FI60709C - Analogifoerfarande foer framstaellning av 9-substituerade puriner anvaendbara saosom antivirala medel - Google Patents
Analogifoerfarande foer framstaellning av 9-substituerade puriner anvaendbara saosom antivirala medel Download PDFInfo
- Publication number
- FI60709C FI60709C FI752465A FI752465A FI60709C FI 60709 C FI60709 C FI 60709C FI 752465 A FI752465 A FI 752465A FI 752465 A FI752465 A FI 752465A FI 60709 C FI60709 C FI 60709C
- Authority
- FI
- Finland
- Prior art keywords
- amino
- formula
- hydroxy
- compound
- hydrogen
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 60
- 238000000034 method Methods 0.000 claims description 41
- -1 9-substituted purines Chemical class 0.000 claims description 37
- 239000000203 mixture Substances 0.000 claims description 35
- 229910052739 hydrogen Inorganic materials 0.000 claims description 28
- 239000001257 hydrogen Chemical group 0.000 claims description 26
- 150000003839 salts Chemical class 0.000 claims description 21
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 19
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 17
- 229910052736 halogen Inorganic materials 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 150000002431 hydrogen Chemical group 0.000 claims description 12
- 150000002367 halogens Chemical group 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 125000002252 acyl group Chemical group 0.000 claims description 10
- 150000001540 azides Chemical class 0.000 claims description 10
- 230000007062 hydrolysis Effects 0.000 claims description 10
- 238000006460 hydrolysis reaction Methods 0.000 claims description 10
- 125000006239 protecting group Chemical group 0.000 claims description 9
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 8
- 239000001301 oxygen Chemical group 0.000 claims description 8
- 229910052760 oxygen Chemical group 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 7
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 230000000840 anti-viral effect Effects 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 230000009467 reduction Effects 0.000 claims description 5
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 230000026030 halogenation Effects 0.000 claims description 4
- 238000005658 halogenation reaction Methods 0.000 claims description 4
- 150000007524 organic acids Chemical class 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 238000006467 substitution reaction Methods 0.000 claims description 4
- 238000006177 thiolation reaction Methods 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 238000006136 alcoholysis reaction Methods 0.000 claims description 3
- 230000029936 alkylation Effects 0.000 claims description 3
- 238000005804 alkylation reaction Methods 0.000 claims description 3
- 238000007098 aminolysis reaction Methods 0.000 claims description 3
- 125000005002 aryl methyl group Chemical group 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 3
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 3
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 claims description 3
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims description 3
- 150000007522 mineralic acids Chemical group 0.000 claims description 3
- 230000003647 oxidation Effects 0.000 claims description 3
- 238000007254 oxidation reaction Methods 0.000 claims description 3
- 238000006722 reduction reaction Methods 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- QDHHCQZDFGDHMP-UHFFFAOYSA-N Chloramine Chemical compound ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 claims description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 2
- 239000003443 antiviral agent Substances 0.000 claims description 2
- ICCBZGUDUOMNOF-UHFFFAOYSA-N azidoamine Chemical compound NN=[N+]=[N-] ICCBZGUDUOMNOF-UHFFFAOYSA-N 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 claims description 2
- 238000003797 solvolysis reaction Methods 0.000 claims description 2
- 125000004665 trialkylsilyl group Chemical group 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims 1
- IVRMZWNICZWHMI-UHFFFAOYSA-N Azide Chemical compound [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 238000001514 detection method Methods 0.000 claims 1
- 239000003337 fertilizer Substances 0.000 claims 1
- 238000009472 formulation Methods 0.000 claims 1
- 150000002894 organic compounds Chemical class 0.000 claims 1
- 238000007342 radical addition reaction Methods 0.000 claims 1
- 230000033764 rhythmic process Effects 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 72
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 67
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 50
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 48
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 36
- 239000000243 solution Substances 0.000 description 36
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 32
- UYTPUPDQBNUYGX-UHFFFAOYSA-N guanine Chemical compound O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 description 31
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 28
- 239000007787 solid Substances 0.000 description 28
- 239000011541 reaction mixture Substances 0.000 description 27
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 26
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- 239000002904 solvent Substances 0.000 description 24
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 19
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 12
- MKUXAQIIEYXACX-UHFFFAOYSA-N aciclovir Chemical compound N1C(N)=NC(=O)C2=C1N(COCCO)C=N2 MKUXAQIIEYXACX-UHFFFAOYSA-N 0.000 description 12
- 238000001953 recrystallisation Methods 0.000 description 12
- 238000010992 reflux Methods 0.000 description 12
- 239000003921 oil Substances 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- 229910021529 ammonia Inorganic materials 0.000 description 10
- 238000001914 filtration Methods 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- 229960000583 acetic acid Drugs 0.000 description 9
- 238000004809 thin layer chromatography Methods 0.000 description 9
- CSMCRCLIPQDIKB-UHFFFAOYSA-N 2-[(2,6-diaminopurin-9-yl)methoxy]ethanol Chemical compound NC1=NC(N)=C2N=CN(COCCO)C2=N1 CSMCRCLIPQDIKB-UHFFFAOYSA-N 0.000 description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- 235000011054 acetic acid Nutrition 0.000 description 8
- HNQDBKBFYQVYLX-UHFFFAOYSA-N 2-(chloromethoxy)ethyl benzoate Chemical compound ClCOCCOC(=O)C1=CC=CC=C1 HNQDBKBFYQVYLX-UHFFFAOYSA-N 0.000 description 7
- 229940086542 triethylamine Drugs 0.000 description 7
- KFGDVSVZKZPADB-UHFFFAOYSA-N 2-[(6-amino-2-chloropurin-9-yl)methoxy]ethanol Chemical compound NC1=NC(Cl)=NC2=C1N=CN2COCCO KFGDVSVZKZPADB-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 239000002674 ointment Substances 0.000 description 6
- MKTTXCDPHPEDCL-UHFFFAOYSA-N 2-[(2-amino-6-chloropurin-9-yl)methoxy]ethyl benzoate Chemical compound C12=NC(N)=NC(Cl)=C2N=CN1COCCOC(=O)C1=CC=CC=C1 MKTTXCDPHPEDCL-UHFFFAOYSA-N 0.000 description 5
- GFFGJBXGBJISGV-UHFFFAOYSA-N Adenine Chemical compound NC1=NC=NC2=C1N=CN2 GFFGJBXGBJISGV-UHFFFAOYSA-N 0.000 description 5
- 229930024421 Adenine Natural products 0.000 description 5
- 229960000643 adenine Drugs 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- XAZMDVUJLSYFIQ-UHFFFAOYSA-N 2-[(2-amino-6-oxo-3h-purin-9-yl)methoxy]ethyl benzoate Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1COCCOC(=O)C1=CC=CC=C1 XAZMDVUJLSYFIQ-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 4
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 4
- 235000011130 ammonium sulphate Nutrition 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 4
- 150000003212 purines Chemical class 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- FKHIFSZMMVMEQY-UHFFFAOYSA-N talc Chemical compound [Mg+2].[O-][Si]([O-])=O FKHIFSZMMVMEQY-UHFFFAOYSA-N 0.000 description 4
- RHMAZSNTRRZPMG-UHFFFAOYSA-N 2-[(2,6-diaminopurin-9-yl)methoxy]ethyl acetate Chemical compound N1=C(N)N=C2N(COCCOC(=O)C)C=NC2=C1N RHMAZSNTRRZPMG-UHFFFAOYSA-N 0.000 description 3
- YWSCFRBAJRWVKB-UHFFFAOYSA-N 2-[(2,6-diaminopurin-9-yl)methoxy]ethyl benzoate Chemical compound C12=NC(N)=NC(N)=C2N=CN1COCCOC(=O)C1=CC=CC=C1 YWSCFRBAJRWVKB-UHFFFAOYSA-N 0.000 description 3
- FZLBUUNVTLPQAK-UHFFFAOYSA-N 2-[(2-amino-6-methylsulfanylpurin-9-yl)methoxy]ethanol Chemical compound CSC1=NC(N)=NC2=C1N=CN2COCCO FZLBUUNVTLPQAK-UHFFFAOYSA-N 0.000 description 3
- DGVVWUTYPXICAM-UHFFFAOYSA-N 2-mercaptoethanol Substances OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 3
- 101710169336 5'-deoxyadenosine deaminase Proteins 0.000 description 3
- LEYMKLZVUYUKSH-UHFFFAOYSA-N 6-chloro-9-(ethylsulfanylmethyl)purine Chemical compound N1=CN=C2N(CSCC)C=NC2=C1Cl LEYMKLZVUYUKSH-UHFFFAOYSA-N 0.000 description 3
- 102000055025 Adenosine deaminases Human genes 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000010511 deprotection reaction Methods 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 238000010828 elution Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- 241001529453 unidentified herpesvirus Species 0.000 description 3
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 2
- RMFWVOLULURGJI-UHFFFAOYSA-N 2,6-dichloro-7h-purine Chemical compound ClC1=NC(Cl)=C2NC=NC2=N1 RMFWVOLULURGJI-UHFFFAOYSA-N 0.000 description 2
- CBGCJDKLQNGINO-UHFFFAOYSA-N 2-(chloromethylsulfanyl)ethyl acetate Chemical compound CC(=O)OCCSCCl CBGCJDKLQNGINO-UHFFFAOYSA-N 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 2
- DRDKSZBQTGDSQJ-UHFFFAOYSA-N 2-amino-9-(2-hydroxyethoxymethyl)-3h-purine-6-thione Chemical compound S=C1NC(N)=NC2=C1N=CN2COCCO DRDKSZBQTGDSQJ-UHFFFAOYSA-N 0.000 description 2
- YZPZJYIBJTVVKO-UHFFFAOYSA-N 2-amino-9-(3-hydroxypropoxymethyl)-3h-purin-6-one Chemical compound O=C1NC(N)=NC2=C1N=CN2COCCCO YZPZJYIBJTVVKO-UHFFFAOYSA-N 0.000 description 2
- RWCYGLJSLQIGDH-UHFFFAOYSA-N 2-chloro-9-(2-hydroxyethoxymethyl)-3h-purin-6-one Chemical compound N1=C(Cl)NC(=O)C2=C1N(COCCO)C=N2 RWCYGLJSLQIGDH-UHFFFAOYSA-N 0.000 description 2
- YDLAHBBJAGGIJZ-UHFFFAOYSA-N 2-sulfanylethyl acetate Chemical compound CC(=O)OCCS YDLAHBBJAGGIJZ-UHFFFAOYSA-N 0.000 description 2
- SMSSGLYHZZTFDI-UHFFFAOYSA-N 3-(chloromethoxy)propyl benzoate Chemical compound ClCOCCCOC(=O)C1=CC=CC=C1 SMSSGLYHZZTFDI-UHFFFAOYSA-N 0.000 description 2
- KSOAFZITIFFWHS-UHFFFAOYSA-N 3-[(2-amino-6-oxo-3h-purin-9-yl)methoxy]propyl benzoate Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1COCCCOC(=O)C1=CC=CC=C1 KSOAFZITIFFWHS-UHFFFAOYSA-N 0.000 description 2
- ZKBQDFAWXLTYKS-UHFFFAOYSA-N 6-Chloro-1H-purine Chemical compound ClC1=NC=NC2=C1NC=N2 ZKBQDFAWXLTYKS-UHFFFAOYSA-N 0.000 description 2
- BLRZKRCLOZMDIP-UHFFFAOYSA-N 9-(2-aminoethoxymethyl)purin-6-amine Chemical compound N1=CN=C2N(COCCN)C=NC2=C1N BLRZKRCLOZMDIP-UHFFFAOYSA-N 0.000 description 2
- NGDBUGSDGNWXQR-UHFFFAOYSA-N 9-(ethylsulfanylmethyl)purin-6-amine Chemical compound N1=CN=C2N(CSCC)C=NC2=C1N NGDBUGSDGNWXQR-UHFFFAOYSA-N 0.000 description 2
- MSSXOMSJDRHRMC-UHFFFAOYSA-N 9H-purine-2,6-diamine Chemical class NC1=NC(N)=C2NC=NC2=N1 MSSXOMSJDRHRMC-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- 208000007514 Herpes zoster Diseases 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- 229930040373 Paraformaldehyde Natural products 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 241000700605 Viruses Species 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- 150000005690 diesters Chemical class 0.000 description 2
- FSBVERYRVPGNGG-UHFFFAOYSA-N dimagnesium dioxido-bis[[oxido(oxo)silyl]oxy]silane hydrate Chemical class O.[Mg+2].[Mg+2].[O-][Si](=O)O[Si]([O-])([O-])O[Si]([O-])=O FSBVERYRVPGNGG-UHFFFAOYSA-N 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 239000003456 ion exchange resin Substances 0.000 description 2
- 229920003303 ion-exchange polymer Polymers 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- 150000004682 monohydrates Chemical class 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 239000003883 ointment base Substances 0.000 description 2
- 229920002866 paraformaldehyde Polymers 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 206010039083 rhinitis Diseases 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ZZQWOHMPHXYXCX-UHFFFAOYSA-N 1-(6-amino-2-methylpurin-9-yl)oxypropan-2-ol Chemical compound OC(CON1C2=NC(=NC(=C2N=C1)N)C)C ZZQWOHMPHXYXCX-UHFFFAOYSA-N 0.000 description 1
- GBNARABVQOUAJF-UHFFFAOYSA-N 1-[6-(dimethylamino)-2-methylpurin-9-yl]oxypropan-2-ol Chemical compound CN(C1=C2N=CN(C2=NC(=N1)C)OCC(C)O)C GBNARABVQOUAJF-UHFFFAOYSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- NXKQMTRWJDSOGU-UHFFFAOYSA-N 2-[(2,6-diaminopurin-9-yl)methoxy]ethanol;hydrochloride Chemical compound Cl.NC1=NC(N)=C2N=CN(COCCO)C2=N1 NXKQMTRWJDSOGU-UHFFFAOYSA-N 0.000 description 1
- WDWFTRKUESNIEQ-UHFFFAOYSA-N 2-[(2,6-dichloropurin-9-yl)methoxy]ethyl acetate Chemical compound N1=C(Cl)N=C2N(COCCOC(=O)C)C=NC2=C1Cl WDWFTRKUESNIEQ-UHFFFAOYSA-N 0.000 description 1
- VUJCFVXDTNKPKW-UHFFFAOYSA-N 2-[(2,6-dichloropurin-9-yl)methoxy]ethyl benzoate Chemical compound C12=NC(Cl)=NC(Cl)=C2N=CN1COCCOC(=O)C1=CC=CC=C1 VUJCFVXDTNKPKW-UHFFFAOYSA-N 0.000 description 1
- YWNMCXWWDNKNTC-UHFFFAOYSA-N 2-[(2-amino-6-phenylmethoxypurin-9-yl)methoxy]ethanol Chemical compound C=12N=CN(COCCO)C2=NC(N)=NC=1OCC1=CC=CC=C1 YWNMCXWWDNKNTC-UHFFFAOYSA-N 0.000 description 1
- PMVOVOOAYGEEHF-UHFFFAOYSA-N 2-[(2-amino-6-sulfanylidene-3h-purin-9-yl)methoxy]ethyl benzoate Chemical compound C1=NC=2C(=S)NC(N)=NC=2N1COCCOC(=O)C1=CC=CC=C1 PMVOVOOAYGEEHF-UHFFFAOYSA-N 0.000 description 1
- ROQWXTQKPITLJM-UHFFFAOYSA-N 2-[(2-aminopurin-9-yl)methoxy]ethyl benzoate Chemical compound C12=NC(N)=NC=C2N=CN1COCCOC(=O)C1=CC=CC=C1 ROQWXTQKPITLJM-UHFFFAOYSA-N 0.000 description 1
- PEIRNIBZTBBIHT-UHFFFAOYSA-N 2-[(6-aminopurin-9-yl)methoxy]ethanol Chemical compound NC1=NC=NC2=C1N=CN2COCCO PEIRNIBZTBBIHT-UHFFFAOYSA-N 0.000 description 1
- BGUQVFPTNOCVHL-UHFFFAOYSA-N 2-[(6-aminopurin-9-yl)methoxy]ethyl sulfamate Chemical compound NC1=NC=NC2=C1N=CN2COCCOS(N)(=O)=O BGUQVFPTNOCVHL-UHFFFAOYSA-N 0.000 description 1
- AQNIHRZKSKEVRM-UHFFFAOYSA-N 2-[(6-aminopurin-9-yl)methylsulfanyl]ethanol Chemical compound NC1=NC=NC2=C1N=CN2CSCCO AQNIHRZKSKEVRM-UHFFFAOYSA-N 0.000 description 1
- IFCSUTHKDBXWGF-UHFFFAOYSA-N 2-[(6-chloropurin-9-yl)methylsulfanyl]ethyl acetate Chemical compound N1=CN=C2N(CSCCOC(=O)C)C=NC2=C1Cl IFCSUTHKDBXWGF-UHFFFAOYSA-N 0.000 description 1
- QFNIAQMULZQGOW-UHFFFAOYSA-N 2-[bis(trimethylsilyl)amino]-8-trimethylsilyl-3,7-dihydropurin-6-one Chemical compound O=C1NC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=C1NC([Si](C)(C)C)=N2 QFNIAQMULZQGOW-UHFFFAOYSA-N 0.000 description 1
- VOXBZHOHGGBLCQ-UHFFFAOYSA-N 2-amino-3,7-dihydropurine-6-thione;hydrate Chemical compound O.N1C(N)=NC(=S)C2=C1N=CN2.N1C(N)=NC(=S)C2=C1N=CN2 VOXBZHOHGGBLCQ-UHFFFAOYSA-N 0.000 description 1
- AVEGLFHOBOAVIJ-UHFFFAOYSA-N 2-amino-9-(ethoxymethyl)-3h-purin-6-one Chemical compound N1=C(N)NC(=O)C2=C1N(COCC)C=N2 AVEGLFHOBOAVIJ-UHFFFAOYSA-N 0.000 description 1
- LAMUXTNQCICZQX-UHFFFAOYSA-N 3-chloropropan-1-ol Chemical compound OCCCCl LAMUXTNQCICZQX-UHFFFAOYSA-N 0.000 description 1
- BZISNWGGPWSXTK-UHFFFAOYSA-N 3-hydroxypropyl benzoate Chemical compound OCCCOC(=O)C1=CC=CC=C1 BZISNWGGPWSXTK-UHFFFAOYSA-N 0.000 description 1
- WYWHKKSPHMUBEB-UHFFFAOYSA-N 6-Mercaptoguanine Natural products N1C(N)=NC(=S)C2=C1N=CN2 WYWHKKSPHMUBEB-UHFFFAOYSA-N 0.000 description 1
- RYYIULNRIVUMTQ-UHFFFAOYSA-N 6-chloroguanine Chemical compound NC1=NC(Cl)=C2N=CNC2=N1 RYYIULNRIVUMTQ-UHFFFAOYSA-N 0.000 description 1
- UKADKJJNEZZNGH-UHFFFAOYSA-N 7h-purine-2,6-diamine;hydrate Chemical compound O.NC1=NC(N)=C2N=CNC2=N1 UKADKJJNEZZNGH-UHFFFAOYSA-N 0.000 description 1
- REAMJNJXSSFGRP-UHFFFAOYSA-N 9-(2-hydroxyethoxymethyl)-3h-purine-6-thione Chemical compound N1=CN=C2N(COCCO)C=NC2=C1S REAMJNJXSSFGRP-UHFFFAOYSA-N 0.000 description 1
- QDQLJQGWLUZFDW-UHFFFAOYSA-N 9-(ethylsulfanylmethyl)-n-methylpurin-6-amine Chemical compound N1=CN=C2N(CSCC)C=NC2=C1NC QDQLJQGWLUZFDW-UHFFFAOYSA-N 0.000 description 1
- YECXMYYFCZOAQQ-UHFFFAOYSA-N 9-[1,3-bis(phenylmethoxy)propan-2-yloxymethyl]purin-6-amine Chemical compound C1=NC=2C(N)=NC=NC=2N1COC(COCC=1C=CC=CC=1)COCC1=CC=CC=C1 YECXMYYFCZOAQQ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- JECFKHUKMAUHQB-UHFFFAOYSA-N C(C)(=O)OCCS.OCCSCN1C2=NC=NC(=C2N=C1)N Chemical compound C(C)(=O)OCCS.OCCSCN1C2=NC=NC(=C2N=C1)N JECFKHUKMAUHQB-UHFFFAOYSA-N 0.000 description 1
- RWGCABMMJLGACX-UHFFFAOYSA-N C(C1=CC=CC=C1)(=O)CCOCCOCCl Chemical compound C(C1=CC=CC=C1)(=O)CCOCCOCCl RWGCABMMJLGACX-UHFFFAOYSA-N 0.000 description 1
- HSZMHRVUMZDJOO-UHFFFAOYSA-N C(C=1C(C(=O)N)=CC=CC1)(=O)NCCOCCl Chemical compound C(C=1C(C(=O)N)=CC=CC1)(=O)NCCOCCl HSZMHRVUMZDJOO-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 201000006082 Chickenpox Diseases 0.000 description 1
- VASAZLHQODZGMJ-UHFFFAOYSA-N Cl.Cl.NCC(ON1C2=NC(=NC(=C2N=C1)N)C)C Chemical compound Cl.Cl.NCC(ON1C2=NC(=NC(=C2N=C1)N)C)C VASAZLHQODZGMJ-UHFFFAOYSA-N 0.000 description 1
- AFTBXNJRUUSXMB-UHFFFAOYSA-N ClC=1N(C2=NC(=NC=C2N1)Cl)COCCOC(C1=CC=CC=C1)=O Chemical compound ClC=1N(C2=NC(=NC=C2N1)Cl)COCCOC(C1=CC=CC=C1)=O AFTBXNJRUUSXMB-UHFFFAOYSA-N 0.000 description 1
- 241000701022 Cytomegalovirus Species 0.000 description 1
- 241000450599 DNA viruses Species 0.000 description 1
- 208000001860 Eye Infections Diseases 0.000 description 1
- 101001018064 Homo sapiens Lysosomal-trafficking regulator Proteins 0.000 description 1
- 241001135569 Human adenovirus 5 Species 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 102100033472 Lysosomal-trafficking regulator Human genes 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241000710185 Mengo virus Species 0.000 description 1
- 235000010703 Modiola caroliniana Nutrition 0.000 description 1
- 244000038561 Modiola caroliniana Species 0.000 description 1
- 208000005647 Mumps Diseases 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- IZCLGIIYSTVIMX-UHFFFAOYSA-N NC1=NC(=C2N=CN(C2=N1)COCCO)N.Cl.NC1=NC(=C2N=CN(C2=N1)COCCO)N Chemical compound NC1=NC(=C2N=CN(C2=N1)COCCO)N.Cl.NC1=NC(=C2N=CN(C2=N1)COCCO)N IZCLGIIYSTVIMX-UHFFFAOYSA-N 0.000 description 1
- ITMJLDHRCZPDQG-UHFFFAOYSA-N O.C(C1=CC=CC=C1)OCC(COCC1=CC=CC=C1)OCN1C2=NC=NC(=C2N=C1)S Chemical compound O.C(C1=CC=CC=C1)OCC(COCC1=CC=CC=C1)OCN1C2=NC=NC(=C2N=C1)S ITMJLDHRCZPDQG-UHFFFAOYSA-N 0.000 description 1
- OZBZONOEYUBXTD-UHFFFAOYSA-N OOOOOOOOO Chemical compound OOOOOOOOO OZBZONOEYUBXTD-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 241000183024 Populus tremula Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 241000710960 Sindbis virus Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- SGPGESCZOCHFCL-UHFFFAOYSA-N Tilisolol hydrochloride Chemical compound [Cl-].C1=CC=C2C(=O)N(C)C=C(OCC(O)C[NH2+]C(C)(C)C)C2=C1 SGPGESCZOCHFCL-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 206010046980 Varicella Diseases 0.000 description 1
- 208000036142 Viral infection Diseases 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 125000002344 aminooxy group Chemical group [H]N([H])O[*] 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 229940121357 antivirals Drugs 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- XZCHJYXUPALGHH-UHFFFAOYSA-N chloromethylsulfanylethane Chemical compound CCSCCl XZCHJYXUPALGHH-UHFFFAOYSA-N 0.000 description 1
- 238000010549 co-Evaporation Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- ZXJXZNDDNMQXFV-UHFFFAOYSA-M crystal violet Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1[C+](C=1C=CC(=CC=1)N(C)C)C1=CC=C(N(C)C)C=C1 ZXJXZNDDNMQXFV-UHFFFAOYSA-M 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000006196 drop Substances 0.000 description 1
- 238000012377 drug delivery Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 241001493065 dsRNA viruses Species 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000003889 eye drop Substances 0.000 description 1
- 229940012356 eye drops Drugs 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 201000006747 infectious mononucleosis Diseases 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- GRWIABMEEKERFV-UHFFFAOYSA-N methanol;oxolane Chemical compound OC.C1CCOC1 GRWIABMEEKERFV-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 208000010805 mumps infectious disease Diseases 0.000 description 1
- 239000007923 nasal drop Substances 0.000 description 1
- 229940100662 nasal drops Drugs 0.000 description 1
- 239000002777 nucleoside Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 238000003303 reheating Methods 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 1
- 239000004299 sodium benzoate Substances 0.000 description 1
- 235000010234 sodium benzoate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- LFQULJPVXNYWAG-UHFFFAOYSA-N sodium;phenylmethanolate Chemical compound [Na]OCC1=CC=CC=C1 LFQULJPVXNYWAG-UHFFFAOYSA-N 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 229960003087 tioguanine Drugs 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
- 241000701161 unidentified adenovirus Species 0.000 description 1
- 239000006213 vaginal ring Substances 0.000 description 1
- 229940044953 vaginal ring Drugs 0.000 description 1
- 210000003501 vero cell Anatomy 0.000 description 1
- 230000009385 viral infection Effects 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/26—Heterocyclic compounds containing purine ring systems with an oxygen, sulphur, or nitrogen atom directly attached in position 2 or 6, but not in both
- C07D473/32—Nitrogen atom
- C07D473/34—Nitrogen atom attached in position 6, e.g. adenine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Communicable Diseases (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Virology (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Saccharide Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP10375076A JPS6029796B2 (ja) | 1975-09-02 | 1976-09-01 | アルカリパルプ化又はアルカリ標白方法。 |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3827874 | 1974-09-02 | ||
| GB38278/74A GB1523865A (en) | 1974-09-02 | 1974-09-02 | Purine compunds and salts thereof |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI752465A7 FI752465A7 (enExample) | 1976-03-03 |
| FI60709B FI60709B (fi) | 1981-11-30 |
| FI60709C true FI60709C (fi) | 1982-03-10 |
Family
ID=10402412
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI752465A FI60709C (fi) | 1974-09-02 | 1975-09-02 | Analogifoerfarande foer framstaellning av 9-substituerade puriner anvaendbara saosom antivirala medel |
Country Status (35)
Families Citing this family (120)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4146715A (en) | 1975-08-27 | 1979-03-27 | Burroughs Wellcome Co. | 2-amido-9-(2-acyloxyethoxymethyl)hypoxanthines |
| US4060616A (en) * | 1976-03-01 | 1977-11-29 | Burroughs Wellcome Co. | Purine derivatives with repeating unit |
| AU521577B2 (en) * | 1977-02-24 | 1982-04-22 | Wellcome Foundation Limited, The | 9-hydroxyethoxymethyl guanine phosphates |
| US4287188A (en) | 1977-02-24 | 1981-09-01 | Burroughs Wellcome Co. | Purine derivatives |
| KR830005852A (ko) * | 1980-07-18 | 1983-09-14 | 미첼 페터 잭슨 | 피부와 점막의 비루스 감염치료에 적합한 국소치료제의 제조방법 |
| US5157120A (en) * | 1980-09-16 | 1992-10-20 | Syntex (U.S.A.) Inc. | Guanine derivatives |
| US4347360A (en) * | 1980-09-16 | 1982-08-31 | Ens Bio Logicals Inc. | Ring open nucleoside analogues |
| JPS57102818A (en) * | 1980-10-15 | 1982-06-26 | Wellcome Found | Treatment for fish virus diseases |
| US4423050A (en) * | 1981-05-21 | 1983-12-27 | Syntex (U.S.A.) Inc. | 9-(1,3-Dihydroxy-2-propoxymethyl)guanine as antiviral agent |
| US4603219A (en) * | 1981-05-21 | 1986-07-29 | Syntex (U.S.A.) Inc. | 1,3-dibenzyloxy-2-acetoxymethoxypropane, intermediate for 9-(1,3-dihydroxy-2-propoxymethyl)guanine |
| US4355032B2 (en) * | 1981-05-21 | 1990-10-30 | 9-(1,3-dihydroxy-2-propoxymethyl)guanine as antiviral agent | |
| DE3278501D1 (en) * | 1981-08-11 | 1988-06-23 | Wellcome Found | Antiviral compounds |
| AT382152B (de) * | 1981-09-16 | 1987-01-26 | Ens Bio Logicals Inc | Verfahren zur herstellung einer neuen 9-substituierten guaninverbindung |
| AU564576B2 (en) * | 1981-09-24 | 1987-08-20 | Sigma-Tau Industrie Farmaceutiche Riunite S.P.A. | Purine derivatives |
| US5250535A (en) * | 1982-02-01 | 1993-10-05 | Syntex Inc. | Substituted 9-(1 or 3-monoacyloxy or 1,3-diacyloxy-2-propoxymethyl) purines as antiviral agent |
| EP0101441B1 (en) * | 1982-02-12 | 1987-01-14 | Syntex (U.S.A.) Inc. | Anti-viral compositions |
| SE8203856D0 (sv) * | 1982-06-21 | 1982-06-21 | Astra Laekemedel Ab | Novel derivatives of guanine ii |
| SE8203855D0 (sv) * | 1982-06-21 | 1982-06-21 | Astra Laekemedel Ab | Novel derivatives of guanine i |
| NL8202626A (nl) * | 1982-06-29 | 1984-01-16 | Stichting Rega V Z W | Derivaten van 9-(2-hydroxyethoxymethyl)guanine. |
| US4609662A (en) * | 1982-10-14 | 1986-09-02 | Burroughs Wellcome Co. | Method for using purine derivatives |
| US5059604A (en) * | 1982-10-14 | 1991-10-22 | Burroughs Wellcome Co. | 2-amino purine derivatives |
| US4745119A (en) * | 1982-10-14 | 1988-05-17 | Burroughs Wellcome Co. | Method for using purine derivatives |
| DK472683A (da) * | 1982-10-14 | 1984-04-15 | Wellcome Found | Fremgangsmaade til fremstilling af purinderivater |
| US4649140A (en) * | 1982-10-14 | 1987-03-10 | Burroughs Wellcome Co. | Purine derivatives |
| US4612314A (en) * | 1982-12-22 | 1986-09-16 | Syntex (U.S.A.) Inc. | Substituted 9-(1 or 3-monoacyloxy or 1,3-diacyloxy-2-propoxymethyl) purines as antiviral agent |
| US4461757A (en) * | 1983-02-23 | 1984-07-24 | Ens Bio Logicals Inc. | Dimethylaminomethylenated anti-herpes compounds |
| ES520140A0 (es) * | 1983-02-25 | 1984-04-01 | Ind Farma Especial | Un procedimiento para la preparacion de acicloguanosina. |
| US5047533A (en) * | 1983-05-24 | 1991-09-10 | Sri International | Acyclic purine phosphonate nucleotide analogs |
| US4557934A (en) | 1983-06-21 | 1985-12-10 | The Procter & Gamble Company | Penetrating topical pharmaceutical compositions containing 1-dodecyl-azacycloheptan-2-one |
| JPS6023380A (ja) * | 1983-06-24 | 1985-02-05 | メルク・エンド・カムパニー・インコーポレーテッド | 抗ウイルス剤 |
| US4880820A (en) * | 1983-06-24 | 1989-11-14 | Merck & Co., Inc. | Guanine derivatives |
| US5684153A (en) | 1984-08-16 | 1997-11-04 | Beecham Group Plc | Process for the preparation of purine derivatives |
| US4897479A (en) * | 1983-09-30 | 1990-01-30 | Merck & Co., Inc. | Arylsulfonyloxy purine intermediates |
| JPS6094992A (ja) * | 1983-10-28 | 1985-05-28 | Sankyo Co Ltd | グリゼオ−ル酸誘導体 |
| IE842642L (en) * | 1983-10-31 | 1985-04-30 | Harvard College | Purine Derivatives |
| US4918219A (en) * | 1983-10-31 | 1990-04-17 | Warner-Lambert Company | Glycerine derivatives |
| US4806642A (en) * | 1984-10-05 | 1989-02-21 | Warner-Lambert Company | Purine derivatives |
| ZA848080B (en) * | 1983-10-31 | 1985-06-26 | Warner Lambert Co | Purine derivatives |
| US4579849A (en) * | 1984-04-06 | 1986-04-01 | Merck & Co., Inc. | N-alkylguanine acyclonucleosides as antiviral agents |
| US4617304A (en) * | 1984-04-10 | 1986-10-14 | Merck & Co., Inc. | Purine derivatives |
| IL74881A0 (en) * | 1984-04-13 | 1985-07-31 | Wellcome Found | Purine derivatives,their preparation and pharmaceutical compositions containing them |
| US4636507A (en) * | 1984-04-30 | 1987-01-13 | Hoechst-Roussel Pharmaceuticals Inc. | Host defense mechanism enhancement |
| DE3585643D1 (de) | 1984-07-03 | 1992-04-23 | Wellcome Found | Antiviren-verbindungen, behandlung und formulierungen. |
| EP0190123A1 (en) * | 1984-07-20 | 1986-08-13 | GAUNTT, Charles, O. | Immunoregulatory and anti-viral compound |
| SE8406538D0 (sv) * | 1984-12-21 | 1984-12-21 | Astra Laekemedel Ab | Novel derivatives of purine |
| US4724232A (en) * | 1985-03-16 | 1988-02-09 | Burroughs Wellcome Co. | Treatment of human viral infections |
| US5683990A (en) * | 1985-03-16 | 1997-11-04 | Glaxo Wellcome Inc. | Treatment of human viral infections |
| CS263952B1 (en) * | 1985-04-25 | 1989-05-12 | Holy Antonin | Remedy with antiviral effect |
| CS263951B1 (en) * | 1985-04-25 | 1989-05-12 | Antonin Holy | 9-(phosponylmethoxyalkyl)adenines and method of their preparation |
| EP0203736B1 (en) | 1985-05-02 | 1989-11-23 | The Wellcome Foundation Limited | Antiviral compounds |
| IL78643A0 (en) * | 1985-05-02 | 1986-08-31 | Wellcome Found | Purine derivatives,their preparation and pharmaceutical compositions containing them |
| DE3529497A1 (de) * | 1985-08-17 | 1987-02-26 | Boehringer Mannheim Gmbh | N(pfeil hoch)6(pfeil hoch)-disubstituierte purinderivate, verfahren zu deren herstellung sowie diese verbindungen enthaltende arzneimittel |
| DE3627024A1 (de) * | 1985-09-24 | 1987-04-02 | Hoechst Ag | In 6- und 9-stellung substituierte 2-aminopurine, ihre verwendung, diese purine enthaltende arzneimittel und verfahren zur herstellung der purine |
| IT1207507B (it) * | 1985-10-21 | 1989-05-25 | Baldacci Lab Spa | Coniugato della 9-(2-idrossietossimetil)guanina con albumina umana lattosaminata, procedimento per la sua preparazione e composizioni farmaceutiche che la contengono. |
| EP0290496B2 (en) * | 1986-10-06 | 1995-12-20 | The University Of Virginia Alumni Patents Foundation | Use of an adenosine, hypoxanthine and ribose-containing solution for improved protection of the heart during surgery |
| EP0290630A4 (de) * | 1986-11-25 | 1990-02-26 | Inst Organicheskogo Sinteza Ak | 9-substituierte guanine. |
| US4978655A (en) * | 1986-12-17 | 1990-12-18 | Yale University | Use of 3'-deoxythymidin-2'-ene (3'deoxy-2',3'-didehydrothymidine) in treating patients infected with retroviruses |
| US4829055A (en) * | 1987-01-23 | 1989-05-09 | Naficy Sadeque S | Method of treatment for herpes infections of external tissues |
| US5565566A (en) * | 1987-04-24 | 1996-10-15 | Discovery Therapeutics, Inc. | N6 -substituted 9-methyladenines: a new class of adenosine receptor antagonists |
| US6306647B1 (en) | 1987-06-16 | 2001-10-23 | Ajinomoto Co., Inc. | Process for producing and purifying 2′,3′-dideoxynucleosides, and process for producing 2′,3′-dideoxy-2′,3′-didehydronucleosides |
| US4835104A (en) * | 1987-06-16 | 1989-05-30 | Ajinomoto Co., Inc., Patent & Licensing Department | Process for producing and purifying 2',3'-dideoxynucleosides, and process for producing 2',3'-dideoxy-2',3'-didehydronucleosides |
| GB8719367D0 (en) * | 1987-08-15 | 1987-09-23 | Wellcome Found | Therapeutic compounds |
| GB8725939D0 (en) * | 1987-11-05 | 1987-12-09 | Wellcome Found | Therapeutic compounds |
| CA1302887C (en) * | 1987-11-24 | 1992-06-09 | Yves Langelier | Combination of acyclovir or a derivative thereof and bacitracin |
| JPH01121424U (enExample) * | 1988-02-10 | 1989-08-17 | ||
| GB8815241D0 (en) * | 1988-06-27 | 1988-08-03 | Wellcome Found | Antiviral combinations & compounds therefor |
| US5164395A (en) * | 1988-06-27 | 1992-11-17 | Burroughs Wellcome Co. | Antiviral acetyl pyridine derivative or said acetyl pyridine derivative in combination with acyclovir |
| GB8816760D0 (en) * | 1988-07-14 | 1988-08-17 | Wellcome Found | Therapeutic compounds |
| DE68907013D1 (de) * | 1988-10-24 | 1993-07-15 | Wellcome Found | Guaninderivate mit antiviraler wirkung und deren pharmazeutisch vertraegliche salze. |
| KR910700253A (ko) * | 1989-01-31 | 1991-03-14 | 로버트 제이, 바란 | N_6-치환-9-메틸아데닌: 신규한 부류의 아데노신 수용체 길항질 |
| US4966895A (en) * | 1989-02-02 | 1990-10-30 | Merck & Co. Inc. | Cyclic monophosphates of purine and pyrimidine acyclonucleosides as anti-retroviral agents |
| GB8907173D0 (en) * | 1989-03-30 | 1989-05-10 | Beecham Group Plc | Novel compounds |
| GB8912043D0 (en) * | 1989-05-25 | 1989-07-12 | Beecham Group Plc | Novel compounds |
| GB9001886D0 (en) * | 1990-01-26 | 1990-03-28 | Beecham Group Plc | Pharmaceutical formulation |
| DE4008858A1 (de) * | 1990-03-20 | 1991-09-26 | Hoechst Ag | Substituierte purine, verfahren zu ihrer hertellung sowie ihre verwendung als antivirale mittel |
| CA2033447C (en) * | 1990-12-31 | 1999-08-31 | Robert Deziel | Synergistic combination for treating herpes infections |
| US5580571A (en) * | 1991-10-15 | 1996-12-03 | Hostetler; Karl Y. | Nucleoside analogues |
| US5879700A (en) * | 1991-10-15 | 1999-03-09 | Hostetler; Karl Y. | Nucleoside analogue phosphates for topical use |
| CA2091732C (en) * | 1992-07-08 | 1998-07-21 | Anica Markovac | A process for the preparation of 2-fluoro-9-(2,3,5-tri-o-benzyl-beta-d-arabinofuranosyl) adenine |
| DK169121B1 (da) | 1992-09-09 | 1994-08-22 | Gea Farmaceutisk Fabrik As | Antiviralt virksom farmaceutisk olie-i-vand-emulsion indeholdende 9-[(2-hydroxyethoxy)methyl]guanin (acyclovir) eller et salt eller en ester deraf |
| DE59310344D1 (de) * | 1992-09-24 | 2003-07-24 | Hoechst Ag | N1-Substituierte 1H-1,2,3-Triazolo[4,5-d]pyrimidine, Verfahren zu ihrer Herstellung sowie ihre Verwendung als antivirale Mittel |
| US5654286A (en) * | 1993-05-12 | 1997-08-05 | Hostetler; Karl Y. | Nucleotides for topical treatment of psoriasis, and methods for using same |
| US6015573A (en) * | 1993-05-12 | 2000-01-18 | Hostetler; Karl Y. | Nucleoside phosphate therapy for viral infection |
| IT1264599B1 (it) * | 1993-06-14 | 1996-10-04 | Solar Chem Sa | Processo per la sintesi della 9-(2-idrossietossimetil)- guanina |
| US5567816A (en) * | 1994-07-26 | 1996-10-22 | Syntex (U.S.A.) Inc. | Preparation of acyclovir using 1,3 dioxolane |
| US5840891A (en) * | 1994-07-28 | 1998-11-24 | Syntex (U.S.A.) Inc. | 2-(2-amino-1,6-dihydro-6-oxo-purin-9-yl) methoxy-1,3-propanediol derivative |
| US5543414A (en) * | 1994-07-28 | 1996-08-06 | Syntex (Usa) Inc. | Achiral amino acid acyl esters of ganciclovir and its derivatives |
| US5565565A (en) | 1994-08-04 | 1996-10-15 | Syntex (U.S.A.) Inc. | Preparation of N-9 substituted guanine compounds |
| US5627185A (en) * | 1994-11-23 | 1997-05-06 | Gosselin; Gilles | Acyclovir derivatives as antiviral agents |
| US5700936A (en) * | 1996-01-26 | 1997-12-23 | Syntex (U.S.A.) Inc. | Process for preparing a 2-(2-amino-1,6-dihydro-6-oxo-purin-9-yl) methoxy-1,3-propanediol valinate |
| US5756736A (en) * | 1996-01-26 | 1998-05-26 | Syntex (U.S.A.) Inc. | Process for preparing a 2-(2-amino-1,6-dihydro-6-oxo-purin-9-yl)methoxy-1,3-propanediol derivative |
| US6040446A (en) | 1996-01-26 | 2000-03-21 | Syntex (U.S.A.) Inc. | Process for preparing a 2-(2-amino-1,6-dihydro-6-oxo-purin-9-yl) methoxy-1,3-propanediol derivative |
| US5840890A (en) * | 1996-01-26 | 1998-11-24 | Syntex (U.S.A.) Inc. | Process for preparing a 2-(2-amino-1,6-dihydro-6-oxo-purin-9-yl)methoxy-1,3-propanediol derivative |
| IN179493B (enExample) * | 1996-02-22 | 1997-10-11 | Lupin Laboraties Ltd | |
| US5789589A (en) * | 1996-04-22 | 1998-08-04 | Drug Innovation & Design, Inc. | Guanine analog phosphates |
| US6440980B1 (en) | 1996-09-17 | 2002-08-27 | Avanir Pharmaceuticals | Synergistic inhibition of viral replication by long-chain hydrocarbons and nucleoside analogs |
| RU2111967C1 (ru) * | 1996-09-26 | 1998-05-27 | Генкин Дмитрий Дмитриевич | Способ получения ацикловира |
| US6180790B1 (en) | 1997-05-15 | 2001-01-30 | Drug Innovation And Design, Inc. | Methods of preparing acyclovir prodrugs |
| AU731225C (en) | 1997-05-15 | 2001-10-18 | Drug Innovation & Design, Inc. | Acyclovir diester derivatives |
| RU2160105C1 (ru) * | 2000-04-27 | 2000-12-10 | Открытое акционерное общество "Химико-фармацевтический комбинат "Акрихин" | Противовирусное средство и способ его получения |
| RU2179851C1 (ru) * | 2000-12-21 | 2002-02-27 | Открытое акционерное общество "Химико-фармацевтический комбинат "Акрихин" | Противовирусный фармацевтический состав |
| RU2175230C1 (ru) * | 2001-01-23 | 2001-10-27 | Открытое акционерное общество "Химико-фармацевтический комбинат "Акрихин" | Фармацевтическая композиция с противовирусной активностью и способ ее получения |
| JP2005519868A (ja) * | 2001-10-16 | 2005-07-07 | アバニール・ファーマシューティカルズ | n−ドコサノールによるウイルス阻害 |
| US20070129334A1 (en) * | 2001-10-30 | 2007-06-07 | Conforma Therapeutics Corporation | Orally Active Purine-Based Inhibitors of Heat Shock Protein 90 |
| WO2003037860A2 (en) * | 2001-10-30 | 2003-05-08 | Conforma Therapeutics Corporation | Purine analogs having hsp90-inhibiting activity |
| US7078524B2 (en) | 2002-11-22 | 2006-07-18 | Ranbaxy Laboratories Limited | Process for the synthesis of ganciclovir |
| RU2233842C1 (ru) * | 2003-01-13 | 2004-08-10 | Петров Владимир Иванович | Производные пурина, обладающие противовирусной активностью |
| US20060234982A1 (en) | 2003-01-14 | 2006-10-19 | Dahl Terrence C | Compositions and methods for combination antiviral therapy |
| US20040200730A1 (en) * | 2003-04-14 | 2004-10-14 | Kyo Jibiki | Hydrometallurgical copper recovery process |
| BRPI0510820A (pt) | 2004-05-19 | 2007-11-27 | Emisphere Tech Inc | composição farmacêutica, forma unitária de dosagem e seus usos |
| TWI375560B (en) | 2005-06-13 | 2012-11-01 | Gilead Sciences Inc | Composition comprising dry granulated emtricitabine and tenofovir df and method for making the same |
| TWI471145B (zh) | 2005-06-13 | 2015-02-01 | Bristol Myers Squibb & Gilead Sciences Llc | 單一式藥學劑量型 |
| CA2644297A1 (en) * | 2006-03-14 | 2007-09-20 | Alt Solutions, Inc. | Prevention and treatment of cancer and other diseases |
| US8173621B2 (en) | 2008-06-11 | 2012-05-08 | Gilead Pharmasset Llc | Nucleoside cyclicphosphates |
| EA019295B1 (ru) | 2008-12-23 | 2014-02-28 | Джилид Фармассет, Ллс. | Соединения пуриновых нуклеозидов и способ их получения |
| MX2011006891A (es) | 2008-12-23 | 2011-10-06 | Pharmasset Inc | Fosforamidatos de nucleosidos. |
| CA2748034A1 (en) | 2008-12-23 | 2010-07-01 | Pharmasset, Inc. | Purified 2'-deoxy'2'-fluoro-2'-c-methyl-nucleoside-phosphoramidate prodrugs for the treatment of viral infections |
| SG184323A1 (en) | 2010-03-31 | 2012-11-29 | Gilead Pharmasett Llc | Stereoselective synthesis of phosphorus containing actives |
| GB201819418D0 (en) | 2018-11-29 | 2019-01-16 | Daniel Calladine Ltd | Anti-viral compositions |
| US20230218644A1 (en) | 2020-04-16 | 2023-07-13 | Som Innovation Biotech, S.A. | Compounds for use in the treatment of viral infections by respiratory syndrome-related coronavirus |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4199574A (en) * | 1974-09-02 | 1980-04-22 | Burroughs Wellcome Co. | Methods and compositions for treating viral infections and guanine acyclic nucleosides |
| US4146715A (en) * | 1975-08-27 | 1979-03-27 | Burroughs Wellcome Co. | 2-amido-9-(2-acyloxyethoxymethyl)hypoxanthines |
-
1974
- 1974-09-02 GB GB38278/74A patent/GB1523865A/en not_active Expired
-
1975
- 1975-09-01 DK DK392675A patent/DK146595C/da not_active IP Right Cessation
- 1975-09-01 SE SE7509675A patent/SE428562C/xx not_active IP Right Cessation
- 1975-09-01 IE IE1911/75A patent/IE42282B1/en not_active IP Right Cessation
- 1975-09-02 AU AU84459/75A patent/AU503160B2/en not_active Expired
- 1975-09-02 RO RO7589174A patent/RO74274A/ro unknown
- 1975-09-02 AR AR260225A patent/AR220299A1/es active
- 1975-09-02 IL IL48035A patent/IL48035A/xx unknown
- 1975-09-02 MC MC751158A patent/MC1068A1/fr unknown
- 1975-09-02 BG BG032819A patent/BG24815A3/xx unknown
- 1975-09-02 RO RO7589175A patent/RO74275A/ro unknown
- 1975-09-02 BG BG032818A patent/BG25094A3/xx unknown
- 1975-09-02 DD DD188132A patent/DD122092A5/xx active Search and Examination
- 1975-09-02 CS CS755957A patent/CS203092B2/cs unknown
- 1975-09-02 AT AT676375A patent/AT354462B/de not_active IP Right Cessation
- 1975-09-02 FR FR7526826A patent/FR2282892A1/fr active Granted
- 1975-09-02 ZM ZM128/75A patent/ZM12875A1/xx unknown
- 1975-09-02 NZ NZ178556A patent/NZ178556A/xx unknown
- 1975-09-02 NO NO753009A patent/NO144216C/no unknown
- 1975-09-02 BG BG030910A patent/BG26389A3/xx unknown
- 1975-09-02 YU YU2220/75A patent/YU39947B/xx unknown
- 1975-09-02 DE DE2539963A patent/DE2539963C2/de not_active Expired
- 1975-09-02 FI FI752465A patent/FI60709C/fi not_active IP Right Cessation
- 1975-09-02 ES ES440631A patent/ES440631A1/es not_active Expired
- 1975-09-02 BE BE159690A patent/BE833006A/xx not_active IP Right Cessation
- 1975-09-02 HU HU75WE527A patent/HU176730B/hu unknown
- 1975-09-02 CY CY1033A patent/CY1033A/xx unknown
- 1975-09-02 BG BG032817A patent/BG26536A4/xx unknown
- 1975-09-02 CH CH1132275A patent/CH626363A5/de active Protection Beyond IP Right Term
- 1975-09-02 LU LU73304A patent/LU73304A1/xx unknown
- 1975-09-02 RO RO7583306A patent/RO76939A/ro unknown
- 1975-09-02 RO RO7589176A patent/RO74276A/ro unknown
- 1975-09-02 CA CA234,591A patent/CA1062257A/en not_active Expired
- 1975-09-02 ZA ZA755574A patent/ZA755574B/xx unknown
- 1975-09-02 NL NLAANVRAGE7510342,A patent/NL175061C/xx not_active IP Right Cessation
- 1975-09-02 SU SU752169001A patent/SU904523A3/ru active
- 1975-09-02 JP JP50106479A patent/JPS5154589A/ja active Granted
- 1975-09-02 CS CS773087A patent/CS203093B2/cs unknown
-
1976
- 1976-04-23 AR AR262994A patent/AR220885A1/es active
- 1976-04-23 AR AR262995A patent/AR220508A1/es active
- 1976-04-28 AR AR262993A patent/AR212914A1/es active
-
1977
- 1977-01-24 SU SU772444408A patent/SU700064A3/ru active
- 1977-01-24 SU SU772442252A patent/SU686618A3/ru active
- 1977-01-24 SU SU772442435A patent/SU751325A3/ru active
- 1977-02-16 ES ES455979A patent/ES455979A1/es not_active Expired
- 1977-02-16 ES ES455978A patent/ES455978A1/es not_active Expired
-
1978
- 1978-02-01 US US05/874,130 patent/US4323573A/en not_active Expired - Lifetime
- 1978-02-01 US US05/874,067 patent/US4360522A/en not_active Expired - Lifetime
- 1978-02-01 US US05/874,060 patent/US4294831A/en not_active Expired - Lifetime
-
1979
- 1979-06-18 SU SU792780252A patent/SU784777A3/ru active
- 1979-08-14 CH CH744679A patent/CH626364A5/de not_active IP Right Cessation
- 1979-08-14 CH CH744879A patent/CH623587A5/de not_active IP Right Cessation
- 1979-08-14 CH CH744779A patent/CH623586A5/de not_active IP Right Cessation
- 1979-08-29 SU SU792804760A patent/SU858569A3/ru active
- 1979-10-18 SU SU792833104A patent/SU799664A3/ru active
- 1979-11-13 KE KE3002A patent/KE3002A/xx unknown
- 1979-12-06 HK HK843/79A patent/HK84379A/xx unknown
-
1981
- 1981-05-05 CH CH292381A patent/CH629206A5/de not_active IP Right Cessation
- 1981-05-05 CH CH292481A patent/CH629805A5/de not_active IP Right Cessation
- 1981-05-05 CH CH292581A patent/CH628897A5/de not_active IP Right Cessation
-
1982
- 1982-06-04 YU YU1200/82A patent/YU40079B/xx unknown
- 1982-06-04 YU YU01199/82A patent/YU119982A/xx unknown
- 1982-06-04 YU YU1201/82A patent/YU40080B/xx unknown
- 1982-12-30 MY MY191/82A patent/MY8200191A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI60709C (fi) | Analogifoerfarande foer framstaellning av 9-substituerade puriner anvaendbara saosom antivirala medel | |
| US4199574A (en) | Methods and compositions for treating viral infections and guanine acyclic nucleosides | |
| KR960002849B1 (ko) | 아사이클로비르의 발린 에스테르 및 이를 함유하는 약학 조성물 | |
| US4146715A (en) | 2-amido-9-(2-acyloxyethoxymethyl)hypoxanthines | |
| EP0099493B1 (en) | Derivatives of 9-(2-hydroxyethoxymethyl)guanine | |
| US4287188A (en) | Purine derivatives | |
| CA1276635C (en) | 9-(2-(hydroxymethyl)cycloalkylmethyl)guanines | |
| CZ391491A3 (en) | Guanine derivatives, process of their preparation and pharmaceutical compositions in which said derivatives are comprised | |
| EP0159264A2 (en) | Antiviral compounds | |
| HU203363B (en) | Process for producing 2',3'-dideoxy-2',2'-difluoronucleosides and pharmaceutical compositions comprising same as active ingredient | |
| KR940010033B1 (ko) | 항비루스 활성을 갖는 화합물의 제조방법 | |
| US4965270A (en) | Purine derivatives | |
| US4060616A (en) | Purine derivatives with repeating unit | |
| FI60710C (fi) | Analogifoerfarande foer framstaellning av 9-(2-acyloxietoximetyl)purinfoereningar anvaendbara saosom antivirala medel | |
| DK147596B (da) | Analogifremgangsmaade til fremstilling af 7-alkoxymethylpuriner | |
| CS203095B2 (cs) | Způsob přípravy substituovaných purinů | |
| Sharma et al. | Synthesis and antiviral evaluation of 2-amino-1, 6-dihydro-6-oxo-9-[4-bis (hydroxymethyl)-2-cyclopenten-1-yl]-9H-purine: an analog of the anti-HIV compound Carbovir |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MA | Patent expired | ||
| MA | Patent expired |
Owner name: THE WELLCOME FOUNDATION LTD |