DEC0010871MA - - Google Patents
Info
- Publication number
- DEC0010871MA DEC0010871MA DEC0010871MA DE C0010871M A DEC0010871M A DE C0010871MA DE C0010871M A DEC0010871M A DE C0010871MA
- Authority
- DE
- Germany
- Prior art keywords
- methoxy
- pentene
- weight
- pyrone
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- ZPSJGADGUYYRKE-UHFFFAOYSA-N 2H-pyran-2-one Chemical compound O=C1C=CC=CO1 ZPSJGADGUYYRKE-UHFFFAOYSA-N 0.000 claims description 7
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- RLAHWVDQYNDAGG-UHFFFAOYSA-N Methanetriol Chemical class OC(O)O RLAHWVDQYNDAGG-UHFFFAOYSA-N 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 3
- 235000019253 formic acid Nutrition 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 2
- 238000000034 method Methods 0.000 claims 1
- 235000019441 ethanol Nutrition 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 3
- -1 butyl alcohols Chemical class 0.000 description 3
- DOBUSJIVSSJEDA-UHFFFAOYSA-L 1,3-dioxa-2$l^{6}-thia-4-mercuracyclobutane 2,2-dioxide Chemical compound [Hg+2].[O-]S([O-])(=O)=O DOBUSJIVSSJEDA-UHFFFAOYSA-L 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 229910000370 mercury sulfate Inorganic materials 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 150000002731 mercury compounds Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- NQBKFULMFQMZBE-UHFFFAOYSA-N n-bz-3-benzanthronylpyrazolanthron Chemical compound C12=CC=CC(C(=O)C=3C4=CC=CC=3)=C2C4=NN1C1=CC=C2C3=C1C1=CC=CC=C1C(=O)C3=CC=C2 NQBKFULMFQMZBE-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DEC0010871MA (cg-RX-API-DMAC7.html) | ||
| DE953879C (de) | Verfahren zur Herstellung von Pyron-(4) | |
| DE890642C (de) | Verfahren zur Herstellung von Diäthylenglykol | |
| DE2237750C2 (de) | Verfahren zur Herstellung von Brenzcatechin | |
| DE3002811C2 (de) | Verfahren zur Epoxydierung von Cyclododecen oder Tricyclodecen-3 | |
| DE898895C (de) | Verfahren zur Herstellung von ª-Alkoxypropionaldehydacetalen bzw. deren ª-substituierten Homologen | |
| DE1114177B (de) | Verfahren zur Herstellung von Milchsaeure | |
| DE955501C (de) | Verfahren zur Herstellung von Oxyendomethylenhexahydrobenzol und bzw. oder Di-(endomethylenhexahydrophenyl)-aether durch Anlagerung von Wasser an Endomethylentetrahydrobenzol | |
| DE840686C (de) | Verfahren zur Herstellung eines Gemisches von Diacetonalkohol und Hydracetylaceton | |
| DE863945C (de) | Verfahren zur Herstellung ungesaettigter cyclischer Acetale | |
| DE953525C (de) | Verfahren zur Herstellung von [2, 3-Dihydro-1, 4-pyranyl-(2)]-[2-formy]-2, 3-dihydro-1, 4-pyranyl-(2)]-carbinol | |
| DE1028130B (de) | Verfahren zur Herstellung von Oxyalkylarylaethern | |
| DE877762C (de) | Verfahren zur Herstellung hoeherer Tetrahydrofurfurylalkylcarbonsaeuren | |
| DE912209C (de) | Verfahren zur Herstellung von 1, 3, 5-Triacetylbenzol | |
| DE912810C (de) | Verfahren zur Herstellung von monomeren Vinylestern | |
| DE922167C (de) | Verfahren zur Herstellung von Cyclohexylidencyclohexanonen | |
| DE1301999B (de) | Verfahren zur Herstellung von delta 4, 16-Pregnadien-20-ol-3-on | |
| DE803354C (de) | Verfahren zur Herstellung ungesaettigter tertiaerer Alkohole | |
| DE765787C (de) | Verfahren zur Herstellung von Umsetzungsprodukten von Formaldehyd mit Blausaeure | |
| DE920247C (de) | Verfahren zur Herstellung von aliphatischen oder araliphatischen Dicarbonsaeuren oder deren Salzen | |
| DE960185C (de) | Verfahren zur Herstellung von Diglycidaethern aus Diolen | |
| DE1138765B (de) | Verfahren zur Herstellung der Kaffeesaeureester der Chinasaeure | |
| DE133564C (cg-RX-API-DMAC7.html) | ||
| DE2242463C3 (de) | Verfahren zur Herstellung von 2-n-Pentyl-3-(2-oxopropyl)-1-cyclopentanon | |
| DE919167C (de) | Herstellung von Dicarbonsaeuren und deren Salzen |