EA018104B1 - Конденсированные тиазолы, обладающие антибактериальными свойствами - Google Patents
Конденсированные тиазолы, обладающие антибактериальными свойствами Download PDFInfo
- Publication number
- EA018104B1 EA018104B1 EA201000993A EA201000993A EA018104B1 EA 018104 B1 EA018104 B1 EA 018104B1 EA 201000993 A EA201000993 A EA 201000993A EA 201000993 A EA201000993 A EA 201000993A EA 018104 B1 EA018104 B1 EA 018104B1
- Authority
- EA
- Eurasian Patent Office
- Prior art keywords
- thiazol
- ethyl
- mmol
- benzo
- urea
- Prior art date
Links
- 230000000844 anti-bacterial effect Effects 0.000 title claims abstract description 13
- 150000003557 thiazoles Chemical class 0.000 title 1
- 238000002360 preparation method Methods 0.000 claims abstract description 140
- 239000000203 mixture Substances 0.000 claims abstract description 114
- 150000001875 compounds Chemical class 0.000 claims abstract description 88
- 230000001580 bacterial effect Effects 0.000 claims abstract description 14
- 150000003839 salts Chemical class 0.000 claims abstract description 13
- 238000011109 contamination Methods 0.000 claims abstract description 7
- 239000003814 drug Substances 0.000 claims abstract description 7
- 208000035143 Bacterial infection Diseases 0.000 claims abstract description 4
- 208000022362 bacterial infectious disease Diseases 0.000 claims abstract description 4
- 239000000758 substrate Substances 0.000 claims abstract 2
- -1 methoxy, mercapto, mercaptomethyl Chemical group 0.000 claims description 328
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 295
- 229910052757 nitrogen Inorganic materials 0.000 claims description 194
- 125000000437 thiazol-2-yl group Chemical group [H]C1=C([H])N=C(*)S1 0.000 claims description 182
- 125000005605 benzo group Chemical group 0.000 claims description 181
- 239000004202 carbamide Substances 0.000 claims description 161
- 125000004496 thiazol-5-yl group Chemical group S1C=NC=C1* 0.000 claims description 47
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 30
- 125000001424 substituent group Chemical group 0.000 claims description 28
- 125000004429 atom Chemical group 0.000 claims description 21
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- 239000001257 hydrogen Substances 0.000 claims description 17
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 claims description 17
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 14
- SIOXPEMLGUPBBT-UHFFFAOYSA-M picolinate Chemical compound [O-]C(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-M 0.000 claims description 14
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims description 13
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 10
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 10
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 10
- 125000002950 monocyclic group Chemical group 0.000 claims description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 10
- 125000001072 heteroaryl group Chemical group 0.000 claims description 9
- 125000005553 heteroaryloxy group Chemical group 0.000 claims description 9
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 9
- 150000002431 hydrogen Chemical class 0.000 claims description 8
- 125000003386 piperidinyl group Chemical group 0.000 claims description 8
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 125000005842 heteroatom Chemical group 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 7
- 125000002757 morpholinyl group Chemical group 0.000 claims description 7
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 7
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 7
- XJLSEXAGTJCILF-RXMQYKEDSA-N (R)-nipecotic acid zwitterion Chemical compound OC(=O)[C@@H]1CCCNC1 XJLSEXAGTJCILF-RXMQYKEDSA-N 0.000 claims description 6
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 6
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 6
- 125000003277 amino group Chemical group 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 125000004193 piperazinyl group Chemical group 0.000 claims description 6
- 125000004122 cyclic group Chemical group 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- SRJOCJYGOFTFLH-UHFFFAOYSA-N isonipecotic acid Chemical compound OC(=O)C1CCNCC1 SRJOCJYGOFTFLH-UHFFFAOYSA-N 0.000 claims description 5
- DNUTZBZXLPWRJG-UHFFFAOYSA-M piperidine-1-carboxylate Chemical compound [O-]C(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-M 0.000 claims description 5
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 claims description 4
- ZPSMOJSIGHAIGD-UHFFFAOYSA-N 1-ethyl-3-[6-fluoro-5-[1-[(3-methoxypyridin-2-yl)methyl]-2-oxopyridin-4-yl]-1,3-benzothiazol-2-yl]urea Chemical compound FC=1C=C2SC(NC(=O)NCC)=NC2=CC=1C(=CC1=O)C=CN1CC1=NC=CC=C1OC ZPSMOJSIGHAIGD-UHFFFAOYSA-N 0.000 claims description 4
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical class O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 claims description 4
- RYECOJGRJDOGPP-UHFFFAOYSA-N Ethylurea Chemical compound CCNC(N)=O RYECOJGRJDOGPP-UHFFFAOYSA-N 0.000 claims description 4
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical class C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- XJLSEXAGTJCILF-UHFFFAOYSA-N nipecotic acid Chemical compound OC(=O)C1CCCNC1 XJLSEXAGTJCILF-UHFFFAOYSA-N 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 125000000101 thioether group Chemical group 0.000 claims description 4
- 125000004455 (C1-C3) alkylthio group Chemical group 0.000 claims description 3
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 3
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 claims description 3
- SESBOEYJZCQDBQ-UHFFFAOYSA-N 1-ethyl-3-(6-fluoro-5-pyridin-3-yl-1,3-benzothiazol-2-yl)urea Chemical compound FC=1C=C2SC(NC(=O)NCC)=NC2=CC=1C1=CC=CN=C1 SESBOEYJZCQDBQ-UHFFFAOYSA-N 0.000 claims description 3
- ICIZQHAUBHCDNR-UHFFFAOYSA-N 1-ethyl-3-[5-(1-methyl-2-oxopyridin-4-yl)-1,3-benzothiazol-2-yl]urea Chemical compound C=1C=C2SC(NC(=O)NCC)=NC2=CC=1C=1C=CN(C)C(=O)C=1 ICIZQHAUBHCDNR-UHFFFAOYSA-N 0.000 claims description 3
- CDRBZIWHZFQOGA-UHFFFAOYSA-N 1-ethyl-3-[6-fluoro-5-(4-methoxypyridin-2-yl)-1,3-benzothiazol-2-yl]urea Chemical compound FC=1C=C2SC(NC(=O)NCC)=NC2=CC=1C1=CC(OC)=CC=N1 CDRBZIWHZFQOGA-UHFFFAOYSA-N 0.000 claims description 3
- ZWMXKXNCZAXWND-UHFFFAOYSA-N 1-ethyl-3-[6-fluoro-5-[2-methyl-1-[1-(6-methylpyridin-3-yl)ethyl]-6-oxopyridin-4-yl]-1,3-benzothiazol-2-yl]urea Chemical compound FC=1C=C2SC(NC(=O)NCC)=NC2=CC=1C(=CC1=O)C=C(C)N1C(C)C1=CC=C(C)N=C1 ZWMXKXNCZAXWND-UHFFFAOYSA-N 0.000 claims description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 3
- VYWQTJWGWLKBQA-UHFFFAOYSA-N [amino(hydroxy)methylidene]azanium;chloride Chemical compound Cl.NC(N)=O VYWQTJWGWLKBQA-UHFFFAOYSA-N 0.000 claims description 3
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims description 3
- 150000001412 amines Chemical group 0.000 claims description 3
- 125000004540 benzothiazol-5-yl group Chemical group S1C=NC2=C1C=CC(=C2)* 0.000 claims description 3
- 125000001033 ether group Chemical group 0.000 claims description 3
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 3
- 125000004552 isoquinolin-4-yl group Chemical group C1=NC=C(C2=CC=CC=C12)* 0.000 claims description 3
- 150000002825 nitriles Chemical class 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 3
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 3
- 125000006526 (C1-C2) alkyl group Chemical group 0.000 claims description 2
- 125000006590 (C2-C6) alkenylene group Chemical group 0.000 claims description 2
- 125000006591 (C2-C6) alkynylene group Chemical group 0.000 claims description 2
- JUZOPGNAEFIKMI-UHFFFAOYSA-N 1-ethyl-3-(5-pyridin-3-yl-1,3-benzothiazol-2-yl)urea Chemical compound C=1C=C2SC(NC(=O)NCC)=NC2=CC=1C1=CC=CN=C1 JUZOPGNAEFIKMI-UHFFFAOYSA-N 0.000 claims description 2
- OJIRJPXQGLKPLX-UHFFFAOYSA-N 1-ethyl-3-(6-pyridin-3-yl-[1,3]thiazolo[5,4-b]pyridin-2-yl)urea Chemical compound C=1N=C2SC(NC(=O)NCC)=NC2=CC=1C1=CC=CN=C1 OJIRJPXQGLKPLX-UHFFFAOYSA-N 0.000 claims description 2
- XRRFWZVFIZUJQM-UHFFFAOYSA-N 1-ethyl-3-[6-(2-methyl-6-oxopyran-4-yl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]urea Chemical compound C=1N=C2SC(NC(=O)NCC)=NC2=CC=1C=1C=C(C)OC(=O)C=1 XRRFWZVFIZUJQM-UHFFFAOYSA-N 0.000 claims description 2
- ZPSJGADGUYYRKE-UHFFFAOYSA-N 2H-pyran-2-one Chemical class O=C1C=CC=CO1 ZPSJGADGUYYRKE-UHFFFAOYSA-N 0.000 claims description 2
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Chemical class C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 claims description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical class C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 2
- 125000004450 alkenylene group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000004419 alkynylene group Chemical group 0.000 claims description 2
- 125000002527 bicyclic carbocyclic group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000002560 nitrile group Chemical group 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 150000004866 oxadiazoles Chemical class 0.000 claims description 2
- SRJOCJYGOFTFLH-UHFFFAOYSA-M piperidine-4-carboxylate Chemical compound [O-]C(=O)C1CCNCC1 SRJOCJYGOFTFLH-UHFFFAOYSA-M 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 claims description 2
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical class OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 claims description 2
- 150000003222 pyridines Chemical class 0.000 claims description 2
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 claims description 2
- YTQDJZOARIHJGS-UHFFFAOYSA-N 1,3-thiazol-2-ylurea Chemical compound NC(=O)NC1=NC=CS1 YTQDJZOARIHJGS-UHFFFAOYSA-N 0.000 claims 2
- 125000005843 halogen group Chemical group 0.000 claims 2
- 125000006413 ring segment Chemical group 0.000 claims 2
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- 125000001153 fluoro group Chemical group F* 0.000 claims 1
- 230000002265 prevention Effects 0.000 claims 1
- 150000001204 N-oxides Chemical class 0.000 abstract 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 380
- 239000011541 reaction mixture Substances 0.000 description 345
- 239000000243 solution Substances 0.000 description 188
- 238000006243 chemical reaction Methods 0.000 description 168
- 238000012544 monitoring process Methods 0.000 description 157
- 238000004809 thin layer chromatography Methods 0.000 description 155
- YNHIGQDRGKUECZ-UHFFFAOYSA-L PdCl2(PPh3)2 Substances [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 134
- 239000000047 product Substances 0.000 description 127
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 122
- 239000012267 brine Substances 0.000 description 95
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 95
- 239000012044 organic layer Substances 0.000 description 90
- 239000000741 silica gel Substances 0.000 description 86
- 229910002027 silica gel Inorganic materials 0.000 description 86
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 67
- 239000005457 ice water Substances 0.000 description 66
- 239000012043 crude product Substances 0.000 description 64
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 63
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 57
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Natural products CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 53
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 52
- 238000004128 high performance liquid chromatography Methods 0.000 description 51
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 48
- WLPUWLXVBWGYMZ-UHFFFAOYSA-N tricyclohexylphosphine Chemical compound C1CCCCC1P(C1CCCCC1)C1CCCCC1 WLPUWLXVBWGYMZ-UHFFFAOYSA-N 0.000 description 47
- UTCSSFWDNNEEBH-UHFFFAOYSA-N imidazo[1,2-a]pyridine Chemical compound C1=CC=CC2=NC=CN21 UTCSSFWDNNEEBH-UHFFFAOYSA-N 0.000 description 46
- IBDINBYDLQQKTJ-UHFFFAOYSA-N 1-(5-bromo-6-fluoro-1,3-benzothiazol-2-yl)-3-ethylurea Chemical compound BrC1=C(F)C=C2SC(NC(=O)NCC)=NC2=C1 IBDINBYDLQQKTJ-UHFFFAOYSA-N 0.000 description 45
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 42
- 238000005406 washing Methods 0.000 description 39
- YMWUJEATGCHHMB-UHFFFAOYSA-N dichloromethane Natural products ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 38
- 238000000746 purification Methods 0.000 description 34
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 32
- 239000000706 filtrate Substances 0.000 description 31
- 239000010410 layer Substances 0.000 description 31
- SGPBDQOKYOKYHV-UHFFFAOYSA-N ethyl 1-methyl-4-oxo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline-3-carboxylate Chemical compound C=1C=C2C(=O)C(C(=O)OCC)=CN(C)C2=CC=1B1OC(C)(C)C(C)(C)O1 SGPBDQOKYOKYHV-UHFFFAOYSA-N 0.000 description 26
- 239000007787 solid Substances 0.000 description 25
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 238000000605 extraction Methods 0.000 description 21
- 239000011734 sodium Substances 0.000 description 17
- ZPUJTWBWSOOMRP-UHFFFAOYSA-N 5-bromo-1,3-benzothiazol-2-amine Chemical compound BrC1=CC=C2SC(N)=NC2=C1 ZPUJTWBWSOOMRP-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 230000000694 effects Effects 0.000 description 14
- 101710183280 Topoisomerase Proteins 0.000 description 13
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 13
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical compound CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 10
- 239000012299 nitrogen atmosphere Substances 0.000 description 10
- IVDFJHOHABJVEH-UHFFFAOYSA-N pinacol Chemical compound CC(C)(O)C(C)(C)O IVDFJHOHABJVEH-UHFFFAOYSA-N 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical class [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 150000003254 radicals Chemical class 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- UXJPMUJPXYOOHG-UHFFFAOYSA-N 1,3-thiazol-5-yl trifluoromethanesulfonate Chemical compound FC(S(=O)(=O)OC1=CN=CS1)(F)F UXJPMUJPXYOOHG-UHFFFAOYSA-N 0.000 description 8
- SSLMGOKTIUIZLY-UHFFFAOYSA-N 4-bromo-1h-pyridin-2-one Chemical compound OC1=CC(Br)=CC=N1 SSLMGOKTIUIZLY-UHFFFAOYSA-N 0.000 description 8
- 241000894006 Bacteria Species 0.000 description 8
- 239000007983 Tris buffer Substances 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 8
- CPEKAXYCDKETEN-UHFFFAOYSA-N benzoyl isothiocyanate Chemical compound S=C=NC(=O)C1=CC=CC=C1 CPEKAXYCDKETEN-UHFFFAOYSA-N 0.000 description 8
- ABMYEXAYWZJVOV-UHFFFAOYSA-N pyridin-3-ylboronic acid Chemical compound OB(O)C1=CC=CN=C1 ABMYEXAYWZJVOV-UHFFFAOYSA-N 0.000 description 8
- NSYSSMYQPLSPOD-UHFFFAOYSA-N triacetate lactone Chemical compound CC1=CC(O)=CC(=O)O1 NSYSSMYQPLSPOD-UHFFFAOYSA-N 0.000 description 8
- 206010065042 Immune reconstitution inflammatory syndrome Diseases 0.000 description 7
- 239000003242 anti bacterial agent Substances 0.000 description 7
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical class C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 7
- NXQGGXCHGDYOHB-UHFFFAOYSA-L cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;dichloropalladium;iron(2+) Chemical compound [Fe+2].Cl[Pd]Cl.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 NXQGGXCHGDYOHB-UHFFFAOYSA-L 0.000 description 7
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 7
- YFOQSLIPUHGGQE-UHFFFAOYSA-N 4-bromo-1-methylpyridin-2-one Chemical compound CN1C=CC(Br)=CC1=O YFOQSLIPUHGGQE-UHFFFAOYSA-N 0.000 description 6
- 108020004414 DNA Proteins 0.000 description 6
- 108090000790 Enzymes Proteins 0.000 description 6
- 102000004190 Enzymes Human genes 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 208000015181 infectious disease Diseases 0.000 description 6
- 239000002480 mineral oil Substances 0.000 description 6
- 235000010446 mineral oil Nutrition 0.000 description 6
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 5
- 229940088710 antibiotic agent Drugs 0.000 description 5
- 238000007429 general method Methods 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000002609 medium Substances 0.000 description 5
- 235000011056 potassium acetate Nutrition 0.000 description 5
- 235000011118 potassium hydroxide Nutrition 0.000 description 5
- 238000010926 purge Methods 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 5
- NCCRJWXFDGJZLM-UHFFFAOYSA-N 1-(5-bromo-1,3-benzothiazol-2-yl)-3-ethylurea Chemical compound BrC1=CC=C2SC(NC(=O)NCC)=NC2=C1 NCCRJWXFDGJZLM-UHFFFAOYSA-N 0.000 description 4
- 108091006112 ATPases Proteins 0.000 description 4
- 102000057290 Adenosine Triphosphatases Human genes 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 230000000845 anti-microbial effect Effects 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 150000003950 cyclic amides Chemical class 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 235000019441 ethanol Nutrition 0.000 description 4
- 238000003818 flash chromatography Methods 0.000 description 4
- 150000002430 hydrocarbons Chemical group 0.000 description 4
- 239000003112 inhibitor Substances 0.000 description 4
- XVAIDCNLVLTVFM-UHFFFAOYSA-N methacetin Chemical compound COC1=CC=C(NC(C)=O)C=C1 XVAIDCNLVLTVFM-UHFFFAOYSA-N 0.000 description 4
- 150000003141 primary amines Chemical class 0.000 description 4
- NYCVCXMSZNOGDH-UHFFFAOYSA-N pyrrolidine-1-carboxylic acid Chemical compound OC(=O)N1CCCC1 NYCVCXMSZNOGDH-UHFFFAOYSA-N 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- 239000006188 syrup Substances 0.000 description 4
- 235000020357 syrup Nutrition 0.000 description 4
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 4
- LENLQGBLVGGAMF-UHFFFAOYSA-N tributyl([1,2,4]triazolo[1,5-a]pyridin-6-yl)stannane Chemical compound C1=C([Sn](CCCC)(CCCC)CCCC)C=CC2=NC=NN21 LENLQGBLVGGAMF-UHFFFAOYSA-N 0.000 description 4
- LMFDEUSLYJMRRF-UHFFFAOYSA-N (5-bromo-2,4-difluorophenyl)thiourea Chemical compound NC(=S)NC1=CC(Br)=C(F)C=C1F LMFDEUSLYJMRRF-UHFFFAOYSA-N 0.000 description 3
- RUCZFWMEACWFER-UHFFFAOYSA-N (5-bromopyridin-2-yl)methanol Chemical compound OCC1=CC=C(Br)C=N1 RUCZFWMEACWFER-UHFFFAOYSA-N 0.000 description 3
- NZZLECBWDDORQM-UHFFFAOYSA-N 1-ethyl-3-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]urea Chemical compound C=1N=C2SC(NC(=O)NCC)=NC2=CC=1B1OC(C)(C)C(C)(C)O1 NZZLECBWDDORQM-UHFFFAOYSA-N 0.000 description 3
- ATKULCGQSLCGEK-UHFFFAOYSA-N 2-(5-bromopyridin-2-yl)acetic acid Chemical compound OC(=O)CC1=CC=C(Br)C=N1 ATKULCGQSLCGEK-UHFFFAOYSA-N 0.000 description 3
- FJWXIWBINYNRCO-UHFFFAOYSA-N 3-(5-bromopyridin-2-yl)-5-methyl-1,2,4-oxadiazole Chemical compound O1C(C)=NC(C=2N=CC(Br)=CC=2)=N1 FJWXIWBINYNRCO-UHFFFAOYSA-N 0.000 description 3
- NWPUIXHXLHVEEN-UHFFFAOYSA-N 4-[(5-bromopyridin-2-yl)methyl]morpholine Chemical compound N1=CC(Br)=CC=C1CN1CCOCC1 NWPUIXHXLHVEEN-UHFFFAOYSA-N 0.000 description 3
- LLFSFJYWGVKYRP-UHFFFAOYSA-N 4-bromo-6-methylpyran-2-one Chemical compound CC1=CC(Br)=CC(=O)O1 LLFSFJYWGVKYRP-UHFFFAOYSA-N 0.000 description 3
- RPCKLZZTGOIHCJ-UHFFFAOYSA-N 5-bromo-6-fluoro-1,3-benzothiazol-2-amine Chemical compound BrC1=C(F)C=C2SC(N)=NC2=C1 RPCKLZZTGOIHCJ-UHFFFAOYSA-N 0.000 description 3
- PUGRLECVVKCJKU-UHFFFAOYSA-N 6-methyl-1-(pyridin-3-ylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one Chemical compound CC1=CC(B2OC(C)(C)C(C)(C)O2)=CC(=O)N1CC1=CC=CN=C1 PUGRLECVVKCJKU-UHFFFAOYSA-N 0.000 description 3
- 125000004939 6-pyridyl group Chemical group N1=CC=CC=C1* 0.000 description 3
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 3
- 108010041052 DNA Topoisomerase IV Proteins 0.000 description 3
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 238000007872 degassing Methods 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- FDZZZRQASAIRJF-UHFFFAOYSA-M malachite green Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1C(C=1C=CC=CC=1)=C1C=CC(=[N+](C)C)C=C1 FDZZZRQASAIRJF-UHFFFAOYSA-M 0.000 description 3
- 229940107698 malachite green Drugs 0.000 description 3
- JJXLVTVWRZCLGJ-UHFFFAOYSA-N n-[(5-bromo-2,4-difluorophenyl)carbamothioyl]benzamide Chemical compound C1=C(Br)C(F)=CC(F)=C1NC(=S)NC(=O)C1=CC=CC=C1 JJXLVTVWRZCLGJ-UHFFFAOYSA-N 0.000 description 3
- RFIOZSIHFNEKFF-UHFFFAOYSA-M piperazine-1-carboxylate Chemical compound [O-]C(=O)N1CCNCC1 RFIOZSIHFNEKFF-UHFFFAOYSA-M 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 229940002612 prodrug Drugs 0.000 description 3
- 239000000651 prodrug Substances 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000012047 saturated solution Substances 0.000 description 3
- 239000012265 solid product Substances 0.000 description 3
- 239000012453 solvate Substances 0.000 description 3
- 239000000600 sorbitol Substances 0.000 description 3
- 235000010356 sorbitol Nutrition 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 230000000699 topical effect Effects 0.000 description 3
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 3
- 229910000404 tripotassium phosphate Inorganic materials 0.000 description 3
- 235000019798 tripotassium phosphate Nutrition 0.000 description 3
- CYPYTURSJDMMMP-WVCUSYJESA-N tris(dibenzylideneacetone)dipalladium(0) Substances [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 3
- GDVJWWGNIMWFRJ-UHFFFAOYSA-N (2,5-dibromophenyl)thiourea Chemical compound NC(=S)NC1=CC(Br)=CC=C1Br GDVJWWGNIMWFRJ-UHFFFAOYSA-N 0.000 description 2
- KBJMQQSEWSWHDL-UHFFFAOYSA-N 1-(6-bromo-[1,3]thiazolo[5,4-b]pyridin-2-yl)-3-ethylurea Chemical compound BrC1=CN=C2SC(NC(=O)NCC)=NC2=C1 KBJMQQSEWSWHDL-UHFFFAOYSA-N 0.000 description 2
- UIHXONVDYVBELZ-UHFFFAOYSA-N 1-[5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-6-fluoro-1,3-benzothiazol-2-yl]-3-ethylurea Chemical compound FC=1C=C2SC(NC(=O)NCC)=NC2=CC=1B1OCC(C)(C)CO1 UIHXONVDYVBELZ-UHFFFAOYSA-N 0.000 description 2
- YZUPZGFPHUVJKC-UHFFFAOYSA-N 1-bromo-2-methoxyethane Chemical compound COCCBr YZUPZGFPHUVJKC-UHFFFAOYSA-N 0.000 description 2
- BFTGFSXOLBQJNU-UHFFFAOYSA-N 1-ethyl-3-(5-hydroxy-6-methyl-1,3-benzothiazol-2-yl)urea Chemical compound OC1=C(C)C=C2SC(NC(=O)NCC)=NC2=C1 BFTGFSXOLBQJNU-UHFFFAOYSA-N 0.000 description 2
- IERZWUZDMPGDGZ-UHFFFAOYSA-N 1-ethyl-3-[5-(2-imidazol-1-ylpyrimidin-5-yl)-1,3-benzothiazol-2-yl]urea Chemical compound C=1C=C2SC(NC(=O)NCC)=NC2=CC=1C(C=N1)=CN=C1N1C=CN=C1 IERZWUZDMPGDGZ-UHFFFAOYSA-N 0.000 description 2
- AVJRGCKNVZTWQH-UHFFFAOYSA-N 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one Chemical compound O=C1N(C)C=CC(B2OC(C)(C)C(C)(C)O2)=C1 AVJRGCKNVZTWQH-UHFFFAOYSA-N 0.000 description 2
- KEBMPIFHPWXEHI-UHFFFAOYSA-N 2,2-dimethylpropyl 2-hydroxyacetate Chemical compound CC(C)(C)COC(=O)CO KEBMPIFHPWXEHI-UHFFFAOYSA-N 0.000 description 2
- VOEFRGFXMMXFGK-UHFFFAOYSA-N 2-(2-methyltetrazol-5-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine Chemical compound CN1N=NC(C=2N=CC(=CC=2)B2OC(C)(C)C(C)(C)O2)=N1 VOEFRGFXMMXFGK-UHFFFAOYSA-N 0.000 description 2
- LGIDGOSYDQTQDO-UHFFFAOYSA-N 2-(4-methylpiperazin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine Chemical compound C1CN(C)CCN1C1=NC=C(B2OC(C)(C)C(C)(C)O2)C=N1 LGIDGOSYDQTQDO-UHFFFAOYSA-N 0.000 description 2
- WAPIGYYBSKBDAO-UHFFFAOYSA-N 2-[4-(5-bromopyridin-2-yl)piperazin-1-yl]ethanol Chemical compound C1CN(CCO)CCN1C1=CC=C(Br)C=N1 WAPIGYYBSKBDAO-UHFFFAOYSA-N 0.000 description 2
- RQEAFKUOEFVYON-UHFFFAOYSA-N 2-amino-6-methyl-1,3-benzothiazol-5-ol Chemical compound C1=C(O)C(C)=CC2=C1N=C(N)S2 RQEAFKUOEFVYON-UHFFFAOYSA-N 0.000 description 2
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 2
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 2
- NMUFTXMBONJQTC-UHFFFAOYSA-N 3-bromo-4-methoxyaniline Chemical compound COC1=CC=C(N)C=C1Br NMUFTXMBONJQTC-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- DDIPWDTXYFXZET-UHFFFAOYSA-N 4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl]methyl]morpholine Chemical compound O1C(C)(C)C(C)(C)OB1C(C=N1)=CC=C1CN1CCOCC1 DDIPWDTXYFXZET-UHFFFAOYSA-N 0.000 description 2
- GAMYYCRTACQSBR-UHFFFAOYSA-N 4-azabenzimidazole Chemical class C1=CC=C2NC=NC2=N1 GAMYYCRTACQSBR-UHFFFAOYSA-N 0.000 description 2
- ZHILQWYDUADXTR-UHFFFAOYSA-N 4-bromo-1-[(3-methoxypyridin-2-yl)methyl]pyridin-2-one Chemical compound COC1=CC=CN=C1CN1C(=O)C=C(Br)C=C1 ZHILQWYDUADXTR-UHFFFAOYSA-N 0.000 description 2
- MCNQUWLLXZZZAC-UHFFFAOYSA-N 4-cyano-1-(2,4-dichlorophenyl)-5-(4-methoxyphenyl)-n-piperidin-1-ylpyrazole-3-carboxamide Chemical compound C1=CC(OC)=CC=C1C1=C(C#N)C(C(=O)NN2CCCCC2)=NN1C1=CC=C(Cl)C=C1Cl MCNQUWLLXZZZAC-UHFFFAOYSA-N 0.000 description 2
- WGDMZZSRDPMNMO-UHFFFAOYSA-N 4-hydroxy-6-methyl-1-[1-(6-methylpyridin-3-yl)ethyl]pyridin-2-one Chemical compound CC1=CC(O)=CC(=O)N1C(C)C1=CC=C(C)N=C1 WGDMZZSRDPMNMO-UHFFFAOYSA-N 0.000 description 2
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 2
- IXTBQKLZPOYJFJ-UHFFFAOYSA-N 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbonitrile Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC=C(C#N)N=C1 IXTBQKLZPOYJFJ-UHFFFAOYSA-N 0.000 description 2
- FQZCUAASVCIWSL-UHFFFAOYSA-N 5-bromo-2,4-difluoroaniline Chemical compound NC1=CC(Br)=C(F)C=C1F FQZCUAASVCIWSL-UHFFFAOYSA-N 0.000 description 2
- DMSHUVBQFSNBBL-UHFFFAOYSA-N 5-bromopyridine-2-carbonitrile Chemical compound BrC1=CC=C(C#N)N=C1 DMSHUVBQFSNBBL-UHFFFAOYSA-N 0.000 description 2
- 208000002874 Acne Vulgaris Diseases 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 206010012438 Dermatitis atopic Diseases 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- 206010021531 Impetigo Diseases 0.000 description 2
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 2
- 240000007472 Leucaena leucocephala Species 0.000 description 2
- 241000588621 Moraxella Species 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 206010035664 Pneumonia Diseases 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- 241000295644 Staphylococcaceae Species 0.000 description 2
- GCTFWCDSFPMHHS-UHFFFAOYSA-M Tributyltin chloride Chemical compound CCCC[Sn](Cl)(CCCC)CCCC GCTFWCDSFPMHHS-UHFFFAOYSA-M 0.000 description 2
- XFCRCZYNRQHVDP-UHFFFAOYSA-N [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl]methanol Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC=C(CO)N=C1 XFCRCZYNRQHVDP-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 206010000496 acne Diseases 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 2
- 201000008937 atopic dermatitis Diseases 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- MYSWGUAQZAJSOK-UHFFFAOYSA-N ciprofloxacin Chemical compound C12=CC(N3CCNCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 MYSWGUAQZAJSOK-UHFFFAOYSA-N 0.000 description 2
- LKJYEAJRWPUOGW-UHFFFAOYSA-N clerocidin Chemical compound CC1CCC(C(=CCC2)C=O)(C)C2C1(C)CC(C1(OC1)C1(O)O2)OC1OC1(O)C2OC(CC2(C)C3C(C(=CCC3)C=O)(C)CCC2C)C11CO1 LKJYEAJRWPUOGW-UHFFFAOYSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000008157 edible vegetable oil Substances 0.000 description 2
- DLOYRBXIOLLBPS-UHFFFAOYSA-N ethyl 7-chloro-1-methyl-4-oxoquinoline-3-carboxylate Chemical compound ClC1=CC=C2C(=O)C(C(=O)OCC)=CN(C)C2=C1 DLOYRBXIOLLBPS-UHFFFAOYSA-N 0.000 description 2
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 229940124307 fluoroquinolone Drugs 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 150000004677 hydrates Chemical class 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 125000001041 indolyl group Chemical group 0.000 description 2
- 230000002458 infectious effect Effects 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 125000000842 isoxazolyl group Chemical group 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000002207 metabolite Substances 0.000 description 2
- LVWZTYCIRDMTEY-UHFFFAOYSA-N metamizole Chemical compound O=C1C(N(CS(O)(=O)=O)C)=C(C)N(C)N1C1=CC=CC=C1 LVWZTYCIRDMTEY-UHFFFAOYSA-N 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- OQTCOFRTCLKRKC-UHFFFAOYSA-N methyl 2-(4-bromopyrazol-1-yl)propanoate Chemical compound COC(=O)C(C)N1C=C(Br)C=N1 OQTCOFRTCLKRKC-UHFFFAOYSA-N 0.000 description 2
- 239000011259 mixed solution Substances 0.000 description 2
- FOMGGBXHSUSZFZ-UHFFFAOYSA-N n-(3-bromo-4-methoxyphenyl)acetamide Chemical compound COC1=CC=C(NC(C)=O)C=C1Br FOMGGBXHSUSZFZ-UHFFFAOYSA-N 0.000 description 2
- MJFCOXATGBYERZ-UHFFFAOYSA-N n-(5-bromopyridin-2-yl)acetamide Chemical compound CC(=O)NC1=CC=C(Br)C=N1 MJFCOXATGBYERZ-UHFFFAOYSA-N 0.000 description 2
- XWAVKOFNOPXRFR-UHFFFAOYSA-N n-(6-methyl-5-phenylmethoxy-1,3-benzothiazol-2-yl)benzamide Chemical compound N=1C=2C=C(OCC=3C=CC=CC=3)C(C)=CC=2SC=1NC(=O)C1=CC=CC=C1 XWAVKOFNOPXRFR-UHFFFAOYSA-N 0.000 description 2
- PPLYDZYBYXUCAC-UHFFFAOYSA-N n-[(2,5-dibromophenyl)carbamothioyl]benzamide Chemical compound BrC1=CC=C(Br)C(NC(=S)NC(=O)C=2C=CC=CC=2)=C1 PPLYDZYBYXUCAC-UHFFFAOYSA-N 0.000 description 2
- JTLDXJTZHRIOOY-UHFFFAOYSA-N n-[(2-bromo-4-methyl-5-phenylmethoxyphenyl)carbamothioyl]benzamide Chemical compound C1=C(OCC=2C=CC=CC=2)C(C)=CC(Br)=C1NC(=S)NC(=O)C1=CC=CC=C1 JTLDXJTZHRIOOY-UHFFFAOYSA-N 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 125000002971 oxazolyl group Chemical group 0.000 description 2
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 125000003226 pyrazolyl group Chemical group 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- 150000007660 quinolones Chemical class 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 2
- 239000010802 sludge Substances 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- ATHGHQPFGPMSJY-UHFFFAOYSA-N spermidine Chemical compound NCCCCNCCCN ATHGHQPFGPMSJY-UHFFFAOYSA-N 0.000 description 2
- MGGZYACWICDRRD-UHFFFAOYSA-N tert-butyl 3-(bromomethyl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCCC(CBr)C1 MGGZYACWICDRRD-UHFFFAOYSA-N 0.000 description 2
- APCBTRDHCDOPNY-UHFFFAOYSA-N tert-butyl 3-hydroxypyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(O)C1 APCBTRDHCDOPNY-UHFFFAOYSA-N 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 229940062627 tribasic potassium phosphate Drugs 0.000 description 2
- GOWNSHUNTJWVOM-UHFFFAOYSA-N tributyl(1,3-thiazol-5-yl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C1=CN=CS1 GOWNSHUNTJWVOM-UHFFFAOYSA-N 0.000 description 2
- UEICGUUUWGMARF-UHFFFAOYSA-N tributyl(imidazo[1,2-a]pyridin-3-yl)stannane Chemical compound C1=CC=CN2C([Sn](CCCC)(CCCC)CCCC)=CN=C21 UEICGUUUWGMARF-UHFFFAOYSA-N 0.000 description 2
- IRDMSBWEFWGVLF-UHFFFAOYSA-N tributyl-(2-methoxy-1,3-thiazol-5-yl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C1=CN=C(OC)S1 IRDMSBWEFWGVLF-UHFFFAOYSA-N 0.000 description 2
- RRHTVQOGUAOHDR-UHFFFAOYSA-N tributyl-(2-methylsulfonylpyrimidin-5-yl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C1=CN=C(S(C)(=O)=O)N=C1 RRHTVQOGUAOHDR-UHFFFAOYSA-N 0.000 description 2
- 150000008648 triflates Chemical class 0.000 description 2
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- RYGOBSYXIIUFOR-UHFFFAOYSA-N (1-methylpyrazol-4-yl)boronic acid Chemical compound CN1C=C(B(O)O)C=N1 RYGOBSYXIIUFOR-UHFFFAOYSA-N 0.000 description 1
- HMHQWJDFNVJCHA-BTZKOOKSSA-N (2s)-2-[[(5r,8s)-8-[[(2s,3r)-1-[(2s)-2-amino-3-hydroxypropanoyl]-3-hydroxypyrrolidine-2-carbonyl]amino]-14,16-dihydroxy-13-methyl-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-5-carbonyl]amino]propanoic acid Chemical compound N([C@H]1COC(=O)C2=C(C)C(O)=CC(O)=C2CSC[C@H](NC1=O)C(=O)N[C@@H](C)C(O)=O)C(=O)[C@@H]1[C@H](O)CCN1C(=O)[C@@H](N)CO HMHQWJDFNVJCHA-BTZKOOKSSA-N 0.000 description 1
- RDXXAIGOEPIQPK-UHFFFAOYSA-N (3-methoxypyridin-2-yl)methanol Chemical compound COC1=CC=CN=C1CO RDXXAIGOEPIQPK-UHFFFAOYSA-N 0.000 description 1
- KGNVRLUGZPASRY-UHFFFAOYSA-N (4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazin-7-yl)boronic acid Chemical compound OB(O)C1=CN=C2N(C)CCOC2=C1 KGNVRLUGZPASRY-UHFFFAOYSA-N 0.000 description 1
- KXNDYMLJDLCBMV-UHFFFAOYSA-N (5-bromo-1-methylimidazol-2-yl)methanol Chemical compound CN1C(Br)=CN=C1CO KXNDYMLJDLCBMV-UHFFFAOYSA-N 0.000 description 1
- OJRWQJNSMWIFMD-UHFFFAOYSA-N (6-methoxycarbonylpyridin-3-yl)boronic acid Chemical compound COC(=O)C1=CC=C(B(O)O)C=N1 OJRWQJNSMWIFMD-UHFFFAOYSA-N 0.000 description 1
- DAXJNUBSBFUTRP-RTQNCGMRSA-N (8r,9s,10r,13s,14s)-6-(hydroxymethyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6h-cyclopenta[a]phenanthrene-3,17-dione Chemical compound O=C1C=C[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC(CO)C2=C1 DAXJNUBSBFUTRP-RTQNCGMRSA-N 0.000 description 1
- 125000006536 (C1-C2)alkoxy group Chemical group 0.000 description 1
- XUBOMFCQGDBHNK-JTQLQIEISA-N (S)-gatifloxacin Chemical compound FC1=CC(C(C(C(O)=O)=CN2C3CC3)=O)=C2C(OC)=C1N1CCN[C@@H](C)C1 XUBOMFCQGDBHNK-JTQLQIEISA-N 0.000 description 1
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 1
- DIOHEXPTUTVCNX-UHFFFAOYSA-N 1,1,1-trifluoro-n-phenyl-n-(trifluoromethylsulfonyl)methanesulfonamide Chemical compound FC(F)(F)S(=O)(=O)N(S(=O)(=O)C(F)(F)F)C1=CC=CC=C1 DIOHEXPTUTVCNX-UHFFFAOYSA-N 0.000 description 1
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 1
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 1
- VLXSIHLNPYRFFN-UHFFFAOYSA-N 1,4-dioxane;methanol Chemical compound OC.C1COCCO1 VLXSIHLNPYRFFN-UHFFFAOYSA-N 0.000 description 1
- GLTIIUKSLNSXKM-UHFFFAOYSA-N 1-(6-methylpyridin-3-yl)ethanamine Chemical compound CC(N)C1=CC=C(C)N=C1 GLTIIUKSLNSXKM-UHFFFAOYSA-N 0.000 description 1
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical group CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 1
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 1
- DNUTZBZXLPWRJG-UHFFFAOYSA-N 1-Piperidine carboxylic acid Chemical compound OC(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-N 0.000 description 1
- HSBMPUYCFQSKRP-UHFFFAOYSA-N 1-bromoimidazole Chemical compound BrN1C=CN=C1 HSBMPUYCFQSKRP-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004972 1-butynyl group Chemical group [H]C([H])([H])C([H])([H])C#C* 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- KEZNMOUMHOZFRA-UHFFFAOYSA-N 1h-pyrazol-4-ylboronic acid Chemical compound OB(O)C=1C=NNC=1 KEZNMOUMHOZFRA-UHFFFAOYSA-N 0.000 description 1
- NEUWPDLMDVINSN-UHFFFAOYSA-N 1h-pyrazol-5-ylboronic acid Chemical compound OB(O)C=1C=CNN=1 NEUWPDLMDVINSN-UHFFFAOYSA-N 0.000 description 1
- WRTAZRGRFBCKBU-UHFFFAOYSA-N 2,5-dibromoaniline Chemical compound NC1=CC(Br)=CC=C1Br WRTAZRGRFBCKBU-UHFFFAOYSA-N 0.000 description 1
- KUCZHEMZMFFWSO-UHFFFAOYSA-N 2-(2,2-dimethylpropyl)-2-hydroxy-4,4-dimethylpentanoic acid Chemical compound CC(C)(C)CC(O)(C(O)=O)CC(C)(C)C KUCZHEMZMFFWSO-UHFFFAOYSA-N 0.000 description 1
- QJDBHMKKZWMMJU-UHFFFAOYSA-N 2-(4-bromopyrazol-1-yl)propanoic acid Chemical compound OC(=O)C(C)N1C=C(Br)C=N1 QJDBHMKKZWMMJU-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- RDRHEYJFNAAXET-UHFFFAOYSA-N 2-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperazin-1-yl]ethanol Chemical compound O1C(C)(C)C(C)(C)OB1C1=CN=C(N2CCN(CCO)CC2)N=C1 RDRHEYJFNAAXET-UHFFFAOYSA-N 0.000 description 1
- FEMSDHJSFUHYSH-UHFFFAOYSA-N 2-bromo-4-methyl-5-phenylmethoxyaniline Chemical compound CC1=CC(Br)=C(N)C=C1OCC1=CC=CC=C1 FEMSDHJSFUHYSH-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- PMTPFBWHUOWTNN-UHFFFAOYSA-N 2-chloro-4-methoxypyridine Chemical compound COC1=CC=NC(Cl)=C1 PMTPFBWHUOWTNN-UHFFFAOYSA-N 0.000 description 1
- 125000006022 2-methyl-2-propenyl group Chemical group 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- JHUUPUMBZGWODW-UHFFFAOYSA-N 3,6-dihydro-1,2-dioxine Chemical compound C1OOCC=C1 JHUUPUMBZGWODW-UHFFFAOYSA-N 0.000 description 1
- UNAGMNGRSGLZEM-UHFFFAOYSA-N 3-bromo-1-tert-butylpyrrole Chemical compound CC(C)(C)n1ccc(Br)c1 UNAGMNGRSGLZEM-UHFFFAOYSA-N 0.000 description 1
- VJDGIJDCXIEXPF-UHFFFAOYSA-N 3-bromo-1h-pyrrolo[2,3-b]pyridine Chemical compound C1=CC=C2C(Br)=CNC2=N1 VJDGIJDCXIEXPF-UHFFFAOYSA-N 0.000 description 1
- FZWUIWQMJFAWJW-UHFFFAOYSA-N 3-bromo-5-methoxypyridine Chemical compound COC1=CN=CC(Br)=C1 FZWUIWQMJFAWJW-UHFFFAOYSA-N 0.000 description 1
- HENXUFOAGXNWKH-UHFFFAOYSA-N 3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine Chemical compound COC1=CN=CC(B2OC(C)(C)C(C)(C)O2)=C1 HENXUFOAGXNWKH-UHFFFAOYSA-N 0.000 description 1
- UBOOKRVGOBKDMM-UHFFFAOYSA-N 3h-imidazo[4,5-c]pyridine Chemical class C1=NC=C2NC=NC2=C1 UBOOKRVGOBKDMM-UHFFFAOYSA-N 0.000 description 1
- ZAPMTSHEXFEPSD-UHFFFAOYSA-N 4-(2-chloroethyl)morpholine Chemical compound ClCCN1CCOCC1 ZAPMTSHEXFEPSD-UHFFFAOYSA-N 0.000 description 1
- AYNUDBSQRXLTKU-UHFFFAOYSA-N 4-bromo-1-[2-(dimethylamino)ethyl]pyridin-2-one Chemical compound CN(C)CCN1C=CC(Br)=CC1=O AYNUDBSQRXLTKU-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- HCXJFMDOHDNDCC-UHFFFAOYSA-N 5-$l^{1}-oxidanyl-3,4-dihydropyrrol-2-one Chemical group O=C1CCC(=O)[N]1 HCXJFMDOHDNDCC-UHFFFAOYSA-N 0.000 description 1
- DPSHRAAMBQYAAQ-UHFFFAOYSA-N 5-bromo-1-(2-methoxyethyl)pyridin-2-one Chemical compound COCCN1C=C(Br)C=CC1=O DPSHRAAMBQYAAQ-UHFFFAOYSA-N 0.000 description 1
- NDMZZQRNZFWMEZ-UHFFFAOYSA-N 5-bromo-1h-pyridin-2-one Chemical compound OC1=CC=C(Br)C=N1 NDMZZQRNZFWMEZ-UHFFFAOYSA-N 0.000 description 1
- JANKGNBDRWYWSN-UHFFFAOYSA-N 5-bromo-2-(2-methyltetrazol-5-yl)pyridine Chemical compound CN1N=NC(C=2N=CC(Br)=CC=2)=N1 JANKGNBDRWYWSN-UHFFFAOYSA-N 0.000 description 1
- PRYPBGVWKANVLV-UHFFFAOYSA-N 5-bromo-2-(4-methylpiperazin-1-yl)pyrimidine Chemical compound C1CN(C)CCN1C1=NC=C(Br)C=N1 PRYPBGVWKANVLV-UHFFFAOYSA-N 0.000 description 1
- CLYOMCMDBNNGSM-UHFFFAOYSA-N 5-bromo-2-fluoropyridin-3-amine Chemical compound NC1=CC(Br)=CN=C1F CLYOMCMDBNNGSM-UHFFFAOYSA-N 0.000 description 1
- YHWLBBPOKRHVAR-UHFFFAOYSA-N 5-bromo-2-piperazin-1-ylpyrimidine Chemical compound N1=CC(Br)=CN=C1N1CCNCC1 YHWLBBPOKRHVAR-UHFFFAOYSA-N 0.000 description 1
- BSDBYOISRBJVEO-UHFFFAOYSA-N 5-bromo-6-fluoro-1,3-benzothiazole Chemical compound BrC=1C(=CC2=C(N=CS2)C=1)F BSDBYOISRBJVEO-UHFFFAOYSA-N 0.000 description 1
- DNYNBLKRHFZGQG-UHFFFAOYSA-N 5-bromo-N'-hydroxypyridine-2-carboximidamide Chemical compound ONC(=N)C1=CC=C(Br)C=N1 DNYNBLKRHFZGQG-UHFFFAOYSA-N 0.000 description 1
- ZQVLPMNLLKGGIU-UHFFFAOYSA-N 5-bromopyridine-2-carbaldehyde Chemical compound BrC1=CC=C(C=O)N=C1 ZQVLPMNLLKGGIU-UHFFFAOYSA-N 0.000 description 1
- VNHBYKHXBCYPBJ-UHFFFAOYSA-N 5-ethynylimidazo[1,2-a]pyridine Chemical compound C#CC1=CC=CC2=NC=CN12 VNHBYKHXBCYPBJ-UHFFFAOYSA-N 0.000 description 1
- RFYJWFMVJVDSDS-UHFFFAOYSA-N 6,6,6-trichlorohexylphosphane Chemical compound PCCCCCC(Cl)(Cl)Cl RFYJWFMVJVDSDS-UHFFFAOYSA-N 0.000 description 1
- VZEBSJIOUMDNLY-UHFFFAOYSA-N 6-bromo-1,3-benzothiazol-2-amine Chemical compound C1=C(Br)C=C2SC(N)=NC2=C1 VZEBSJIOUMDNLY-UHFFFAOYSA-N 0.000 description 1
- FXPMFQUOGYGTAM-UHFFFAOYSA-N 6-bromoimidazo[1,2-a]pyridine Chemical compound C1=C(Br)C=CC2=NC=CN21 FXPMFQUOGYGTAM-UHFFFAOYSA-N 0.000 description 1
- PLURNWKIBYPKLG-UHFFFAOYSA-N 6-methyl-1-[(1-methylpyrrolidin-3-yl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one Chemical compound C1N(C)CCC1CN1C(=O)C=C(B2OC(C)(C)C(C)(C)O2)C=C1C PLURNWKIBYPKLG-UHFFFAOYSA-N 0.000 description 1
- UEZCMDFHCHWUFM-UHFFFAOYSA-N 7-chloro-1-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C(Cl)C=C2N(C)C=C(C(O)=O)C(=O)C2=C1 UEZCMDFHCHWUFM-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- 235000019489 Almond oil Nutrition 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 241000271566 Aves Species 0.000 description 1
- SALYZUBPLZWQFS-UHFFFAOYSA-N BrC1=CC=2OCCNC2N=C1.N1=CC=CC=C1 Chemical compound BrC1=CC=2OCCNC2N=C1.N1=CC=CC=C1 SALYZUBPLZWQFS-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- GHXZTYHSJHQHIJ-UHFFFAOYSA-N Chlorhexidine Chemical compound C=1C=C(Cl)C=CC=1NC(N)=NC(N)=NCCCCCCN=C(N)N=C(N)NC1=CC=C(Cl)C=C1 GHXZTYHSJHQHIJ-UHFFFAOYSA-N 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- XYZPRKPYRIPTFB-UHFFFAOYSA-N Cynodine Natural products CN1CC(C(C(C(=O)Oc2ccccc2)c3ccccc3)C1=O)c4cn(C)cn4 XYZPRKPYRIPTFB-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 102000053602 DNA Human genes 0.000 description 1
- 108010054814 DNA Gyrase Proteins 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- 102100027094 Echinoderm microtubule-associated protein-like 1 Human genes 0.000 description 1
- 208000010201 Exanthema Diseases 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 1
- 208000031220 Hemophilia Diseases 0.000 description 1
- 208000009292 Hemophilia A Diseases 0.000 description 1
- 102100039121 Histone-lysine N-methyltransferase MECOM Human genes 0.000 description 1
- 101001057941 Homo sapiens Echinoderm microtubule-associated protein-like 1 Proteins 0.000 description 1
- 101001033728 Homo sapiens Histone-lysine N-methyltransferase MECOM Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 108090000769 Isomerases Proteins 0.000 description 1
- 102000004195 Isomerases Human genes 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 101000653787 Mus musculus Protein S100-A11 Proteins 0.000 description 1
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-diisopropylethylamine Substances CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- YJQPYGGHQPGBLI-UHFFFAOYSA-N Novobiocin Natural products O1C(C)(C)C(OC)C(OC(N)=O)C(O)C1OC1=CC=C(C(O)=C(NC(=O)C=2C=C(CC=C(C)C)C(O)=CC=2)C(=O)O2)C2=C1C YJQPYGGHQPGBLI-UHFFFAOYSA-N 0.000 description 1
- KYGZCKSPAKDVKC-UHFFFAOYSA-N Oxolinic acid Chemical compound C1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC2=C1OCO2 KYGZCKSPAKDVKC-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- 108020004682 Single-Stranded DNA Proteins 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 101100046503 Symbiobacterium thermophilum (strain T / IAM 14863) tnaA1 gene Proteins 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 1
- SSHMQMIDPVSRSY-UHFFFAOYSA-N [1-(2-morpholin-4-ylethyl)pyrazol-4-yl]boronic acid Chemical compound C1=C(B(O)O)C=NN1CCN1CCOCC1 SSHMQMIDPVSRSY-UHFFFAOYSA-N 0.000 description 1
- GUSWDABWOGUSCQ-UHFFFAOYSA-N [2-methyl-1-[(6-methylpyridin-2-yl)methyl]-6-oxopyridin-4-yl] trifluoromethanesulfonate Chemical compound CC1=CC=CC(CN2C(C=C(OS(=O)(=O)C(F)(F)F)C=C2C)=O)=N1 GUSWDABWOGUSCQ-UHFFFAOYSA-N 0.000 description 1
- SDHMCFCMXQARPR-UHFFFAOYSA-N [2-methyl-6-oxo-1-(pyridin-2-ylmethyl)pyridin-4-yl] trifluoromethanesulfonate Chemical compound CC1=CC(OS(=O)(=O)C(F)(F)F)=CC(=O)N1CC1=CC=CC=N1 SDHMCFCMXQARPR-UHFFFAOYSA-N 0.000 description 1
- BEFIPGDUDZAVKN-UHFFFAOYSA-N [2-methyl-6-oxo-1-(pyridin-3-ylmethyl)pyridin-4-yl] trifluoromethanesulfonate Chemical compound CC1=CC(OS(=O)(=O)C(F)(F)F)=CC(=O)N1CC1=CC=CN=C1 BEFIPGDUDZAVKN-UHFFFAOYSA-N 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 238000002814 agar dilution Methods 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 1
- 239000008168 almond oil Substances 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- APUPEJJSWDHEBO-UHFFFAOYSA-P ammonium molybdate Chemical compound [NH4+].[NH4+].[O-][Mo]([O-])(=O)=O APUPEJJSWDHEBO-UHFFFAOYSA-P 0.000 description 1
- 235000018660 ammonium molybdate Nutrition 0.000 description 1
- 239000011609 ammonium molybdate Substances 0.000 description 1
- 229940010552 ammonium molybdate Drugs 0.000 description 1
- 230000033115 angiogenesis Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 229960000686 benzalkonium chloride Drugs 0.000 description 1
- 150000001556 benzimidazoles Chemical class 0.000 description 1
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N benzo-alpha-pyrone Natural products C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000005621 boronate group Chemical class 0.000 description 1
- 238000002815 broth microdilution Methods 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 210000004899 c-terminal region Anatomy 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229960003260 chlorhexidine Drugs 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 210000000349 chromosome Anatomy 0.000 description 1
- VDUWPHTZYNWKRN-UHFFFAOYSA-N cinoxacin Chemical compound C1=C2N(CC)N=C(C(O)=O)C(=O)C2=CC2=C1OCO2 VDUWPHTZYNWKRN-UHFFFAOYSA-N 0.000 description 1
- 229960004621 cinoxacin Drugs 0.000 description 1
- 229960003405 ciprofloxacin Drugs 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 235000001671 coumarin Nutrition 0.000 description 1
- 150000004775 coumarins Chemical class 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- WZHCOOQXZCIUNC-UHFFFAOYSA-N cyclandelate Chemical class C1C(C)(C)CC(C)CC1OC(=O)C(O)C1=CC=CC=C1 WZHCOOQXZCIUNC-UHFFFAOYSA-N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- HMHQWJDFNVJCHA-UHFFFAOYSA-N cyclothialidine Natural products O=C1NC(C(=O)NC(C)C(O)=O)CSCC2=C(O)C=C(O)C(C)=C2C(=O)OCC1NC(=O)C1C(O)CCN1C(=O)C(N)CO HMHQWJDFNVJCHA-UHFFFAOYSA-N 0.000 description 1
- 108010083968 cyclothialidine Proteins 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N dimethyl sulfoxide Natural products CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- GPAYUJZHTULNBE-UHFFFAOYSA-N diphenylphosphine Chemical compound C=1C=CC=CC=1PC1=CC=CC=C1 GPAYUJZHTULNBE-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- 201000005884 exanthem Diseases 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- KTWOOEGAPBSYNW-UHFFFAOYSA-N ferrocene Chemical compound [Fe+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 KTWOOEGAPBSYNW-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 238000011010 flushing procedure Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 229960003923 gatifloxacin Drugs 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000001727 glucose Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 229960003943 hypromellose Drugs 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 229910052816 inorganic phosphate Inorganic materials 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- GDTOUTKTCGPAGY-UHFFFAOYSA-N isoquinolin-4-ylboronic acid Chemical compound C1=CC=C2C(B(O)O)=CN=CC2=C1 GDTOUTKTCGPAGY-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical class [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 235000012254 magnesium hydroxide Nutrition 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 230000010534 mechanism of action Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910001987 mercury nitrate Inorganic materials 0.000 description 1
- QFRWWTBTWUSSDA-UHFFFAOYSA-M mercury(1+);2-phenylacetate Chemical compound [Hg+].[O-]C(=O)CC1=CC=CC=C1 QFRWWTBTWUSSDA-UHFFFAOYSA-M 0.000 description 1
- 229940071648 metered dose inhaler Drugs 0.000 description 1
- JCMHISYFYGLZEA-UHFFFAOYSA-N methyl 1-(5-bromopyrimidin-2-yl)piperidine-3-carboxylate Chemical compound C1C(C(=O)OC)CCCN1C1=NC=C(Br)C=N1 JCMHISYFYGLZEA-UHFFFAOYSA-N 0.000 description 1
- CCUNQFMNCAFIEV-UHFFFAOYSA-N methyl 1-(5-bromopyrimidin-2-yl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OC)CCN1C1=NC=C(Br)C=N1 CCUNQFMNCAFIEV-UHFFFAOYSA-N 0.000 description 1
- QOJWFINFNCLGHK-UHFFFAOYSA-N methyl 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidine-3-carboxylate Chemical compound C1C(C(=O)OC)CCCN1C1=NC=C(B2OC(C)(C)C(C)(C)O2)C=N1 QOJWFINFNCLGHK-UHFFFAOYSA-N 0.000 description 1
- 229940095102 methyl benzoate Drugs 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000006203 morpholinoethyl group Chemical group [H]C([H])(*)C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 description 1
- FABPRXSRWADJSP-MEDUHNTESA-N moxifloxacin Chemical compound COC1=C(N2C[C@H]3NCCC[C@H]3C2)C(F)=CC(C(C(C(O)=O)=C2)=O)=C1N2C1CC1 FABPRXSRWADJSP-MEDUHNTESA-N 0.000 description 1
- 229960003702 moxifloxacin Drugs 0.000 description 1
- DEDVANSVZSKPQO-UHFFFAOYSA-N n-[(5-bromo-2-fluoropyridin-3-yl)carbamothioyl]benzamide Chemical compound FC1=NC=C(Br)C=C1NC(=S)NC(=O)C1=CC=CC=C1 DEDVANSVZSKPQO-UHFFFAOYSA-N 0.000 description 1
- YCWPTBAHVWJMEY-UHFFFAOYSA-N n-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl]acetamide Chemical compound C1=NC(NC(=O)C)=CC=C1B1OC(C)(C)C(C)(C)O1 YCWPTBAHVWJMEY-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000006199 nebulizer Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002829 nitrogen Chemical class 0.000 description 1
- DRXYRSRECMWYAV-UHFFFAOYSA-N nitrooxymercury Chemical compound [Hg+].[O-][N+]([O-])=O DRXYRSRECMWYAV-UHFFFAOYSA-N 0.000 description 1
- 239000002687 nonaqueous vehicle Substances 0.000 description 1
- 229960001180 norfloxacin Drugs 0.000 description 1
- OGJPXUAPXNRGGI-UHFFFAOYSA-N norfloxacin Chemical compound C1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCNCC1 OGJPXUAPXNRGGI-UHFFFAOYSA-N 0.000 description 1
- YJQPYGGHQPGBLI-KGSXXDOSSA-N novobiocin Chemical compound O1C(C)(C)[C@H](OC)[C@@H](OC(N)=O)[C@@H](O)[C@@H]1OC1=CC=C(C(O)=C(NC(=O)C=2C=C(CC=C(C)C)C(O)=CC=2)C(=O)O2)C2=C1C YJQPYGGHQPGBLI-KGSXXDOSSA-N 0.000 description 1
- 229960002950 novobiocin Drugs 0.000 description 1
- 235000016709 nutrition Nutrition 0.000 description 1
- 230000035764 nutrition Effects 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 229960000321 oxolinic acid Drugs 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- MUJIDPITZJWBSW-UHFFFAOYSA-N palladium(2+) Chemical compound [Pd+2] MUJIDPITZJWBSW-UHFFFAOYSA-N 0.000 description 1
- 239000003182 parenteral nutrition solution Substances 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 1
- 229960003415 propylparaben Drugs 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical compound C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 description 1
- 206010037844 rash Diseases 0.000 description 1
- 230000010076 replication Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 231100000046 skin rash Toxicity 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 229940001584 sodium metabisulfite Drugs 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 239000001593 sorbitan monooleate Substances 0.000 description 1
- 235000011069 sorbitan monooleate Nutrition 0.000 description 1
- 229940035049 sorbitan monooleate Drugs 0.000 description 1
- 238000002798 spectrophotometry method Methods 0.000 description 1
- 229940063673 spermidine Drugs 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 230000008685 targeting Effects 0.000 description 1
- FVLLXBVYFZDUGB-UHFFFAOYSA-N tert-butyl 3-(4-bromo-2-oxopyridin-1-yl)pyrrolidine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC1N1C(=O)C=C(Br)C=C1 FVLLXBVYFZDUGB-UHFFFAOYSA-N 0.000 description 1
- IBCVARZOMTXMPC-UHFFFAOYSA-N tert-butyl 3-[2-oxo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-1-yl]pyrrolidine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC1N1C(=O)C=C(B2OC(C)(C)C(C)(C)O2)C=C1 IBCVARZOMTXMPC-UHFFFAOYSA-N 0.000 description 1
- LRMPSYYFDWATPN-UHFFFAOYSA-N tert-butyl 3-bromopyrrolo[2,3-b]pyridine-1-carboxylate Chemical compound C1=CN=C2N(C(=O)OC(C)(C)C)C=C(Br)C2=C1 LRMPSYYFDWATPN-UHFFFAOYSA-N 0.000 description 1
- UKCBGXCNXOKVTF-UHFFFAOYSA-N tert-butyl 4-(5-bromopyrimidin-2-yl)piperazine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCN1C1=NC=C(Br)C=N1 UKCBGXCNXOKVTF-UHFFFAOYSA-N 0.000 description 1
- VPJUDECFCLDRIG-UHFFFAOYSA-N tert-butyl 4-bromo-2-oxopyridine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1C=CC(Br)=CC1=O VPJUDECFCLDRIG-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- IVIIAEVMQHEPAY-UHFFFAOYSA-N tridodecyl phosphite Chemical compound CCCCCCCCCCCCOP(OCCCCCCCCCCCC)OCCCCCCCCCCCC IVIIAEVMQHEPAY-UHFFFAOYSA-N 0.000 description 1
- FIQMHBFVRAXMOP-UHFFFAOYSA-N triphenylphosphane oxide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)C1=CC=CC=C1 FIQMHBFVRAXMOP-UHFFFAOYSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/41—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with two or more ring hetero atoms, at least one of which being nitrogen, e.g. tetrazole
- A61K31/425—Thiazoles
- A61K31/428—Thiazoles condensed with carbocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/68—Benzothiazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D277/82—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D498/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D498/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Oncology (AREA)
- Communicable Diseases (AREA)
- Epidemiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GBGB0724342.1A GB0724342D0 (en) | 2007-12-13 | 2007-12-13 | Anitbacterial compositions |
| PCT/GB2008/004114 WO2009074812A1 (en) | 2007-12-13 | 2008-12-12 | Antibacterial condensed thiazoles |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| EA201000993A1 EA201000993A1 (ru) | 2011-02-28 |
| EA018104B1 true EA018104B1 (ru) | 2013-05-30 |
Family
ID=39048076
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| EA201000993A EA018104B1 (ru) | 2007-12-13 | 2008-12-12 | Конденсированные тиазолы, обладающие антибактериальными свойствами |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US8299065B2 (enExample) |
| EP (1) | EP2231653B1 (enExample) |
| JP (1) | JP5539898B2 (enExample) |
| KR (1) | KR20100105847A (enExample) |
| CN (1) | CN102015700B (enExample) |
| AU (1) | AU2008334427B2 (enExample) |
| BR (1) | BRPI0820656A2 (enExample) |
| CA (1) | CA2709021A1 (enExample) |
| EA (1) | EA018104B1 (enExample) |
| ES (1) | ES2416059T3 (enExample) |
| GB (1) | GB0724342D0 (enExample) |
| MX (1) | MX2010006428A (enExample) |
| NZ (1) | NZ586508A (enExample) |
| WO (1) | WO2009074812A1 (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US10945999B2 (en) | 2016-04-08 | 2021-03-16 | Quretech Bio Ab | Ring-fused thiazolino 2-pyridones, methods for preparation thereof and their use in the treatment and/or prevention of tuberculosis |
| US11958871B2 (en) | 2018-02-23 | 2024-04-16 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung e.V. | Inhibitors of bacterial glutaminyl cyclases for use in the treatment of periodontal and related diseases |
Families Citing this family (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR20110031419A (ko) * | 2008-06-04 | 2011-03-28 | 아스트라제네카 아베 | 항박테리아제로서의 티아졸로［５,４ｂ］피리딘 및 옥사졸로［５,４ｂ］피리딘 유도체 |
| EP2321309A1 (en) * | 2008-06-25 | 2011-05-18 | Ranbaxy Laboratories Limited | Benzothiazoles and aza-analogues thereof use as antibacterial agents |
| NZ599290A (en) | 2009-10-16 | 2014-10-31 | Melinta Therapeutics Inc | Antimicrobial compounds and methods of making and using the same |
| NZ599291A (en) * | 2009-10-16 | 2014-06-27 | Melinta Therapeutics Inc | Antimicrobial compounds and methods of making and using the same |
| EA201270568A1 (ru) | 2009-10-16 | 2012-11-30 | Риб-Экс Фармасьютикалз, Инк. | Антимикробные композиции и способы их получения и применения |
| RU2012146246A (ru) | 2010-03-31 | 2014-05-10 | Актелион Фармасьютиклз Лтд | Антибактериальные производные изохинолин-3-илмочевины |
| US8648192B2 (en) | 2010-05-26 | 2014-02-11 | Boehringer Ingelheim International Gmbh | 2-oxo-1,2-dihydropyridin-4-ylboronic acid derivatives |
| JP5864589B2 (ja) * | 2010-10-08 | 2016-02-17 | ビオタ ヨーロッパ リミテッドＢｉｏｔａ Ｅｕｒｏｐｅ Ｌｔｄ | 細菌トポイソメラーゼｉｉ阻害性２−エチルカルバモイルアミノ−１，３−ベンゾチアゾール−５−イル類 |
| TW201309676A (zh) | 2011-01-14 | 2013-03-01 | Vertex Pharma | 旋轉酶抑制劑（ｒ）－１－乙基－３－［５－［２－（１－羥基－１－甲基－乙基）嘧啶－５－基］－７－（四氫呋喃－２－基］－１ｈ－苯并咪唑－２－基］脲之固體形式 |
| JP6085829B2 (ja) | 2011-01-14 | 2017-03-01 | スペロ トリネム， インコーポレイテッド | ピリミジンジャイレースおよびトポイソメラーゼｉｖ阻害剤 |
| EP2663562B1 (en) | 2011-01-14 | 2018-11-07 | Spero Trinem, Inc. | Solid forms of gyrase inhibitor (r)-1-ethyl-3-[6-fluoro-5-[2-(1-hydroxy-1-methyl-ethyl) pyrimidin-5-yl]-7-(tetrahydrofuran-2-yl)-1h-benzimidazol-2-yl]urea |
| CA2824519C (en) | 2011-01-14 | 2020-06-16 | Vertex Pharmaceuticals Incorporated | Process of making gyrase and topoisomerase inhibitors |
| US8921383B2 (en) * | 2011-03-28 | 2014-12-30 | Hoffmann-La Roche Inc. | Thiazolopyrimidine compounds |
| AR088729A1 (es) | 2011-03-29 | 2014-07-02 | Actelion Pharmaceuticals Ltd | Derivados de 3-ureidoisoquinolin-8-ilo y una composicion farmaceutica |
| MY173518A (en) | 2011-04-15 | 2020-01-30 | Melinta Therapeutics Inc | Antimicrobial compounds and methods of making and using the same |
| TWI554515B (zh) | 2011-06-20 | 2016-10-21 | 維泰克斯製藥公司 | 旋轉酶（ｇｙｒａｓｅ）及拓樸異構酶抑制劑之磷酸酯 |
| WO2013106756A2 (en) | 2012-01-13 | 2013-07-18 | Rutgers, The State University Of New Jersey | Antimicrobial agents |
| AU2013235038A1 (en) | 2012-03-21 | 2014-10-09 | Malvika Kaul | Antimicrobial agents |
| WO2013138860A1 (en) | 2012-03-22 | 2013-09-26 | Biota Europe Limited | Antibacterial compounds |
| BR112015000308A2 (pt) * | 2012-07-10 | 2017-06-27 | Bayer Pharma AG | método para preparo de triazolopiridinas substituídas |
| US9572809B2 (en) | 2012-07-18 | 2017-02-21 | Spero Trinem, Inc. | Combination therapy to treat Mycobacterium diseases |
| WO2014015105A1 (en) | 2012-07-18 | 2014-01-23 | Vertex Pharmaceuticals Incorporated | Solid forms of (r)-2-(5-(2-(3-ethylureido)-6-fluoro-7-(tetrahydrofuran-2-yl)-1h-benzo[d]imidazol-5-yl)pyrimidin-2-yl)propan-2-yl dihydrogen phosphate and salts thereof |
| CN103570630B (zh) * | 2012-07-18 | 2016-04-20 | 广东东阳光药业有限公司 | 氮杂环衍生物及其在药物中的应用 |
| US9428474B2 (en) | 2012-12-21 | 2016-08-30 | Janssen Sciences Ireland Uc | Antibacterial compounds |
| EP3038623A4 (en) | 2013-09-09 | 2017-04-19 | Melinta Therapeutics, Inc. | Antimicrobial compounds and methods of making and using the same |
| SG10201801956SA (en) | 2013-09-09 | 2018-04-27 | Melinta Therapeutics Inc | Antimicrobial compounds and methods of making and using the same |
| US9458150B2 (en) | 2013-11-08 | 2016-10-04 | Rutgers, The State University Of New Jersey | Antimicrobial agents |
| JP2017504662A (ja) | 2014-02-03 | 2017-02-09 | スペロ ジャイレース インク | ポリミキシンを含む抗菌剤の組合せ |
| CN105367547B (zh) * | 2014-08-19 | 2019-04-23 | 北京桦冠生物技术有限公司 | 一种噁唑啉酮抗生素的新合成工艺 |
| UY36350A (es) * | 2014-10-10 | 2016-06-01 | Glaxosmithkline Ip Dev Ltd | Compuesto derivado de pirazol para tratamiento o prevención de la enfermedad de chagas. |
| BR112017019349A2 (pt) | 2015-03-11 | 2018-06-05 | Melinta Therapeutics Inc | compostos antimicrobianos e métodos de fabricação e uso dos mesmos |
| CA3015768A1 (en) | 2016-02-25 | 2017-08-31 | Taxis Pharmaceuticals, Inc. | Synthetic processes and intermediates |
| US11098047B2 (en) | 2016-05-06 | 2021-08-24 | BioVersys AG | Antimicrobials and methods of making and using same |
| KR20190133667A (ko) | 2017-03-24 | 2019-12-03 | 다이쇼 세이야꾸 가부시끼가이샤 | 2(1h)-퀴놀리논 유도체 |
| CA3058183A1 (en) | 2017-03-30 | 2018-10-04 | Taxis Pharmaceuticals, Inc. | Synthetic processes and synthetic intermediates |
| CN107325093B (zh) * | 2017-07-09 | 2020-06-05 | 西南科技大学 | 具抗菌活性的硫脲类化合物合成及应用 |
| US12215105B2 (en) | 2019-09-13 | 2025-02-04 | Nimbus Saturn, Inc. | HPK1 antagonists and uses thereof |
| WO2022174253A1 (en) | 2021-02-12 | 2022-08-18 | Nimbus Saturn, Inc. | Hpk1 antagonists and uses thereof |
| EP4301756A4 (en) | 2021-03-05 | 2025-02-26 | Nimbus Saturn, Inc. | HPK1 ANTAGONISTS AND THEIR USES |
| US12071442B2 (en) | 2021-03-29 | 2024-08-27 | Nimbus Saturn, Inc. | Substituted pyrrolo[3,4-c]pyridines as HPK1 antagonists |
| WO2025202955A1 (en) | 2024-03-28 | 2025-10-02 | Pi Industries Ltd. | Fused bicyclic compounds and their use as pest control agents |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3725428A (en) * | 1968-11-01 | 1973-04-03 | Ciba Geigy Ag | N-benzothiazol-2-yl-n{40 -propylureas |
| WO2002060879A2 (en) * | 2000-12-15 | 2002-08-08 | Vertex Pharmaceuticals Incorporated | Bacterial gyrase inhibitors and uses thereof |
| EP1790640A1 (en) * | 2004-09-09 | 2007-05-30 | Chugai Seiyaku Kabushiki Kaisha | Novel imidazolidine derivative and use thereof |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4028374A (en) * | 1975-11-03 | 1977-06-07 | Morton-Norwich Products, Inc. | Antibacterial thiocyanatobenzothiazoles |
| JPS57149280A (en) * | 1981-03-10 | 1982-09-14 | Kyowa Hakko Kogyo Co Ltd | Amino acid derivative and its preparation |
| CN1422262A (zh) | 2000-02-07 | 2003-06-04 | 艾博特股份有限两合公司 | 2－苯并噻唑基脲衍生物及其作为蛋白激酶抑制剂的应用 |
| KR100526487B1 (ko) | 2000-06-21 | 2005-11-08 | 에프. 호프만-라 로슈 아게 | 벤조티아졸 유도체 |
| AU2003245442B2 (en) | 2002-06-13 | 2009-02-05 | Vertex Pharmaceuticals Incorporated | 2-ureido-6-heteroaryl-3h-benzoimidazole-4-carboxylic acid derivatives and related compounds as gyrase and/or topoisomerase IV inhibitors for the treatment of bacterial infections |
| AR042956A1 (es) | 2003-01-31 | 2005-07-13 | Vertex Pharma | Inhibidores de girasa y usos de los mismos |
| WO2005037845A1 (en) | 2003-10-17 | 2005-04-28 | Rigel Pharmaceuticals, Inc. | Benzothiazole and thiazole[5,5-b] pyridine compositions and their use as ubiquitin ligase inhibitors |
| GB0612428D0 (en) | 2006-06-22 | 2006-08-02 | Prolysis Ltd | Antibacterial agents |
-
2007
- 2007-12-13 GB GBGB0724342.1A patent/GB0724342D0/en not_active Ceased
-
2008
- 2008-12-12 EA EA201000993A patent/EA018104B1/ru not_active IP Right Cessation
- 2008-12-12 JP JP2010537517A patent/JP5539898B2/ja not_active Expired - Fee Related
- 2008-12-12 KR KR20107015443A patent/KR20100105847A/ko not_active Ceased
- 2008-12-12 CN CN200880126437.2A patent/CN102015700B/zh not_active Expired - Fee Related
- 2008-12-12 WO PCT/GB2008/004114 patent/WO2009074812A1/en not_active Ceased
- 2008-12-12 US US12/747,811 patent/US8299065B2/en not_active Expired - Fee Related
- 2008-12-12 BR BRPI0820656-2A patent/BRPI0820656A2/pt not_active IP Right Cessation
- 2008-12-12 MX MX2010006428A patent/MX2010006428A/es active IP Right Grant
- 2008-12-12 NZ NZ586508A patent/NZ586508A/en not_active IP Right Cessation
- 2008-12-12 CA CA 2709021 patent/CA2709021A1/en not_active Abandoned
- 2008-12-12 AU AU2008334427A patent/AU2008334427B2/en not_active Ceased
- 2008-12-12 EP EP20080859786 patent/EP2231653B1/en not_active Not-in-force
- 2008-12-12 ES ES08859786T patent/ES2416059T3/es active Active
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3725428A (en) * | 1968-11-01 | 1973-04-03 | Ciba Geigy Ag | N-benzothiazol-2-yl-n{40 -propylureas |
| WO2002060879A2 (en) * | 2000-12-15 | 2002-08-08 | Vertex Pharmaceuticals Incorporated | Bacterial gyrase inhibitors and uses thereof |
| EP1790640A1 (en) * | 2004-09-09 | 2007-05-30 | Chugai Seiyaku Kabushiki Kaisha | Novel imidazolidine derivative and use thereof |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US10945999B2 (en) | 2016-04-08 | 2021-03-16 | Quretech Bio Ab | Ring-fused thiazolino 2-pyridones, methods for preparation thereof and their use in the treatment and/or prevention of tuberculosis |
| US11958871B2 (en) | 2018-02-23 | 2024-04-16 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung e.V. | Inhibitors of bacterial glutaminyl cyclases for use in the treatment of periodontal and related diseases |
Also Published As
| Publication number | Publication date |
|---|---|
| BRPI0820656A2 (pt) | 2015-06-16 |
| JP5539898B2 (ja) | 2014-07-02 |
| CA2709021A1 (en) | 2009-06-18 |
| CN102015700B (zh) | 2014-12-03 |
| WO2009074812A1 (en) | 2009-06-18 |
| EA201000993A1 (ru) | 2011-02-28 |
| US8299065B2 (en) | 2012-10-30 |
| NZ586508A (en) | 2012-05-25 |
| ES2416059T3 (es) | 2013-07-30 |
| KR20100105847A (ko) | 2010-09-30 |
| US20100305067A1 (en) | 2010-12-02 |
| EP2231653B1 (en) | 2013-04-03 |
| EP2231653A1 (en) | 2010-09-29 |
| AU2008334427B2 (en) | 2014-06-19 |
| MX2010006428A (es) | 2010-09-30 |
| JP2011506417A (ja) | 2011-03-03 |
| GB0724342D0 (en) | 2008-01-30 |
| AU2008334427A1 (en) | 2009-06-18 |
| CN102015700A (zh) | 2011-04-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EA018104B1 (ru) | Конденсированные тиазолы, обладающие антибактериальными свойствами | |
| KR101443795B1 (ko) | 항균성 조성물 | |
| US10301305B2 (en) | Heteroaromatic derivatives and their use as pharmaceuticals | |
| JP2025533951A (ja) | 縮合環含窒素化合物、その中間体、調製方法および用途 | |
| WO2009074810A1 (en) | Antibacterial compositions | |
| KR20230019431A (ko) | Enpp1의 이미노 설파논 억제제 | |
| EA020715B1 (ru) | ПРОИЗВОДНЫЕ 1H-ИМИДАЗО[4,5-c]ХИНОЛИНОНА | |
| AU2015276699B2 (en) | Pyridino[1,2-a]pyrimidone analogue used as PI3K inhibitor | |
| CA2977539A1 (en) | Sterol regulatory element-binding proteins (srebps) inhibitors | |
| KR102351782B1 (ko) | 피리도 5원 방향족 고리계 화합물, 이의 제조 방법 및 용도 | |
| JP2012528137A (ja) | 複素環式尿素誘導体およびそれらの使用方法 | |
| US20030092720A1 (en) | Drug efflux pump inhibitor | |
| WO2009001021A1 (en) | Imidazopyridine derivatives useful as enzyme inhibitors for the treatment of cell proliferative and autoimmune diseases | |
| EP3997088A1 (en) | Derivatives of 4-(imidazo[l,2-a]pyridin-3-yl)-n-(pyridinyl)pyrimidin- 2-amine as therapeutic agents | |
| CA3036114C (en) | Pyrido five-element aromatic ring compound, preparation method therefor and use thereof | |
| AU2023304182A1 (en) | C-myc mrna translation modulators and uses thereof in the treatment of cancer | |
| US20250353862A1 (en) | C-myc mrna translation modulators and uses thereof in the treatment of cancer | |
| BR102019005173A2 (pt) | Composto de pirido de anel aromático de cinco elementos, método de preparação do mesmo e uso do mesmo | |
| BR112017025356B1 (pt) | Composto, composição farmacêutica, e, uso para a fabricação de um medicamento |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Lapse of a eurasian patent due to non-payment of renewal fees within the time limit in the following designated state(s) |
Designated state(s): AM AZ BY KZ KG MD TJ TM |
|
| MM4A | Lapse of a eurasian patent due to non-payment of renewal fees within the time limit in the following designated state(s) |
Designated state(s): RU |