DE941766C - Photographisches Material mit Lichthofschutzschicht - Google Patents
Photographisches Material mit LichthofschutzschichtInfo
- Publication number
- DE941766C DE941766C DEG7362A DEG0007362A DE941766C DE 941766 C DE941766 C DE 941766C DE G7362 A DEG7362 A DE G7362A DE G0007362 A DEG0007362 A DE G0007362A DE 941766 C DE941766 C DE 941766C
- Authority
- DE
- Germany
- Prior art keywords
- acid amide
- fatty acid
- antihalation layer
- layer
- material according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 title claims description 11
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 19
- 239000000194 fatty acid Substances 0.000 claims description 19
- 229930195729 fatty acid Natural products 0.000 claims description 19
- 150000004665 fatty acids Chemical class 0.000 claims description 19
- 239000011347 resin Substances 0.000 claims description 16
- 229920005989 resin Polymers 0.000 claims description 16
- 239000000839 emulsion Substances 0.000 claims description 12
- 229920000159 gelatin Polymers 0.000 claims description 9
- 235000019322 gelatine Nutrition 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 9
- 108010010803 Gelatin Proteins 0.000 claims description 8
- 239000008273 gelatin Substances 0.000 claims description 8
- 235000011852 gelatine desserts Nutrition 0.000 claims description 8
- 229910052709 silver Inorganic materials 0.000 claims description 6
- 239000004332 silver Substances 0.000 claims description 6
- LYRFLYHAGKPMFH-UHFFFAOYSA-N octadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(N)=O LYRFLYHAGKPMFH-UHFFFAOYSA-N 0.000 claims description 5
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 4
- ILRSCQWREDREME-UHFFFAOYSA-N dodecanamide Chemical compound CCCCCCCCCCCC(N)=O ILRSCQWREDREME-UHFFFAOYSA-N 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- FATBGEAMYMYZAF-KTKRTIGZSA-N oleamide Chemical compound CCCCCCCC\C=C/CCCCCCCC(N)=O FATBGEAMYMYZAF-KTKRTIGZSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- HSEMFIZWXHQJAE-UHFFFAOYSA-N hexadecanamide Chemical compound CCCCCCCCCCCCCCCC(N)=O HSEMFIZWXHQJAE-UHFFFAOYSA-N 0.000 claims description 2
- QFIHQWXKTUONPL-UHFFFAOYSA-N octadeca-2,4-dienamide Chemical compound CCCCCCCCCCCCCC=CC=CC(N)=O QFIHQWXKTUONPL-UHFFFAOYSA-N 0.000 claims description 2
- LTHCSWBWNVGEFE-UHFFFAOYSA-N octanamide Chemical compound CCCCCCCC(N)=O LTHCSWBWNVGEFE-UHFFFAOYSA-N 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims 1
- 239000000975 dye Substances 0.000 description 10
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 239000000049 pigment Substances 0.000 description 5
- 239000000758 substrate Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 4
- -1 silver halide Chemical class 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 3
- 239000011976 maleic acid Substances 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- OZCMOJQQLBXBKI-UHFFFAOYSA-N 1-ethenoxy-2-methylpropane Chemical compound CC(C)COC=C OZCMOJQQLBXBKI-UHFFFAOYSA-N 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N 1-ethenoxybutane Chemical compound CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- GHVNFZFCNZKVNT-UHFFFAOYSA-N decanoic acid Chemical compound CCCCCCCCCC(O)=O GHVNFZFCNZKVNT-UHFFFAOYSA-N 0.000 description 2
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 2
- IPCSVZSSVZVIGE-UHFFFAOYSA-N hexadecanoic acid Chemical compound CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 2
- LCPDWSOZIOUXRV-UHFFFAOYSA-N phenoxyacetic acid Chemical compound OC(=O)COC1=CC=CC=C1 LCPDWSOZIOUXRV-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- ADHNUPOJJCKWRT-JLXBFWJWSA-N (2e,4e)-octadeca-2,4-dienoic acid Chemical compound CCCCCCCCCCCCC\C=C\C=C\C(O)=O ADHNUPOJJCKWRT-JLXBFWJWSA-N 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- PYSRRFNXTXNWCD-UHFFFAOYSA-N 3-(2-phenylethenyl)furan-2,5-dione Chemical compound O=C1OC(=O)C(C=CC=2C=CC=CC=2)=C1 PYSRRFNXTXNWCD-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- 239000004925 Acrylic resin Substances 0.000 description 1
- JMOGPBKCUKFZIE-UHFFFAOYSA-N C1(C=C/C(=O)O1)=O.C(C(C)C)OCC(C)C Chemical compound C1(C=C/C(=O)O1)=O.C(C(C)C)OCC(C)C JMOGPBKCUKFZIE-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 239000005632 Capric acid (CAS 334-48-5) Substances 0.000 description 1
- 239000005635 Caprylic acid (CAS 124-07-2) Substances 0.000 description 1
- 229920000623 Cellulose acetate phthalate Polymers 0.000 description 1
- 241000790917 Dioxys <bee> Species 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 235000021314 Palmitic acid Nutrition 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229920000147 Styrene maleic anhydride Polymers 0.000 description 1
- YRACHDVMKITFAZ-UHFFFAOYSA-N [1,2,4]triazolo[4,3-b]pyridazine Chemical compound C1=CC=NN2C=NN=C21 YRACHDVMKITFAZ-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 238000004026 adhesive bonding Methods 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000005233 alkylalcohol group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 238000000149 argon plasma sintering Methods 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 229940081734 cellulose acetate phthalate Drugs 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000001246 colloidal dispersion Methods 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- TUTWLYPCGCUWQI-UHFFFAOYSA-N decanamide Chemical compound CCCCCCCCCC(N)=O TUTWLYPCGCUWQI-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- 210000002837 heart atrium Anatomy 0.000 description 1
- DCYOBGZUOMKFPA-UHFFFAOYSA-N iron(2+);iron(3+);octadecacyanide Chemical compound [Fe+2].[Fe+2].[Fe+2].[Fe+3].[Fe+3].[Fe+3].[Fe+3].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] DCYOBGZUOMKFPA-UHFFFAOYSA-N 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 229940116335 lauramide Drugs 0.000 description 1
- 229910001425 magnesium ion Inorganic materials 0.000 description 1
- FDZZZRQASAIRJF-UHFFFAOYSA-M malachite green Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1C(C=1C=CC=CC=1)=C1C=CC(=[N+](C)C)C=C1 FDZZZRQASAIRJF-UHFFFAOYSA-M 0.000 description 1
- 229940107698 malachite green Drugs 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- QEALYLRSRQDCRA-UHFFFAOYSA-N myristamide Chemical compound CCCCCCCCCCCCCC(N)=O QEALYLRSRQDCRA-UHFFFAOYSA-N 0.000 description 1
- WQEPLUUGTLDZJY-UHFFFAOYSA-N n-Pentadecanoic acid Natural products CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 229960002446 octanoic acid Drugs 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 235000021313 oleic acid Nutrition 0.000 description 1
- 125000005506 phthalide group Chemical group 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 229960003351 prussian blue Drugs 0.000 description 1
- 239000013225 prussian blue Substances 0.000 description 1
- WVIICGIFSIBFOG-UHFFFAOYSA-N pyrylium Chemical compound C1=CC=[O+]C=C1 WVIICGIFSIBFOG-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 150000003378 silver Chemical class 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- TUNFSRHWOTWDNC-HKGQFRNVSA-N tetradecanoic acid Chemical compound CCCCCCCCCCCCC[14C](O)=O TUNFSRHWOTWDNC-HKGQFRNVSA-N 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 150000004961 triphenylmethanes Chemical class 0.000 description 1
- 239000012224 working solution Substances 0.000 description 1
- OIHZGFWAMWHYPA-UHFFFAOYSA-N xanthylium Chemical compound C1=CC=CC2=CC3=CC=CC=C3[O+]=C21 OIHZGFWAMWHYPA-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/76—Photosensitive materials characterised by the base or auxiliary layers
- G03C1/825—Photosensitive materials characterised by the base or auxiliary layers characterised by antireflection means or visible-light filtering means, e.g. antihalation
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Materials For Medical Uses (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US299390XA | 1950-11-07 | 1950-11-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE941766C true DE941766C (de) | 1956-04-19 |
Family
ID=21851680
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEG7362A Expired DE941766C (de) | 1950-11-07 | 1951-11-07 | Photographisches Material mit Lichthofschutzschicht |
Country Status (6)
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE617284A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1961-05-05 | |||
| GB1103287A (en) * | 1965-04-20 | 1968-02-14 | Fuji Photo Film Co Ltd | Improvements in and relating to photographic light-sensitive films |
| US3990895A (en) * | 1974-04-23 | 1976-11-09 | Polaroid Corporation | Silver halide, color screen elements and their use in forming negative color images and diffusion transfer positive silver images |
| JPS5834821B2 (ja) * | 1978-12-13 | 1983-07-29 | 富士写真フイルム株式会社 | 写真感光材料 |
| CA2034788A1 (en) * | 1990-01-26 | 1991-07-27 | Rudolf W. Beisswenger | Element having improved adhesion of auxiliary layers to film supports containing antistatic layers |
| US5529891A (en) * | 1995-05-12 | 1996-06-25 | Eastman Kodak Company | Photographic element having improved scratch resistance |
| US5541048A (en) * | 1995-05-12 | 1996-07-30 | Eastman Kodak Company | Lubricant particles, method of preparation, and photographic elements |
| US5912109A (en) | 1996-02-12 | 1999-06-15 | Eastman Kodak Company | Imaging element comprising an electrically-conductive layer containing conductive fine particles and water-insoluble polymer particles of specified shear modulus |
| US5695920A (en) | 1996-04-22 | 1997-12-09 | Eastman Kodak Company | Aqueous coating compositions useful in the preparation of auxiliary layers of imaging elements |
| EP0886176A1 (en) * | 1997-06-19 | 1998-12-23 | Eastman Kodak Company | Imaging element containing polymer particles and lubricant |
| US5956555A (en) * | 1998-07-27 | 1999-09-21 | Eastman Kodak Company | Fusing belt having polyurethane release layer |
| US6344310B1 (en) * | 1998-11-20 | 2002-02-05 | Eastman Kodak Company | Thin durable photographic element |
| JP3646285B2 (ja) * | 1998-12-14 | 2005-05-11 | コニカミノルタホールディングス株式会社 | ハロゲン化銀写真感光材料の画像形成方法 |
| US6197482B1 (en) | 1999-05-14 | 2001-03-06 | Eastman Kodak Company | Polymer overcoat for imaging elements |
| US6153362A (en) * | 1999-05-14 | 2000-11-28 | Eastman Kodak Company | Overcoat for reticulation control in photographic elements |
| US6740480B1 (en) * | 2000-11-03 | 2004-05-25 | Eastman Kodak Company | Fingerprint protection for clear photographic shield |
| US6468339B1 (en) | 2001-08-23 | 2002-10-22 | Eastman Kodak Company | Alumina filled gelatin |
| GB0329925D0 (en) | 2003-12-24 | 2004-01-28 | Eastman Kodak Co | Imaging element having improved durability |
| JP2010256908A (ja) | 2010-05-07 | 2010-11-11 | Fujifilm Corp | 映画用ハロゲン化銀写真感光材料 |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE584662C (de) * | 1932-03-02 | 1933-09-22 | I G Farbenindustrie Akt Ges | In alkalischen photographischen Behandlungsbaedern loesliche Lichthofschutzschicht fuer photographische Platten und Filme |
| DE653197C (de) * | 1931-02-16 | 1937-11-16 | Kodak Akt Ges | Verfahren zum Herstellen einer Lichthofschutzschicht fuer photographische Filme unter Verwendung einer gefaerbten Wachsschicht |
| DE729724C (de) * | 1937-10-13 | 1942-12-22 | Kodak Ag | Bindemittel fuer Lichthofschutzschichten |
| CH235052A (de) * | 1942-04-20 | 1944-11-15 | Ig Farbenindustrie Ag | Verfahren zur Herstellung von Blitzschutzschichten an photographischen Filmen. |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2118059A (en) * | 1935-09-20 | 1938-05-24 | Eastman Kodak Co | Antistatic photographic film |
| US2278457A (en) * | 1939-07-13 | 1942-04-07 | Du Pont Film Mfg Corp | Nonhalation photographic element |
| GB591124A (en) * | 1945-05-15 | 1947-08-07 | Ronald Bernard Collins | Improvements in the production of coloured colloid layers |
| US2533514A (en) * | 1947-11-19 | 1950-12-12 | Eastman Kodak Co | Photographic emulsions containing color couplers and amide coupler solvents |
-
0
- US US2732305D patent/US2732305A/en not_active Expired - Lifetime
- BE BE506949D patent/BE506949A/xx unknown
-
1951
- 1951-10-22 GB GB24594/51A patent/GB690142A/en not_active Expired
- 1951-11-05 FR FR1054081D patent/FR1054081A/fr not_active Expired
- 1951-11-06 CH CH299390D patent/CH299390A/fr unknown
- 1951-11-07 DE DEG7362A patent/DE941766C/de not_active Expired
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE653197C (de) * | 1931-02-16 | 1937-11-16 | Kodak Akt Ges | Verfahren zum Herstellen einer Lichthofschutzschicht fuer photographische Filme unter Verwendung einer gefaerbten Wachsschicht |
| DE584662C (de) * | 1932-03-02 | 1933-09-22 | I G Farbenindustrie Akt Ges | In alkalischen photographischen Behandlungsbaedern loesliche Lichthofschutzschicht fuer photographische Platten und Filme |
| DE729724C (de) * | 1937-10-13 | 1942-12-22 | Kodak Ag | Bindemittel fuer Lichthofschutzschichten |
| CH235052A (de) * | 1942-04-20 | 1944-11-15 | Ig Farbenindustrie Ag | Verfahren zur Herstellung von Blitzschutzschichten an photographischen Filmen. |
Also Published As
| Publication number | Publication date |
|---|---|
| BE506949A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| CH299390A (fr) | 1954-06-15 |
| US2732305A (en) | 1956-01-24 |
| GB690142A (en) | 1953-04-15 |
| FR1054081A (fr) | 1954-02-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE941766C (de) | Photographisches Material mit Lichthofschutzschicht | |
| DE1447619A1 (de) | Beizmittelkomposition fuer die Erzeugung von Farbstoffbeizschichten in oder auf farbphotographischem Material | |
| DE1146752B (de) | Lichtschutzschicht bzw. Lichtschutzlack fuer farbenphotographische Bilder | |
| DE2832530C2 (de) | Lichtempfindliches Material für die Gerbentwicklung | |
| DE687950C (de) | Photographischer Abziehfilm | |
| DE2230936C3 (de) | Lichtempfindliches Gemisch | |
| DE2111766A1 (de) | Verwendung von 2-Hydroxybenzophenonen als Stabilisierungsmittel gegen Ultraviolettstrahlung in farbphotographischem Material | |
| DE1472797C3 (de) | Photographischer Schichtträger aus biaxial orientiertem Polyethylenterephthalat | |
| DE1572119C3 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| DE1621872B2 (de) | Verfahren zur herstellung wasserpermeabler, fluoreszierender schichten auf photographischen aufzeichnungsmaterialien | |
| DE1447781A1 (de) | Fotografischer Abziehfilm | |
| DE946587C (de) | Photographisches Material und Verfahren zu seiner Herstellung | |
| DE1572119A1 (de) | Waessrige Dispersion fuer photographische oder Zeichenfilme | |
| DE1035472B (de) | Verfahren zur Herstellung von Lichthofschutzschichten | |
| DE876951C (de) | Lichtempfindliches Material zur Herstellung von Druckformen | |
| DE735673C (de) | Schutz- und Hilfsschichten fuer photographisches Material | |
| DE1447936A1 (de) | Lichtempfindliches Filmmaterial fuer die Herstellung von AEtzdruckplatten | |
| DE604456C (de) | Verfahren zur Verminderung der elektrischen Erregbarkeit von Folien und aehnlichen kuenstlichen Gebilden | |
| DE1772280A1 (de) | AEtz-Resistfilm zur Erzeugung von Resistschichten auf Tiefdruckplatten,-zylindern u.dgl. | |
| DE2601377A1 (de) | Verfahren zur verhinderung der bildung von kontaktflecken auf photographischen materialien | |
| DE729724C (de) | Bindemittel fuer Lichthofschutzschichten | |
| DE1045798B (de) | Verfahren zur Herstellung von Lichthofschutzschichten | |
| DE1572171C3 (de) | Verfahren zur Herstellung von Lichthofschutzschichten auf photographischen Schichtträgern | |
| DE967864C (de) | Verfahren zur Herstellung von Lichthofschutzschichten | |
| AT159319B (de) | Ultraviolett absorbierende Filterschichten. |