DE929171C - Verfahren und Material zum Herstellen farbiger photographischer Bilder - Google Patents
Verfahren und Material zum Herstellen farbiger photographischer BilderInfo
- Publication number
- DE929171C DE929171C DEN3941A DEN0003941A DE929171C DE 929171 C DE929171 C DE 929171C DE N3941 A DEN3941 A DE N3941A DE N0003941 A DEN0003941 A DE N0003941A DE 929171 C DE929171 C DE 929171C
- Authority
- DE
- Germany
- Prior art keywords
- solution
- dye
- image
- color
- ecm
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 46
- 239000000463 material Substances 0.000 title claims description 13
- 238000011161 development Methods 0.000 claims description 42
- 229910052751 metal Inorganic materials 0.000 claims description 36
- 239000002184 metal Substances 0.000 claims description 36
- 239000007864 aqueous solution Substances 0.000 claims description 24
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 14
- 239000000126 substance Substances 0.000 claims description 11
- 229910021529 ammonia Inorganic materials 0.000 claims description 7
- 229940100892 mercury compound Drugs 0.000 claims description 7
- 150000002731 mercury compounds Chemical class 0.000 claims description 7
- 239000000654 additive Substances 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 230000000996 additive effect Effects 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- 150000008049 diazo compounds Chemical class 0.000 claims description 4
- 150000002736 metal compounds Chemical class 0.000 claims description 4
- 206010070834 Sensitisation Diseases 0.000 claims description 3
- 230000008313 sensitization Effects 0.000 claims description 3
- 239000003638 chemical reducing agent Substances 0.000 claims description 2
- 150000001989 diazonium salts Chemical class 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims 2
- 238000007323 disproportionation reaction Methods 0.000 claims 1
- 238000011065 in-situ storage Methods 0.000 claims 1
- 230000003647 oxidation Effects 0.000 claims 1
- 238000007254 oxidation reaction Methods 0.000 claims 1
- 239000000047 product Substances 0.000 claims 1
- 238000010517 secondary reaction Methods 0.000 claims 1
- 239000000243 solution Substances 0.000 description 107
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 35
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 32
- 239000000975 dye Substances 0.000 description 30
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 229910001961 silver nitrate Inorganic materials 0.000 description 18
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 14
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 14
- 235000002906 tartaric acid Nutrition 0.000 description 14
- 239000011975 tartaric acid Substances 0.000 description 14
- 239000000123 paper Substances 0.000 description 13
- 239000012153 distilled water Substances 0.000 description 12
- 239000010410 layer Substances 0.000 description 12
- 239000003086 colorant Substances 0.000 description 11
- -1 potassium ferricyanide Chemical compound 0.000 description 9
- 238000002791 soaking Methods 0.000 description 9
- 239000011550 stock solution Substances 0.000 description 8
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 7
- 238000002156 mixing Methods 0.000 description 7
- 229910052709 silver Inorganic materials 0.000 description 7
- 239000004332 silver Substances 0.000 description 7
- 238000005755 formation reaction Methods 0.000 description 6
- 229910052753 mercury Inorganic materials 0.000 description 6
- 229910002651 NO3 Inorganic materials 0.000 description 5
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 229920002301 cellulose acetate Polymers 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- PFWLKSROSIDDNA-UHFFFAOYSA-N 4-N,4-N-dimethylbenzene-1,4-diamine nitric acid Chemical compound [N+](=O)(O)[O-].CN(C1=CC=C(C=C1)N)C PFWLKSROSIDDNA-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 4
- 229940092714 benzenesulfonic acid Drugs 0.000 description 4
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 4
- 229910001987 mercury nitrate Inorganic materials 0.000 description 4
- XEBWQGVWTUSTLN-UHFFFAOYSA-M phenylmercury acetate Chemical compound CC(=O)O[Hg]C1=CC=CC=C1 XEBWQGVWTUSTLN-UHFFFAOYSA-M 0.000 description 4
- 239000001044 red dye Substances 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- XHQBIYCRFVVHFD-UHFFFAOYSA-N 1-benzothiophen-3-ol Chemical group C1=CC=C2C(O)=CSC2=C1 XHQBIYCRFVVHFD-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- 230000001476 alcoholic effect Effects 0.000 description 3
- 239000001045 blue dye Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000001046 green dye Substances 0.000 description 3
- NGYIMTKLQULBOO-UHFFFAOYSA-L mercury dibromide Chemical compound Br[Hg]Br NGYIMTKLQULBOO-UHFFFAOYSA-L 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- DRXYRSRECMWYAV-UHFFFAOYSA-N nitrooxymercury Chemical compound [Hg+].[O-][N+]([O-])=O DRXYRSRECMWYAV-UHFFFAOYSA-N 0.000 description 3
- 229910000510 noble metal Inorganic materials 0.000 description 3
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 3
- 239000010970 precious metal Substances 0.000 description 3
- 239000004627 regenerated cellulose Substances 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 3
- 235000019345 sodium thiosulphate Nutrition 0.000 description 3
- ZEYKLMDPUOVUCR-UHFFFAOYSA-N 2-chloro-5-(trifluoromethyl)benzenesulfonyl chloride Chemical compound FC(F)(F)C1=CC=C(Cl)C(S(Cl)(=O)=O)=C1 ZEYKLMDPUOVUCR-UHFFFAOYSA-N 0.000 description 2
- QNGVNLMMEQUVQK-UHFFFAOYSA-N 4-n,4-n-diethylbenzene-1,4-diamine Chemical compound CCN(CC)C1=CC=C(N)C=C1 QNGVNLMMEQUVQK-UHFFFAOYSA-N 0.000 description 2
- 229910000497 Amalgam Inorganic materials 0.000 description 2
- 229920002284 Cellulose triacetate Polymers 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- AKOJTNQYOAONRM-UHFFFAOYSA-N benzene-1,4-diamine;nitric acid Chemical compound O[N+]([O-])=O.NC1=CC=C(N)C=C1 AKOJTNQYOAONRM-UHFFFAOYSA-N 0.000 description 2
- 239000001049 brown dye Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- PCKPVGOLPKLUHR-UHFFFAOYSA-N indoxyl Chemical group C1=CC=C2C(O)=CNC2=C1 PCKPVGOLPKLUHR-UHFFFAOYSA-N 0.000 description 2
- 235000014655 lactic acid Nutrition 0.000 description 2
- 239000004310 lactic acid Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 239000001048 orange dye Substances 0.000 description 2
- RMVRSNDYEFQCLF-UHFFFAOYSA-N phenyl mercaptan Natural products SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 2
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- 239000001047 purple dye Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 230000001235 sensitizing effect Effects 0.000 description 2
- 229940100890 silver compound Drugs 0.000 description 2
- 150000003379 silver compounds Chemical class 0.000 description 2
- 230000004304 visual acuity Effects 0.000 description 2
- 239000001043 yellow dye Substances 0.000 description 2
- ZRHUHDUEXWHZMA-UHFFFAOYSA-N 1,4-dihydropyrazol-5-one Chemical compound O=C1CC=NN1 ZRHUHDUEXWHZMA-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- UERKTBSAPLOJRQ-UHFFFAOYSA-N 1-amino-1-phenylurea Chemical compound NC(=O)N(N)C1=CC=CC=C1 UERKTBSAPLOJRQ-UHFFFAOYSA-N 0.000 description 1
- RBTBFTRPCNLSDE-UHFFFAOYSA-N 3,7-bis(dimethylamino)phenothiazin-5-ium Chemical compound C1=CC(N(C)C)=CC2=[S+]C3=CC(N(C)C)=CC=C3N=C21 RBTBFTRPCNLSDE-UHFFFAOYSA-N 0.000 description 1
- MESJRHHDBDCQTH-UHFFFAOYSA-N 3-(dimethylamino)phenol Chemical compound CN(C)C1=CC=CC(O)=C1 MESJRHHDBDCQTH-UHFFFAOYSA-N 0.000 description 1
- CWLKGDAVCFYWJK-UHFFFAOYSA-N 3-aminophenol Chemical compound NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 description 1
- 229940018563 3-aminophenol Drugs 0.000 description 1
- OPXYNEYEDHAXOM-UHFFFAOYSA-N 3-oxobutanenitrile Chemical compound CC(=O)CC#N OPXYNEYEDHAXOM-UHFFFAOYSA-N 0.000 description 1
- OHYPPUOVSUINHM-UHFFFAOYSA-N 4-(methylamino)phenol;sulfuric acid Chemical compound OS(O)(=O)=O.CNC1=CC=C(O)C=C1 OHYPPUOVSUINHM-UHFFFAOYSA-N 0.000 description 1
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 1
- 239000005725 8-Hydroxyquinoline Substances 0.000 description 1
- 241000212814 Alosa caspia Species 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- GKKZMYDNDDMXSE-UHFFFAOYSA-N Ethyl 3-oxo-3-phenylpropanoate Chemical compound CCOC(=O)CC(=O)C1=CC=CC=C1 GKKZMYDNDDMXSE-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 206010034972 Photosensitivity reaction Diseases 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- 239000004133 Sodium thiosulphate Substances 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- VBIXEXWLHSRNKB-UHFFFAOYSA-N ammonium oxalate Chemical compound [NH4+].[NH4+].[O-]C(=O)C([O-])=O VBIXEXWLHSRNKB-UHFFFAOYSA-N 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 238000012822 chemical development Methods 0.000 description 1
- 229940089960 chloroacetate Drugs 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 230000035622 drinking Effects 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- AMANDCZTVNQSNB-UHFFFAOYSA-N glyoxamide Chemical compound NC(=O)C=O AMANDCZTVNQSNB-UHFFFAOYSA-N 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- DCYOBGZUOMKFPA-UHFFFAOYSA-N iron(2+);iron(3+);octadecacyanide Chemical compound [Fe+2].[Fe+2].[Fe+2].[Fe+3].[Fe+3].[Fe+3].[Fe+3].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] DCYOBGZUOMKFPA-UHFFFAOYSA-N 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 229960000907 methylthioninium chloride Drugs 0.000 description 1
- 150000005002 naphthylamines Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229960003540 oxyquinoline Drugs 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- IYDGMDWEHDFVQI-UHFFFAOYSA-N phosphoric acid;trioxotungsten Chemical compound O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.OP(O)(O)=O IYDGMDWEHDFVQI-UHFFFAOYSA-N 0.000 description 1
- 230000036211 photosensitivity Effects 0.000 description 1
- 238000005554 pickling Methods 0.000 description 1
- RWPGFSMJFRPDDP-UHFFFAOYSA-L potassium metabisulfite Chemical compound [K+].[K+].[O-]S(=O)S([O-])(=O)=O RWPGFSMJFRPDDP-UHFFFAOYSA-L 0.000 description 1
- 229940043349 potassium metabisulfite Drugs 0.000 description 1
- 235000010263 potassium metabisulphite Nutrition 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- 239000002964 rayon Substances 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 1
- 239000008399 tap water Substances 0.000 description 1
- 235000020679 tap water Nutrition 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- SWGJCIMEBVHMTA-UHFFFAOYSA-K trisodium;6-oxido-4-sulfo-5-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate Chemical compound [Na+].[Na+].[Na+].C1=CC=C2C(N=NC3=C4C(=CC(=CC4=CC=C3O)S([O-])(=O)=O)S([O-])(=O)=O)=CC=C(S([O-])(=O)=O)C2=C1 SWGJCIMEBVHMTA-UHFFFAOYSA-K 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/52—Compositions containing diazo compounds as photosensitive substances
- G03C1/62—Metal compounds reducible to metal
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Photosensitive Polymer And Photoresist Processing (AREA)
- Polymerisation Methods In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL153804 | 1950-05-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE929171C true DE929171C (de) | 1955-06-20 |
Family
ID=19750496
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEN3941A Expired DE929171C (de) | 1950-05-26 | 1951-05-23 | Verfahren und Material zum Herstellen farbiger photographischer Bilder |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2750292A (enExample) |
| BE (1) | BE503489A (enExample) |
| CH (1) | CH301839A (enExample) |
| DE (1) | DE929171C (enExample) |
| FR (1) | FR1044725A (enExample) |
| GB (1) | GB735424A (enExample) |
| NL (1) | NL85806C (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2929709A (en) * | 1951-07-10 | 1960-03-22 | Philips Corp | Photographic process |
| BE531295A (enExample) * | 1953-08-21 | |||
| NL241541A (enExample) * | 1959-07-22 | |||
| NL241689A (enExample) * | 1959-07-27 | |||
| BE637400A (enExample) * | 1962-09-14 | |||
| US3390989A (en) * | 1964-04-15 | 1968-07-02 | Itek Corp | Methods of imaging a data storage medium |
| BE720382A (enExample) * | 1967-09-14 | 1969-02-17 | ||
| US3867141A (en) * | 1973-03-05 | 1975-02-18 | Xerox Corp | Photoelectric and electrophotographic pigments comprising derivatives of condensed polycyclic aromatic hydrocarbon aldehydes |
| US4002477A (en) * | 1973-11-28 | 1977-01-11 | Eastman Kodak Company | Diffusion transfer processes and elements using or containing inert transitional metal complex oxidizing agents |
| CN113550156B (zh) * | 2021-02-04 | 2023-04-07 | 浙江金昌特种纸股份有限公司 | 一种染料染色的棕色游龙丝的制备方法 |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE296266C (enExample) * | 1914-02-26 | 1917-02-08 | ||
| US1744642A (en) * | 1925-08-04 | 1930-01-21 | Kondo Kenyu | Manufacture of reproduced diffraction gratings |
| US1794693A (en) * | 1929-07-11 | 1931-03-03 | Joseph Deutsch | Screen employed in photo-engraving and method for making the same |
| NL46296C (enExample) * | 1930-02-05 | |||
| US1933789A (en) * | 1930-03-14 | 1933-11-07 | Eastman Kodak Co | Photographic developer for use at high temperatures |
| GB427732A (en) * | 1933-10-09 | 1935-04-16 | Philips Nv | Improvements in photographic processes and materials therefor |
| BE411530A (enExample) * | 1934-10-10 | |||
| US2150834A (en) * | 1936-02-17 | 1939-03-14 | Philips Nv | Sound record and method of making same |
| BE429591A (enExample) * | 1937-08-09 | |||
| BE444784A (enExample) * | 1939-11-02 | |||
| BE467711A (enExample) * | 1945-02-24 | |||
| US2553500A (en) * | 1946-08-01 | 1951-05-15 | Gen Aniline & Film Corp | Production of photographs in blue-black tones and compositions thereof |
| GB629656A (en) * | 1946-09-12 | 1949-09-26 | Gen Aniline & Film Corp | Process for positive diazo-type and negative metal reproduction images and light-sensitive material therefor |
| US2622025A (en) * | 1947-04-03 | 1952-12-16 | Ilford Ltd | Light-sensitive photographic element and process using it |
| US2497917A (en) * | 1947-10-17 | 1950-02-21 | Eastman Kodak Co | Method of producing direct positive photographs having increased density |
-
0
- NL NL85806D patent/NL85806C/xx active
- BE BE503489D patent/BE503489A/xx unknown
-
1951
- 1951-05-22 US US227564A patent/US2750292A/en not_active Expired - Lifetime
- 1951-05-23 DE DEN3941A patent/DE929171C/de not_active Expired
- 1951-05-23 GB GB12063/51A patent/GB735424A/en not_active Expired
- 1951-05-24 CH CH301839D patent/CH301839A/de unknown
- 1951-05-24 FR FR1044725D patent/FR1044725A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL85806C (enExample) | |
| CH301839A (de) | 1954-09-30 |
| US2750292A (en) | 1956-06-12 |
| BE503489A (enExample) | |
| FR1044725A (fr) | 1953-11-20 |
| GB735424A (en) | 1955-08-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE764572C (de) | Verfahren zur Herstellung von Bildern mit Hilfe von Halogensilber | |
| DE2700651A1 (de) | Photographische silberhalogenidmaterialien mit lichtabsorbierenden farbstoffen | |
| DE1422468B2 (de) | Verfahren zur herstellung von lithographischen druckplatten | |
| DE929171C (de) | Verfahren und Material zum Herstellen farbiger photographischer Bilder | |
| DE1522374C2 (de) | Verfahren zur Herstellung eines direktpositiven photographischen Bildes | |
| DE895247C (de) | Fotografischer Mehrschichtenfarbfilm | |
| DE896297C (de) | Verfahren zur Herstellung von Positiven unmittelbar von Originalen mittels eines Umkehrverfahrens, insbesondere fuer photomechanische Zwecke | |
| DE1422857A1 (de) | Verfahren zum Entwickeln von photographischem Material,insbesondere fuer die Farbphotographie | |
| DE848909C (de) | Photographisches Material und Verfahren zu seiner Verarbeitung | |
| DE1472870C3 (de) | Photographisches Aufzeichnungsmaterial | |
| DE825203C (de) | Verfahren zur Herstellung mehrfarbiger Kopien auf Diazotypieschichten | |
| DE723388C (de) | Verfahren zur direkten Erzeugung eines Naturfarbenbildes | |
| DE1202638B (de) | Photographisches Entwicklungsverfahren zur Herstellung von Farbbildern nach dem Farbentwicklungsverfahren | |
| DE1043806B (de) | Verfahren zur Herstellung eines stabilen Blaubildes in photographischem Farbenentwicklungsmaterial | |
| DE1289739B (de) | Farbumkehrverfahren, bei dem ein mehrschichtiger farbfotografischer Film verwendet wird | |
| DE2453641A1 (de) | Mehrschichtiges farbphotographisches aufzeichnungsmaterial sowie verfahren zur herstellung positiver farbphotographischer bilder | |
| DE2524431A1 (de) | Verfahren zur herstellung eines positiven farbphotographischen bildes | |
| DE851720C (de) | Verfahren zur Herstellung von Farbenphotographien | |
| DE1813713C3 (de) | Verfahren zur Herstellung von Diazotypie-Zwischenoriginalen | |
| DE965614C (de) | Verfahren zur Herstellung mehrfarbiger photographischer Bilder | |
| DE659720C (de) | Verfahren zur Herstellung von Mehrfarbenbildern auf der Grundlage von Mehrschichtenfilmen | |
| DE69213715T2 (de) | Verfahren zur herstellung von stabilen farbphotographischen abzügen | |
| AT247717B (de) | Verfahren zur Herstellung farbiger Bilder nach der Silberfarbbleichmethode | |
| DE1422468C (de) | Verfahren zur Herstellung von htho graphischen Druckplatten | |
| DE830611C (de) | Verfahren zur Erzeugung von Masken in farbenphotographischen Materialien |