DEB0031568MA - - Google Patents
Info
- Publication number
- DEB0031568MA DEB0031568MA DEB0031568MA DE B0031568M A DEB0031568M A DE B0031568MA DE B0031568M A DEB0031568M A DE B0031568MA
- Authority
- DE
- Germany
- Prior art keywords
- dyeing
- treated
- amino group
- sulfonic acid
- thioethers
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000004043 dyeing Methods 0.000 claims description 11
- 239000000975 dye Substances 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 5
- 150000002170 ethers Chemical class 0.000 claims description 4
- 150000003568 thioethers Chemical class 0.000 claims description 4
- 229920002678 cellulose Polymers 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 238000009987 spinning Methods 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 2
- 125000000565 sulfonamide group Chemical group 0.000 claims description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 125000003277 amino group Chemical group 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000004744 fabric Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical class C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 4
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 2
- DZXNARMBWJFBGD-UHFFFAOYSA-N 1,4-diamino-9,10-dioxoanthracene-2-sulfonic acid Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(N)=C(S(O)(=O)=O)C=C2N DZXNARMBWJFBGD-UHFFFAOYSA-N 0.000 description 1
- AGKGEVFNBHWDHG-UHFFFAOYSA-N 2-[(4-chlorophenoxy)methoxy]-N-[2-[(4-chlorophenoxy)methoxy]ethyl]-N-methylethanamine Chemical compound ClC1=CC=C(OCOCCN(CCOCOC2=CC=C(C=C2)Cl)C)C=C1 AGKGEVFNBHWDHG-UHFFFAOYSA-N 0.000 description 1
- BIXYENQGVAOIJE-UHFFFAOYSA-N 2-amino-5-methyl-n-phenylbenzenesulfonamide Chemical compound CC1=CC=C(N)C(S(=O)(=O)NC=2C=CC=CC=2)=C1 BIXYENQGVAOIJE-UHFFFAOYSA-N 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- VVXOXKRUYVRMDG-UHFFFAOYSA-N 2-phenylmethoxy-n-(2-phenylmethoxyethyl)ethanamine Chemical compound C=1C=CC=CC=1COCCNCCOCC1=CC=CC=C1 VVXOXKRUYVRMDG-UHFFFAOYSA-N 0.000 description 1
- ZFWRTOGKYLEMAB-UHFFFAOYSA-N 4-(2-phenylmethoxyethyl)morpholine Chemical compound C=1C=CC=CC=1COCCN1CCOCC1 ZFWRTOGKYLEMAB-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- VYZAHLCBVHPDDF-UHFFFAOYSA-N Dinitrochlorobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 VYZAHLCBVHPDDF-UHFFFAOYSA-N 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 1
- 229940081735 acetylcellulose Drugs 0.000 description 1
- -1 aldehyde bisulfite compounds Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE953428C (de) | Verfahren zum Faerben oder Bedrucken von Gebilden aus Celluloseestern | |
| DE743155C (de) | Verfahren zum Faerben von Fasern tierischen Ursprungs, gegebenenfalls im Gemisch mit pflanzlichen Fasern, oder Leder | |
| DE966651C (de) | Verfahren zur Herstellung von Faerbungen | |
| DEB0031568MA (cg-RX-API-DMAC7.html) | ||
| DE690240C (de) | Verfahren zum Faerben von Textilstoffen aus Cellulosefasern | |
| DE707263C (de) | Verfahren zur Herstellung von wasserunloeslichen Azofarbstoffen auf Stoffen pflanzlichen Ursprungs | |
| DE2032238B2 (de) | Verfahren zum faerben und bedrucken von hydrophobem fasermaterial | |
| DE657487C (de) | Verfahren zum Faerben von Mischungen aus Wolle und Kunstseide aus Cellulose | |
| DE702278C (de) | Verfahren zur Herstellung von Azofarbstoffen auf Celluloseestern und -aethern jeder Verformungsart | |
| DE899698C (de) | Verfahren zur Herstellung von Kobaltphthalocyanin | |
| DE556453C (de) | Verfahren zur Herstellung von Azofarbstoffen auf der Faser | |
| DE957471C (de) | Verfahren zum Faerben oder Bedrucken von Gebilden aus Celluloseestern | |
| DE617381C (de) | Verfahren zum Faerben von Acetatseide oder Cellulosefasern enthaltender Acetatseide | |
| DE402502C (de) | Verfahren zur Herstellung waschechter Faerbungen auf pflanzlichen Fasern | |
| DE728463C (de) | Verfahren zum Faerben und Drucken von tierischen Fasern | |
| DE709724C (de) | Verfahren zur Herstellung von wasserunloeslichen Azofarbstoffen auf Faserstoffen tierischen Ursprungs oder Cellulosefasern sowie deren Gemischen untereinander oder auf Formstuecken aus Vulkanfiber | |
| DE760561C (de) | Verfahren zum Faerben von Cellulosefasern oder Fasergemischen daraus | |
| AT219552B (de) | Verfahren zum Färben und Bedrucken von Textilien | |
| DE686846C (de) | Verfahren zum Reservieren von Anilinschwarzfaerbungen auf Acetatkunstseide oder diese enthaltenden Fasergemischen | |
| DE856138C (de) | Verfahren zum Bedrucken von Gebilden aus Cellulose, wie Textilstoffen, Papier u. dgl. mit Chromfarbstoffen | |
| DE204799C (cg-RX-API-DMAC7.html) | ||
| DE639838C (de) | Verfahren zum Faerben von Fasergemischen aus Wolle und Cellulosefasern mit Kuepenfarbstoffen | |
| DE695399C (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE683952C (de) | Verfahren zum Drucken mit Beizenfarbstoffen auf Seide oder Cellulosefasern | |
| DE734796C (de) | Verfahren zur Herstellung von Azofarbstoffen auf der Faser |