EA030631B1 - 1,4-дизамещенные аналоги пиридазинхинолина и способы лечения состояний, связанных с smn-дефицитом - Google Patents
1,4-дизамещенные аналоги пиридазинхинолина и способы лечения состояний, связанных с smn-дефицитом Download PDFInfo
- Publication number
- EA030631B1 EA030631B1 EA201690287A EA201690287A EA030631B1 EA 030631 B1 EA030631 B1 EA 030631B1 EA 201690287 A EA201690287 A EA 201690287A EA 201690287 A EA201690287 A EA 201690287A EA 030631 B1 EA030631 B1 EA 030631B1
- Authority
- EA
- Eurasian Patent Office
- Prior art keywords
- methyl
- pyridazin
- tetramethylpiperidin
- amino
- quinolin
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 77
- -1 1,4-disubstituted pyridazine quinoline Chemical class 0.000 title claims description 318
- 229940027991 antiseptic and disinfectant quinoline derivative Drugs 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 246
- 150000003839 salts Chemical class 0.000 claims abstract description 77
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 179
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 claims description 115
- XCRPPAPDRUBKRJ-UHFFFAOYSA-N quinolin-7-ol Chemical compound C1=CC=NC2=CC(O)=CC=C21 XCRPPAPDRUBKRJ-UHFFFAOYSA-N 0.000 claims description 61
- 229910052739 hydrogen Inorganic materials 0.000 claims description 49
- 239000001257 hydrogen Substances 0.000 claims description 49
- 150000002431 hydrogen Chemical class 0.000 claims description 28
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 20
- 229910052736 halogen Inorganic materials 0.000 claims description 20
- 150000002367 halogens Chemical group 0.000 claims description 20
- 229910052700 potassium Inorganic materials 0.000 claims description 18
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 16
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 16
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 10
- GCJZYOIXXVVQKC-UHFFFAOYSA-N 6-hydroxy-2h-isoquinolin-1-one Chemical compound C1=CNC(=O)C=2C1=CC(O)=CC=2 GCJZYOIXXVVQKC-UHFFFAOYSA-N 0.000 claims description 10
- 230000007812 deficiency Effects 0.000 claims description 9
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 6
- BMGVHYDWFZRANN-UHFFFAOYSA-N 6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinazolin-7-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2cncnc2cc1O BMGVHYDWFZRANN-UHFFFAOYSA-N 0.000 claims description 6
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 6
- JXWBBPKJELCLRU-UHFFFAOYSA-N 3-bromo-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2cc(Br)cnc2cc1O JXWBBPKJELCLRU-UHFFFAOYSA-N 0.000 claims description 5
- LNCLQDJLRSOWFL-UHFFFAOYSA-N 3-methyl-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-6-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2ncc(C)cc2cc1O LNCLQDJLRSOWFL-UHFFFAOYSA-N 0.000 claims description 5
- CMVMITNSNBQYBG-UHFFFAOYSA-N 8-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1c(O)ccc2cccnc12 CMVMITNSNBQYBG-UHFFFAOYSA-N 0.000 claims description 5
- RKWWOATWXUKVNQ-UHFFFAOYSA-N 1-amino-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]isoquinolin-6-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2c(N)nccc2cc1O RKWWOATWXUKVNQ-UHFFFAOYSA-N 0.000 claims description 4
- FYDPJWQVSOUHAA-UHFFFAOYSA-N 2-methyl-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-6-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2nc(C)ccc2cc1O FYDPJWQVSOUHAA-UHFFFAOYSA-N 0.000 claims description 4
- VZUWEJZGMQJUTF-UHFFFAOYSA-N 3-(1-methylimidazol-4-yl)-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2cc(cnc2cc1O)-c1cn(C)cn1 VZUWEJZGMQJUTF-UHFFFAOYSA-N 0.000 claims description 4
- PQTSGRNTENIYJY-UHFFFAOYSA-N 3-ethyl-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol Chemical compound CCc1cnc2cc(O)c(cc2c1)-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 PQTSGRNTENIYJY-UHFFFAOYSA-N 0.000 claims description 4
- NYPPBHDATRBQNF-UHFFFAOYSA-N 4-chloro-2-methyl-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2c(Cl)cc(C)nc2cc1O NYPPBHDATRBQNF-UHFFFAOYSA-N 0.000 claims description 4
- SSYLTHILNWJDRE-UHFFFAOYSA-N 4-chloro-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-6-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2nccc(Cl)c2cc1O SSYLTHILNWJDRE-UHFFFAOYSA-N 0.000 claims description 4
- UEQRZGKZFNDJOM-UHFFFAOYSA-N 4-cyclopropyl-2-methyl-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2c(cc(C)nc2cc1O)C1CC1 UEQRZGKZFNDJOM-UHFFFAOYSA-N 0.000 claims description 4
- UISGQKNCYSNSMB-UHFFFAOYSA-N 7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]isoquinolin-6-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2cnccc2cc1O UISGQKNCYSNSMB-UHFFFAOYSA-N 0.000 claims description 4
- PDHGPCYZHVHIEE-UHFFFAOYSA-N 7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-6-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2ncccc2cc1O PDHGPCYZHVHIEE-UHFFFAOYSA-N 0.000 claims description 4
- HFDKNFYGTRBYDP-UHFFFAOYSA-N 7-hydroxy-6-(6-piperazin-1-ylpyridazin-3-yl)quinoline-2-carbonitrile Chemical compound Oc1cc2nc(ccc2cc1-c1ccc(nn1)N1CCNCC1)C#N HFDKNFYGTRBYDP-UHFFFAOYSA-N 0.000 claims description 4
- OEDAUVBPDJGMQP-UHFFFAOYSA-N 1,3-dimethyl-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]isoquinolin-6-ol Chemical compound CC1=NC(=CC2=CC(=C(C=C12)C=1N=NC(=CC=1)N(C1CC(NC(C1)(C)C)(C)C)C)O)C OEDAUVBPDJGMQP-UHFFFAOYSA-N 0.000 claims description 3
- RTGFFVKASDADDP-UHFFFAOYSA-N 1-cyclopropyl-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]isoquinolin-6-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2c(nccc2cc1O)C1CC1 RTGFFVKASDADDP-UHFFFAOYSA-N 0.000 claims description 3
- PQSWLKMDSXVWTM-UHFFFAOYSA-N 1-ethoxy-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]isoquinolin-6-ol Chemical compound CCOc1nccc2cc(O)c(cc12)-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 PQSWLKMDSXVWTM-UHFFFAOYSA-N 0.000 claims description 3
- PGUIUAOENNXRTN-UHFFFAOYSA-N 1-methyl-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]isoquinolin-7-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2ccnc(C)c2cc1O PGUIUAOENNXRTN-UHFFFAOYSA-N 0.000 claims description 3
- HCMLBEFSAKVMAO-UHFFFAOYSA-N 1-methyl-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]isoquinolin-6-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2c(C)nccc2cc1O HCMLBEFSAKVMAO-UHFFFAOYSA-N 0.000 claims description 3
- CNHKRZSIRJZIMJ-UHFFFAOYSA-N 2-methyl-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-4-(oxetan-3-yl)quinolin-7-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2c(cc(C)nc2cc1O)C1COC1 CNHKRZSIRJZIMJ-UHFFFAOYSA-N 0.000 claims description 3
- YMNPTSOPWZOZTM-UHFFFAOYSA-N 2-methyl-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2ccc(C)nc2cc1O YMNPTSOPWZOZTM-UHFFFAOYSA-N 0.000 claims description 3
- FTPCUWZBXFQYSJ-UHFFFAOYSA-N 3-chloro-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2cc(Cl)cnc2cc1O FTPCUWZBXFQYSJ-UHFFFAOYSA-N 0.000 claims description 3
- IZQLWNLOMDVYNM-UHFFFAOYSA-N 3-methyl-7-(6-piperazin-1-ylpyridazin-3-yl)isoquinolin-6-ol Chemical compound Cc1cc2cc(O)c(cc2cn1)-c1ccc(nn1)N1CCNCC1 IZQLWNLOMDVYNM-UHFFFAOYSA-N 0.000 claims description 3
- ZKCBHTOTVWEVDK-UHFFFAOYSA-N 4-(azetidin-1-yl)-2-methyl-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2c(cc(C)nc2cc1O)N1CCC1 ZKCBHTOTVWEVDK-UHFFFAOYSA-N 0.000 claims description 3
- NTQWLOKZEYZZMK-UHFFFAOYSA-N 6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-3-(oxan-4-yl)quinolin-7-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2cc(cnc2cc1O)C1CCOCC1 NTQWLOKZEYZZMK-UHFFFAOYSA-N 0.000 claims description 3
- XJMXYHSLTQIUAX-UHFFFAOYSA-N 6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-3-propan-2-ylquinolin-7-ol Chemical compound CC(C)c1cnc2cc(O)c(cc2c1)-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 XJMXYHSLTQIUAX-UHFFFAOYSA-N 0.000 claims description 3
- ZSZUXEAVYDRBAV-UHFFFAOYSA-N 6-hydroxy-7-(6-piperazin-1-ylpyridazin-3-yl)quinoline-2-carbonitrile Chemical compound Oc1cc2ccc(nc2cc1-c1ccc(nn1)N1CCNCC1)C#N ZSZUXEAVYDRBAV-UHFFFAOYSA-N 0.000 claims description 3
- IIFPGIOUUVZHGZ-UHFFFAOYSA-N 6-hydroxy-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-2H-isoquinolin-1-one Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2c(O)nccc2cc1O IIFPGIOUUVZHGZ-UHFFFAOYSA-N 0.000 claims description 3
- AEKJAPJUDBOCEP-UHFFFAOYSA-N 6-hydroxy-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]isoquinoline-1-carboxamide Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2c(nccc2cc1O)C(N)=O AEKJAPJUDBOCEP-UHFFFAOYSA-N 0.000 claims description 3
- DPISPNALPFPKAB-UHFFFAOYSA-N 6-hydroxy-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinoline-2-carbonitrile Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2nc(ccc2cc1O)C#N DPISPNALPFPKAB-UHFFFAOYSA-N 0.000 claims description 3
- FLVNPTKIPBVYBD-UHFFFAOYSA-N 7-(6-piperazin-1-ylpyridazin-3-yl)isoquinolin-6-ol Chemical compound Oc1cc2ccncc2cc1-c1ccc(nn1)N1CCNCC1 FLVNPTKIPBVYBD-UHFFFAOYSA-N 0.000 claims description 3
- RYENUJYIJKSFCH-UHFFFAOYSA-N 7-[6-(1,2,3,6-tetrahydropyridin-4-yl)pyridazin-3-yl]quinolin-6-ol Chemical compound Oc1cc2cccnc2cc1-c1ccc(nn1)C1=CCNCC1 RYENUJYIJKSFCH-UHFFFAOYSA-N 0.000 claims description 3
- VMQPZOMKVZZBSJ-UHFFFAOYSA-N 7-[6-[methyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyridazin-3-yl]isoquinolin-6-ol Chemical compound CN(C1CC(C)(C)N(C)C(C)(C)C1)c1ccc(nn1)-c1cc2cnccc2cc1O VMQPZOMKVZZBSJ-UHFFFAOYSA-N 0.000 claims description 3
- YBVOKIUNQQDJBQ-UHFFFAOYSA-N 7-hydroxy-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]isoquinoline-1-carbonitrile Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2ccnc(C#N)c2cc1O YBVOKIUNQQDJBQ-UHFFFAOYSA-N 0.000 claims description 3
- QHDMPFUVTSHHJN-UHFFFAOYSA-N 7-hydroxy-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinoline-2-carbonitrile Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2ccc(nc2cc1O)C#N QHDMPFUVTSHHJN-UHFFFAOYSA-N 0.000 claims description 3
- VUQIMGRMLSRSQM-UHFFFAOYSA-N 7-hydroxy-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinoline-2-carboxamide Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2ccc(nc2cc1O)C(N)=O VUQIMGRMLSRSQM-UHFFFAOYSA-N 0.000 claims description 3
- XJFOQYPVXKHCDR-UHFFFAOYSA-N 7-hydroxy-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinoline-3-carbonitrile Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2cc(cnc2cc1O)C#N XJFOQYPVXKHCDR-UHFFFAOYSA-N 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- RHAHDEAGPRJBNP-UHFFFAOYSA-N methyl 6-hydroxy-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinoline-2-carboxylate Chemical compound COC(=O)c1ccc2cc(O)c(cc2n1)-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 RHAHDEAGPRJBNP-UHFFFAOYSA-N 0.000 claims description 3
- SDIHMVVNHVUCGB-UHFFFAOYSA-N 3-bromo-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-6-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2ncc(Br)cc2cc1O SDIHMVVNHVUCGB-UHFFFAOYSA-N 0.000 claims description 2
- LAISJLNYBTWODC-UHFFFAOYSA-N 3-chloro-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-6-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2ncc(Cl)cc2cc1O LAISJLNYBTWODC-UHFFFAOYSA-N 0.000 claims description 2
- XERDUDXIDOFDTR-UHFFFAOYSA-N 4-methoxy-2-methyl-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol Chemical compound COc1cc(C)nc2cc(O)c(cc12)-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 XERDUDXIDOFDTR-UHFFFAOYSA-N 0.000 claims description 2
- MLOYTJQIAFNFIJ-UHFFFAOYSA-N 4-methoxy-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol Chemical compound COc1ccnc2cc(O)c(cc12)-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 MLOYTJQIAFNFIJ-UHFFFAOYSA-N 0.000 claims description 2
- ZFLHXUXUQRZZPS-UHFFFAOYSA-N 5-bromo-3-methyl-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-6-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2ncc(C)cc2c(Br)c1O ZFLHXUXUQRZZPS-UHFFFAOYSA-N 0.000 claims description 2
- STWQJDCKXMIKCQ-UHFFFAOYSA-N 6-hydroxy-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinoline-2-carboxamide Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2nc(ccc2cc1O)C(N)=O STWQJDCKXMIKCQ-UHFFFAOYSA-N 0.000 claims description 2
- MVSUKLWYCKKYGF-UHFFFAOYSA-N 7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-3-propan-2-ylisoquinolin-6-ol Chemical compound C(C)(C)C=1N=CC2=CC(=C(C=C2C=1)O)C=1N=NC(=CC=1)N(C1CC(NC(C1)(C)C)(C)C)C MVSUKLWYCKKYGF-UHFFFAOYSA-N 0.000 claims description 2
- BPWKBWPEQGLJFW-UHFFFAOYSA-N 7-hydroxy-1-methyl-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-2-one Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2ccc(=O)n(C)c2cc1O BPWKBWPEQGLJFW-UHFFFAOYSA-N 0.000 claims description 2
- HIAULMCKQNQJEP-UHFFFAOYSA-N 7-hydroxy-2-methyl-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinoline-4-carbonitrile Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2c(cc(C)nc2cc1O)C#N HIAULMCKQNQJEP-UHFFFAOYSA-N 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 8
- YNHWGIUAGQVDHU-UHFFFAOYSA-N 2-methyl-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-4-morpholin-4-ylquinolin-7-ol Chemical compound CC1=NC2=CC(=C(C=C2C(=C1)N1CCOCC1)C=1N=NC(=CC=1)N(C1CC(NC(C1)(C)C)(C)C)C)O YNHWGIUAGQVDHU-UHFFFAOYSA-N 0.000 claims 1
- WRUMCQLPFBQNFK-UHFFFAOYSA-N 3-cyclopropyl-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]isoquinolin-6-ol Chemical compound C1(CC1)C=1N=CC2=CC(=C(C=C2C=1)O)C=1N=NC(=CC=1)N(C1CC(NC(C1)(C)C)(C)C)C WRUMCQLPFBQNFK-UHFFFAOYSA-N 0.000 claims 1
- JHAVFFZXDSZQQG-UHFFFAOYSA-N 3-imidazol-1-yl-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2cc(cnc2cc1O)-n1ccnc1 JHAVFFZXDSZQQG-UHFFFAOYSA-N 0.000 claims 1
- ZMWFREOFRCUZPZ-UHFFFAOYSA-N 3-methyl-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]isoquinolin-6-ol Chemical compound CC=1N=CC2=CC(=C(C=C2C=1)O)C=1N=NC(=CC=1)N(C1CC(NC(C1)(C)C)(C)C)C ZMWFREOFRCUZPZ-UHFFFAOYSA-N 0.000 claims 1
- YXOVSPBORCIRFW-UHFFFAOYSA-N 3-propan-2-yl-7-[6-(2,2,6,6-tetramethylpiperidin-4-yl)oxypyridazin-3-yl]isoquinolin-6-ol Chemical compound C(C)(C)C=1N=CC2=CC(=C(C=C2C=1)O)C=1N=NC(=CC=1)OC1CC(NC(C1)(C)C)(C)C YXOVSPBORCIRFW-UHFFFAOYSA-N 0.000 claims 1
- REAJINFOLSJWGJ-UHFFFAOYSA-N 3-propyl-7-[6-(2,2,6,6-tetramethylpiperidin-4-yl)oxypyridazin-3-yl]isoquinolin-6-ol Chemical compound C(CC)C=1N=CC2=CC(=C(C=C2C=1)O)C=1N=NC(=CC=1)OC1CC(NC(C1)(C)C)(C)C REAJINFOLSJWGJ-UHFFFAOYSA-N 0.000 claims 1
- GPAJYJLFDSHYCB-UHFFFAOYSA-N 4-(dimethylamino)-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol Chemical compound CN(C1=CC=NC2=CC(=C(C=C12)C=1N=NC(=CC=1)N(C1CC(NC(C1)(C)C)(C)C)C)O)C GPAJYJLFDSHYCB-UHFFFAOYSA-N 0.000 claims 1
- DDLLOLGACFZYDU-UHFFFAOYSA-N 4-ethoxy-2-methyl-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol Chemical compound C(C)OC1=CC(=NC2=CC(=C(C=C12)C=1N=NC(=CC=1)N(C1CC(NC(C1)(C)C)(C)C)C)O)C DDLLOLGACFZYDU-UHFFFAOYSA-N 0.000 claims 1
- OZCFUWGMZGTCSF-UHFFFAOYSA-N 6-[6-[methyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol Chemical compound CN(C1CC(C)(C)N(C)C(C)(C)C1)c1ccc(nn1)-c1cc2cccnc2cc1O OZCFUWGMZGTCSF-UHFFFAOYSA-N 0.000 claims 1
- NBDLBNPFPBBYKY-UHFFFAOYSA-N 6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2cccnc2cc1O NBDLBNPFPBBYKY-UHFFFAOYSA-N 0.000 claims 1
- HTFHFUDOJSBNJA-UHFFFAOYSA-N 6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinoline-3,7-diol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2cc(O)cnc2cc1O HTFHFUDOJSBNJA-UHFFFAOYSA-N 0.000 claims 1
- DFBCSZAWLKXZKN-UHFFFAOYSA-N 7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-3-phenylisoquinolin-6-ol Chemical compound CN(C1=CC=C(N=N1)C1=C(C=C2C=C(N=CC2=C1)C1=CC=CC=C1)O)C1CC(NC(C1)(C)C)(C)C DFBCSZAWLKXZKN-UHFFFAOYSA-N 0.000 claims 1
- NVHXMNNCHAFIHX-UHFFFAOYSA-N pyridazin-3-amine Chemical compound NC1=CC=C=N[N]1 NVHXMNNCHAFIHX-UHFFFAOYSA-N 0.000 claims 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 23
- 238000004519 manufacturing process Methods 0.000 abstract description 8
- 230000001225 therapeutic effect Effects 0.000 abstract description 5
- 239000013543 active substance Substances 0.000 abstract description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 366
- 239000000203 mixture Substances 0.000 description 255
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 186
- 238000007429 general method Methods 0.000 description 183
- 239000007787 solid Substances 0.000 description 135
- 239000000543 intermediate Substances 0.000 description 126
- 239000011541 reaction mixture Substances 0.000 description 125
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 115
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 105
- 230000015572 biosynthetic process Effects 0.000 description 105
- 238000003786 synthesis reaction Methods 0.000 description 96
- 239000000243 solution Substances 0.000 description 88
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 74
- 238000010898 silica gel chromatography Methods 0.000 description 69
- 238000006243 chemical reaction Methods 0.000 description 66
- 238000000746 purification Methods 0.000 description 58
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 56
- 239000007864 aqueous solution Substances 0.000 description 48
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 45
- 239000000047 product Substances 0.000 description 43
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 42
- 239000012043 crude product Substances 0.000 description 38
- PWCHLICTKMYGRZ-UHFFFAOYSA-N 4-(2,2,6,6-tetramethylpiperidin-4-yl)pyridazin-3-amine Chemical compound CC1(C)CC(CC(C)(C)N1)c1ccnnc1N PWCHLICTKMYGRZ-UHFFFAOYSA-N 0.000 description 37
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 37
- 239000002904 solvent Substances 0.000 description 36
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 34
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 34
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 34
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 33
- 108090000623 proteins and genes Proteins 0.000 description 33
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 32
- 239000013058 crude material Substances 0.000 description 32
- 239000000284 extract Substances 0.000 description 31
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 30
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 30
- 125000000217 alkyl group Chemical group 0.000 description 29
- 239000000741 silica gel Substances 0.000 description 29
- 229910002027 silica gel Inorganic materials 0.000 description 29
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 28
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 28
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N DMSO Substances CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 27
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 27
- 125000000623 heterocyclic group Chemical group 0.000 description 26
- 229920006395 saturated elastomer Polymers 0.000 description 26
- 201000010099 disease Diseases 0.000 description 25
- GPVPDRHTRGTSIH-UHFFFAOYSA-N isoquinolin-6-ol Chemical compound C1=NC=CC2=CC(O)=CC=C21 GPVPDRHTRGTSIH-UHFFFAOYSA-N 0.000 description 25
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 24
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 24
- 230000002829 reductive effect Effects 0.000 description 24
- 239000012267 brine Substances 0.000 description 23
- 238000004007 reversed phase HPLC Methods 0.000 description 23
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 23
- 238000010511 deprotection reaction Methods 0.000 description 22
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 22
- 239000003607 modifier Substances 0.000 description 21
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 21
- 239000000725 suspension Substances 0.000 description 21
- 239000000460 chlorine Substances 0.000 description 20
- 239000012071 phase Substances 0.000 description 20
- 102000004169 proteins and genes Human genes 0.000 description 20
- 230000002441 reversible effect Effects 0.000 description 20
- 239000003708 ampul Substances 0.000 description 19
- 239000008346 aqueous phase Substances 0.000 description 18
- 238000004587 chromatography analysis Methods 0.000 description 18
- 125000001072 heteroaryl group Chemical group 0.000 description 18
- 239000011777 magnesium Substances 0.000 description 18
- 238000002953 preparative HPLC Methods 0.000 description 18
- 125000006239 protecting group Chemical group 0.000 description 18
- 208000002320 spinal muscular atrophy Diseases 0.000 description 18
- 229910021529 ammonia Inorganic materials 0.000 description 17
- 239000010410 layer Substances 0.000 description 17
- 229910052757 nitrogen Inorganic materials 0.000 description 17
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 16
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 16
- 229910052805 deuterium Inorganic materials 0.000 description 16
- 239000012074 organic phase Substances 0.000 description 16
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 16
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 15
- 239000000706 filtrate Substances 0.000 description 15
- 239000012458 free base Substances 0.000 description 15
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 14
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 14
- 239000000908 ammonium hydroxide Substances 0.000 description 14
- 239000003814 drug Substances 0.000 description 14
- 230000000694 effects Effects 0.000 description 14
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 14
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 14
- 239000002244 precipitate Substances 0.000 description 14
- 239000011734 sodium Substances 0.000 description 14
- 239000002253 acid Substances 0.000 description 13
- 239000003153 chemical reaction reagent Substances 0.000 description 13
- OVYWMEWYEJLIER-UHFFFAOYSA-N quinolin-6-ol Chemical compound N1=CC=CC2=CC(O)=CC=C21 OVYWMEWYEJLIER-UHFFFAOYSA-N 0.000 description 13
- 238000010992 reflux Methods 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 125000003118 aryl group Chemical group 0.000 description 12
- 239000012044 organic layer Substances 0.000 description 12
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 description 11
- 125000006650 (C2-C4) alkynyl group Chemical group 0.000 description 11
- 238000004458 analytical method Methods 0.000 description 11
- 210000004027 cell Anatomy 0.000 description 11
- 238000002360 preparation method Methods 0.000 description 11
- XYVMOLOUBJBNBF-UHFFFAOYSA-N 3h-1,3-oxazol-2-one Chemical compound OC1=NC=CO1 XYVMOLOUBJBNBF-UHFFFAOYSA-N 0.000 description 10
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 10
- 239000004480 active ingredient Substances 0.000 description 10
- 125000005605 benzo group Chemical group 0.000 description 10
- 229910052799 carbon Inorganic materials 0.000 description 10
- 230000017858 demethylation Effects 0.000 description 10
- 238000010520 demethylation reaction Methods 0.000 description 10
- 238000001914 filtration Methods 0.000 description 10
- 125000005842 heteroatom Chemical group 0.000 description 10
- OKKJLVBELUTLKV-VMNATFBRSA-N methanol-d1 Chemical compound [2H]OC OKKJLVBELUTLKV-VMNATFBRSA-N 0.000 description 10
- 239000003921 oil Substances 0.000 description 10
- 235000019198 oils Nutrition 0.000 description 10
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical compound C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 description 10
- 125000006413 ring segment Chemical group 0.000 description 10
- 239000007858 starting material Substances 0.000 description 10
- 239000003826 tablet Substances 0.000 description 10
- 238000012360 testing method Methods 0.000 description 10
- 239000002585 base Substances 0.000 description 9
- 239000000463 material Substances 0.000 description 9
- 201000000585 muscular atrophy Diseases 0.000 description 9
- LETVJWLLIMJADE-UHFFFAOYSA-N pyridazin-3-amine Chemical compound NC1=CC=CN=N1 LETVJWLLIMJADE-UHFFFAOYSA-N 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- 108020004414 DNA Proteins 0.000 description 8
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 8
- 125000004429 atom Chemical group 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- 208000035475 disorder Diseases 0.000 description 8
- 150000002430 hydrocarbons Chemical group 0.000 description 8
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 125000001424 substituent group Chemical group 0.000 description 8
- 238000002560 therapeutic procedure Methods 0.000 description 8
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- 239000003795 chemical substances by application Substances 0.000 description 7
- 229910052801 chlorine Inorganic materials 0.000 description 7
- 238000010828 elution Methods 0.000 description 7
- 235000019253 formic acid Nutrition 0.000 description 7
- 229910052738 indium Inorganic materials 0.000 description 7
- 230000002401 inhibitory effect Effects 0.000 description 7
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 7
- 238000002955 isolation Methods 0.000 description 7
- 210000002161 motor neuron Anatomy 0.000 description 7
- WDXARTMCIRVMAE-UHFFFAOYSA-N quinoline-2-carbonitrile Chemical compound C1=CC=CC2=NC(C#N)=CC=C21 WDXARTMCIRVMAE-UHFFFAOYSA-N 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- 208000024891 symptom Diseases 0.000 description 7
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 6
- 239000011575 calcium Substances 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 6
- VDBNYAPERZTOOF-UHFFFAOYSA-N isoquinolin-1(2H)-one Chemical compound C1=CC=C2C(=O)NC=CC2=C1 VDBNYAPERZTOOF-UHFFFAOYSA-N 0.000 description 6
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 6
- 230000001404 mediated effect Effects 0.000 description 6
- 108020004999 messenger RNA Proteins 0.000 description 6
- 125000002950 monocyclic group Chemical group 0.000 description 6
- 210000003205 muscle Anatomy 0.000 description 6
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 6
- 239000012041 precatalyst Substances 0.000 description 6
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 6
- RQPVXTQTNVVKEJ-UHFFFAOYSA-N quinoxalin-6-ol Chemical compound N1=CC=NC2=CC(O)=CC=C21 RQPVXTQTNVVKEJ-UHFFFAOYSA-N 0.000 description 6
- 238000013456 study Methods 0.000 description 6
- 229940124597 therapeutic agent Drugs 0.000 description 6
- GUSWJGOYDXFJSI-UHFFFAOYSA-N 3,6-dichloropyridazine Chemical compound ClC1=CC=C(Cl)N=N1 GUSWJGOYDXFJSI-UHFFFAOYSA-N 0.000 description 5
- PSHMOAMQURRJLX-UHFFFAOYSA-N CC1(CC(CC(N1)(C)C)N(C)C2=NN=C(C=C2)C3=CC4=C(C=C3)C=CC(=N4)C#N)C Chemical compound CC1(CC(CC(N1)(C)C)N(C)C2=NN=C(C=C2)C3=CC4=C(C=C3)C=CC(=N4)C#N)C PSHMOAMQURRJLX-UHFFFAOYSA-N 0.000 description 5
- QJDLKZSJQVEQHX-UHFFFAOYSA-N CCOc1cc(N)c(N)cc1Br Chemical compound CCOc1cc(N)c(N)cc1Br QJDLKZSJQVEQHX-UHFFFAOYSA-N 0.000 description 5
- FTHAZWLZPJURPZ-UHFFFAOYSA-N CCOc1nccc2cc(OC)c(cc12)B1OC(C)(C)C(C)(C)O1 Chemical compound CCOc1nccc2cc(OC)c(cc12)B1OC(C)(C)C(C)(C)O1 FTHAZWLZPJURPZ-UHFFFAOYSA-N 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 5
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 5
- 239000005089 Luciferase Substances 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 5
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 5
- 125000002619 bicyclic group Chemical group 0.000 description 5
- 239000000872 buffer Substances 0.000 description 5
- 150000001721 carbon Chemical group 0.000 description 5
- 238000004132 cross linking Methods 0.000 description 5
- 125000005843 halogen group Chemical group 0.000 description 5
- 230000003287 optical effect Effects 0.000 description 5
- 235000011056 potassium acetate Nutrition 0.000 description 5
- 239000007921 spray Substances 0.000 description 5
- GDIRCPUYAABDNW-UHFFFAOYSA-N (7-methoxy-2-methyl-4-oxo-1H-quinolin-6-yl)boronic acid Chemical compound COc1cc2[nH]c(C)cc(=O)c2cc1B(O)O GDIRCPUYAABDNW-UHFFFAOYSA-N 0.000 description 4
- GZOKAVHTSXSLNB-UHFFFAOYSA-N 1,1-dimethoxypropan-2-amine Chemical compound COC(OC)C(C)N GZOKAVHTSXSLNB-UHFFFAOYSA-N 0.000 description 4
- YJLUBHOZZTYQIP-UHFFFAOYSA-N 2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NN=C(O1)CC(=O)N1CC2=C(CC1)NN=N2 YJLUBHOZZTYQIP-UHFFFAOYSA-N 0.000 description 4
- ATTFTXASVWTGHE-UHFFFAOYSA-N 2-amino-5-bromo-4-methoxybenzaldehyde Chemical compound COC1=CC(N)=C(C=O)C=C1Br ATTFTXASVWTGHE-UHFFFAOYSA-N 0.000 description 4
- CAXSNQIZSZMCCE-UHFFFAOYSA-N 2-methyl-4-(1-methylpyrazol-4-yl)-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2c(cc(C)nc2cc1O)-c1cnn(C)c1 CAXSNQIZSZMCCE-UHFFFAOYSA-N 0.000 description 4
- IBWYHNOFSKJKKY-UHFFFAOYSA-N 3-chloropyridazine Chemical compound ClC1=CC=CN=N1 IBWYHNOFSKJKKY-UHFFFAOYSA-N 0.000 description 4
- CTCIPOUJESJUJS-UHFFFAOYSA-N 6-bromo-7-methoxy-2-oxidoisoquinolin-2-ium Chemical compound [O-][N+]1=CC=C2C=C(Br)C(OC)=CC2=C1 CTCIPOUJESJUJS-UHFFFAOYSA-N 0.000 description 4
- UACHUBQTGCSWOR-UHFFFAOYSA-N 6-bromo-7-methoxyquinoline Chemical compound C1=CC=C2C=C(Br)C(OC)=CC2=N1 UACHUBQTGCSWOR-UHFFFAOYSA-N 0.000 description 4
- JSNVQSUOPCWXNJ-UHFFFAOYSA-N 6-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline-1-carbonitrile Chemical compound COc1cc2ccnc(C#N)c2cc1B1OC(C)(C)C(C)(C)O1 JSNVQSUOPCWXNJ-UHFFFAOYSA-N 0.000 description 4
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- KNRGQQVFZDSSNZ-UHFFFAOYSA-N BrC1=C(C=C2C=C[N+](=CC2=C1)[O-])OC Chemical compound BrC1=C(C=C2C=C[N+](=CC2=C1)[O-])OC KNRGQQVFZDSSNZ-UHFFFAOYSA-N 0.000 description 4
- REILZWAZOVXDCR-UHFFFAOYSA-N COc1cc(CO)c(N)cc1Br Chemical compound COc1cc(CO)c(N)cc1Br REILZWAZOVXDCR-UHFFFAOYSA-N 0.000 description 4
- YAPXQAHAMKKAGV-UHFFFAOYSA-N COc1cc2c(cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1)[nH]ccc2=O Chemical compound COc1cc2c(cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1)[nH]ccc2=O YAPXQAHAMKKAGV-UHFFFAOYSA-N 0.000 description 4
- CLVSXFBVUXPTPR-UHFFFAOYSA-N COc1cc2cnc(C)cc2cc1Br Chemical compound COc1cc2cnc(C)cc2cc1Br CLVSXFBVUXPTPR-UHFFFAOYSA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- 206010010356 Congenital anomaly Diseases 0.000 description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 108060001084 Luciferase Proteins 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- 241000283973 Oryctolagus cuniculus Species 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical group C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 208000006269 X-Linked Bulbo-Spinal Atrophy Diseases 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Substances CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 230000004913 activation Effects 0.000 description 4
- 125000002947 alkylene group Chemical group 0.000 description 4
- 239000012298 atmosphere Substances 0.000 description 4
- SDQJTWBNWQABLE-UHFFFAOYSA-N benzoylene urea Natural products C1=CC=C2C(=O)NC(=O)NC2=C1 SDQJTWBNWQABLE-UHFFFAOYSA-N 0.000 description 4
- 229930189065 blasticidin Natural products 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- 239000003086 colorant Substances 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- 238000011161 development Methods 0.000 description 4
- 230000018109 developmental process Effects 0.000 description 4
- 239000002552 dosage form Substances 0.000 description 4
- 239000003937 drug carrier Substances 0.000 description 4
- 239000011737 fluorine Substances 0.000 description 4
- 229910052731 fluorine Inorganic materials 0.000 description 4
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 description 4
- 230000000670 limiting effect Effects 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 229910052749 magnesium Inorganic materials 0.000 description 4
- 230000007246 mechanism Effects 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- RFIOZSIHFNEKFF-UHFFFAOYSA-M piperazine-1-carboxylate Chemical compound [O-]C(=O)N1CCNCC1 RFIOZSIHFNEKFF-UHFFFAOYSA-M 0.000 description 4
- RFIOZSIHFNEKFF-UHFFFAOYSA-N piperazine-1-carboxylic acid Chemical compound OC(=O)N1CCNCC1 RFIOZSIHFNEKFF-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000003755 preservative agent Substances 0.000 description 4
- 239000000651 prodrug Substances 0.000 description 4
- 229940002612 prodrug Drugs 0.000 description 4
- PMZDQRJGMBOQBF-UHFFFAOYSA-N quinolin-4-ol Chemical compound C1=CC=C2C(O)=CC=NC2=C1 PMZDQRJGMBOQBF-UHFFFAOYSA-N 0.000 description 4
- ZEXKKIXCRDTKBF-UHFFFAOYSA-N quinoline-2-carboxamide Chemical compound C1=CC=CC2=NC(C(=O)N)=CC=C21 ZEXKKIXCRDTKBF-UHFFFAOYSA-N 0.000 description 4
- 238000007363 ring formation reaction Methods 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000012453 solvate Substances 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- 238000006467 substitution reaction Methods 0.000 description 4
- MIXODQAAOQHDTG-UHFFFAOYSA-N tert-butyl 4-(6-chloropyridazin-3-yl)piperazine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCN1C1=CC=C(Cl)N=N1 MIXODQAAOQHDTG-UHFFFAOYSA-N 0.000 description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- 230000000699 topical effect Effects 0.000 description 4
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- YADVRGBMVCQOIA-UHFFFAOYSA-N (2-amino-5-bromo-4-methoxyphenyl)methanol Chemical compound COC1=CC(N)=C(CO)C=C1Br YADVRGBMVCQOIA-UHFFFAOYSA-N 0.000 description 3
- ALJYAXXNTCOWFR-UHFFFAOYSA-N (6-methoxy-2-methylquinolin-7-yl)boronic acid Chemical compound COc1cc2ccc(C)nc2cc1B(O)O ALJYAXXNTCOWFR-UHFFFAOYSA-N 0.000 description 3
- CBPABMPHIZIVNK-UHFFFAOYSA-N (6-methoxy-3-methylquinolin-7-yl)boronic acid Chemical compound COc1cc2cc(C)cnc2cc1B(O)O CBPABMPHIZIVNK-UHFFFAOYSA-N 0.000 description 3
- VDUSVXZZRLOLDM-UHFFFAOYSA-N (6-methoxyisoquinolin-7-yl)boronic acid Chemical compound COC=1C=C2C=CN=CC2=CC=1B(O)O VDUSVXZZRLOLDM-UHFFFAOYSA-N 0.000 description 3
- DNURXVYDURMBTO-UHFFFAOYSA-N (7-ethoxy-3-methylquinoxalin-6-yl)boronic acid Chemical compound CCOc1cc2ncc(C)nc2cc1B(O)O DNURXVYDURMBTO-UHFFFAOYSA-N 0.000 description 3
- QYUWOEDGGVXPJM-UHFFFAOYSA-N (7-methoxy-2-oxo-1H-quinolin-6-yl)boronic acid Chemical compound COc1cc2[nH]c(=O)ccc2cc1B(O)O QYUWOEDGGVXPJM-UHFFFAOYSA-N 0.000 description 3
- YZMDDPNRNSJEAP-UHFFFAOYSA-N (7-methoxyisoquinolin-6-yl)boronic acid Chemical compound COC1=C(C=C2C=CN=CC2=C1)B(O)O YZMDDPNRNSJEAP-UHFFFAOYSA-N 0.000 description 3
- SHMJEIWQGMIYND-UHFFFAOYSA-N (7-phenylmethoxyquinolin-8-yl)boronic acid Chemical compound OB(O)c1c(OCc2ccccc2)ccc2cccnc12 SHMJEIWQGMIYND-UHFFFAOYSA-N 0.000 description 3
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 description 3
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 3
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 3
- KZEVSDGEBAJOTK-UHFFFAOYSA-N 1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-2-[5-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]ethanone Chemical compound N1N=NC=2CN(CCC=21)C(CC=1OC(=NN=1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)=O KZEVSDGEBAJOTK-UHFFFAOYSA-N 0.000 description 3
- JZVCMOJSPCGLTC-UHFFFAOYSA-N 1020717-99-0 Chemical compound OC(=O)C1=CC(F)=C(Br)C=C1[N+]([O-])=O JZVCMOJSPCGLTC-UHFFFAOYSA-N 0.000 description 3
- ZRPAUEVGEGEPFQ-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]pyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2 ZRPAUEVGEGEPFQ-UHFFFAOYSA-N 0.000 description 3
- ICTRNDFVFBPDJT-UHFFFAOYSA-N 2-[6-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-1-yl]isoindole-1,3-dione Chemical compound COc1cc2ccnc(N3C(=O)c4ccccc4C3=O)c2cc1B1OC(C)(C)C(C)(C)O1 ICTRNDFVFBPDJT-UHFFFAOYSA-N 0.000 description 3
- MFBXUCNGQIZZLN-UHFFFAOYSA-N 2-amino-4-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C(N)=C1 MFBXUCNGQIZZLN-UHFFFAOYSA-N 0.000 description 3
- YTAASTFSTXYEIX-UHFFFAOYSA-N 2-amino-5-bromo-4-methoxybenzoic acid Chemical compound COC1=CC(N)=C(C(O)=O)C=C1Br YTAASTFSTXYEIX-UHFFFAOYSA-N 0.000 description 3
- ZMEUGHNBUHVZQU-UHFFFAOYSA-N 4-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyridazin-3-amine Chemical compound CN1C(CC(CC1(C)C)C1=C(N=NC=C1)N)(C)C ZMEUGHNBUHVZQU-UHFFFAOYSA-N 0.000 description 3
- RUTNWXBHRAIQSP-UHFFFAOYSA-N 4-bromo-3-methoxyaniline Chemical compound COC1=CC(N)=CC=C1Br RUTNWXBHRAIQSP-UHFFFAOYSA-N 0.000 description 3
- OMAONLDTAXRLNK-UHFFFAOYSA-N 4-chloro-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2c(Cl)ccnc2cc1O OMAONLDTAXRLNK-UHFFFAOYSA-N 0.000 description 3
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 3
- MDBXQYGPASNWCF-UHFFFAOYSA-N 5-[(4-bromo-3-methoxyanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione Chemical compound C1=C(Br)C(OC)=CC(NC=C2C(OC(C)(C)OC2=O)=O)=C1 MDBXQYGPASNWCF-UHFFFAOYSA-N 0.000 description 3
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 3
- WYOOKLVWUVBNQJ-UHFFFAOYSA-N 6-bromo-7-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C=C(O)C(Br)=C2 WYOOKLVWUVBNQJ-UHFFFAOYSA-N 0.000 description 3
- JPXWREWDTVNWQS-UHFFFAOYSA-N 6-bromo-7-methoxy-1-methyl-3,4-dihydroquinolin-2-one Chemical compound CN1C(=O)CCC2=C1C=C(OC)C(Br)=C2 JPXWREWDTVNWQS-UHFFFAOYSA-N 0.000 description 3
- WSJIADZBJSYSIW-UHFFFAOYSA-N 6-bromo-7-methoxy-1h-quinazolin-4-one Chemical compound N1=CNC(=O)C2=C1C=C(OC)C(Br)=C2 WSJIADZBJSYSIW-UHFFFAOYSA-N 0.000 description 3
- AYNMXUJMSXVSBU-UHFFFAOYSA-N 6-bromo-7-methoxy-2-methyl-1h-quinolin-4-one Chemical compound CC1=CC(O)=C2C=C(Br)C(OC)=CC2=N1 AYNMXUJMSXVSBU-UHFFFAOYSA-N 0.000 description 3
- LDGVJQBLUIJOPD-UHFFFAOYSA-N 6-bromo-7-methoxyisoquinoline Chemical compound N1=CC=C2C=C(Br)C(OC)=CC2=C1 LDGVJQBLUIJOPD-UHFFFAOYSA-N 0.000 description 3
- UDHSWGVPTLIGSE-UHFFFAOYSA-N 6-bromo-7-methoxyquinazoline Chemical compound C1=NC=C2C=C(Br)C(OC)=CC2=N1 UDHSWGVPTLIGSE-UHFFFAOYSA-N 0.000 description 3
- ATKGMSAEUVWOCI-UHFFFAOYSA-N 6-chloro-7-methoxy-1-oxidoquinolin-1-ium Chemical compound C1=CC=C2C=C(Cl)C(OC)=CC2=[N+]1[O-] ATKGMSAEUVWOCI-UHFFFAOYSA-N 0.000 description 3
- PCOIAVAXFTXGAX-UHFFFAOYSA-N 6-chloro-7-methoxyquinoline Chemical compound C1=CC=C2C=C(Cl)C(OC)=CC2=N1 PCOIAVAXFTXGAX-UHFFFAOYSA-N 0.000 description 3
- FYBNHINAWQOOCT-UHFFFAOYSA-N 6-ethoxy-2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline Chemical compound CCOc1cc2ncc(C)nc2cc1B1OC(C)(C)C(C)(C)O1 FYBNHINAWQOOCT-UHFFFAOYSA-N 0.000 description 3
- VTVSSLTXLCKHCZ-UHFFFAOYSA-N 6-methoxy-1-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline Chemical compound COc1cc2ccnc(C)c2cc1B1OC(C)(C)C(C)(C)O1 VTVSSLTXLCKHCZ-UHFFFAOYSA-N 0.000 description 3
- FFYNMDCJSFWPJI-UHFFFAOYSA-N 6-methoxy-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole Chemical compound COc1cc2nn(C)cc2cc1B1OC(C)(C)C(C)(C)O1 FFYNMDCJSFWPJI-UHFFFAOYSA-N 0.000 description 3
- KAUTUNCDUJLDTJ-UHFFFAOYSA-N 7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinoxalin-6-ol hydrochloride Chemical compound Cl.CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2nccnc2cc1O KAUTUNCDUJLDTJ-UHFFFAOYSA-N 0.000 description 3
- PPIUOJLFVXPVET-UHFFFAOYSA-N 7-bromo-1-chloro-6-methoxyisoquinoline Chemical compound C1=NC(Cl)=C2C=C(Br)C(OC)=CC2=C1 PPIUOJLFVXPVET-UHFFFAOYSA-N 0.000 description 3
- NYACWLFLEHSJSS-UHFFFAOYSA-N 7-bromo-6-methoxy-1-methylisoquinoline Chemical compound C1=NC(C)=C2C=C(Br)C(OC)=CC2=C1 NYACWLFLEHSJSS-UHFFFAOYSA-N 0.000 description 3
- JDLROPKCBPAQGJ-UHFFFAOYSA-N 7-bromo-6-methoxy-2-methylquinoline Chemical compound C1=C(C)N=C2C=C(Br)C(OC)=CC2=C1 JDLROPKCBPAQGJ-UHFFFAOYSA-N 0.000 description 3
- SALVVNBIQORSAL-UHFFFAOYSA-N 7-bromo-6-methoxyisoquinoline Chemical compound C1=NC=C2C=C(Br)C(OC)=CC2=C1 SALVVNBIQORSAL-UHFFFAOYSA-N 0.000 description 3
- PUVNBWJBWQUILR-UHFFFAOYSA-N 7-bromo-6-methoxyquinoline Chemical compound C1=CN=C2C=C(Br)C(OC)=CC2=C1 PUVNBWJBWQUILR-UHFFFAOYSA-N 0.000 description 3
- IMLXOQRBTBGKRP-UHFFFAOYSA-N 7-ethoxy-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline Chemical compound CCOc1cc2nc(C)cnc2cc1B1OC(C)(C)C(C)(C)O1 IMLXOQRBTBGKRP-UHFFFAOYSA-N 0.000 description 3
- DRVYAHOGFDSAJR-UHFFFAOYSA-N 7-hydroxy-1-methyl-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-3,4-dihydroquinolin-2-one Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2CCC(=O)N(C)c2cc1O DRVYAHOGFDSAJR-UHFFFAOYSA-N 0.000 description 3
- IZPBAJNYUBZFLY-UHFFFAOYSA-N 7-hydroxy-1-methyl-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-2-one hydrochloride Chemical compound Cl.CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2ccc(=O)n(C)c2cc1O IZPBAJNYUBZFLY-UHFFFAOYSA-N 0.000 description 3
- IDCZPELYVBFAJI-UHFFFAOYSA-N 7-hydroxy-3-methyl-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]isoquinoline-1-carbonitrile Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2cc(C)nc(C#N)c2cc1O IDCZPELYVBFAJI-UHFFFAOYSA-N 0.000 description 3
- AXDQJGREOXEECG-UHFFFAOYSA-N 7-hydroxy-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-3H-quinazolin-4-one Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2c(cc1O)[nH]cnc2=O AXDQJGREOXEECG-UHFFFAOYSA-N 0.000 description 3
- BWNARWBVYPIJJU-UHFFFAOYSA-N 7-methoxy-1-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydroquinolin-2-one Chemical compound COc1cc2N(C)C(=O)CCc2cc1B1OC(C)(C)C(C)(C)O1 BWNARWBVYPIJJU-UHFFFAOYSA-N 0.000 description 3
- SIAHCGIFTDTFOR-UHFFFAOYSA-N 7-methoxy-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinolin-4-one Chemical compound COc1cc2[nH]c(C)cc(=O)c2cc1B1OC(C)(C)C(C)(C)O1 SIAHCGIFTDTFOR-UHFFFAOYSA-N 0.000 description 3
- IHWLFBJHCQDAKM-UHFFFAOYSA-N 7-methoxy-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline Chemical compound COc1cc2nc(C)ncc2cc1B1OC(C)(C)C(C)(C)O1 IHWLFBJHCQDAKM-UHFFFAOYSA-N 0.000 description 3
- MSLHXTVLIMOWSV-UHFFFAOYSA-N 7-methoxy-2-methyl-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-1H-quinolin-4-one Chemical compound COc1cc2[nH]c(C)cc(=O)c2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 MSLHXTVLIMOWSV-UHFFFAOYSA-N 0.000 description 3
- CMHGQVRDPNKUFK-UHFFFAOYSA-N 7-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinolin-2-one Chemical compound COc1cc2[nH]c(=O)ccc2cc1B1OC(C)(C)C(C)(C)O1 CMHGQVRDPNKUFK-UHFFFAOYSA-N 0.000 description 3
- IGWWEHSGGQTBKZ-UHFFFAOYSA-N 7-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-quinazolin-4-one Chemical compound COc1cc2[nH]cnc(=O)c2cc1B1OC(C)(C)C(C)(C)O1 IGWWEHSGGQTBKZ-UHFFFAOYSA-N 0.000 description 3
- IJCZCUJHAPUIRV-UHFFFAOYSA-N 7-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline Chemical compound COc1cc2ncncc2cc1B1OC(C)(C)C(C)(C)O1 IJCZCUJHAPUIRV-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- AJIICIOLVBPEPC-UHFFFAOYSA-N BrC1=C(C=C2C=CN(C(C2=C1)=O)CC)OC Chemical compound BrC1=C(C=C2C=CN(C(C2=C1)=O)CC)OC AJIICIOLVBPEPC-UHFFFAOYSA-N 0.000 description 3
- ZDEJTJYLTURBKZ-UHFFFAOYSA-N BrC1=C(C=C2C=CN=C(C2=C1)C#N)OC Chemical compound BrC1=C(C=C2C=CN=C(C2=C1)C#N)OC ZDEJTJYLTURBKZ-UHFFFAOYSA-N 0.000 description 3
- FHKOZHIMPYMIRJ-UHFFFAOYSA-N BrC1=C(C=C2C=CN=C(C2=C1)N1C(C2=CC=CC=C2C1=O)=O)OC Chemical compound BrC1=C(C=C2C=CN=C(C2=C1)N1C(C2=CC=CC=C2C1=O)=O)OC FHKOZHIMPYMIRJ-UHFFFAOYSA-N 0.000 description 3
- WRSAWKZWBZPVKJ-UHFFFAOYSA-N BrC1=C(C=C2C=CN=C(C2=C1)OCC)OC Chemical compound BrC1=C(C=C2C=CN=C(C2=C1)OCC)OC WRSAWKZWBZPVKJ-UHFFFAOYSA-N 0.000 description 3
- GTXZLDCWCDLDLE-UHFFFAOYSA-N Brc1c(OCc2ccccc2)ccc2cccnc12 Chemical compound Brc1c(OCc2ccccc2)ccc2cccnc12 GTXZLDCWCDLDLE-UHFFFAOYSA-N 0.000 description 3
- YGIHQIBXKVTAGY-UHFFFAOYSA-N Brc1cc2c(cc1OCc1ccccc1)[nH]c(=O)[nH]c2=O Chemical compound Brc1cc2c(cc1OCc1ccccc1)[nH]c(=O)[nH]c2=O YGIHQIBXKVTAGY-UHFFFAOYSA-N 0.000 description 3
- SSEIJJFKBYCOQE-UHFFFAOYSA-N CCOc1cc2nc(C)c(C)nc2cc1Br Chemical compound CCOc1cc2nc(C)c(C)nc2cc1Br SSEIJJFKBYCOQE-UHFFFAOYSA-N 0.000 description 3
- CJVFMJQMEBLGBR-UHFFFAOYSA-N CCOc1cc2nc(C)cnc2cc1Br Chemical compound CCOc1cc2nc(C)cnc2cc1Br CJVFMJQMEBLGBR-UHFFFAOYSA-N 0.000 description 3
- WYNOATUIUFKTOB-UHFFFAOYSA-N CCOc1cc2ncc(C)nc2cc1Br Chemical compound CCOc1cc2ncc(C)nc2cc1Br WYNOATUIUFKTOB-UHFFFAOYSA-N 0.000 description 3
- XILARMZPKYBIGD-UHFFFAOYSA-N CCOc1cc2nccnc2cc1Br Chemical compound CCOc1cc2nccnc2cc1Br XILARMZPKYBIGD-UHFFFAOYSA-N 0.000 description 3
- WUKLMWOCQBTUSM-UHFFFAOYSA-N CCc1cnc2cc(OC)c(Br)cc2c1 Chemical compound CCc1cnc2cc(OC)c(Br)cc2c1 WUKLMWOCQBTUSM-UHFFFAOYSA-N 0.000 description 3
- DWZTZNZAAUOZTD-UHFFFAOYSA-N CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1ccc(cc1OCc1ccccc1)C(O)C[N+]([O-])=O Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1ccc(cc1OCc1ccccc1)C(O)C[N+]([O-])=O DWZTZNZAAUOZTD-UHFFFAOYSA-N 0.000 description 3
- FGBZSTVPHVKQHB-UHFFFAOYSA-N COc1cc(ccc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1)C(O)CN Chemical compound COc1cc(ccc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1)C(O)CN FGBZSTVPHVKQHB-UHFFFAOYSA-N 0.000 description 3
- PSEVHFUIUHDMHY-UHFFFAOYSA-N COc1cc(ccc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1)C(O)CNC(=O)C1CC1 Chemical compound COc1cc(ccc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1)C(O)CNC(=O)C1CC1 PSEVHFUIUHDMHY-UHFFFAOYSA-N 0.000 description 3
- JBZANXYEUSMRGC-UHFFFAOYSA-N COc1cc2[n+]([O-])cccc2cc1Br Chemical compound COc1cc2[n+]([O-])cccc2cc1Br JBZANXYEUSMRGC-UHFFFAOYSA-N 0.000 description 3
- ZGMDAMSEPCXTNQ-UHFFFAOYSA-N COc1cc2c(C)nccc2cc1B1OC(C)(C)C(C)(C)O1 Chemical compound COc1cc2c(C)nccc2cc1B1OC(C)(C)C(C)(C)O1 ZGMDAMSEPCXTNQ-UHFFFAOYSA-N 0.000 description 3
- JJHUQDDDHJMOGD-UHFFFAOYSA-N COc1cc2c(nc(C)cc2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1)C#N Chemical compound COc1cc2c(nc(C)cc2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1)C#N JJHUQDDDHJMOGD-UHFFFAOYSA-N 0.000 description 3
- HYODOZOOKFDSBN-UHFFFAOYSA-N COc1cc2c(nc(C)cc2cc1B1OC(C)(C)C(C)(C)O1)C#N Chemical compound COc1cc2c(nc(C)cc2cc1B1OC(C)(C)C(C)(C)O1)C#N HYODOZOOKFDSBN-UHFFFAOYSA-N 0.000 description 3
- JJVHBKYWCGLOGE-UHFFFAOYSA-N COc1cc2c(nc(C)cc2cc1Br)C#N Chemical compound COc1cc2c(nc(C)cc2cc1Br)C#N JJVHBKYWCGLOGE-UHFFFAOYSA-N 0.000 description 3
- GZMYUEDUFCYUCT-UHFFFAOYSA-N COc1cc2cc(C)cnc2cc1Br Chemical compound COc1cc2cc(C)cnc2cc1Br GZMYUEDUFCYUCT-UHFFFAOYSA-N 0.000 description 3
- FZGDDFNCKBUZNY-UHFFFAOYSA-N COc1cc2cc(C)nc(C)c2cc1B1OC(C)(C)C(C)(C)O1 Chemical compound COc1cc2cc(C)nc(C)c2cc1B1OC(C)(C)C(C)(C)O1 FZGDDFNCKBUZNY-UHFFFAOYSA-N 0.000 description 3
- HUUVHRHKJLYTFD-UHFFFAOYSA-N COc1cc2ccn(C)c(=O)c2cc1Br Chemical compound COc1cc2ccn(C)c(=O)c2cc1Br HUUVHRHKJLYTFD-UHFFFAOYSA-N 0.000 description 3
- HKCCRWBIZSSZCA-UHFFFAOYSA-N COc1cc2ccnc(C#N)c2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 Chemical compound COc1cc2ccnc(C#N)c2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 HKCCRWBIZSSZCA-UHFFFAOYSA-N 0.000 description 3
- XUARCFMCYBYSSV-UHFFFAOYSA-N COc1cc2ccnc(N)c2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 Chemical compound COc1cc2ccnc(N)c2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 XUARCFMCYBYSSV-UHFFFAOYSA-N 0.000 description 3
- LTMUSXFYMBDEQA-UHFFFAOYSA-N COc1cc2n(C)c(=O)ccc2cc1Cl Chemical compound COc1cc2n(C)c(=O)ccc2cc1Cl LTMUSXFYMBDEQA-UHFFFAOYSA-N 0.000 description 3
- HVCZOVIQQJFHJD-UHFFFAOYSA-N COc1cc2nc(C)ncc2cc1Br Chemical compound COc1cc2nc(C)ncc2cc1Br HVCZOVIQQJFHJD-UHFFFAOYSA-N 0.000 description 3
- JHAGYXYBHGOMJH-UHFFFAOYSA-N COc1cc2nn(C)cc2cc1Br Chemical compound COc1cc2nn(C)cc2cc1Br JHAGYXYBHGOMJH-UHFFFAOYSA-N 0.000 description 3
- 241000282472 Canis lupus familiaris Species 0.000 description 3
- 241000283707 Capra Species 0.000 description 3
- NDIYJBROFAKQHK-UHFFFAOYSA-N Cn1c2cc(OCc3ccccc3)c(Br)cc2c(=O)n(C)c1=O Chemical compound Cn1c2cc(OCc3ccccc3)c(Br)cc2c(=O)n(C)c1=O NDIYJBROFAKQHK-UHFFFAOYSA-N 0.000 description 3
- 229940126062 Compound A Drugs 0.000 description 3
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 3
- 101100520660 Drosophila melanogaster Poc1 gene Proteins 0.000 description 3
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 229910003110 Mg K Inorganic materials 0.000 description 3
- BZBFBCKTUJCWJL-UHFFFAOYSA-N N1=CC=C2C=C(Br)C(OC)=CC2=C1C Chemical compound N1=CC=C2C=C(Br)C(OC)=CC2=C1C BZBFBCKTUJCWJL-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 101100520662 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) PBA1 gene Proteins 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- IPWKHHSGDUIRAH-UHFFFAOYSA-N bis(pinacolato)diboron Chemical compound O1C(C)(C)C(C)(C)OB1B1OC(C)(C)C(C)(C)O1 IPWKHHSGDUIRAH-UHFFFAOYSA-N 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 229910052796 boron Inorganic materials 0.000 description 3
- 229910052791 calcium Inorganic materials 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 3
- 230000001684 chronic effect Effects 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 3
- LDHQCZJRKDOVOX-NSCUHMNNSA-M crotonate Chemical compound C\C=C\C([O-])=O LDHQCZJRKDOVOX-NSCUHMNNSA-M 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 230000003247 decreasing effect Effects 0.000 description 3
- ZOCHARZZJNPSEU-UHFFFAOYSA-N diboron Chemical compound B#B ZOCHARZZJNPSEU-UHFFFAOYSA-N 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 239000003623 enhancer Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000006260 foam Substances 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 239000012634 fragment Substances 0.000 description 3
- 230000006870 function Effects 0.000 description 3
- 239000007903 gelatin capsule Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000008241 heterogeneous mixture Substances 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- WCRKBMABEPCYII-UHFFFAOYSA-N isoquinolin-7-ol Chemical compound C1=CN=CC2=CC(O)=CC=C21 WCRKBMABEPCYII-UHFFFAOYSA-N 0.000 description 3
- HJHXYSBRTVFEDD-UHFFFAOYSA-N isoquinoline-1-carbonitrile Chemical compound C1=CC=C2C(C#N)=NC=CC2=C1 HJHXYSBRTVFEDD-UHFFFAOYSA-N 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 238000004811 liquid chromatography Methods 0.000 description 3
- 239000000314 lubricant Substances 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- HPMNCYDJGIMYKN-UHFFFAOYSA-N methyl 4-bromo-5-fluoro-2-nitrobenzoate Chemical compound COC(=O)C1=CC(F)=C(Br)C=C1[N+]([O-])=O HPMNCYDJGIMYKN-UHFFFAOYSA-N 0.000 description 3
- HBRVKIMKZSYQHS-UHFFFAOYSA-N methyl 4-bromo-5-methoxy-2-nitrobenzoate Chemical compound COC(=O)C1=CC(OC)=C(Br)C=C1[N+]([O-])=O HBRVKIMKZSYQHS-UHFFFAOYSA-N 0.000 description 3
- 230000035772 mutation Effects 0.000 description 3
- 230000001272 neurogenic effect Effects 0.000 description 3
- 239000002773 nucleotide Substances 0.000 description 3
- 125000003729 nucleotide group Chemical group 0.000 description 3
- 235000016709 nutrition Nutrition 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- MUJIDPITZJWBSW-UHFFFAOYSA-N palladium(2+) Chemical compound [Pd+2] MUJIDPITZJWBSW-UHFFFAOYSA-N 0.000 description 3
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- BWDCBBZUYJDNJZ-UHFFFAOYSA-N quinazolin-7-ol Chemical compound C1=NC=NC2=CC(O)=CC=C21 BWDCBBZUYJDNJZ-UHFFFAOYSA-N 0.000 description 3
- MMZBCUGLVXSHNG-UHFFFAOYSA-N quinolin-7-ol hydrochloride Chemical compound Cl.C1=CC=NC2=CC(O)=CC=C21 MMZBCUGLVXSHNG-UHFFFAOYSA-N 0.000 description 3
- DHAAIWSOKGHKQM-UHFFFAOYSA-N quinoline-3,7-diol Chemical compound N1=CC(=CC2=CC=C(C=C12)O)O DHAAIWSOKGHKQM-UHFFFAOYSA-N 0.000 description 3
- QZZYYBQGTSGDPP-UHFFFAOYSA-N quinoline-3-carbonitrile Chemical compound C1=CC=CC2=CC(C#N)=CN=C21 QZZYYBQGTSGDPP-UHFFFAOYSA-N 0.000 description 3
- JBSAUEMFOKUWTP-UHFFFAOYSA-N quinoline-4-carbonitrile Chemical compound C1=CC=C2C(C#N)=CC=NC2=C1 JBSAUEMFOKUWTP-UHFFFAOYSA-N 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000012047 saturated solution Substances 0.000 description 3
- 239000010802 sludge Substances 0.000 description 3
- 230000000087 stabilizing effect Effects 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 125000003107 substituted aryl group Chemical group 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- QMKAMAYUJSDMPU-UHFFFAOYSA-N tert-butyl 4-(6-chloropyridazin-3-yl)-3,6-dihydro-2h-pyridine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC(C=2N=NC(Cl)=CC=2)=C1 QMKAMAYUJSDMPU-UHFFFAOYSA-N 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- 210000001519 tissue Anatomy 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- 229910052723 transition metal Inorganic materials 0.000 description 3
- 150000003624 transition metals Chemical class 0.000 description 3
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 3
- 239000003039 volatile agent Substances 0.000 description 3
- QLQIBGWUFIHPSU-UHFFFAOYSA-N (4-iodo-3-phenylmethoxyphenyl)methanol Chemical compound OCC1=CC=C(I)C(OCC=2C=CC=CC=2)=C1 QLQIBGWUFIHPSU-UHFFFAOYSA-N 0.000 description 2
- OAGGUQDIFMRKGR-UHFFFAOYSA-N (6-methoxy-2-methyl-1-oxoisoquinolin-7-yl)boronic acid Chemical compound COc1cc2ccn(C)c(=O)c2cc1B(O)O OAGGUQDIFMRKGR-UHFFFAOYSA-N 0.000 description 2
- AREOWVIZQYKSIU-UHFFFAOYSA-N (7-ethoxy-2-methylquinoxalin-6-yl)boronic acid Chemical compound CCOc1cc2nc(C)cnc2cc1B(O)O AREOWVIZQYKSIU-UHFFFAOYSA-N 0.000 description 2
- REEAYGDFNCWDLA-UHFFFAOYSA-N (7-methoxy-4-oxo-1H-quinolin-6-yl)boronic acid Chemical compound COc1cc2[nH]ccc(=O)c2cc1B(O)O REEAYGDFNCWDLA-UHFFFAOYSA-N 0.000 description 2
- LOZWAPSEEHRYPG-UHFFFAOYSA-N 1,4-dithiane Chemical compound C1CSCCS1 LOZWAPSEEHRYPG-UHFFFAOYSA-N 0.000 description 2
- JYPGOBDETCKKKV-UHFFFAOYSA-N 1-(3-bromo-4-methoxyphenyl)ethanone Chemical compound COC1=CC=C(C(C)=O)C=C1Br JYPGOBDETCKKKV-UHFFFAOYSA-N 0.000 description 2
- YFKXGNASTUKQRA-UHFFFAOYSA-N 1-methyl-5-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]indazol-6-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2cnn(C)c2cc1O YFKXGNASTUKQRA-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- QMNUDYFKZYBWQX-UHFFFAOYSA-N 1H-quinazolin-4-one Chemical compound C1=CC=C2C(=O)N=CNC2=C1 QMNUDYFKZYBWQX-UHFFFAOYSA-N 0.000 description 2
- RKMGAJGJIURJSJ-UHFFFAOYSA-N 2,2,6,6-tetramethylpiperidine Chemical compound CC1(C)CCCC(C)(C)N1 RKMGAJGJIURJSJ-UHFFFAOYSA-N 0.000 description 2
- QKWWDTYDYOFRJL-UHFFFAOYSA-N 2,2-dimethoxyethanamine Chemical compound COC(CN)OC QKWWDTYDYOFRJL-UHFFFAOYSA-N 0.000 description 2
- ZDMGIPVNWBZWAJ-UHFFFAOYSA-N 2,3-dimethyl-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinoxalin-6-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2nc(C)c(C)nc2cc1O ZDMGIPVNWBZWAJ-UHFFFAOYSA-N 0.000 description 2
- WZUODJNEIXSNEU-UHFFFAOYSA-N 2-Hydroxy-4-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C(O)=C1 WZUODJNEIXSNEU-UHFFFAOYSA-N 0.000 description 2
- VWVRASTUFJRTHW-UHFFFAOYSA-N 2-[3-(azetidin-3-yloxy)-4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]pyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound O=C(CN1C=C(C(OC2CNC2)=N1)C1=CN=C(NC2CC3=C(C2)C=CC=C3)N=C1)N1CCC2=C(C1)N=NN2 VWVRASTUFJRTHW-UHFFFAOYSA-N 0.000 description 2
- SXAMGRAIZSSWIH-UHFFFAOYSA-N 2-[3-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,2,4-oxadiazol-5-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NOC(=N1)CC(=O)N1CC2=C(CC1)NN=N2 SXAMGRAIZSSWIH-UHFFFAOYSA-N 0.000 description 2
- WWSJZGAPAVMETJ-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-3-ethoxypyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2)OCC WWSJZGAPAVMETJ-UHFFFAOYSA-N 0.000 description 2
- IZHVBANLECCAGF-UHFFFAOYSA-N 2-hydroxy-3-(octadecanoyloxy)propyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCCCCCCCCCCC IZHVBANLECCAGF-UHFFFAOYSA-N 0.000 description 2
- IUAGSVFWOYFPKG-UHFFFAOYSA-N 2-hydroxy-4-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde Chemical compound COc1cc(O)c(C=O)cc1B1OC(C)(C)C(C)(C)O1 IUAGSVFWOYFPKG-UHFFFAOYSA-N 0.000 description 2
- NYVFEMFOWAYCCX-UHFFFAOYSA-N 2-hydroxy-4-methoxy-5-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]benzaldehyde Chemical compound COc1cc(O)c(C=O)cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 NYVFEMFOWAYCCX-UHFFFAOYSA-N 0.000 description 2
- GYLDHFWNQGAMKG-UHFFFAOYSA-N 2-methyl-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-4-pyrrolidin-1-ylquinolin-7-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2c(cc(C)nc2cc1O)N1CCCC1 GYLDHFWNQGAMKG-UHFFFAOYSA-N 0.000 description 2
- WSXCLCAOTCOCLA-UHFFFAOYSA-N 2-methyl-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinoxalin-6-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2nc(C)cnc2cc1O WSXCLCAOTCOCLA-UHFFFAOYSA-N 0.000 description 2
- TWBPWBPGNQWFSJ-UHFFFAOYSA-N 2-phenylaniline Chemical group NC1=CC=CC=C1C1=CC=CC=C1 TWBPWBPGNQWFSJ-UHFFFAOYSA-N 0.000 description 2
- NMUFTXMBONJQTC-UHFFFAOYSA-N 3-bromo-4-methoxyaniline Chemical compound COC1=CC=C(N)C=C1Br NMUFTXMBONJQTC-UHFFFAOYSA-N 0.000 description 2
- QNZZWJGBBWNRHW-UHFFFAOYSA-N 3-chloro-6-(2,2,6,6-tetramethylpiperidin-4-yl)oxypyridazine Chemical compound C1C(C)(C)NC(C)(C)CC1OC1=CC=C(Cl)N=N1 QNZZWJGBBWNRHW-UHFFFAOYSA-N 0.000 description 2
- KGVDYVAHQRDWHA-UHFFFAOYSA-N 3-chloro-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol hydrochloride Chemical compound Cl.CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2cc(Cl)cnc2cc1O KGVDYVAHQRDWHA-UHFFFAOYSA-N 0.000 description 2
- PDYFYSDCGYKJQR-UHFFFAOYSA-N 3-methyl-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinoxalin-6-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2ncc(C)nc2cc1O PDYFYSDCGYKJQR-UHFFFAOYSA-N 0.000 description 2
- YGHRJJRRZDOVPD-UHFFFAOYSA-N 3-methylbutanal Chemical compound CC(C)CC=O YGHRJJRRZDOVPD-UHFFFAOYSA-N 0.000 description 2
- IHDALGOXWIOXAJ-UHFFFAOYSA-N 4-(3,6-dihydro-2H-pyran-4-yl)-2-methyl-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2c(cc(C)nc2cc1O)C1=CCOCC1 IHDALGOXWIOXAJ-UHFFFAOYSA-N 0.000 description 2
- XDPZVIQGXZHYDJ-UHFFFAOYSA-N 4-(dimethylamino)-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol formic acid Chemical class OC=O.OC=O.CN(C)c1ccnc2cc(O)c(cc12)-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 XDPZVIQGXZHYDJ-UHFFFAOYSA-N 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 2
- HKLCOMKRVBQSHA-UHFFFAOYSA-N 4-bromo-3-methoxybenzaldehyde Chemical compound COC1=CC(C=O)=CC=C1Br HKLCOMKRVBQSHA-UHFFFAOYSA-N 0.000 description 2
- GLFUTNCUEJYRHF-UHFFFAOYSA-N 4-iodo-3-phenylmethoxybenzoic acid Chemical compound OC(=O)c1ccc(I)c(OCc2ccccc2)c1 GLFUTNCUEJYRHF-UHFFFAOYSA-N 0.000 description 2
- SYGSUIHFSZSNEA-UHFFFAOYSA-N 5-[(3-chloro-4-methoxyanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione Chemical compound C1=C(Cl)C(OC)=CC=C1NC=C1C(=O)OC(C)(C)OC1=O SYGSUIHFSZSNEA-UHFFFAOYSA-N 0.000 description 2
- OHSSWZLKWHLYFP-UHFFFAOYSA-N 5-bromo-2-hydroxy-4-methoxybenzaldehyde Chemical compound COC1=CC(O)=C(C=O)C=C1Br OHSSWZLKWHLYFP-UHFFFAOYSA-N 0.000 description 2
- NFXLNUOVILGQOM-UHFFFAOYSA-N 5-bromo-6-methoxy-1-methylindazole Chemical compound C1=C(Br)C(OC)=CC2=C1C=NN2C NFXLNUOVILGQOM-UHFFFAOYSA-N 0.000 description 2
- CONKBQPVFMXDOV-QHCPKHFHSA-N 6-[(5S)-5-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C[C@H]1CN(C(O1)=O)C1=CC2=C(NC(O2)=O)C=C1 CONKBQPVFMXDOV-QHCPKHFHSA-N 0.000 description 2
- QBEHYLSWZSIVSK-UHFFFAOYSA-N 6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]isoquinolin-7-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2ccncc2cc1O QBEHYLSWZSIVSK-UHFFFAOYSA-N 0.000 description 2
- FQYMBNRXODZMMG-UHFFFAOYSA-N 6-hydroxy-1-methyl-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-4-one Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2n(C)ccc(=O)c2cc1O FQYMBNRXODZMMG-UHFFFAOYSA-N 0.000 description 2
- VWOUEHXDNKMWCV-UHFFFAOYSA-N 6-hydroxy-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]isoquinoline-1-carbonitrile Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2c(nccc2cc1O)C#N VWOUEHXDNKMWCV-UHFFFAOYSA-N 0.000 description 2
- IIXYRYQGVBWJHW-UHFFFAOYSA-N 6-methoxy-1-methyl-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-4-one Chemical compound COc1cc2c(cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1)n(C)ccc2=O IIXYRYQGVBWJHW-UHFFFAOYSA-N 0.000 description 2
- BIOCLYNSTMVCRB-UHFFFAOYSA-N 7-bromo-6-methoxy-2h-isoquinolin-1-one Chemical compound C1=CNC(=O)C2=C1C=C(OC)C(Br)=C2 BIOCLYNSTMVCRB-UHFFFAOYSA-N 0.000 description 2
- XEFPZKYCESWBHF-UHFFFAOYSA-N 7-hydroxy-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-1H-quinolin-2-one Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2ccc(=O)[nH]c2cc1O XEFPZKYCESWBHF-UHFFFAOYSA-N 0.000 description 2
- VLUADXHOVAFNLP-UHFFFAOYSA-N 7-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinolin-4-one Chemical compound COc1cc2[nH]ccc(=O)c2cc1B1OC(C)(C)C(C)(C)O1 VLUADXHOVAFNLP-UHFFFAOYSA-N 0.000 description 2
- XCTSPYRSAULHTM-UHFFFAOYSA-N 7-methoxy-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-1H-quinolin-2-one Chemical compound COc1cc2[nH]c(=O)ccc2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 XCTSPYRSAULHTM-UHFFFAOYSA-N 0.000 description 2
- RAOHAVNPKZOMEZ-UHFFFAOYSA-N 7-methoxy-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-3H-quinazolin-4-one Chemical compound COc1cc2[nH]cnc(=O)c2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 RAOHAVNPKZOMEZ-UHFFFAOYSA-N 0.000 description 2
- 206010001052 Acute respiratory distress syndrome Diseases 0.000 description 2
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 102100032187 Androgen receptor Human genes 0.000 description 2
- 208000008037 Arthrogryposis Diseases 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- 241000283690 Bos taurus Species 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 208000029402 Bulbospinal muscular atrophy Diseases 0.000 description 2
- 206010068597 Bulbospinal muscular atrophy congenital Diseases 0.000 description 2
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 2
- SBSYZSFZTTUJSR-UHFFFAOYSA-N C(=O)OC=1C=C2C(=CC=NC2=CC=1C=1N=NC(=CC=1)N(C1CC(NC(C1)(C)C)(C)C)C)OC Chemical class C(=O)OC=1C=C2C(=CC=NC2=CC=1C=1N=NC(=CC=1)N(C1CC(NC(C1)(C)C)(C)C)C)OC SBSYZSFZTTUJSR-UHFFFAOYSA-N 0.000 description 2
- TWSLDUJFSPZKIM-UHFFFAOYSA-N CCn1ccc2cc(OC)c(cc2c1=O)B1OC(C)(C)C(C)(C)O1 Chemical compound CCn1ccc2cc(OC)c(cc2c1=O)B1OC(C)(C)C(C)(C)O1 TWSLDUJFSPZKIM-UHFFFAOYSA-N 0.000 description 2
- IXPVQUPHVWBREQ-UHFFFAOYSA-N CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2c(cc1OCc1ccccc1)n(C)c(=O)n(C)c2=O Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2c(cc1OCc1ccccc1)n(C)c(=O)n(C)c2=O IXPVQUPHVWBREQ-UHFFFAOYSA-N 0.000 description 2
- ZBRYRHGLDJBZGU-UHFFFAOYSA-N CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1ccc(C=O)cc1OCc1ccccc1 Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1ccc(C=O)cc1OCc1ccccc1 ZBRYRHGLDJBZGU-UHFFFAOYSA-N 0.000 description 2
- JPPHQYKVERLRQW-UHFFFAOYSA-N CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1ccc(CO)cc1OCc1ccccc1 Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1ccc(CO)cc1OCc1ccccc1 JPPHQYKVERLRQW-UHFFFAOYSA-N 0.000 description 2
- IVXYGBHIWPHJOF-UHFFFAOYSA-N COc1cc(NC(C)=O)c(C=O)cc1Br Chemical compound COc1cc(NC(C)=O)c(C=O)cc1Br IVXYGBHIWPHJOF-UHFFFAOYSA-N 0.000 description 2
- YALYQGNJQVNIHM-UHFFFAOYSA-N COc1cc(OS(=O)(=O)C(F)(F)F)c(C=O)cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 Chemical compound COc1cc(OS(=O)(=O)C(F)(F)F)c(C=O)cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 YALYQGNJQVNIHM-UHFFFAOYSA-N 0.000 description 2
- HMKIPJHODGXCDQ-UHFFFAOYSA-N COc1cc2N(C)C(=O)CCc2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 Chemical compound COc1cc2N(C)C(=O)CCc2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 HMKIPJHODGXCDQ-UHFFFAOYSA-N 0.000 description 2
- WZBDDYYGAADYTO-UHFFFAOYSA-N COc1cc2[nH]ccc(=O)c2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 Chemical compound COc1cc2[nH]ccc(=O)c2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 WZBDDYYGAADYTO-UHFFFAOYSA-N 0.000 description 2
- KIQGXJWYOHRLBY-UHFFFAOYSA-N COc1cc2c[n+]([O-])c(C)cc2cc1Br Chemical compound COc1cc2c[n+]([O-])c(C)cc2cc1Br KIQGXJWYOHRLBY-UHFFFAOYSA-N 0.000 description 2
- HGSIEELWUFRZJD-UHFFFAOYSA-N COc1cc2cc(C)nc(C)c2cc1Br Chemical compound COc1cc2cc(C)nc(C)c2cc1Br HGSIEELWUFRZJD-UHFFFAOYSA-N 0.000 description 2
- UQNXXKQTRBJEFL-UHFFFAOYSA-N COc1cc2ccn(C)c(=O)c2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 Chemical compound COc1cc2ccn(C)c(=O)c2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 UQNXXKQTRBJEFL-UHFFFAOYSA-N 0.000 description 2
- AMQBVIYZJLAVHL-UHFFFAOYSA-N COc1cc2ccnc(C(N)=O)c2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 Chemical compound COc1cc2ccnc(C(N)=O)c2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 AMQBVIYZJLAVHL-UHFFFAOYSA-N 0.000 description 2
- ONFULYOBEARTQB-UHFFFAOYSA-N COc1cc2ncc(O)cc2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 Chemical compound COc1cc2ncc(O)cc2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 ONFULYOBEARTQB-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- SYXLVVACFSDNRU-UHFFFAOYSA-N Cn1c2cc(OCc3ccccc3)c(cc2c(=O)n(C)c1=O)B1OC(C)(C)C(C)(C)O1 Chemical compound Cn1c2cc(OCc3ccccc3)c(cc2c(=O)n(C)c1=O)B1OC(C)(C)C(C)(C)O1 SYXLVVACFSDNRU-UHFFFAOYSA-N 0.000 description 2
- 101100270233 Dictyostelium discoideum arrH gene Proteins 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 241000283086 Equidae Species 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- 101000775732 Homo sapiens Androgen receptor Proteins 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- LYDPVPZCGUGDAH-UHFFFAOYSA-N Ic1ccc(COC2CCCCO2)cc1OCc1ccccc1 Chemical compound Ic1ccc(COC2CCCCO2)cc1OCc1ccccc1 LYDPVPZCGUGDAH-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 208000027747 Kennedy disease Diseases 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- AIJULSRZWUXGPQ-UHFFFAOYSA-N Methylglyoxal Chemical compound CC(=O)C=O AIJULSRZWUXGPQ-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-diisopropylethylamine Substances CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- 241001494479 Pecora Species 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 241000288906 Primates Species 0.000 description 2
- 208000033526 Proximal spinal muscular atrophy type 3 Diseases 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- 108700008625 Reporter Genes Proteins 0.000 description 2
- 208000013616 Respiratory Distress Syndrome Diseases 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 208000003954 Spinal Muscular Atrophies of Childhood Diseases 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- PFWWJPODQJTYNX-UHFFFAOYSA-N [7-methoxy-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-3-yl]boronic acid Chemical compound COc1cc2ncc(cc2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1)B(O)O PFWWJPODQJTYNX-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- XPOLVIIHTDKJRY-UHFFFAOYSA-N acetic acid;methanimidamide Chemical compound NC=N.CC(O)=O XPOLVIIHTDKJRY-UHFFFAOYSA-N 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 235000010443 alginic acid Nutrition 0.000 description 2
- 239000000783 alginic acid Substances 0.000 description 2
- 229920000615 alginic acid Polymers 0.000 description 2
- 229960001126 alginic acid Drugs 0.000 description 2
- 150000004781 alginic acids Chemical class 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 206010002026 amyotrophic lateral sclerosis Diseases 0.000 description 2
- 125000004566 azetidin-1-yl group Chemical group N1(CCC1)* 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 2
- 239000012965 benzophenone Substances 0.000 description 2
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 2
- 229910000024 caesium carbonate Inorganic materials 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 235000010216 calcium carbonate Nutrition 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 229910000389 calcium phosphate Inorganic materials 0.000 description 2
- 235000011010 calcium phosphates Nutrition 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 230000001413 cellular effect Effects 0.000 description 2
- 238000012512 characterization method Methods 0.000 description 2
- 208000024971 chromosomal disease Diseases 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 238000002648 combination therapy Methods 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 238000012937 correction Methods 0.000 description 2
- 230000002596 correlated effect Effects 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 230000034994 death Effects 0.000 description 2
- 150000001975 deuterium Chemical group 0.000 description 2
- 125000006003 dichloroethyl group Chemical group 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000007884 disintegrant Substances 0.000 description 2
- 208000014720 distal hereditary motor neuropathy Diseases 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- FCZCIXQGZOUIDN-UHFFFAOYSA-N ethyl 2-diethoxyphosphinothioyloxyacetate Chemical compound CCOC(=O)COP(=S)(OCC)OCC FCZCIXQGZOUIDN-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000019634 flavors Nutrition 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- FPPHLCBONDPWAU-UHFFFAOYSA-N formic acid 6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinoline-3,7-diol Chemical class OC=O.CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2cc(O)cnc2cc1O FPPHLCBONDPWAU-UHFFFAOYSA-N 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 150000004677 hydrates Chemical class 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 239000003701 inert diluent Substances 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- YZDXFUGIDTUCDA-UHFFFAOYSA-N isoquinoline-1-carboxamide Chemical compound C1=CC=C2C(C(=O)N)=NC=CC2=C1 YZDXFUGIDTUCDA-UHFFFAOYSA-N 0.000 description 2
- 230000000155 isotopic effect Effects 0.000 description 2
- 201000004815 juvenile spinal muscular atrophy Diseases 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 2
- 238000004949 mass spectrometry Methods 0.000 description 2
- 230000002503 metabolic effect Effects 0.000 description 2
- VLYQTTVQFZRGQX-UHFFFAOYSA-N methyl 2-amino-4-bromo-5-methoxybenzoate Chemical compound COC(=O)C1=CC(OC)=C(Br)C=C1N VLYQTTVQFZRGQX-UHFFFAOYSA-N 0.000 description 2
- 238000004452 microanalysis Methods 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 230000002232 neuromuscular Effects 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 2
- 125000004043 oxo group Chemical group O=* 0.000 description 2
- ATGAWOHQWWULNK-UHFFFAOYSA-I pentapotassium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [K+].[K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O ATGAWOHQWWULNK-UHFFFAOYSA-I 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- GRJHONXDTNBDTC-UHFFFAOYSA-N phenyl trifluoromethanesulfonate Chemical compound FC(F)(F)S(=O)(=O)OC1=CC=CC=C1 GRJHONXDTNBDTC-UHFFFAOYSA-N 0.000 description 2
- IVDFJHOHABJVEH-UHFFFAOYSA-N pinacol Chemical compound CC(C)(O)C(C)(C)O IVDFJHOHABJVEH-UHFFFAOYSA-N 0.000 description 2
- 229960005141 piperazine Drugs 0.000 description 2
- 238000002600 positron emission tomography Methods 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- IUBQJLUDMLPAGT-UHFFFAOYSA-N potassium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([K])[Si](C)(C)C IUBQJLUDMLPAGT-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- LJCNRYVRMXRIQR-OLXYHTOASA-L potassium sodium L-tartrate Chemical compound [Na+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O LJCNRYVRMXRIQR-OLXYHTOASA-L 0.000 description 2
- 230000000069 prophylactic effect Effects 0.000 description 2
- 208000022074 proximal spinal muscular atrophy Diseases 0.000 description 2
- 238000010926 purge Methods 0.000 description 2
- 239000012264 purified product Substances 0.000 description 2
- XSCHRSMBECNVNS-UHFFFAOYSA-N quinoxaline Chemical compound N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 2
- 230000002285 radioactive effect Effects 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 206010039722 scoliosis Diseases 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 235000011006 sodium potassium tartrate Nutrition 0.000 description 2
- 210000000278 spinal cord Anatomy 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 230000004083 survival effect Effects 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- RXSKUIFMUUDPPT-UHFFFAOYSA-N tert-butyl 4-[6-(6-methoxy-3-methylisoquinolin-7-yl)pyridazin-3-yl]piperazine-1-carboxylate Chemical compound COc1cc2cc(C)ncc2cc1-c1ccc(nn1)N1CCN(CC1)C(=O)OC(C)(C)C RXSKUIFMUUDPPT-UHFFFAOYSA-N 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 2
- WRECIMRULFAWHA-UHFFFAOYSA-N trimethyl borate Chemical compound COB(OC)OC WRECIMRULFAWHA-UHFFFAOYSA-N 0.000 description 2
- LEIMLDGFXIOXMT-UHFFFAOYSA-N trimethylsilyl cyanide Chemical compound C[Si](C)(C)C#N LEIMLDGFXIOXMT-UHFFFAOYSA-N 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- NHDIQVFFNDKAQU-UHFFFAOYSA-N tripropan-2-yl borate Chemical compound CC(C)OB(OC(C)C)OC(C)C NHDIQVFFNDKAQU-UHFFFAOYSA-N 0.000 description 2
- 230000003313 weakening effect Effects 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- UGOMMVLRQDMAQQ-UHFFFAOYSA-N xphos Chemical group CC(C)C1=CC(C(C)C)=CC(C(C)C)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 UGOMMVLRQDMAQQ-UHFFFAOYSA-N 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- GTLDTDOJJJZVBW-UHFFFAOYSA-N zinc cyanide Chemical compound [Zn+2].N#[C-].N#[C-] GTLDTDOJJJZVBW-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- DTGKSKDOIYIVQL-WEDXCCLWSA-N (+)-borneol Chemical group C1C[C@@]2(C)[C@@H](O)C[C@@H]1C2(C)C DTGKSKDOIYIVQL-WEDXCCLWSA-N 0.000 description 1
- AIRVVOQVTLZCFV-UHFFFAOYSA-N (2-amino-4-methoxyphenyl)methanol Chemical compound COC1=CC=C(CO)C(N)=C1 AIRVVOQVTLZCFV-UHFFFAOYSA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- DNISEZBAYYIQFB-PHDIDXHHSA-N (2r,3r)-2,3-diacetyloxybutanedioic acid Chemical compound CC(=O)O[C@@H](C(O)=O)[C@H](C(O)=O)OC(C)=O DNISEZBAYYIQFB-PHDIDXHHSA-N 0.000 description 1
- NXEXQFJTEXHMBC-UHFFFAOYSA-N (7-ethoxy-2,3-dimethylquinoxalin-6-yl)boronic acid Chemical compound CCOc1cc2nc(C)c(C)nc2cc1B(O)O NXEXQFJTEXHMBC-UHFFFAOYSA-N 0.000 description 1
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 description 1
- 125000006652 (C3-C12) cycloalkyl group Chemical group 0.000 description 1
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- LFGDCUQVRIGRAI-TYYBGVCCSA-N (e)-but-2-enedioic acid;ethane-1,2-disulfonic acid Chemical compound OC(=O)\C=C\C(O)=O.OS(=O)(=O)CCS(O)(=O)=O LFGDCUQVRIGRAI-TYYBGVCCSA-N 0.000 description 1
- 101150084750 1 gene Proteins 0.000 description 1
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 1
- ULVSHNOGEVXRDR-UHFFFAOYSA-N 1,1-dimethoxypropan-2-one Chemical compound COC(OC)C(C)=O ULVSHNOGEVXRDR-UHFFFAOYSA-N 0.000 description 1
- VDFVNEFVBPFDSB-UHFFFAOYSA-N 1,3-dioxane Chemical compound C1COCOC1 VDFVNEFVBPFDSB-UHFFFAOYSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- WQADWIOXOXRPLN-UHFFFAOYSA-N 1,3-dithiane Chemical compound C1CSCSC1 WQADWIOXOXRPLN-UHFFFAOYSA-N 0.000 description 1
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical group CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 1
- HMUNWXXNJPVALC-UHFFFAOYSA-N 1-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C(CN1CC2=C(CC1)NN=N2)=O HMUNWXXNJPVALC-UHFFFAOYSA-N 0.000 description 1
- JFLSOKIMYBSASW-UHFFFAOYSA-N 1-chloro-2-[chloro(diphenyl)methyl]benzene Chemical compound ClC1=CC=CC=C1C(Cl)(C=1C=CC=CC=1)C1=CC=CC=C1 JFLSOKIMYBSASW-UHFFFAOYSA-N 0.000 description 1
- AFFLGGQVNFXPEV-UHFFFAOYSA-N 1-decene Chemical group CCCCCCCCC=C AFFLGGQVNFXPEV-UHFFFAOYSA-N 0.000 description 1
- UCNGGGYMLHAMJG-UHFFFAOYSA-N 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole Chemical compound C1=NN(C)C=C1B1OC(C)(C)C(C)(C)O1 UCNGGGYMLHAMJG-UHFFFAOYSA-N 0.000 description 1
- LNETULKMXZVUST-UHFFFAOYSA-N 1-naphthoic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1 LNETULKMXZVUST-UHFFFAOYSA-N 0.000 description 1
- NUYZVDBIVNOTSC-UHFFFAOYSA-N 1H-indazol-6-ol Chemical compound OC1=CC=C2C=NNC2=C1 NUYZVDBIVNOTSC-UHFFFAOYSA-N 0.000 description 1
- FTVFPPFZRRKJIH-UHFFFAOYSA-N 2,2,6,6-tetramethylpiperidin-4-amine Chemical compound CC1(C)CC(N)CC(C)(C)N1 FTVFPPFZRRKJIH-UHFFFAOYSA-N 0.000 description 1
- VDVUCLWJZJHFAV-UHFFFAOYSA-N 2,2,6,6-tetramethylpiperidin-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)N1 VDVUCLWJZJHFAV-UHFFFAOYSA-N 0.000 description 1
- UZXMWHJCMJOGGY-UHFFFAOYSA-N 2,2-dimethoxybutylbenzene Chemical compound CCC(OC)(OC)CC1=CC=CC=C1 UZXMWHJCMJOGGY-UHFFFAOYSA-N 0.000 description 1
- 125000003562 2,2-dimethylpentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- JKTCBAGSMQIFNL-UHFFFAOYSA-N 2,3-dihydrofuran Chemical compound C1CC=CO1 JKTCBAGSMQIFNL-UHFFFAOYSA-N 0.000 description 1
- 125000003660 2,3-dimethylpentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- LDXJRKWFNNFDSA-UHFFFAOYSA-N 2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound C1CN(CC2=NNN=C21)CC(=O)N3CCN(CC3)C4=CN=C(N=C4)NCC5=CC(=CC=C5)OC(F)(F)F LDXJRKWFNNFDSA-UHFFFAOYSA-N 0.000 description 1
- AUCJQPPZTFKDHI-UHFFFAOYSA-N 2-(oxan-4-yl)acetaldehyde Chemical compound O=CCC1CCOCC1 AUCJQPPZTFKDHI-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- MFYSUUPKMDJYPF-UHFFFAOYSA-N 2-[(4-methyl-2-nitrophenyl)diazenyl]-3-oxo-n-phenylbutanamide Chemical compound C=1C=CC=CC=1NC(=O)C(C(=O)C)N=NC1=CC=C(C)C=C1[N+]([O-])=O MFYSUUPKMDJYPF-UHFFFAOYSA-N 0.000 description 1
- XXZCIYUJYUESMD-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-3-(morpholin-4-ylmethyl)pyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2)CN1CCOCC1 XXZCIYUJYUESMD-UHFFFAOYSA-N 0.000 description 1
- FYELSNVLZVIGTI-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-5-ethylpyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C=NN(C=1CC)CC(=O)N1CC2=C(CC1)NN=N2 FYELSNVLZVIGTI-UHFFFAOYSA-N 0.000 description 1
- WZFUQSJFWNHZHM-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 WZFUQSJFWNHZHM-UHFFFAOYSA-N 0.000 description 1
- JVKRKMWZYMKVTQ-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]pyrazol-1-yl]-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C=NN(C=1)CC(=O)NC1=CC2=C(NC(O2)=O)C=C1 JVKRKMWZYMKVTQ-UHFFFAOYSA-N 0.000 description 1
- WXHLLJAMBQLULT-UHFFFAOYSA-N 2-[[6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-n-(2-methyl-6-sulfanylphenyl)-1,3-thiazole-5-carboxamide;hydrate Chemical compound O.C=1C(N2CCN(CCO)CC2)=NC(C)=NC=1NC(S1)=NC=C1C(=O)NC1=C(C)C=CC=C1S WXHLLJAMBQLULT-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- AGOBBCBXDHIZOJ-UHFFFAOYSA-N 2-amino-4-bromo-5-methoxybenzoic acid Chemical compound COC1=CC(C(O)=O)=C(N)C=C1Br AGOBBCBXDHIZOJ-UHFFFAOYSA-N 0.000 description 1
- HHNWXQCVWVVVQZ-UHFFFAOYSA-N 2-amino-4-methoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C(N)=C1 HHNWXQCVWVVVQZ-UHFFFAOYSA-N 0.000 description 1
- KMGUEILFFWDGFV-UHFFFAOYSA-N 2-benzoyl-2-benzoyloxy-3-hydroxybutanedioic acid Chemical compound C=1C=CC=CC=1C(=O)C(C(C(O)=O)O)(C(O)=O)OC(=O)C1=CC=CC=C1 KMGUEILFFWDGFV-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- BMIBJCFFZPYJHF-UHFFFAOYSA-N 2-methoxy-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine Chemical compound COC1=NC=C(C)C=C1B1OC(C)(C)C(C)(C)O1 BMIBJCFFZPYJHF-UHFFFAOYSA-N 0.000 description 1
- SQVKQWSAKALIKG-UHFFFAOYSA-N 2-methyl-5-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]indazol-6-ol Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2cn(C)nc2cc1O SQVKQWSAKALIKG-UHFFFAOYSA-N 0.000 description 1
- RSEBUVRVKCANEP-UHFFFAOYSA-N 2-pyrroline Chemical compound C1CC=CN1 RSEBUVRVKCANEP-UHFFFAOYSA-N 0.000 description 1
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- PUJYERFTXHTQQE-UHFFFAOYSA-N 2h-isoquinolin-1-one;hydrochloride Chemical compound Cl.C1=CC=C2C(=O)NC=CC2=C1 PUJYERFTXHTQQE-UHFFFAOYSA-N 0.000 description 1
- UAIUNKRWKOVEES-UHFFFAOYSA-N 3,3',5,5'-tetramethylbenzidine Chemical compound CC1=C(N)C(C)=CC(C=2C=C(C)C(N)=C(C)C=2)=C1 UAIUNKRWKOVEES-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- XQVCBOLNTSUFGD-UHFFFAOYSA-N 3-chloro-4-methoxyaniline Chemical compound COC1=CC=C(N)C=C1Cl XQVCBOLNTSUFGD-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- UABBBWVTEWIIMN-UHFFFAOYSA-N 3-hydroxy-4-iodobenzoic acid Chemical compound OC(=O)C1=CC=C(I)C(O)=C1 UABBBWVTEWIIMN-UHFFFAOYSA-N 0.000 description 1
- UCEPCBZEXBIGGW-UHFFFAOYSA-N 3-imidazol-1-yl-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]quinolin-7-ol hydrochloride Chemical compound Cl.CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2cc(cnc2cc1O)-n1ccnc1 UCEPCBZEXBIGGW-UHFFFAOYSA-N 0.000 description 1
- KBEIFKMKVCDETC-UHFFFAOYSA-N 3-iodooxetane Chemical compound IC1COC1 KBEIFKMKVCDETC-UHFFFAOYSA-N 0.000 description 1
- 125000003469 3-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- LNKBDFVSILQKSI-UHFFFAOYSA-N 4-Chloro-3-methoxyaniline Chemical compound COC1=CC(N)=CC=C1Cl LNKBDFVSILQKSI-UHFFFAOYSA-N 0.000 description 1
- YRNWIFYIFSBPAU-UHFFFAOYSA-N 4-[4-(dimethylamino)phenyl]-n,n-dimethylaniline Chemical compound C1=CC(N(C)C)=CC=C1C1=CC=C(N(C)C)C=C1 YRNWIFYIFSBPAU-UHFFFAOYSA-N 0.000 description 1
- IOTSLMMLLXTNNH-UHFFFAOYSA-N 4-bromo-1-methylimidazole Chemical compound CN1C=NC(Br)=C1 IOTSLMMLLXTNNH-UHFFFAOYSA-N 0.000 description 1
- RMYOGXPGIDWJLU-UHFFFAOYSA-N 4-bromo-3-fluorobenzoic acid Chemical compound OC(=O)C1=CC=C(Br)C(F)=C1 RMYOGXPGIDWJLU-UHFFFAOYSA-N 0.000 description 1
- VZUYPQXQCGVAFU-UHFFFAOYSA-N 4-bromo-5-ethoxy-2-nitroaniline Chemical compound CCOC1=CC(N)=C([N+]([O-])=O)C=C1Br VZUYPQXQCGVAFU-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical compound [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- XXCLETAREMGZFZ-UHFFFAOYSA-N 6-bromo-7-methoxy-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C=C(OC)C(Br)=C2 XXCLETAREMGZFZ-UHFFFAOYSA-N 0.000 description 1
- OQASLDMEONMQKC-UHFFFAOYSA-N 6-hydroxy-2-methyl-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]isoquinolin-1-one Chemical compound CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2c(ccn(C)c2=O)cc1O OQASLDMEONMQKC-UHFFFAOYSA-N 0.000 description 1
- WNRKHLOKYPEHBS-UHFFFAOYSA-N 6-hydroxy-2-methyl-7-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]isoquinolin-1-one hydrochloride Chemical compound Cl.CN(C1CC(C)(C)NC(C)(C)C1)c1ccc(nn1)-c1cc2c(ccn(C)c2=O)cc1O WNRKHLOKYPEHBS-UHFFFAOYSA-N 0.000 description 1
- NAGJQQFMJKMXJQ-UHFFFAOYSA-N 6-methoxy-2-methylquinoline Chemical compound N1=C(C)C=CC2=CC(OC)=CC=C21 NAGJQQFMJKMXJQ-UHFFFAOYSA-N 0.000 description 1
- AMHPMQSPYVUTPN-UHFFFAOYSA-N 6-methoxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline Chemical compound COc1cc2cccnc2cc1B1OC(C)(C)C(C)(C)O1 AMHPMQSPYVUTPN-UHFFFAOYSA-N 0.000 description 1
- LKLSFDWYIBUGNT-UHFFFAOYSA-N 7-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CC(=O)NC2=CC(O)=CC=C21 LKLSFDWYIBUGNT-UHFFFAOYSA-N 0.000 description 1
- LZRNEPJCTTUDND-UHFFFAOYSA-N 7-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-2-carbonitrile Chemical compound COC1=CC2=NC(C#N)=CC=C2C=C1B1OC(C)(C)C(C)(C)O1 LZRNEPJCTTUDND-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- ACQSKLVTXZNXGL-UHFFFAOYSA-N 8-bromoquinolin-7-ol Chemical compound C1=CC=NC2=C(Br)C(O)=CC=C21 ACQSKLVTXZNXGL-UHFFFAOYSA-N 0.000 description 1
- ONMOULMPIIOVTQ-UHFFFAOYSA-N 98-47-5 Chemical compound OS(=O)(=O)C1=CC=CC([N+]([O-])=O)=C1 ONMOULMPIIOVTQ-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 108020005544 Antisense RNA Proteins 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 206010003694 Atrophy Diseases 0.000 description 1
- 241000271566 Aves Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 102100033641 Bromodomain-containing protein 2 Human genes 0.000 description 1
- 238000006418 Brown reaction Methods 0.000 description 1
- ZLKWZUKIUDGZRW-UHFFFAOYSA-N C(=O)OC1=C(C=C2C(=CC(=NC2=C1)C)C1CCOCC1)C=1N=NC(=CC=1)N(C1CC(NC(C1)(C)C)(C)C)C Chemical class C(=O)OC1=C(C=C2C(=CC(=NC2=C1)C)C1CCOCC1)C=1N=NC(=CC=1)N(C1CC(NC(C1)(C)C)(C)C)C ZLKWZUKIUDGZRW-UHFFFAOYSA-N 0.000 description 1
- VUWBMXNMKRWSEI-UHFFFAOYSA-N C1(CCCCC1)P(C1=C(C=CC=C1)C1=C(C=C(C=C1C(C)C)C(C)C)C(C)C)C1CCCCC1.[Cl] Chemical group C1(CCCCC1)P(C1=C(C=CC=C1)C1=C(C=C(C=C1C(C)C)C(C)C)C(C)C)C1CCCCC1.[Cl] VUWBMXNMKRWSEI-UHFFFAOYSA-N 0.000 description 1
- LPGRVLLGYPPEJV-UHFFFAOYSA-N CC(C)(C1)NC(C)(C)CC1N(C)C1=CC=C(C2=CC3=CC=CC=C3N=C2C#N)N=N1 Chemical compound CC(C)(C1)NC(C)(C)CC1N(C)C1=CC=C(C2=CC3=CC=CC=C3N=C2C#N)N=N1 LPGRVLLGYPPEJV-UHFFFAOYSA-N 0.000 description 1
- RBNBXRPYGRQXIJ-UHFFFAOYSA-N COc1cc2n(C)c(=O)ccc2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 Chemical compound COc1cc2n(C)c(=O)ccc2cc1-c1ccc(nn1)N(C)C1CC(C)(C)NC(C)(C)C1 RBNBXRPYGRQXIJ-UHFFFAOYSA-N 0.000 description 1
- VGFFUBSCGJMPKM-UHFFFAOYSA-N COc1ccc2ncc(C)cc2c1Br Chemical compound COc1ccc2ncc(C)cc2c1Br VGFFUBSCGJMPKM-UHFFFAOYSA-N 0.000 description 1
- FDHJSHWELRKJDD-UHFFFAOYSA-M C[Al](C(C1C=CC=C1)C1C=CC=C1)Cl Chemical compound C[Al](C(C1C=CC=C1)C1C=CC=C1)Cl FDHJSHWELRKJDD-UHFFFAOYSA-M 0.000 description 1
- 241000282693 Cercopithecidae Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- MLCGYFRCUOKTGA-UHFFFAOYSA-N Cl.CN(C1=CC=CN=N1)C1CC(NC(C1)(C)C)(C)C Chemical compound Cl.CN(C1=CC=CN=N1)C1CC(NC(C1)(C)C)(C)C MLCGYFRCUOKTGA-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 206010011224 Cough Diseases 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 description 1
- AEMOLEFTQBMNLQ-AQKNRBDQSA-N D-glucopyranuronic acid Chemical compound OC1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O AEMOLEFTQBMNLQ-AQKNRBDQSA-N 0.000 description 1
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 1
- QSJXEFYPDANLFS-UHFFFAOYSA-N Diacetyl Chemical group CC(=O)C(C)=O QSJXEFYPDANLFS-UHFFFAOYSA-N 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 1
- 239000006145 Eagle's minimal essential medium Substances 0.000 description 1
- 241000402754 Erythranthe moschata Species 0.000 description 1
- 108700024394 Exon Proteins 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- 108700039691 Genetic Promoter Regions Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 108010001336 Horseradish Peroxidase Proteins 0.000 description 1
- 241000701024 Human betaherpesvirus 5 Species 0.000 description 1
- LELOWRISYMNNSU-UHFFFAOYSA-N Hydrocyanic acid Natural products N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 208000001953 Hypotension Diseases 0.000 description 1
- WRYCSMQKUKOKBP-UHFFFAOYSA-N Imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 1
- 206010065042 Immune reconstitution inflammatory syndrome Diseases 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 239000012097 Lipofectamine 2000 Substances 0.000 description 1
- 241001572347 Lycaena hermes Species 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- STNJBCKSHOAVAJ-UHFFFAOYSA-N Methacrolein Chemical compound CC(=C)C=O STNJBCKSHOAVAJ-UHFFFAOYSA-N 0.000 description 1
- 206010028289 Muscle atrophy Diseases 0.000 description 1
- 206010028293 Muscle contractions involuntary Diseases 0.000 description 1
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- QIAFMBKCNZACKA-UHFFFAOYSA-N N-benzoylglycine Chemical compound OC(=O)CNC(=O)C1=CC=CC=C1 QIAFMBKCNZACKA-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- OZKLIEUYHIFZAY-UHFFFAOYSA-N Nc1cc(OCc2ccccc2)c(Br)cc1C(O)=O Chemical compound Nc1cc(OCc2ccccc2)c(Br)cc1C(O)=O OZKLIEUYHIFZAY-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 206010054808 Peripheral paralysis Diseases 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-L Phosphate ion(2-) Chemical compound OP([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-L 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 208000004756 Respiratory Insufficiency Diseases 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 208000000453 Skin Neoplasms Diseases 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical class [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- 241000009298 Trigla lyra Species 0.000 description 1
- 235000009754 Vitis X bourquina Nutrition 0.000 description 1
- 235000012333 Vitis X labruscana Nutrition 0.000 description 1
- 240000006365 Vitis vinifera Species 0.000 description 1
- 235000014787 Vitis vinifera Nutrition 0.000 description 1
- 239000003875 Wang resin Substances 0.000 description 1
- NERFNHBZJXXFGY-UHFFFAOYSA-N [4-[(4-methylphenyl)methoxy]phenyl]methanol Chemical compound C1=CC(C)=CC=C1COC1=CC=C(CO)C=C1 NERFNHBZJXXFGY-UHFFFAOYSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000012445 acidic reagent Substances 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 125000005075 adamantyloxy group Chemical group C12(CC3CC(CC(C1)C3)C2)O* 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000005213 alkyl heteroaryl group Chemical group 0.000 description 1
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- SNAAJJQQZSMGQD-UHFFFAOYSA-N aluminum magnesium Chemical compound [Mg].[Al] SNAAJJQQZSMGQD-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 229940009098 aspartate Drugs 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000037444 atrophy Effects 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 239000012620 biological material Substances 0.000 description 1
- 230000031018 biological processes and functions Effects 0.000 description 1
- HTJWUNNIRKDDIV-UHFFFAOYSA-N bis(1-adamantyl)-butylphosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(CCCC)C1(C2)CC(C3)CC2CC3C1 HTJWUNNIRKDDIV-UHFFFAOYSA-N 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- UWTDFICHZKXYAC-UHFFFAOYSA-N boron;oxolane Chemical compound [B].C1CCOC1 UWTDFICHZKXYAC-UHFFFAOYSA-N 0.000 description 1
- 238000006795 borylation reaction Methods 0.000 description 1
- 239000012888 bovine serum Substances 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 229940045348 brown mixture Drugs 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- SNCZNSNPXMPCGN-UHFFFAOYSA-N butanediamide Chemical compound NC(=O)CCC(N)=O SNCZNSNPXMPCGN-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- JHRWWRDRBPCWTF-OLQVQODUSA-N captafol Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)C(Cl)Cl)C(=O)[C@H]21 JHRWWRDRBPCWTF-OLQVQODUSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 229940023913 cation exchange resins Drugs 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000012069 chiral reagent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- NMMPMZWIIQCZBA-UHFFFAOYSA-M chloropalladium(1+);dicyclohexyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane;2-phenylethanamine Chemical compound [Pd+]Cl.NCCC1=CC=CC=[C-]1.CC(C)C1=CC(C(C)C)=CC(C(C)C)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 NMMPMZWIIQCZBA-UHFFFAOYSA-M 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 239000013066 combination product Substances 0.000 description 1
- 229940127555 combination product Drugs 0.000 description 1
- 239000002299 complementary DNA Substances 0.000 description 1
- 229940125810 compound 20 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- MLUCVPSAIODCQM-NSCUHMNNSA-N crotonaldehyde Chemical compound C\C=C\C=O MLUCVPSAIODCQM-NSCUHMNNSA-N 0.000 description 1
- MLUCVPSAIODCQM-UHFFFAOYSA-N crotonaldehyde Natural products CC=CC=O MLUCVPSAIODCQM-UHFFFAOYSA-N 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical compound OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000006612 decyloxy group Chemical group 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 230000007850 degeneration Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000012217 deletion Methods 0.000 description 1
- 230000037430 deletion Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- 125000004774 dichlorofluoromethyl group Chemical group FC(Cl)(Cl)* 0.000 description 1
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000006001 difluoroethyl group Chemical group 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-M dihydrogenphosphate Chemical compound OP(O)([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-M 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 1
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003596 drug target Substances 0.000 description 1
- 229940112141 dry powder inhaler Drugs 0.000 description 1
- 238000002567 electromyography Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 230000013020 embryo development Effects 0.000 description 1
- 238000003821 enantio-separation Methods 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 239000013604 expression vector Substances 0.000 description 1
- 230000001815 facial effect Effects 0.000 description 1
- 230000001605 fetal effect Effects 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 238000012224 gene deletion Methods 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 229960001731 gluceptate Drugs 0.000 description 1
- KWMLJOLKUYYJFJ-VFUOTHLCSA-N glucoheptonic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)C(O)=O KWMLJOLKUYYJFJ-VFUOTHLCSA-N 0.000 description 1
- 229940050410 gluconate Drugs 0.000 description 1
- 229940097042 glucuronate Drugs 0.000 description 1
- 229940074045 glyceryl distearate Drugs 0.000 description 1
- 229940075507 glyceryl monostearate Drugs 0.000 description 1
- 229940015043 glyoxal Drugs 0.000 description 1
- 239000003979 granulating agent Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 1
- 239000007902 hard capsule Substances 0.000 description 1
- 230000004886 head movement Effects 0.000 description 1
- 125000006343 heptafluoro propyl group Chemical group 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-M hexadecanoate Chemical compound CCCCCCCCCCCCCCCC([O-])=O IPCSVZSSVZVIGE-UHFFFAOYSA-M 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 150000004050 homopiperazines Chemical class 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 230000036543 hypotension Effects 0.000 description 1
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 1
- 238000003018 immunoassay Methods 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 239000007972 injectable composition Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 230000003601 intercostal effect Effects 0.000 description 1
- 210000000876 intercostal muscle Anatomy 0.000 description 1
- QWXYZCJEXYQNEI-OSZHWHEXSA-N intermediate I Chemical compound COC(=O)[C@@]1(C=O)[C@H]2CC=[N+](C\C2=C\C)CCc2c1[nH]c1ccccc21 QWXYZCJEXYQNEI-OSZHWHEXSA-N 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229940001447 lactate Drugs 0.000 description 1
- 229940099584 lactobionate Drugs 0.000 description 1
- JYTUSYBCFIZPBE-AMTLMPIISA-N lactobionic acid Chemical compound OC(=O)[C@H](O)[C@@H](O)[C@@H]([C@H](O)CO)O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O JYTUSYBCFIZPBE-AMTLMPIISA-N 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000006166 lysate Substances 0.000 description 1
- 229960003646 lysine Drugs 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-M mandelate Chemical compound [O-]C(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-M 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229960003194 meglumine Drugs 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 230000004899 motility Effects 0.000 description 1
- 230000007659 motor function Effects 0.000 description 1
- 238000010172 mouse model Methods 0.000 description 1
- 230000020763 muscle atrophy Effects 0.000 description 1
- 238000001964 muscle biopsy Methods 0.000 description 1
- 230000004220 muscle function Effects 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229950006327 napsilate Drugs 0.000 description 1
- 239000006199 nebulizer Substances 0.000 description 1
- 230000032405 negative regulation of neuron apoptotic process Effects 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000001537 neural effect Effects 0.000 description 1
- 208000018360 neuromuscular disease Diseases 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- LFLZOWIFJOBEPN-UHFFFAOYSA-N nitrate, nitrate Chemical compound O[N+]([O-])=O.O[N+]([O-])=O LFLZOWIFJOBEPN-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- RNPNPEKBPDIYQF-UHFFFAOYSA-N nitric acid;pyridine-3-carboxylic acid Chemical compound O[N+]([O-])=O.OC(=O)C1=CC=CN=C1 RNPNPEKBPDIYQF-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 125000006574 non-aromatic ring group Chemical group 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 238000004958 nuclear spectroscopy Methods 0.000 description 1
- 238000011330 nucleic acid test Methods 0.000 description 1
- 230000035764 nutrition Effects 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- IVMHDOBGNQOUHO-UHFFFAOYSA-N oxathiane Chemical compound C1CCSOC1 IVMHDOBGNQOUHO-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000006174 pH buffer Substances 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 230000007170 pathology Effects 0.000 description 1
- 235000021400 peanut butter Nutrition 0.000 description 1
- 235000019371 penicillin G benzathine Nutrition 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 150000004686 pentahydrates Chemical class 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 125000004934 phenanthridinyl group Chemical group C1(=CC=CC2=NC=C3C=CC=CC3=C12)* 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000002953 phosphate buffered saline Substances 0.000 description 1
- 150000003904 phospholipids Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 150000004885 piperazines Chemical class 0.000 description 1
- LWMPFIOTEAXAGV-UHFFFAOYSA-N piperidin-1-amine Chemical class NN1CCCCC1 LWMPFIOTEAXAGV-UHFFFAOYSA-N 0.000 description 1
- HDOWRFHMPULYOA-UHFFFAOYSA-N piperidin-4-ol Chemical class OC1CCNCC1 HDOWRFHMPULYOA-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000002952 polymeric resin Substances 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 229940074439 potassium sodium tartrate Drugs 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 1
- 125000004940 pyridazin-4-yl group Chemical group N1=NC=C(C=C1)* 0.000 description 1
- RGMIBYFVHSOSNS-UHFFFAOYSA-N pyridazine;quinoline Chemical class C1=CC=NN=C1.N1=CC=CC2=CC=CC=C21 RGMIBYFVHSOSNS-UHFFFAOYSA-N 0.000 description 1
- 150000004892 pyridazines Chemical class 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 1
- ZVJHJDDKYZXRJI-UHFFFAOYSA-N pyrroline Natural products C1CC=NC1 ZVJHJDDKYZXRJI-UHFFFAOYSA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- LOAUVZALPPNFOQ-UHFFFAOYSA-M quinaldate Chemical compound C1=CC=CC2=NC(C(=O)[O-])=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-M 0.000 description 1
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical compound C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000004548 quinolin-3-yl group Chemical group N1=CC(=CC2=CC=CC=C12)* 0.000 description 1
- NDBZKMOXRLZEJA-UHFFFAOYSA-N quinolin-7-yl formate Chemical class C1=CC=NC2=CC(OC=O)=CC=C21 NDBZKMOXRLZEJA-UHFFFAOYSA-N 0.000 description 1
- FFRYUAVNPBUEIC-UHFFFAOYSA-N quinoxalin-2-ol Chemical compound C1=CC=CC2=NC(O)=CN=C21 FFRYUAVNPBUEIC-UHFFFAOYSA-N 0.000 description 1
- 238000003156 radioimmunoprecipitation Methods 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000000241 respiratory effect Effects 0.000 description 1
- 201000004193 respiratory failure Diseases 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 210000003019 respiratory muscle Anatomy 0.000 description 1
- MOODSJOROWROTO-UHFFFAOYSA-N salicylsulfuric acid Chemical compound OC(=O)C1=CC=CC=C1OS(O)(=O)=O MOODSJOROWROTO-UHFFFAOYSA-N 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 125000001824 selenocyanato group Chemical group *[Se]C#N 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 238000002603 single-photon emission computed tomography Methods 0.000 description 1
- 201000000849 skin cancer Diseases 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 229910001467 sodium calcium phosphate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- VNFWTIYUKDMAOP-UHFFFAOYSA-N sphos Chemical compound COC1=CC=CC(OC)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 VNFWTIYUKDMAOP-UHFFFAOYSA-N 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 229940114926 stearate Drugs 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000012799 strong cation exchange Methods 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 229940086735 succinate Drugs 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 229940071103 sulfosalicylate Drugs 0.000 description 1
- 238000004808 supercritical fluid chromatography Methods 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 230000009747 swallowing Effects 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 210000002435 tendon Anatomy 0.000 description 1
- VVDCRJGWILREQH-UHFFFAOYSA-N tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2h-pyridine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC(B2OC(C)(C)C(C)(C)O2)=C1 VVDCRJGWILREQH-UHFFFAOYSA-N 0.000 description 1
- IYXTZCJHBCBNNC-UHFFFAOYSA-N tert-butyl 4-[6-(5-formyl-4-hydroxy-2-methoxyphenyl)pyridazin-3-yl]piperazine-1-carboxylate Chemical compound COc1cc(O)c(C=O)cc1-c1ccc(nn1)N1CCN(CC1)C(=O)OC(C)(C)C IYXTZCJHBCBNNC-UHFFFAOYSA-N 0.000 description 1
- PYWMYLZNELAYDH-UHFFFAOYSA-N tert-butyl 4-[6-(6-methoxyisoquinolin-7-yl)pyridazin-3-yl]piperazine-1-carboxylate Chemical compound COC=1C=C2C=CN=CC2=CC=1C1=CC=C(N=N1)N1CCN(CC1)C(=O)OC(C)(C)C PYWMYLZNELAYDH-UHFFFAOYSA-N 0.000 description 1
- VUZSVALPMOPXAS-UHFFFAOYSA-N tert-butyl 4-[6-[5-formyl-2-methoxy-4-(trifluoromethylsulfonyloxy)phenyl]pyridazin-3-yl]piperazine-1-carboxylate Chemical compound COc1cc(OS(=O)(=O)C(F)(F)F)c(C=O)cc1-c1ccc(nn1)N1CCN(CC1)C(=O)OC(C)(C)C VUZSVALPMOPXAS-UHFFFAOYSA-N 0.000 description 1
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 1
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000037 tert-butyldiphenylsilyl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1[Si]([H])([*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 238000010257 thawing Methods 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- 238000009210 therapy by ultrasound Methods 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 230000014616 translation Effects 0.000 description 1
- 230000032258 transport Effects 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- FTVLMFQEYACZNP-UHFFFAOYSA-N trimethylsilyl trifluoromethanesulfonate Chemical compound C[Si](C)(C)OS(=O)(=O)C(F)(F)F FTVLMFQEYACZNP-UHFFFAOYSA-N 0.000 description 1
- 229910000404 tripotassium phosphate Inorganic materials 0.000 description 1
- 235000019798 tripotassium phosphate Nutrition 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 229960000281 trometamol Drugs 0.000 description 1
- 230000001228 trophic effect Effects 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/50—Pyridazines; Hydrogenated pyridazines
- A61K31/501—Pyridazines; Hydrogenated pyridazines not condensed and containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
- A61K31/472—Non-condensed isoquinolines, e.g. papaverine
- A61K31/4725—Non-condensed isoquinolines, e.g. papaverine containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/50—Pyridazines; Hydrogenated pyridazines
- A61K31/502—Pyridazines; Hydrogenated pyridazines ortho- or peri-condensed with carbocyclic ring systems, e.g. cinnoline, phthalazine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
- A61K31/517—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim ortho- or peri-condensed with carbocyclic ring systems, e.g. quinazoline, perimidine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/535—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one oxygen as the ring hetero atoms, e.g. 1,2-oxazines
- A61K31/5375—1,4-Oxazines, e.g. morpholine
- A61K31/5377—1,4-Oxazines, e.g. morpholine not condensed and containing further heterocyclic rings, e.g. timolol
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P21/00—Drugs for disorders of the muscular or neuromuscular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P21/00—Drugs for disorders of the muscular or neuromuscular system
- A61P21/02—Muscle relaxants, e.g. for tetanus or cramps
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/10—Spiro-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- General Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Neurology (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Physical Education & Sports Medicine (AREA)
- Pain & Pain Management (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201361860388P | 2013-07-31 | 2013-07-31 | |
| PCT/US2014/048984 WO2015017589A1 (en) | 2013-07-31 | 2014-07-30 | 1,4-disubstituted pyridazine derivatives and their use for treating smn-deficiency-related conditions |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| EA201690287A1 EA201690287A1 (ru) | 2016-07-29 |
| EA030631B1 true EA030631B1 (ru) | 2018-09-28 |
Family
ID=51352849
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| EA201690287A EA030631B1 (ru) | 2013-07-31 | 2014-07-30 | 1,4-дизамещенные аналоги пиридазинхинолина и способы лечения состояний, связанных с smn-дефицитом |
Country Status (14)
| Country | Link |
|---|---|
| US (3) | US20160184305A1 (enExample) |
| EP (2) | EP3027600B1 (enExample) |
| JP (3) | JP6461150B2 (enExample) |
| KR (2) | KR20210130843A (enExample) |
| CN (1) | CN105636953B (enExample) |
| AU (1) | AU2014296255B2 (enExample) |
| BR (1) | BR112016001899B1 (enExample) |
| CA (1) | CA2918805C (enExample) |
| EA (1) | EA030631B1 (enExample) |
| ES (1) | ES2917979T3 (enExample) |
| MX (2) | MX2020011652A (enExample) |
| PL (1) | PL3027600T3 (enExample) |
| PT (1) | PT3027600T (enExample) |
| WO (1) | WO2015017589A1 (enExample) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8729263B2 (en) | 2012-08-13 | 2014-05-20 | Novartis Ag | 1,4-disubstituted pyridazine analogs there of and methods for treating SMN-deficiency-related conditions |
| PL3027600T3 (pl) | 2013-07-31 | 2022-08-08 | Novartis Ag | 1,4-dwupodstawione pochodne pirydazyny i ich zastosowanie do leczenia stanów związanych z niedoborem smn |
| EP3053577A1 (en) * | 2015-02-09 | 2016-08-10 | F. Hoffmann-La Roche AG | Compounds for the treatment of cancer |
| EP3256126B1 (en) * | 2015-02-09 | 2024-03-27 | F. Hoffmann-La Roche AG | Compounds for the treatment of cancer |
| JP6749343B2 (ja) * | 2015-05-20 | 2020-09-02 | エフ.ホフマン−ラ ロシュ アーゲーF. Hoffmann−La Roche Aktiengesellschaft | 脊髄性筋萎縮症を処置するための化合物 |
| WO2017087486A1 (en) | 2015-11-16 | 2017-05-26 | Ohio State Innovation Foundation | Methods and compositions for treating disorders and diseases using survival motor neuron (smn) protein |
| EA201800367A1 (ru) | 2015-12-10 | 2019-02-28 | ПиТиСи ТЕРАПЬЮТИКС, ИНК. | Способы лечения болезни хантингтона |
| KR20200033249A (ko) | 2017-06-05 | 2020-03-27 | 피티씨 테라퓨틱스, 인크. | 헌팅턴병 치료 화합물 |
| JP2020523365A (ja) | 2017-06-14 | 2020-08-06 | ピーティーシー セラピューティクス,インコーポレーテッド | Rnaスプライシングを改変する方法 |
| WO2019000144A1 (zh) * | 2017-06-26 | 2019-01-03 | 深圳市博奥康生物科技有限公司 | 一种表达aitr基因的cho细胞及其应用 |
| WO2019000150A1 (zh) * | 2017-06-26 | 2019-01-03 | 深圳市博奥康生物科技有限公司 | 一种tl6高表达的重组cho细胞的构建方法 |
| US11395822B2 (en) | 2017-06-28 | 2022-07-26 | Ptc Therapeutics, Inc. | Methods for treating Huntington's disease |
| CA3067591A1 (en) | 2017-06-28 | 2019-01-03 | Ptc Therapeutics, Inc. | Methods for treating huntington's disease |
| CN111499615B (zh) | 2017-08-04 | 2024-02-02 | 斯基霍克疗法公司 | 用于调节剪接的方法和组合物 |
| US12103926B2 (en) | 2018-03-27 | 2024-10-01 | Ptc Therapeutics, Inc. | Compounds for treating huntington's disease |
| BR112020026545A2 (pt) | 2018-06-27 | 2021-03-23 | Ptc Therapeutics, Inc. | Compostos heterocíclicos e de heteroarila para o tratamento da doença de huntington |
| EP3814360B8 (en) | 2018-06-27 | 2024-11-06 | PTC Therapeutics, Inc. | Heteroaryl compounds for treating huntington's disease |
| EA202092899A1 (ru) | 2018-06-27 | 2021-05-14 | ПиТиСи ТЕРАПЬЮТИКС, ИНК. | Гетероарильные соединения для лечения болезни гентингтона |
| CN114007613A (zh) | 2019-02-05 | 2022-02-01 | 斯基霍克疗法公司 | 用于调节剪接的方法和组合物 |
| JP7603595B2 (ja) | 2019-02-06 | 2024-12-20 | スカイホーク・セラピューティクス・インコーポレーテッド | スプライシングを調節するための方法および組成物 |
| US11129829B2 (en) | 2019-06-17 | 2021-09-28 | Skyhawk Therapeutics, Inc. | Methods for modulating splicing |
| CN110256342B (zh) * | 2019-07-16 | 2022-06-07 | 河南省科学院化学研究所有限公司 | 一种2-氰基喹啉衍生物的合成方法 |
| US20220307053A1 (en) | 2019-07-25 | 2022-09-29 | Novartis Ag | Regulatable expression systems |
| AU2020377204A1 (en) | 2019-11-01 | 2022-06-02 | Novartis Ag | The use of a splicing modulator for a treatment slowing progression of huntington's disease |
| TW202304446A (zh) | 2021-03-29 | 2023-02-01 | 瑞士商諾華公司 | 剪接調節子用於減慢杭丁頓氏舞蹈症進展的治療之用途 |
| JP7396737B2 (ja) | 2021-06-03 | 2023-12-12 | エムディー ヘルスケア インコーポレイテッド | ラクトバチルス・パラカゼイ由来細胞外小胞を含む眼疾患の予防または治療用組成物 |
Citations (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2427943A1 (de) * | 1974-06-10 | 1976-01-08 | Thomae Gmbh Dr K | Neue benzimidazole |
| WO2001058891A2 (en) * | 2000-02-11 | 2001-08-16 | Vertex Pharmaceuticals Incorporated | Piperazine and piperidine derivatives for treatment or prevention of neuronal damage |
| WO2001066129A1 (en) * | 2000-03-10 | 2001-09-13 | MAX-PLANCK-Gesellschaft zur Förderung der Wissenschaften e.V. | Substances for the treatment of spinal muscular atrophy |
| WO2001094351A1 (en) * | 2000-06-07 | 2001-12-13 | Vertex Pharmaceuticals Incorporated | Caspase inhibitors and uses thereof |
| US6376508B1 (en) * | 2000-12-13 | 2002-04-23 | Academia Sinica | Treatments for spinal muscular atrophy |
| WO2007137030A2 (en) * | 2006-05-19 | 2007-11-29 | Abbott Laboratories | Cns active fused bicycloheterocycle substituted azabicyclic alkane derivatives |
| US20080247964A1 (en) * | 2006-05-08 | 2008-10-09 | Yuelian Xu | Substituted azaspiro derivatives |
| WO2009108657A2 (en) * | 2008-02-28 | 2009-09-03 | Vertex Pharmaceuticals Incorporated | Heteroaryl derivatives as cftr modulators |
| WO2009137503A1 (en) * | 2008-05-05 | 2009-11-12 | Envivo Pharmaceuticals, Inc. | Hdac inhibitors and uses thereof |
| WO2009150139A2 (en) * | 2008-06-10 | 2009-12-17 | Neurosearch A/S | Indolyl-pyridazinyl-diazabicyclononane derivatives in labelled and unlabelled form and their use in diagnostic methods |
| WO2010028192A1 (en) * | 2008-09-03 | 2010-03-11 | Repligen Corporation | Compositions including 6-aminohexanoic acid derivatives as hdac inhibitors |
| WO2011036167A1 (en) * | 2009-09-22 | 2011-03-31 | Novartis Ag | Use of nicotinic acetylcholine receptor alpha 7 activators |
| WO2011063159A1 (en) * | 2009-11-18 | 2011-05-26 | Plexxikon, Inc. | Compounds and methods for kinase modulation, and indications therefor |
| WO2012022467A2 (en) * | 2010-08-16 | 2012-02-23 | Santhera Pharmaceuticals (Schweiz) Ag | Novel benzoquinone derivatives and use thereof as modulators of mitochondrial function |
| WO2012127393A1 (en) * | 2011-03-18 | 2012-09-27 | Novartis Ag | COMBINATIONS OF ALPHA 7 NICOTINIC ACETYLCHOLINE RECEPTOR ACTIVATORS AND mGluR5 ANTAGONISTS FOR USE IN DOPAMINE INDUCED DYSKINESIA IN PARKINSON'S DISEASE |
| WO2014028459A1 (en) * | 2012-08-13 | 2014-02-20 | Novartis Ag | 1,4-disubstituted pyridazine analogs and methods for treating smn-deficiency-related conditions |
Family Cites Families (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2516040C2 (de) * | 1974-06-10 | 1984-12-20 | Dr. Karl Thomae Gmbh, 7950 Biberach | Benzimidazole, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel |
| DK0730590T3 (da) | 1993-11-24 | 2001-03-19 | Du Pont Pharm Co | Isoxazolin og isozazol fibrinogenreceptorantagonister |
| US6982259B2 (en) | 2002-04-30 | 2006-01-03 | Schering Aktiengesellschaft | N-heterocyclic derivatives as NOS inhibitors |
| IL166510A0 (en) | 2002-08-09 | 2006-01-15 | Nps Pharma Inc | 1,2,4"oxadiazole as modulators of metabotropic glutamate receptor-5 |
| EP1581525A2 (en) | 2002-08-09 | 2005-10-05 | AstraZeneca AB | Compounds having an activity at metabotropic glutamate receptors |
| JP2006506340A (ja) | 2002-08-09 | 2006-02-23 | アストラゼネカ アクチボラグ | 代謝調節型グルタミン酸受容体5のモジュレーターとしてのオキサジアゾール |
| AU2003280309A1 (en) | 2002-11-11 | 2004-06-03 | Neurosearch A/S | 1,4-diazabicyclo (3,2,2)nonane derivatives, preparation and therapeutical use thereof |
| JP2007524596A (ja) | 2003-02-28 | 2007-08-30 | トランスフォーム・ファーマシューティカルズ・インコーポレイテッド | 共結晶医薬組成物 |
| WO2004110351A2 (en) | 2003-05-14 | 2004-12-23 | Anadys Pharmaceuticals, Inc. | Heterocyclic compounds for treating hepatitis c virus |
| CN1812981A (zh) | 2003-06-27 | 2006-08-02 | 万有制药株式会社 | 杂芳氧基含氮饱和杂环衍生物 |
| CN1835756A (zh) | 2003-08-15 | 2006-09-20 | 默克公司 | 有丝分裂驱动蛋白抑制剂 |
| US7399765B2 (en) * | 2003-09-19 | 2008-07-15 | Abbott Laboratories | Substituted diazabicycloalkane derivatives |
| US7655657B2 (en) * | 2003-12-22 | 2010-02-02 | Abbott Laboratories | Fused bicycloheterocycle substituted quinuclidine derivatives |
| WO2005077373A2 (en) | 2004-02-03 | 2005-08-25 | Astrazeneca Ab | Treatment of gastro-esophageal reflux disease (gerd) |
| WO2005077368A2 (en) | 2004-02-03 | 2005-08-25 | Astrazeneca Ab | Treatment of gastro-esophageal reflux disease (gerd) |
| FR2868780B1 (fr) | 2004-04-13 | 2008-10-17 | Sanofi Synthelabo | Derives de la 1-amino-phthalazine, leur preparation et leur application en therapeutique |
| JP2008502719A (ja) | 2004-05-21 | 2008-01-31 | メルク エンド カムパニー インコーポレーテッド | アミノシクロペンチル複素環および炭素環系ケモカイン受容体活性調節剤 |
| AU2005283085B2 (en) | 2004-06-18 | 2012-06-21 | 3M Innovative Properties Company | Substituted imidazoquinolines, imidazopyridines, and imidazonaphthyridines |
| MX2007003319A (es) | 2004-09-20 | 2007-06-05 | Xenon Pharmaceuticals Inc | Derivados heterociclicos y su uso como agentes terapeuticos. |
| PL1637141T3 (pl) | 2004-09-21 | 2012-04-30 | Trobio Ab | Stabilizowana kompozycja proteazy zawierająca proteazę serynową, pochodne morfoliny i odwracalne inhibitory tej proteazy serynowej |
| CN101389335A (zh) | 2004-10-18 | 2009-03-18 | 安姆根有限公司 | 噻二唑化合物和使用方法 |
| WO2007000240A1 (en) | 2005-06-28 | 2007-01-04 | Sanofi-Aventis | Isoquinoline derivatives as inhibitors of rho-kinase |
| KR101286569B1 (ko) | 2005-07-04 | 2013-07-23 | 하이 포인트 파마슈티칼스, 엘엘씨 | 신규 약제 |
| GB0517184D0 (en) * | 2005-08-22 | 2005-09-28 | Glaxo Group Ltd | Compounds |
| TW200813051A (en) * | 2006-05-08 | 2008-03-16 | Neurogen Corp | Substituted azaspiro derivatives |
| US20080076924A1 (en) * | 2006-06-30 | 2008-03-27 | Patrick Betschmann | Piperazines as P2X7 antagonists |
| WO2008058064A1 (en) | 2006-11-07 | 2008-05-15 | Lexicon Pharmaceuticals, Inc. | Amine-linked multicyclic compounds as inhibitors of the proline transporter |
| US20100216767A1 (en) | 2006-12-22 | 2010-08-26 | Mina Aikawa | Quinazolines for pdk1 inhibition |
| GB0704394D0 (en) | 2007-03-07 | 2007-04-11 | Senexis Ltd | Compounds |
| GB0705803D0 (en) * | 2007-03-28 | 2007-05-02 | Glaxo Group Ltd | Novel compounds |
| EP2014656A3 (en) | 2007-06-11 | 2011-08-24 | High Point Pharmaceuticals, LLC | New heteocyclic h3 antagonists |
| ES2552733T3 (es) | 2007-11-16 | 2015-12-01 | Rigel Pharmaceuticals, Inc. | Compuestos de carboxamida, sulfonamida y amina para trastornos metabólicos |
| GB0810902D0 (en) | 2008-06-13 | 2008-07-23 | Astex Therapeutics Ltd | New compounds |
| CN102203074A (zh) | 2008-06-20 | 2011-09-28 | 麦它波莱克斯股份有限公司 | 芳基gpr119激动剂及其用途 |
| JP2012504556A (ja) | 2008-10-03 | 2012-02-23 | ベーリンガー インゲルハイム インターナショナル ゲゼルシャフト ミット ベシュレンクテル ハフツング | ウイルスポリメラーゼ阻害剤 |
| CA2739491A1 (en) | 2008-10-16 | 2010-04-22 | Schering Corporation | Azine derivatives and methods of use thereof |
| CA2742515C (en) | 2008-11-04 | 2017-07-11 | Chemocentryx, Inc. | 1,4-diazepane modulators of cxcr7 |
| KR101705158B1 (ko) | 2009-05-05 | 2017-02-09 | 다나-파버 캔서 인스티튜트 인크. | Egfr 억제제 및 질환 치료방법 |
| WO2011009890A2 (en) * | 2009-07-23 | 2011-01-27 | Novartis Ag | Use of azabicycloalkyl derivatives or pyrrolidine-2-one derivatives |
| BR112012005382A2 (pt) | 2009-09-10 | 2016-03-29 | Hoffmann La Roche | inibidores de jak |
| WO2011078143A1 (ja) | 2009-12-22 | 2011-06-30 | 塩野義製薬株式会社 | ピリミジン誘導体およびそれらを含有する医薬組成物 |
| JP6026284B2 (ja) | 2010-03-03 | 2016-11-16 | プロビオドルグ エージー | グルタミニルシクラーゼの阻害剤 |
| US20130096160A1 (en) | 2010-04-14 | 2013-04-18 | Secretary, Department Of Health And Human Services | Arylthiazolyl piperidines and related compounds as modulators of survival motor neuron (smn) protein production |
| AR081626A1 (es) | 2010-04-23 | 2012-10-10 | Cytokinetics Inc | Compuestos amino-piridazinicos, composiciones farmaceuticas que los contienen y uso de los mismos para tratar trastornos musculares cardiacos y esqueleticos |
| PL3027600T3 (pl) * | 2013-07-31 | 2022-08-08 | Novartis Ag | 1,4-dwupodstawione pochodne pirydazyny i ich zastosowanie do leczenia stanów związanych z niedoborem smn |
-
2014
- 2014-07-30 PL PL14750931.9T patent/PL3027600T3/pl unknown
- 2014-07-30 KR KR1020217034080A patent/KR20210130843A/ko not_active Abandoned
- 2014-07-30 EA EA201690287A patent/EA030631B1/ru not_active IP Right Cessation
- 2014-07-30 US US14/909,052 patent/US20160184305A1/en not_active Abandoned
- 2014-07-30 BR BR112016001899-0A patent/BR112016001899B1/pt not_active IP Right Cessation
- 2014-07-30 JP JP2016531875A patent/JP6461150B2/ja not_active Expired - Fee Related
- 2014-07-30 CN CN201480054025.8A patent/CN105636953B/zh not_active Expired - Fee Related
- 2014-07-30 KR KR1020167004818A patent/KR102318727B1/ko not_active Expired - Fee Related
- 2014-07-30 AU AU2014296255A patent/AU2014296255B2/en not_active Ceased
- 2014-07-30 EP EP14750931.9A patent/EP3027600B1/en active Active
- 2014-07-30 WO PCT/US2014/048984 patent/WO2015017589A1/en not_active Ceased
- 2014-07-30 EP EP22159905.3A patent/EP4105208A1/en active Pending
- 2014-07-30 MX MX2020011652A patent/MX2020011652A/es unknown
- 2014-07-30 MX MX2016001400A patent/MX383686B/es unknown
- 2014-07-30 ES ES14750931T patent/ES2917979T3/es active Active
- 2014-07-30 PT PT147509319T patent/PT3027600T/pt unknown
- 2014-07-30 CA CA2918805A patent/CA2918805C/en active Active
-
2018
- 2018-12-25 JP JP2018240458A patent/JP6856614B2/ja not_active Expired - Fee Related
-
2019
- 2019-01-28 US US16/259,441 patent/US11672799B2/en active Active
-
2021
- 2021-03-17 JP JP2021043919A patent/JP7208285B2/ja active Active
-
2023
- 2023-05-23 US US18/322,521 patent/US20240009189A1/en not_active Abandoned
Patent Citations (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2427943A1 (de) * | 1974-06-10 | 1976-01-08 | Thomae Gmbh Dr K | Neue benzimidazole |
| WO2001058891A2 (en) * | 2000-02-11 | 2001-08-16 | Vertex Pharmaceuticals Incorporated | Piperazine and piperidine derivatives for treatment or prevention of neuronal damage |
| WO2001066129A1 (en) * | 2000-03-10 | 2001-09-13 | MAX-PLANCK-Gesellschaft zur Förderung der Wissenschaften e.V. | Substances for the treatment of spinal muscular atrophy |
| WO2001094351A1 (en) * | 2000-06-07 | 2001-12-13 | Vertex Pharmaceuticals Incorporated | Caspase inhibitors and uses thereof |
| US6376508B1 (en) * | 2000-12-13 | 2002-04-23 | Academia Sinica | Treatments for spinal muscular atrophy |
| US20080247964A1 (en) * | 2006-05-08 | 2008-10-09 | Yuelian Xu | Substituted azaspiro derivatives |
| WO2007137030A2 (en) * | 2006-05-19 | 2007-11-29 | Abbott Laboratories | Cns active fused bicycloheterocycle substituted azabicyclic alkane derivatives |
| WO2009108657A2 (en) * | 2008-02-28 | 2009-09-03 | Vertex Pharmaceuticals Incorporated | Heteroaryl derivatives as cftr modulators |
| WO2009137503A1 (en) * | 2008-05-05 | 2009-11-12 | Envivo Pharmaceuticals, Inc. | Hdac inhibitors and uses thereof |
| WO2009150139A2 (en) * | 2008-06-10 | 2009-12-17 | Neurosearch A/S | Indolyl-pyridazinyl-diazabicyclononane derivatives in labelled and unlabelled form and their use in diagnostic methods |
| WO2010028192A1 (en) * | 2008-09-03 | 2010-03-11 | Repligen Corporation | Compositions including 6-aminohexanoic acid derivatives as hdac inhibitors |
| WO2011036167A1 (en) * | 2009-09-22 | 2011-03-31 | Novartis Ag | Use of nicotinic acetylcholine receptor alpha 7 activators |
| WO2011063159A1 (en) * | 2009-11-18 | 2011-05-26 | Plexxikon, Inc. | Compounds and methods for kinase modulation, and indications therefor |
| WO2012022467A2 (en) * | 2010-08-16 | 2012-02-23 | Santhera Pharmaceuticals (Schweiz) Ag | Novel benzoquinone derivatives and use thereof as modulators of mitochondrial function |
| WO2012127393A1 (en) * | 2011-03-18 | 2012-09-27 | Novartis Ag | COMBINATIONS OF ALPHA 7 NICOTINIC ACETYLCHOLINE RECEPTOR ACTIVATORS AND mGluR5 ANTAGONISTS FOR USE IN DOPAMINE INDUCED DYSKINESIA IN PARKINSON'S DISEASE |
| WO2014028459A1 (en) * | 2012-08-13 | 2014-02-20 | Novartis Ag | 1,4-disubstituted pyridazine analogs and methods for treating smn-deficiency-related conditions |
Non-Patent Citations (4)
| Title |
|---|
| BUNNELLE W H, TIETJE K R, FROST J M, PETERS D, JI J, LI T, SCANIO M J, SHI L, ANDERSON D J, DYHRING T, GRØNLIEN J H, WEEN H, THORI: "Octahydropyrrolo[3,4-c]pyrrole: a diamine scaffold for construction of either alpha4beta2 or alpha7-selective nicotinic acetylcholine receptor (nAChR) ligands. Substitutions that switch subtype selectivity.", JOURNAL OF MEDICINAL CHEMISTRY, AMERICAN CHEMICAL SOCIETY, vol. 52, no. 14, 23 July 2009 (2009-07-23), pages 4126 - 4141, XP002732635, ISSN: 0022-2623, DOI: 10.1021/jm900249k * |
| JINHE LI; SUZANNE L. MATHIEU; RICHARD HARRIS; JIANGUO JI; DAVID J. ANDERSON; JOHN MALYSZ; WILLIAM H. BUNNELLE; JEFFREY F. WARING; : "Role of 7 nicotinic acetylcholine receptors in regulating tumor necrosis factor- (TNF- ) as revealed by subtype selective agonists", JOURNAL OF NEUROIMMUNOLOGY., ELSEVIER SCIENCE PUBLISHERS BV., NL, vol. 239, no. 1, 10 August 2011 (2011-08-10), NL, pages 37 - 43, XP028328732, ISSN: 0165-5728, DOI: 10.1016/j.jneuroim.2011.08.007 * |
| LI, T. ; BUNNELLE, W.H. ; RYTHER, K.B. ; ANDERSON, D.J. ; MALYSZ, J. ; HELFRICH, R. ; GRONLIEN, J.H. ; HAKERUD, M. ; PETERS, D. ; : "Syntheses and structure-activity relationship (SAR) studies of 2,5-diazabicyclo[2.2.1]heptanes as novel @a7 neuronal nicotinic receptor (NNR) ligands", BIOORGANIC & MEDICINAL CHEMISTRY LETTERS, PERGAMON, AMSTERDAM, NL, vol. 20, no. 12, 15 June 2010 (2010-06-15), AMSTERDAM, NL, pages 3636 - 3639, XP027351220, ISSN: 0960-894X * |
| R. S. BITNER, BUNNELLE W. H., DECKER M. W., DRESCHER K. U., KOHLHAAS K. L., MARKOSYAN S., MARSH K. C., NIKKEL A. L., BROWMAN K., R: "In Vivo Pharmacological Characterization of a Novel Selective �7 Neuronal Nicotinic Acetylcholine Receptor Agonist ABT-107: Preclinical Considerations in Alzheimer's Disease", JOURNAL OF PHARMACOLOGY AND EXPERIMENTAL THERAPEUTICS, WILLIAMS AND WILKINS CO., vol. 334, no. 3, 1 September 2010 (2010-09-01), pages 875 - 886, XP055008274, ISSN: 00223565, DOI: 10.1124/jpet.110.167213 * |
Also Published As
| Publication number | Publication date |
|---|---|
| PL3027600T3 (pl) | 2022-08-08 |
| US11672799B2 (en) | 2023-06-13 |
| CA2918805A1 (en) | 2015-02-05 |
| KR20160037199A (ko) | 2016-04-05 |
| EP4105208A1 (en) | 2022-12-21 |
| KR20210130843A (ko) | 2021-11-01 |
| JP2016527272A (ja) | 2016-09-08 |
| US20240009189A1 (en) | 2024-01-11 |
| US20160184305A1 (en) | 2016-06-30 |
| AU2014296255A1 (en) | 2016-02-18 |
| JP7208285B2 (ja) | 2023-01-18 |
| MX2020011652A (es) | 2022-09-27 |
| BR112016001899B1 (pt) | 2022-03-15 |
| EP3027600A1 (en) | 2016-06-08 |
| CN105636953B (zh) | 2018-01-02 |
| MX383686B (es) | 2025-03-14 |
| ES2917979T3 (es) | 2022-07-12 |
| PT3027600T (pt) | 2022-06-23 |
| EP3027600B1 (en) | 2022-04-06 |
| BR112016001899A2 (enExample) | 2017-09-05 |
| US20190160062A1 (en) | 2019-05-30 |
| MX2016001400A (es) | 2016-05-05 |
| JP6856614B2 (ja) | 2021-04-07 |
| JP2021098753A (ja) | 2021-07-01 |
| CN105636953A (zh) | 2016-06-01 |
| EA201690287A1 (ru) | 2016-07-29 |
| JP2019059783A (ja) | 2019-04-18 |
| AU2014296255B2 (en) | 2017-08-03 |
| WO2015017589A1 (en) | 2015-02-05 |
| JP6461150B2 (ja) | 2019-01-30 |
| KR102318727B1 (ko) | 2021-10-28 |
| CA2918805C (en) | 2023-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP7208285B2 (ja) | 1,4-二置換ピリダジン誘導体およびsmn欠損に関連する状態を処置するためのその使用 | |
| JP6190883B2 (ja) | 1,4−二置換ピリダジン類似体およびsmn欠損に関連する状態を処置するための方法 | |
| JP5820921B2 (ja) | 1,2−二置換複素環式化合物 | |
| US9040712B2 (en) | Thiadiazole analogs thereof and methods for treating SMN-deficiency-related-conditions | |
| WO2017129116A1 (zh) | 吡咯嘧啶五元氮杂环衍生物及其应用 | |
| CN116514846A (zh) | 杂环类衍生物、其制备方法及其医药上的用途 | |
| AU2013302859B9 (en) | 1,4-disubstituted pyridazine analogs and methods for treating SMN-deficiency-related conditions | |
| HK40012123A (en) | 1,4-disubstituted pyridazine analogs and methods for treating smn-deficiency-related conditions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Lapse of a eurasian patent due to non-payment of renewal fees within the time limit in the following designated state(s) |
Designated state(s): AM AZ BY KZ KG TJ TM |