DE902582C - Verfahren zum Entwickeln eines Farbbildes in einer Silberhalogenid-Emulsionsschicht - Google Patents
Verfahren zum Entwickeln eines Farbbildes in einer Silberhalogenid-EmulsionsschichtInfo
- Publication number
- DE902582C DE902582C DEE2173A DEE0002173A DE902582C DE 902582 C DE902582 C DE 902582C DE E2173 A DEE2173 A DE E2173A DE E0002173 A DEE0002173 A DE E0002173A DE 902582 C DE902582 C DE 902582C
- Authority
- DE
- Germany
- Prior art keywords
- color
- emulsion layer
- developing
- following formula
- silver halide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000839 emulsion Substances 0.000 title claims description 11
- -1 silver halide Chemical class 0.000 title claims description 10
- 238000000034 method Methods 0.000 title claims description 9
- 229910052709 silver Inorganic materials 0.000 title claims description 4
- 239000004332 silver Substances 0.000 title claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 claims description 3
- 229940124530 sulfonamide Drugs 0.000 claims description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 2
- 150000003456 sulfonamides Chemical group 0.000 claims 2
- 150000004780 naphthols Chemical class 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 11
- 239000000243 solution Substances 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 150000002989 phenols Chemical class 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical class NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 1
- XBTWVJKPQPQTDW-UHFFFAOYSA-N 4-n,4-n-diethyl-2-methylbenzene-1,4-diamine Chemical compound CCN(CC)C1=CC=C(N)C(C)=C1 XBTWVJKPQPQTDW-UHFFFAOYSA-N 0.000 description 1
- QNGVNLMMEQUVQK-UHFFFAOYSA-N 4-n,4-n-diethylbenzene-1,4-diamine Chemical compound CCN(CC)C1=CC=C(N)C=C1 QNGVNLMMEQUVQK-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- BZORFPDSXLZWJF-UHFFFAOYSA-N N,N-dimethyl-1,4-phenylenediamine Chemical compound CN(C)C1=CC=C(N)C=C1 BZORFPDSXLZWJF-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000000873 masking effect Effects 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 150000004986 phenylenediamines Chemical class 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C7/00—Multicolour photographic processes or agents therefor; Regeneration of such processing agents; Photosensitive materials for multicolour processes
- G03C7/30—Colour processes using colour-coupling substances; Materials therefor; Preparing or processing such materials
- G03C7/32—Colour coupling substances
- G03C7/333—Coloured coupling substances, e.g. for the correction of the coloured image
- G03C7/3335—Coloured coupling substances, e.g. for the correction of the coloured image containing an azo chromophore
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US533931A US2455169A (en) | 1944-05-03 | 1944-05-03 | Colored couplers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE902582C true DE902582C (de) | 1954-01-25 |
Family
ID=24128024
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEE2173A Expired DE902582C (de) | 1944-05-03 | 1950-09-22 | Verfahren zum Entwickeln eines Farbbildes in einer Silberhalogenid-Emulsionsschicht |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2455169A (enExample) |
| BE (1) | BE476360A (enExample) |
| CH (2) | CH280513A (enExample) |
| DE (1) | DE902582C (enExample) |
| ES (1) | ES181502A1 (enExample) |
| FR (1) | FR950286A (enExample) |
| NL (1) | NL71530C (enExample) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL79214C (enExample) * | 1946-08-21 | |||
| BE480525A (enExample) * | 1947-03-13 | |||
| US2725291A (en) * | 1952-05-01 | 1955-11-29 | Eastman Kodak Co | Azo dye couplers having two coupling nuclei |
| US2725292A (en) * | 1952-05-15 | 1955-11-29 | Eastman Kodak Co | Colored couplers containing solubilizing groups |
| BE619300A (enExample) * | 1959-04-06 | |||
| US3148062A (en) * | 1959-04-06 | 1964-09-08 | Eastman Kodak Co | Photographic elements and processes using splittable couplers |
| US3227550A (en) * | 1962-09-07 | 1966-01-04 | Eastman Kodak Co | Photographic color reproduction process and element |
| US3625919A (en) * | 1967-02-10 | 1971-12-07 | Hiroyoshi Kamogawa | Process for the preparation of diazotized vinylphenol polymers having phototropic properties |
| GB1222444A (en) * | 1967-05-15 | 1971-02-10 | Ferrania Spa | Compounds useful as magenta-coloured couplers in colour photography |
| LU67859A1 (enExample) * | 1973-06-22 | 1975-03-27 | ||
| LU68988A1 (enExample) * | 1973-12-12 | 1975-08-20 | ||
| DE3161758D1 (en) * | 1980-04-30 | 1984-02-02 | Ciba Geigy Ag | Colour photopgraphic material for the silver-dye bleaching process, process for the production of this material and its use in the production of photographic images |
| JPH0619551B2 (ja) * | 1986-02-24 | 1994-03-16 | 富士写真フイルム株式会社 | 感光材料 |
| US4871655A (en) * | 1987-01-16 | 1989-10-03 | Konica Corporation | Light-sensitive silver halide color photographic material containing multi-functional dye |
| US4777120A (en) * | 1987-05-18 | 1988-10-11 | Eastman Kodak Company | Photographic element and process comprising a masking coupler |
| JPH08101477A (ja) | 1994-08-01 | 1996-04-16 | Eastman Kodak Co | 水性写真用コーティング組成物 |
| US5681691A (en) | 1995-12-11 | 1997-10-28 | Eastman Kodak Company | Photographic element containing an improved pyrazolotriazole coupler |
| US7611829B2 (en) | 2004-01-30 | 2009-11-03 | Fujifilm Corporation | Silver halide color photographic light-sensitive material and color image-forming method |
| US20130052594A1 (en) | 2011-08-31 | 2013-02-28 | Diane M. Carroll-Yacoby | Motion picture films to provide archival images |
| CN114933818B (zh) * | 2022-06-28 | 2024-01-16 | 绍兴文理学院 | 一种吲哚啉分散染料及其制备方法 |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2135366A (en) * | 1938-11-01 | Naphthazarine intermediate-aro | ||
| US2107941A (en) * | 1938-02-08 | Fast brown leather dyesttjffs and a | ||
| US1102028A (en) * | 1913-01-27 | 1914-06-30 | Rudolf Fischer | Process of making colored photographs. |
| NL41202C (enExample) * | 1934-12-15 | 1900-01-01 | ||
| GB458664A (en) * | 1935-03-21 | 1936-12-21 | Eastman Kodak Co | Improvements in and relating to colour forming developers and processes of colour development |
| FR834371A (fr) * | 1936-07-07 | 1938-11-18 | Kodak Pathe | Perfectionnements à la photographie en couleurs naturelles par développement en plusieurs couleurs |
| GB503824A (en) * | 1936-07-07 | 1939-04-11 | Kodak Ltd | Process of colour photography |
| US2227981A (en) * | 1937-10-22 | 1941-01-07 | Eastman Kodak Co | Method of preparation of natural color pictures |
| US2263012A (en) * | 1937-12-23 | 1941-11-18 | Eastman Kodak Co | Process for making natural color photographs |
| BE436514A (enExample) * | 1938-10-01 | |||
| GB524558A (en) * | 1938-10-26 | 1940-08-08 | Kodak Ltd | Improvements in and relating to photographic materials and the processing thereof |
| US2182814A (en) * | 1938-12-12 | 1939-12-12 | Du Pont Film Mfg Corp | Photographic film |
| US2189817A (en) * | 1939-03-13 | 1940-02-13 | Du Pont Film Mfg Corp | Color-forming photographic composition, element, and process |
| US2271230A (en) * | 1939-09-07 | 1942-01-27 | Eastman Kodak Co | Sulphonamides of dyes |
| US2330291A (en) * | 1939-10-24 | 1943-09-28 | Du Pont | Dye intermediate |
| US2304820A (en) * | 1939-10-24 | 1942-12-15 | Du Pont | Substituted monoamides of aliphatic dibasic acids |
| US2299641A (en) * | 1939-12-26 | 1942-10-20 | Du Pont | Processes of color photography and compositions and elements therefor |
| US2322006A (en) * | 1939-12-29 | 1943-06-15 | Eastman Kodak Co | Photographic filter and antihalation layer |
| GB540636A (en) * | 1940-03-12 | 1941-10-23 | Eastman Kodak Co | Improvements relating to coupling components for use in colour photography |
| US2295009A (en) * | 1940-03-12 | 1942-09-08 | Eastman Kodak Co | Photographic color forming compound |
| US2297732A (en) * | 1940-05-15 | 1942-10-06 | Du Pont | Photographic color process involving the formation of azo dye images |
| US2367531A (en) * | 1942-06-12 | 1945-01-16 | Eastman Kodak Co | Acylaminophenol photographic couplers |
-
0
- BE BE476360D patent/BE476360A/xx unknown
- NL NL71530D patent/NL71530C/xx active
-
1944
- 1944-05-03 US US533931A patent/US2455169A/en not_active Expired - Lifetime
-
1946
- 1946-08-29 FR FR950286D patent/FR950286A/fr not_active Expired
-
1947
- 1947-12-23 CH CH280513D patent/CH280513A/fr unknown
- 1947-12-23 CH CH282410D patent/CH282410A/fr unknown
- 1947-12-31 ES ES0181502A patent/ES181502A1/es not_active Expired
-
1950
- 1950-09-22 DE DEE2173A patent/DE902582C/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BE476360A (enExample) | |
| US2455169A (en) | 1948-11-30 |
| CH280513A (fr) | 1952-01-31 |
| CH282410A (fr) | 1952-04-30 |
| FR950286A (fr) | 1949-09-22 |
| NL71530C (enExample) | |
| ES181502A1 (es) | 1948-04-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE902582C (de) | Verfahren zum Entwickeln eines Farbbildes in einer Silberhalogenid-Emulsionsschicht | |
| DE1547803A1 (de) | Verwendung von nicht diffundierenden Farbkupplerverbindungen zur Farbentwicklung photographischer Materialien | |
| DE837959C (de) | Photographischer Entwickler, insbesondere zur Erzeugung von Phenazonium-Farbstoffbildern | |
| DE2362752C2 (de) | Einen photographischen Entwicklungsinhibitor abspaltende Verbindung und ihre Verwendung | |
| DE964654C (de) | Photographisches Material mit einer ultraviolettabsorbierenden Schicht | |
| DE1236332B (de) | Verfahren zur Herstellung von gelben Farbbildern in photographischen Schichten | |
| DE1181057B (de) | Farbkuppler fuer Purpur und Blaugruen enthaltendes photographisches Material | |
| DE1000233B (de) | Farbenphotographisches Material mit mindestens einer photographischen, einen alkoxylierten Benzoylacetanilidkuppler enthaltenden Halogensilberemulsion | |
| DE2248906A1 (de) | Farbphotographisches entwicklungsverfahren und farbentwickler zur durchfuehrung des verfahrens | |
| DE837958C (de) | Verfahren zur Herstellung von Azomethin-Farbstoffbildern durch farbgebende Entwicklung | |
| DE1254463B (de) | Farbphotographisches Material | |
| DE827900C (de) | Entwickler fuer Schwarz-Weiss- und insbesondere fuer Farbenfotografie | |
| DE1124349B (de) | Verfahren zur Sensibilisierung photographischer Emulsionen und zugehoerige sensibilisierte Emulsion | |
| DE1124356B (de) | Verfahren zum photographischen Farb-Entwickeln | |
| DE848154C (de) | Verfahren zum Entwickeln eines Farbbildes in einer Silber-halogen-Emulsionsschicht, insbesondere einer Gelatine-Silberhalogen-Emulsionsschicht | |
| DE69328335T2 (de) | Verfahren zur Herstellung eines photographischen Farbbildes | |
| DE2734148B2 (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE968641C (de) | Verfahren zur Herstellung von farbwertkorrigierten Farbenteilbildern in farbenphotographischen Halogensilberemulsionen | |
| DE892860C (de) | Halogensilberemulsionen fuer das Silber-Azofarbstoff-Ausbleichverfahren | |
| DE1109523B (de) | Verfahren zur Herstellung von photographischen Farbbildern | |
| DE1282457B (de) | Farbphotographisches Aufzeichnungsmaterial | |
| DE1157483B (de) | Verfahren zur Herstellung gelber Farbbilder mit Hilfe der farbgebenden Entwicklung und lichtempfindliche Silberhalogenidemulsion hierfuer | |
| DE885197C (de) | Verfahren zur Herstellung von purpurfarbigen photographischen Bildern in Halogen-Gelatine-Emulsionsschichten durch farbbildende Entwicklung | |
| DE1962574C3 (de) | Farbfotografisches Aufzeichnungsmaterial | |
| DE2133655C3 (de) | Farbphotographisches Aufzeichnungsmaterial |