the production of chlorine dioxide |
| US5487881A (en) * | 1993-02-26 | 1996-01-30 | Eka Nobel Inc. | Process of producing chlorine dioxide |
| US5380517B1 (en) * | 1993-02-26 | 1999-01-19 | Eka Nobel Inc | Process for continuously producing chlorine dioxide |
| US5478446A (en) * | 1993-07-02 | 1995-12-26 | Eka Nobel Inc. | Electrochemical process |
| SE501684C2 (sv) * | 1993-10-07 | 1995-04-24 | Eka Nobel Ab | Förfarande och anordning att framställa klorsyra |
| US5399332A (en) * | 1993-10-20 | 1995-03-21 | Sterling Canada, Inc. | Dynamic leaching procedure for metathesis |
| US6585950B1 (en) * | 1995-06-07 | 2003-07-01 | Eka Nobel Ab | Method of producing chlorine dioxide |
| SE9502077L (sv) * | 1995-06-07 | 1996-08-22 | Eka Chemicals Ab | Sätt att framställa klordioxid |
| US5676920A (en) * | 1996-08-20 | 1997-10-14 | Sterling Canada, Inc. | Chlorine dioxide generating process |
| US5792441A (en) * | 1996-10-11 | 1998-08-11 | Pulp And Paper Research Institute Of Canada | Fixed-resin bed technologies for the treatment of the chlorine dioxide generator effluent and feeds stream |
| CA2242685C (en) * | 1997-08-01 | 2004-09-28 | Sterling Canada, Inc. | Nitric acid based chlorine dioxide generation process |
| CA2273667C (en) * | 1998-06-09 | 2009-03-17 | Sterling Canada, Inc. | High purity alkali metal chlorite and method of manufacture |
| US6322768B1 (en) | 1998-09-29 | 2001-11-27 | International Paper Company | Recovery of chlorine dioxide from gas streams |
| NZ520939A (en) * | 2000-03-17 | 2004-07-30 | Superior Plus Inc | Advanced control strategies for chlorine dioxide generating processes |
| US20030138371A1 (en) * | 2002-01-18 | 2003-07-24 | Cdg Technology, Inc. | Method and apparatus for generating gaseous chlorine dioxide-chlorine mixtures |
| JP2007537969A (ja) * | 2004-05-17 | 2007-12-27 | ジョン・ワイ・メイソン | 二酸化塩素を用いて処理する方法 |
| CN100339309C (zh) * | 2005-08-11 | 2007-09-26 | 上海交通大学 | 无机类富勒烯结构二硫化钼的制备方法 |
| MX2011013588A (es) * | 2009-06-16 | 2012-03-16 | Akzo Nobel Nv | Proceso para la produccion de dioxido de cloro. |
| UY32927A (es) | 2009-10-12 | 2011-03-31 | Akzo Nobel Chemicals Int Bv | Proceso para la producción de dióxido de cloro |
| FI122623B (fi) | 2009-10-30 | 2012-04-30 | Kemira Oyj | Menetelmä klooridioksidin valmistamiseksi |
| JP5902400B2 (ja) | 2011-04-26 | 2016-04-13 | トヨタ自動車株式会社 | レーザ溶接装置、レーザ溶接方法、鋼板積層体の製造方法及び積層体のレーザ溶接による溶接構造 |
| US9517934B2 (en) | 2013-03-14 | 2016-12-13 | The United States Of America As Represented By The Secretary Of The Army | Process for the generation of chlorine dioxide |
| US9238587B2 (en) | 2013-03-15 | 2016-01-19 | Sabre Intellectual Property Holdings Llc | Method and system for the treatment of water and fluids with chlorine dioxide |
| US10442711B2 (en) | 2013-03-15 | 2019-10-15 | Sabre Intellectual Property Holdings Llc | Method and system for the treatment of produced water and fluids with chlorine dioxide for reuse |
| US9567216B2 (en) | 2014-02-12 | 2017-02-14 | Chemtreat, Inc. | Reducing agents for producing chlorine dioxide |
| FI129150B (fi) * | 2017-09-25 | 2021-08-13 | Andritz Oy | Menetelmä kemikaalitasapainon optimoimiseksi sellutehtaalla |
| US10626016B2 (en) | 2017-11-27 | 2020-04-21 | Brandeis University | Method and composition of humidity-controlled generation of chlorine dioxide in polymers and superabsorbent hydrogels |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE378289C (de) * | 1922-01-19 | 1923-07-09 | Koeln Rottweil Akt Ges | Verfahren zur Herstellung von Chlordioxyd |
| US2605168A (en) * | 1948-06-10 | 1952-07-29 | Degussa | Process for the preparation of chlorine dioxide |
| US2881052A (en) * | 1953-06-08 | 1959-04-07 | Allied Chem | Production of chlorine dioxide |
| US3933987A (en) * | 1966-10-24 | 1976-01-20 | Hooker Chemicals & Plastics Corporation | Simultaneous production of chlorine dioxide and a salt of a strong acid |
| US3933988A (en) * | 1966-10-24 | 1976-01-20 | Hooker Chemicals & Plastics Corporation | Method of simultaneously producing chlorine dioxide and a sulfate salt |
| JPS4859095A (fi) * | 1971-11-22 | 1973-08-18 |
-
1977
- 1977-02-21 CA CA272,176A patent/CA1080433A/en not_active Expired
- 1977-02-21 CA CA272,251A patent/CA1080434A/en not_active Expired
- 1977-02-21 CA CA272,252A patent/CA1079931A/en not_active Expired
- 1977-02-22 US US05/770,360 patent/US4081520A/en not_active Expired - Lifetime
- 1977-03-16 NZ NZ183623A patent/NZ183623A/xx unknown
- 1977-03-17 FI FI770851A patent/FI66817C/fi not_active IP Right Cessation
- 1977-03-17 FI FI770852A patent/FI66818C/fi not_active IP Right Cessation
- 1977-03-18 SE SE7703151A patent/SE452878B/xx not_active IP Right Cessation
- 1977-03-18 SE SE7703152A patent/SE439916B/xx not_active IP Right Cessation
- 1977-03-18 ES ES457003A patent/ES457003A1/es not_active Expired
- 1977-03-18 JP JP2936677A patent/JPS52114493A/ja active Granted
- 1977-03-18 AR AR266909A patent/AR214879A1/es active
- 1977-03-18 FR FR7708302A patent/FR2344497A1/fr active Granted
- 1977-03-18 BR BR7701679A patent/BR7701679A/pt unknown
- 1977-03-18 JP JP52029365A patent/JPS6055441B2/ja not_active Expired
- 1977-03-21 BR BR7701734A patent/BR7701734A/pt unknown
- 1977-03-21 AT AT0196177A patent/AT394706B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FI66817B (fi) | 1984-08-31 |
| FI66817C (fi) | 1984-12-10 |
| FR2344497A1 (fr) | 1977-10-14 |
| SE7703152L (sv) | 1977-09-20 |
| AR214879A1 (es) | 1979-08-15 |
| CA1079931A (en) | 1980-06-24 |
| JPS6055441B2 (ja) | 1985-12-05 |
| NZ183623A (en) | 1979-07-11 |
| JPS52114493A (en) | 1977-09-26 |
| AT394706B (de) | 1992-06-10 |
| SE439916B (sv) | 1985-07-08 |
| FI770851A7 (fi) | 1977-09-20 |
| FI66818C (fi) | 1984-12-10 |
| CA1080433A (en) | 1980-07-01 |
| JPS52114492A (en) | 1977-09-26 |
| US4081520A (en) | 1978-03-28 |
| SE452878B (sv) | 1987-12-21 |
| FI770852A7 (fi) | 1977-09-20 |
| BR7701679A (pt) | 1978-01-24 |
| SE7703151L (sv) | 1977-09-20 |
| JPS6256082B2 (fi) | 1987-11-24 |
| ES457003A1 (es) | 1978-01-16 |
| FR2344497B1 (fi) | 1978-11-03 |
| CA1080434A (en) | 1980-07-01 |
| BR7701734A (pt) | 1978-01-24 |
| ATA196177A (de) | 1991-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI66818B (fi) | Framstaellning av klordioxid | |
| FI107911B (fi) | Menetelmä klooridioksidin valmistamiseksi | |
| FI107910B (fi) | Menetelmä klooridioksidin valmistamiseksi | |
| FI112353B (fi) | Menetelmä kooridioksidin valmistamiseksi jatkuvatoimisesti | |
| JP2819065B2 (ja) | 二酸化塩素の製造方法 | |
| US4292292A (en) | Chlorine dioxide generation process | |
| FI81555C (fi) | Framstaellning av klordioxid. | |
| FI94950B (fi) | Menetelmä klooridioksidin valmistamiseksi | |
| SE448864B (sv) | Sett att framstella en vattenlosning lemplig for framstellning av klordioxid och samtidig reducering av klorinnehallet i en gasformig klordioxidstrom | |
| FI112352B (fi) | Menetelmä klooridioksidin valmistamiseksi | |
| US4145401A (en) | High efficiency chlorine dioxide production at low acidity with methanol addition | |
| FI108536B (fi) | Menetelmä klooridioksidin valmistamiseksi eri pelkistimien yhteiskäytöllä | |
| SU1114331A3 (ru) | Способ получени диоксида хлора | |
| US6251357B1 (en) | High purity alkali metal chlorite and method of manufacture | |
| KR890002542B1 (ko) | 안정화된 이산화염소의 제조방법 | |
| EP0131378A1 (en) | Process for the production of chlorine dioxide | |
| NO309519B1 (no) | Fremgangsmåte for fremstilling av klordioksid | |
| CS207601B2 (cs) | Způsob výroby kysličníku chloričitého | |
| JPH0312306A (ja) | 高純度の二酸化塩素を製造する方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MA | Patent expired | ||
| MA | Patent expired |
Owner name: STERLING CANADA,_INC. |