DE842407C - Verfahren zur Herstellung von Polymeren - Google Patents
Verfahren zur Herstellung von PolymerenInfo
- Publication number
- DE842407C DE842407C DEN124A DEN0000124A DE842407C DE 842407 C DE842407 C DE 842407C DE N124 A DEN124 A DE N124A DE N0000124 A DEN0000124 A DE N0000124A DE 842407 C DE842407 C DE 842407C
- Authority
- DE
- Germany
- Prior art keywords
- parts
- polymers
- vinyl
- polymer
- preformed
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000642 polymer Polymers 0.000 title claims description 135
- 238000000034 method Methods 0.000 title claims description 60
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 239000000203 mixture Substances 0.000 claims description 47
- 239000000178 monomer Substances 0.000 claims description 41
- 150000001875 compounds Chemical class 0.000 claims description 32
- 229920003229 poly(methyl methacrylate) Polymers 0.000 claims description 23
- 239000004926 polymethyl methacrylate Substances 0.000 claims description 23
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 14
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 claims description 13
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 claims description 13
- 238000011282 treatment Methods 0.000 claims description 12
- 229920002367 Polyisobutene Polymers 0.000 claims description 11
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 claims description 8
- 230000015572 biosynthetic process Effects 0.000 claims description 5
- GBURUDXSBYGPBL-UHFFFAOYSA-N 2,2,3-trimethylhexanedioic acid Chemical compound OC(=O)C(C)(C)C(C)CCC(O)=O GBURUDXSBYGPBL-UHFFFAOYSA-N 0.000 claims description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 3
- 239000007859 condensation product Substances 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims 1
- 150000004985 diamines Chemical class 0.000 claims 1
- 229920001577 copolymer Polymers 0.000 description 59
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 25
- -1 persalts Chemical class 0.000 description 24
- 238000006116 polymerization reaction Methods 0.000 description 23
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 18
- 239000002253 acid Substances 0.000 description 17
- 229920003214 poly(methacrylonitrile) Polymers 0.000 description 17
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 15
- 229920001567 vinyl ester resin Polymers 0.000 description 14
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 description 13
- 239000004793 Polystyrene Substances 0.000 description 12
- 150000007513 acids Chemical class 0.000 description 12
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 12
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 11
- 229910052760 oxygen Inorganic materials 0.000 description 11
- 239000001301 oxygen Substances 0.000 description 11
- 229920002223 polystyrene Polymers 0.000 description 11
- 229920002554 vinyl polymer Polymers 0.000 description 11
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 10
- 239000003054 catalyst Substances 0.000 description 10
- 229920001519 homopolymer Polymers 0.000 description 10
- 229920002239 polyacrylonitrile Polymers 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- 229920000915 polyvinyl chloride Polymers 0.000 description 9
- 239000004800 polyvinyl chloride Substances 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 239000007795 chemical reaction product Substances 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 7
- 150000001253 acrylic acids Chemical class 0.000 description 7
- 230000015556 catabolic process Effects 0.000 description 7
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 6
- 238000007334 copolymerization reaction Methods 0.000 description 6
- 238000006731 degradation reaction Methods 0.000 description 6
- 150000002894 organic compounds Chemical class 0.000 description 6
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 150000002763 monocarboxylic acids Chemical class 0.000 description 5
- JLIDVCMBCGBIEY-UHFFFAOYSA-N 1-penten-3-one Chemical compound CCC(=O)C=C JLIDVCMBCGBIEY-UHFFFAOYSA-N 0.000 description 4
- JESXATFQYMPTNL-UHFFFAOYSA-N 2-ethenylphenol Chemical compound OC1=CC=CC=C1C=C JESXATFQYMPTNL-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 4
- 229920002319 Poly(methyl acrylate) Polymers 0.000 description 4
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 4
- 229920002678 cellulose Polymers 0.000 description 4
- FJKIXWOMBXYWOQ-UHFFFAOYSA-N ethenoxyethane Chemical compound CCOC=C FJKIXWOMBXYWOQ-UHFFFAOYSA-N 0.000 description 4
- MEGHWIAOTJPCHQ-UHFFFAOYSA-N ethenyl butanoate Chemical compound CCCC(=O)OC=C MEGHWIAOTJPCHQ-UHFFFAOYSA-N 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000004014 plasticizer Substances 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- SXZSFWHOSHAKMN-UHFFFAOYSA-N 2,3,4,4',5-Pentachlorobiphenyl Chemical compound C1=CC(Cl)=CC=C1C1=CC(Cl)=C(Cl)C(Cl)=C1Cl SXZSFWHOSHAKMN-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- TVONJMOVBKMLOM-UHFFFAOYSA-N 2-methylidenebutanenitrile Chemical compound CCC(=C)C#N TVONJMOVBKMLOM-UHFFFAOYSA-N 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- 239000001856 Ethyl cellulose Substances 0.000 description 3
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 3
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 3
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 3
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 3
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 3
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 3
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- YACLQRRMGMJLJV-UHFFFAOYSA-N chloroprene Chemical compound ClC(=C)C=C YACLQRRMGMJLJV-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- XJELOQYISYPGDX-UHFFFAOYSA-N ethenyl 2-chloroacetate Chemical compound ClCC(=O)OC=C XJELOQYISYPGDX-UHFFFAOYSA-N 0.000 description 3
- FFYWKOUKJFCBAM-UHFFFAOYSA-N ethenyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OC=C FFYWKOUKJFCBAM-UHFFFAOYSA-N 0.000 description 3
- BLCTWBJQROOONQ-UHFFFAOYSA-N ethenyl prop-2-enoate Chemical compound C=COC(=O)C=C BLCTWBJQROOONQ-UHFFFAOYSA-N 0.000 description 3
- 229920001249 ethyl cellulose Polymers 0.000 description 3
- 235000019325 ethyl cellulose Nutrition 0.000 description 3
- 230000001976 improved effect Effects 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 230000000379 polymerizing effect Effects 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000000523 sample Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical group C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N 1-ethenoxybutane Chemical compound CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- OYLCUJRJCUXQBQ-UHFFFAOYSA-N 1-hepten-3-one Chemical compound CCCCC(=O)C=C OYLCUJRJCUXQBQ-UHFFFAOYSA-N 0.000 description 2
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 description 2
- CISIJYCKDJSTMX-UHFFFAOYSA-N 2,2-dichloroethenylbenzene Chemical compound ClC(Cl)=CC1=CC=CC=C1 CISIJYCKDJSTMX-UHFFFAOYSA-N 0.000 description 2
- FEUFEGJTJIHPOF-UHFFFAOYSA-N 2-butyl acrylic acid Chemical compound CCCCC(=C)C(O)=O FEUFEGJTJIHPOF-UHFFFAOYSA-N 0.000 description 2
- ZXABMDQSAABDMG-UHFFFAOYSA-N 3-ethenoxyprop-1-ene Chemical compound C=CCOC=C ZXABMDQSAABDMG-UHFFFAOYSA-N 0.000 description 2
- FKWUKKNHLHTXJE-UHFFFAOYSA-N 5-o-ethenyl 1-o-methyl pentanedioate Chemical compound COC(=O)CCCC(=O)OC=C FKWUKKNHLHTXJE-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Natural products OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical class C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 2
- 125000003158 alcohol group Chemical group 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 150000001491 aromatic compounds Chemical class 0.000 description 2
- JZQAAQZDDMEFGZ-UHFFFAOYSA-N bis(ethenyl) hexanedioate Chemical compound C=COC(=O)CCCCC(=O)OC=C JZQAAQZDDMEFGZ-UHFFFAOYSA-N 0.000 description 2
- 239000012496 blank sample Substances 0.000 description 2
- INLLPKCGLOXCIV-UHFFFAOYSA-N bromoethene Chemical compound BrC=C INLLPKCGLOXCIV-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N butadiene group Chemical group C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 150000002009 diols Chemical class 0.000 description 2
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- IYNRVIKPUTZSOR-HWKANZROSA-N ethenyl (e)-but-2-enoate Chemical compound C\C=C\C(=O)OC=C IYNRVIKPUTZSOR-HWKANZROSA-N 0.000 description 2
- UIWXSTHGICQLQT-UHFFFAOYSA-N ethenyl propanoate Chemical compound CCC(=O)OC=C UIWXSTHGICQLQT-UHFFFAOYSA-N 0.000 description 2
- 229920006158 high molecular weight polymer Polymers 0.000 description 2
- 230000000977 initiatory effect Effects 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000005394 methallyl group Chemical group 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- UCUUFSAXZMGPGH-UHFFFAOYSA-N penta-1,4-dien-3-one Chemical class C=CC(=O)C=C UCUUFSAXZMGPGH-UHFFFAOYSA-N 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- WLJVNTCWHIRURA-UHFFFAOYSA-M pimelate(1-) Chemical compound OC(=O)CCCCCC([O-])=O WLJVNTCWHIRURA-UHFFFAOYSA-M 0.000 description 2
- PMJHHCWVYXUKFD-UHFFFAOYSA-N piperylene Natural products CC=CC=C PMJHHCWVYXUKFD-UHFFFAOYSA-N 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 239000011118 polyvinyl acetate Substances 0.000 description 2
- 229920002689 polyvinyl acetate Polymers 0.000 description 2
- 239000005033 polyvinylidene chloride Substances 0.000 description 2
- PNXMTCDJUBJHQJ-UHFFFAOYSA-N propyl prop-2-enoate Chemical compound CCCOC(=O)C=C PNXMTCDJUBJHQJ-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- KOZCZZVUFDCZGG-UHFFFAOYSA-N vinyl benzoate Chemical compound C=COC(=O)C1=CC=CC=C1 KOZCZZVUFDCZGG-UHFFFAOYSA-N 0.000 description 2
- BVIUYHQPSZOHOV-UHFFFAOYSA-N 1,1-dichloroethene;2-methylprop-2-enoic acid Chemical compound ClC(Cl)=C.CC(=C)C(O)=O BVIUYHQPSZOHOV-UHFFFAOYSA-N 0.000 description 1
- STWZWUFRTQEEMW-UHFFFAOYSA-N 1,1-dichloroethene;prop-2-enoic acid Chemical compound ClC(Cl)=C.OC(=O)C=C STWZWUFRTQEEMW-UHFFFAOYSA-N 0.000 description 1
- VFRMAHVDXYSEON-UHFFFAOYSA-N 1,1-diiodoethene Chemical compound IC(I)=C VFRMAHVDXYSEON-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- PIGJZPZYWKFDBR-UHFFFAOYSA-N 2,5-dimethyl-1-(4-methylpyridin-2-yl)pyrrole-3-carbaldehyde Chemical compound CC1=CC(C=O)=C(C)N1C1=CC(C)=CC=N1 PIGJZPZYWKFDBR-UHFFFAOYSA-N 0.000 description 1
- VSGKEWJNJIONGY-UHFFFAOYSA-N 2-methylprop-2-enenitrile;prop-2-enoic acid Chemical compound CC(=C)C#N.OC(=O)C=C VSGKEWJNJIONGY-UHFFFAOYSA-N 0.000 description 1
- OHXAOPZTJOUYKM-UHFFFAOYSA-N 3-Chloro-2-methylpropene Chemical compound CC(=C)CCl OHXAOPZTJOUYKM-UHFFFAOYSA-N 0.000 description 1
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- RMZIOVJHUJAAEY-UHFFFAOYSA-N Allyl butyrate Chemical compound CCCC(=O)OCC=C RMZIOVJHUJAAEY-UHFFFAOYSA-N 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- DQEFEBPAPFSJLV-UHFFFAOYSA-N Cellulose propionate Chemical compound CCC(=O)OCC1OC(OC(=O)CC)C(OC(=O)CC)C(OC(=O)CC)C1OC1C(OC(=O)CC)C(OC(=O)CC)C(OC(=O)CC)C(COC(=O)CC)O1 DQEFEBPAPFSJLV-UHFFFAOYSA-N 0.000 description 1
- IEPRKVQEAMIZSS-UHFFFAOYSA-N Di-Et ester-Fumaric acid Natural products CCOC(=O)C=CC(=O)OCC IEPRKVQEAMIZSS-UHFFFAOYSA-N 0.000 description 1
- 239000004641 Diallyl-phthalate Substances 0.000 description 1
- IEPRKVQEAMIZSS-WAYWQWQTSA-N Diethyl maleate Chemical compound CCOC(=O)\C=C/C(=O)OCC IEPRKVQEAMIZSS-WAYWQWQTSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical group C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229920001756 Polyvinyl chloride acetate Polymers 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- TXAHPQBGJGJQME-UHFFFAOYSA-N acetaldehyde;phenol Chemical compound CC=O.OC1=CC=CC=C1 TXAHPQBGJGJQME-UHFFFAOYSA-N 0.000 description 1
- 238000012644 addition polymerization Methods 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- QUDWYFHPNIMBFC-UHFFFAOYSA-N bis(prop-2-enyl) benzene-1,2-dicarboxylate Chemical compound C=CCOC(=O)C1=CC=CC=C1C(=O)OCC=C QUDWYFHPNIMBFC-UHFFFAOYSA-N 0.000 description 1
- HABAXTXIECRCKH-UHFFFAOYSA-N bis(prop-2-enyl) butanedioate Chemical compound C=CCOC(=O)CCC(=O)OCC=C HABAXTXIECRCKH-UHFFFAOYSA-N 0.000 description 1
- FPODCVUTIPDRTE-UHFFFAOYSA-N bis(prop-2-enyl) hexanedioate Chemical compound C=CCOC(=O)CCCCC(=O)OCC=C FPODCVUTIPDRTE-UHFFFAOYSA-N 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 229920006218 cellulose propionate Polymers 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- DHHPHEAWKZTPAI-UHFFFAOYSA-N chloroethene;2-methylprop-2-enenitrile Chemical compound ClC=C.CC(=C)C#N DHHPHEAWKZTPAI-UHFFFAOYSA-N 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- IEPRKVQEAMIZSS-AATRIKPKSA-N diethyl fumarate Chemical compound CCOC(=O)\C=C\C(=O)OCC IEPRKVQEAMIZSS-AATRIKPKSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- GMSCBRSQMRDRCD-UHFFFAOYSA-N dodecyl 2-methylprop-2-enoate Chemical compound CCCCCCCCCCCCOC(=O)C(C)=C GMSCBRSQMRDRCD-UHFFFAOYSA-N 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- GLVVKKSPKXTQRB-UHFFFAOYSA-N ethenyl dodecanoate Chemical class CCCCCCCCCCCC(=O)OC=C GLVVKKSPKXTQRB-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- XUCNUKMRBVNAPB-UHFFFAOYSA-N fluoroethene Chemical compound FC=C XUCNUKMRBVNAPB-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N formaldehyde Substances O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical compound O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000009775 high-speed stirring Methods 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 238000011031 large-scale manufacturing process Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N n-hexanoic acid Natural products CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- NZIDBRBFGPQCRY-UHFFFAOYSA-N octyl 2-methylprop-2-enoate Chemical compound CCCCCCCCOC(=O)C(C)=C NZIDBRBFGPQCRY-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000009931 pascalization Methods 0.000 description 1
- HVAMZGADVCBITI-UHFFFAOYSA-M pent-4-enoate Chemical compound [O-]C(=O)CCC=C HVAMZGADVCBITI-UHFFFAOYSA-M 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 150000002976 peresters Chemical class 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 229920001485 poly(butyl acrylate) polymer Polymers 0.000 description 1
- 229920005735 poly(methyl vinyl ketone) Polymers 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000120 polyethyl acrylate Polymers 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- 229920005553 polystyrene-acrylate Polymers 0.000 description 1
- 229920002620 polyvinyl fluoride Polymers 0.000 description 1
- QTECDUFMBMSHKR-UHFFFAOYSA-N prop-2-enyl prop-2-enoate Chemical compound C=CCOC(=O)C=C QTECDUFMBMSHKR-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- UBLMWQYLVOVZMT-UHFFFAOYSA-N tert-butyl n-(3-acetylphenyl)carbamate Chemical compound CC(=O)C1=CC=CC(NC(=O)OC(C)(C)C)=C1 UBLMWQYLVOVZMT-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000009210 therapy by ultrasound Methods 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F293/00—Macromolecular compounds obtained by polymerisation on to a macromolecule having groups capable of inducing the formation of new polymer chains bound exclusively at one or both ends of the starting macromolecule
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F291/00—Macromolecular compounds obtained by polymerising monomers on to macromolecular compounds according to more than one of the groups C08F251/00 - C08F289/00
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US286509XA | 1948-11-16 | 1948-11-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE842407C true DE842407C (de) | 1952-06-26 |
Family
ID=21844655
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEN124A Expired DE842407C (de) | 1948-11-16 | 1949-11-04 | Verfahren zur Herstellung von Polymeren |
Country Status (5)
| Country | Link |
|---|---|
| BE (1) | BE492180A (OSRAM) |
| CH (1) | CH286509A (OSRAM) |
| DE (1) | DE842407C (OSRAM) |
| FR (1) | FR999594A (OSRAM) |
| GB (1) | GB679562A (OSRAM) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1012071B (de) * | 1955-02-22 | 1957-07-11 | Courtaulds Ltd | Verfahren zur Herstellung von Blockmischpolymeren |
| DE1104180B (de) * | 1955-12-09 | 1961-04-06 | Natural Rubber Producers | Verfahren zur Herstellung von Pfropf-Mischpolymerisaten |
| DE1245131B (de) * | 1962-12-26 | 1967-07-20 | Dow Chemical Co | Verfahren zur Polymerisation |
Families Citing this family (68)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2899405A (en) * | 1959-08-11 | Polymerization of vinyl chloride or | ||
| US2741650A (en) * | 1951-11-08 | 1956-04-10 | Shawinigan Resins Corp | Styrene-modified polyvinyl acetate resins |
| US2719136A (en) * | 1951-11-29 | 1955-09-27 | Eastman Kodak Co | Compositions from polymerizing acrylonitrile in the presence of maleic anhydride copolymers |
| US2773050A (en) * | 1952-04-30 | 1956-12-04 | Eastman Kodak Co | Water vapor permeable compositions and articles containing a polyacrylic ester and polyvinyl alcohol |
| US2763631A (en) * | 1952-05-23 | 1956-09-18 | Eastman Kodak Co | Acrylonitrile polymers containing vinyl chloride or vinylidene chloride |
| US2794793A (en) * | 1952-10-21 | 1957-06-04 | Eastman Kodak Co | Copolymerization of ethenoid monomers in the presence of polyacrylonitrile |
| US2879253A (en) * | 1954-02-03 | 1959-03-24 | Eastman Kodak Co | Copolymerization of acrylonitrile and another unsaturated monomer, in the presence of preformed homopolymers and products obtained thereby |
| FR1087197A (fr) * | 1952-11-19 | 1955-02-22 | Basf Ag | Procédé de production de polymères |
| US2837496A (en) * | 1952-12-31 | 1958-06-03 | Hercules Powder Co Ltd | Graft copolymers and preparation thereof from polymer hydroperoxides |
| US2713568A (en) * | 1953-03-04 | 1955-07-19 | Firestone Tire & Rubber Co | Stripping vinylidene-vinyl chloride copolymers with aid of alkyl acrylate and product |
| US3062777A (en) * | 1953-04-14 | 1962-11-06 | Union Carbide Corp | Graft copolymers of styrene on butadiene rubbers and method for making same |
| US2784172A (en) * | 1953-04-27 | 1957-03-05 | Monsanto Chemicals | Acrylonitrile copolymers stabilized with acrylic acid salts |
| US2779025A (en) * | 1953-08-27 | 1957-01-29 | Firestone Tire & Rubber Co | New polymeric material containing copolymerized monochlorotrifluoroethylene and an alkyl vinyl ether |
| DE1123476B (de) * | 1953-09-08 | 1962-02-08 | Phil Oliver Wallis Burke Jun D | Verfahren zur Herstellung von unloeslichen, vernetzten Hochpolymeren kolloider Teilchengroesse |
| US2859201A (en) * | 1953-11-09 | 1958-11-04 | Phillips Petroleum Co | Graft-type polymer of conjugated diene and acrylic acid and process of preparation |
| US2830032A (en) * | 1954-01-15 | 1958-04-08 | Basf Ag | Cross-linked copolymers of a polymerizable monomer with an unsaturated copolymer of a vinyl ether and vinyl allyl ether and process for making same |
| US3019208A (en) * | 1954-01-18 | 1962-01-30 | Firestone Tire & Rubber Co | Method of making graft copolymers of vinyl chloride and polyacrylate |
| US2858281A (en) * | 1954-01-22 | 1958-10-28 | Goodrich Co B F | Insoluble, acid and alkali-resistant carboxylic polymers |
| US2879254A (en) * | 1954-02-03 | 1959-03-24 | Eastman Kodak Co | Copolymerization of acrylonitrile and another monomer in the presence of preformed polymers and products obtained thereby |
| US2838470A (en) * | 1954-02-03 | 1958-06-10 | Eastman Kodak Co | Copolymerization of acrylonitrile and another unsaturated monomer in the presence ofpreformed interpolymer |
| BE535395A (OSRAM) * | 1954-02-03 | |||
| US2816087A (en) * | 1954-02-10 | 1957-12-10 | Eastman Kodak Co | Modified polyvinyl alcohol polymers and their preparation |
| NL94817C (OSRAM) * | 1954-03-26 | |||
| US2849419A (en) * | 1954-04-15 | 1958-08-26 | Firestone Tire & Rubber Co | Oriented filaments of graft copolymer of polyacrylate polymerized on vinylidene chloride resin |
| US2886552A (en) * | 1954-06-10 | 1959-05-12 | Diamond Alkali Co | Polymerization employing polyvinyl alkyl ethers as suspension stabilizers |
| US2886551A (en) * | 1954-06-10 | 1959-05-12 | Diamond Alkali Co | Polymerization employing a phthalic glycerol alkyd resin as a suspension stabilizer |
| US2842518A (en) * | 1954-09-13 | 1958-07-08 | Borg Warner | Product produced by polymerization of vinylidene chloride-acrylonitrile mixtures onto polychloroprene |
| US2879256A (en) * | 1954-11-26 | 1959-03-24 | Eastman Kodak Co | Continuous process for preparing vinyl or vinylidene chloride graft polymers of improved solubility |
| US2835645A (en) * | 1955-01-05 | 1958-05-20 | Goodyear Tire & Rubber | High styrene-low diene resins of high heat softening point |
| FR1140814A (OSRAM) * | 1955-02-25 | 1900-01-01 | ||
| US2861973A (en) * | 1956-01-31 | 1958-11-25 | Borden Co | Moldable slurry comprising vinyl butyrate and polyethyl methacrylate and molding obtained therefrom |
| US2991269A (en) * | 1956-02-21 | 1961-07-04 | Shell Oil Co | Process for preparing block copolymers by degrading a preformed polymer in the presence of dissimilar monomer |
| US3091595A (en) * | 1956-03-22 | 1963-05-28 | Shell Oil Co | Cyano-substituted polyamides and their use as curing agents for polyepoxides |
| NL221084A (OSRAM) * | 1956-09-28 | |||
| US2908661A (en) * | 1957-01-11 | 1959-10-13 | Borg Warner | Polymerization of acrylonitrile-alpha methyl styrene mixtures onto polybutadiene and products produced thereby |
| DE1070381B (de) * | 1957-03-15 | 1959-12-03 | Rohm & LIaas Company, Philadelphia, Pa. (V. St. A.) | Verfahren zur Herstellung von Ionenaustauscherharzen auf Basis der Acrylsäuren und Methacrylsäuren |
| US2992203A (en) * | 1957-03-25 | 1961-07-11 | Rohm & Haas | High impact resistant polymers derived primarily from esters of acrylic and methacrylic acids |
| US2905653A (en) * | 1957-05-14 | 1959-09-22 | Firestone Tire & Rubber Co | Oriented products from graft copolymers of vinyl ester on acrylonitrile polymer |
| US2941990A (en) * | 1957-07-15 | 1960-06-21 | American Cyanamid Co | Cyanoethylated polymers |
| NL231903A (OSRAM) * | 1957-10-02 | |||
| BE572577A (OSRAM) * | 1957-10-31 | 1900-01-01 | ||
| US3074866A (en) * | 1958-01-06 | 1963-01-22 | Alelio Gaetano F D | Irradiated polymers |
| US3082161A (en) * | 1958-01-06 | 1963-03-19 | Alelio Gaetano F D | Irradiated polymers |
| US3075905A (en) * | 1958-01-06 | 1963-01-29 | Alelio Gaetano F D | Irradiated polymers |
| US3075904A (en) * | 1958-01-06 | 1963-01-29 | Alelio Gaetano F D | Irradiated polymers |
| US3020257A (en) * | 1958-02-12 | 1962-02-06 | Haris Co Ltd | Method for manufacture of polyisobutylene-vinyl acetate graft copolymer |
| CA643619A (en) * | 1958-02-14 | 1962-06-26 | Dominion Rubber Company | Polymethylmethacrylate polybutadiene and styrene composition |
| US2961421A (en) * | 1958-02-17 | 1960-11-22 | Monsanto Chemicals | Interpolymer latices comprising acrylates and monovinylidene aromatic hydrocarbons, process of preparing same and cellulose coated therewith |
| NL246911A (OSRAM) * | 1958-03-06 | |||
| US2961423A (en) * | 1958-04-03 | 1960-11-22 | Monsanto Chemicals | Crossed-linked styrene-allyl alcohol copolymers as binders for fibrous fillers and structural units manufactured therefrom |
| US2903440A (en) * | 1958-04-08 | 1959-09-08 | Exxon Research Engineering Co | Thermo setting resin from a liquid butadiene polymer and styrene |
| US3188228A (en) * | 1958-05-14 | 1965-06-08 | Du Pont | Method of graft polymerizing an organic compound to a solid shaped condensation polymer structure |
| US3041307A (en) * | 1959-04-24 | 1962-06-26 | Monsanto Chemicals | Blend of styrene copolymer with a graft-copolymer of styrene and a nitrile upon an alkyl acrylate polymer |
| US3061582A (en) * | 1959-07-09 | 1962-10-30 | Nat Distillers Chem Corp | Ethylenic modification of branched chain polyamides |
| US3061581A (en) * | 1959-07-09 | 1962-10-30 | Nat Distillers Chem Corp | Vinyl modification of branched chain polyamides |
| US3113912A (en) * | 1959-07-16 | 1963-12-10 | Phillips Petroleum Co | Preparation of vulcanizates by irradiation of block copolymers |
| US3135717A (en) * | 1960-02-10 | 1964-06-02 | Grace W R & Co | Process of forming graft copolymers of polystyrene and polyvinyl chloride |
| US3128528A (en) * | 1960-04-28 | 1964-04-14 | Du Pont | Preparation of hydroset textile material |
| NL270024A (OSRAM) * | 1960-10-07 | 1900-01-01 | ||
| US3177269A (en) * | 1960-10-10 | 1965-04-06 | Dow Chemical Co | Graft copolymers of polyolefins and acrylic and methacrylic acid and method of making the same |
| US3177270A (en) * | 1960-10-10 | 1965-04-06 | Dow Chemical Co | Graft copolymers of polyolefins and monovinyl aromatic compounds and method of making the same |
| US3294711A (en) * | 1963-04-22 | 1966-12-27 | Bayer Ag | Graft polymers of vinyl acetate or vinyl chloride onto a saturated polyester backbone, and polyurethane foams therefrom |
| US3297471A (en) * | 1965-04-08 | 1967-01-10 | Du Pont | Acrylic or methacrylic acid grafting copolymerized on nylon and forming salt of said graft |
| US3296339A (en) * | 1966-01-20 | 1967-01-03 | Rohm & Haas | Thermoplastic compositions formed by polymerizing methacrylic acid esters and polybutadiene latices |
| US3413378A (en) * | 1966-11-14 | 1968-11-26 | Du Pont | Graft copolymers of nitrile groups on polyamide substrates |
| IL86605A (en) * | 1988-06-02 | 1992-02-16 | Bromine Compounds Ltd | Process for the polymerization of pentabromobenzylester monoacrylate |
| US6228948B1 (en) | 1998-01-16 | 2001-05-08 | E. I. Du Pont De Nemours And Company | High melt flow, highly-grafted polypropylene |
| DE102007011825B3 (de) * | 2007-03-12 | 2008-05-15 | Deutsche Gumtec Ag | Verfahren zur Modifizierung von Gummi- und Thermoplastabfällen mittels Pfropfung während eines Mahlprozesses sowie Verwendung der so modifizierten Gummi-und Thermoplastabfälle |
-
0
- BE BE492180D patent/BE492180A/xx unknown
-
1949
- 1949-11-04 DE DEN124A patent/DE842407C/de not_active Expired
- 1949-11-15 CH CH286509D patent/CH286509A/de unknown
- 1949-11-15 FR FR999594D patent/FR999594A/fr not_active Expired
- 1949-11-16 GB GB29343/49A patent/GB679562A/en not_active Expired
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1012071B (de) * | 1955-02-22 | 1957-07-11 | Courtaulds Ltd | Verfahren zur Herstellung von Blockmischpolymeren |
| DE1104180B (de) * | 1955-12-09 | 1961-04-06 | Natural Rubber Producers | Verfahren zur Herstellung von Pfropf-Mischpolymerisaten |
| DE1245131B (de) * | 1962-12-26 | 1967-07-20 | Dow Chemical Co | Verfahren zur Polymerisation |
Also Published As
| Publication number | Publication date |
|---|---|
| FR999594A (fr) | 1952-02-01 |
| BE492180A (OSRAM) | |
| CH286509A (de) | 1952-10-31 |
| GB679562A (en) | 1952-09-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE842407C (de) | Verfahren zur Herstellung von Polymeren | |
| DE1495694B2 (de) | Verfahren zur Herstellung von Polymerisaten des Vinylchlorids | |
| DE1064719B (de) | Verfahren zur Herstellung vernetzbarer bzw. vernetzter Polymerer | |
| DE2034989A1 (de) | Sternförmige Homo und Kopolymerisate von konjugierten Dienen bzw konjugierten Dienen mit vinylaromatischen Verbindungen und Verfahren zu ihrer Herstellung | |
| DE1595849B2 (de) | Verfahren zur herstellung von vinylchloridpolymerisaten | |
| DE1520310B2 (de) | Verfahren zur Herstellung einer Pfropfpolymerisatmasse | |
| DE2104597A1 (de) | Verfahren zur herstellung von polymerisaten von konjugierten dienen | |
| DE2153886B2 (de) | Verfahren zur Herstellung von Vinylchloridpolymeren mit verbesserten Eigenschaften | |
| DE1620960C3 (de) | Verfahren zur Herstellung von Polyvinylidenfluorid | |
| DE2133606A1 (de) | Verfahren zur Herstellung von Pfropfpolymeren des Vinylchlonds | |
| DE1201061B (de) | Verfahren zur Herstellung verspinnbarer Loesungen faserbildender Acrylnitrilpolymerisate | |
| DE2003331B2 (de) | Verfahren zur herstellung eines vinylchloridpfropfpolymerisates | |
| AT283545B (de) | Verfahren zur Herstellung von Lösungen von Acrylpolymeren in einem organischen Lösungsmittel | |
| DE2208340A1 (de) | Polymerisate und Verfahren zu ihrer Herstellung | |
| DE1119516B (de) | Verfahren zur Herstellung eines mit Styrol modifizierten Butadien-Styrol-Pfropfmischpolymerisates | |
| DE1128664B (de) | Verfahren zur Herstellung eines Hilfs-Suspensionsmittels, das bei der Erzeugung von koernigem, stark poroesem Polyvinylchlorid mit nicht glasartiger Oberflaeche nach demSuspensions-polymerisationsverfahren verwendbar ist | |
| DE944996C (de) | Verfahren zur Herstellung von Mischpolymerisaten aus Vinylhalogenid mit einer anderen polymerisierbaren organischen Verbindung | |
| DE912152C (de) | Verfahren zur Polymerisation oder Kopolymerisation polymerisierbarer ungesaettigter organischer Verbindungen | |
| DE2500494C2 (OSRAM) | ||
| EP0281838B1 (de) | Sulfosuccinamidsäuren von Polyoxypropylendiaminen und ihre Verwendung als Emulgatoren | |
| DE906515C (de) | Verfahren zur Herstellung von Polyacrylsaeurenitril- oder Acrylsaeurenitrilmischpolymerisat-Weichmacher-Mischungen | |
| DE871366C (de) | Verfahren zum Polymerisieren ungesaettigter Verbindungen | |
| DE2603758A1 (de) | Verfahren zur herstellung von pfropf-copolymeren | |
| DE966375C (de) | Verfahren zur Herstellung von Acrylnitrilharzen | |
| DE1084919B (de) | Verfahren zur Blockmischpolymerisation olefinisch ungesaettigter Verbindungen |