DE968363C - Verfahren zur Herstellung von Salzen des Hydroxylamins - Google Patents
Verfahren zur Herstellung von Salzen des HydroxylaminsInfo
- Publication number
- DE968363C DE968363C DEE327A DEE0000327A DE968363C DE 968363 C DE968363 C DE 968363C DE E327 A DEE327 A DE E327A DE E0000327 A DEE0000327 A DE E0000327A DE 968363 C DE968363 C DE 968363C
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- hydroxylamine
- nitrogen oxide
- hydrogen
- chemie
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical class ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 title claims description 32
- 238000000034 method Methods 0.000 title claims description 11
- 150000003839 salts Chemical class 0.000 title claims description 4
- 238000002360 preparation method Methods 0.000 title claims description 3
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 claims description 84
- 238000006243 chemical reaction Methods 0.000 claims description 35
- 239000001257 hydrogen Substances 0.000 claims description 24
- 229910052739 hydrogen Inorganic materials 0.000 claims description 24
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 24
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 21
- 239000011541 reaction mixture Substances 0.000 claims description 21
- 239000003054 catalyst Substances 0.000 claims description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 12
- 229910052697 platinum Inorganic materials 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 9
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 230000002378 acidificating effect Effects 0.000 claims description 5
- 230000035484 reaction time Effects 0.000 claims description 5
- 230000008014 freezing Effects 0.000 claims description 3
- 238000007710 freezing Methods 0.000 claims description 3
- 238000004451 qualitative analysis Methods 0.000 claims description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims 1
- 238000005516 engineering process Methods 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 4
- 239000003610 charcoal Substances 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- VEZUQRBDRNJBJY-UHFFFAOYSA-N cyclohexanone oxime Chemical compound ON=C1CCCCC1 VEZUQRBDRNJBJY-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 2
- 238000007711 solidification Methods 0.000 description 2
- 230000008023 solidification Effects 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229940076286 cupric acetate Drugs 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- -1 dilute acetic acid Chemical class 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 239000008246 gaseous mixture Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical compound [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- VCRYGHPVKURQMM-UHFFFAOYSA-N methane;platinum Chemical compound C.[Pt] VCRYGHPVKURQMM-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 230000002250 progressing effect Effects 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B21/00—Nitrogen; Compounds thereof
- C01B21/082—Compounds containing nitrogen and non-metals and optionally metals
- C01B21/14—Hydroxylamine; Salts thereof
- C01B21/1409—Preparation
- C01B21/1418—Preparation by catalytic reduction of nitrogen oxides or nitrates with hydrogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Inorganic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US112841A US2628889A (en) | 1949-08-27 | 1949-08-27 | Preparation of hydroxylamine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE968363C true DE968363C (de) | 1958-02-06 |
Family
ID=22346107
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEE327A Expired DE968363C (de) | 1949-08-27 | 1949-12-01 | Verfahren zur Herstellung von Salzen des Hydroxylamins |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2628889A (OSRAM) |
| DE (1) | DE968363C (OSRAM) |
| FR (1) | FR1006865A (OSRAM) |
| GB (1) | GB667870A (OSRAM) |
| NL (1) | NL74063C (OSRAM) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2100036A1 (de) * | 1971-01-02 | 1972-07-27 | Badische Anilin- & Soda-Fabrik Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Hydroxy !ammoniumnitrat |
| EP0001972A1 (de) * | 1977-09-27 | 1979-05-30 | BASF Aktiengesellschaft | Verfahren zur Herstellung von Hydroxylammoniumsalzen in Reaktionsgefässen aus Edelstahl |
| EP0001971A1 (de) * | 1977-09-27 | 1979-05-30 | BASF Aktiengesellschaft | Verfahren zur Herstellung von Hydroxylammoniumsalzen in Reaktionsgefässen aus Edelstahl |
| EP0002178A1 (de) * | 1977-09-27 | 1979-06-13 | BASF Aktiengesellschaft | Verfahren zur Herstellung von Hydroxylammoniumsalzen |
| EP0059366A1 (de) * | 1981-02-28 | 1982-09-08 | BASF Aktiengesellschaft | Verfahren zur kontinuierlichen Herstellung von Hydroxylammoniumsalzen |
| US4457906A (en) * | 1981-07-31 | 1984-07-03 | Basf Aktiengesellschaft | Preparation of hydroxylammonium salts |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL86978C (OSRAM) * | 1951-09-18 | |||
| US2798791A (en) * | 1953-01-23 | 1957-07-09 | Basf Ag | Production of hydroxylammonium sulfate |
| GB754343A (en) * | 1953-02-25 | 1956-08-08 | Basf Ag | Improvements in the production of hydroxylammonium salts |
| NL199741A (OSRAM) * | 1953-07-28 | |||
| US2749217A (en) * | 1953-10-12 | 1956-06-05 | Spencer Chem Co | Production of hydroxylamine and semicarbazide salts |
| DE956038C (de) * | 1954-04-01 | 1957-01-10 | Basf Ag | Verfahren zur Herstellung von Hydroxylammoniumsalzen |
| DE1047178B (de) * | 1955-08-22 | 1958-12-24 | Spencer Chem Co | Verfahren zur Herstellung von Hydroxylaminsalzen oder Hydroxylamin |
| US3180771A (en) * | 1958-01-16 | 1965-04-27 | Iit Res Inst | Method of preparing rocket monopropellent compounds |
| NL267754A (OSRAM) * | 1960-08-04 | 1900-01-01 | ||
| BE634876A (OSRAM) * | 1962-07-13 | |||
| NL123476C (OSRAM) * | 1963-03-08 | |||
| DE1567511A1 (de) * | 1965-12-04 | 1970-04-16 | Bayer Ag | Verfahren zur Herstellung von Hydroxylammoniumsulfat |
| DE1567515B2 (de) * | 1966-01-21 | 1975-05-28 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Hydroxylammoniumsulfat |
| DE1767113C2 (de) * | 1968-04-03 | 1981-10-15 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Hydroxylammoniumsulfat |
| DE2222027A1 (de) * | 1971-09-24 | 1973-04-05 | Centrale Ind De Fibre Chimice | Verfahren zur erzeugung von hydroxylamin und von gesaettigten zyklischen ketoximen |
| NL7412381A (nl) * | 1974-09-19 | 1976-03-23 | Stamicarbon | Afscheiding van katalysatoren uit een suspensie van deze deeltjes in een waterige hydroxyl- ammoniumzoutoplossing. |
| BE1010719A3 (nl) * | 1996-10-28 | 1998-12-01 | Dsm Nv | Werkwijze voor de bereiding van hydroxylammoniumzouten. |
Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE41987C (de) * | Dr. F. RASCHIG in Ludwigshafen a. Rh | Verfahren zur Darstellung der hydroxylamindisulfonsauren Alkalisalze und von \ Hydroxylamin aus letzteren | ||
| DE133457C (de) * | 1901-07-26 | 1902-07-10 | C.F. Boehringer & Söhne | Verfahren zur elektrolytischen darstellung von hydroxylamin |
| DE900212C (de) * | 1951-10-19 | 1953-12-21 | Basf Ag | Verfahren zur Herstellung von Hydroxylamin |
| DE900213C (de) * | 1951-10-20 | 1953-12-21 | Basf Ag | Verfahren zur Herstellung von Hydroxylamin |
| DE920963C (de) * | 1953-02-25 | 1954-12-06 | Basf Ag | Verfahren zur Herstellung von Hydroxylammoniumsalzen |
| DE936264C (de) * | 1952-11-28 | 1955-12-07 | Huels Chemische Werke Ag | Verfahren zur Herstellung von Hydroxylaminsulfat |
-
0
- NL NL74063D patent/NL74063C/xx active
-
1949
- 1949-08-27 US US112841A patent/US2628889A/en not_active Expired - Lifetime
- 1949-12-01 DE DEE327A patent/DE968363C/de not_active Expired
- 1949-12-05 FR FR1006865D patent/FR1006865A/fr not_active Expired
-
1950
- 1950-01-31 GB GB2451/50A patent/GB667870A/en not_active Expired
Patent Citations (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE41987C (de) * | Dr. F. RASCHIG in Ludwigshafen a. Rh | Verfahren zur Darstellung der hydroxylamindisulfonsauren Alkalisalze und von \ Hydroxylamin aus letzteren | ||
| DE133457C (de) * | 1901-07-26 | 1902-07-10 | C.F. Boehringer & Söhne | Verfahren zur elektrolytischen darstellung von hydroxylamin |
| DE137697C (de) * | 1901-07-26 | 1902-11-26 | C.F. Boehringer & Söhne | Verfahren zur elektrolytischen darstellung von hydroxylamin |
| DE900212C (de) * | 1951-10-19 | 1953-12-21 | Basf Ag | Verfahren zur Herstellung von Hydroxylamin |
| DE900213C (de) * | 1951-10-20 | 1953-12-21 | Basf Ag | Verfahren zur Herstellung von Hydroxylamin |
| DE936264C (de) * | 1952-11-28 | 1955-12-07 | Huels Chemische Werke Ag | Verfahren zur Herstellung von Hydroxylaminsulfat |
| DE920963C (de) * | 1953-02-25 | 1954-12-06 | Basf Ag | Verfahren zur Herstellung von Hydroxylammoniumsalzen |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2100036A1 (de) * | 1971-01-02 | 1972-07-27 | Badische Anilin- & Soda-Fabrik Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Hydroxy !ammoniumnitrat |
| EP0001972A1 (de) * | 1977-09-27 | 1979-05-30 | BASF Aktiengesellschaft | Verfahren zur Herstellung von Hydroxylammoniumsalzen in Reaktionsgefässen aus Edelstahl |
| EP0001971A1 (de) * | 1977-09-27 | 1979-05-30 | BASF Aktiengesellschaft | Verfahren zur Herstellung von Hydroxylammoniumsalzen in Reaktionsgefässen aus Edelstahl |
| EP0002178A1 (de) * | 1977-09-27 | 1979-06-13 | BASF Aktiengesellschaft | Verfahren zur Herstellung von Hydroxylammoniumsalzen |
| EP0059366A1 (de) * | 1981-02-28 | 1982-09-08 | BASF Aktiengesellschaft | Verfahren zur kontinuierlichen Herstellung von Hydroxylammoniumsalzen |
| US4477424A (en) * | 1981-02-28 | 1984-10-16 | Basf Aktiengesellschaft | Continuous preparation of hydroxylammonium salts |
| US4457906A (en) * | 1981-07-31 | 1984-07-03 | Basf Aktiengesellschaft | Preparation of hydroxylammonium salts |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1006865A (fr) | 1952-04-28 |
| NL74063C (OSRAM) | |
| US2628889A (en) | 1953-02-17 |
| GB667870A (en) | 1952-03-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE968363C (de) | Verfahren zur Herstellung von Salzen des Hydroxylamins | |
| DE1177118C2 (de) | Verfahren zur kontinuierlichen Herstellung von Hydroxylammoniumsalzen | |
| DE3530820A1 (de) | Verfahren zur regeneration von katalysatoren fuer die gasphasenreduktion von aromatischen nitroverbindungen | |
| DE2913925A1 (de) | Verfahren zur herstellung von cyanwasserstoff | |
| DE1297589C2 (de) | Verfahren zur Herstellung von Dicyan | |
| DE854205C (de) | Herstellung von Schwefelsaeure | |
| DE2758935A1 (de) | Verfahren zur herstellung von distickstoffmonoxyd | |
| DE814144C (de) | Verfahren zur Herstellung von Hydroxylaminsulfonaten und/oder Hydroxylaminsulfat | |
| EP0059445A1 (de) | Verfahren zur Entfernung von Distickstoffoxid aus solches enthaltenden Abgasen | |
| DE852992C (de) | Verfahren zur Herstellung von ungesaettigten Aldehyden | |
| DE2442231A1 (de) | Verfahren zur herstellung von formaldehyd | |
| DE350922C (de) | Verfahren zur Gewinnung von Formaldehyd aus AEthylen | |
| DE2006205A1 (de) | Verfahren zur Herstellung von Nitrophenol und Salzen desselben | |
| DE2116947C3 (de) | Verfahren zur Herstellung von Formaldehyd | |
| DE2923472A1 (de) | Verfahren zur herstellung von aminen und katalysator zur durchfuehrung des verfahrens | |
| DE2736906C2 (de) | Verfahren zur Herstellung von Hydroxylammoniumsalzen | |
| DE2813520C2 (OSRAM) | ||
| EP0071097B1 (de) | Verfahren zur Herstellung von Hydroxylammoniumsalzen | |
| DE1592477B1 (de) | Verfahren zur Herstellung von Ammoniumuranylcarbonat | |
| DE2916589A1 (de) | Verfahren zur herstellung von terephthalsaeure | |
| DE1160409B (de) | Verfahren zur Herstellung von Sulfurylfluorid | |
| CH638466A5 (de) | Verfahren zum konzentrieren und reinigen von waessrigen schwefelsaeureloesungen. | |
| DE489570C (de) | Verfahren zur Herstellung von festem Ammoniumchlorid | |
| DE956046C (de) | Verfahren zur Herstellung von Diphenylamin und kernalkylsubstituierten Diphenylaminen | |
| DE525998C (de) | Verfahren der Ammoniaksynthese |